Record Information |
---|
Version | 5.0 |
---|
Status | Expected but not Quantified |
---|
Creation Date | 2012-09-06 15:16:52 UTC |
---|
Update Date | 2022-03-07 02:52:02 UTC |
---|
HMDB ID | HMDB0015574 |
---|
Secondary Accession Numbers | |
---|
Metabolite Identification |
---|
Common Name | Latamoxef |
---|
Description | Latamoxef, also known as festamoxin or lamoxactam, belongs to the class of organic compounds known as n-acyl-alpha amino acids and derivatives. N-acyl-alpha amino acids and derivatives are compounds containing an alpha amino acid (or a derivative thereof) which bears an acyl group at its terminal nitrogen atom. Based on a literature review a significant number of articles have been published on Latamoxef. |
---|
Structure | [H][C@]12OCC(CSC3=NN=NN3C)=C(N1C(=O)[C@]2(NC(=O)C(C(O)=O)C1=CC=C(O)C=C1)OC)C(O)=O InChI=1S/C20H20N6O9S/c1-25-19(22-23-24-25)36-8-10-7-35-18-20(34-2,17(33)26(18)13(10)16(31)32)21-14(28)12(15(29)30)9-3-5-11(27)6-4-9/h3-6,12,18,27H,7-8H2,1-2H3,(H,21,28)(H,29,30)(H,31,32)/t12?,18-,20+/m1/s1 |
---|
Synonyms | Value | Source |
---|
Festamoxin | ChEBI | Lamoxactam | ChEBI | Latamoxefum | ChEBI | LMOX | ChEBI | Oxa-cephem | ChEBI | Moxalactam | HMDB | Disodium latamoxef | HMDB | Disodium, moxalactam | HMDB | Latamoxef, disodium | HMDB | 1 Oxacephalosporin | HMDB | 1-Oxacephalosporin | HMDB | Disodium moxalactam | HMDB | Moxalactam disodium | HMDB | Moxalactam, disodium | HMDB | Shiomarin | HMDB | Latamoxef | ChEBI |
|
---|
Chemical Formula | C20H20N6O9S |
---|
Average Molecular Weight | 520.473 |
---|
Monoisotopic Molecular Weight | 520.101246958 |
---|
IUPAC Name | (6R,7R)-7-[2-carboxy-2-(4-hydroxyphenyl)acetamido]-7-methoxy-3-{[(1-methyl-1H-1,2,3,4-tetrazol-5-yl)sulfanyl]methyl}-8-oxo-5-oxa-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
---|
Traditional Name | latamoxef |
---|
CAS Registry Number | 64952-97-2 |
---|
SMILES | [H][C@]12OCC(CSC3=NN=NN3C)=C(N1C(=O)[C@]2(NC(=O)C(C(O)=O)C1=CC=C(O)C=C1)OC)C(O)=O |
---|
InChI Identifier | InChI=1S/C20H20N6O9S/c1-25-19(22-23-24-25)36-8-10-7-35-18-20(34-2,17(33)26(18)13(10)16(31)32)21-14(28)12(15(29)30)9-3-5-11(27)6-4-9/h3-6,12,18,27H,7-8H2,1-2H3,(H,21,28)(H,29,30)(H,31,32)/t12?,18-,20+/m1/s1 |
---|
InChI Key | JWCSIUVGFCSJCK-CAVRMKNVSA-N |
---|
Chemical Taxonomy |
---|
Description | Belongs to the class of organic compounds known as n-acyl-alpha amino acids and derivatives. N-acyl-alpha amino acids and derivatives are compounds containing an alpha amino acid (or a derivative thereof) which bears an acyl group at its terminal nitrogen atom. |
---|
Kingdom | Organic compounds |
---|
Super Class | Organic acids and derivatives |
---|
Class | Carboxylic acids and derivatives |
---|
Sub Class | Amino acids, peptides, and analogues |
---|
Direct Parent | N-acyl-alpha amino acids and derivatives |
---|
Alternative Parents | |
---|
Substituents | - N-acyl-alpha amino acid or derivatives
- Phenylacetamide
- Oxacephem
- Aryl thioether
- 1-hydroxy-2-unsubstituted benzenoid
- Phenol
- Alkylarylthioether
- Monocyclic benzene moiety
- Dicarboxylic acid or derivatives
- Benzenoid
- 1,3-dicarbonyl compound
- Azole
- Beta-lactam
- Heteroaromatic compound
- Tertiary carboxylic acid amide
- Tetrazole
- Azetidine
- Carboxamide group
- Lactam
- Secondary carboxylic acid amide
- Azacycle
- Oxacycle
- Carboxylic acid
- Organoheterocyclic compound
- Sulfenyl compound
- Thioether
- Organosulfur compound
- Organooxygen compound
- Organonitrogen compound
- Hydrocarbon derivative
- Organic nitrogen compound
- Organic oxide
- Carbonyl group
- Organopnictogen compound
- Organic oxygen compound
- Aromatic heteropolycyclic compound
|
---|
Molecular Framework | Aromatic heteropolycyclic compounds |
---|
External Descriptors | |
---|
Ontology |
---|
Physiological effect | Not Available |
---|
Disposition | |
---|
Process | Not Available |
---|
Role | Not Available |
---|
Physical Properties |
---|
State | Solid |
---|
Experimental Molecular Properties | Property | Value | Reference |
---|
Melting Point | Not Available | Not Available | Boiling Point | Not Available | Not Available | Water Solubility | 0.75 g/L | Not Available | LogP | Not Available | Not Available |
|
---|
Experimental Chromatographic Properties | Not Available |
---|
Predicted Molecular Properties | | Show more...
---|
Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Kovats Retention IndicesUnderivatizedDerivatizedDerivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
---|
Latamoxef,1TMS,isomer #1 | CO[C@@]1(NC(=O)C(C(=O)O[Si](C)(C)C)C2=CC=C(O)C=C2)C(=O)N2C(C(=O)O)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4198.6 | Semi standard non polar | 33892256 | Latamoxef,1TMS,isomer #2 | CO[C@@]1(NC(=O)C(C(=O)O)C2=CC=C(O[Si](C)(C)C)C=C2)C(=O)N2C(C(=O)O)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4287.1 | Semi standard non polar | 33892256 | Latamoxef,1TMS,isomer #3 | CO[C@@]1(NC(=O)C(C(=O)O)C2=CC=C(O)C=C2)C(=O)N2C(C(=O)O[Si](C)(C)C)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4190.3 | Semi standard non polar | 33892256 | Latamoxef,1TMS,isomer #4 | CO[C@@]1(N(C(=O)C(C(=O)O)C2=CC=C(O)C=C2)[Si](C)(C)C)C(=O)N2C(C(=O)O)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4171.2 | Semi standard non polar | 33892256 | Latamoxef,2TMS,isomer #1 | CO[C@@]1(NC(=O)C(C(=O)O[Si](C)(C)C)C2=CC=C(O[Si](C)(C)C)C=C2)C(=O)N2C(C(=O)O)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4154.9 | Semi standard non polar | 33892256 | Latamoxef,2TMS,isomer #2 | CO[C@@]1(NC(=O)C(C(=O)O[Si](C)(C)C)C2=CC=C(O)C=C2)C(=O)N2C(C(=O)O[Si](C)(C)C)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4047.0 | Semi standard non polar | 33892256 | Latamoxef,2TMS,isomer #3 | CO[C@@]1(N(C(=O)C(C(=O)O[Si](C)(C)C)C2=CC=C(O)C=C2)[Si](C)(C)C)C(=O)N2C(C(=O)O)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4008.8 | Semi standard non polar | 33892256 | Latamoxef,2TMS,isomer #4 | CO[C@@]1(NC(=O)C(C(=O)O)C2=CC=C(O[Si](C)(C)C)C=C2)C(=O)N2C(C(=O)O[Si](C)(C)C)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4152.4 | Semi standard non polar | 33892256 | Latamoxef,2TMS,isomer #5 | CO[C@@]1(N(C(=O)C(C(=O)O)C2=CC=C(O[Si](C)(C)C)C=C2)[Si](C)(C)C)C(=O)N2C(C(=O)O)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4128.7 | Semi standard non polar | 33892256 | Latamoxef,2TMS,isomer #6 | CO[C@@]1(N(C(=O)C(C(=O)O)C2=CC=C(O)C=C2)[Si](C)(C)C)C(=O)N2C(C(=O)O[Si](C)(C)C)=C(CSC3=NN=NN3C)CO[C@@H]21 | 3999.5 | Semi standard non polar | 33892256 | Latamoxef,3TMS,isomer #1 | CO[C@@]1(NC(=O)C(C(=O)O[Si](C)(C)C)C2=CC=C(O[Si](C)(C)C)C=C2)C(=O)N2C(C(=O)O[Si](C)(C)C)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4074.0 | Semi standard non polar | 33892256 | Latamoxef,3TMS,isomer #2 | CO[C@@]1(N(C(=O)C(C(=O)O[Si](C)(C)C)C2=CC=C(O[Si](C)(C)C)C=C2)[Si](C)(C)C)C(=O)N2C(C(=O)O)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4039.6 | Semi standard non polar | 33892256 | Latamoxef,3TMS,isomer #3 | CO[C@@]1(N(C(=O)C(C(=O)O[Si](C)(C)C)C2=CC=C(O)C=C2)[Si](C)(C)C)C(=O)N2C(C(=O)O[Si](C)(C)C)=C(CSC3=NN=NN3C)CO[C@@H]21 | 3955.6 | Semi standard non polar | 33892256 | Latamoxef,3TMS,isomer #4 | CO[C@@]1(N(C(=O)C(C(=O)O)C2=CC=C(O[Si](C)(C)C)C=C2)[Si](C)(C)C)C(=O)N2C(C(=O)O[Si](C)(C)C)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4030.3 | Semi standard non polar | 33892256 | Latamoxef,4TMS,isomer #1 | CO[C@@]1(N(C(=O)C(C(=O)O[Si](C)(C)C)C2=CC=C(O[Si](C)(C)C)C=C2)[Si](C)(C)C)C(=O)N2C(C(=O)O[Si](C)(C)C)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4010.6 | Semi standard non polar | 33892256 | Latamoxef,4TMS,isomer #1 | CO[C@@]1(N(C(=O)C(C(=O)O[Si](C)(C)C)C2=CC=C(O[Si](C)(C)C)C=C2)[Si](C)(C)C)C(=O)N2C(C(=O)O[Si](C)(C)C)=C(CSC3=NN=NN3C)CO[C@@H]21 | 3729.0 | Standard non polar | 33892256 | Latamoxef,4TMS,isomer #1 | CO[C@@]1(N(C(=O)C(C(=O)O[Si](C)(C)C)C2=CC=C(O[Si](C)(C)C)C=C2)[Si](C)(C)C)C(=O)N2C(C(=O)O[Si](C)(C)C)=C(CSC3=NN=NN3C)CO[C@@H]21 | 5656.8 | Standard polar | 33892256 | Latamoxef,1TBDMS,isomer #1 | CO[C@@]1(NC(=O)C(C(=O)O[Si](C)(C)C(C)(C)C)C2=CC=C(O)C=C2)C(=O)N2C(C(=O)O)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4433.2 | Semi standard non polar | 33892256 | Latamoxef,1TBDMS,isomer #2 | CO[C@@]1(NC(=O)C(C(=O)O)C2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2)C(=O)N2C(C(=O)O)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4506.7 | Semi standard non polar | 33892256 | Latamoxef,1TBDMS,isomer #3 | CO[C@@]1(NC(=O)C(C(=O)O)C2=CC=C(O)C=C2)C(=O)N2C(C(=O)O[Si](C)(C)C(C)(C)C)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4415.5 | Semi standard non polar | 33892256 | Latamoxef,1TBDMS,isomer #4 | CO[C@@]1(N(C(=O)C(C(=O)O)C2=CC=C(O)C=C2)[Si](C)(C)C(C)(C)C)C(=O)N2C(C(=O)O)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4433.2 | Semi standard non polar | 33892256 | Latamoxef,2TBDMS,isomer #1 | CO[C@@]1(NC(=O)C(C(=O)O[Si](C)(C)C(C)(C)C)C2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2)C(=O)N2C(C(=O)O)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4610.9 | Semi standard non polar | 33892256 | Latamoxef,2TBDMS,isomer #2 | CO[C@@]1(NC(=O)C(C(=O)O[Si](C)(C)C(C)(C)C)C2=CC=C(O)C=C2)C(=O)N2C(C(=O)O[Si](C)(C)C(C)(C)C)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4512.0 | Semi standard non polar | 33892256 | Latamoxef,2TBDMS,isomer #3 | CO[C@@]1(N(C(=O)C(C(=O)O[Si](C)(C)C(C)(C)C)C2=CC=C(O)C=C2)[Si](C)(C)C(C)(C)C)C(=O)N2C(C(=O)O)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4494.7 | Semi standard non polar | 33892256 | Latamoxef,2TBDMS,isomer #4 | CO[C@@]1(NC(=O)C(C(=O)O)C2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2)C(=O)N2C(C(=O)O[Si](C)(C)C(C)(C)C)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4622.8 | Semi standard non polar | 33892256 | Latamoxef,2TBDMS,isomer #5 | CO[C@@]1(N(C(=O)C(C(=O)O)C2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2)[Si](C)(C)C(C)(C)C)C(=O)N2C(C(=O)O)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4589.8 | Semi standard non polar | 33892256 | Latamoxef,2TBDMS,isomer #6 | CO[C@@]1(N(C(=O)C(C(=O)O)C2=CC=C(O)C=C2)[Si](C)(C)C(C)(C)C)C(=O)N2C(C(=O)O[Si](C)(C)C(C)(C)C)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4501.8 | Semi standard non polar | 33892256 | Latamoxef,3TBDMS,isomer #1 | CO[C@@]1(NC(=O)C(C(=O)O[Si](C)(C)C(C)(C)C)C2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2)C(=O)N2C(C(=O)O[Si](C)(C)C(C)(C)C)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4741.1 | Semi standard non polar | 33892256 | Latamoxef,3TBDMS,isomer #2 | CO[C@@]1(N(C(=O)C(C(=O)O[Si](C)(C)C(C)(C)C)C2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2)[Si](C)(C)C(C)(C)C)C(=O)N2C(C(=O)O)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4713.1 | Semi standard non polar | 33892256 | Latamoxef,3TBDMS,isomer #3 | CO[C@@]1(N(C(=O)C(C(=O)O[Si](C)(C)C(C)(C)C)C2=CC=C(O)C=C2)[Si](C)(C)C(C)(C)C)C(=O)N2C(C(=O)O[Si](C)(C)C(C)(C)C)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4621.7 | Semi standard non polar | 33892256 | Latamoxef,3TBDMS,isomer #4 | CO[C@@]1(N(C(=O)C(C(=O)O)C2=CC=C(O[Si](C)(C)C(C)(C)C)C=C2)[Si](C)(C)C(C)(C)C)C(=O)N2C(C(=O)O[Si](C)(C)C(C)(C)C)=C(CSC3=NN=NN3C)CO[C@@H]21 | 4721.2 | Semi standard non polar | 33892256 |
| Show more...
---|