Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-12 03:10:39 UTC

Update Date

2022-03-07 02:57:02 UTC

HMDB ID

HMDB0041487

Secondary Accession Numbers

HMDB41487

Metabolite Identification

Common Name

D-Pinitol 2-O-alpha-D-Galactopyranosyl

Description

D-Pinitol 2-O-alpha-D-Galactopyranosyl belongs to the class of organic compounds known as o-glycosyl compounds. These are glycoside in which a sugar group is bonded through one carbon to another group via a O-glycosidic bond. D-Pinitol 2-O-alpha-D-Galactopyranosyl has been detected, but not quantified in, pulses. This could make D-pinitol 2-O-alpha-D-galactopyranosyl a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on D-Pinitol 2-O-alpha-D-Galactopyranosyl.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI

HMDB0041487
     RDKit          3D
D-Pinitol 2-O-alpha-D-Galactopyranosyl
 48 49  0  0  0  0  0  0  0  0999 V2000
    1.8156    0.8058   -3.0352 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8633    1.2493   -1.7414 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3180    0.4079   -0.7992 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5700    0.8272   -0.0807 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3410    1.7421    0.9201 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1498   -0.4329    0.5670 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7223   -0.1296    1.8123 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1079   -1.4993    0.7271 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5500   -2.3317    1.7815 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7655   -0.9860    1.1418 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8922   -0.4353    2.4192 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2149    0.0625    0.1704 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1945   -0.5570   -0.5103 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0674   -0.0242   -0.2903 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8923   -0.9292    0.3824 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8251   -0.1987    1.1188 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9562   -1.0422    1.6260 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8403   -0.2703    2.3423 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3778    0.9516    0.3063 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7423    1.0328    0.5663 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2240    0.6890   -1.1780 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0726   -0.2985   -1.6188 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7783    0.4318   -1.5299 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1806    1.5760   -2.0697 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7781    0.5036   -3.4647 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3015    1.5617   -3.6636 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1618   -0.0976   -3.0577 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5829   -0.5678   -1.3071 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3004    1.1479   -0.8363 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7465    2.4769    0.6080 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9713   -0.8590   -0.0472 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6618   -0.8933    2.4402 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0627   -2.1846   -0.1620 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3819   -3.2787    1.5999 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0894   -1.8555    1.2448 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0208   -0.0876    2.7491 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8495    0.9148    0.7681 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9485    0.8338    0.4187 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2930    0.2348    1.9865 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5120   -1.4087    0.7198 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6226   -1.9478    2.1542 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4090    0.3235    3.0152 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9321    1.9281    0.5805 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2924    0.9696   -0.2516 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5174    1.6309   -1.7130 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7104   -1.2187   -1.5336 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7422   -0.4155   -2.2631 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4772    1.6481   -3.0129 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  4  6  1  0
  6  7  1  0
  6  8  1  0
  8  9  1  0
  8 10  1  0
 10 11  1  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 16 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 12  3  1  0
 23 14  1  0
  1 25  1  0
  1 26  1  0
  1 27  1  0
  3 28  1  0
  4 29  1  0
  5 30  1  0
  6 31  1  0
  7 32  1  0
  8 33  1  0
  9 34  1  0
 10 35  1  0
 11 36  1  0
 12 37  1  0
 14 38  1  0
 16 39  1  0
 17 40  1  0
 17 41  1  0
 18 42  1  0
 19 43  1  0
 20 44  1  0
 21 45  1  0
 22 46  1  0
 23 47  1  0
 24 48  1  0
M  END

  Mrv0541 05061312422D          

 24 25  0  0  0  0            999 V2000
    0.0000    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  7  6  1  0  0  0  0
  8  6  1  0  0  0  0
  9  7  1  0  0  0  0
 10  5  1  0  0  0  0
 11  8  1  0  0  0  0
 12  9  1  0  0  0  0
 12 11  1  0  0  0  0
 13 10  1  0  0  0  0
 14  2  1  0  0  0  0
 15  4  1  0  0  0  0
 16  5  1  0  0  0  0
 17  6  1  0  0  0  0
 18  7  1  0  0  0  0
 19  8  1  0  0  0  0
 20  9  1  0  0  0  0
 21 10  1  0  0  0  0
 22  1  1  0  0  0  0
 22 11  1  0  0  0  0
 23  3  1  0  0  0  0
 23 13  1  0  0  0  0
 24 12  1  0  0  0  0
 24 13  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0041487

> <DATABASE_NAME>
hmdb

> <SMILES>
COC1C(O)C(O)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O

> <INCHI_IDENTIFIER>
InChI=1S/C13H24O11/c1-22-11-8(19)6(17)7(18)9(20)12(11)24-13-10(21)5(16)4(15)3(2-14)23-13/h3-21H,2H2,1H3

> <INCHI_KEY>
RSYNCMYDVZFZBP-UHFFFAOYSA-N

> <FORMULA>
C13H24O11

> <MOLECULAR_WEIGHT>
356.3231

> <EXACT_MASS>
356.13186161

> <JCHEM_ACCEPTOR_COUNT>
11

> <JCHEM_AVERAGE_POLARIZABILITY>
33.36998844024745

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
8

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
5-methoxy-6-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}cyclohexane-1,2,3,4-tetrol

> <ALOGPS_LOGP>
-2.38

> <JCHEM_LOGP>
-4.909718794

> <ALOGPS_LOGS>
0.15

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
2

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
12.54074146118181

> <JCHEM_PKA_STRONGEST_ACIDIC>
12.01454211733498

> <JCHEM_PKA_STRONGEST_BASIC>
-2.9810835653034973

> <JCHEM_POLAR_SURFACE_AREA>
189.52999999999997

> <JCHEM_REFRACTIVITY>
72.9395

> <JCHEM_ROTATABLE_BOND_COUNT>
4

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
4.98e+02 g/l

> <JCHEM_TRADITIONAL_IUPAC>
5-methoxy-6-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}cyclohexane-1,2,3,4-tetrol

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0041487
     RDKit          3D
D-Pinitol 2-O-alpha-D-Galactopyranosyl
 48 49  0  0  0  0  0  0  0  0999 V2000
    1.8156    0.8058   -3.0352 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8633    1.2493   -1.7414 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3180    0.4079   -0.7992 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5700    0.8272   -0.0807 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3410    1.7421    0.9201 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1498   -0.4329    0.5670 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7223   -0.1296    1.8123 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1079   -1.4993    0.7271 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5500   -2.3317    1.7815 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7655   -0.9860    1.1418 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8922   -0.4353    2.4192 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2149    0.0625    0.1704 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1945   -0.5570   -0.5103 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0674   -0.0242   -0.2903 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8923   -0.9292    0.3824 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8251   -0.1987    1.1188 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9562   -1.0422    1.6260 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8403   -0.2703    2.3423 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3778    0.9516    0.3063 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7423    1.0328    0.5663 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2240    0.6890   -1.1780 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0726   -0.2985   -1.6188 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7783    0.4318   -1.5299 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1806    1.5760   -2.0697 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7781    0.5036   -3.4647 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3015    1.5617   -3.6636 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1618   -0.0976   -3.0577 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5829   -0.5678   -1.3071 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3004    1.1479   -0.8363 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7465    2.4769    0.6080 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9713   -0.8590   -0.0472 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6618   -0.8933    2.4402 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0627   -2.1846   -0.1620 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3819   -3.2787    1.5999 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0894   -1.8555    1.2448 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0208   -0.0876    2.7491 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8495    0.9148    0.7681 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9485    0.8338    0.4187 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2930    0.2348    1.9865 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5120   -1.4087    0.7198 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6226   -1.9478    2.1542 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4090    0.3235    3.0152 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9321    1.9281    0.5805 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2924    0.9696   -0.2516 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5174    1.6309   -1.7130 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7104   -1.2187   -1.5336 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7422   -0.4155   -2.2631 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4772    1.6481   -3.0129 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  4  6  1  0
  6  7  1  0
  6  8  1  0
  8  9  1  0
  8 10  1  0
 10 11  1  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 16 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 12  3  1  0
 23 14  1  0
  1 25  1  0
  1 26  1  0
  1 27  1  0
  3 28  1  0
  4 29  1  0
  5 30  1  0
  6 31  1  0
  7 32  1  0
  8 33  1  0
  9 34  1  0
 10 35  1  0
 11 36  1  0
 12 37  1  0
 14 38  1  0
 16 39  1  0
 17 40  1  0
 17 41  1  0
 18 42  1  0
 19 43  1  0
 20 44  1  0
 21 45  1  0
 22 46  1  0
 23 47  1  0
 24 48  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0       0.000   4.620   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0       1.334   6.930   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       2.667   6.160   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0       4.001   6.930   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0       5.335   6.160   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0       1.334  -0.770   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0       0.000   1.540   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0       2.667   0.000   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       5.335   4.620   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       1.334   2.310   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       2.667   1.540   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       4.001   3.850   0.000  0.00  0.00           C+0
HETATM   14  O   UNK     0       1.334   8.470   0.000  0.00  0.00           O+0
HETATM   15  O   UNK     0       4.001   8.470   0.000  0.00  0.00           O+0
HETATM   16  O   UNK     0       6.668   6.930   0.000  0.00  0.00           O+0
HETATM   17  O   UNK     0      -1.334  -0.770   0.000  0.00  0.00           O+0
HETATM   18  O   UNK     0       1.334  -2.310   0.000  0.00  0.00           O+0
HETATM   19  O   UNK     0      -1.334   2.310   0.000  0.00  0.00           O+0
HETATM   20  O   UNK     0       4.001  -0.770   0.000  0.00  0.00           O+0
HETATM   21  O   UNK     0       6.668   3.850   0.000  0.00  0.00           O+0
HETATM   22  O   UNK     0       1.334   3.850   0.000  0.00  0.00           O+0
HETATM   23  O   UNK     0       2.667   4.620   0.000  0.00  0.00           O+0
HETATM   24  O   UNK     0       4.001   2.310   0.000  0.00  0.00           O+0
CONECT    1   22                                                            
CONECT    2    3   14                                                       
CONECT    3    2    4   23                                                  
CONECT    4    3    5   15                                                  
CONECT    5    4   10   16                                                  
CONECT    6    7    8   17                                                  
CONECT    7    6    9   18                                                  
CONECT    8    6   11   19                                                  
CONECT    9    7   12   20                                                  
CONECT   10    5   13   21                                                  
CONECT   11    8   12   22                                                  
CONECT   12    9   11   24                                                  
CONECT   13   10   23   24                                                  
CONECT   14    2                                                            
CONECT   15    4                                                            
CONECT   16    5                                                            
CONECT   17    6                                                            
CONECT   18    7                                                            
CONECT   19    8                                                            
CONECT   20    9                                                            
CONECT   21   10                                                            
CONECT   22    1   11                                                       
CONECT   23    3   13                                                       
CONECT   24   12   13                                                       
MASTER        0    0    0    0    0    0    0    0   24    0   50    0
END

COMPND    HMDB0041487
HETATM    1  C1  UNL     1       1.816   0.806  -3.035  1.00  0.00           C  
HETATM    2  O1  UNL     1       1.863   1.249  -1.741  1.00  0.00           O  
HETATM    3  C2  UNL     1       2.318   0.408  -0.799  1.00  0.00           C  
HETATM    4  C3  UNL     1       3.570   0.827  -0.081  1.00  0.00           C  
HETATM    5  O2  UNL     1       3.341   1.742   0.920  1.00  0.00           O  
HETATM    6  C4  UNL     1       4.150  -0.433   0.567  1.00  0.00           C  
HETATM    7  O3  UNL     1       4.722  -0.130   1.812  1.00  0.00           O  
HETATM    8  C5  UNL     1       3.108  -1.499   0.727  1.00  0.00           C  
HETATM    9  O4  UNL     1       3.550  -2.332   1.782  1.00  0.00           O  
HETATM   10  C6  UNL     1       1.766  -0.986   1.142  1.00  0.00           C  
HETATM   11  O5  UNL     1       1.892  -0.435   2.419  1.00  0.00           O  
HETATM   12  C7  UNL     1       1.215   0.063   0.170  1.00  0.00           C  
HETATM   13  O6  UNL     1       0.195  -0.557  -0.510  1.00  0.00           O  
HETATM   14  C8  UNL     1      -1.067  -0.024  -0.290  1.00  0.00           C  
HETATM   15  O7  UNL     1      -1.892  -0.929   0.382  1.00  0.00           O  
HETATM   16  C9  UNL     1      -2.825  -0.199   1.119  1.00  0.00           C  
HETATM   17  C10 UNL     1      -3.956  -1.042   1.626  1.00  0.00           C  
HETATM   18  O8  UNL     1      -4.840  -0.270   2.342  1.00  0.00           O  
HETATM   19  C11 UNL     1      -3.378   0.952   0.306  1.00  0.00           C  
HETATM   20  O9  UNL     1      -4.742   1.033   0.566  1.00  0.00           O  
HETATM   21  C12 UNL     1      -3.224   0.689  -1.178  1.00  0.00           C  
HETATM   22  O10 UNL     1      -4.073  -0.298  -1.619  1.00  0.00           O  
HETATM   23  C13 UNL     1      -1.778   0.432  -1.530  1.00  0.00           C  
HETATM   24  O11 UNL     1      -1.181   1.576  -2.070  1.00  0.00           O  
HETATM   25  H1  UNL     1       2.778   0.504  -3.465  1.00  0.00           H  
HETATM   26  H2  UNL     1       1.301   1.562  -3.664  1.00  0.00           H  
HETATM   27  H3  UNL     1       1.162  -0.098  -3.058  1.00  0.00           H  
HETATM   28  H4  UNL     1       2.583  -0.568  -1.307  1.00  0.00           H  
HETATM   29  H5  UNL     1       4.300   1.148  -0.836  1.00  0.00           H  
HETATM   30  H6  UNL     1       2.746   2.477   0.608  1.00  0.00           H  
HETATM   31  H7  UNL     1       4.971  -0.859  -0.047  1.00  0.00           H  
HETATM   32  H8  UNL     1       4.662  -0.893   2.440  1.00  0.00           H  
HETATM   33  H9  UNL     1       3.063  -2.185  -0.162  1.00  0.00           H  
HETATM   34  H10 UNL     1       3.382  -3.279   1.600  1.00  0.00           H  
HETATM   35  H11 UNL     1       1.089  -1.855   1.245  1.00  0.00           H  
HETATM   36  H12 UNL     1       1.021  -0.088   2.749  1.00  0.00           H  
HETATM   37  H13 UNL     1       0.850   0.915   0.768  1.00  0.00           H  
HETATM   38  H14 UNL     1      -0.949   0.834   0.419  1.00  0.00           H  
HETATM   39  H15 UNL     1      -2.293   0.235   1.986  1.00  0.00           H  
HETATM   40  H16 UNL     1      -4.512  -1.409   0.720  1.00  0.00           H  
HETATM   41  H17 UNL     1      -3.623  -1.948   2.154  1.00  0.00           H  
HETATM   42  H18 UNL     1      -4.409   0.323   3.015  1.00  0.00           H  
HETATM   43  H19 UNL     1      -2.932   1.928   0.580  1.00  0.00           H  
HETATM   44  H20 UNL     1      -5.292   0.970  -0.252  1.00  0.00           H  
HETATM   45  H21 UNL     1      -3.517   1.631  -1.713  1.00  0.00           H  
HETATM   46  H22 UNL     1      -3.710  -1.219  -1.534  1.00  0.00           H  
HETATM   47  H23 UNL     1      -1.742  -0.416  -2.263  1.00  0.00           H  
HETATM   48  H24 UNL     1      -1.477   1.648  -3.013  1.00  0.00           H  
CONECT    1    2   25   26   27
CONECT    2    3
CONECT    3    4   12   28
CONECT    4    5    6   29
CONECT    5   30
CONECT    6    7    8   31
CONECT    7   32
CONECT    8    9   10   33
CONECT    9   34
CONECT   10   11   12   35
CONECT   11   36
CONECT   12   13   37
CONECT   13   14
CONECT   14   15   23   38
CONECT   15   16
CONECT   16   17   19   39
CONECT   17   18   40   41
CONECT   18   42
CONECT   19   20   21   43
CONECT   20   44
CONECT   21   22   23   45
CONECT   22   46
CONECT   23   24   47
CONECT   24   48
END

HMDB0041487
     RDKit          3D
D-Pinitol 2-O-alpha-D-Galactopyranosyl
 48 49  0  0  0  0  0  0  0  0999 V2000
    1.8156    0.8058   -3.0352 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8633    1.2493   -1.7414 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3180    0.4079   -0.7992 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5700    0.8272   -0.0807 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3410    1.7421    0.9201 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1498   -0.4329    0.5670 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7223   -0.1296    1.8123 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.1079   -1.4993    0.7271 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5500   -2.3317    1.7815 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7655   -0.9860    1.1418 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8922   -0.4353    2.4192 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2149    0.0625    0.1704 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1945   -0.5570   -0.5103 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0674   -0.0242   -0.2903 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8923   -0.9292    0.3824 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8251   -0.1987    1.1188 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9562   -1.0422    1.6260 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8403   -0.2703    2.3423 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3778    0.9516    0.3063 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7423    1.0328    0.5663 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2240    0.6890   -1.1780 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0726   -0.2985   -1.6188 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7783    0.4318   -1.5299 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1806    1.5760   -2.0697 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7781    0.5036   -3.4647 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3015    1.5617   -3.6636 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1618   -0.0976   -3.0577 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5829   -0.5678   -1.3071 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3004    1.1479   -0.8363 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7465    2.4769    0.6080 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9713   -0.8590   -0.0472 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6618   -0.8933    2.4402 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0627   -2.1846   -0.1620 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3819   -3.2787    1.5999 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0894   -1.8555    1.2448 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0208   -0.0876    2.7491 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8495    0.9148    0.7681 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9485    0.8338    0.4187 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2930    0.2348    1.9865 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5120   -1.4087    0.7198 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6226   -1.9478    2.1542 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4090    0.3235    3.0152 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9321    1.9281    0.5805 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2924    0.9696   -0.2516 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5174    1.6309   -1.7130 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7104   -1.2187   -1.5336 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7422   -0.4155   -2.2631 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4772    1.6481   -3.0129 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  4  6  1  0
  6  7  1  0
  6  8  1  0
  8  9  1  0
  8 10  1  0
 10 11  1  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 16 19  1  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 12  3  1  0
 23 14  1  0
  1 25  1  0
  1 26  1  0
  1 27  1  0
  3 28  1  0
  4 29  1  0
  5 30  1  0
  6 31  1  0
  7 32  1  0
  8 33  1  0
  9 34  1  0
 10 35  1  0
 11 36  1  0
 12 37  1  0
 14 38  1  0
 16 39  1  0
 17 40  1  0
 17 41  1  0
 18 42  1  0
 19 43  1  0
 20 44  1  0
 21 45  1  0
 22 46  1  0
 23 47  1  0
 24 48  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
D-Pinitol 2-O-a-D-galactopyranosyl	Generator
D-Pinitol 2-O-α-D-galactopyranosyl	Generator
2-O-a-D-Galactopyranosyl-3-O-methyl-D-chiro-inositol	HMDB
2-Propane sulfonic acid, sodium salt	HMDB
2-Propanesulfonic acid, sodium salt	HMDB
2-Propanesulfonic acid, sodium salt (1:1)	HMDB
Sodium isopropyl sulfate	HMDB
Sodium isopropyl sulphate	HMDB
Sodium propane-2-sulphonate	HMDB

Chemical Formula

C₁₃H₂₄O₁₁

Average Molecular Weight

356.3231

Monoisotopic Molecular Weight

356.13186161

IUPAC Name

5-methoxy-6-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}cyclohexane-1,2,3,4-tetrol

Traditional Name

5-methoxy-6-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}cyclohexane-1,2,3,4-tetrol

CAS Registry Number

79391-03-0

SMILES

COC1C(O)C(O)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O

InChI Identifier

InChI=1S/C13H24O11/c1-22-11-8(19)6(17)7(18)9(20)12(11)24-13-10(21)5(16)4(15)3(2-14)23-13/h3-21H,2H2,1H3

InChI Key

RSYNCMYDVZFZBP-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as o-glycosyl compounds. These are glycoside in which a sugar group is bonded through one carbon to another group via a O-glycosidic bond.

Kingdom

Organic compounds

Super Class

Organic oxygen compounds

Class

Organooxygen compounds

Sub Class

Carbohydrates and carbohydrate conjugates

Direct Parent

O-glycosyl compounds

Alternative Parents

Substituents

Hexose monosaccharide
O-glycosyl compound
Cyclohexanol
Cyclitol or derivatives
Monosaccharide
Oxane
Cyclic alcohol
Secondary alcohol
Organoheterocyclic compound
Ether
Dialkyl ether
Oxacycle
Acetal
Polyol
Primary alcohol
Hydrocarbon derivative
Alcohol
Aliphatic heteromonocyclic compound

Molecular Framework

Aliphatic heteromonocyclic compounds

External Descriptors

a methylated inositol (CPD-8058 )
a galactosyl inositol (CPD-8058 )

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0041487)
Cytoplasm (HMDB: HMDB0041487)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0041487)

Source

Exogenous

Exogenous (HMDB: HMDB0041487)

Food

Food (HMDB: HMDB0041487)

Pulse

Pulses (FooDB: FOOD00867)

Endogenous

Plant

Fabaceae (HMDB: HMDB0041487)

Process

Not Available

Role

Biological role

Nutrient (HMDB: HMDB0041487)

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	498 g/L	ALOGPS
logP	-2.4	ALOGPS
logP	-4.9	ChemAxon
logS	0.15	ALOGPS
pKa (Strongest Acidic)	12.01	ChemAxon
pKa (Strongest Basic)	-3	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	11	ChemAxon
Hydrogen Donor Count	8	ChemAxon
Polar Surface Area	189.53 Å²	ChemAxon
Rotatable Bond Count	4	ChemAxon
Refractivity	72.94 m³·mol⁻¹	ChemAxon
Polarizability	33.37 Å³	ChemAxon
Number of Rings	2	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DarkChem	[M+H]+	179.433	31661259
DarkChem	[M-H]-	174.865	31661259
DeepCCS	[M+H]+	178.766	30932474
DeepCCS	[M-H]-	176.408	30932474
DeepCCS	[M-2H]-	210.186	30932474
DeepCCS	[M+Na]+	185.412	30932474
AllCCS	[M+H]+	182.1	32859911
AllCCS	[M+H-H2O]+	179.4	32859911
AllCCS	[M+NH4]+	184.7	32859911
AllCCS	[M+Na]+	185.4	32859911
AllCCS	[M-H]-	179.3	32859911
AllCCS	[M+Na-2H]-	179.0	32859911
AllCCS	[M+HCOO]-	178.7	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
D-Pinitol 2-O-alpha-D-Galactopyranosyl	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O	4727.9	Standard polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O	3526.5	Standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O	3036.4	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
D-Pinitol 2-O-alpha-D-Galactopyranosyl,1TMS,isomer #1	COC1C(OC2OC(CO)C(O)C(O)C2O)C(O)C(O)C(O)C1O[Si](C)(C)C	3041.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,1TMS,isomer #2	COC1C(O)C(O[Si](C)(C)C)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O	3030.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,1TMS,isomer #3	COC1C(O)C(O)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	3038.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,1TMS,isomer #4	COC1C(O)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	3029.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,1TMS,isomer #5	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	3002.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,1TMS,isomer #6	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	3048.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,1TMS,isomer #7	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	3030.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,1TMS,isomer #8	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	3046.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #1	COC1C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O)C(O)C(O)C1O[Si](C)(C)C	2999.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #10	COC1C(O)C(O[Si](C)(C)C)C(O)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	2993.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #11	COC1C(O)C(O[Si](C)(C)C)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	3016.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #12	COC1C(O)C(O[Si](C)(C)C)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	2986.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #13	COC1C(O)C(O[Si](C)(C)C)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	3017.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #14	COC1C(O)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	3030.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #15	COC1C(O)C(O)C(O[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	2994.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #16	COC1C(O)C(O)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	3020.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #17	COC1C(O)C(O)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	2991.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #18	COC1C(O)C(O)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	3021.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #19	COC1C(O)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	2990.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #2	COC1C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O)C(O)C1O[Si](C)(C)C	3027.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #20	COC1C(O)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	3013.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #21	COC1C(O)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	2998.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #22	COC1C(O)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	3017.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #23	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3007.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #24	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	2993.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #25	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3010.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #26	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3025.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #27	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3004.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #28	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3017.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #3	COC1C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O)C(O)C1O[Si](C)(C)C	3010.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #4	COC1C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O)C(O)C1O[Si](C)(C)C	3031.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #5	COC1C(O[Si](C)(C)C)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	3025.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #6	COC1C(OC2OC(CO)C(O)C(O)C2O)C(O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3014.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #7	COC1C(OC2OC(CO)C(O)C(O)C2O)C(O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3040.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #8	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	3022.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TMS,isomer #9	COC1C(O)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	3000.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #1	COC1C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O)C(O)C1O[Si](C)(C)C	3045.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #10	COC1C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3040.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #11	COC1C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3069.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #12	COC1C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C(O)C1O[Si](C)(C)C	3048.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #13	COC1C(O[Si](C)(C)C)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	3024.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #14	COC1C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3009.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #15	COC1C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3034.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #16	COC1C(O[Si](C)(C)C)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	3056.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #17	COC1C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3044.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #18	COC1C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3070.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #19	COC1C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3034.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #2	COC1C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O)C(O)C1O[Si](C)(C)C	3015.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #20	COC1C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	3038.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #21	COC1C(OC2OC(CO)C(O)C(O)C2O)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3056.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #22	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	3043.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #23	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	3006.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #24	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	3043.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #25	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	3016.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #26	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	3047.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #27	COC1C(O)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	2989.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #28	COC1C(O)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	3026.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #29	COC1C(O)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	3002.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #3	COC1C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O)C(O)C1O[Si](C)(C)C	3042.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #30	COC1C(O)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	3027.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #31	COC1C(O)C(O[Si](C)(C)C)C(O)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3041.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #32	COC1C(O)C(O[Si](C)(C)C)C(O)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3006.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #33	COC1C(O)C(O[Si](C)(C)C)C(O)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3041.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #34	COC1C(O)C(O[Si](C)(C)C)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3039.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #35	COC1C(O)C(O[Si](C)(C)C)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3033.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #36	COC1C(O)C(O[Si](C)(C)C)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3035.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #37	COC1C(O)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	3025.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #38	COC1C(O)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	3059.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #39	COC1C(O)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	3023.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #4	COC1C(O[Si](C)(C)C)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	3026.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #40	COC1C(O)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	3057.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #41	COC1C(O)C(O)C(O[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3038.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #42	COC1C(O)C(O)C(O[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3005.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #43	COC1C(O)C(O)C(O[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3037.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #44	COC1C(O)C(O)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3039.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #45	COC1C(O)C(O)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3032.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #46	COC1C(O)C(O)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3036.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #47	COC1C(O)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	3032.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #48	COC1C(O)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	3000.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #49	COC1C(O)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	3028.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #5	COC1C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3007.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #50	COC1C(O)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3037.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #51	COC1C(O)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3020.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #52	COC1C(O)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3030.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #53	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3031.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #54	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	3025.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #55	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3021.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #56	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3043.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #6	COC1C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3040.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #7	COC1C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C(O)C1O[Si](C)(C)C	3051.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #8	COC1C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C(O)C1O[Si](C)(C)C	3038.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TMS,isomer #9	COC1C(O[Si](C)(C)C)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	3057.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #1	COC1C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C(O)C1O[Si](C)(C)C	2910.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #10	COC1C(O[Si](C)(C)C)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	2980.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #11	COC1C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2935.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #12	COC1C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2990.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #13	COC1C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2914.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #14	COC1C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	2916.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #15	COC1C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2961.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #16	COC1C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C(O)C1O[Si](C)(C)C	3010.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #17	COC1C(O[Si](C)(C)C)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3035.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #18	COC1C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2991.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #19	COC1C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3045.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #2	COC1C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C(O)C1O[Si](C)(C)C	2912.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #20	COC1C(O[Si](C)(C)C)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2992.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #21	COC1C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2951.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #22	COC1C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3004.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #23	COC1C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3004.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #24	COC1C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	3009.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #25	COC1C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3057.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #26	COC1C(O[Si](C)(C)C)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2993.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #27	COC1C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2953.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #28	COC1C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3006.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #29	COC1C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2923.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #3	COC1C(O[Si](C)(C)C)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	2996.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #30	COC1C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	2928.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #31	COC1C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2981.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #32	COC1C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2967.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #33	COC1C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	2973.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #34	COC1C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3027.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #35	COC1C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3036.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #36	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	2957.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #37	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	3050.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #38	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	2987.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #39	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	3027.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #4	COC1C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2952.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #40	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	2983.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #41	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	2921.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #42	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	2964.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #43	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3017.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #44	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2991.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #45	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2982.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #46	COC1C(O)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	2954.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #47	COC1C(O)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	2899.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #48	COC1C(O)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	2934.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #49	COC1C(O)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	2989.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #5	COC1C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3007.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #50	COC1C(O)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2958.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #51	COC1C(O)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2952.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #52	COC1C(O)C(O[Si](C)(C)C)C(O)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	2918.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #53	COC1C(O)C(O[Si](C)(C)C)C(O)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2918.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #54	COC1C(O)C(O[Si](C)(C)C)C(O)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2890.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #55	COC1C(O)C(O[Si](C)(C)C)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3010.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #56	COC1C(O)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	2987.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #57	COC1C(O)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	2915.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #58	COC1C(O)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	2969.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #59	COC1C(O)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	3030.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #6	COC1C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C(O)C1O[Si](C)(C)C	2888.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #60	COC1C(O)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2988.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #61	COC1C(O)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2989.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #62	COC1C(O)C(O)C(O[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	2906.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #63	COC1C(O)C(O)C(O[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2906.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #64	COC1C(O)C(O)C(O[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2879.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #65	COC1C(O)C(O)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3002.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #66	COC1C(O)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	2903.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #67	COC1C(O)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2903.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #68	COC1C(O)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2876.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #69	COC1C(O)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	3000.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #7	COC1C(O[Si](C)(C)C)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	2918.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #70	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2906.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #8	COC1C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2892.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TMS,isomer #9	COC1C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2929.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #1	COC1C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C(O)C1O[Si](C)(C)C	2782.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #10	COC1C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2796.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #11	COC1C(O[Si](C)(C)C)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2747.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #12	COC1C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2706.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #13	COC1C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2762.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #14	COC1C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2729.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #15	COC1C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	2712.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #16	COC1C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2729.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #17	COC1C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2776.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #18	COC1C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	2759.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #19	COC1C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2772.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #2	COC1C(O[Si](C)(C)C)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	2769.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #20	COC1C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2817.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #21	COC1C(O[Si](C)(C)C)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2828.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #22	COC1C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2777.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #23	COC1C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2842.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #24	COC1C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2791.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #25	COC1C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	2781.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #26	COC1C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2802.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #27	COC1C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2783.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #28	COC1C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2776.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #29	COC1C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2789.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #3	COC1C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2727.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #30	COC1C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2896.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #31	COC1C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2767.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #32	COC1C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2757.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #33	COC1C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2772.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #34	COC1C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2800.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #35	COC1C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2846.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #36	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	2808.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #37	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	2743.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #38	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	2783.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #39	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	2814.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #4	COC1C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2784.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #40	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2806.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #41	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2786.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #42	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	2761.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #43	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2755.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #44	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2729.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #45	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2790.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #46	COC1C(O)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	2755.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #47	COC1C(O)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2752.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #48	COC1C(O)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2728.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #49	COC1C(O)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2791.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #5	COC1C(O[Si](C)(C)C)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2765.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #50	COC1C(O)C(O[Si](C)(C)C)C(O)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2797.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #51	COC1C(O)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	2780.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #52	COC1C(O)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2777.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #53	COC1C(O)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2756.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #54	COC1C(O)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2822.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #55	COC1C(O)C(O)C(O[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2776.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #56	COC1C(O)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2785.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #6	COC1C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2728.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #7	COC1C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2783.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #8	COC1C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2797.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,5TMS,isomer #9	COC1C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	2779.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #1	COC1C(O[Si](C)(C)C)C(O)C(O)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2697.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #10	COC1C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2737.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #11	COC1C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2685.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #12	COC1C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2650.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #13	COC1C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2669.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #14	COC1C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2706.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #15	COC1C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2720.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #16	COC1C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2722.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #17	COC1C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2699.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #18	COC1C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2712.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #19	COC1C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2751.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #2	COC1C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2662.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #20	COC1C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2747.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #21	COC1C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2719.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #22	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	2707.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #23	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2695.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #24	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2680.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #25	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2735.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #26	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2704.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #27	COC1C(O)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2707.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #28	COC1C(O)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2697.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #3	COC1C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2709.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #4	COC1C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2711.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #5	COC1C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	2672.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #6	COC1C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2692.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #7	COC1C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2708.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #8	COC1C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	2669.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,6TMS,isomer #9	COC1C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2689.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,7TMS,isomer #1	COC1C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2693.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,7TMS,isomer #2	COC1C(O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2659.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,7TMS,isomer #3	COC1C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2673.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,7TMS,isomer #4	COC1C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2707.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,7TMS,isomer #5	COC1C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2700.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,7TMS,isomer #6	COC1C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2692.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,7TMS,isomer #7	COC1C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2705.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,7TMS,isomer #8	COC1C(O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	2673.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,1TBDMS,isomer #1	COC1C(OC2OC(CO)C(O)C(O)C2O)C(O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3285.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,1TBDMS,isomer #2	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O	3282.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,1TBDMS,isomer #3	COC1C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	3288.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,1TBDMS,isomer #4	COC1C(O)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	3276.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,1TBDMS,isomer #5	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	3269.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,1TBDMS,isomer #6	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3300.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,1TBDMS,isomer #7	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3293.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,1TBDMS,isomer #8	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3288.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #1	COC1C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3445.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #10	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	3440.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #11	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3475.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #12	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3455.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #13	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3465.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #14	COC1C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	3479.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #15	COC1C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	3444.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #16	COC1C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3477.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #17	COC1C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3455.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #18	COC1C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3467.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #19	COC1C(O)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	3437.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #2	COC1C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3475.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #20	COC1C(O)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3466.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #21	COC1C(O)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3442.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #22	COC1C(O)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3453.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #23	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3454.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #24	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3442.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #25	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3452.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #26	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	3461.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #27	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3445.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #28	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3453.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #3	COC1C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3446.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #4	COC1C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3465.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #5	COC1C(O[Si](C)(C)C(C)(C)C)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	3478.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #6	COC1C(OC2OC(CO)C(O)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3476.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #7	COC1C(OC2OC(CO)C(O)C(O)C2O)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3485.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #8	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	3472.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,2TBDMS,isomer #9	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	3469.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #1	COC1C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3577.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #10	COC1C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3624.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #11	COC1C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3615.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #12	COC1C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3583.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #13	COC1C(O[Si](C)(C)C(C)(C)C)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3593.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #14	COC1C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3628.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #15	COC1C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3602.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #16	COC1C(O[Si](C)(C)C(C)(C)C)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3590.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #17	COC1C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3597.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #18	COC1C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3595.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #19	COC1C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3608.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #2	COC1C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3558.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #20	COC1C(O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	3606.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #21	COC1C(OC2OC(CO)C(O)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3613.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #22	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	3616.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #23	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	3575.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #24	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3632.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #25	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3636.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #26	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3605.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #27	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	3574.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #28	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3629.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #29	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3634.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #3	COC1C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3565.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #30	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3601.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #31	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3589.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #32	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3587.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #33	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3580.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #34	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	3610.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #35	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3597.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #36	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3601.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #37	COC1C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	3572.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #38	COC1C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3613.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #39	COC1C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3603.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #4	COC1C(O[Si](C)(C)C(C)(C)C)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	3568.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #40	COC1C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3594.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #41	COC1C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3588.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #42	COC1C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3586.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #43	COC1C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3579.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #44	COC1C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	3609.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #45	COC1C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3597.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #46	COC1C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3601.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #47	COC1C(O)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3577.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #48	COC1C(O)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3559.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #49	COC1C(O)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3564.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #5	COC1C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3572.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #50	COC1C(O)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	3585.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #51	COC1C(O)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3580.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #52	COC1C(O)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3580.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #53	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	3577.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #54	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3572.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #55	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3567.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #56	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3582.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #6	COC1C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3572.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #7	COC1C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3588.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #8	COC1C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3581.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,3TBDMS,isomer #9	COC1C(O[Si](C)(C)C(C)(C)C)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3609.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #1	COC1C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3679.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #10	COC1C(O[Si](C)(C)C(C)(C)C)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3675.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #11	COC1C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3695.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #12	COC1C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3674.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #13	COC1C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3684.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #14	COC1C(O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	3674.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #15	COC1C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3678.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #16	COC1C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3684.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #17	COC1C(O[Si](C)(C)C(C)(C)C)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	3724.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #18	COC1C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3740.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #19	COC1C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3720.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #2	COC1C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3663.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #20	COC1C(O[Si](C)(C)C(C)(C)C)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3703.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #21	COC1C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3726.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #22	COC1C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3702.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #23	COC1C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3750.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #24	COC1C(O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3743.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #25	COC1C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3743.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #26	COC1C(O[Si](C)(C)C(C)(C)C)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3719.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #27	COC1C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3735.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #28	COC1C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3715.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #29	COC1C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3757.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #3	COC1C(O[Si](C)(C)C(C)(C)C)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3695.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #30	COC1C(O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3749.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #31	COC1C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3750.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #32	COC1C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3718.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #33	COC1C(O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3715.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #34	COC1C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3718.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #35	COC1C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3744.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #36	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	3689.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #37	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3753.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #38	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3761.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #39	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3725.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #4	COC1C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3714.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #40	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3723.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #41	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3730.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #42	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3704.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #43	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	3749.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #44	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3735.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #45	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3744.0	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #46	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3728.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #47	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3736.6	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #48	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3704.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #49	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	3752.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #5	COC1C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3694.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #50	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3738.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #51	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3743.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #52	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	3722.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #53	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3702.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #54	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3697.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #55	COC1C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3716.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #56	COC1C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	3697.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #57	COC1C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3697.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #58	COC1C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3675.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #59	COC1C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	3727.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #6	COC1C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	3657.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #60	COC1C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3704.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #61	COC1C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3723.7	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #62	COC1C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	3714.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #63	COC1C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3697.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #64	COC1C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3691.3	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #65	COC1C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3714.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #66	COC1C(O)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	3684.1	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #67	COC1C(O)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3663.4	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #68	COC1C(O)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3659.9	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #69	COC1C(O)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3687.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #7	COC1C(O[Si](C)(C)C(C)(C)C)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	3697.8	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #70	COC1C(O)C(O)C(O)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3681.5	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #8	COC1C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	3722.2	Semi standard non polar	33892256
D-Pinitol 2-O-alpha-D-Galactopyranosyl,4TBDMS,isomer #9	COC1C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	3694.1	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - D-Pinitol 2-O-alpha-D-Galactopyranosyl GC-MS (Non-derivatized) - 70eV, Positive	splash10-0fmr-8976000000-6fd89e44eea858a0f57e	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - D-Pinitol 2-O-alpha-D-Galactopyranosyl GC-MS (4 TMS) - 70eV, Positive	splash10-0059-1460249000-49368c7f6133c90a46ad	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - D-Pinitol 2-O-alpha-D-Galactopyranosyl GC-MS (Non-derivatized) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - D-Pinitol 2-O-alpha-D-Galactopyranosyl GC-MS (Non-derivatized) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - D-Pinitol 2-O-alpha-D-Galactopyranosyl 10V, Positive-QTOF	splash10-052b-0906000000-6b64b8d4607cfff7da49	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - D-Pinitol 2-O-alpha-D-Galactopyranosyl 20V, Positive-QTOF	splash10-002b-0900000000-818e8d9be9ec87b73e85	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - D-Pinitol 2-O-alpha-D-Galactopyranosyl 40V, Positive-QTOF	splash10-004j-2900000000-8d54bf7cf4c7af7a5fc4	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - D-Pinitol 2-O-alpha-D-Galactopyranosyl 10V, Negative-QTOF	splash10-0a6u-0609000000-b817ea70fd41a99636c7	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - D-Pinitol 2-O-alpha-D-Galactopyranosyl 20V, Negative-QTOF	splash10-004l-0901000000-99b251f3d9b16dc7eaec	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - D-Pinitol 2-O-alpha-D-Galactopyranosyl 40V, Negative-QTOF	splash10-004l-2900000000-13e9b2a3cf80e62a4a36	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - D-Pinitol 2-O-alpha-D-Galactopyranosyl 10V, Positive-QTOF	splash10-0a4i-0209000000-cede7266b96723c4d129	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - D-Pinitol 2-O-alpha-D-Galactopyranosyl 20V, Positive-QTOF	splash10-002b-0900000000-28b70a2caf8d518d0f58	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - D-Pinitol 2-O-alpha-D-Galactopyranosyl 40V, Positive-QTOF	splash10-0537-9360000000-b183734984ff3a4ff1b7	2021-09-22	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - D-Pinitol 2-O-alpha-D-Galactopyranosyl 10V, Negative-QTOF	splash10-0a4i-0109000000-1069475e67ad9d391e77	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - D-Pinitol 2-O-alpha-D-Galactopyranosyl 20V, Negative-QTOF	splash10-0a4i-8797000000-be6805ba4a62d13bc1eb	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - D-Pinitol 2-O-alpha-D-Galactopyranosyl 40V, Negative-QTOF	splash10-0k9f-9310000000-797c34c06da9a129c11c	2021-09-23	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB021455

KNApSAcK ID

Not Available

Chemspider ID

24784716

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

74427727

PDB ID

Not Available

ChEBI ID

175578

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for D-Pinitol 2-O-alpha-D-Galactopyranosyl (HMDB0041487)

MOL for HMDB0041487 (D-Pinitol 2-O-alpha-D-Galactopyranosyl)

3D MOL for HMDB0041487 (D-Pinitol 2-O-alpha-D-Galactopyranosyl)

3D SDF for HMDB0041487 (D-Pinitol 2-O-alpha-D-Galactopyranosyl)

3D-SDF for HMDB0041487 (D-Pinitol 2-O-alpha-D-Galactopyranosyl)

PDB for HMDB0041487 (D-Pinitol 2-O-alpha-D-Galactopyranosyl)

3D PDB for HMDB0041487 (D-Pinitol 2-O-alpha-D-Galactopyranosyl)

SMILES for HMDB0041487 (D-Pinitol 2-O-alpha-D-Galactopyranosyl)

INCHI for HMDB0041487 (D-Pinitol 2-O-alpha-D-Galactopyranosyl)

Structure for HMDB0041487 (D-Pinitol 2-O-alpha-D-Galactopyranosyl)

3D Structure for HMDB0041487 (D-Pinitol 2-O-alpha-D-Galactopyranosyl)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra