| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2012-09-11 20:15:29 UTC |
|---|
| Update Date | 2022-03-07 02:54:27 UTC |
|---|
| HMDB ID | HMDB0035299 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Ganolucidic acid D |
|---|
| Description | Ganolucidic acid D, also known as ganolucidate D, belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. Based on a literature review a small amount of articles have been published on Ganolucidic acid D. |
|---|
| Structure | CC(CC(O)\C=C(/C)C(O)=O)C1CC(O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(=O)C(C)(C)C1CC3 InChI=1S/C30H44O6/c1-16(12-18(31)13-17(2)26(35)36)20-14-24(34)30(7)19-8-9-22-27(3,4)23(33)10-11-28(22,5)25(19)21(32)15-29(20,30)6/h13,16,18,20,22,24,31,34H,8-12,14-15H2,1-7H3,(H,35,36)/b17-13+ |
|---|
| Synonyms | | Value | Source |
|---|
| Ganolucidate D | Generator | | (+)-Ganolucidic acid D | HMDB, ChEBI | | 15alpha,23-Dihydroxy-3,11-dioxo-5alpha-lanosta-8,24E-dien-26-Oic acid | HMDB | | (2E)-4-Hydroxy-6-{12-hydroxy-2,6,6,11,15-pentamethyl-5,17-dioxotetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-1(10)-en-14-yl}-2-methylhept-2-enoate | Generator | | (15alpha,23S,24E)-15,23-Dihydroxy-3,11-dioxolanosta-8,24-dien-26-Oic acid | ChEBI | | (2E,4S,6R)-4-Hydroxy-6-[(1R,3S,3ar,5ar,9as,11ar)-3-hydroxy-3a,6,6,9a,11a-pentamethyl-7,10-dioxo-2,3,3a,4,5,5a,6,7,8,9,9a,10,11,11a-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl]-2-methylhept-2-enoic acid | ChEBI | | (+)-Ganolucidate D | Generator | | (15a,23S,24E)-15,23-Dihydroxy-3,11-dioxolanosta-8,24-dien-26-Oate | Generator | | (15a,23S,24E)-15,23-Dihydroxy-3,11-dioxolanosta-8,24-dien-26-Oic acid | Generator | | (15alpha,23S,24E)-15,23-Dihydroxy-3,11-dioxolanosta-8,24-dien-26-Oate | Generator | | (15Α,23S,24E)-15,23-dihydroxy-3,11-dioxolanosta-8,24-dien-26-Oate | Generator | | (15Α,23S,24E)-15,23-dihydroxy-3,11-dioxolanosta-8,24-dien-26-Oic acid | Generator | | (2E,4S,6R)-4-Hydroxy-6-[(1R,3S,3ar,5ar,9as,11ar)-3-hydroxy-3a,6,6,9a,11a-pentamethyl-7,10-dioxo-2,3,3a,4,5,5a,6,7,8,9,9a,10,11,11a-tetradecahydro-1H-cyclopenta[a]phenanthren-1-yl]-2-methylhept-2-enoate | Generator |
|
|---|
| Chemical Formula | C30H44O6 |
|---|
| Average Molecular Weight | 500.6668 |
|---|
| Monoisotopic Molecular Weight | 500.31378914 |
|---|
| IUPAC Name | (2E)-4-hydroxy-6-{12-hydroxy-2,6,6,11,15-pentamethyl-5,17-dioxotetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-1(10)-en-14-yl}-2-methylhept-2-enoic acid |
|---|
| Traditional Name | (2E)-4-hydroxy-6-{12-hydroxy-2,6,6,11,15-pentamethyl-5,17-dioxotetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-1(10)-en-14-yl}-2-methylhept-2-enoic acid |
|---|
| CAS Registry Number | 102607-22-7 |
|---|
| SMILES | CC(CC(O)\C=C(/C)C(O)=O)C1CC(O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(=O)C(C)(C)C1CC3 |
|---|
| InChI Identifier | InChI=1S/C30H44O6/c1-16(12-18(31)13-17(2)26(35)36)20-14-24(34)30(7)19-8-9-22-27(3,4)23(33)10-11-28(22,5)25(19)21(32)15-29(20,30)6/h13,16,18,20,22,24,31,34H,8-12,14-15H2,1-7H3,(H,35,36)/b17-13+ |
|---|
| InChI Key | AUAXRALNWSHMRJ-GHRIWEEISA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Prenol lipids |
|---|
| Sub Class | Triterpenoids |
|---|
| Direct Parent | Triterpenoids |
|---|
| Alternative Parents | |
|---|
| Substituents | - Triterpenoid
- Dihydroxy bile acid, alcohol, or derivatives
- Hydroxy bile acid, alcohol, or derivatives
- 23-hydroxysteroid
- Bile acid, alcohol, or derivatives
- Steroid acid
- 3-oxosteroid
- 15-hydroxysteroid
- Hydroxysteroid
- 11-oxosteroid
- Oxosteroid
- Steroid
- Medium-chain hydroxy acid
- Medium-chain fatty acid
- Hydroxy fatty acid
- Cyclohexenone
- Unsaturated fatty acid
- Fatty acid
- Fatty acyl
- Cyclic alcohol
- Secondary alcohol
- Ketone
- Cyclic ketone
- Monocarboxylic acid or derivatives
- Carboxylic acid derivative
- Carboxylic acid
- Organooxygen compound
- Hydrocarbon derivative
- Organic oxygen compound
- Carbonyl group
- Organic oxide
- Alcohol
- Aliphatic homopolycyclic compound
|
|---|
| Molecular Framework | Aliphatic homopolycyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | |
|---|
| Role | |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 7.82 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 14.497 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 2.0 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 3081.0 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 175.8 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 220.9 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 163.7 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 180.6 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 607.2 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 675.0 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 88.2 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 1162.9 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 607.1 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1583.6 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 360.1 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 497.8 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 211.7 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 249.6 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 11.3 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Ganolucidic acid D,1TMS,isomer #1 | C/C(=C\C(CC(C)C1CC(O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)O[Si](C)(C)C)C(=O)O | 4180.4 | Semi standard non polar | 33892256 | | Ganolucidic acid D,1TMS,isomer #2 | C/C(=C\C(O)CC(C)C1CC(O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)C(=O)O[Si](C)(C)C | 4092.2 | Semi standard non polar | 33892256 | | Ganolucidic acid D,1TMS,isomer #3 | C/C(=C\C(O)CC(C)C1CC(O[Si](C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)C(=O)O | 4144.9 | Semi standard non polar | 33892256 | | Ganolucidic acid D,1TMS,isomer #4 | C/C(=C\C(O)CC(C)C1CC(O)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)C(=O)O | 4024.0 | Semi standard non polar | 33892256 | | Ganolucidic acid D,1TMS,isomer #5 | C/C(=C\C(O)CC(C)C1CC(O)C2(C)C3=C(C(=O)CC12C)C1(C)CC=C(O[Si](C)(C)C)C(C)(C)C1CC3)C(=O)O | 4081.6 | Semi standard non polar | 33892256 | | Ganolucidic acid D,2TMS,isomer #1 | C/C(=C\C(CC(C)C1CC(O[Si](C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)O[Si](C)(C)C)C(=O)O | 4089.4 | Semi standard non polar | 33892256 | | Ganolucidic acid D,2TMS,isomer #10 | C/C(=C\C(O)CC(C)C1CC(O)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CC=C(O[Si](C)(C)C)C(C)(C)C1CC3)C(=O)O | 3844.4 | Semi standard non polar | 33892256 | | Ganolucidic acid D,2TMS,isomer #2 | C/C(=C\C(CC(C)C1CC(O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 4080.6 | Semi standard non polar | 33892256 | | Ganolucidic acid D,2TMS,isomer #3 | C/C(=C\C(CC(C)C1CC(O)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)O[Si](C)(C)C)C(=O)O | 3947.4 | Semi standard non polar | 33892256 | | Ganolucidic acid D,2TMS,isomer #4 | C/C(=C\C(CC(C)C1CC(O)C2(C)C3=C(C(=O)CC12C)C1(C)CC=C(O[Si](C)(C)C)C(C)(C)C1CC3)O[Si](C)(C)C)C(=O)O | 4018.9 | Semi standard non polar | 33892256 | | Ganolucidic acid D,2TMS,isomer #5 | C/C(=C\C(O)CC(C)C1CC(O[Si](C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)C(=O)O[Si](C)(C)C | 4013.0 | Semi standard non polar | 33892256 | | Ganolucidic acid D,2TMS,isomer #6 | C/C(=C\C(O)CC(C)C1CC(O)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)C(=O)O[Si](C)(C)C | 3908.5 | Semi standard non polar | 33892256 | | Ganolucidic acid D,2TMS,isomer #7 | C/C(=C\C(O)CC(C)C1CC(O)C2(C)C3=C(C(=O)CC12C)C1(C)CC=C(O[Si](C)(C)C)C(C)(C)C1CC3)C(=O)O[Si](C)(C)C | 3980.5 | Semi standard non polar | 33892256 | | Ganolucidic acid D,2TMS,isomer #8 | C/C(=C\C(O)CC(C)C1CC(O[Si](C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)C(=O)O | 3921.1 | Semi standard non polar | 33892256 | | Ganolucidic acid D,2TMS,isomer #9 | C/C(=C\C(O)CC(C)C1CC(O[Si](C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CC=C(O[Si](C)(C)C)C(C)(C)C1CC3)C(=O)O | 3941.9 | Semi standard non polar | 33892256 | | Ganolucidic acid D,3TMS,isomer #1 | C/C(=C\C(CC(C)C1CC(O[Si](C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 3910.9 | Semi standard non polar | 33892256 | | Ganolucidic acid D,3TMS,isomer #10 | C/C(=C\C(O)CC(C)C1CC(O[Si](C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CC=C(O[Si](C)(C)C)C(C)(C)C1CC3)C(=O)O | 3711.6 | Semi standard non polar | 33892256 | | Ganolucidic acid D,3TMS,isomer #2 | C/C(=C\C(CC(C)C1CC(O[Si](C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)O[Si](C)(C)C)C(=O)O | 3802.4 | Semi standard non polar | 33892256 | | Ganolucidic acid D,3TMS,isomer #3 | C/C(=C\C(CC(C)C1CC(O[Si](C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CC=C(O[Si](C)(C)C)C(C)(C)C1CC3)O[Si](C)(C)C)C(=O)O | 3795.7 | Semi standard non polar | 33892256 | | Ganolucidic acid D,3TMS,isomer #4 | C/C(=C\C(CC(C)C1CC(O)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 3830.9 | Semi standard non polar | 33892256 | | Ganolucidic acid D,3TMS,isomer #5 | C/C(=C\C(CC(C)C1CC(O)C2(C)C3=C(C(=O)CC12C)C1(C)CC=C(O[Si](C)(C)C)C(C)(C)C1CC3)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 3875.8 | Semi standard non polar | 33892256 | | Ganolucidic acid D,3TMS,isomer #6 | C/C(=C\C(CC(C)C1CC(O)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CC=C(O[Si](C)(C)C)C(C)(C)C1CC3)O[Si](C)(C)C)C(=O)O | 3739.5 | Semi standard non polar | 33892256 | | Ganolucidic acid D,3TMS,isomer #7 | C/C(=C\C(O)CC(C)C1CC(O[Si](C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)C(=O)O[Si](C)(C)C | 3786.0 | Semi standard non polar | 33892256 | | Ganolucidic acid D,3TMS,isomer #8 | C/C(=C\C(O)CC(C)C1CC(O[Si](C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CC=C(O[Si](C)(C)C)C(C)(C)C1CC3)C(=O)O[Si](C)(C)C | 3790.9 | Semi standard non polar | 33892256 | | Ganolucidic acid D,3TMS,isomer #9 | C/C(=C\C(O)CC(C)C1CC(O)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CC=C(O[Si](C)(C)C)C(C)(C)C1CC3)C(=O)O[Si](C)(C)C | 3748.1 | Semi standard non polar | 33892256 | | Ganolucidic acid D,4TMS,isomer #1 | C/C(=C\C(CC(C)C1CC(O[Si](C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 3704.5 | Semi standard non polar | 33892256 | | Ganolucidic acid D,4TMS,isomer #1 | C/C(=C\C(CC(C)C1CC(O[Si](C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 3843.2 | Standard non polar | 33892256 | | Ganolucidic acid D,4TMS,isomer #2 | C/C(=C\C(CC(C)C1CC(O[Si](C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CC=C(O[Si](C)(C)C)C(C)(C)C1CC3)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 3676.9 | Semi standard non polar | 33892256 | | Ganolucidic acid D,4TMS,isomer #2 | C/C(=C\C(CC(C)C1CC(O[Si](C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CC=C(O[Si](C)(C)C)C(C)(C)C1CC3)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 3746.3 | Standard non polar | 33892256 | | Ganolucidic acid D,4TMS,isomer #3 | C/C(=C\C(CC(C)C1CC(O[Si](C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CC=C(O[Si](C)(C)C)C(C)(C)C1CC3)O[Si](C)(C)C)C(=O)O | 3622.4 | Semi standard non polar | 33892256 | | Ganolucidic acid D,4TMS,isomer #3 | C/C(=C\C(CC(C)C1CC(O[Si](C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CC=C(O[Si](C)(C)C)C(C)(C)C1CC3)O[Si](C)(C)C)C(=O)O | 3709.5 | Standard non polar | 33892256 | | Ganolucidic acid D,4TMS,isomer #4 | C/C(=C\C(CC(C)C1CC(O)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CC=C(O[Si](C)(C)C)C(C)(C)C1CC3)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 3668.7 | Semi standard non polar | 33892256 | | Ganolucidic acid D,4TMS,isomer #4 | C/C(=C\C(CC(C)C1CC(O)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CC=C(O[Si](C)(C)C)C(C)(C)C1CC3)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 3761.7 | Standard non polar | 33892256 | | Ganolucidic acid D,4TMS,isomer #5 | C/C(=C\C(O)CC(C)C1CC(O[Si](C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CC=C(O[Si](C)(C)C)C(C)(C)C1CC3)C(=O)O[Si](C)(C)C | 3640.4 | Semi standard non polar | 33892256 | | Ganolucidic acid D,4TMS,isomer #5 | C/C(=C\C(O)CC(C)C1CC(O[Si](C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CC=C(O[Si](C)(C)C)C(C)(C)C1CC3)C(=O)O[Si](C)(C)C | 3684.7 | Standard non polar | 33892256 | | Ganolucidic acid D,5TMS,isomer #1 | C/C(=C\C(CC(C)C1CC(O[Si](C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CC=C(O[Si](C)(C)C)C(C)(C)C1CC3)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 3531.3 | Semi standard non polar | 33892256 | | Ganolucidic acid D,5TMS,isomer #1 | C/C(=C\C(CC(C)C1CC(O[Si](C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C)=CC12C)C1(C)CC=C(O[Si](C)(C)C)C(C)(C)C1CC3)O[Si](C)(C)C)C(=O)O[Si](C)(C)C | 3715.7 | Standard non polar | 33892256 | | Ganolucidic acid D,1TBDMS,isomer #1 | C/C(=C\C(CC(C)C1CC(O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)O[Si](C)(C)C(C)(C)C)C(=O)O | 4431.4 | Semi standard non polar | 33892256 | | Ganolucidic acid D,1TBDMS,isomer #2 | C/C(=C\C(O)CC(C)C1CC(O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)C(=O)O[Si](C)(C)C(C)(C)C | 4348.6 | Semi standard non polar | 33892256 | | Ganolucidic acid D,1TBDMS,isomer #3 | C/C(=C\C(O)CC(C)C1CC(O[Si](C)(C)C(C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)C(=O)O | 4383.7 | Semi standard non polar | 33892256 | | Ganolucidic acid D,1TBDMS,isomer #4 | C/C(=C\C(O)CC(C)C1CC(O)C2(C)C3=C(C(O[Si](C)(C)C(C)(C)C)=CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)C(=O)O | 4293.5 | Semi standard non polar | 33892256 | | Ganolucidic acid D,1TBDMS,isomer #5 | C/C(=C\C(O)CC(C)C1CC(O)C2(C)C3=C(C(=O)CC12C)C1(C)CC=C(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3)C(=O)O | 4323.9 | Semi standard non polar | 33892256 | | Ganolucidic acid D,2TBDMS,isomer #1 | C/C(=C\C(CC(C)C1CC(O[Si](C)(C)C(C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)O[Si](C)(C)C(C)(C)C)C(=O)O | 4571.8 | Semi standard non polar | 33892256 | | Ganolucidic acid D,2TBDMS,isomer #10 | C/C(=C\C(O)CC(C)C1CC(O)C2(C)C3=C(C(O[Si](C)(C)C(C)(C)C)=CC12C)C1(C)CC=C(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3)C(=O)O | 4347.9 | Semi standard non polar | 33892256 | | Ganolucidic acid D,2TBDMS,isomer #2 | C/C(=C\C(CC(C)C1CC(O)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 4586.1 | Semi standard non polar | 33892256 | | Ganolucidic acid D,2TBDMS,isomer #3 | C/C(=C\C(CC(C)C1CC(O)C2(C)C3=C(C(O[Si](C)(C)C(C)(C)C)=CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)O[Si](C)(C)C(C)(C)C)C(=O)O | 4436.5 | Semi standard non polar | 33892256 | | Ganolucidic acid D,2TBDMS,isomer #4 | C/C(=C\C(CC(C)C1CC(O)C2(C)C3=C(C(=O)CC12C)C1(C)CC=C(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3)O[Si](C)(C)C(C)(C)C)C(=O)O | 4504.3 | Semi standard non polar | 33892256 | | Ganolucidic acid D,2TBDMS,isomer #5 | C/C(=C\C(O)CC(C)C1CC(O[Si](C)(C)C(C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)C(=O)O[Si](C)(C)C(C)(C)C | 4501.0 | Semi standard non polar | 33892256 | | Ganolucidic acid D,2TBDMS,isomer #6 | C/C(=C\C(O)CC(C)C1CC(O)C2(C)C3=C(C(O[Si](C)(C)C(C)(C)C)=CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)C(=O)O[Si](C)(C)C(C)(C)C | 4382.4 | Semi standard non polar | 33892256 | | Ganolucidic acid D,2TBDMS,isomer #7 | C/C(=C\C(O)CC(C)C1CC(O)C2(C)C3=C(C(=O)CC12C)C1(C)CC=C(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3)C(=O)O[Si](C)(C)C(C)(C)C | 4471.9 | Semi standard non polar | 33892256 | | Ganolucidic acid D,2TBDMS,isomer #8 | C/C(=C\C(O)CC(C)C1CC(O[Si](C)(C)C(C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C(C)(C)C)=CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)C(=O)O | 4411.2 | Semi standard non polar | 33892256 | | Ganolucidic acid D,2TBDMS,isomer #9 | C/C(=C\C(O)CC(C)C1CC(O[Si](C)(C)C(C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CC=C(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3)C(=O)O | 4437.7 | Semi standard non polar | 33892256 | | Ganolucidic acid D,3TBDMS,isomer #1 | C/C(=C\C(CC(C)C1CC(O[Si](C)(C)C(C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 4660.4 | Semi standard non polar | 33892256 | | Ganolucidic acid D,3TBDMS,isomer #10 | C/C(=C\C(O)CC(C)C1CC(O[Si](C)(C)C(C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C(C)(C)C)=CC12C)C1(C)CC=C(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3)C(=O)O | 4407.0 | Semi standard non polar | 33892256 | | Ganolucidic acid D,3TBDMS,isomer #2 | C/C(=C\C(CC(C)C1CC(O[Si](C)(C)C(C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C(C)(C)C)=CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)O[Si](C)(C)C(C)(C)C)C(=O)O | 4509.5 | Semi standard non polar | 33892256 | | Ganolucidic acid D,3TBDMS,isomer #3 | C/C(=C\C(CC(C)C1CC(O[Si](C)(C)C(C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CC=C(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3)O[Si](C)(C)C(C)(C)C)C(=O)O | 4528.1 | Semi standard non polar | 33892256 | | Ganolucidic acid D,3TBDMS,isomer #4 | C/C(=C\C(CC(C)C1CC(O)C2(C)C3=C(C(O[Si](C)(C)C(C)(C)C)=CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 4529.0 | Semi standard non polar | 33892256 | | Ganolucidic acid D,3TBDMS,isomer #5 | C/C(=C\C(CC(C)C1CC(O)C2(C)C3=C(C(=O)CC12C)C1(C)CC=C(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3)O[Si](C)(C)C(C)(C)C)C(=O)O[Si](C)(C)C(C)(C)C | 4613.9 | Semi standard non polar | 33892256 | | Ganolucidic acid D,3TBDMS,isomer #6 | C/C(=C\C(CC(C)C1CC(O)C2(C)C3=C(C(O[Si](C)(C)C(C)(C)C)=CC12C)C1(C)CC=C(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3)O[Si](C)(C)C(C)(C)C)C(=O)O | 4437.5 | Semi standard non polar | 33892256 | | Ganolucidic acid D,3TBDMS,isomer #7 | C/C(=C\C(O)CC(C)C1CC(O[Si](C)(C)C(C)(C)C)C2(C)C3=C(C(O[Si](C)(C)C(C)(C)C)=CC12C)C1(C)CCC(=O)C(C)(C)C1CC3)C(=O)O[Si](C)(C)C(C)(C)C | 4471.7 | Semi standard non polar | 33892256 | | Ganolucidic acid D,3TBDMS,isomer #8 | C/C(=C\C(O)CC(C)C1CC(O[Si](C)(C)C(C)(C)C)C2(C)C3=C(C(=O)CC12C)C1(C)CC=C(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3)C(=O)O[Si](C)(C)C(C)(C)C | 4510.9 | Semi standard non polar | 33892256 | | Ganolucidic acid D,3TBDMS,isomer #9 | C/C(=C\C(O)CC(C)C1CC(O)C2(C)C3=C(C(O[Si](C)(C)C(C)(C)C)=CC12C)C1(C)CC=C(O[Si](C)(C)C(C)(C)C)C(C)(C)C1CC3)C(=O)O[Si](C)(C)C(C)(C)C | 4409.8 | Semi standard non polar | 33892256 |
|
|---|