Hmdb loader
You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Human Metabolome Database.
Record Information
Version5.0
StatusDetected and Quantified
Creation Date2005-11-16 15:48:42 UTC
Update Date2021-09-14 15:44:43 UTC
HMDB IDHMDB0000163
Secondary Accession Numbers
  • HMDB00163
Metabolite Identification
Common NameD-Maltose
DescriptionD-Maltose, also known as maltose, maltobiose or malt sugar, is a disaccharide formed from two units of glucose joined with an alpha (1→4) bond. Its name comes from malt, combined with the suffix '-ose' which is used in names of sugars. Maltose is a key structural motif of starch. When alpha-amylase breaks down starch, it removes two glucose units at a time, producing maltose. Maltose can be further broken down to glucose by the maltase enzyme, which catalyses the hydrolysis of the glycosidic bond. D-maltose exists in all living species, ranging from bacteria to plants to humans. Within humans, D-maltose participates in a number of enzymatic reactions. In particular, maltose can be converted into glucose; which is mediated by the enzyme maltase-glucoamylase. In addition, maltose can be converted into glucose through its interaction with the enzyme glycogen debranching enzyme. Maltose is found in high concentrations in oriental wheats and in a lower concentrations in sweet potato, grape wines, yellow pond-lilies, sunflowers, and spinach. Maltose is a component of malt, a substance which is obtained in the process of allowing grain to soften in water and germinate. It is also present in highly variable quantities in partially hydrolysed starch products like maltodextrin, corn syrup and acid-thinned starch. Maltose has a sweet taste but is only about 30–60% as sweet as sucrose, depending on the concentration.
Structure
Data?1582752114
Synonyms
ValueSource
4-O-alpha-D-Glucopyranosyl-alpha-D-mannopyranoseChEBI
4-O-a-D-Glucopyranosyl-a-D-mannopyranoseGenerator
4-O-Α-D-glucopyranosyl-α-D-mannopyranoseGenerator
1-alpha-D-Glucopyranosyl-4-alpha-D-glucopyranoseHMDB
1-alpha-delta-Glucopyranosyl-4-alpha-delta-glucopyranoseHMDB
4-(alpha-D-Glucopyranosido)-alpha-glucopyranoseHMDB
4-(alpha-D-Glucosido)-D-glucoseHMDB
4-(alpha-delta-Glucopyranosido)-alpha-glucopyranoseHMDB
4-(alpha-delta-Glucosido)-delta-glucoseHMDB
4-O-a-D-Glucopyranosyl-D-glucoseHMDB
4-O-alpha-D-Glucopyranosyl-D-glucopyranoseHMDB
4-O-alpha-D-Glucopyranosyl-D-glucoseHMDB
4-O-alpha-delta-Glucopyranosyl-delta-glucopyranoseHMDB
4-O-alpha-delta-Glucopyranosyl-delta-glucoseHMDB
Advantose 100HMDB
alpha-D-GLCP-(1->4)-D-GLCPHMDB
alpha-D-Glucopyranosyl-(1->4)-D-glucopyranoseHMDB
alpha-D-Glucopyranosyl-(1->4)-D-glucoseHMDB
alpha-delta-GLCP-(1->4)-delta-GLCPHMDB
alpha-delta-Glucopyranosyl-(1->4)-delta-glucopyranoseHMDB
alpha-delta-Glucopyranosyl-(1->4)-delta-glucoseHMDB
alpha-Malt sugarHMDB
CextromaltoseHMDB
D-(+)-MaltoseHMDB
delta-(+)-MaltoseHMDB
delta-MaltoseHMDB
FinetoseHMDB
Finetose FHMDB
MadorosHMDB
Malt sugarHMDB
MaltobioseHMDB
MaltodioseHMDB
MaltosHMDB
MaltoseHMDB
Maltose HHHMDB
Maltose HHHHMDB
Maltose solutionHMDB
MalzzuckerHMDB
Martos-10HMDB
SunmaltHMDB
Sunmalt SHMDB
Chemical FormulaC12H22O11
Average Molecular Weight342.2965
Monoisotopic Molecular Weight342.116211546
IUPAC Name(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-{[(2R,3S,4R,5S,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}oxane-3,4,5-triol
Traditional Name(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-{[(2R,3S,4R,5S,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}oxane-3,4,5-triol
CAS Registry Number69-79-4
SMILES
OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O
InChI Identifier
InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5-,6+,7-,8+,9-,10-,11+,12-/m1/s1
InChI KeyGUBGYTABKSRVRQ-DKBJLJRDSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as o-glycosyl compounds. These are glycoside in which a sugar group is bonded through one carbon to another group via a O-glycosidic bond.
KingdomOrganic compounds
Super ClassOrganic oxygen compounds
ClassOrganooxygen compounds
Sub ClassCarbohydrates and carbohydrate conjugates
Direct ParentO-glycosyl compounds
Alternative Parents
Substituents
  • O-glycosyl compound
  • Disaccharide
  • Oxane
  • Secondary alcohol
  • Hemiacetal
  • Oxacycle
  • Organoheterocyclic compound
  • Polyol
  • Acetal
  • Hydrocarbon derivative
  • Primary alcohol
  • Alcohol
  • Aliphatic heteromonocyclic compound
Molecular FrameworkAliphatic heteromonocyclic compounds
External Descriptors
Ontology
Physiological effect

Adverse health effect

Disposition

Biological location

Source

Route of exposure

Process

Naturally occurring process

Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting Point102 - 103 °CNot Available
Boiling PointNot AvailableNot Available
Water Solubility780 mg/mLNot Available
LogPNot AvailableNot Available
Experimental Spectral Properties

Experimental Collision Cross Sections

PredictorAdduct TypeData SourceCCS Value (Å2)Reference
DeepCCS[M-H]-Baker205.930932474
Predicted Molecular Properties
PropertyValueSource
Water Solubility586 g/LALOGPS
logP10(-3) g/LALOGPS
logP10(-4.7) g/LChemAxon
logS10(0.23) g/LALOGPS
pKa (Strongest Acidic)11.25ChemAxon
pKa (Strongest Basic)-3ChemAxon
Physiological Charge0ChemAxon
Hydrogen Acceptor Count11ChemAxon
Hydrogen Donor Count8ChemAxon
Polar Surface Area189.53 ŲChemAxon
Rotatable Bond Count4ChemAxon
Refractivity68.34 m³·mol⁻¹ChemAxon
Polarizability31.43 ųChemAxon
Number of Rings2ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleNoChemAxon
Predicted Spectral Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DarkChem[M+H]+174.90131661259
DarkChem[M-H]-171.0431661259
AllCCS[M+H]+176.31132859911
AllCCS[M-H]-174.37632859911

Predicted Kovats Retention Indices

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
D-Maltose,1TMS,#1C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O2784.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,1TMS,#2C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](O)O[C@H](CO)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O2790.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,1TMS,#3C[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O2785.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,1TMS,#4C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H]1O2809.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,1TMS,#5C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O2802.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,1TMS,#6C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]1O2787.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,1TMS,#7C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)[C@@H]1O2784.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,1TMS,#8C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)[C@H](O)[C@H]1O2776.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#1C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O2814.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#2C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O2805.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#3C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O2775.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#4C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O2776.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#5C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O2780.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#6C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O2778.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#7C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C2796.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#8C[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C2785.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#9C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H]1O2796.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#10C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O2789.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#11C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O2781.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#12C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O2776.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#13C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C2774.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#14C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](CO)O[C@@H]1O[Si](C)(C)C2793.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#15C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O2790.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#16C[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O2777.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#17C[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O2771.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#18C[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O2775.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#19C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O2808.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#20C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](O)[C@H]1O2798.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#21C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@@H]1O2790.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#22C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H]1O2801.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#23C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2800.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#24C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2788.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#25C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C2796.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#26C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C2782.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#27C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)O[C@@H]1CO2774.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TMS,#28C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C2784.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#1C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O2681.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#2C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O2685.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#3C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O2670.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#4C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O2679.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#5C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2678.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#6C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2692.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#7C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O2679.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#8C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O2685.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#9C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O2693.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#10C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O2679.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#11C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C2697.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#12C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O2676.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#13C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O2682.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#14C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O2674.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#15C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C2693.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#16C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O2660.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#17C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O2664.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#18C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C2681.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#19C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2663.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#20C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2696.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#21C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2670.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#22C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](CO)O[C@@H]1O[Si](C)(C)C2710.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#23C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O2689.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#24C[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C2719.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#25C[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C2706.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#26C[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2699.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#27C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O2687.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#28C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O2720.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#29C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O2697.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#30C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O2702.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#31C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2682.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#32C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2678.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#33C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C2670.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#34C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO2700.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#35C[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](O)O[C@H](CO)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2706.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#36C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2685.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#37C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](CO)O[C@@H]1O[Si](C)(C)C2727.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#38C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](CO)O[C@@H]1O[Si](C)(C)C2706.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#39C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](CO)O[C@@H]1O[Si](C)(C)C2717.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#40C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O2681.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#41C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2696.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#42C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2688.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#43C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C2693.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#44C[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O2711.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#45C[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O2707.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#46C[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O2700.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#47C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2694.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#48C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2687.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#49C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C2695.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#50C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)O[C@@H]1CO2723.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#51C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H]1O2719.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#52C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C2709.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#53C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2680.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#54C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C2691.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#55C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2678.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TMS,#56C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C2689.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#1C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O2619.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#2C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O2613.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#3C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O2606.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#4C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2614.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#5C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2618.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#6C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O2620.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#7C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O2625.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#8C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2640.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#9C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2632.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#10C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O2585.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#11C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O2612.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#12C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C2609.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#13C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2604.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#14C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2626.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#15C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2623.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#16C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O2634.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#17C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O2619.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#18C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O2635.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#19C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C2630.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#20C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O2604.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#21C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O2628.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#22C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C2620.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#23C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2610.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#24C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2631.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#25C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2631.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#26C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O2614.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#27C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O2643.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#28C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C2628.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#29C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2638.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#30C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2654.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#31C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2652.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#32C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2604.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#33C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2620.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#34C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2625.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#35C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2626.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#36C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](CO)O[C@@H]1O[Si](C)(C)C2654.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#37C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](CO)O[C@@H]1O[Si](C)(C)C2670.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#38C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](CO)O[C@@H]1O[Si](C)(C)C2643.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#39C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O2632.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#40C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2623.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#41C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2643.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#42C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C2615.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#43C[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C2683.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#44C[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2660.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#45C[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2665.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#46C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2616.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#47C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2633.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#48C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C2605.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#49C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO2644.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#50C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H]1O2668.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#51C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2646.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#52C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2623.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#53C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C2606.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#54C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2601.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#55C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2630.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#56C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](CO)O[C@@H]1O[Si](C)(C)C2677.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#57C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)O[C@@H]1CO2659.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#58C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2620.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#59C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](CO)O[C@@H]1O[Si](C)(C)C2656.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#60C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2635.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#61C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C2617.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#62C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2656.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#63C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C2645.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#64C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2640.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#65C[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O2669.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#66C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2624.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#67C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C2614.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#68C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2607.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#69C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C2637.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TMS,#70C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2623.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#1C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O2629.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#2C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O2602.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#3C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2620.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#4C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2611.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#5C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O2582.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#6C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O2613.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#7C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C2599.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#8C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2594.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#9C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2601.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#10C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2609.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#11C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O2597.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#12C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O2622.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#13C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C2612.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#14C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2634.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#15C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C2646.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#16C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2646.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#17C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2595.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#18C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2609.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#19C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2614.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#20C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2625.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#21C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O2630.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#22C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O2646.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#23C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C2650.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#24C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2630.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#25C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2639.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#26C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2643.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#27C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2615.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#28C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2624.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#29C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2637.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#30C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2630.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#31C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2637.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#32C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2646.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#33C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2652.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#34C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2665.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#35C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2635.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#36C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](CO)O[C@@H]1O[Si](C)(C)C2675.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#37C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)O[C@@H]1CO2649.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#38C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O2647.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#39C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](CO)O[C@@H]1O[Si](C)(C)C2656.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#40C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O2656.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#41C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C2631.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#42C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2652.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#43C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C2621.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#44C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2631.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#45C[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2661.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#46C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2638.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#47C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C2607.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#48C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2613.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#49C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2650.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#50C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2633.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#51C[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](CO)O[C@@H]1O[Si](C)(C)C2663.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#52C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2644.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#53C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C2620.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#54C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2626.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#55C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2659.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,5TMS,#56C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2634.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#1C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O2618.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#2C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O2637.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#3C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C2642.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#4C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2623.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#5C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C2623.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#6C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2638.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#7C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2600.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#8C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2607.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#9C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2626.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#10C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2618.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#11C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2614.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#12C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2620.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#13C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2634.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#14C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2635.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#15C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2618.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#16C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2632.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#17C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2636.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#18C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2658.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#19C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2644.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#20C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2621.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#21C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2635.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#22C[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](CO)O[C@@H]1O[Si](C)(C)C2662.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#23C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2662.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#24C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C2636.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#25C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2634.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#26C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2637.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#27C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2629.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,6TMS,#28C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2650.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,7TMS,#1C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2646.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,7TMS,#2C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2657.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,7TMS,#3C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2671.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,7TMS,#4C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2661.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,7TMS,#5C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2647.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,7TMS,#6C[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2652.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,7TMS,#7C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2656.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,7TMS,#8C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2652.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,1TBDMS,#1CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3021.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,1TBDMS,#2CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](O)O[C@H](CO)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3038.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,1TBDMS,#3CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3022.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,1TBDMS,#4CC(C)(C)[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H]1O3040.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,1TBDMS,#5CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3039.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,1TBDMS,#6CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]1O3043.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,1TBDMS,#7CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)[C@@H]1O3036.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,1TBDMS,#8CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)[C@H](O)[C@H]1O3029.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#1CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O)[C@@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3246.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#2CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3253.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#3CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3229.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#4CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3235.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#5CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3251.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#6CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3243.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#7CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3251.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#8CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C3255.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#9CC(C)(C)[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3248.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#10CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3251.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#11CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3257.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#12CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O3247.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#13CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3263.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#14CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](CO)O[C@@H]1O[Si](C)(C)C(C)(C)C3248.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#15CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3248.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#16CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3245.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#17CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H]1O3242.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#18CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O3255.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#19CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3260.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#20CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)[C@H](O)[C@H]1O3265.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#21CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)[C@@H]1O3257.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#22CC(C)(C)[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O3278.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#23CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3267.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#24CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3257.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#25CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3269.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#26CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C3254.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#27CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)O[C@@H]1CO3244.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,2TBDMS,#28CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3248.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#1CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3392.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#2CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3395.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#4CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O)[C@@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3407.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#5CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3395.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#6CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3403.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#7CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3387.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#8CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3386.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#9CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3421.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#10CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3399.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#11CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3406.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#12CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3394.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#13CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3412.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#14CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3400.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#15CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3404.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#17CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3390.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#18CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3396.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#19CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3393.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#20CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3396.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#21CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3395.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#22CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](CO)O[C@@H]1O[Si](C)(C)C(C)(C)C3426.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#23CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3414.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#24CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C3422.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#25CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C3422.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#26CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3432.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#27CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3401.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#28CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3412.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#29CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O3410.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#30CC(C)(C)[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3427.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#31CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3402.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#32CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3402.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#33CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3416.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#34CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@@H]1CO3405.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#35CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H](O)O[C@H](CO)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3397.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#36CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3410.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#37CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@@H](CO)O[C@@H]1O[Si](C)(C)C(C)(C)C3412.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#38CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H](CO)O[C@@H]1O[Si](C)(C)C(C)(C)C3409.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#39CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H]1O[Si](C)(C)C(C)(C)C3427.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#40CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3398.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#41CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3417.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#42CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3420.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#43CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3430.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#44CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H]1O3407.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#45CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O3411.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#46CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O3419.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#47CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3410.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#48CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3409.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#49CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3429.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#50CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)O[C@@H]1CO3417.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#51CC(C)(C)[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@@H]1O3411.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#52CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C3423.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#53CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3401.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#54CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3403.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#55CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3410.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#56CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C3405.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#1CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)O[C@@H]2CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3520.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#3CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3546.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#4CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3540.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#5CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3536.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#6CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3538.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#7CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3559.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#8CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3555.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#9CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3549.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#13CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3544.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#14CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O)[C@@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3546.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#15CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3546.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#16CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3541.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#17CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3548.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#18CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3546.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#19CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3544.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#21CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3548.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#22CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3544.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#23CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3553.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#24CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3555.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#25CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3554.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#26CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3554.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#27CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3555.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#28CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3550.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#29CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3559.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#30CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3561.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#31CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3561.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#34CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3548.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#35CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3552.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#36CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@@H](CO)O[C@@H]1O[Si](C)(C)C(C)(C)C3568.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#37CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H](CO)O[C@@H]1O[Si](C)(C)C(C)(C)C3573.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#38CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H]1O[Si](C)(C)C(C)(C)C3572.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#39CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3555.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#40CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3558.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#41CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3566.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#42CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3567.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#43CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C3565.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#44CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3568.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#45CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3574.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#46CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3547.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#47CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3553.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#48CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3559.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#49CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@@H]1CO3558.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#50CC(C)(C)[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3557.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#51CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3565.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#52CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3539.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#53CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3541.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#54CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3545.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#55CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3547.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#56CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H](CO)O[C@@H]1O[Si](C)(C)C(C)(C)C3555.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#57CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]2[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)O[C@@H]2CO)O[C@@H]1CO3557.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#58CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3539.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#59CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H]1O[Si](C)(C)C(C)(C)C3564.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#60CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3546.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#61CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3547.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#62CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3563.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#63CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3562.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#64CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3569.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#65CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O3570.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#66CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3543.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#67CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3543.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#68CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3550.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#69CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C3558.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,4TBDMS,#70CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3545.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
D-Maltose,3TBDMS,#3CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3383.6Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
D-Maltose,3TBDMS,#16CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3409.2Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
D-Maltose,4TBDMS,#2CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3526.1Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
D-Maltose,4TBDMS,#10CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3543.5Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
D-Maltose,4TBDMS,#11CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3535.5Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
D-Maltose,4TBDMS,#12CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3533.0Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
D-Maltose,4TBDMS,#20CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3552.7Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
D-Maltose,4TBDMS,#32CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3547.3Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
D-Maltose,4TBDMS,#33CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3551.2Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
Spectra

GC-MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted GC-MSPredicted GC-MS Spectrum - D-Maltose GC-MS (Non-derivatized) - 70eV, Positivesplash10-03e9-4897000000-332d470623cd7f1e1ced2017-09-01Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - D-Maltose GC-MS (4 TMS) - 70eV, Positivesplash10-014i-3421129000-03a98898fd3278f955022017-10-06Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - D-Maltose GC-MS (TBDMS_3_3) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - D-Maltose GC-MS (TBDMS_3_16) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - D-Maltose GC-MS (TBDMS_4_2) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - D-Maltose GC-MS (TBDMS_4_10) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - D-Maltose GC-MS (TBDMS_4_11) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - D-Maltose GC-MS (TBDMS_4_12) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - D-Maltose GC-MS (TBDMS_4_20) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - D-Maltose GC-MS (TBDMS_4_32) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - D-Maltose GC-MS (TBDMS_4_33) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - D-Maltose GC-MS (Non-derivatized) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - D-Maltose GC-MS ("D-Maltose,3TBDMS,#3" TMS) - 70eV, PositiveNot Available2021-10-14Wishart LabView Spectrum

MS/MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Experimental LC-MS/MSLC-MS/MS Spectrum - D-Maltose Quattro_QQQ 10V, Positive-QTOF (Annotated)splash10-01ox-0149000000-74748828832d879323422012-07-24HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - D-Maltose Quattro_QQQ 25V, Positive-QTOF (Annotated)splash10-008c-2950000000-4ebee22b86c2cc9ee3ab2012-07-24HMDB team, MONAView Spectrum
Experimental LC-MS/MSLC-MS/MS Spectrum - D-Maltose Quattro_QQQ 40V, Positive-QTOF (Annotated)splash10-00kg-9710000000-041dbc580f99b88815182012-07-24HMDB team, MONAView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - D-Maltose 10V, Positive-QTOFsplash10-03gl-0907000000-a1de7813fbe8b5258c102017-09-01Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - D-Maltose 20V, Positive-QTOFsplash10-03e9-0900000000-79cc5059a3f338e8c1dd2017-09-01Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - D-Maltose 40V, Positive-QTOFsplash10-03di-3900000000-851d0bc84d91b6e095792017-09-01Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - D-Maltose 10V, Negative-QTOFsplash10-002f-0749000000-af1d18f2bc3ab8e028832017-09-01Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - D-Maltose 20V, Negative-QTOFsplash10-0200-2902000000-67218697344afb9e70fa2017-09-01Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - D-Maltose 40V, Negative-QTOFsplash10-01td-4900000000-40aa2d8125769803cfbb2017-09-01Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - D-Maltose 10V, Positive-QTOFsplash10-0006-0109000000-9d0f9a68a67bafd734ab2021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - D-Maltose 20V, Positive-QTOFsplash10-01rw-3898000000-7f495a1bcfdbed6466c42021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - D-Maltose 40V, Positive-QTOFsplash10-01ti-9210000000-b8a83657f0266d372bee2021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - D-Maltose 10V, Negative-QTOFsplash10-000x-1069000000-9cd867711bca0eecf9352021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - D-Maltose 20V, Negative-QTOFsplash10-0006-9365000000-65403961bfb5e35eaa0d2021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - D-Maltose 40V, Negative-QTOFsplash10-000l-9200000000-0de9785c1c5df1430dd22021-09-22Wishart LabView Spectrum

NMR Spectra

Spectrum TypeDescriptionDeposition DateSourceView
Predicted 1D NMR1H NMR Spectrum (1D, 100 MHz, D2O, predicted)2021-09-16Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 100 MHz, D2O, predicted)2021-09-16Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 200 MHz, D2O, predicted)2021-09-16Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 200 MHz, D2O, predicted)2021-09-16Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 300 MHz, D2O, predicted)2021-09-16Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 300 MHz, D2O, predicted)2021-09-16Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 400 MHz, D2O, predicted)2021-09-16Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 400 MHz, D2O, predicted)2021-09-16Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 500 MHz, D2O, predicted)2021-09-16Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 500 MHz, D2O, predicted)2021-09-16Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 600 MHz, D2O, predicted)2021-09-16Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 600 MHz, D2O, predicted)2021-09-16Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 700 MHz, D2O, predicted)2021-09-16Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 700 MHz, D2O, predicted)2021-09-16Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 800 MHz, D2O, predicted)2021-09-16Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 800 MHz, D2O, predicted)2021-09-16Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 900 MHz, D2O, predicted)2021-09-16Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 900 MHz, D2O, predicted)2021-09-16Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 1000 MHz, D2O, predicted)2021-09-16Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 1000 MHz, D2O, predicted)2021-09-16Wishart LabView Spectrum
Experimental 1D NMR13C NMR Spectrum (1D, 400 MHz, H2O, experimental)2021-10-10Wishart LabView Spectrum
Experimental 2D NMR[1H, 1H]-TOCSY 2D NMR Spectrum (experimental)2012-12-04Wishart LabView Spectrum
Experimental 2D NMR[1H, 13C]-HSQC NMR Spectrum (2D, 600 MHz, H2O, experimental)2012-12-05Wishart LabView Spectrum
Biological Properties
Cellular Locations
  • Cytoplasm
  • Extracellular
  • Lysosome
Biospecimen Locations
  • Blood
  • Feces
  • Sweat
  • Urine
Tissue Locations
  • Kidney
  • Liver
  • Placenta
  • Platelet
Pathways
Normal Concentrations
BiospecimenStatusValueAgeSexConditionReferenceDetails
FecesDetected but not QuantifiedNot QuantifiedInfant (0-1 year old)Both
Normal
details
FecesDetected but not QuantifiedNot QuantifiedAdult (>18 years old)Both
Normal
details
FecesDetected but not QuantifiedNot QuantifiedAdult (>18 years old)Both
Normal
details
FecesDetected but not QuantifiedNot QuantifiedAdult (>18 years old)Both
Normal
details
FecesDetected but not QuantifiedNot QuantifiedNot SpecifiedNot Specified
Normal
details
SweatDetected but not QuantifiedNot QuantifiedAdult BothNormal details
UrineDetected and Quantified16.424 +/- 6.538 umol/mmol creatinineChildren (1 - 13 years old)Not Specified
Normal
    • Mordechai, Hien, ...
details
UrineDetected and Quantified6.0 (1.3-21.4) umol/mmol creatinineAdult (>18 years old)Both
Normal
details
UrineDetected and Quantified6.14 +/- 5.12 umol/mmol creatinineInfant (0-1 year old)BothNormal details
Abnormal Concentrations
BiospecimenStatusValueAgeSexConditionReferenceDetails
BloodDetected and Quantified1169.0 +/- 526.0 uMAdult (>18 years old)BothPeritoneal dialysis details
FecesDetected but not QuantifiedNot QuantifiedAdult (>18 years old)BothColorectal Cancer details
FecesDetected but not QuantifiedNot QuantifiedAdult (>18 years old)Both
Colorectal cancer
details
UrineDetected and Quantified8.332 +/- 5.36 umol/mmol creatinineChildren (1 - 13 years old)Not Specified
Eosinophilic esophagitis
    • Mordechai, Hien, ...
details
UrineDetected but not QuantifiedNot QuantifiedAdult (>18 years old)BothBladder cancer details
Associated Disorders and Diseases
Disease References
Peritoneal dialysis
  1. Garcia-Lopez E, Anderstam B, Heimburger O, Amici G, Werynski A, Lindholm B: Determination of high and low molecular weight molecules of icodextrin in plasma and dialysate, using gel filtration chromatography, in peritoneal dialysis patients. Perit Dial Int. 2005 Mar-Apr;25(2):181-91. [PubMed:15796147 ]
Colorectal cancer
  1. Brown DG, Rao S, Weir TL, O'Malia J, Bazan M, Brown RJ, Ryan EP: Metabolomics and metabolic pathway networks from human colorectal cancers, adjacent mucosa, and stool. Cancer Metab. 2016 Jun 6;4:11. doi: 10.1186/s40170-016-0151-y. eCollection 2016. [PubMed:27275383 ]
  2. Goedert JJ, Sampson JN, Moore SC, Xiao Q, Xiong X, Hayes RB, Ahn J, Shi J, Sinha R: Fecal metabolomics: assay performance and association with colorectal cancer. Carcinogenesis. 2014 Sep;35(9):2089-96. doi: 10.1093/carcin/bgu131. Epub 2014 Jul 18. [PubMed:25037050 ]
Eosinophilic esophagitis
  1. (). Mordechai, Hien, and David S. Wishart. .
Associated OMIM IDs
DrugBank IDNot Available
Phenol Explorer Compound IDNot Available
FooDB IDFDB001193
KNApSAcK IDC00001140
Chemspider ID9166684
KEGG Compound IDC00208
BioCyc IDNot Available
BiGG ID34261
Wikipedia LinkMaltose
METLIN ID413
PubChem Compound10991489
PDB IDNot Available
ChEBI ID47937
Food Biomarker OntologyNot Available
VMH IDMALT
MarkerDB IDNot Available
Good Scents IDNot Available
References
Synthesis ReferencePedersen, Sven; Vang Hendriksen, Hanne. Method for production of maltose and/or enzymatically modified starch. PCT Int. Appl. (2001), 99 pp.
Material Safety Data Sheet (MSDS)Download (PDF)
General References
  1. Lu J, Willis AC, Reid KB: Purification, characterization and cDNA cloning of human lung surfactant protein D. Biochem J. 1992 Jun 15;284 ( Pt 3):795-802. [PubMed:1339284 ]
  2. Rubaltelli FF, Biadaioli R, Pecile P, Nicoletti P: Intestinal flora in breast- and bottle-fed infants. J Perinat Med. 1998;26(3):186-91. [PubMed:9773376 ]
  3. Andrews RK, Suzuki-Inoue K, Shen Y, Tulasne D, Watson SP, Berndt MC: Interaction of calmodulin with the cytoplasmic domain of platelet glycoprotein VI. Blood. 2002 Jun 1;99(11):4219-21. [PubMed:12010829 ]
  4. Hirooka EY, Muller EE, Freitas JC, Vicente E, Yoshimoto Y, Bergdoll MS: Enterotoxigenicity of Staphylococcus intermedius of canine origin. Int J Food Microbiol. 1988 Dec;7(3):185-91. [PubMed:3275321 ]
  5. Daly JJ, Sherman JK, Green L, Hostetler TL: Survival of Trichomonas vaginalis in human semen. Genitourin Med. 1989 Apr;65(2):106-8. [PubMed:2787774 ]
  6. Sherman JK, Hostetler TL, McHenry K, Daly JJ: Cryosurvival of Trichomonas vaginalis during cryopreservation of human semen. Cryobiology. 1991 Jun;28(3):246-50. [PubMed:1864083 ]
  7. van Leeuwen L: New saccharogenic determination of alpha-amylase in serum and urine. Clin Chem. 1979 Feb;25(2):215-7. [PubMed:215341 ]
  8. Miller LJ, Malagelada JR, Taylor WF, Go VL: Intestinal control of human postprandial gastric function: the role of components of jejunoileal chyme in regulating gastric secretion and gastric emptying. Gastroenterology. 1981 Apr;80(4):763-9. [PubMed:7202948 ]
  9. Roy E, Stavropoulos E, Brennan J, Coade S, Grigorieva E, Walker B, Dagg B, Tascon RE, Lowrie DB, Colston MJ, Jolles S: Therapeutic efficacy of high-dose intravenous immunoglobulin in Mycobacterium tuberculosis infection in mice. Infect Immun. 2005 Sep;73(9):6101-9. [PubMed:16113331 ]
  10. Wyss C, Choi BK, Schupbach P, Guggenheim B, Gobel UB: Treponema maltophilum sp. nov., a small oral spirochete isolated from human periodontal lesions. Int J Syst Bacteriol. 1996 Jul;46(3):745-52. [PubMed:8782684 ]
  11. Morse DR, Schacterle GR, Furst L, Zaydenberg M, Pollack RL: Oral digestion of a complex-carbohydrate cereal: effects of stress and relaxation on physiological and salivary measures. Am J Clin Nutr. 1989 Jan;49(1):97-105. [PubMed:2463752 ]
  12. Yamamoto T, Kajiura S, Hirai Y, Watanabe T: Capnocytophaga haemolytica sp. nov. and Capnocytophaga granulosa sp. nov., from human dental plaque. Int J Syst Bacteriol. 1994 Apr;44(2):324-9. [PubMed:8186098 ]
  13. Zhu J, Marchant RE: Dendritic saccharide surfactant polymers as antifouling interface materials to reduce platelet adhesion. Biomacromolecules. 2006 Apr;7(4):1036-41. [PubMed:16602718 ]
  14. Lingstrom P, Birkhed D, Granfeldt Y, Bjorck I: pH measurements of human dental plaque after consumption of starchy foods using the microtouch and the sampling method. Caries Res. 1993;27(5):394-401. [PubMed:8242677 ]
  15. Leth-Larsen R, Holmskov U, Hojrup P: Structural characterization of human and bovine lung surfactant protein D. Biochem J. 1999 Nov 1;343 Pt 3:645-52. [PubMed:10527944 ]
  16. Janoshazi A, Solomon AK: Initial steps of alpha- and beta-D-glucose binding to intact red cell membrane. J Membr Biol. 1993 Mar;132(2):167-78. [PubMed:8496948 ]
  17. Tiwari F, Singh DK: Behavioural responses of the snail Lymnaea acuminata to carbohydrates in snail-attractant pellets. Naturwissenschaften. 2004 Aug;91(8):378-80. Epub 2004 Jun 2. [PubMed:15309310 ]
  18. Chiba S, Hiromi K, Minamiura N, Ohnishi M, Shimomura T, Suga K, Suganuma T, Tanaka A, Tomioka S, Yamamoto T: Quantitative study on anomeric forms of glucose produced by alpha-glucosidases. J Biochem. 1979 May;85(5):1135-41. [PubMed:376499 ]
  19. McCue JP, Hein RH, Tenold R: Three generations of immunoglobulin G preparations for clinical use. Rev Infect Dis. 1986 Jul-Aug;8 Suppl 4:S374-81. [PubMed:3092303 ]
  20. Dorner KM: Quantitative determination of lactose, maltose, and sucrose in urine. Eur J Pediatr. 1977 Aug 23;126(1-2):45-52. [PubMed:902663 ]
  21. Sigman-Grant M, Morita J: Defining and interpreting intakes of sugars. Am J Clin Nutr. 2003 Oct;78(4):815S-826S. [PubMed:14522745 ]
  22. Elshenawy S, Pinney SE, Stuart T, Doulias PT, Zura G, Parry S, Elovitz MA, Bennett MJ, Bansal A, Strauss JF 3rd, Ischiropoulos H, Simmons RA: The Metabolomic Signature of the Placenta in Spontaneous Preterm Birth. Int J Mol Sci. 2020 Feb 4;21(3). pii: ijms21031043. doi: 10.3390/ijms21031043. [PubMed:32033212 ]

Enzymes

General function:
Involved in catalytic activity
Specific function:
Multifunctional enzyme acting as 1,4-alpha-D-glucan:1,4-alpha-D-glucan 4-alpha-D-glycosyltransferase and amylo-1,6-glucosidase in glycogen degradation.
Gene Name:
AGL
Uniprot ID:
P35573
Molecular weight:
Not Available
General function:
Involved in catalytic activity
Specific function:
Essential for the degradation of glygogen to glucose in lysosomes.
Gene Name:
GAA
Uniprot ID:
P10253
Molecular weight:
Not Available
Reactions
D-Maltose + Water → alpha-D-Glucosedetails
General function:
Involved in catalytic activity
Specific function:
Not Available
Gene Name:
AMY1A
Uniprot ID:
P04745
Molecular weight:
Not Available
General function:
Involved in catalytic activity
Specific function:
Not Available
Gene Name:
AMY2B
Uniprot ID:
P19961
Molecular weight:
Not Available
References
  1. Overington JP, Al-Lazikani B, Hopkins AL: How many drug targets are there? Nat Rev Drug Discov. 2006 Dec;5(12):993-6. [PubMed:17139284 ]
  2. Imming P, Sinning C, Meyer A: Drugs, their targets and the nature and number of drug targets. Nat Rev Drug Discov. 2006 Oct;5(10):821-34. [PubMed:17016423 ]
  3. Berman HM, Westbrook J, Feng Z, Gilliland G, Bhat TN, Weissig H, Shindyalov IN, Bourne PE: The Protein Data Bank. Nucleic Acids Res. 2000 Jan 1;28(1):235-42. [PubMed:10592235 ]
General function:
Involved in catalytic activity
Specific function:
May serve as an alternate pathway for starch digestion when luminal alpha-amylase activity is reduced because of immaturity or malnutrition. May play a unique role in the digestion of malted dietary oligosaccharides used in food manufacturing.
Gene Name:
MGAM
Uniprot ID:
O43451
Molecular weight:
Not Available
Reactions
D-Maltose + Water → alpha-D-Glucosedetails
General function:
Involved in catalytic activity
Specific function:
Has alpha-glucosidase activity.
Gene Name:
GANC
Uniprot ID:
Q8TET4
Molecular weight:
Not Available
Reactions
D-Maltose + Water → alpha-D-Glucosedetails