| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 2.56 minutes | 32390414 |
| Predicted by Siyang on May 30, 2022 | 12.2807 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 6.85 minutes | 32390414 |
| AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 101.6 seconds | 40023050 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 1606.7 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 228.9 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 89.7 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 166.8 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 72.4 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 426.5 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 418.0 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 116.3 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 727.1 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 352.6 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1431.8 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 228.8 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 260.6 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 380.9 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 217.3 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 191.1 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| 2-Methylpropyl glucosinolate,1TMS,isomer #1 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C)C(O)C(O)C1O | 2928.5 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,1TMS,isomer #2 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O[Si](C)(C)C)C(O)C1O | 2898.3 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,1TMS,isomer #3 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O)C(O[Si](C)(C)C)C1O | 2896.8 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,1TMS,isomer #4 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O)C(O)C1O[Si](C)(C)C | 2905.3 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,1TMS,isomer #5 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO)C(O)C(O)C1O | 2970.3 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,2TMS,isomer #1 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O | 2898.0 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,2TMS,isomer #10 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO)C(O)C(O)C1O[Si](C)(C)C | 2906.8 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,2TMS,isomer #2 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O | 2899.4 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,2TMS,isomer #3 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C | 2891.3 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,2TMS,isomer #4 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO[Si](C)(C)C)C(O)C(O)C1O | 2914.4 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,2TMS,isomer #5 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O | 2904.5 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,2TMS,isomer #6 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C | 2891.7 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,2TMS,isomer #7 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO)C(O[Si](C)(C)C)C(O)C1O | 2901.8 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,2TMS,isomer #8 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C | 2894.6 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,2TMS,isomer #9 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO)C(O)C(O[Si](C)(C)C)C1O | 2904.4 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,3TMS,isomer #1 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O | 2832.5 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,3TMS,isomer #10 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C | 2838.3 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,3TMS,isomer #2 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C | 2813.8 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,3TMS,isomer #3 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O | 2830.8 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,3TMS,isomer #4 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C | 2819.0 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,3TMS,isomer #5 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O | 2842.6 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,3TMS,isomer #6 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C | 2827.2 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,3TMS,isomer #7 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C | 2835.7 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,3TMS,isomer #8 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O | 2857.9 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,3TMS,isomer #9 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C | 2850.6 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,4TMS,isomer #1 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C | 2778.9 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,4TMS,isomer #2 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O | 2789.7 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,4TMS,isomer #3 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C | 2779.1 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,4TMS,isomer #4 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C | 2787.9 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,4TMS,isomer #5 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C | 2772.1 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,5TMS,isomer #1 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C | 2746.3 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,5TMS,isomer #1 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C)SC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C | 3181.8 | Standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,1TBDMS,isomer #1 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O | 3155.7 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,1TBDMS,isomer #2 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O | 3137.1 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,1TBDMS,isomer #3 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O | 3139.5 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,1TBDMS,isomer #4 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C | 3144.2 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,1TBDMS,isomer #5 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO)C(O)C(O)C1O | 3201.4 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,2TBDMS,isomer #1 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O | 3277.0 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,2TBDMS,isomer #10 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C | 3319.1 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,2TBDMS,isomer #2 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O | 3307.6 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,2TBDMS,isomer #3 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C | 3271.7 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,2TBDMS,isomer #4 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O | 3319.2 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,2TBDMS,isomer #5 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O | 3316.2 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,2TBDMS,isomer #6 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C | 3293.7 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,2TBDMS,isomer #7 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O | 3321.8 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,2TBDMS,isomer #8 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C | 3299.3 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,2TBDMS,isomer #9 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O | 3324.1 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,3TBDMS,isomer #1 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O | 3457.3 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,3TBDMS,isomer #10 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C | 3443.4 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,3TBDMS,isomer #2 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C | 3413.8 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,3TBDMS,isomer #3 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O | 3441.4 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,3TBDMS,isomer #4 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C | 3434.3 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,3TBDMS,isomer #5 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O | 3463.2 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,3TBDMS,isomer #6 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C | 3431.9 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,3TBDMS,isomer #7 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C | 3418.2 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,3TBDMS,isomer #8 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O | 3457.8 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,3TBDMS,isomer #9 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C | 3441.1 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,4TBDMS,isomer #1 | CC(C)C/C(=N\OS(=O)(=O)O)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C | 3565.4 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,4TBDMS,isomer #2 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O | 3632.7 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,4TBDMS,isomer #3 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C | 3612.5 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,4TBDMS,isomer #4 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C | 3617.6 | Semi standard non polar | 33892256 |
| 2-Methylpropyl glucosinolate,4TBDMS,isomer #5 | CC(C)C/C(=N\OS(=O)(=O)O[Si](C)(C)C(C)(C)C)SC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C | 3585.0 | Semi standard non polar | 33892256 |