Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References enzymes (1) Show 1 protein XML

Show more...Show more...Show more...

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 18:14:58 UTC

Update Date

2022-03-07 02:53:44 UTC

HMDB ID

HMDB0033512

Secondary Accession Numbers

HMDB33512

Metabolite Identification

Common Name

Gonyautoxin VI

Description

Gonyautoxin VI belongs to the class of organic compounds known as saxitoxins, gonyautoxins, and derivatives. Saxitoxins, gonyautoxins, and derivatives are compounds with a structure based on a 2,6-diamino-4-methyl-pyrrolo[1,2-c]purin-10-ol skeleton. Gonyautoxin VI has been detected, but not quantified in, mollusks. This could make gonyautoxin VI a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on Gonyautoxin VI.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI

  Mrv0541 05061307092D          

 26 28  0  0  0  0            999 V2000
    1.9014   -4.0332    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7264   -3.2082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9014   -3.2082    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.0764   -3.2082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9014   -2.3832    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1869   -1.9707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4725   -2.3832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1869   -1.1457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4725   -0.7332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4725    0.0918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2420    0.5043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2420    1.3293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0266    1.5843    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9014    0.0918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1869    0.5043    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0266    0.2494    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5116    0.9168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3366    0.9168    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9014    1.7418    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1869    1.3293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4725    1.7418    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3009    2.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5195    2.6350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8551    1.8814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3266    2.6027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6423    2.1281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  3  2  0  0  0  0
  2  3  2  0  0  0  0
  3  4  1  0  0  0  0
  3  5  1  0  0  0  0
  5  6  1  0  0  0  0
  6  7  2  0  0  0  0
  6  8  1  0  0  0  0
  8  9  1  0  0  0  0
  9 10  1  0  0  0  0
 10 11  1  0  0  0  0
 10 15  1  0  0  0  0
 11 12  1  0  0  0  0
 11 16  1  0  0  0  0
 12 13  1  0  0  0  0
 12 21  1  0  0  0  0
 12 24  1  0  0  0  0
 13 17  1  0  0  0  0
 14 15  1  0  0  0  0
 15 20  1  0  0  0  0
 16 17  1  0  0  0  0
 17 18  2  0  0  0  0
 19 20  2  0  0  0  0
 20 21  1  0  0  0  0
 21 22  1  0  0  0  0
 22 23  1  0  0  0  0
 23 24  1  0  0  0  0
 24 25  1  0  0  0  0
 24 26  1  0  0  0  0
M  END

HMDB0033512
     RDKit          3D
Gonyautoxin VI
 43 45  0  0  0  0  0  0  0  0999 V2000
   -2.4756   -2.4627   -2.9387 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0713   -1.7755   -1.9303 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9439   -0.8640   -1.9181 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7354   -0.6321   -0.5399 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2013    0.3788   -0.0575 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5865    0.0426   -0.5779 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5735    0.8757   -0.0511 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8887    0.6863   -0.4365 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1444   -0.2266   -1.2449 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9472    1.4919    0.0558 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5665    1.2292   -0.4426 S   0  0  0  0  0  6  0  0  0  0  0  0
    6.8917    1.9309   -1.7375 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5320    1.7801    0.5869 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8632   -0.4276   -0.5564 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2134    0.2267    1.4101 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2930    0.5094    2.1248 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9925   -0.2446    2.0730 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9603   -0.5656    3.3158 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1994   -0.3401    1.3486 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5979   -0.2395    1.6562 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1930    0.4565    0.4072 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9768    0.5945   -0.5376 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4396    0.4630   -1.8206 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4332    1.8349   -0.2449 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1492   -0.5499   -0.0480 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6557   -1.7717   -0.5972 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2764   -3.0970   -2.9112 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4353   -0.4902   -2.7337 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3658   -1.6321   -0.1141 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0795    1.3798   -0.3714 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5664   -0.0108   -1.6739 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7907   -1.0094   -0.2204 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7697    2.2691    0.7372 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.8213   -0.5360   -0.7330 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1289    1.1635    2.8577 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8228   -0.9005    3.7819 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8369    0.3239    2.5581 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0236   -1.2529    1.7606 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9136   -0.2180   -0.0658 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6187    1.4255    0.6552 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7607    0.6311   -2.5011 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5444    2.0414    0.7198 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2769   -2.4880   -0.1834 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  3
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  2  0
 11 13  2  0
 11 14  1  0
  5 15  1  0
 15 16  1  0
 15 17  1  0
 17 18  2  3
 17 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 22 25  1  0
 25 26  1  0
 26  2  1  0
 25  4  1  0
 25 19  1  0
  1 27  1  0
  3 28  1  0
  4 29  1  0
  5 30  1  0
  6 31  1  0
  6 32  1  0
 10 33  1  0
 14 34  1  0
 16 35  1  0
 18 36  1  0
 20 37  1  0
 20 38  1  0
 21 39  1  0
 21 40  1  0
 23 41  1  0
 24 42  1  0
 26 43  1  0
M  END

  Mrv0541 05061307092D          

 26 28  0  0  0  0            999 V2000
    1.9014   -4.0332    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7264   -3.2082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9014   -3.2082    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.0764   -3.2082    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9014   -2.3832    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1869   -1.9707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4725   -2.3832    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1869   -1.1457    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4725   -0.7332    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4725    0.0918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2420    0.5043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2420    1.3293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0266    1.5843    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9014    0.0918    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.1869    0.5043    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0266    0.2494    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5116    0.9168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3366    0.9168    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.9014    1.7418    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1869    1.3293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4725    1.7418    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.3009    2.5488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5195    2.6350    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8551    1.8814    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3266    2.6027    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6423    2.1281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  3  2  0  0  0  0
  2  3  2  0  0  0  0
  3  4  1  0  0  0  0
  3  5  1  0  0  0  0
  5  6  1  0  0  0  0
  6  7  2  0  0  0  0
  6  8  1  0  0  0  0
  8  9  1  0  0  0  0
  9 10  1  0  0  0  0
 10 11  1  0  0  0  0
 10 15  1  0  0  0  0
 11 12  1  0  0  0  0
 11 16  1  0  0  0  0
 12 13  1  0  0  0  0
 12 21  1  0  0  0  0
 12 24  1  0  0  0  0
 13 17  1  0  0  0  0
 14 15  1  0  0  0  0
 15 20  1  0  0  0  0
 16 17  1  0  0  0  0
 17 18  2  0  0  0  0
 19 20  2  0  0  0  0
 20 21  1  0  0  0  0
 21 22  1  0  0  0  0
 22 23  1  0  0  0  0
 23 24  1  0  0  0  0
 24 25  1  0  0  0  0
 24 26  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0033512

> <DATABASE_NAME>
hmdb

> <SMILES>
ON1C(COC(=O)NS(O)(=O)=O)C2NC(=N)NC22N(CCC2(O)O)C1=N

> <INCHI_IDENTIFIER>
InChI=1S/C10H17N7O8S/c11-6-13-5-4(3-25-8(18)15-26(22,23)24)17(21)7(12)16-2-1-9(19,20)10(5,16)14-6/h4-5,12,19-21H,1-3H2,(H,15,18)(H3,11,13,14)(H,22,23,24)

> <INCHI_KEY>
ALRRPAKWGUBPBK-UHFFFAOYSA-N

> <FORMULA>
C10H17N7O8S

> <MOLECULAR_WEIGHT>
395.349

> <EXACT_MASS>
395.085931245

> <JCHEM_ACCEPTOR_COUNT>
13

> <JCHEM_AVERAGE_POLARIZABILITY>
33.44949896608239

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
9

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
2,6-diimino-4-({[(sulfoamino)carbonyl]oxy}methyl)-decahydropyrrolo[1,2-c]purine-5,10,10-triol

> <ALOGPS_LOGP>
-2.07

> <JCHEM_LOGP>
-4.3392393393438935

> <ALOGPS_LOGS>
-2.44

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
3

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
6.709212464404382

> <JCHEM_PKA_STRONGEST_ACIDIC>
-1.6009163436767908

> <JCHEM_PKA_STRONGEST_BASIC>
9.710309399700298

> <JCHEM_POLAR_SURFACE_AREA>
231.63

> <JCHEM_REFRACTIVITY>
100.5932

> <JCHEM_ROTATABLE_BOND_COUNT>
3

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
1.45e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
2,6-diimino-4-({[(sulfoamino)carbonyl]oxy}methyl)-hexahydropyrrolo[1,2-c]purine-5,10,10-triol

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0033512
     RDKit          3D
Gonyautoxin VI
 43 45  0  0  0  0  0  0  0  0999 V2000
   -2.4756   -2.4627   -2.9387 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0713   -1.7755   -1.9303 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9439   -0.8640   -1.9181 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7354   -0.6321   -0.5399 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2013    0.3788   -0.0575 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5865    0.0426   -0.5779 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5735    0.8757   -0.0511 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8887    0.6863   -0.4365 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1444   -0.2266   -1.2449 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9472    1.4919    0.0558 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5665    1.2292   -0.4426 S   0  0  0  0  0  6  0  0  0  0  0  0
    6.8917    1.9309   -1.7375 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5320    1.7801    0.5869 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8632   -0.4276   -0.5564 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2134    0.2267    1.4101 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2930    0.5094    2.1248 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9925   -0.2446    2.0730 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9603   -0.5656    3.3158 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1994   -0.3401    1.3486 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5979   -0.2395    1.6562 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1930    0.4565    0.4072 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9768    0.5945   -0.5376 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4396    0.4630   -1.8206 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4332    1.8349   -0.2449 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1492   -0.5499   -0.0480 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6557   -1.7717   -0.5972 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2764   -3.0970   -2.9112 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4353   -0.4902   -2.7337 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3658   -1.6321   -0.1141 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0795    1.3798   -0.3714 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5664   -0.0108   -1.6739 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7907   -1.0094   -0.2204 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7697    2.2691    0.7372 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.8213   -0.5360   -0.7330 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1289    1.1635    2.8577 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8228   -0.9005    3.7819 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8369    0.3239    2.5581 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0236   -1.2529    1.7606 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9136   -0.2180   -0.0658 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6187    1.4255    0.6552 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7607    0.6311   -2.5011 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5444    2.0414    0.7198 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2769   -2.4880   -0.1834 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  3
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  2  0
 11 13  2  0
 11 14  1  0
  5 15  1  0
 15 16  1  0
 15 17  1  0
 17 18  2  3
 17 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 22 25  1  0
 25 26  1  0
 26  2  1  0
 25  4  1  0
 25 19  1  0
  1 27  1  0
  3 28  1  0
  4 29  1  0
  5 30  1  0
  6 31  1  0
  6 32  1  0
 10 33  1  0
 14 34  1  0
 16 35  1  0
 18 36  1  0
 20 37  1  0
 20 38  1  0
 21 39  1  0
 21 40  1  0
 23 41  1  0
 24 42  1  0
 26 43  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  O   UNK     0       3.549  -7.529   0.000  0.00  0.00           O+0
HETATM    2  O   UNK     0       5.089  -5.989   0.000  0.00  0.00           O+0
HETATM    3  S   UNK     0       3.549  -5.989   0.000  0.00  0.00           S+0
HETATM    4  O   UNK     0       2.009  -5.989   0.000  0.00  0.00           O+0
HETATM    5  N   UNK     0       3.549  -4.449   0.000  0.00  0.00           N+0
HETATM    6  C   UNK     0       2.216  -3.679   0.000  0.00  0.00           C+0
HETATM    7  O   UNK     0       0.882  -4.449   0.000  0.00  0.00           O+0
HETATM    8  O   UNK     0       2.216  -2.139   0.000  0.00  0.00           O+0
HETATM    9  C   UNK     0       0.882  -1.369   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       0.882   0.171   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0      -0.452   0.941   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0      -0.452   2.481   0.000  0.00  0.00           C+0
HETATM   13  N   UNK     0      -1.916   2.957   0.000  0.00  0.00           N+0
HETATM   14  O   UNK     0       3.549   0.171   0.000  0.00  0.00           O+0
HETATM   15  N   UNK     0       2.216   0.941   0.000  0.00  0.00           N+0
HETATM   16  N   UNK     0      -1.916   0.466   0.000  0.00  0.00           N+0
HETATM   17  C   UNK     0      -2.822   1.711   0.000  0.00  0.00           C+0
HETATM   18  N   UNK     0      -4.362   1.711   0.000  0.00  0.00           N+0
HETATM   19  N   UNK     0       3.549   3.251   0.000  0.00  0.00           N+0
HETATM   20  C   UNK     0       2.216   2.481   0.000  0.00  0.00           C+0
HETATM   21  N   UNK     0       0.882   3.251   0.000  0.00  0.00           N+0
HETATM   22  C   UNK     0       0.562   4.758   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0      -0.970   4.919   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0      -1.596   3.512   0.000  0.00  0.00           C+0
HETATM   25  O   UNK     0      -2.476   4.858   0.000  0.00  0.00           O+0
HETATM   26  O   UNK     0      -3.066   3.972   0.000  0.00  0.00           O+0
CONECT    1    3                                                            
CONECT    2    3                                                            
CONECT    3    1    2    4    5                                             
CONECT    4    3                                                            
CONECT    5    3    6                                                       
CONECT    6    5    7    8                                                  
CONECT    7    6                                                            
CONECT    8    6    9                                                       
CONECT    9    8   10                                                       
CONECT   10    9   11   15                                                  
CONECT   11   10   12   16                                                  
CONECT   12   11   13   21   24                                             
CONECT   13   12   17                                                       
CONECT   14   15                                                            
CONECT   15   10   14   20                                                  
CONECT   16   11   17                                                       
CONECT   17   13   16   18                                                  
CONECT   18   17                                                            
CONECT   19   20                                                            
CONECT   20   15   19   21                                                  
CONECT   21   12   20   22                                                  
CONECT   22   21   23                                                       
CONECT   23   22   24                                                       
CONECT   24   12   23   25   26                                             
CONECT   25   24                                                            
CONECT   26   24                                                            
MASTER        0    0    0    0    0    0    0    0   26    0   56    0
END

COMPND    HMDB0033512
HETATM    1  N1  UNL     1      -2.476  -2.463  -2.939  1.00  0.00           N  
HETATM    2  C1  UNL     1      -2.071  -1.775  -1.930  1.00  0.00           C  
HETATM    3  N2  UNL     1      -0.944  -0.864  -1.918  1.00  0.00           N  
HETATM    4  C2  UNL     1      -0.735  -0.632  -0.540  1.00  0.00           C  
HETATM    5  C3  UNL     1       0.201   0.379  -0.058  1.00  0.00           C  
HETATM    6  C4  UNL     1       1.587   0.043  -0.578  1.00  0.00           C  
HETATM    7  O1  UNL     1       2.574   0.876  -0.051  1.00  0.00           O  
HETATM    8  C5  UNL     1       3.889   0.686  -0.436  1.00  0.00           C  
HETATM    9  O2  UNL     1       4.144  -0.227  -1.245  1.00  0.00           O  
HETATM   10  N3  UNL     1       4.947   1.492   0.056  1.00  0.00           N  
HETATM   11  S1  UNL     1       6.566   1.229  -0.443  1.00  0.00           S  
HETATM   12  O3  UNL     1       6.892   1.931  -1.738  1.00  0.00           O  
HETATM   13  O4  UNL     1       7.532   1.780   0.587  1.00  0.00           O  
HETATM   14  O5  UNL     1       6.863  -0.428  -0.556  1.00  0.00           O  
HETATM   15  N4  UNL     1       0.213   0.227   1.410  1.00  0.00           N  
HETATM   16  O6  UNL     1       1.293   0.509   2.125  1.00  0.00           O  
HETATM   17  C6  UNL     1      -0.993  -0.245   2.073  1.00  0.00           C  
HETATM   18  N5  UNL     1      -0.960  -0.566   3.316  1.00  0.00           N  
HETATM   19  N6  UNL     1      -2.199  -0.340   1.349  1.00  0.00           N  
HETATM   20  C7  UNL     1      -3.598  -0.239   1.656  1.00  0.00           C  
HETATM   21  C8  UNL     1      -4.193   0.456   0.407  1.00  0.00           C  
HETATM   22  C9  UNL     1      -2.977   0.595  -0.538  1.00  0.00           C  
HETATM   23  O7  UNL     1      -3.440   0.463  -1.821  1.00  0.00           O  
HETATM   24  O8  UNL     1      -2.433   1.835  -0.245  1.00  0.00           O  
HETATM   25  C10 UNL     1      -2.149  -0.550  -0.048  1.00  0.00           C  
HETATM   26  N7  UNL     1      -2.656  -1.772  -0.597  1.00  0.00           N  
HETATM   27  H1  UNL     1      -3.276  -3.097  -2.911  1.00  0.00           H  
HETATM   28  H2  UNL     1      -0.435  -0.490  -2.734  1.00  0.00           H  
HETATM   29  H3  UNL     1      -0.366  -1.632  -0.114  1.00  0.00           H  
HETATM   30  H4  UNL     1      -0.080   1.380  -0.371  1.00  0.00           H  
HETATM   31  H5  UNL     1       1.566  -0.011  -1.674  1.00  0.00           H  
HETATM   32  H6  UNL     1       1.791  -1.009  -0.220  1.00  0.00           H  
HETATM   33  H7  UNL     1       4.770   2.269   0.737  1.00  0.00           H  
HETATM   34  H8  UNL     1       7.821  -0.536  -0.733  1.00  0.00           H  
HETATM   35  H9  UNL     1       1.129   1.164   2.858  1.00  0.00           H  
HETATM   36  H10 UNL     1      -1.823  -0.901   3.782  1.00  0.00           H  
HETATM   37  H11 UNL     1      -3.837   0.324   2.558  1.00  0.00           H  
HETATM   38  H12 UNL     1      -4.024  -1.253   1.761  1.00  0.00           H  
HETATM   39  H13 UNL     1      -4.914  -0.218  -0.066  1.00  0.00           H  
HETATM   40  H14 UNL     1      -4.619   1.425   0.655  1.00  0.00           H  
HETATM   41  H15 UNL     1      -2.761   0.631  -2.501  1.00  0.00           H  
HETATM   42  H16 UNL     1      -2.544   2.041   0.720  1.00  0.00           H  
HETATM   43  H17 UNL     1      -3.277  -2.488  -0.183  1.00  0.00           H  
CONECT    1    2    2   27
CONECT    2    3   26
CONECT    3    4   28
CONECT    4    5   25   29
CONECT    5    6   15   30
CONECT    6    7   31   32
CONECT    7    8
CONECT    8    9    9   10
CONECT   10   11   33
CONECT   11   12   12   13   13
CONECT   11   14
CONECT   14   34
CONECT   15   16   17
CONECT   16   35
CONECT   17   18   18   19
CONECT   18   36
CONECT   19   20   25
CONECT   20   21   37   38
CONECT   21   22   39   40
CONECT   22   23   24   25
CONECT   23   41
CONECT   24   42
CONECT   25   26
CONECT   26   43
END

HMDB0033512
     RDKit          3D
Gonyautoxin VI
 43 45  0  0  0  0  0  0  0  0999 V2000
   -2.4756   -2.4627   -2.9387 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0713   -1.7755   -1.9303 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9439   -0.8640   -1.9181 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7354   -0.6321   -0.5399 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2013    0.3788   -0.0575 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5865    0.0426   -0.5779 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5735    0.8757   -0.0511 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8887    0.6863   -0.4365 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1444   -0.2266   -1.2449 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9472    1.4919    0.0558 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.5665    1.2292   -0.4426 S   0  0  0  0  0  6  0  0  0  0  0  0
    6.8917    1.9309   -1.7375 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5320    1.7801    0.5869 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8632   -0.4276   -0.5564 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2134    0.2267    1.4101 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2930    0.5094    2.1248 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9925   -0.2446    2.0730 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9603   -0.5656    3.3158 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1994   -0.3401    1.3486 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5979   -0.2395    1.6562 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1930    0.4565    0.4072 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9768    0.5945   -0.5376 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4396    0.4630   -1.8206 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4332    1.8349   -0.2449 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1492   -0.5499   -0.0480 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6557   -1.7717   -0.5972 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2764   -3.0970   -2.9112 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4353   -0.4902   -2.7337 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3658   -1.6321   -0.1141 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0795    1.3798   -0.3714 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5664   -0.0108   -1.6739 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7907   -1.0094   -0.2204 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7697    2.2691    0.7372 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.8213   -0.5360   -0.7330 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1289    1.1635    2.8577 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8228   -0.9005    3.7819 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8369    0.3239    2.5581 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0236   -1.2529    1.7606 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9136   -0.2180   -0.0658 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6187    1.4255    0.6552 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7607    0.6311   -2.5011 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5444    2.0414    0.7198 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2769   -2.4880   -0.1834 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  3
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  8 10  1  0
 10 11  1  0
 11 12  2  0
 11 13  2  0
 11 14  1  0
  5 15  1  0
 15 16  1  0
 15 17  1  0
 17 18  2  3
 17 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 22 24  1  0
 22 25  1  0
 25 26  1  0
 26  2  1  0
 25  4  1  0
 25 19  1  0
  1 27  1  0
  3 28  1  0
  4 29  1  0
  5 30  1  0
  6 31  1  0
  6 32  1  0
 10 33  1  0
 14 34  1  0
 16 35  1  0
 18 36  1  0
 20 37  1  0
 20 38  1  0
 21 39  1  0
 21 40  1  0
 23 41  1  0
 24 42  1  0
 26 43  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
Gonyautoxin-vi	HMDB
Toxin b2	HMDB
N-SulfO({5,10,10-trihydroxy-2,6-diimino-decahydropyrrolo[1,2-c]purin-4-yl}methoxy)carboximidate	Generator
N-SulphO({5,10,10-trihydroxy-2,6-diimino-decahydropyrrolo[1,2-c]purin-4-yl}methoxy)carboximidate	Generator
N-SulphO({5,10,10-trihydroxy-2,6-diimino-decahydropyrrolo[1,2-c]purin-4-yl}methoxy)carboximidic acid	Generator

Chemical Formula

C₁₀H₁₇N₇O₈S

Average Molecular Weight

395.349

Monoisotopic Molecular Weight

395.085931245

IUPAC Name

2,6-diimino-4-({[(sulfoamino)carbonyl]oxy}methyl)-decahydropyrrolo[1,2-c]purine-5,10,10-triol

Traditional Name

2,6-diimino-4-({[(sulfoamino)carbonyl]oxy}methyl)-hexahydropyrrolo[1,2-c]purine-5,10,10-triol

CAS Registry Number

82810-44-4

SMILES

ON1C(COC(=O)NS(O)(=O)=O)C2NC(=N)NC22N(CCC2(O)O)C1=N

InChI Identifier

InChI=1S/C10H17N7O8S/c11-6-13-5-4(3-25-8(18)15-26(22,23)24)17(21)7(12)16-2-1-9(19,20)10(5,16)14-6/h4-5,12,19-21H,1-3H2,(H,15,18)(H3,11,13,14)(H,22,23,24)

InChI Key

ALRRPAKWGUBPBK-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as saxitoxins, gonyautoxins, and derivatives. Saxitoxins, gonyautoxins, and derivatives are compounds with a structure based on a 2,6-diamino-4-methyl-pyrrolo[1,2-c]purin-10-ol skeleton.

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Saxitoxins, gonyautoxins, and derivatives

Sub Class

Not Available

Direct Parent

Saxitoxins, gonyautoxins, and derivatives

Alternative Parents

Substituents

Saxitoxin-gonyautoxin skeleton
Imidazopyrimidine
Alkaloid or derivatives
1,3-diazinane
N-hydroxyguanidine
Imidazolidine
Organic sulfuric acid or derivatives
Pyrrolidine
Guanidine
Azacycle
Carbonyl hydrate
Polyol
Organoheterocyclic compound
Carboximidamide
Organonitrogen compound
Organopnictogen compound
Imine
Organooxygen compound
Organic oxide
Hydrocarbon derivative
Organic nitrogen compound
Organic oxygen compound
Aliphatic heteropolycyclic compound

Molecular Framework

Aliphatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Route of exposure

Enteral

Ingestion (HMDB: HMDB0033512)

Source

Exogenous

Exogenous (HMDB: HMDB0033512)

Food

Food (HMDB: HMDB0033512)

Aquatic origin

Mollusk

Mollusks (FooDB: FOOD00868)

Endogenous

Plant

Plant (HMDB: HMDB0033512)

Animal

Animal (HMDB: HMDB0033512)

Process

Not Available

Role

Biological role

Nutrient (HMDB: HMDB0033512)

Environmental role

Environmental contaminant (HMDB: HMDB0033512)

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	1.45 g/L	ALOGPS
logP	-2.1	ALOGPS
logP	-4.3	ChemAxon
logS	-2.4	ALOGPS
pKa (Strongest Acidic)	-1.6	ChemAxon
pKa (Strongest Basic)	9.71	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	13	ChemAxon
Hydrogen Donor Count	9	ChemAxon
Polar Surface Area	231.63 Å²	ChemAxon
Rotatable Bond Count	3	ChemAxon
Refractivity	100.59 m³·mol⁻¹	ChemAxon
Polarizability	33.45 Å³	ChemAxon
Number of Rings	3	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DarkChem	[M+H]+	185.322	31661259
DarkChem	[M-H]-	174.726	31661259
DeepCCS	[M-2H]-	221.318	30932474
DeepCCS	[M+Na]+	197.19	30932474
AllCCS	[M+H]+	182.4	32859911
AllCCS	[M+H-H2O]+	179.8	32859911
AllCCS	[M+NH4]+	184.8	32859911
AllCCS	[M+Na]+	185.5	32859911
AllCCS	[M-H]-	179.5	32859911
AllCCS	[M+Na-2H]-	179.1	32859911
AllCCS	[M+HCOO]-	178.7	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Gonyautoxin VI	ON1C(COC(=O)NS(O)(=O)=O)C2NC(=N)NC22N(CCC2(O)O)C1=N	6030.0	Standard polar	33892256
Gonyautoxin VI	ON1C(COC(=O)NS(O)(=O)=O)C2NC(=N)NC22N(CCC2(O)O)C1=N	3322.6	Standard non polar	33892256
Gonyautoxin VI	ON1C(COC(=O)NS(O)(=O)=O)C2NC(=N)NC22N(CCC2(O)O)C1=N	4074.6	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Gonyautoxin VI,1TMS,isomer #1	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O)C3NC(=N)NC321	3942.2	Semi standard non polar	33892256
Gonyautoxin VI,1TMS,isomer #2	C[Si](C)(C)OS(=O)(=O)NC(=O)OCC1C2NC(=N)NC23N(CCC3(O)O)C(=N)N1O	4007.2	Semi standard non polar	33892256
Gonyautoxin VI,1TMS,isomer #3	C[Si](C)(C)N(C(=O)OCC1C2NC(=N)NC23N(CCC3(O)O)C(=N)N1O)S(=O)(=O)O	3981.9	Semi standard non polar	33892256
Gonyautoxin VI,1TMS,isomer #4	C[Si](C)(C)N1C(=N)NC23C1C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N2CCC3(O)O	3815.5	Semi standard non polar	33892256
Gonyautoxin VI,1TMS,isomer #5	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O)(O)C23N1	3940.3	Semi standard non polar	33892256
Gonyautoxin VI,1TMS,isomer #6	C[Si](C)(C)N1C(=N)NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O)(O)C231	3852.1	Semi standard non polar	33892256
Gonyautoxin VI,1TMS,isomer #7	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N)NC23N1CCC3(O)O	3917.9	Semi standard non polar	33892256
Gonyautoxin VI,2TMS,isomer #1	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O)C3NC(=N)NC321	3872.0	Semi standard non polar	33892256
Gonyautoxin VI,2TMS,isomer #10	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O)(O)C23N1	3913.7	Semi standard non polar	33892256
Gonyautoxin VI,2TMS,isomer #11	C[Si](C)(C)OS(=O)(=O)NC(=O)OCC1C2NC(=N)N([Si](C)(C)C)C23N(CCC3(O)O)C(=N)N1O	3833.9	Semi standard non polar	33892256
Gonyautoxin VI,2TMS,isomer #12	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2NC(=N)NC23N1CCC3(O)O	3902.8	Semi standard non polar	33892256
Gonyautoxin VI,2TMS,isomer #13	C[Si](C)(C)N1C(=N)NC23C1C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N2CCC3(O)O	3789.8	Semi standard non polar	33892256
Gonyautoxin VI,2TMS,isomer #14	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O)(O)C23N1	3896.7	Semi standard non polar	33892256
Gonyautoxin VI,2TMS,isomer #15	C[Si](C)(C)N1C(=N)NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O)(O)C231	3799.4	Semi standard non polar	33892256
Gonyautoxin VI,2TMS,isomer #16	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2NC(=N)NC23N1CCC3(O)O	3849.2	Semi standard non polar	33892256
Gonyautoxin VI,2TMS,isomer #17	C[Si](C)(C)N=C1NC23C(C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N2CCC3(O)O)N1[Si](C)(C)C	3728.3	Semi standard non polar	33892256
Gonyautoxin VI,2TMS,isomer #18	C[Si](C)(C)N1C(=N)N([Si](C)(C)C)C23C1C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N2CCC3(O)O	3616.3	Semi standard non polar	33892256
Gonyautoxin VI,2TMS,isomer #19	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C)C(=N)NC23N1CCC3(O)O	3723.4	Semi standard non polar	33892256
Gonyautoxin VI,2TMS,isomer #2	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C3NC(=N)NC321	3920.0	Semi standard non polar	33892256
Gonyautoxin VI,2TMS,isomer #20	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N[Si](C)(C)C)N3CCC(O)(O)C23N1	3814.1	Semi standard non polar	33892256
Gonyautoxin VI,2TMS,isomer #21	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C	3748.8	Semi standard non polar	33892256
Gonyautoxin VI,2TMS,isomer #22	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N)N([Si](C)(C)C)C23N1CCC3(O)O	3741.5	Semi standard non polar	33892256
Gonyautoxin VI,2TMS,isomer #3	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N)NC23N1CCC3(O)O[Si](C)(C)C	3851.4	Semi standard non polar	33892256
Gonyautoxin VI,2TMS,isomer #4	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C3NC(=N)NC321	3904.8	Semi standard non polar	33892256
Gonyautoxin VI,2TMS,isomer #5	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O)C3N([Si](C)(C)C)C(=N)NC321	3771.0	Semi standard non polar	33892256
Gonyautoxin VI,2TMS,isomer #6	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C)C23N1	3865.6	Semi standard non polar	33892256
Gonyautoxin VI,2TMS,isomer #7	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O)C3NC(=N)N([Si](C)(C)C)C321	3811.7	Semi standard non polar	33892256
Gonyautoxin VI,2TMS,isomer #8	C[Si](C)(C)OS(=O)(=O)N(C(=O)OCC1C2NC(=N)NC23N(CCC3(O)O)C(=N)N1O)[Si](C)(C)C	3937.6	Semi standard non polar	33892256
Gonyautoxin VI,2TMS,isomer #9	C[Si](C)(C)OS(=O)(=O)NC(=O)OCC1C2N([Si](C)(C)C)C(=N)NC23N(CCC3(O)O)C(=N)N1O	3816.1	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #1	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C3NC(=N)NC321	3787.9	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #1	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C3NC(=N)NC321	3806.6	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #10	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C)C23N1	3813.2	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #10	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C)C23N1	3814.8	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #11	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C3NC(=N)N([Si](C)(C)C)C321	3770.5	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #11	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C3NC(=N)N([Si](C)(C)C)C321	3909.7	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #12	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2NC(=N)NC23N1CCC3(O)O[Si](C)(C)C	3775.5	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #12	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2NC(=N)NC23N1CCC3(O)O[Si](C)(C)C	3758.5	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #13	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C)C(=N)NC23N1CCC3(O)O[Si](C)(C)C	3638.0	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #13	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C)C(=N)NC23N1CCC3(O)O[Si](C)(C)C	3716.1	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #14	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N[Si](C)(C)C)N3CCC(O)(O[Si](C)(C)C)C23N1	3709.9	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #14	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N[Si](C)(C)C)N3CCC(O)(O[Si](C)(C)C)C23N1	3637.9	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #15	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	3669.9	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #15	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	3753.0	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #16	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C3N([Si](C)(C)C)C(=N)NC321	3727.9	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #16	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C3N([Si](C)(C)C)C(=N)NC321	3883.3	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #17	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C)C23N1	3812.8	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #17	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C)C23N1	3823.8	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #18	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C3NC(=N)N([Si](C)(C)C)C321	3752.6	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #18	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C3NC(=N)N([Si](C)(C)C)C321	3921.8	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #19	C[Si](C)(C)N=C1NC23C(C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N2CCC3(O)O[Si](C)(C)C)N1[Si](C)(C)C	3652.9	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #19	C[Si](C)(C)N=C1NC23C(C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N2CCC3(O)O[Si](C)(C)C)N1[Si](C)(C)C	3770.1	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #2	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N)NC23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3759.6	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #2	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N)NC23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3640.7	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #20	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O)C3N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C321	3588.1	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #20	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O)C3N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C321	3900.7	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #21	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C)C23N1[Si](C)(C)C	3685.1	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #21	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C)C23N1[Si](C)(C)C	3807.3	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #22	C[Si](C)(C)OS(=O)(=O)N(C(=O)OCC1C2N([Si](C)(C)C)C(=N)NC23N(CCC3(O)O)C(=N)N1O)[Si](C)(C)C	3742.2	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #22	C[Si](C)(C)OS(=O)(=O)N(C(=O)OCC1C2N([Si](C)(C)C)C(=N)NC23N(CCC3(O)O)C(=N)N1O)[Si](C)(C)C	3885.7	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #23	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O)(O)C23N1	3815.4	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #23	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O)(O)C23N1	3824.7	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #24	C[Si](C)(C)OS(=O)(=O)N(C(=O)OCC1C2NC(=N)N([Si](C)(C)C)C23N(CCC3(O)O)C(=N)N1O)[Si](C)(C)C	3735.1	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #24	C[Si](C)(C)OS(=O)(=O)N(C(=O)OCC1C2NC(=N)N([Si](C)(C)C)C23N(CCC3(O)O)C(=N)N1O)[Si](C)(C)C	3917.9	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #25	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2NC(=N)NC23N1CCC3(O)O	3781.8	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #25	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2NC(=N)NC23N1CCC3(O)O	3762.3	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #26	C[Si](C)(C)N=C1NC23C(C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N2CCC3(O)O)N1[Si](C)(C)C	3690.8	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #26	C[Si](C)(C)N=C1NC23C(C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N2CCC3(O)O)N1[Si](C)(C)C	3850.2	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #27	C[Si](C)(C)OS(=O)(=O)NC(=O)OCC1C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N(CCC3(O)O)C(=N)N1O	3574.2	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #27	C[Si](C)(C)OS(=O)(=O)NC(=O)OCC1C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N(CCC3(O)O)C(=N)N1O	3959.7	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #28	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N)NC23N1CCC3(O)O	3683.1	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #28	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N)NC23N1CCC3(O)O	3804.5	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #29	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N[Si](C)(C)C)N3CCC(O)(O)C23N1	3762.2	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #29	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N[Si](C)(C)C)N3CCC(O)(O)C23N1	3728.2	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #3	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C3NC(=N)NC321	3823.8	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #3	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C3NC(=N)NC321	3813.2	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #30	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C	3702.3	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #30	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C	3870.6	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #31	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2NC(=N)N([Si](C)(C)C)C23N1CCC3(O)O	3691.1	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #31	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2NC(=N)N([Si](C)(C)C)C23N1CCC3(O)O	3816.6	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #32	C[Si](C)(C)N=C1NC23C(C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N2CCC3(O)O)N1[Si](C)(C)C	3694.3	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #32	C[Si](C)(C)N=C1NC23C(C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N2CCC3(O)O)N1[Si](C)(C)C	3862.4	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #33	C[Si](C)(C)N1C(=N)N([Si](C)(C)C)C23C1C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N2CCC3(O)O	3580.0	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #33	C[Si](C)(C)N1C(=N)N([Si](C)(C)C)C23C1C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N2CCC3(O)O	3971.4	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #34	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C)C(=N)NC23N1CCC3(O)O	3666.9	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #34	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C)C(=N)NC23N1CCC3(O)O	3814.5	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #35	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N[Si](C)(C)C)N3CCC(O)(O)C23N1	3764.0	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #35	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N[Si](C)(C)C)N3CCC(O)(O)C23N1	3737.2	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #36	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C	3699.4	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #36	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C	3881.9	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #37	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2NC(=N)N([Si](C)(C)C)C23N1CCC3(O)O	3666.9	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #37	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2NC(=N)N([Si](C)(C)C)C23N1CCC3(O)O	3826.1	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #38	C[Si](C)(C)N=C1N([Si](C)(C)C)C2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C	3535.4	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #38	C[Si](C)(C)N=C1N([Si](C)(C)C)C2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C	3687.4	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #39	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)NC23N1CCC3(O)O	3611.4	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #39	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)NC23N1CCC3(O)O	3656.2	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #4	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O)C3N([Si](C)(C)C)C(=N)NC321	3702.0	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #4	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O)C3N([Si](C)(C)C)C(=N)NC321	3795.7	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #40	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N1CCC3(O)O	3513.9	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #40	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N1CCC3(O)O	3783.1	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #41	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O	3621.5	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #41	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O	3698.3	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #5	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1	3778.9	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #5	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1	3736.9	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #6	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O)C3NC(=N)N([Si](C)(C)C)C321	3748.3	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #6	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O)C3NC(=N)N([Si](C)(C)C)C321	3848.7	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #7	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2NC(=N)NC23N1CCC3(O)O[Si](C)(C)C	3794.8	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #7	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2NC(=N)NC23N1CCC3(O)O[Si](C)(C)C	3751.2	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #8	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C3NC(=N)NC321	3820.7	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #8	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C3NC(=N)NC321	3823.6	Standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #9	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C3N([Si](C)(C)C)C(=N)NC321	3732.1	Semi standard non polar	33892256
Gonyautoxin VI,3TMS,isomer #9	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C3N([Si](C)(C)C)C(=N)NC321	3870.9	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #1	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2NC(=N)NC23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3673.3	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #1	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2NC(=N)NC23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3833.6	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #10	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C3N([Si](C)(C)C)C(=N)NC321	3682.8	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #10	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C3N([Si](C)(C)C)C(=N)NC321	3974.5	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #11	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1	3718.8	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #11	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1	3924.0	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #12	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C3NC(=N)N([Si](C)(C)C)C321	3693.2	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #12	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C3NC(=N)N([Si](C)(C)C)C321	4021.7	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #13	C[Si](C)(C)N=C1NC23C(C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N2CCC3(O[Si](C)(C)C)O[Si](C)(C)C)N1[Si](C)(C)C	3618.0	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #13	C[Si](C)(C)N=C1NC23C(C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N2CCC3(O[Si](C)(C)C)O[Si](C)(C)C)N1[Si](C)(C)C	3805.3	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #14	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O)C3N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C321	3573.6	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #14	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O)C3N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C321	3929.1	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #15	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1[Si](C)(C)C	3635.9	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #15	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1[Si](C)(C)C	3853.4	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #16	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2NC(=N)NC23N1CCC3(O)O[Si](C)(C)C	3689.1	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #16	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2NC(=N)NC23N1CCC3(O)O[Si](C)(C)C	3861.0	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #17	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N)NC23N1CCC3(O)O[Si](C)(C)C	3610.4	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #17	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N)NC23N1CCC3(O)O[Si](C)(C)C	3914.1	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #18	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N[Si](C)(C)C)N3CCC(O)(O[Si](C)(C)C)C23N1	3663.0	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #18	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N[Si](C)(C)C)N3CCC(O)(O[Si](C)(C)C)C23N1	3830.2	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #19	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2NC(=N)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	3614.6	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #19	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2NC(=N)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	3927.2	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #2	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C3NC(=N)NC321	3717.0	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #2	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C3NC(=N)NC321	3905.2	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #20	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C3N([Si](C)(C)C)C(=N)NC321	3670.8	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #20	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C3N([Si](C)(C)C)C(=N)NC321	3983.0	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #21	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C)C23N1	3723.7	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #21	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C)C23N1	3928.2	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #22	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C3NC(=N)N([Si](C)(C)C)C321	3673.9	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #22	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C3NC(=N)N([Si](C)(C)C)C321	4019.2	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #23	C[Si](C)(C)N=C1NC23C(C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N2CCC3(O)O[Si](C)(C)C)N1[Si](C)(C)C	3622.4	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #23	C[Si](C)(C)N=C1NC23C(C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N2CCC3(O)O[Si](C)(C)C)N1[Si](C)(C)C	3953.3	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #24	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C3N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C321	3560.6	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #24	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C3N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C321	4059.1	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #25	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C)C23N1[Si](C)(C)C	3633.0	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #25	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C)C23N1[Si](C)(C)C	3981.7	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #26	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C)C(=N)NC23N1CCC3(O)O[Si](C)(C)C	3607.8	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #26	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C)C(=N)NC23N1CCC3(O)O[Si](C)(C)C	3930.4	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #27	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N[Si](C)(C)C)N3CCC(O)(O[Si](C)(C)C)C23N1	3675.2	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #27	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N[Si](C)(C)C)N3CCC(O)(O[Si](C)(C)C)C23N1	3853.6	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #28	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2NC(=N)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	3603.8	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #28	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2NC(=N)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	3945.8	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #29	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)NC23N1CCC3(O)O[Si](C)(C)C	3542.3	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #29	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)NC23N1CCC3(O)O[Si](C)(C)C	3725.1	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #3	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C3N([Si](C)(C)C)C(=N)NC321	3686.6	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #3	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C3N([Si](C)(C)C)C(=N)NC321	3959.2	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #30	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	3483.5	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #30	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	3847.7	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #31	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	3534.7	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #31	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	3762.8	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #32	C[Si](C)(C)N=C1NC23C(C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N2CCC3(O)O[Si](C)(C)C)N1[Si](C)(C)C	3637.5	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #32	C[Si](C)(C)N=C1NC23C(C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N2CCC3(O)O[Si](C)(C)C)N1[Si](C)(C)C	3970.5	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #33	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C3N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C321	3574.8	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #33	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C3N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C321	4078.8	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #34	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C)C23N1[Si](C)(C)C	3640.0	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #34	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C)C23N1[Si](C)(C)C	3997.5	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #35	C[Si](C)(C)N=C1N([Si](C)(C)C)C2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C)C23N1[Si](C)(C)C	3515.7	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #35	C[Si](C)(C)N=C1N([Si](C)(C)C)C2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C)C23N1[Si](C)(C)C	3766.9	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #36	C[Si](C)(C)N=C1NC23C(C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N2CCC3(O)O)N1[Si](C)(C)C	3646.3	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #36	C[Si](C)(C)N=C1NC23C(C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N2CCC3(O)O)N1[Si](C)(C)C	3975.8	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #37	C[Si](C)(C)OS(=O)(=O)N(C(=O)OCC1C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N(CCC3(O)O)C(=N)N1O)[Si](C)(C)C	3525.3	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #37	C[Si](C)(C)OS(=O)(=O)N(C(=O)OCC1C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N(CCC3(O)O)C(=N)N1O)[Si](C)(C)C	4077.1	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #38	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N)NC23N1CCC3(O)O	3618.7	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #38	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N)NC23N1CCC3(O)O	3936.1	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #39	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N[Si](C)(C)C)N3CCC(O)(O)C23N1	3690.8	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #39	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N[Si](C)(C)C)N3CCC(O)(O)C23N1	3851.4	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #4	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1	3708.2	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #4	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1	3904.0	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #40	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C	3619.5	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #40	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C	3999.0	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #41	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2NC(=N)N([Si](C)(C)C)C23N1CCC3(O)O	3587.8	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #41	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2NC(=N)N([Si](C)(C)C)C23N1CCC3(O)O	3946.4	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #42	C[Si](C)(C)N=C1N([Si](C)(C)C)C2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C	3502.3	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #42	C[Si](C)(C)N=C1N([Si](C)(C)C)C2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C	3916.7	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #43	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)NC23N1CCC3(O)O	3580.2	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #43	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)NC23N1CCC3(O)O	3876.9	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #44	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N1CCC3(O)O	3464.0	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #44	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N1CCC3(O)O	3984.9	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #45	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2NC(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O	3543.1	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #45	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2NC(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O	3894.8	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #46	C[Si](C)(C)N=C1N([Si](C)(C)C)C2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C	3497.0	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #46	C[Si](C)(C)N=C1N([Si](C)(C)C)C2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C	3931.6	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #47	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)NC23N1CCC3(O)O	3590.2	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #47	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)NC23N1CCC3(O)O	3894.8	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #48	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N1CCC3(O)O	3468.1	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #48	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N1CCC3(O)O	4000.5	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #49	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2NC(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O	3550.0	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #49	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2NC(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O	3915.3	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #5	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C3NC(=N)N([Si](C)(C)C)C321	3702.8	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #5	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C3NC(=N)N([Si](C)(C)C)C321	4006.8	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #50	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O	3425.9	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #50	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O	3673.8	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #6	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2NC(=N)NC23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3683.2	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #6	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2NC(=N)NC23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3854.7	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #7	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C)C(=N)NC23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3588.4	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #7	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C)C(=N)NC23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3755.7	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #8	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N[Si](C)(C)C)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1	3617.9	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #8	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N[Si](C)(C)C)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1	3682.7	Standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #9	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3622.1	Semi standard non polar	33892256
Gonyautoxin VI,4TMS,isomer #9	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3794.3	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #1	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2NC(=N)NC23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3593.1	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #1	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2NC(=N)NC23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3935.3	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #10	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1[Si](C)(C)C	3608.4	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #10	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1[Si](C)(C)C	4074.8	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #11	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C)C(=N)NC23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3572.5	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #11	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C)C(=N)NC23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	4024.7	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #12	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N[Si](C)(C)C)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1	3578.3	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #12	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N[Si](C)(C)C)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1	3942.2	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #13	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2NC(=N)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3573.8	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #13	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2NC(=N)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	4040.7	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #14	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)NC23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3512.3	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #14	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)NC23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3758.2	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #15	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3476.3	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #15	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3891.0	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #16	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3496.3	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #16	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3789.2	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #17	C[Si](C)(C)N=C1NC23C(C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N2CCC3(O[Si](C)(C)C)O[Si](C)(C)C)N1[Si](C)(C)C	3604.4	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #17	C[Si](C)(C)N=C1NC23C(C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N2CCC3(O[Si](C)(C)C)O[Si](C)(C)C)N1[Si](C)(C)C	4073.7	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #18	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C3N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C321	3555.5	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #18	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C3N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C321	4182.3	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #19	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1[Si](C)(C)C	3603.7	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #19	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1[Si](C)(C)C	4104.7	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #2	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N)NC23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3580.0	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #2	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N)NC23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3988.9	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #20	C[Si](C)(C)N=C1N([Si](C)(C)C)C2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1[Si](C)(C)C	3521.0	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #20	C[Si](C)(C)N=C1N([Si](C)(C)C)C2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1[Si](C)(C)C	3803.7	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #21	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N)NC23N1CCC3(O)O[Si](C)(C)C	3574.7	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #21	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N)NC23N1CCC3(O)O[Si](C)(C)C	4032.1	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #22	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N[Si](C)(C)C)N3CCC(O)(O[Si](C)(C)C)C23N1	3585.6	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #22	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N[Si](C)(C)C)N3CCC(O)(O[Si](C)(C)C)C23N1	3945.1	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #23	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2NC(=N)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	3561.2	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #23	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2NC(=N)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	4043.7	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #24	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)NC23N1CCC3(O)O[Si](C)(C)C	3534.3	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #24	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)NC23N1CCC3(O)O[Si](C)(C)C	3966.9	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #25	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	3468.5	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #25	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	4088.7	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #26	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2NC(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	3508.1	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #26	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2NC(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	3982.0	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #27	C[Si](C)(C)N=C1NC23C(C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N2CCC3(O)O[Si](C)(C)C)N1[Si](C)(C)C	3604.5	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #27	C[Si](C)(C)N=C1NC23C(C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N2CCC3(O)O[Si](C)(C)C)N1[Si](C)(C)C	4079.9	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #28	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C3N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C321	3532.6	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #28	C[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C3N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C321	4185.3	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #29	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C)C23N1[Si](C)(C)C	3590.3	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #29	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C)C23N1[Si](C)(C)C	4105.4	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #3	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N[Si](C)(C)C)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1	3579.1	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #3	C[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N[Si](C)(C)C)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1	3899.5	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #30	C[Si](C)(C)N=C1N([Si](C)(C)C)C2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C)C23N1[Si](C)(C)C	3494.5	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #30	C[Si](C)(C)N=C1N([Si](C)(C)C)C2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C)C23N1[Si](C)(C)C	4010.5	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #31	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)NC23N1CCC3(O)O[Si](C)(C)C	3537.7	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #31	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)NC23N1CCC3(O)O[Si](C)(C)C	4003.9	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #32	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	3475.1	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #32	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	4119.6	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #33	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2NC(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	3506.9	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #33	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2NC(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	4017.8	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #34	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	3426.8	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #34	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	3713.9	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #35	C[Si](C)(C)N=C1N([Si](C)(C)C)C2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C)C23N1[Si](C)(C)C	3509.5	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #35	C[Si](C)(C)N=C1N([Si](C)(C)C)C2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C)C23N1[Si](C)(C)C	4040.6	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #36	C[Si](C)(C)N=C1N([Si](C)(C)C)C2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C	3476.2	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #36	C[Si](C)(C)N=C1N([Si](C)(C)C)C2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C	4048.8	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #37	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)NC23N1CCC3(O)O	3553.4	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #37	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)NC23N1CCC3(O)O	4000.7	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #38	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N1CCC3(O)O	3440.8	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #38	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N1CCC3(O)O	4126.1	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #39	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2NC(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O	3494.4	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #39	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2NC(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O	4026.1	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #4	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2NC(=N)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3583.2	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #4	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2NC(=N)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	4005.3	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #40	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O	3418.5	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #40	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O	3897.3	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #41	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O	3429.7	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #41	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O	3952.8	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #5	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C3N([Si](C)(C)C)C(=N)NC321	3650.4	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #5	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C3N([Si](C)(C)C)C(=N)NC321	4067.2	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #6	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1	3647.5	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #6	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1	4013.2	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #7	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C3NC(=N)N([Si](C)(C)C)C321	3642.2	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #7	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C3NC(=N)N([Si](C)(C)C)C321	4106.3	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #8	C[Si](C)(C)N=C1NC23C(C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N2CCC3(O[Si](C)(C)C)O[Si](C)(C)C)N1[Si](C)(C)C	3593.0	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #8	C[Si](C)(C)N=C1NC23C(C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N2CCC3(O[Si](C)(C)C)O[Si](C)(C)C)N1[Si](C)(C)C	4041.8	Standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #9	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C3N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C321	3553.0	Semi standard non polar	33892256
Gonyautoxin VI,5TMS,isomer #9	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C3N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C321	4158.7	Standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #1	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N)NC23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3564.2	Semi standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #1	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N)NC23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	4112.2	Standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #10	C[Si](C)(C)N=C1N([Si](C)(C)C)C2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1[Si](C)(C)C	3519.8	Semi standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #10	C[Si](C)(C)N=C1N([Si](C)(C)C)C2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1[Si](C)(C)C	4087.1	Standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #11	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)NC23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3539.3	Semi standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #11	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)NC23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	4083.4	Standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #12	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3489.5	Semi standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #12	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	4206.9	Standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #13	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2NC(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3514.5	Semi standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #13	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2NC(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	4098.0	Standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #14	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3453.2	Semi standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #14	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3732.8	Standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #15	C[Si](C)(C)N=C1N([Si](C)(C)C)C2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1[Si](C)(C)C	3521.9	Semi standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #15	C[Si](C)(C)N=C1N([Si](C)(C)C)C2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1[Si](C)(C)C	4137.3	Standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #16	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)NC23N1CCC3(O)O[Si](C)(C)C	3540.0	Semi standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #16	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)NC23N1CCC3(O)O[Si](C)(C)C	4096.1	Standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #17	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	3473.4	Semi standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #17	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	4213.7	Standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #18	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2NC(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	3515.9	Semi standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #18	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2NC(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	4110.3	Standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #19	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	3445.5	Semi standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #19	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	3968.8	Standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #2	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N[Si](C)(C)C)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1	3550.4	Semi standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #2	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N[Si](C)(C)C)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1	4030.8	Standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #20	C[Si](C)(C)N=C1N([Si](C)(C)C)C2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C)C23N1[Si](C)(C)C	3501.2	Semi standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #20	C[Si](C)(C)N=C1N([Si](C)(C)C)C2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C)C23N1[Si](C)(C)C	4138.5	Standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #21	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	3451.8	Semi standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #21	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	4031.2	Standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #22	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O	3427.1	Semi standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #22	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O	4047.3	Standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #3	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2NC(=N)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3566.6	Semi standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #3	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2NC(=N)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	4120.6	Standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #4	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)NC23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3540.5	Semi standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #4	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)NC23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	4034.0	Standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #5	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3492.9	Semi standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #5	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	4154.5	Standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #6	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2NC(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3517.7	Semi standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #6	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2NC(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	4049.3	Standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #7	C[Si](C)(C)N=C1NC23C(C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N2CCC3(O[Si](C)(C)C)O[Si](C)(C)C)N1[Si](C)(C)C	3601.2	Semi standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #7	C[Si](C)(C)N=C1NC23C(C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N2CCC3(O[Si](C)(C)C)O[Si](C)(C)C)N1[Si](C)(C)C	4162.3	Standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #8	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C3N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C321	3543.2	Semi standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #8	C[Si](C)(C)OC1(O[Si](C)(C)C)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C3N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C321	4264.3	Standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #9	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1[Si](C)(C)C	3597.1	Semi standard non polar	33892256
Gonyautoxin VI,6TMS,isomer #9	C[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1[Si](C)(C)C	4193.7	Standard non polar	33892256
Gonyautoxin VI,7TMS,isomer #1	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)NC23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3570.2	Semi standard non polar	33892256
Gonyautoxin VI,7TMS,isomer #1	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)NC23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	4187.9	Standard non polar	33892256
Gonyautoxin VI,7TMS,isomer #2	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3521.9	Semi standard non polar	33892256
Gonyautoxin VI,7TMS,isomer #2	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	4281.0	Standard non polar	33892256
Gonyautoxin VI,7TMS,isomer #3	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2NC(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3554.5	Semi standard non polar	33892256
Gonyautoxin VI,7TMS,isomer #3	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2NC(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	4190.5	Standard non polar	33892256
Gonyautoxin VI,7TMS,isomer #4	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3488.7	Semi standard non polar	33892256
Gonyautoxin VI,7TMS,isomer #4	C[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	4039.2	Standard non polar	33892256
Gonyautoxin VI,7TMS,isomer #5	C[Si](C)(C)N=C1N([Si](C)(C)C)C2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1[Si](C)(C)C	3537.7	Semi standard non polar	33892256
Gonyautoxin VI,7TMS,isomer #5	C[Si](C)(C)N=C1N([Si](C)(C)C)C2C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)N(O)C(=N)N3CCC(O[Si](C)(C)C)(O[Si](C)(C)C)C23N1[Si](C)(C)C	4229.5	Standard non polar	33892256
Gonyautoxin VI,7TMS,isomer #6	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	3487.9	Semi standard non polar	33892256
Gonyautoxin VI,7TMS,isomer #6	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O[Si](C)(C)C)O[Si](C)(C)C	4109.7	Standard non polar	33892256
Gonyautoxin VI,7TMS,isomer #7	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	3476.4	Semi standard non polar	33892256
Gonyautoxin VI,7TMS,isomer #7	C[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C)S(=O)(=O)O[Si](C)(C)C)C2N([Si](C)(C)C)C(=N[Si](C)(C)C)N([Si](C)(C)C)C23N1CCC3(O)O[Si](C)(C)C	4134.0	Standard non polar	33892256
Gonyautoxin VI,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O)C3NC(=N)NC321	4169.1	Semi standard non polar	33892256
Gonyautoxin VI,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OS(=O)(=O)NC(=O)OCC1C2NC(=N)NC23N(CCC3(O)O)C(=N)N1O	4220.2	Semi standard non polar	33892256
Gonyautoxin VI,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)N(C(=O)OCC1C2NC(=N)NC23N(CCC3(O)O)C(=N)N1O)S(=O)(=O)O	4189.9	Semi standard non polar	33892256
Gonyautoxin VI,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)N1C(=N)NC23C1C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N2CCC3(O)O	4108.3	Semi standard non polar	33892256
Gonyautoxin VI,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O)(O)C23N1	4178.0	Semi standard non polar	33892256
Gonyautoxin VI,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)N1C(=N)NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O)(O)C231	4108.2	Semi standard non polar	33892256
Gonyautoxin VI,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N)NC23N1CCC3(O)O	4107.5	Semi standard non polar	33892256
Gonyautoxin VI,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC1(O[Si](C)(C)C(C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O)C3NC(=N)NC321	4307.6	Semi standard non polar	33892256
Gonyautoxin VI,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N)N3CCC(O)(O)C23N1	4337.4	Semi standard non polar	33892256
Gonyautoxin VI,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OS(=O)(=O)NC(=O)OCC1C2NC(=N)N([Si](C)(C)C(C)(C)C)C23N(CCC3(O)O)C(=N)N1O	4267.6	Semi standard non polar	33892256
Gonyautoxin VI,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C2NC(=N)NC23N1CCC3(O)O	4299.1	Semi standard non polar	33892256
Gonyautoxin VI,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)N1C(=N)NC23C1C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)N(O)C(=N)N2CCC3(O)O	4273.1	Semi standard non polar	33892256
Gonyautoxin VI,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O)(O)C23N1	4326.5	Semi standard non polar	33892256
Gonyautoxin VI,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)N1C(=N)NC2C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O)(O)C231	4251.1	Semi standard non polar	33892256
Gonyautoxin VI,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C2NC(=N)NC23N1CCC3(O)O	4261.4	Semi standard non polar	33892256
Gonyautoxin VI,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)N=C1NC23C(C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N2CCC3(O)O)N1[Si](C)(C)C(C)(C)C	4174.5	Semi standard non polar	33892256
Gonyautoxin VI,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)N1C(=N)N([Si](C)(C)C(C)(C)C)C23C1C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N2CCC3(O)O	4088.8	Semi standard non polar	33892256
Gonyautoxin VI,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C(C)(C)C)C(=N)NC23N1CCC3(O)O	4186.3	Semi standard non polar	33892256
Gonyautoxin VI,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C3NC(=N)NC321	4353.7	Semi standard non polar	33892256
Gonyautoxin VI,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N[Si](C)(C)C(C)(C)C)N3CCC(O)(O)C23N1	4215.2	Semi standard non polar	33892256
Gonyautoxin VI,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C(C)(C)C	4163.5	Semi standard non polar	33892256
Gonyautoxin VI,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O	4140.0	Semi standard non polar	33892256
Gonyautoxin VI,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N)NC23N1CCC3(O)O[Si](C)(C)C(C)(C)C	4235.4	Semi standard non polar	33892256
Gonyautoxin VI,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C3NC(=N)NC321	4338.3	Semi standard non polar	33892256
Gonyautoxin VI,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O)C3N([Si](C)(C)C(C)(C)C)C(=N)NC321	4256.9	Semi standard non polar	33892256
Gonyautoxin VI,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C(C)(C)C)C23N1	4286.9	Semi standard non polar	33892256
Gonyautoxin VI,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O)C3NC(=N)N([Si](C)(C)C(C)(C)C)C321	4257.7	Semi standard non polar	33892256
Gonyautoxin VI,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OS(=O)(=O)N(C(=O)OCC1C2NC(=N)NC23N(CCC3(O)O)C(=N)N1O)[Si](C)(C)C(C)(C)C	4356.9	Semi standard non polar	33892256
Gonyautoxin VI,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OS(=O)(=O)NC(=O)OCC1C2N([Si](C)(C)C(C)(C)C)C(=N)NC23N(CCC3(O)O)C(=N)N1O	4307.3	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC1(O[Si](C)(C)C(C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C3NC(=N)NC321	4458.3	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC1(O[Si](C)(C)C(C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C3NC(=N)NC321	4629.8	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #10	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C(C)(C)C)C23N1	4427.3	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #10	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C(C)(C)C)C23N1	4623.6	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C3NC(=N)N([Si](C)(C)C(C)(C)C)C321	4397.2	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C3NC(=N)N([Si](C)(C)C(C)(C)C)C321	4695.9	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #12	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C2NC(=N)NC23N1CCC3(O)O[Si](C)(C)C(C)(C)C	4362.3	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #12	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C2NC(=N)NC23N1CCC3(O)O[Si](C)(C)C(C)(C)C	4560.0	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #13	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C(C)(C)C)C(=N)NC23N1CCC3(O)O[Si](C)(C)C(C)(C)C	4297.4	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #13	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C(C)(C)C)C(=N)NC23N1CCC3(O)O[Si](C)(C)C(C)(C)C	4469.5	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #14	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N[Si](C)(C)C(C)(C)C)N3CCC(O)(O[Si](C)(C)C(C)(C)C)C23N1	4273.3	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #14	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N[Si](C)(C)C(C)(C)C)N3CCC(O)(O[Si](C)(C)C(C)(C)C)C23N1	4393.3	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #15	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O[Si](C)(C)C(C)(C)C	4253.4	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #15	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O[Si](C)(C)C(C)(C)C	4470.9	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C3N([Si](C)(C)C(C)(C)C)C(=N)NC321	4403.5	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C3N([Si](C)(C)C(C)(C)C)C(=N)NC321	4686.1	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #17	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C(C)(C)C)C23N1	4439.5	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #17	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C(C)(C)C)C23N1	4635.8	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C3NC(=N)N([Si](C)(C)C(C)(C)C)C321	4385.7	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C3NC(=N)N([Si](C)(C)C(C)(C)C)C321	4709.6	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #19	CC(C)(C)[Si](C)(C)N=C1NC23C(C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N2CCC3(O)O[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C	4310.8	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #19	CC(C)(C)[Si](C)(C)N=C1NC23C(C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N2CCC3(O)O[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C	4524.7	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #2	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N)NC23N1CCC3(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C	4343.0	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #2	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N)NC23N1CCC3(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C	4436.2	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O)C3N([Si](C)(C)C(C)(C)C)C(=N)N([Si](C)(C)C(C)(C)C)C321	4250.0	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O)C3N([Si](C)(C)C(C)(C)C)C(=N)N([Si](C)(C)C(C)(C)C)C321	4602.0	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #21	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C(C)(C)C)C23N1[Si](C)(C)C(C)(C)C	4298.3	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #21	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C(C)(C)C)C23N1[Si](C)(C)C(C)(C)C	4534.6	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OS(=O)(=O)N(C(=O)OCC1C2N([Si](C)(C)C(C)(C)C)C(=N)NC23N(CCC3(O)O)C(=N)N1O)[Si](C)(C)C(C)(C)C	4419.4	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OS(=O)(=O)N(C(=O)OCC1C2N([Si](C)(C)C(C)(C)C)C(=N)NC23N(CCC3(O)O)C(=N)N1O)[Si](C)(C)C(C)(C)C	4696.9	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #23	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N)N3CCC(O)(O)C23N1	4460.2	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #23	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N)N3CCC(O)(O)C23N1	4649.3	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OS(=O)(=O)N(C(=O)OCC1C2NC(=N)N([Si](C)(C)C(C)(C)C)C23N(CCC3(O)O)C(=N)N1O)[Si](C)(C)C(C)(C)C	4363.9	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OS(=O)(=O)N(C(=O)OCC1C2NC(=N)N([Si](C)(C)C(C)(C)C)C23N(CCC3(O)O)C(=N)N1O)[Si](C)(C)C(C)(C)C	4713.7	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #25	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O[Si](C)(C)C(C)(C)C)C2NC(=N)NC23N1CCC3(O)O	4388.9	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #25	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O[Si](C)(C)C(C)(C)C)C2NC(=N)NC23N1CCC3(O)O	4578.1	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #26	CC(C)(C)[Si](C)(C)N=C1NC23C(C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N)N2CCC3(O)O)N1[Si](C)(C)C(C)(C)C	4331.9	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #26	CC(C)(C)[Si](C)(C)N=C1NC23C(C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N)N2CCC3(O)O)N1[Si](C)(C)C(C)(C)C	4629.6	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OS(=O)(=O)NC(=O)OCC1C2N([Si](C)(C)C(C)(C)C)C(=N)N([Si](C)(C)C(C)(C)C)C23N(CCC3(O)O)C(=N)N1O	4215.4	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OS(=O)(=O)NC(=O)OCC1C2N([Si](C)(C)C(C)(C)C)C(=N)N([Si](C)(C)C(C)(C)C)C23N(CCC3(O)O)C(=N)N1O	4730.0	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #28	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C2N([Si](C)(C)C(C)(C)C)C(=N)NC23N1CCC3(O)O	4321.9	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #28	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C2N([Si](C)(C)C(C)(C)C)C(=N)NC23N1CCC3(O)O	4586.3	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #29	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N[Si](C)(C)C(C)(C)C)N3CCC(O)(O)C23N1	4311.3	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #29	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N[Si](C)(C)C(C)(C)C)N3CCC(O)(O)C23N1	4501.2	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1(O[Si](C)(C)C(C)(C)C)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C3NC(=N)NC321	4456.6	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1(O[Si](C)(C)C(C)(C)C)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C3NC(=N)NC321	4641.8	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #30	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C(C)(C)C	4305.1	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #30	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C(C)(C)C	4643.9	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #31	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C2NC(=N)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O	4257.4	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #31	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C2NC(=N)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O	4589.5	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #32	CC(C)(C)[Si](C)(C)N=C1NC23C(C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)N(O)C(=N)N2CCC3(O)O)N1[Si](C)(C)C(C)(C)C	4332.8	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #32	CC(C)(C)[Si](C)(C)N=C1NC23C(C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)N(O)C(=N)N2CCC3(O)O)N1[Si](C)(C)C(C)(C)C	4642.0	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #33	CC(C)(C)[Si](C)(C)N1C(=N)N([Si](C)(C)C(C)(C)C)C23C1C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)N(O)C(=N)N2CCC3(O)O	4231.3	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #33	CC(C)(C)[Si](C)(C)N1C(=N)N([Si](C)(C)C(C)(C)C)C23C1C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)N(O)C(=N)N2CCC3(O)O	4740.0	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #34	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C(C)(C)C)C(=N)NC23N1CCC3(O)O	4319.7	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #34	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C(C)(C)C)C(=N)NC23N1CCC3(O)O	4596.4	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #35	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)N(O)C(=N[Si](C)(C)C(C)(C)C)N3CCC(O)(O)C23N1	4330.8	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #35	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)N(O)C(=N[Si](C)(C)C(C)(C)C)N3CCC(O)(O)C23N1	4511.1	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #36	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C(C)(C)C	4309.9	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #36	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C(C)(C)C	4656.8	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #37	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C2NC(=N)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O	4269.4	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #37	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C2NC(=N)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O	4599.4	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #38	CC(C)(C)[Si](C)(C)N=C1N([Si](C)(C)C(C)(C)C)C2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C(C)(C)C	4168.3	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #38	CC(C)(C)[Si](C)(C)N=C1N([Si](C)(C)C(C)(C)C)C2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C(C)(C)C	4427.4	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #39	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C(C)(C)C)C(=N[Si](C)(C)C(C)(C)C)NC23N1CCC3(O)O	4221.7	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #39	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C(C)(C)C)C(=N[Si](C)(C)C(C)(C)C)NC23N1CCC3(O)O	4394.4	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1(O[Si](C)(C)C(C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O)C3N([Si](C)(C)C(C)(C)C)C(=N)NC321	4399.5	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1(O[Si](C)(C)C(C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O)C3N([Si](C)(C)C(C)(C)C)C(=N)NC321	4566.0	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #40	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C(C)(C)C)C(=N)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O	4134.7	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #40	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C(C)(C)C)C(=N)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O	4488.3	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #41	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O	4181.0	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #41	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O	4405.9	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #5	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O[Si](C)(C)C(C)(C)C)(O[Si](C)(C)C(C)(C)C)C23N1	4404.1	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #5	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O[Si](C)(C)C(C)(C)C)(O[Si](C)(C)C(C)(C)C)C23N1	4526.8	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1(O[Si](C)(C)C(C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O)C3NC(=N)N([Si](C)(C)C(C)(C)C)C321	4381.9	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1(O[Si](C)(C)C(C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O)C3NC(=N)N([Si](C)(C)C(C)(C)C)C321	4581.9	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #7	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C2NC(=N)NC23N1CCC3(O)O[Si](C)(C)C(C)(C)C	4355.0	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #7	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C2NC(=N)NC23N1CCC3(O)O[Si](C)(C)C(C)(C)C	4552.9	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O[Si](C)(C)C(C)(C)C)C3NC(=N)NC321	4476.4	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O[Si](C)(C)C(C)(C)C)C3NC(=N)NC321	4654.5	Standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C3N([Si](C)(C)C(C)(C)C)C(=N)NC321	4418.7	Semi standard non polar	33892256
Gonyautoxin VI,3TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C3N([Si](C)(C)C(C)(C)C)C(=N)NC321	4675.6	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #1	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C2NC(=N)NC23N1CCC3(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C	4463.5	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #1	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C2NC(=N)NC23N1CCC3(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C	4879.6	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1(O[Si](C)(C)C(C)(C)C)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C3N([Si](C)(C)C(C)(C)C)C(=N)NC321	4504.6	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1(O[Si](C)(C)C(C)(C)C)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C3N([Si](C)(C)C(C)(C)C)C(=N)NC321	5022.2	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #11	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O[Si](C)(C)C(C)(C)C)(O[Si](C)(C)C(C)(C)C)C23N1	4529.7	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #11	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O[Si](C)(C)C(C)(C)C)(O[Si](C)(C)C(C)(C)C)C23N1	4976.4	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC1(O[Si](C)(C)C(C)(C)C)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C3NC(=N)N([Si](C)(C)C(C)(C)C)C321	4486.6	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC1(O[Si](C)(C)C(C)(C)C)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C3NC(=N)N([Si](C)(C)C(C)(C)C)C321	5049.8	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #13	CC(C)(C)[Si](C)(C)N=C1NC23C(C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N2CCC3(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C	4438.2	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #13	CC(C)(C)[Si](C)(C)N=C1NC23C(C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N2CCC3(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C	4757.9	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC1(O[Si](C)(C)C(C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O)C3N([Si](C)(C)C(C)(C)C)C(=N)N([Si](C)(C)C(C)(C)C)C321	4377.9	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC1(O[Si](C)(C)C(C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O)C3N([Si](C)(C)C(C)(C)C)C(=N)N([Si](C)(C)C(C)(C)C)C321	4840.2	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #15	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O[Si](C)(C)C(C)(C)C)(O[Si](C)(C)C(C)(C)C)C23N1[Si](C)(C)C(C)(C)C	4422.1	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #15	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O[Si](C)(C)C(C)(C)C)(O[Si](C)(C)C(C)(C)C)C23N1[Si](C)(C)C(C)(C)C	4773.7	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #16	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O[Si](C)(C)C(C)(C)C)C2NC(=N)NC23N1CCC3(O)O[Si](C)(C)C(C)(C)C	4478.5	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #16	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O[Si](C)(C)C(C)(C)C)C2NC(=N)NC23N1CCC3(O)O[Si](C)(C)C(C)(C)C	4913.0	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #17	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C2N([Si](C)(C)C(C)(C)C)C(=N)NC23N1CCC3(O)O[Si](C)(C)C(C)(C)C	4430.1	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #17	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C2N([Si](C)(C)C(C)(C)C)C(=N)NC23N1CCC3(O)O[Si](C)(C)C(C)(C)C	4935.1	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #18	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N[Si](C)(C)C(C)(C)C)N3CCC(O)(O[Si](C)(C)C(C)(C)C)C23N1	4407.9	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #18	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N[Si](C)(C)C(C)(C)C)N3CCC(O)(O[Si](C)(C)C(C)(C)C)C23N1	4852.6	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #19	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C2NC(=N)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O[Si](C)(C)C(C)(C)C	4382.4	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #19	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C2NC(=N)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O[Si](C)(C)C(C)(C)C	4932.2	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1(O[Si](C)(C)C(C)(C)C)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O[Si](C)(C)C(C)(C)C)C3NC(=N)NC321	4554.2	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1(O[Si](C)(C)C(C)(C)C)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O[Si](C)(C)C(C)(C)C)C3NC(=N)NC321	4979.4	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O[Si](C)(C)C(C)(C)C)C3N([Si](C)(C)C(C)(C)C)C(=N)NC321	4503.7	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O[Si](C)(C)C(C)(C)C)C3N([Si](C)(C)C(C)(C)C)C(=N)NC321	5036.6	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #21	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C(C)(C)C)C23N1	4541.7	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #21	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C(C)(C)C)C23N1	4993.1	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O[Si](C)(C)C(C)(C)C)C3NC(=N)N([Si](C)(C)C(C)(C)C)C321	4484.4	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O[Si](C)(C)C(C)(C)C)C3NC(=N)N([Si](C)(C)C(C)(C)C)C321	5055.8	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #23	CC(C)(C)[Si](C)(C)N=C1NC23C(C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N)N2CCC3(O)O[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C	4449.4	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #23	CC(C)(C)[Si](C)(C)N=C1NC23C(C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N)N2CCC3(O)O[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C	4979.9	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C3N([Si](C)(C)C(C)(C)C)C(=N)N([Si](C)(C)C(C)(C)C)C321	4366.2	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C3N([Si](C)(C)C(C)(C)C)C(=N)N([Si](C)(C)C(C)(C)C)C321	5070.1	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #25	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C(C)(C)C)C23N1[Si](C)(C)C(C)(C)C	4433.3	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #25	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C(C)(C)C)C23N1[Si](C)(C)C(C)(C)C	4995.7	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #26	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C(C)(C)C)C(=N)NC23N1CCC3(O)O[Si](C)(C)C(C)(C)C	4423.1	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #26	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C(C)(C)C)C(=N)NC23N1CCC3(O)O[Si](C)(C)C(C)(C)C	4956.8	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #27	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)N(O)C(=N[Si](C)(C)C(C)(C)C)N3CCC(O)(O[Si](C)(C)C(C)(C)C)C23N1	4413.0	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #27	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)N(O)C(=N[Si](C)(C)C(C)(C)C)N3CCC(O)(O[Si](C)(C)C(C)(C)C)C23N1	4872.4	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #28	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C2NC(=N)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O[Si](C)(C)C(C)(C)C	4387.4	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #28	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C2NC(=N)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O[Si](C)(C)C(C)(C)C	4957.8	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #29	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C(C)(C)C)C(=N[Si](C)(C)C(C)(C)C)NC23N1CCC3(O)O[Si](C)(C)C(C)(C)C	4349.8	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #29	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C(C)(C)C)C(=N[Si](C)(C)C(C)(C)C)NC23N1CCC3(O)O[Si](C)(C)C(C)(C)C	4655.7	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1(O[Si](C)(C)C(C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C3N([Si](C)(C)C(C)(C)C)C(=N)NC321	4517.3	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1(O[Si](C)(C)C(C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C3N([Si](C)(C)C(C)(C)C)C(=N)NC321	5001.1	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #30	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C(C)(C)C)C(=N)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O[Si](C)(C)C(C)(C)C	4282.1	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #30	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C(C)(C)C)C(=N)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O[Si](C)(C)C(C)(C)C	4753.1	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #31	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O[Si](C)(C)C(C)(C)C	4301.7	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #31	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O[Si](C)(C)C(C)(C)C	4664.5	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #32	CC(C)(C)[Si](C)(C)N=C1NC23C(C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)N(O)C(=N)N2CCC3(O)O[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C	4441.8	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #32	CC(C)(C)[Si](C)(C)N=C1NC23C(C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)N(O)C(=N)N2CCC3(O)O[Si](C)(C)C(C)(C)C)N1[Si](C)(C)C(C)(C)C	5000.7	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C3N([Si](C)(C)C(C)(C)C)C(=N)N([Si](C)(C)C(C)(C)C)C321	4380.7	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1(O)CCN2C(=N)N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C3N([Si](C)(C)C(C)(C)C)C(=N)N([Si](C)(C)C(C)(C)C)C321	5090.6	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #34	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C(C)(C)C)C23N1[Si](C)(C)C(C)(C)C	4437.4	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #34	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C(C)(C)C)C23N1[Si](C)(C)C(C)(C)C	5017.9	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #35	CC(C)(C)[Si](C)(C)N=C1N([Si](C)(C)C(C)(C)C)C2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C(C)(C)C)C23N1[Si](C)(C)C(C)(C)C	4308.0	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #35	CC(C)(C)[Si](C)(C)N=C1N([Si](C)(C)C(C)(C)C)C2C(COC(=O)NS(=O)(=O)O)N(O)C(=N)N3CCC(O)(O[Si](C)(C)C(C)(C)C)C23N1[Si](C)(C)C(C)(C)C	4696.9	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #36	CC(C)(C)[Si](C)(C)N=C1NC23C(C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N)N2CCC3(O)O)N1[Si](C)(C)C(C)(C)C	4454.6	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #36	CC(C)(C)[Si](C)(C)N=C1NC23C(C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N)N2CCC3(O)O)N1[Si](C)(C)C(C)(C)C	5013.9	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OS(=O)(=O)N(C(=O)OCC1C2N([Si](C)(C)C(C)(C)C)C(=N)N([Si](C)(C)C(C)(C)C)C23N(CCC3(O)O)C(=N)N1O)[Si](C)(C)C(C)(C)C	4333.6	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OS(=O)(=O)N(C(=O)OCC1C2N([Si](C)(C)C(C)(C)C)C(=N)N([Si](C)(C)C(C)(C)C)C23N(CCC3(O)O)C(=N)N1O)[Si](C)(C)C(C)(C)C	5104.1	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #38	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O[Si](C)(C)C(C)(C)C)C2N([Si](C)(C)C(C)(C)C)C(=N)NC23N1CCC3(O)O	4448.6	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #38	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O[Si](C)(C)C(C)(C)C)C2N([Si](C)(C)C(C)(C)C)C(=N)NC23N1CCC3(O)O	4971.7	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #39	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N[Si](C)(C)C(C)(C)C)N3CCC(O)(O)C23N1	4438.8	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #39	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N[Si](C)(C)C(C)(C)C)N3CCC(O)(O)C23N1	4882.2	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #4	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N)N3CCC(O[Si](C)(C)C(C)(C)C)(O[Si](C)(C)C(C)(C)C)C23N1	4520.0	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #4	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N)N3CCC(O[Si](C)(C)C(C)(C)C)(O[Si](C)(C)C(C)(C)C)C23N1	4956.7	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #40	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C(C)(C)C	4417.6	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #40	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C(C)(C)C	5030.4	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #41	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O[Si](C)(C)C(C)(C)C)C2NC(=N)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O	4371.7	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #41	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O[Si](C)(C)C(C)(C)C)C2NC(=N)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O	4971.1	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #42	CC(C)(C)[Si](C)(C)N=C1N([Si](C)(C)C(C)(C)C)C2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C(C)(C)C	4273.4	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #42	CC(C)(C)[Si](C)(C)N=C1N([Si](C)(C)C(C)(C)C)C2C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C(C)(C)C	4935.6	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #43	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C2N([Si](C)(C)C(C)(C)C)C(=N[Si](C)(C)C(C)(C)C)NC23N1CCC3(O)O	4373.5	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #43	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C2N([Si](C)(C)C(C)(C)C)C(=N[Si](C)(C)C(C)(C)C)NC23N1CCC3(O)O	4879.1	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #44	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C2N([Si](C)(C)C(C)(C)C)C(=N)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O	4260.0	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #44	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C2N([Si](C)(C)C(C)(C)C)C(=N)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O	4987.4	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #45	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C2NC(=N[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O	4310.7	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #45	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C2NC(=N[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O	4886.3	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #46	CC(C)(C)[Si](C)(C)N=C1N([Si](C)(C)C(C)(C)C)C2C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C(C)(C)C	4309.6	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #46	CC(C)(C)[Si](C)(C)N=C1N([Si](C)(C)C(C)(C)C)C2C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)N(O)C(=N)N3CCC(O)(O)C23N1[Si](C)(C)C(C)(C)C	4956.2	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #47	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C(C)(C)C)C(=N[Si](C)(C)C(C)(C)C)NC23N1CCC3(O)O	4389.1	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #47	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C(C)(C)C)C(=N[Si](C)(C)C(C)(C)C)NC23N1CCC3(O)O	4894.9	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #48	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C(C)(C)C)C(=N)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O	4292.5	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #48	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C2N([Si](C)(C)C(C)(C)C)C(=N)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O	5009.6	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #49	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C2NC(=N[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O	4330.2	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #49	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C2NC(=N[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O	4908.0	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1(O[Si](C)(C)C(C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C3NC(=N)N([Si](C)(C)C(C)(C)C)C321	4495.3	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1(O[Si](C)(C)C(C)(C)C)CCN2C(=N)N(O)C(COC(=O)NS(=O)(=O)O[Si](C)(C)C(C)(C)C)C3NC(=N)N([Si](C)(C)C(C)(C)C)C321	5028.0	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #50	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C(C)(C)C)C(=N[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O	4233.8	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #50	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C(C)(C)C)C(=N[Si](C)(C)C(C)(C)C)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O)O	4598.3	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #6	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C2NC(=N)NC23N1CCC3(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C	4460.7	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #6	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)N([Si](C)(C)C(C)(C)C)S(=O)(=O)O)C2NC(=N)NC23N1CCC3(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C	4902.7	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #7	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C(C)(C)C)C(=N)NC23N1CCC3(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C	4409.3	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #7	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2N([Si](C)(C)C(C)(C)C)C(=N)NC23N1CCC3(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C	4706.7	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #8	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N[Si](C)(C)C(C)(C)C)N3CCC(O[Si](C)(C)C(C)(C)C)(O[Si](C)(C)C(C)(C)C)C23N1	4377.1	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #8	CC(C)(C)[Si](C)(C)N=C1NC2C(COC(=O)NS(=O)(=O)O)N(O)C(=N[Si](C)(C)C(C)(C)C)N3CCC(O[Si](C)(C)C(C)(C)C)(O[Si](C)(C)C(C)(C)C)C23N1	4634.7	Standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #9	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C	4363.0	Semi standard non polar	33892256
Gonyautoxin VI,4TBDMS,isomer #9	CC(C)(C)[Si](C)(C)N=C1N(O)C(COC(=O)NS(=O)(=O)O)C2NC(=N)N([Si](C)(C)C(C)(C)C)C23N1CCC3(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C	4707.2	Standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Gonyautoxin VI GC-MS (Non-derivatized) - 70eV, Positive	splash10-00fs-9753000000-0d138463d6255c0b48ac	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Gonyautoxin VI GC-MS (2 TMS) - 70eV, Positive	splash10-00g0-9204110000-9f5935b580a9996504bf	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Gonyautoxin VI GC-MS (Non-derivatized) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Gonyautoxin VI 10V, Positive-QTOF	splash10-002b-1329000000-a8184a0ff89d658a27d7	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Gonyautoxin VI 20V, Positive-QTOF	splash10-0a4i-3094000000-4ec74d3821e03cd6db94	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Gonyautoxin VI 40V, Positive-QTOF	splash10-006w-9420000000-1ed2e166ad1b9a0cc6db	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Gonyautoxin VI 10V, Negative-QTOF	splash10-00di-2914000000-9a835776a885fefc121a	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Gonyautoxin VI 20V, Negative-QTOF	splash10-00dj-9622000000-81829f557e16b369310e	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Gonyautoxin VI 40V, Negative-QTOF	splash10-00dj-8900000000-d3d38073ea9c4e741c8b	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Gonyautoxin VI 10V, Negative-QTOF	splash10-006x-1089000000-6cda379cd91bd40bac8a	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Gonyautoxin VI 20V, Negative-QTOF	splash10-0udi-4090000000-fc918574c805fab71683	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Gonyautoxin VI 40V, Negative-QTOF	splash10-0002-9000000000-a5f985bdf988ed93c9d8	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Gonyautoxin VI 10V, Positive-QTOF	splash10-0002-0009000000-c092305201217902f987	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Gonyautoxin VI 20V, Positive-QTOF	splash10-0a4j-1195000000-a9544dd4f6dc1d129dad	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Gonyautoxin VI 40V, Positive-QTOF	splash10-000i-0290000000-5c4e1bfbe6350fc6a6cd	2021-09-24	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB011567

KNApSAcK ID

C00058215

Chemspider ID

35013618

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

15646822

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Enzymes

Enzyme Details

1. UDP-glucuronosyltransferase 1-1

General function:: Involved in transferase activity, transferring hexosyl groups
Specific function:: UDPGT is of major importance in the conjugation and subsequent elimination of potentially toxic xenobiotics and endogenous compounds. This isoform glucuronidates bilirubin IX-alpha to form both the IX-alpha-C8 and IX-alpha-C12 monoconjugates and diconjugate. Is also able to catalyze the glucuronidation of 17beta-estradiol, 17alpha-ethinylestradiol, 1-hydroxypyrene, 4-methylumbelliferone, 1-naphthol, paranitrophenol, scopoletin, and umbelliferone.
Gene Name:: UGT1A1
Uniprot ID:: P22309
Molecular weight:: 59590.91

Reactions

Gonyautoxin VI → 3,4,5-trihydroxy-6-(5,10,10-trihydroxy-2,6-diimino-4-{[(sulfo-C-hydroxycarbonimidoyl)oxy]methyl}-decahydro-5λ⁵-pyrrolo[1,2-c]purin-5-yl)oxane-2-carboxylic acid	details

Showing metabocard for Gonyautoxin VI (HMDB0033512)

MOL for HMDB0033512 (Gonyautoxin VI)

3D MOL for HMDB0033512 (Gonyautoxin VI)

3D SDF for HMDB0033512 (Gonyautoxin VI)

3D-SDF for HMDB0033512 (Gonyautoxin VI)

PDB for HMDB0033512 (Gonyautoxin VI)

3D PDB for HMDB0033512 (Gonyautoxin VI)

SMILES for HMDB0033512 (Gonyautoxin VI)

INCHI for HMDB0033512 (Gonyautoxin VI)

Structure for HMDB0033512 (Gonyautoxin VI)

3D Structure for HMDB0033512 (Gonyautoxin VI)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra

Enzymes

Reactions