Hmdb loader

Showing metabocard for Ginsenoside Rh7 (HMDB0039446)

Jump To Section:
IdentificationTaxonomyOntologyPhysical propertiesSpectraBiological propertiesConcentrationsLinksReferencesXML
Record Information
Version5.0
StatusExpected but not Quantified
Creation Date2012-09-12 00:54:39 UTC
Update Date2022-03-07 02:56:12 UTC
HMDB IDHMDB0039446
Secondary Accession Numbers
  • HMDB39446
Metabolite Identification
Common NameGinsenoside Rh7
DescriptionGinsenoside Rh7 belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. Based on a literature review a small amount of articles have been published on Ginsenoside Rh7.
Structure
Data?1563863377
MOL3D MOLSDF3D SDFPDB3D PDBSMILESInChI

MOL for HMDB0039446 (Ginsenoside Rh7)


  Mrv0541 02241207412D          

 45 49  0  0  0  0            999 V2000
   -3.6089   -2.2422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6089   -3.0688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8951   -3.4821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1816   -3.0688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1816   -2.2422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8951   -1.8316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4666   -3.4821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7530   -3.0688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7530   -2.2422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4666   -1.8316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0421   -1.8316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0421   -1.0092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7530   -0.6026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4666   -1.0092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7392   -2.0837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2145   -1.4183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7392   -0.7612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3084   -4.1999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4819   -4.1999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7392    0.0654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4555    0.4787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1734    0.0654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8911    0.4787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6089    0.0654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3267    0.4787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6089   -0.7612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1816   -1.4183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7530   -1.4183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0421   -3.4821    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3267   -3.4821    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7861    0.2239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7392    0.8921    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0421   -2.6583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0213    0.4787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7392    1.7186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4555    2.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4555    2.9641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7392    3.3733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0213    2.9641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0213    2.1360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6937    3.3733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4100    2.9641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7392    4.1999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1734    3.3733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1734    1.7186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  1  6  1  0  0  0  0
  2  3  1  0  0  0  0
  2 30  1  0  0  0  0
  3  4  1  0  0  0  0
  3 18  1  0  0  0  0
  3 19  1  0  0  0  0
  4  5  1  0  0  0  0
  4  7  2  0  0  0  0
  5  6  1  0  0  0  0
  5 10  1  0  0  0  0
  5 27  1  0  0  0  0
  7  8  1  0  0  0  0
  8  9  1  0  0  0  0
  8 29  1  0  0  0  0
  9 10  1  0  0  0  0
  9 11  1  0  0  0  0
  9 28  1  0  0  0  0
 10 14  1  0  0  0  0
 11 12  1  0  0  0  0
 11 15  1  0  0  0  0
 11 33  1  0  0  0  0
 12 13  1  0  0  0  0
 12 17  1  0  0  0  0
 13 14  1  0  0  0  0
 13 31  1  0  0  0  0
 15 16  1  0  0  0  0
 16 17  1  0  0  0  0
 17 20  1  0  0  0  0
 20 21  1  0  0  0  0
 20 32  1  0  0  0  0
 20 34  1  0  0  0  0
 21 22  1  0  0  0  0
 22 23  1  0  0  0  0
 23 24  2  0  0  0  0
 24 25  1  0  0  0  0
 24 26  1  0  0  0  0
 32 35  1  0  0  0  0
 35 36  1  0  0  0  0
 35 40  1  0  0  0  0
 36 37  1  0  0  0  0
 36 45  1  0  0  0  0
 37 38  1  0  0  0  0
 37 44  1  0  0  0  0
 38 39  1  0  0  0  0
 38 43  1  0  0  0  0
 39 40  1  0  0  0  0
 39 41  1  0  0  0  0
 41 42  1  0  0  0  0
M  END
Download

3D MOL for HMDB0039446 (Ginsenoside Rh7)

HMDB0039446
     RDKit          3D
Ginsenoside Rh7
105109  0  0  0  0  0  0  0  0999 V2000
   -5.2865    5.0677   -0.8792 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7311    4.0006   -1.8137 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0801    4.0802   -2.4056 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9391    2.9895   -2.1180 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5442    2.8261   -1.5604 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5791    1.4839   -0.8187 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3286    1.0703   -0.1600 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9584    2.1820    0.8094 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8496    0.0994    0.8353 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5139   -0.9473    0.2462 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9110   -2.1509    0.5238 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5768   -3.2948    0.5104 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8220   -4.3497    1.2950 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6666   -3.9384    2.5996 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9972   -3.2912    0.9870 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5934   -4.5106    0.7564 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6933   -2.1708    0.2267 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0254   -2.0627    0.5758 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9548   -0.9080    0.7056 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9850   -0.9666    2.1005 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2503    0.3489   -0.8250 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6377    0.9407   -2.0650 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6137    1.6738   -1.6663 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1029    0.9609   -0.4161 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5196    2.0715    0.5498 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0078    0.1522    0.1036 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2294   -1.2389    0.4803 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2966   -1.4911    1.7858 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6334   -1.7576    0.4641 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6601   -0.6190    0.4794 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0379   -1.0597    0.7338 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1446   -2.5596    0.5308 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3506   -0.8681    2.2318 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6463   -0.1888    2.4803 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7991   -0.8224    1.7121 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9562   -0.1439    2.1421 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5350   -0.5955    0.2332 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0591   -1.7127   -0.6245 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3721    0.6439   -0.1339 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0925   -0.3249    0.0190 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7753    0.6088   -0.8545 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4423    1.0636   -1.2566 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2988    2.4228   -1.0160 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3832    0.1740   -0.7565 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1032   -0.7868   -1.9176 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9850    5.9245   -0.9507 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2819    5.4780   -1.1859 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2855    4.7522    0.1769 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8670    4.3711   -1.6660 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1423    4.8225   -3.2197 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4078    3.0704   -2.7870 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3013    2.2357   -2.8014 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7894    2.9705   -2.2876 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4659    3.6542   -0.7893 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1678    0.7583   -1.3766 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2803    1.7730    0.0497 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7104    1.8581    1.8177 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8902    2.7963    0.9535 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2416    2.8986    0.3660 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5356   -0.9049   -0.8558 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6086   -3.6931   -0.5496 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8473   -4.5510    0.7754 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3714   -5.3250    1.2874 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4166   -3.0016    2.6712 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9916   -2.9992    2.0603 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3638   -4.6188    1.3516 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5375   -2.2823   -0.8615 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5674   -2.0029   -0.2488 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5508   -0.0779    0.3629 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2920   -0.1442    2.5232 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5502   -0.6754   -1.0843 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2490    1.5487   -2.6983 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2920    0.1084   -2.7700 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3502    1.6932   -2.4708 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3406    2.7346   -1.4585 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5002    1.9045    1.0268 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7998    1.9792    1.4186 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3664    3.0779    0.1472 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3305    0.6740    1.0606 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3643   -1.9147   -0.1611 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0894   -2.4218    2.0080 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8098   -2.4935   -0.3353 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7694   -2.3705    1.4065 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3118   -0.0526    1.4093 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2221   -2.8945    0.6628 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7606   -2.9313   -0.4092 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6528   -3.0287    1.4054 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5507   -0.2424    2.7004 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3316   -1.8207    2.7894 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8922   -0.3140    3.5539 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6610    0.8921    2.2701 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9499   -1.8715    1.9709 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.0109   -0.2480    3.1071 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5056   -2.4840    0.0597 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9299   -1.4020   -1.2750 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3201   -2.1299   -1.3241 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9437    1.5617    0.2765 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5719    0.6714   -1.2222 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3619    0.4894    0.3634 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6004    1.1585   -1.3864 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4489    1.0078   -2.3984 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9976    2.9157   -1.4858 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0298   -1.4132   -2.0877 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2072   -1.3649   -1.8307 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0505   -0.2076   -2.8848 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  3
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 12 15  1  0
 15 16  1  0
 15 17  1  0
 17 18  1  0
 17 19  1  0
 19 20  1  0
  7 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 37 39  1  0
 37 40  1  0
 40 41  2  0
 41 42  1  0
 42 43  1  0
 42 44  1  0
 44 45  1  0
 19 10  1  0
 26 21  1  0
 44 30  1  0
 44 24  1  0
 40 31  1  0
  1 46  1  0
  1 47  1  0
  1 48  1  0
  3 49  1  0
  3 50  1  0
  3 51  1  0
  4 52  1  0
  5 53  1  0
  5 54  1  0
  6 55  1  0
  6 56  1  0
  8 57  1  0
  8 58  1  0
  8 59  1  0
 10 60  1  0
 12 61  1  0
 13 62  1  0
 13 63  1  0
 14 64  1  0
 15 65  1  0
 16 66  1  0
 17 67  1  0
 18 68  1  0
 19 69  1  0
 20 70  1  0
 21 71  1  0
 22 72  1  0
 22 73  1  0
 23 74  1  0
 23 75  1  0
 25 76  1  0
 25 77  1  0
 25 78  1  0
 26 79  1  0
 27 80  1  0
 28 81  1  0
 29 82  1  0
 29 83  1  0
 30 84  1  0
 32 85  1  0
 32 86  1  0
 32 87  1  0
 33 88  1  0
 33 89  1  0
 34 90  1  0
 34 91  1  0
 35 92  1  0
 36 93  1  0
 38 94  1  0
 38 95  1  0
 38 96  1  0
 39 97  1  0
 39 98  1  0
 39 99  1  0
 41100  1  0
 42101  1  0
 43102  1  0
 45103  1  0
 45104  1  0
 45105  1  0
M  END
Download

3D SDF for HMDB0039446 (Ginsenoside Rh7)


  Mrv0541 02241207412D          

 45 49  0  0  0  0            999 V2000
   -3.6089   -2.2422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6089   -3.0688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8951   -3.4821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1816   -3.0688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1816   -2.2422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8951   -1.8316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4666   -3.4821    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7530   -3.0688    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7530   -2.2422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4666   -1.8316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0421   -1.8316    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0421   -1.0092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7530   -0.6026    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4666   -1.0092    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7392   -2.0837    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2145   -1.4183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7392   -0.7612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3084   -4.1999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4819   -4.1999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7392    0.0654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4555    0.4787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1734    0.0654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8911    0.4787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6089    0.0654    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3267    0.4787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6089   -0.7612    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1816   -1.4183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7530   -1.4183    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0421   -3.4821    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3267   -3.4821    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7861    0.2239    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7392    0.8921    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0421   -2.6583    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0213    0.4787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7392    1.7186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4555    2.1360    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4555    2.9641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7392    3.3733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0213    2.9641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0213    2.1360    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6937    3.3733    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4100    2.9641    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7392    4.1999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1734    3.3733    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1734    1.7186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  1  6  1  0  0  0  0
  2  3  1  0  0  0  0
  2 30  1  0  0  0  0
  3  4  1  0  0  0  0
  3 18  1  0  0  0  0
  3 19  1  0  0  0  0
  4  5  1  0  0  0  0
  4  7  2  0  0  0  0
  5  6  1  0  0  0  0
  5 10  1  0  0  0  0
  5 27  1  0  0  0  0
  7  8  1  0  0  0  0
  8  9  1  0  0  0  0
  8 29  1  0  0  0  0
  9 10  1  0  0  0  0
  9 11  1  0  0  0  0
  9 28  1  0  0  0  0
 10 14  1  0  0  0  0
 11 12  1  0  0  0  0
 11 15  1  0  0  0  0
 11 33  1  0  0  0  0
 12 13  1  0  0  0  0
 12 17  1  0  0  0  0
 13 14  1  0  0  0  0
 13 31  1  0  0  0  0
 15 16  1  0  0  0  0
 16 17  1  0  0  0  0
 17 20  1  0  0  0  0
 20 21  1  0  0  0  0
 20 32  1  0  0  0  0
 20 34  1  0  0  0  0
 21 22  1  0  0  0  0
 22 23  1  0  0  0  0
 23 24  2  0  0  0  0
 24 25  1  0  0  0  0
 24 26  1  0  0  0  0
 32 35  1  0  0  0  0
 35 36  1  0  0  0  0
 35 40  1  0  0  0  0
 36 37  1  0  0  0  0
 36 45  1  0  0  0  0
 37 38  1  0  0  0  0
 37 44  1  0  0  0  0
 38 39  1  0  0  0  0
 38 43  1  0  0  0  0
 39 40  1  0  0  0  0
 39 41  1  0  0  0  0
 41 42  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0039446

> <DATABASE_NAME>
hmdb

> <SMILES>
CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C21C

> <INCHI_IDENTIFIER>
InChI=1S/C36H60O9/c1-19(2)10-9-13-35(7,45-31-30(43)29(42)28(41)22(18-37)44-31)20-11-15-34(6)27(20)21(38)16-24-33(5)14-12-25(39)32(3,4)23(33)17-26(40)36(24,34)8/h10,17,20-22,24-31,37-43H,9,11-16,18H2,1-8H3

> <INCHI_KEY>
ARPGURKWJGBPTN-UHFFFAOYSA-N

> <FORMULA>
C36H60O9

> <MOLECULAR_WEIGHT>
636.8562

> <EXACT_MASS>
636.423733518

> <JCHEM_ACCEPTOR_COUNT>
9

> <JCHEM_AVERAGE_POLARIZABILITY>
72.55765644487809

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
7

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
2-(hydroxymethyl)-6-[(6-methyl-2-{5,9,16-trihydroxy-2,6,6,10,11-pentamethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-7-en-14-yl}hept-5-en-2-yl)oxy]oxane-3,4,5-triol

> <ALOGPS_LOGP>
2.58

> <JCHEM_LOGP>
2.2806190709999994

> <ALOGPS_LOGS>
-3.90

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
5

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
13.192371257566144

> <JCHEM_PKA_STRONGEST_ACIDIC>
12.209291726070173

> <JCHEM_PKA_STRONGEST_BASIC>
-0.36101813741278066

> <JCHEM_POLAR_SURFACE_AREA>
160.07

> <JCHEM_REFRACTIVITY>
171.86070000000004

> <JCHEM_ROTATABLE_BOND_COUNT>
7

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
8.07e-02 g/l

> <JCHEM_TRADITIONAL_IUPAC>
2-(hydroxymethyl)-6-[(6-methyl-2-{5,9,16-trihydroxy-2,6,6,10,11-pentamethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-7-en-14-yl}hept-5-en-2-yl)oxy]oxane-3,4,5-triol

> <JCHEM_VEBER_RULE>
0

$$$$
Download

3D-SDF for HMDB0039446 (Ginsenoside Rh7)

HMDB0039446
     RDKit          3D
Ginsenoside Rh7
105109  0  0  0  0  0  0  0  0999 V2000
   -5.2865    5.0677   -0.8792 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7311    4.0006   -1.8137 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0801    4.0802   -2.4056 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9391    2.9895   -2.1180 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5442    2.8261   -1.5604 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5791    1.4839   -0.8187 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3286    1.0703   -0.1600 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9584    2.1820    0.8094 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8496    0.0994    0.8353 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5139   -0.9473    0.2462 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9110   -2.1509    0.5238 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5768   -3.2948    0.5104 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8220   -4.3497    1.2950 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6666   -3.9384    2.5996 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9972   -3.2912    0.9870 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5934   -4.5106    0.7564 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6933   -2.1708    0.2267 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0254   -2.0627    0.5758 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9548   -0.9080    0.7056 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9850   -0.9666    2.1005 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2503    0.3489   -0.8250 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6377    0.9407   -2.0650 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6137    1.6738   -1.6663 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1029    0.9609   -0.4161 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5196    2.0715    0.5498 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0078    0.1522    0.1036 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2294   -1.2389    0.4803 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2966   -1.4911    1.7858 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6334   -1.7576    0.4641 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6601   -0.6190    0.4794 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0379   -1.0597    0.7338 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1446   -2.5596    0.5308 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3506   -0.8681    2.2318 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6463   -0.1888    2.4803 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7991   -0.8224    1.7121 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9562   -0.1439    2.1421 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5350   -0.5955    0.2332 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0591   -1.7127   -0.6245 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3721    0.6439   -0.1339 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0925   -0.3249    0.0190 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7753    0.6088   -0.8545 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4423    1.0636   -1.2566 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2988    2.4228   -1.0160 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3832    0.1740   -0.7565 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1032   -0.7868   -1.9176 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9850    5.9245   -0.9507 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2819    5.4780   -1.1859 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2855    4.7522    0.1769 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8670    4.3711   -1.6660 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.1423    4.8225   -3.2197 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4078    3.0704   -2.7870 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3013    2.2357   -2.8014 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7894    2.9705   -2.2876 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4659    3.6542   -0.7893 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1678    0.7583   -1.3766 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2803    1.7730    0.0497 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7104    1.8581    1.8177 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8902    2.7963    0.9535 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2416    2.8986    0.3660 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5356   -0.9049   -0.8558 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6086   -3.6931   -0.5496 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8473   -4.5510    0.7754 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3714   -5.3250    1.2874 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4166   -3.0016    2.6712 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9916   -2.9992    2.0603 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3638   -4.6188    1.3516 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5375   -2.2823   -0.8615 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5674   -2.0029   -0.2488 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5508   -0.0779    0.3629 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2920   -0.1442    2.5232 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5502   -0.6754   -1.0843 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2490    1.5487   -2.6983 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2920    0.1084   -2.7700 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3502    1.6932   -2.4708 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3406    2.7346   -1.4585 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5002    1.9045    1.0268 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7998    1.9792    1.4186 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3664    3.0779    0.1472 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3305    0.6740    1.0606 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3643   -1.9147   -0.1611 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0894   -2.4218    2.0080 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8098   -2.4935   -0.3353 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7694   -2.3705    1.4065 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3118   -0.0526    1.4093 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2221   -2.8945    0.6628 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7606   -2.9313   -0.4092 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6528   -3.0287    1.4054 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5507   -0.2424    2.7004 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3316   -1.8207    2.7894 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8922   -0.3140    3.5539 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6610    0.8921    2.2701 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9499   -1.8715    1.9709 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.0109   -0.2480    3.1071 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5056   -2.4840    0.0597 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9299   -1.4020   -1.2750 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3201   -2.1299   -1.3241 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9437    1.5617    0.2765 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5719    0.6714   -1.2222 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3619    0.4894    0.3634 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6004    1.1585   -1.3864 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4489    1.0078   -2.3984 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9976    2.9157   -1.4858 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0298   -1.4132   -2.0877 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2072   -1.3649   -1.8307 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0505   -0.2076   -2.8848 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  2  4  2  3
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  7  9  1  0
  9 10  1  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 12 15  1  0
 15 16  1  0
 15 17  1  0
 17 18  1  0
 17 19  1  0
 19 20  1  0
  7 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 24 26  1  0
 26 27  1  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 31 33  1  0
 33 34  1  0
 34 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 37 39  1  0
 37 40  1  0
 40 41  2  0
 41 42  1  0
 42 43  1  0
 42 44  1  0
 44 45  1  0
 19 10  1  0
 26 21  1  0
 44 30  1  0
 44 24  1  0
 40 31  1  0
  1 46  1  0
  1 47  1  0
  1 48  1  0
  3 49  1  0
  3 50  1  0
  3 51  1  0
  4 52  1  0
  5 53  1  0
  5 54  1  0
  6 55  1  0
  6 56  1  0
  8 57  1  0
  8 58  1  0
  8 59  1  0
 10 60  1  0
 12 61  1  0
 13 62  1  0
 13 63  1  0
 14 64  1  0
 15 65  1  0
 16 66  1  0
 17 67  1  0
 18 68  1  0
 19 69  1  0
 20 70  1  0
 21 71  1  0
 22 72  1  0
 22 73  1  0
 23 74  1  0
 23 75  1  0
 25 76  1  0
 25 77  1  0
 25 78  1  0
 26 79  1  0
 27 80  1  0
 28 81  1  0
 29 82  1  0
 29 83  1  0
 30 84  1  0
 32 85  1  0
 32 86  1  0
 32 87  1  0
 33 88  1  0
 33 89  1  0
 34 90  1  0
 34 91  1  0
 35 92  1  0
 36 93  1  0
 38 94  1  0
 38 95  1  0
 38 96  1  0
 39 97  1  0
 39 98  1  0
 39 99  1  0
 41100  1  0
 42101  1  0
 43102  1  0
 45103  1  0
 45104  1  0
 45105  1  0
M  END
Download

PDB for HMDB0039446 (Ginsenoside Rh7)

HEADER    PROTEIN                                 24-FEB-12   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   24-FEB-12         0                                  
HETATM    1  C   UNK     0      -6.737  -4.185   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      -6.737  -5.728   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0      -5.404  -6.500   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0      -4.072  -5.728   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0      -4.072  -4.185   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0      -5.404  -3.419   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0      -2.738  -6.500   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      -1.406  -5.728   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0      -1.406  -4.185   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0      -2.738  -3.419   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0      -0.079  -3.419   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0      -0.079  -1.884   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0      -1.406  -1.125   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0      -2.738  -1.884   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       1.380  -3.890   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       2.267  -2.647   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0       1.380  -1.421   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0      -6.176  -7.840   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0      -4.633  -7.840   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0       1.380   0.122   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0       2.717   0.894   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0       4.057   0.122   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0       5.397   0.894   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0       6.737   0.122   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0       8.077   0.894   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0       6.737  -1.421   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0      -4.072  -2.647   0.000  0.00  0.00           C+0
HETATM   28  C   UNK     0      -1.406  -2.647   0.000  0.00  0.00           C+0
HETATM   29  O   UNK     0      -0.079  -6.500   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0      -8.077  -6.500   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0      -1.467   0.418   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0       1.380   1.665   0.000  0.00  0.00           O+0
HETATM   33  C   UNK     0      -0.079  -4.962   0.000  0.00  0.00           C+0
HETATM   34  C   UNK     0       0.040   0.894   0.000  0.00  0.00           C+0
HETATM   35  C   UNK     0       1.380   3.208   0.000  0.00  0.00           C+0
HETATM   36  C   UNK     0       2.717   3.987   0.000  0.00  0.00           C+0
HETATM   37  C   UNK     0       2.717   5.533   0.000  0.00  0.00           C+0
HETATM   38  C   UNK     0       1.380   6.297   0.000  0.00  0.00           C+0
HETATM   39  C   UNK     0       0.040   5.533   0.000  0.00  0.00           C+0
HETATM   40  O   UNK     0       0.040   3.987   0.000  0.00  0.00           O+0
HETATM   41  C   UNK     0      -1.295   6.297   0.000  0.00  0.00           C+0
HETATM   42  O   UNK     0      -2.632   5.533   0.000  0.00  0.00           O+0
HETATM   43  O   UNK     0       1.380   7.840   0.000  0.00  0.00           O+0
HETATM   44  O   UNK     0       4.057   6.297   0.000  0.00  0.00           O+0
HETATM   45  O   UNK     0       4.057   3.208   0.000  0.00  0.00           O+0
CONECT    1    2    6                                                       
CONECT    2    1    3   30                                                  
CONECT    3    2    4   18   19                                             
CONECT    4    3    5    7                                                  
CONECT    5    4    6   10   27                                             
CONECT    6    1    5                                                       
CONECT    7    4    8                                                       
CONECT    8    7    9   29                                                  
CONECT    9    8   10   11   28                                             
CONECT   10    5    9   14                                                  
CONECT   11    9   12   15   33                                             
CONECT   12   11   13   17                                                  
CONECT   13   12   14   31                                                  
CONECT   14   10   13                                                       
CONECT   15   11   16                                                       
CONECT   16   15   17                                                       
CONECT   17   12   16   20                                                  
CONECT   18    3                                                            
CONECT   19    3                                                            
CONECT   20   17   21   32   34                                             
CONECT   21   20   22                                                       
CONECT   22   21   23                                                       
CONECT   23   22   24                                                       
CONECT   24   23   25   26                                                  
CONECT   25   24                                                            
CONECT   26   24                                                            
CONECT   27    5                                                            
CONECT   28    9                                                            
CONECT   29    8                                                            
CONECT   30    2                                                            
CONECT   31   13                                                            
CONECT   32   20   35                                                       
CONECT   33   11                                                            
CONECT   34   20                                                            
CONECT   35   32   36   40                                                  
CONECT   36   35   37   45                                                  
CONECT   37   36   38   44                                                  
CONECT   38   37   39   43                                                  
CONECT   39   38   40   41                                                  
CONECT   40   35   39                                                       
CONECT   41   39   42                                                       
CONECT   42   41                                                            
CONECT   43   38                                                            
CONECT   44   37                                                            
CONECT   45   36                                                            
MASTER        0    0    0    0    0    0    0    0   45    0   98    0
END
Download

3D PDB for HMDB0039446 (Ginsenoside Rh7)

COMPND    HMDB0039446
HETATM    1  C1  UNL     1      -5.287   5.068  -0.879  1.00  0.00           C  
HETATM    2  C2  UNL     1      -5.731   4.001  -1.814  1.00  0.00           C  
HETATM    3  C3  UNL     1      -7.080   4.080  -2.406  1.00  0.00           C  
HETATM    4  C4  UNL     1      -4.939   2.989  -2.118  1.00  0.00           C  
HETATM    5  C5  UNL     1      -3.544   2.826  -1.560  1.00  0.00           C  
HETATM    6  C6  UNL     1      -3.579   1.484  -0.819  1.00  0.00           C  
HETATM    7  C7  UNL     1      -2.329   1.070  -0.160  1.00  0.00           C  
HETATM    8  C8  UNL     1      -1.958   2.182   0.809  1.00  0.00           C  
HETATM    9  O1  UNL     1      -2.850   0.099   0.835  1.00  0.00           O  
HETATM   10  C9  UNL     1      -3.514  -0.947   0.246  1.00  0.00           C  
HETATM   11  O2  UNL     1      -2.911  -2.151   0.524  1.00  0.00           O  
HETATM   12  C10 UNL     1      -3.577  -3.295   0.510  1.00  0.00           C  
HETATM   13  C11 UNL     1      -2.822  -4.350   1.295  1.00  0.00           C  
HETATM   14  O3  UNL     1      -2.667  -3.938   2.600  1.00  0.00           O  
HETATM   15  C12 UNL     1      -4.997  -3.291   0.987  1.00  0.00           C  
HETATM   16  O4  UNL     1      -5.593  -4.511   0.756  1.00  0.00           O  
HETATM   17  C13 UNL     1      -5.693  -2.171   0.227  1.00  0.00           C  
HETATM   18  O5  UNL     1      -7.025  -2.063   0.576  1.00  0.00           O  
HETATM   19  C14 UNL     1      -4.955  -0.908   0.706  1.00  0.00           C  
HETATM   20  O6  UNL     1      -4.985  -0.967   2.101  1.00  0.00           O  
HETATM   21  C15 UNL     1      -1.250   0.349  -0.825  1.00  0.00           C  
HETATM   22  C16 UNL     1      -0.638   0.941  -2.065  1.00  0.00           C  
HETATM   23  C17 UNL     1       0.614   1.674  -1.666  1.00  0.00           C  
HETATM   24  C18 UNL     1       1.103   0.961  -0.416  1.00  0.00           C  
HETATM   25  C19 UNL     1       1.520   2.072   0.550  1.00  0.00           C  
HETATM   26  C20 UNL     1      -0.008   0.152   0.104  1.00  0.00           C  
HETATM   27  C21 UNL     1       0.229  -1.239   0.480  1.00  0.00           C  
HETATM   28  O7  UNL     1      -0.297  -1.491   1.786  1.00  0.00           O  
HETATM   29  C22 UNL     1       1.633  -1.758   0.464  1.00  0.00           C  
HETATM   30  C23 UNL     1       2.660  -0.619   0.479  1.00  0.00           C  
HETATM   31  C24 UNL     1       4.038  -1.060   0.734  1.00  0.00           C  
HETATM   32  C25 UNL     1       4.145  -2.560   0.531  1.00  0.00           C  
HETATM   33  C26 UNL     1       4.351  -0.868   2.232  1.00  0.00           C  
HETATM   34  C27 UNL     1       5.646  -0.189   2.480  1.00  0.00           C  
HETATM   35  C28 UNL     1       6.799  -0.822   1.712  1.00  0.00           C  
HETATM   36  O8  UNL     1       7.956  -0.144   2.142  1.00  0.00           O  
HETATM   37  C29 UNL     1       6.535  -0.595   0.233  1.00  0.00           C  
HETATM   38  C30 UNL     1       7.059  -1.713  -0.625  1.00  0.00           C  
HETATM   39  C31 UNL     1       7.372   0.644  -0.134  1.00  0.00           C  
HETATM   40  C32 UNL     1       5.093  -0.325   0.019  1.00  0.00           C  
HETATM   41  C33 UNL     1       4.775   0.609  -0.855  1.00  0.00           C  
HETATM   42  C34 UNL     1       3.442   1.064  -1.257  1.00  0.00           C  
HETATM   43  O9  UNL     1       3.299   2.423  -1.016  1.00  0.00           O  
HETATM   44  C35 UNL     1       2.383   0.174  -0.757  1.00  0.00           C  
HETATM   45  C36 UNL     1       2.103  -0.787  -1.918  1.00  0.00           C  
HETATM   46  H1  UNL     1      -5.985   5.925  -0.951  1.00  0.00           H  
HETATM   47  H2  UNL     1      -4.282   5.478  -1.186  1.00  0.00           H  
HETATM   48  H3  UNL     1      -5.286   4.752   0.177  1.00  0.00           H  
HETATM   49  H4  UNL     1      -7.867   4.371  -1.666  1.00  0.00           H  
HETATM   50  H5  UNL     1      -7.142   4.822  -3.220  1.00  0.00           H  
HETATM   51  H6  UNL     1      -7.408   3.070  -2.787  1.00  0.00           H  
HETATM   52  H7  UNL     1      -5.301   2.236  -2.801  1.00  0.00           H  
HETATM   53  H8  UNL     1      -2.789   2.971  -2.288  1.00  0.00           H  
HETATM   54  H9  UNL     1      -3.466   3.654  -0.789  1.00  0.00           H  
HETATM   55  H10 UNL     1      -4.168   0.758  -1.377  1.00  0.00           H  
HETATM   56  H11 UNL     1      -4.280   1.773   0.050  1.00  0.00           H  
HETATM   57  H12 UNL     1      -1.710   1.858   1.818  1.00  0.00           H  
HETATM   58  H13 UNL     1      -2.890   2.796   0.954  1.00  0.00           H  
HETATM   59  H14 UNL     1      -1.242   2.899   0.366  1.00  0.00           H  
HETATM   60  H15 UNL     1      -3.536  -0.905  -0.856  1.00  0.00           H  
HETATM   61  H16 UNL     1      -3.609  -3.693  -0.550  1.00  0.00           H  
HETATM   62  H17 UNL     1      -1.847  -4.551   0.775  1.00  0.00           H  
HETATM   63  H18 UNL     1      -3.371  -5.325   1.287  1.00  0.00           H  
HETATM   64  H19 UNL     1      -2.417  -3.002   2.671  1.00  0.00           H  
HETATM   65  H20 UNL     1      -4.992  -2.999   2.060  1.00  0.00           H  
HETATM   66  H21 UNL     1      -6.364  -4.619   1.352  1.00  0.00           H  
HETATM   67  H22 UNL     1      -5.538  -2.282  -0.861  1.00  0.00           H  
HETATM   68  H23 UNL     1      -7.567  -2.003  -0.249  1.00  0.00           H  
HETATM   69  H24 UNL     1      -5.551  -0.078   0.363  1.00  0.00           H  
HETATM   70  H25 UNL     1      -5.292  -0.144   2.523  1.00  0.00           H  
HETATM   71  H26 UNL     1      -1.550  -0.675  -1.084  1.00  0.00           H  
HETATM   72  H27 UNL     1      -1.249   1.549  -2.698  1.00  0.00           H  
HETATM   73  H28 UNL     1      -0.292   0.108  -2.770  1.00  0.00           H  
HETATM   74  H29 UNL     1       1.350   1.693  -2.471  1.00  0.00           H  
HETATM   75  H30 UNL     1       0.341   2.735  -1.459  1.00  0.00           H  
HETATM   76  H31 UNL     1       2.500   1.905   1.027  1.00  0.00           H  
HETATM   77  H32 UNL     1       0.800   1.979   1.419  1.00  0.00           H  
HETATM   78  H33 UNL     1       1.366   3.078   0.147  1.00  0.00           H  
HETATM   79  H34 UNL     1      -0.330   0.674   1.061  1.00  0.00           H  
HETATM   80  H35 UNL     1      -0.364  -1.915  -0.161  1.00  0.00           H  
HETATM   81  H36 UNL     1      -0.089  -2.422   2.008  1.00  0.00           H  
HETATM   82  H37 UNL     1       1.810  -2.493  -0.335  1.00  0.00           H  
HETATM   83  H38 UNL     1       1.769  -2.370   1.406  1.00  0.00           H  
HETATM   84  H39 UNL     1       2.312  -0.053   1.409  1.00  0.00           H  
HETATM   85  H40 UNL     1       5.222  -2.894   0.663  1.00  0.00           H  
HETATM   86  H41 UNL     1       3.761  -2.931  -0.409  1.00  0.00           H  
HETATM   87  H42 UNL     1       3.653  -3.029   1.405  1.00  0.00           H  
HETATM   88  H43 UNL     1       3.551  -0.242   2.700  1.00  0.00           H  
HETATM   89  H44 UNL     1       4.332  -1.821   2.789  1.00  0.00           H  
HETATM   90  H45 UNL     1       5.892  -0.314   3.554  1.00  0.00           H  
HETATM   91  H46 UNL     1       5.661   0.892   2.270  1.00  0.00           H  
HETATM   92  H47 UNL     1       6.950  -1.872   1.971  1.00  0.00           H  
HETATM   93  H48 UNL     1       8.011  -0.248   3.107  1.00  0.00           H  
HETATM   94  H49 UNL     1       7.506  -2.484   0.060  1.00  0.00           H  
HETATM   95  H50 UNL     1       7.930  -1.402  -1.275  1.00  0.00           H  
HETATM   96  H51 UNL     1       6.320  -2.130  -1.324  1.00  0.00           H  
HETATM   97  H52 UNL     1       6.944   1.562   0.276  1.00  0.00           H  
HETATM   98  H53 UNL     1       7.572   0.671  -1.222  1.00  0.00           H  
HETATM   99  H54 UNL     1       8.362   0.489   0.363  1.00  0.00           H  
HETATM  100  H55 UNL     1       5.600   1.158  -1.386  1.00  0.00           H  
HETATM  101  H56 UNL     1       3.449   1.008  -2.398  1.00  0.00           H  
HETATM  102  H57 UNL     1       3.998   2.916  -1.486  1.00  0.00           H  
HETATM  103  H58 UNL     1       3.030  -1.413  -2.088  1.00  0.00           H  
HETATM  104  H59 UNL     1       1.207  -1.365  -1.831  1.00  0.00           H  
HETATM  105  H60 UNL     1       2.050  -0.208  -2.885  1.00  0.00           H  
CONECT    1    2   46   47   48
CONECT    2    3    4    4
CONECT    3   49   50   51
CONECT    4    5   52
CONECT    5    6   53   54
CONECT    6    7   55   56
CONECT    7    8    9   21
CONECT    8   57   58   59
CONECT    9   10
CONECT   10   11   19   60
CONECT   11   12
CONECT   12   13   15   61
CONECT   13   14   62   63
CONECT   14   64
CONECT   15   16   17   65
CONECT   16   66
CONECT   17   18   19   67
CONECT   18   68
CONECT   19   20   69
CONECT   20   70
CONECT   21   22   26   71
CONECT   22   23   72   73
CONECT   23   24   74   75
CONECT   24   25   26   44
CONECT   25   76   77   78
CONECT   26   27   79
CONECT   27   28   29   80
CONECT   28   81
CONECT   29   30   82   83
CONECT   30   31   44   84
CONECT   31   32   33   40
CONECT   32   85   86   87
CONECT   33   34   88   89
CONECT   34   35   90   91
CONECT   35   36   37   92
CONECT   36   93
CONECT   37   38   39   40
CONECT   38   94   95   96
CONECT   39   97   98   99
CONECT   40   41   41
CONECT   41   42  100
CONECT   42   43   44  101
CONECT   43  102
CONECT   44   45
CONECT   45  103  104  105
END
Download

SMILES for HMDB0039446 (Ginsenoside Rh7)

CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C21C
Download

INCHI for HMDB0039446 (Ginsenoside Rh7)

InChI=1S/C36H60O9/c1-19(2)10-9-13-35(7,45-31-30(43)29(42)28(41)22(18-37)44-31)20-11-15-34(6)27(20)21(38)16-24-33(5)14-12-25(39)32(3,4)23(33)17-26(40)36(24,34)8/h10,17,20-22,24-31,37-43H,9,11-16,18H2,1-8H3
Download
View in JSmolView Stereo Labels
Synonyms
ValueSource
(+)-Ginsenoside RH7HMDB
Chemical FormulaC36H60O9
Average Molecular Weight636.8562
Monoisotopic Molecular Weight636.423733518
IUPAC Name2-(hydroxymethyl)-6-[(6-methyl-2-{5,9,16-trihydroxy-2,6,6,10,11-pentamethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-7-en-14-yl}hept-5-en-2-yl)oxy]oxane-3,4,5-triol
Traditional Name2-(hydroxymethyl)-6-[(6-methyl-2-{5,9,16-trihydroxy-2,6,6,10,11-pentamethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-7-en-14-yl}hept-5-en-2-yl)oxy]oxane-3,4,5-triol
CAS Registry Number343780-68-7
SMILES
CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C21C
InChI Identifier
InChI=1S/C36H60O9/c1-19(2)10-9-13-35(7,45-31-30(43)29(42)28(41)22(18-37)44-31)20-11-15-34(6)27(20)21(38)16-24-33(5)14-12-25(39)32(3,4)23(33)17-26(40)36(24,34)8/h10,17,20-22,24-31,37-43H,9,11-16,18H2,1-8H3
InChI KeyARPGURKWJGBPTN-UHFFFAOYSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units.
KingdomOrganic compounds
Super ClassLipids and lipid-like molecules
ClassPrenol lipids
Sub ClassTriterpenoids
Direct ParentTriterpenoids
Alternative Parents
Substituents
  • Triterpenoid
  • 3-hydroxy-delta-5-steroid
  • 3-hydroxysteroid
  • 12-hydroxysteroid
  • Hydroxysteroid
  • 7-hydroxysteroid
  • Delta-5-steroid
  • Steroid
  • Fatty acyl glycoside
  • Fatty acyl glycoside of mono- or disaccharide
  • Alkyl glycoside
  • Glycosyl compound
  • O-glycosyl compound
  • Monosaccharide
  • Fatty acyl
  • Oxane
  • Cyclic alcohol
  • Secondary alcohol
  • Oxacycle
  • Organoheterocyclic compound
  • Polyol
  • Acetal
  • Hydrocarbon derivative
  • Primary alcohol
  • Organic oxygen compound
  • Alcohol
  • Organooxygen compound
  • Aliphatic heteropolycyclic compound
Molecular FrameworkAliphatic heteropolycyclic compounds
External DescriptorsNot Available
Ontology
Physiological effectNot Available
Disposition
Biological locationRoute of exposureSource
Process
Naturally occurring process
Role
Biological roleIndustrial application
Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water SolubilityNot AvailableNot Available
LogPNot AvailableNot Available
Experimental Chromatographic PropertiesNot Available
Predicted Molecular Properties
PropertyValueSource
Water Solubility0.081 g/LALOGPS
logP2.58ALOGPS
logP2.28ChemAxon
logS-3.9ALOGPS
pKa (Strongest Acidic)12.21ChemAxon
pKa (Strongest Basic)-0.36ChemAxon
Physiological Charge0ChemAxon
Hydrogen Acceptor Count9ChemAxon
Hydrogen Donor Count7ChemAxon
Polar Surface Area160.07 ŲChemAxon
Rotatable Bond Count7ChemAxon
Refractivity171.86 m³·mol⁻¹ChemAxon
Polarizability72.56 ųChemAxon
Number of Rings5ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleYesChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DarkChem[M+H]+245.95331661259
DarkChem[M-H]-236.41331661259
DeepCCS[M-2H]-277.72830932474
DeepCCS[M+Na]+252.8330932474
AllCCS[M+H]+245.332859911
AllCCS[M+H-H2O]+244.532859911
AllCCS[M+NH4]+246.132859911
AllCCS[M+Na]+246.332859911
AllCCS[M-H]-230.632859911
AllCCS[M+Na-2H]-235.132859911
AllCCS[M+HCOO]-240.132859911

Predicted Retention Times

Underivatized

Chromatographic MethodRetention TimeReference
Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022.7.48 minutes32390414
Predicted by Siyang on May 30, 202213.9846 minutes33406817
Predicted by Siyang using ReTip algorithm on June 8, 20223.49 minutes32390414
AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid96.7 seconds40023050
Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid3564.2 seconds40023050
Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid150.2 seconds40023050
Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid207.8 seconds40023050
Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid169.6 seconds40023050
RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid152.8 seconds40023050
Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid597.6 seconds40023050
BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid619.8 seconds40023050
HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate)142.8 seconds40023050
UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid1046.2 seconds40023050
BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid615.5 seconds40023050
UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid1473.4 seconds40023050
SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid392.6 seconds40023050
RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid428.2 seconds40023050
MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate243.3 seconds40023050
KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA184.6 seconds40023050
Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water8.5 seconds40023050

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
Ginsenoside Rh7CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C21C3368.4Standard polar33892256
Ginsenoside Rh7CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C21C4246.3Standard non polar33892256
Ginsenoside Rh7CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C21C4908.9Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
Ginsenoside Rh7,1TMS,isomer #1CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C4980.4Semi standard non polar33892256
Ginsenoside Rh7,1TMS,isomer #2CC(C)=CCCC(C)(OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C4999.8Semi standard non polar33892256
Ginsenoside Rh7,1TMS,isomer #3CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C4999.7Semi standard non polar33892256
Ginsenoside Rh7,1TMS,isomer #4CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C4986.7Semi standard non polar33892256
Ginsenoside Rh7,1TMS,isomer #5CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C4950.3Semi standard non polar33892256
Ginsenoside Rh7,1TMS,isomer #6CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3=CC(O)C12C4963.6Semi standard non polar33892256
Ginsenoside Rh7,1TMS,isomer #7CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O[Si](C)(C)C)C12C4970.5Semi standard non polar33892256
Ginsenoside Rh7,2TMS,isomer #1CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C4913.2Semi standard non polar33892256
Ginsenoside Rh7,2TMS,isomer #10CC(C)=CCCC(C)(OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3=CC(O)C12C4865.4Semi standard non polar33892256
Ginsenoside Rh7,2TMS,isomer #11CC(C)=CCCC(C)(OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O[Si](C)(C)C)C12C4864.7Semi standard non polar33892256
Ginsenoside Rh7,2TMS,isomer #12CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C4951.6Semi standard non polar33892256
Ginsenoside Rh7,2TMS,isomer #13CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C4847.5Semi standard non polar33892256
Ginsenoside Rh7,2TMS,isomer #14CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3=CC(O)C12C4851.0Semi standard non polar33892256
Ginsenoside Rh7,2TMS,isomer #15CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O[Si](C)(C)C)C12C4848.4Semi standard non polar33892256
Ginsenoside Rh7,2TMS,isomer #16CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C4830.9Semi standard non polar33892256
Ginsenoside Rh7,2TMS,isomer #17CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3=CC(O)C12C4835.8Semi standard non polar33892256
Ginsenoside Rh7,2TMS,isomer #18CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O[Si](C)(C)C)C12C4839.0Semi standard non polar33892256
Ginsenoside Rh7,2TMS,isomer #19CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3=CC(O)C12C4795.1Semi standard non polar33892256
Ginsenoside Rh7,2TMS,isomer #2CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C4922.0Semi standard non polar33892256
Ginsenoside Rh7,2TMS,isomer #20CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3=CC(O[Si](C)(C)C)C12C4822.8Semi standard non polar33892256
Ginsenoside Rh7,2TMS,isomer #21CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3=CC(O[Si](C)(C)C)C12C4824.9Semi standard non polar33892256
Ginsenoside Rh7,2TMS,isomer #3CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C4900.1Semi standard non polar33892256
Ginsenoside Rh7,2TMS,isomer #4CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C4845.8Semi standard non polar33892256
Ginsenoside Rh7,2TMS,isomer #5CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3=CC(O)C12C4851.7Semi standard non polar33892256
Ginsenoside Rh7,2TMS,isomer #6CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O[Si](C)(C)C)C12C4860.9Semi standard non polar33892256
Ginsenoside Rh7,2TMS,isomer #7CC(C)=CCCC(C)(OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C4940.4Semi standard non polar33892256
Ginsenoside Rh7,2TMS,isomer #8CC(C)=CCCC(C)(OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C4928.6Semi standard non polar33892256
Ginsenoside Rh7,2TMS,isomer #9CC(C)=CCCC(C)(OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C4856.7Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #1CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C4864.7Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #10CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C4713.3Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #11CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3=CC(O)C12C4720.2Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #12CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O[Si](C)(C)C)C12C4719.9Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #13CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3=CC(O)C12C4661.3Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #14CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3=CC(O[Si](C)(C)C)C12C4697.0Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #15CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3=CC(O[Si](C)(C)C)C12C4681.4Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #16CC(C)=CCCC(C)(OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C4862.1Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #17CC(C)=CCCC(C)(OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C4740.9Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #18CC(C)=CCCC(C)(OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3=CC(O)C12C4750.2Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #19CC(C)=CCCC(C)(OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O[Si](C)(C)C)C12C4741.6Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #2CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C4832.8Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #20CC(C)=CCCC(C)(OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C4731.3Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #21CC(C)=CCCC(C)(OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3=CC(O)C12C4741.7Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #22CC(C)=CCCC(C)(OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O[Si](C)(C)C)C12C4733.2Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #23CC(C)=CCCC(C)(OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3=CC(O)C12C4659.3Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #24CC(C)=CCCC(C)(OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3=CC(O[Si](C)(C)C)C12C4689.7Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #25CC(C)=CCCC(C)(OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3=CC(O[Si](C)(C)C)C12C4678.7Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #26CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C4746.0Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #27CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3=CC(O)C12C4755.8Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #28CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O[Si](C)(C)C)C12C4751.3Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #29CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3=CC(O)C12C4637.7Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #3CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C4735.9Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #30CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3=CC(O[Si](C)(C)C)C12C4659.8Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #31CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3=CC(O[Si](C)(C)C)C12C4652.9Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #32CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3=CC(O)C12C4631.1Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #33CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3=CC(O[Si](C)(C)C)C12C4664.6Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #34CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3=CC(O[Si](C)(C)C)C12C4650.0Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #35CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3=CC(O[Si](C)(C)C)C12C4648.1Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #4CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3=CC(O)C12C4742.5Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #5CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O[Si](C)(C)C)C12C4740.2Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #6CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C4854.0Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #7CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O)C1CCC2(C)C1C(O[Si](C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C4733.7Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #8CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C)C(C)(C)C3=CC(O)C12C4737.8Semi standard non polar33892256
Ginsenoside Rh7,3TMS,isomer #9CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O[Si](C)(C)C)C12C4728.5Semi standard non polar33892256
Ginsenoside Rh7,1TBDMS,isomer #1CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C5191.4Semi standard non polar33892256
Ginsenoside Rh7,1TBDMS,isomer #2CC(C)=CCCC(C)(OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C5241.0Semi standard non polar33892256
Ginsenoside Rh7,1TBDMS,isomer #3CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C5236.3Semi standard non polar33892256
Ginsenoside Rh7,1TBDMS,isomer #4CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C5228.7Semi standard non polar33892256
Ginsenoside Rh7,1TBDMS,isomer #5CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O)C1CCC2(C)C1C(O[Si](C)(C)C(C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C5177.6Semi standard non polar33892256
Ginsenoside Rh7,1TBDMS,isomer #6CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C3=CC(O)C12C5187.9Semi standard non polar33892256
Ginsenoside Rh7,1TBDMS,isomer #7CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O[Si](C)(C)C(C)(C)C)C12C5197.6Semi standard non polar33892256
Ginsenoside Rh7,2TBDMS,isomer #1CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C5368.4Semi standard non polar33892256
Ginsenoside Rh7,2TBDMS,isomer #10CC(C)=CCCC(C)(OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C3=CC(O)C12C5321.8Semi standard non polar33892256
Ginsenoside Rh7,2TBDMS,isomer #11CC(C)=CCCC(C)(OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O[Si](C)(C)C(C)(C)C)C12C5332.4Semi standard non polar33892256
Ginsenoside Rh7,2TBDMS,isomer #12CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C5421.1Semi standard non polar33892256
Ginsenoside Rh7,2TBDMS,isomer #13CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)C1CCC2(C)C1C(O[Si](C)(C)C(C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C5310.9Semi standard non polar33892256
Ginsenoside Rh7,2TBDMS,isomer #14CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C3=CC(O)C12C5308.8Semi standard non polar33892256
Ginsenoside Rh7,2TBDMS,isomer #15CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O[Si](C)(C)C(C)(C)C)C12C5308.4Semi standard non polar33892256
Ginsenoside Rh7,2TBDMS,isomer #16CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)C1CCC2(C)C1C(O[Si](C)(C)C(C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C5301.2Semi standard non polar33892256
Ginsenoside Rh7,2TBDMS,isomer #17CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C3=CC(O)C12C5302.5Semi standard non polar33892256
Ginsenoside Rh7,2TBDMS,isomer #18CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O[Si](C)(C)C(C)(C)C)C12C5315.2Semi standard non polar33892256
Ginsenoside Rh7,2TBDMS,isomer #19CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O)C1CCC2(C)C1C(O[Si](C)(C)C(C)(C)C)CC1C3(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C3=CC(O)C12C5239.8Semi standard non polar33892256
Ginsenoside Rh7,2TBDMS,isomer #2CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C5376.7Semi standard non polar33892256
Ginsenoside Rh7,2TBDMS,isomer #20CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O)C1CCC2(C)C1C(O[Si](C)(C)C(C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3=CC(O[Si](C)(C)C(C)(C)C)C12C5279.1Semi standard non polar33892256
Ginsenoside Rh7,2TBDMS,isomer #21CC(C)=CCCC(C)(OC1OC(CO)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C3=CC(O[Si](C)(C)C(C)(C)C)C12C5273.6Semi standard non polar33892256
Ginsenoside Rh7,2TBDMS,isomer #3CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C5361.4Semi standard non polar33892256
Ginsenoside Rh7,2TBDMS,isomer #4CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O)C1CCC2(C)C1C(O[Si](C)(C)C(C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C5287.4Semi standard non polar33892256
Ginsenoside Rh7,2TBDMS,isomer #5CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O[Si](C)(C)C(C)(C)C)C(C)(C)C3=CC(O)C12C5292.3Semi standard non polar33892256
Ginsenoside Rh7,2TBDMS,isomer #6CC(C)=CCCC(C)(OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O[Si](C)(C)C(C)(C)C)C12C5305.8Semi standard non polar33892256
Ginsenoside Rh7,2TBDMS,isomer #7CC(C)=CCCC(C)(OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C5412.1Semi standard non polar33892256
Ginsenoside Rh7,2TBDMS,isomer #8CC(C)=CCCC(C)(OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C)C1CCC2(C)C1C(O)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C5402.5Semi standard non polar33892256
Ginsenoside Rh7,2TBDMS,isomer #9CC(C)=CCCC(C)(OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)C1CCC2(C)C1C(O[Si](C)(C)C(C)(C)C)CC1C3(C)CCC(O)C(C)(C)C3=CC(O)C12C5317.9Semi standard non polar33892256
Spectra

GC-MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh7 GC-MS (Non-derivatized) - 70eV, Positivesplash10-01bd-3323129000-a6a08c661391e10558792017-09-01Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh7 GC-MS (TMS_1_1) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh7 GC-MS (TMS_1_2) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh7 GC-MS (TMS_1_3) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh7 GC-MS (TMS_1_4) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh7 GC-MS (TMS_1_5) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh7 GC-MS (TMS_1_6) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh7 GC-MS (TMS_1_7) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh7 GC-MS (TMS_2_1) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh7 GC-MS (TMS_2_2) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh7 GC-MS (TMS_2_3) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh7 GC-MS (TMS_2_4) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh7 GC-MS (TMS_2_5) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh7 GC-MS (TMS_2_6) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh7 GC-MS (TMS_2_7) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh7 GC-MS (TMS_2_8) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh7 GC-MS (TMS_2_9) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh7 GC-MS (TMS_2_10) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh7 GC-MS (TMS_2_11) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh7 GC-MS (TMS_2_12) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh7 GC-MS (TMS_2_13) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh7 GC-MS (TMS_2_14) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh7 GC-MS (TMS_2_15) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh7 GC-MS (TMS_2_16) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ginsenoside Rh7 GC-MS (TMS_2_17) - 70eV, PositiveNot Available2021-10-17Wishart LabView Spectrum

MS/MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh7 10V, Positive-QTOFsplash10-0ldr-0000709000-208f1a11421fe606ac722015-04-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh7 20V, Positive-QTOFsplash10-0a4i-0100901000-37808aa8ab256e1193062015-04-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh7 40V, Positive-QTOFsplash10-0aor-3310900000-f2b4f511f6aad0f8579d2015-04-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh7 10V, Negative-QTOFsplash10-05n0-1100729000-2429316e1477e362fbac2015-04-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh7 20V, Negative-QTOFsplash10-0ab9-1100911000-0cfa678f4c957de3da4b2015-04-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh7 40V, Negative-QTOFsplash10-0ab9-3001900000-9bc650e27150291ef6bf2015-04-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh7 10V, Positive-QTOFsplash10-052r-0202911000-170350d544e6a57d7efe2021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh7 20V, Positive-QTOFsplash10-0ap0-3931644000-31e52865507952c831092021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh7 40V, Positive-QTOFsplash10-0002-9706300000-0473ea69391bbc860ab72021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh7 10V, Negative-QTOFsplash10-000i-0000009000-24c464415be0e799b9dc2021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh7 20V, Negative-QTOFsplash10-000i-2100129000-d407a3cbbcc942a35e122021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ginsenoside Rh7 40V, Negative-QTOFsplash10-0ab9-9202501000-8cf382d859c2a883501e2021-09-22Wishart LabView Spectrum
Biological Properties
Cellular Locations
  • Extracellular
  • Membrane
Biospecimen LocationsNot Available
Tissue LocationsNot Available
Pathways
Normal Concentrations
Not Available
Abnormal Concentrations
Not Available
Associated Disorders and Diseases
Disease ReferencesNone
Associated OMIM IDsNone
DrugBank IDNot Available
Phenol Explorer Compound IDNot Available
FooDB IDFDB019045
KNApSAcK IDC00032993
Chemspider IDNot Available
KEGG Compound IDNot Available
BioCyc IDNot Available
BiGG IDNot Available
Wikipedia LinkNot Available
METLIN IDNot Available
PubChem Compound85193319
PDB IDNot Available
ChEBI IDNot Available
Food Biomarker OntologyNot Available
VMH IDNot Available
MarkerDB IDNot Available
Good Scents IDNot Available
References
Synthesis ReferenceNot Available
Material Safety Data Sheet (MSDS)Not Available
General References
  1. Simons K, Toomre D: Lipid rafts and signal transduction. Nat Rev Mol Cell Biol. 2000 Oct;1(1):31-9. [PubMed:11413487 ]
  2. Watson AD: Thematic review series: systems biology approaches to metabolic and cardiovascular disorders. Lipidomics: a global approach to lipid analysis in biological systems. J Lipid Res. 2006 Oct;47(10):2101-11. Epub 2006 Aug 10. [PubMed:16902246 ]
  3. Sethi JK, Vidal-Puig AJ: Thematic review series: adipocyte biology. Adipose tissue function and plasticity orchestrate nutritional adaptation. J Lipid Res. 2007 Jun;48(6):1253-62. Epub 2007 Mar 20. [PubMed:17374880 ]
  4. Lingwood D, Simons K: Lipid rafts as a membrane-organizing principle. Science. 2010 Jan 1;327(5961):46-50. doi: 10.1126/science.1174621. [PubMed:20044567 ]
  5. (). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .
  6. Gunstone, Frank D., John L. Harwood, and Albert J. Dijkstra (2007). The lipid handbook with CD-ROM. CRC Press.