Record Information |
---|
Version | 5.0 |
---|
Status | Expected but not Quantified |
---|
Creation Date | 2012-09-11 19:35:20 UTC |
---|
Update Date | 2022-03-07 02:54:12 UTC |
---|
HMDB ID | HMDB0034689 |
---|
Secondary Accession Numbers | |
---|
Metabolite Identification |
---|
Common Name | Glabric acid |
---|
Description | Glabric acid, also known as glabrate, belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. Based on a literature review a small amount of articles have been published on Glabric acid. |
---|
Structure | CC1(C)C(O)CCC2(C)C1CCC1(C)C2C(=O)C=C2C3CC(C)(C(O)CC3(C)CCC12C)C(O)=O InChI=1S/C30H46O5/c1-25(2)20-8-11-30(7)23(27(20,4)10-9-21(25)32)19(31)14-17-18-15-28(5,24(34)35)22(33)16-26(18,3)12-13-29(17,30)6/h14,18,20-23,32-33H,8-13,15-16H2,1-7H3,(H,34,35) |
---|
Synonyms | Value | Source |
---|
Glabrate | Generator | 3,10-Dihydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-icosahydropicene-2-carboxylate | HMDB |
|
---|
Chemical Formula | C30H46O5 |
---|
Average Molecular Weight | 486.6832 |
---|
Monoisotopic Molecular Weight | 486.334524582 |
---|
IUPAC Name | 3,10-dihydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-1,2,3,4,4a,5,6,6a,6b,7,8,8a,9,10,11,12,12a,12b,13,14b-icosahydropicene-2-carboxylic acid |
---|
Traditional Name | 3,10-dihydroxy-2,4a,6a,6b,9,9,12a-heptamethyl-13-oxo-3,4,5,6,7,8,8a,10,11,12,12b,14b-dodecahydro-1H-picene-2-carboxylic acid |
---|
CAS Registry Number | 22327-86-2 |
---|
SMILES | CC1(C)C(O)CCC2(C)C1CCC1(C)C2C(=O)C=C2C3CC(C)(C(O)CC3(C)CCC12C)C(O)=O |
---|
InChI Identifier | InChI=1S/C30H46O5/c1-25(2)20-8-11-30(7)23(27(20,4)10-9-21(25)32)19(31)14-17-18-15-28(5,24(34)35)22(33)16-26(18,3)12-13-29(17,30)6/h14,18,20-23,32-33H,8-13,15-16H2,1-7H3,(H,34,35) |
---|
InChI Key | HFTWTHSIMCSLFQ-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Description | Belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. |
---|
Kingdom | Organic compounds |
---|
Super Class | Lipids and lipid-like molecules |
---|
Class | Prenol lipids |
---|
Sub Class | Triterpenoids |
---|
Direct Parent | Triterpenoids |
---|
Alternative Parents | |
---|
Substituents | - Triterpenoid
- Beta-hydroxy acid
- Cyclohexenone
- Hydroxy acid
- Cyclic alcohol
- Ketone
- Secondary alcohol
- Monocarboxylic acid or derivatives
- Carboxylic acid
- Carboxylic acid derivative
- Alcohol
- Hydrocarbon derivative
- Organic oxide
- Carbonyl group
- Organic oxygen compound
- Organooxygen compound
- Aliphatic homopolycyclic compound
|
---|
Molecular Framework | Aliphatic homopolycyclic compounds |
---|
External Descriptors | Not Available |
---|
Ontology |
---|
Physiological effect | Not Available |
---|
Disposition | |
---|
Process | |
---|
Role | |
---|
Physical Properties |
---|
State | Solid |
---|
Experimental Molecular Properties | Property | Value | Reference |
---|
Melting Point | 329 - 333 °C | Not Available | Boiling Point | Not Available | Not Available | Water Solubility | Not Available | Not Available | LogP | Not Available | Not Available |
|
---|
Experimental Chromatographic Properties | Not Available |
---|
Predicted Molecular Properties | |
---|
Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Kovats Retention IndicesUnderivatizedDerivatizedDerivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
---|
Glabric acid,1TMS,isomer #1 | CC12CCC3(C)C(=CC(=O)C4C5(C)CCC(O[Si](C)(C)C)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O)C(O)C2 | 4193.6 | Semi standard non polar | 33892256 | Glabric acid,1TMS,isomer #2 | CC12CCC3(C)C(=CC(=O)C4C5(C)CCC(O)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O)C(O[Si](C)(C)C)C2 | 4166.7 | Semi standard non polar | 33892256 | Glabric acid,1TMS,isomer #3 | CC12CCC3(C)C(=CC(=O)C4C5(C)CCC(O)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O[Si](C)(C)C)C(O)C2 | 4101.3 | Semi standard non polar | 33892256 | Glabric acid,1TMS,isomer #4 | CC12CCC3(C)C(=CC(O[Si](C)(C)C)=C4C5(C)CCC(O)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O)C(O)C2 | 4079.6 | Semi standard non polar | 33892256 | Glabric acid,2TMS,isomer #1 | CC12CCC3(C)C(=CC(=O)C4C5(C)CCC(O[Si](C)(C)C)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O[Si](C)(C)C)C(O)C2 | 4104.6 | Semi standard non polar | 33892256 | Glabric acid,2TMS,isomer #2 | CC12CCC3(C)C(=CC(=O)C4C5(C)CCC(O[Si](C)(C)C)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O)C(O[Si](C)(C)C)C2 | 4185.6 | Semi standard non polar | 33892256 | Glabric acid,2TMS,isomer #3 | CC12CCC3(C)C(=CC(O[Si](C)(C)C)=C4C5(C)CCC(O[Si](C)(C)C)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O)C(O)C2 | 4073.7 | Semi standard non polar | 33892256 | Glabric acid,2TMS,isomer #4 | CC12CCC3(C)C(=CC(=O)C4C5(C)CCC(O)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C2 | 4101.6 | Semi standard non polar | 33892256 | Glabric acid,2TMS,isomer #5 | CC12CCC3(C)C(=CC(O[Si](C)(C)C)=C4C5(C)CCC(O)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O)C(O[Si](C)(C)C)C2 | 4050.8 | Semi standard non polar | 33892256 | Glabric acid,2TMS,isomer #6 | CC12CCC3(C)C(=CC(O[Si](C)(C)C)=C4C5(C)CCC(O)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O[Si](C)(C)C)C(O)C2 | 4024.7 | Semi standard non polar | 33892256 | Glabric acid,3TMS,isomer #1 | CC12CCC3(C)C(=CC(=O)C4C5(C)CCC(O[Si](C)(C)C)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C2 | 4032.9 | Semi standard non polar | 33892256 | Glabric acid,3TMS,isomer #2 | CC12CCC3(C)C(=CC(O[Si](C)(C)C)=C4C5(C)CCC(O[Si](C)(C)C)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O[Si](C)(C)C)C(O)C2 | 3963.5 | Semi standard non polar | 33892256 | Glabric acid,3TMS,isomer #3 | CC12CCC3(C)C(=CC(O[Si](C)(C)C)=C4C5(C)CCC(O[Si](C)(C)C)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O)C(O[Si](C)(C)C)C2 | 3969.6 | Semi standard non polar | 33892256 | Glabric acid,3TMS,isomer #4 | CC12CCC3(C)C(=CC(O[Si](C)(C)C)=C4C5(C)CCC(O)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C2 | 3939.2 | Semi standard non polar | 33892256 | Glabric acid,4TMS,isomer #1 | CC12CCC3(C)C(=CC(O[Si](C)(C)C)=C4C5(C)CCC(O[Si](C)(C)C)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C2 | 3852.3 | Semi standard non polar | 33892256 | Glabric acid,4TMS,isomer #1 | CC12CCC3(C)C(=CC(O[Si](C)(C)C)=C4C5(C)CCC(O[Si](C)(C)C)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O[Si](C)(C)C)C(O[Si](C)(C)C)C2 | 3841.9 | Standard non polar | 33892256 | Glabric acid,1TBDMS,isomer #1 | CC12CCC3(C)C(=CC(=O)C4C5(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O)C(O)C2 | 4403.1 | Semi standard non polar | 33892256 | Glabric acid,1TBDMS,isomer #2 | CC12CCC3(C)C(=CC(=O)C4C5(C)CCC(O)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O)C(O[Si](C)(C)C(C)(C)C)C2 | 4379.9 | Semi standard non polar | 33892256 | Glabric acid,1TBDMS,isomer #3 | CC12CCC3(C)C(=CC(=O)C4C5(C)CCC(O)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O[Si](C)(C)C(C)(C)C)C(O)C2 | 4335.8 | Semi standard non polar | 33892256 | Glabric acid,1TBDMS,isomer #4 | CC12CCC3(C)C(=CC(O[Si](C)(C)C(C)(C)C)=C4C5(C)CCC(O)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O)C(O)C2 | 4315.7 | Semi standard non polar | 33892256 | Glabric acid,2TBDMS,isomer #1 | CC12CCC3(C)C(=CC(=O)C4C5(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O[Si](C)(C)C(C)(C)C)C(O)C2 | 4547.9 | Semi standard non polar | 33892256 | Glabric acid,2TBDMS,isomer #2 | CC12CCC3(C)C(=CC(=O)C4C5(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O)C(O[Si](C)(C)C(C)(C)C)C2 | 4612.5 | Semi standard non polar | 33892256 | Glabric acid,2TBDMS,isomer #3 | CC12CCC3(C)C(=CC(O[Si](C)(C)C(C)(C)C)=C4C5(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O)C(O)C2 | 4495.9 | Semi standard non polar | 33892256 | Glabric acid,2TBDMS,isomer #4 | CC12CCC3(C)C(=CC(=O)C4C5(C)CCC(O)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2 | 4553.3 | Semi standard non polar | 33892256 | Glabric acid,2TBDMS,isomer #5 | CC12CCC3(C)C(=CC(O[Si](C)(C)C(C)(C)C)=C4C5(C)CCC(O)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O)C(O[Si](C)(C)C(C)(C)C)C2 | 4480.7 | Semi standard non polar | 33892256 | Glabric acid,2TBDMS,isomer #6 | CC12CCC3(C)C(=CC(O[Si](C)(C)C(C)(C)C)=C4C5(C)CCC(O)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O[Si](C)(C)C(C)(C)C)C(O)C2 | 4447.5 | Semi standard non polar | 33892256 | Glabric acid,3TBDMS,isomer #1 | CC12CCC3(C)C(=CC(=O)C4C5(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2 | 4718.9 | Semi standard non polar | 33892256 | Glabric acid,3TBDMS,isomer #2 | CC12CCC3(C)C(=CC(O[Si](C)(C)C(C)(C)C)=C4C5(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O[Si](C)(C)C(C)(C)C)C(O)C2 | 4573.1 | Semi standard non polar | 33892256 | Glabric acid,3TBDMS,isomer #3 | CC12CCC3(C)C(=CC(O[Si](C)(C)C(C)(C)C)=C4C5(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O)C(O[Si](C)(C)C(C)(C)C)C2 | 4599.3 | Semi standard non polar | 33892256 | Glabric acid,3TBDMS,isomer #4 | CC12CCC3(C)C(=CC(O[Si](C)(C)C(C)(C)C)=C4C5(C)CCC(O)C(C)(C)C5CCC43C)C1CC(C)(C(=O)O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2 | 4547.2 | Semi standard non polar | 33892256 |
|
---|