×
Showing structure for C[Si](C)(C)N(N)C(=O)C1=CC=NC=C1