| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2009-07-25 00:11:16 UTC |
|---|
| Update Date | 2021-09-14 14:59:18 UTC |
|---|
| HMDB ID | HMDB0012994 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Leukotriene D5 |
|---|
| Description | leukotriene D5 is coverted from 5-hydroxy-6-S-glutathionyl-7,9,11,14,17-eicosapentaenoic acid (leukotriene C5) by gamma-glutamyl transpeptidase. Leukotrienes are eicosanoids. The eicosanoids consist of the prostaglandins (PGs), thromboxanes (TXs), leukotrienes (LTs), and lipoxins (LXs). The PGs and TXs are collectively identified as prostanoids. Prostaglandins were originally shown to be synthesized in the prostate gland, thromboxanes from platelets (thrombocytes), and leukotrienes from leukocytes, hence the derivation of their names. All mammalian cells except erythrocytes synthesize eicosanoids. These molecules are extremely potent, able to cause profound physiological effects at very dilute concentrations. All eicosanoids function locally at the site of synthesis, through receptor-mediated G-protein linked signalling pathways. |
|---|
| Structure | CC\C=C/C\C=C/C\C=C/C=C/C=C/[C@H](SC[C@H](N)C(=O)NCC(O)=O)[C@H](O)CCCC(O)=O InChI=1S/C25H38N2O6S/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-22(21(28)15-14-17-23(29)30)34-19-20(26)25(33)27-18-24(31)32/h3-4,6-7,9-13,16,20-22,28H,2,5,8,14-15,17-19,26H2,1H3,(H,27,33)(H,29,30)(H,31,32)/b4-3-,7-6-,10-9-,12-11+,16-13+/t20-,21+,22-/m0/s1 |
|---|
| Synonyms | |
|---|
| Chemical Formula | C25H38N2O6S |
|---|
| Average Molecular Weight | 494.644 |
|---|
| Monoisotopic Molecular Weight | 494.245057648 |
|---|
| IUPAC Name | (5R,6S,7E,9E,11Z,14Z,17Z)-6-{[(2R)-2-amino-2-[(carboxymethyl)carbamoyl]ethyl]sulfanyl}-5-hydroxyicosa-7,9,11,14,17-pentaenoic acid |
|---|
| Traditional Name | (5R,6S,7E,9E,11Z,14Z,17Z)-6-{[(2R)-2-amino-2-(carboxymethylcarbamoyl)ethyl]sulfanyl}-5-hydroxyicosa-7,9,11,14,17-pentaenoic acid |
|---|
| CAS Registry Number | Not Available |
|---|
| SMILES | CC\C=C/C\C=C/C\C=C/C=C/C=C/[C@H](SC[C@H](N)C(=O)NCC(O)=O)[C@H](O)CCCC(O)=O |
|---|
| InChI Identifier | InChI=1S/C25H38N2O6S/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-22(21(28)15-14-17-23(29)30)34-19-20(26)25(33)27-18-24(31)32/h3-4,6-7,9-13,16,20-22,28H,2,5,8,14-15,17-19,26H2,1H3,(H,27,33)(H,29,30)(H,31,32)/b4-3-,7-6-,10-9-,12-11+,16-13+/t20-,21+,22-/m0/s1 |
|---|
| InChI Key | RWLDHKGRPLNPBN-DSJHTHEWSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as hydroxyeicosapentaenoic acids. These are eicosanoic acids with an attached hydroxyl group and five CC double bonds. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Fatty Acyls |
|---|
| Sub Class | Eicosanoids |
|---|
| Direct Parent | Hydroxyeicosapentaenoic acids |
|---|
| Alternative Parents | |
|---|
| Substituents | - Hydroxyeicosapentaenoic acid
- Alpha-dipeptide
- Alpha peptide
- Long-chain fatty acid
- N-acyl-alpha amino acid or derivatives
- N-acyl-alpha-amino acid
- Alpha-amino acid amide
- Cysteine or derivatives
- Alpha-amino acid or derivatives
- Thia fatty acid
- Hydroxy fatty acid
- Unsaturated fatty acid
- Dicarboxylic acid or derivatives
- Fatty acid
- Amino acid or derivatives
- Secondary carboxylic acid amide
- Secondary alcohol
- Amino acid
- Carboxamide group
- Carboxylic acid derivative
- Carboxylic acid
- Dialkylthioether
- Sulfenyl compound
- Thioether
- Amine
- Organic oxygen compound
- Organic nitrogen compound
- Hydrocarbon derivative
- Alcohol
- Organic oxide
- Carbonyl group
- Organopnictogen compound
- Primary aliphatic amine
- Primary amine
- Organosulfur compound
- Organonitrogen compound
- Organooxygen compound
- Aliphatic acyclic compound
|
|---|
| Molecular Framework | Aliphatic acyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | |
|---|
| Role | |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 3.64 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 17.9254 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 4.36 minutes | 32390414 | | AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 61.2 seconds | 40023050 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 2938.1 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 231.6 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 174.7 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 198.1 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 214.0 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 698.3 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 498.3 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 296.3 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 1546.2 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 645.5 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1625.8 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 487.0 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 457.6 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 329.9 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 187.5 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 8.9 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Leukotriene D5,1TMS,isomer #1 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)NCC(=O)O[Si](C)(C)C)[C@H](O)CCCC(=O)O | 4238.8 | Semi standard non polar | 33892256 | | Leukotriene D5,1TMS,isomer #2 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)NCC(=O)O)[C@@H](CCCC(=O)O)O[Si](C)(C)C | 4285.6 | Semi standard non polar | 33892256 | | Leukotriene D5,1TMS,isomer #3 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)NCC(=O)O)[C@H](O)CCCC(=O)O[Si](C)(C)C | 4252.2 | Semi standard non polar | 33892256 | | Leukotriene D5,1TMS,isomer #4 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C)C(=O)NCC(=O)O)[C@H](O)CCCC(=O)O | 4367.7 | Semi standard non polar | 33892256 | | Leukotriene D5,1TMS,isomer #5 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)N(CC(=O)O)[Si](C)(C)C)[C@H](O)CCCC(=O)O | 4239.6 | Semi standard non polar | 33892256 | | Leukotriene D5,2TMS,isomer #1 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)NCC(=O)O[Si](C)(C)C)[C@@H](CCCC(=O)O)O[Si](C)(C)C | 4229.3 | Semi standard non polar | 33892256 | | Leukotriene D5,2TMS,isomer #10 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)NCC(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CCCC(=O)O | 4452.9 | Semi standard non polar | 33892256 | | Leukotriene D5,2TMS,isomer #11 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C)C(=O)N(CC(=O)O)[Si](C)(C)C)[C@H](O)CCCC(=O)O | 4318.5 | Semi standard non polar | 33892256 | | Leukotriene D5,2TMS,isomer #2 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)NCC(=O)O[Si](C)(C)C)[C@H](O)CCCC(=O)O[Si](C)(C)C | 4190.4 | Semi standard non polar | 33892256 | | Leukotriene D5,2TMS,isomer #3 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C)C(=O)NCC(=O)O[Si](C)(C)C)[C@H](O)CCCC(=O)O | 4295.5 | Semi standard non polar | 33892256 | | Leukotriene D5,2TMS,isomer #4 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@H](O)CCCC(=O)O | 4179.6 | Semi standard non polar | 33892256 | | Leukotriene D5,2TMS,isomer #5 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)NCC(=O)O)[C@@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4240.7 | Semi standard non polar | 33892256 | | Leukotriene D5,2TMS,isomer #6 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C)C(=O)NCC(=O)O)[C@@H](CCCC(=O)O)O[Si](C)(C)C | 4350.7 | Semi standard non polar | 33892256 | | Leukotriene D5,2TMS,isomer #7 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)N(CC(=O)O)[Si](C)(C)C)[C@@H](CCCC(=O)O)O[Si](C)(C)C | 4237.0 | Semi standard non polar | 33892256 | | Leukotriene D5,2TMS,isomer #8 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C)C(=O)NCC(=O)O)[C@H](O)CCCC(=O)O[Si](C)(C)C | 4309.1 | Semi standard non polar | 33892256 | | Leukotriene D5,2TMS,isomer #9 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)N(CC(=O)O)[Si](C)(C)C)[C@H](O)CCCC(=O)O[Si](C)(C)C | 4188.9 | Semi standard non polar | 33892256 | | Leukotriene D5,3TMS,isomer #1 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)NCC(=O)O[Si](C)(C)C)[C@@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4187.1 | Semi standard non polar | 33892256 | | Leukotriene D5,3TMS,isomer #10 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)NCC(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O)O[Si](C)(C)C | 4421.9 | Semi standard non polar | 33892256 | | Leukotriene D5,3TMS,isomer #11 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C)C(=O)N(CC(=O)O)[Si](C)(C)C)[C@@H](CCCC(=O)O)O[Si](C)(C)C | 4288.0 | Semi standard non polar | 33892256 | | Leukotriene D5,3TMS,isomer #12 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)NCC(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CCCC(=O)O[Si](C)(C)C | 4371.5 | Semi standard non polar | 33892256 | | Leukotriene D5,3TMS,isomer #13 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C)C(=O)N(CC(=O)O)[Si](C)(C)C)[C@H](O)CCCC(=O)O[Si](C)(C)C | 4221.8 | Semi standard non polar | 33892256 | | Leukotriene D5,3TMS,isomer #14 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)N(CC(=O)O)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CCCC(=O)O | 4395.7 | Semi standard non polar | 33892256 | | Leukotriene D5,3TMS,isomer #2 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C)C(=O)NCC(=O)O[Si](C)(C)C)[C@@H](CCCC(=O)O)O[Si](C)(C)C | 4275.6 | Semi standard non polar | 33892256 | | Leukotriene D5,3TMS,isomer #3 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O)O[Si](C)(C)C | 4150.6 | Semi standard non polar | 33892256 | | Leukotriene D5,3TMS,isomer #4 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C)C(=O)NCC(=O)O[Si](C)(C)C)[C@H](O)CCCC(=O)O[Si](C)(C)C | 4220.1 | Semi standard non polar | 33892256 | | Leukotriene D5,3TMS,isomer #5 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@H](O)CCCC(=O)O[Si](C)(C)C | 4093.9 | Semi standard non polar | 33892256 | | Leukotriene D5,3TMS,isomer #6 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)NCC(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CCCC(=O)O | 4360.6 | Semi standard non polar | 33892256 | | Leukotriene D5,3TMS,isomer #7 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C)C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@H](O)CCCC(=O)O | 4219.8 | Semi standard non polar | 33892256 | | Leukotriene D5,3TMS,isomer #8 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C)C(=O)NCC(=O)O)[C@@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4289.4 | Semi standard non polar | 33892256 | | Leukotriene D5,3TMS,isomer #9 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)N(CC(=O)O)[Si](C)(C)C)[C@@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4160.6 | Semi standard non polar | 33892256 | | Leukotriene D5,4TMS,isomer #1 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C)C(=O)NCC(=O)O[Si](C)(C)C)[C@@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4188.2 | Semi standard non polar | 33892256 | | Leukotriene D5,4TMS,isomer #1 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C)C(=O)NCC(=O)O[Si](C)(C)C)[C@@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 3846.4 | Standard non polar | 33892256 | | Leukotriene D5,4TMS,isomer #1 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C)C(=O)NCC(=O)O[Si](C)(C)C)[C@@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4854.3 | Standard polar | 33892256 | | Leukotriene D5,4TMS,isomer #10 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)N(CC(=O)O)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O)O[Si](C)(C)C | 4360.5 | Semi standard non polar | 33892256 | | Leukotriene D5,4TMS,isomer #10 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)N(CC(=O)O)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O)O[Si](C)(C)C | 4001.4 | Standard non polar | 33892256 | | Leukotriene D5,4TMS,isomer #10 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)N(CC(=O)O)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O)O[Si](C)(C)C | 5015.3 | Standard polar | 33892256 | | Leukotriene D5,4TMS,isomer #11 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)N(CC(=O)O)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CCCC(=O)O[Si](C)(C)C | 4290.8 | Semi standard non polar | 33892256 | | Leukotriene D5,4TMS,isomer #11 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)N(CC(=O)O)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CCCC(=O)O[Si](C)(C)C | 4042.3 | Standard non polar | 33892256 | | Leukotriene D5,4TMS,isomer #11 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)N(CC(=O)O)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CCCC(=O)O[Si](C)(C)C | 5048.4 | Standard polar | 33892256 | | Leukotriene D5,4TMS,isomer #2 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4059.2 | Semi standard non polar | 33892256 | | Leukotriene D5,4TMS,isomer #2 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 3751.2 | Standard non polar | 33892256 | | Leukotriene D5,4TMS,isomer #2 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 5150.4 | Standard polar | 33892256 | | Leukotriene D5,4TMS,isomer #3 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)NCC(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O)O[Si](C)(C)C | 4307.2 | Semi standard non polar | 33892256 | | Leukotriene D5,4TMS,isomer #3 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)NCC(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O)O[Si](C)(C)C | 3957.9 | Standard non polar | 33892256 | | Leukotriene D5,4TMS,isomer #3 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)NCC(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O)O[Si](C)(C)C | 4973.2 | Standard polar | 33892256 | | Leukotriene D5,4TMS,isomer #4 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C)C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O)O[Si](C)(C)C | 4173.4 | Semi standard non polar | 33892256 | | Leukotriene D5,4TMS,isomer #4 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C)C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O)O[Si](C)(C)C | 3912.7 | Standard non polar | 33892256 | | Leukotriene D5,4TMS,isomer #4 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C)C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O)O[Si](C)(C)C | 4913.9 | Standard polar | 33892256 | | Leukotriene D5,4TMS,isomer #5 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)NCC(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CCCC(=O)O[Si](C)(C)C | 4251.7 | Semi standard non polar | 33892256 | | Leukotriene D5,4TMS,isomer #5 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)NCC(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CCCC(=O)O[Si](C)(C)C | 3991.5 | Standard non polar | 33892256 | | Leukotriene D5,4TMS,isomer #5 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)NCC(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CCCC(=O)O[Si](C)(C)C | 5017.3 | Standard polar | 33892256 | | Leukotriene D5,4TMS,isomer #6 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C)C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@H](O)CCCC(=O)O[Si](C)(C)C | 4109.3 | Semi standard non polar | 33892256 | | Leukotriene D5,4TMS,isomer #6 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C)C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@H](O)CCCC(=O)O[Si](C)(C)C | 3940.7 | Standard non polar | 33892256 | | Leukotriene D5,4TMS,isomer #6 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C)C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@H](O)CCCC(=O)O[Si](C)(C)C | 4946.2 | Standard polar | 33892256 | | Leukotriene D5,4TMS,isomer #7 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CCCC(=O)O | 4293.4 | Semi standard non polar | 33892256 | | Leukotriene D5,4TMS,isomer #7 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CCCC(=O)O | 4055.8 | Standard non polar | 33892256 | | Leukotriene D5,4TMS,isomer #7 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CCCC(=O)O | 5051.4 | Standard polar | 33892256 | | Leukotriene D5,4TMS,isomer #8 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)NCC(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4328.1 | Semi standard non polar | 33892256 | | Leukotriene D5,4TMS,isomer #8 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)NCC(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 3943.8 | Standard non polar | 33892256 | | Leukotriene D5,4TMS,isomer #8 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)NCC(=O)O)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4970.0 | Standard polar | 33892256 | | Leukotriene D5,4TMS,isomer #9 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C)C(=O)N(CC(=O)O)[Si](C)(C)C)[C@@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4170.5 | Semi standard non polar | 33892256 | | Leukotriene D5,4TMS,isomer #9 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C)C(=O)N(CC(=O)O)[Si](C)(C)C)[C@@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 3901.5 | Standard non polar | 33892256 | | Leukotriene D5,4TMS,isomer #9 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C)C(=O)N(CC(=O)O)[Si](C)(C)C)[C@@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4890.1 | Standard polar | 33892256 | | Leukotriene D5,5TMS,isomer #1 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)NCC(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4206.1 | Semi standard non polar | 33892256 | | Leukotriene D5,5TMS,isomer #1 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)NCC(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 3944.5 | Standard non polar | 33892256 | | Leukotriene D5,5TMS,isomer #1 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)NCC(=O)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4607.3 | Standard polar | 33892256 | | Leukotriene D5,5TMS,isomer #2 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C)C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4080.6 | Semi standard non polar | 33892256 | | Leukotriene D5,5TMS,isomer #2 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C)C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 3908.5 | Standard non polar | 33892256 | | Leukotriene D5,5TMS,isomer #2 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C)C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4570.6 | Standard polar | 33892256 | | Leukotriene D5,5TMS,isomer #3 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O)O[Si](C)(C)C | 4264.4 | Semi standard non polar | 33892256 | | Leukotriene D5,5TMS,isomer #3 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O)O[Si](C)(C)C | 4002.0 | Standard non polar | 33892256 | | Leukotriene D5,5TMS,isomer #3 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O)O[Si](C)(C)C | 4695.2 | Standard polar | 33892256 | | Leukotriene D5,5TMS,isomer #4 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CCCC(=O)O[Si](C)(C)C | 4195.0 | Semi standard non polar | 33892256 | | Leukotriene D5,5TMS,isomer #4 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CCCC(=O)O[Si](C)(C)C | 4037.4 | Standard non polar | 33892256 | | Leukotriene D5,5TMS,isomer #4 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)N(CC(=O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CCCC(=O)O[Si](C)(C)C | 4745.2 | Standard polar | 33892256 | | Leukotriene D5,5TMS,isomer #5 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)N(CC(=O)O)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4260.5 | Semi standard non polar | 33892256 | | Leukotriene D5,5TMS,isomer #5 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)N(CC(=O)O)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 3989.9 | Standard non polar | 33892256 | | Leukotriene D5,5TMS,isomer #5 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)N(CC(=O)O)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CCCC(=O)O[Si](C)(C)C)O[Si](C)(C)C | 4683.8 | Standard polar | 33892256 | | Leukotriene D5,1TBDMS,isomer #1 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)NCC(=O)O[Si](C)(C)C(C)(C)C)[C@H](O)CCCC(=O)O | 4497.0 | Semi standard non polar | 33892256 | | Leukotriene D5,1TBDMS,isomer #2 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)NCC(=O)O)[C@@H](CCCC(=O)O)O[Si](C)(C)C(C)(C)C | 4537.7 | Semi standard non polar | 33892256 | | Leukotriene D5,1TBDMS,isomer #3 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)NCC(=O)O)[C@H](O)CCCC(=O)O[Si](C)(C)C(C)(C)C | 4512.4 | Semi standard non polar | 33892256 | | Leukotriene D5,1TBDMS,isomer #4 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C(C)(C)C)C(=O)NCC(=O)O)[C@H](O)CCCC(=O)O | 4567.6 | Semi standard non polar | 33892256 | | Leukotriene D5,1TBDMS,isomer #5 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)N(CC(=O)O)[Si](C)(C)C(C)(C)C)[C@H](O)CCCC(=O)O | 4491.0 | Semi standard non polar | 33892256 | | Leukotriene D5,2TBDMS,isomer #1 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)NCC(=O)O[Si](C)(C)C(C)(C)C)[C@@H](CCCC(=O)O)O[Si](C)(C)C(C)(C)C | 4740.7 | Semi standard non polar | 33892256 | | Leukotriene D5,2TBDMS,isomer #10 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)NCC(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)CCCC(=O)O | 4882.3 | Semi standard non polar | 33892256 | | Leukotriene D5,2TBDMS,isomer #11 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C(C)(C)C)C(=O)N(CC(=O)O)[Si](C)(C)C(C)(C)C)[C@H](O)CCCC(=O)O | 4749.2 | Semi standard non polar | 33892256 | | Leukotriene D5,2TBDMS,isomer #2 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)NCC(=O)O[Si](C)(C)C(C)(C)C)[C@H](O)CCCC(=O)O[Si](C)(C)C(C)(C)C | 4685.8 | Semi standard non polar | 33892256 | | Leukotriene D5,2TBDMS,isomer #3 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C(C)(C)C)C(=O)NCC(=O)O[Si](C)(C)C(C)(C)C)[C@H](O)CCCC(=O)O | 4741.0 | Semi standard non polar | 33892256 | | Leukotriene D5,2TBDMS,isomer #4 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)N(CC(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)CCCC(=O)O | 4669.6 | Semi standard non polar | 33892256 | | Leukotriene D5,2TBDMS,isomer #5 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)NCC(=O)O)[C@@H](CCCC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 4758.7 | Semi standard non polar | 33892256 | | Leukotriene D5,2TBDMS,isomer #6 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C(C)(C)C)C(=O)NCC(=O)O)[C@@H](CCCC(=O)O)O[Si](C)(C)C(C)(C)C | 4795.9 | Semi standard non polar | 33892256 | | Leukotriene D5,2TBDMS,isomer #7 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)N(CC(=O)O)[Si](C)(C)C(C)(C)C)[C@@H](CCCC(=O)O)O[Si](C)(C)C(C)(C)C | 4731.8 | Semi standard non polar | 33892256 | | Leukotriene D5,2TBDMS,isomer #8 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C(C)(C)C)C(=O)NCC(=O)O)[C@H](O)CCCC(=O)O[Si](C)(C)C(C)(C)C | 4746.2 | Semi standard non polar | 33892256 | | Leukotriene D5,2TBDMS,isomer #9 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)N(CC(=O)O)[Si](C)(C)C(C)(C)C)[C@H](O)CCCC(=O)O[Si](C)(C)C(C)(C)C | 4677.7 | Semi standard non polar | 33892256 | | Leukotriene D5,3TBDMS,isomer #1 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)NCC(=O)O[Si](C)(C)C(C)(C)C)[C@@H](CCCC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 4905.6 | Semi standard non polar | 33892256 | | Leukotriene D5,3TBDMS,isomer #10 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)NCC(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](CCCC(=O)O)O[Si](C)(C)C(C)(C)C | 5108.3 | Semi standard non polar | 33892256 | | Leukotriene D5,3TBDMS,isomer #11 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C(C)(C)C)C(=O)N(CC(=O)O)[Si](C)(C)C(C)(C)C)[C@@H](CCCC(=O)O)O[Si](C)(C)C(C)(C)C | 4936.9 | Semi standard non polar | 33892256 | | Leukotriene D5,3TBDMS,isomer #12 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)NCC(=O)O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)CCCC(=O)O[Si](C)(C)C(C)(C)C | 5065.5 | Semi standard non polar | 33892256 | | Leukotriene D5,3TBDMS,isomer #13 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C(C)(C)C)C(=O)N(CC(=O)O)[Si](C)(C)C(C)(C)C)[C@H](O)CCCC(=O)O[Si](C)(C)C(C)(C)C | 4870.1 | Semi standard non polar | 33892256 | | Leukotriene D5,3TBDMS,isomer #14 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)N(CC(=O)O)[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)CCCC(=O)O | 5036.8 | Semi standard non polar | 33892256 | | Leukotriene D5,3TBDMS,isomer #2 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C(C)(C)C)C(=O)NCC(=O)O[Si](C)(C)C(C)(C)C)[C@@H](CCCC(=O)O)O[Si](C)(C)C(C)(C)C | 4931.2 | Semi standard non polar | 33892256 | | Leukotriene D5,3TBDMS,isomer #3 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)N(CC(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](CCCC(=O)O)O[Si](C)(C)C(C)(C)C | 4890.5 | Semi standard non polar | 33892256 | | Leukotriene D5,3TBDMS,isomer #4 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C(C)(C)C)C(=O)NCC(=O)O[Si](C)(C)C(C)(C)C)[C@H](O)CCCC(=O)O[Si](C)(C)C(C)(C)C | 4871.7 | Semi standard non polar | 33892256 | | Leukotriene D5,3TBDMS,isomer #5 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)N(CC(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)CCCC(=O)O[Si](C)(C)C(C)(C)C | 4830.5 | Semi standard non polar | 33892256 | | Leukotriene D5,3TBDMS,isomer #6 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@@H](C(=O)NCC(=O)O[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)CCCC(=O)O | 5051.7 | Semi standard non polar | 33892256 | | Leukotriene D5,3TBDMS,isomer #7 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C(C)(C)C)C(=O)N(CC(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)CCCC(=O)O | 4870.1 | Semi standard non polar | 33892256 | | Leukotriene D5,3TBDMS,isomer #8 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N[Si](C)(C)C(C)(C)C)C(=O)NCC(=O)O)[C@@H](CCCC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 4942.8 | Semi standard non polar | 33892256 | | Leukotriene D5,3TBDMS,isomer #9 | CC/C=C\C/C=C\C/C=C\C=C\C=C\[C@H](SC[C@H](N)C(=O)N(CC(=O)O)[Si](C)(C)C(C)(C)C)[C@@H](CCCC(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C | 4894.2 | Semi standard non polar | 33892256 |
|
|---|