| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Detected and Quantified |
|---|
| Creation Date | 2005-11-16 15:48:42 UTC |
|---|
| Update Date | 2021-09-14 15:46:09 UTC |
|---|
| HMDB ID | HMDB0000982 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | 5-Methylcytidine |
|---|
| Description | 5-Methylcytidine belongs to the class of organic compounds known as pyrimidine nucleosides. Pyrimidine nucleosides are compounds comprising a pyrimidine base attached to a ribosyl or deoxyribosyl moiety. 5-Methylcytidine has been detected, but not quantified in, a few different foods, such as anatidaes (Anatidae), chickens (Gallus gallus), and domestic pigs (Sus scrofa domestica). This could make 5-methylcytidine a potential biomarker for the consumption of these foods. Based on a literature review a significant number of articles have been published on 5-Methylcytidine. |
|---|
| Structure | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)N=C1N InChI=1S/C10H15N3O5/c1-4-2-13(10(17)12-8(4)11)9-7(16)6(15)5(3-14)18-9/h2,5-7,9,14-16H,3H2,1H3,(H2,11,12,17)/t5-,6-,7-,9-/m1/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| 5-Methyl-cytidine | HMDB | | 5-Methylcytidine | HMDB |
|
|---|
| Chemical Formula | C10H15N3O5 |
|---|
| Average Molecular Weight | 257.2432 |
|---|
| Monoisotopic Molecular Weight | 257.101170605 |
|---|
| IUPAC Name | 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-1,2-dihydropyrimidin-2-one |
|---|
| Traditional Name | 5-methylcytidine |
|---|
| CAS Registry Number | 2140-61-6 |
|---|
| SMILES | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)N=C1N |
|---|
| InChI Identifier | InChI=1S/C10H15N3O5/c1-4-2-13(10(17)12-8(4)11)9-7(16)6(15)5(3-14)18-9/h2,5-7,9,14-16H,3H2,1H3,(H2,11,12,17)/t5-,6-,7-,9-/m1/s1 |
|---|
| InChI Key | ZAYHVCMSTBRABG-JXOAFFINSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as pyrimidine nucleosides. Pyrimidine nucleosides are compounds comprising a pyrimidine base attached to a ribosyl or deoxyribosyl moiety. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Nucleosides, nucleotides, and analogues |
|---|
| Class | Pyrimidine nucleosides |
|---|
| Sub Class | Not Available |
|---|
| Direct Parent | Pyrimidine nucleosides |
|---|
| Alternative Parents | |
|---|
| Substituents | - Pyrimidine nucleoside
- Glycosyl compound
- N-glycosyl compound
- Pentose monosaccharide
- Hydroxypyrimidine
- Hydropyrimidine
- Monosaccharide
- Pyrimidine
- Tetrahydrofuran
- Heteroaromatic compound
- Secondary alcohol
- Organoheterocyclic compound
- Azacycle
- Oxacycle
- Organic nitrogen compound
- Hydrocarbon derivative
- Primary alcohol
- Organopnictogen compound
- Organooxygen compound
- Organonitrogen compound
- Alcohol
- Organic oxygen compound
- Aromatic heteromonocyclic compound
|
|---|
| Molecular Framework | Aromatic heteromonocyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | Not Available |
|---|
| Role | Not Available |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | 213 °C | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | -2.01 | HANSCH,C ET AL. (1995) |
|
|---|
| Experimental Chromatographic Properties | Experimental Collision Cross Sections |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 1.72 minutes | 32390414 | | Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 2.44 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 8.9975 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 6.15 minutes | 32390414 | | AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 149.9 seconds | 40023050 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 429.2 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 229.0 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 61.5 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 157.5 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 47.6 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 296.1 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 239.3 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 648.3 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 556.7 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 59.3 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 703.9 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 161.9 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 186.2 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 573.4 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 366.3 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 257.8 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| 5-Methylcytidine,1TMS,isomer #1 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)N=C1N | 2477.7 | Semi standard non polar | 33892256 | | 5-Methylcytidine,1TMS,isomer #2 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)N=C1N | 2481.8 | Semi standard non polar | 33892256 | | 5-Methylcytidine,1TMS,isomer #3 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)N=C1N | 2468.8 | Semi standard non polar | 33892256 | | 5-Methylcytidine,1TMS,isomer #4 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)N=C1N[Si](C)(C)C | 2535.8 | Semi standard non polar | 33892256 | | 5-Methylcytidine,2TMS,isomer #1 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)N=C1N | 2467.9 | Semi standard non polar | 33892256 | | 5-Methylcytidine,2TMS,isomer #2 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)N=C1N | 2464.9 | Semi standard non polar | 33892256 | | 5-Methylcytidine,2TMS,isomer #3 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)N=C1N[Si](C)(C)C | 2492.8 | Semi standard non polar | 33892256 | | 5-Methylcytidine,2TMS,isomer #4 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)N=C1N | 2467.7 | Semi standard non polar | 33892256 | | 5-Methylcytidine,2TMS,isomer #5 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)N=C1N[Si](C)(C)C | 2507.1 | Semi standard non polar | 33892256 | | 5-Methylcytidine,2TMS,isomer #6 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)N=C1N[Si](C)(C)C | 2504.2 | Semi standard non polar | 33892256 | | 5-Methylcytidine,2TMS,isomer #7 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)N=C1N([Si](C)(C)C)[Si](C)(C)C | 2489.5 | Semi standard non polar | 33892256 | | 5-Methylcytidine,3TMS,isomer #1 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)N=C1N | 2454.3 | Semi standard non polar | 33892256 | | 5-Methylcytidine,3TMS,isomer #2 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)N=C1N[Si](C)(C)C | 2489.0 | Semi standard non polar | 33892256 | | 5-Methylcytidine,3TMS,isomer #3 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)N=C1N[Si](C)(C)C | 2492.9 | Semi standard non polar | 33892256 | | 5-Methylcytidine,3TMS,isomer #4 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]2O)C(=O)N=C1N([Si](C)(C)C)[Si](C)(C)C | 2464.8 | Semi standard non polar | 33892256 | | 5-Methylcytidine,3TMS,isomer #5 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)N=C1N[Si](C)(C)C | 2482.3 | Semi standard non polar | 33892256 | | 5-Methylcytidine,3TMS,isomer #6 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)N=C1N([Si](C)(C)C)[Si](C)(C)C | 2461.2 | Semi standard non polar | 33892256 | | 5-Methylcytidine,3TMS,isomer #7 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)N=C1N([Si](C)(C)C)[Si](C)(C)C | 2461.1 | Semi standard non polar | 33892256 | | 5-Methylcytidine,4TMS,isomer #1 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)N=C1N[Si](C)(C)C | 2507.5 | Semi standard non polar | 33892256 | | 5-Methylcytidine,4TMS,isomer #1 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)N=C1N[Si](C)(C)C | 2564.4 | Standard non polar | 33892256 | | 5-Methylcytidine,4TMS,isomer #1 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)N=C1N[Si](C)(C)C | 3016.6 | Standard polar | 33892256 | | 5-Methylcytidine,4TMS,isomer #2 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)N=C1N([Si](C)(C)C)[Si](C)(C)C | 2489.9 | Semi standard non polar | 33892256 | | 5-Methylcytidine,4TMS,isomer #2 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)N=C1N([Si](C)(C)C)[Si](C)(C)C | 2623.6 | Standard non polar | 33892256 | | 5-Methylcytidine,4TMS,isomer #2 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O)C(=O)N=C1N([Si](C)(C)C)[Si](C)(C)C | 2885.6 | Standard polar | 33892256 | | 5-Methylcytidine,4TMS,isomer #3 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)N=C1N([Si](C)(C)C)[Si](C)(C)C | 2498.3 | Semi standard non polar | 33892256 | | 5-Methylcytidine,4TMS,isomer #3 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)N=C1N([Si](C)(C)C)[Si](C)(C)C | 2634.6 | Standard non polar | 33892256 | | 5-Methylcytidine,4TMS,isomer #3 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C)C(=O)N=C1N([Si](C)(C)C)[Si](C)(C)C | 2929.0 | Standard polar | 33892256 | | 5-Methylcytidine,4TMS,isomer #4 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)N=C1N([Si](C)(C)C)[Si](C)(C)C | 2486.0 | Semi standard non polar | 33892256 | | 5-Methylcytidine,4TMS,isomer #4 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)N=C1N([Si](C)(C)C)[Si](C)(C)C | 2628.7 | Standard non polar | 33892256 | | 5-Methylcytidine,4TMS,isomer #4 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)N=C1N([Si](C)(C)C)[Si](C)(C)C | 2859.1 | Standard polar | 33892256 | | 5-Methylcytidine,5TMS,isomer #1 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)N=C1N([Si](C)(C)C)[Si](C)(C)C | 2532.5 | Semi standard non polar | 33892256 | | 5-Methylcytidine,5TMS,isomer #1 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)N=C1N([Si](C)(C)C)[Si](C)(C)C | 2617.3 | Standard non polar | 33892256 | | 5-Methylcytidine,5TMS,isomer #1 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)C(=O)N=C1N([Si](C)(C)C)[Si](C)(C)C | 2714.2 | Standard polar | 33892256 | | 5-Methylcytidine,1TBDMS,isomer #1 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)C(=O)N=C1N | 2749.7 | Semi standard non polar | 33892256 | | 5-Methylcytidine,1TBDMS,isomer #2 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)C(=O)N=C1N | 2737.5 | Semi standard non polar | 33892256 | | 5-Methylcytidine,1TBDMS,isomer #3 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N=C1N | 2733.5 | Semi standard non polar | 33892256 | | 5-Methylcytidine,1TBDMS,isomer #4 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)N=C1N[Si](C)(C)C(C)(C)C | 2787.2 | Semi standard non polar | 33892256 | | 5-Methylcytidine,2TBDMS,isomer #1 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)C(=O)N=C1N | 2940.6 | Semi standard non polar | 33892256 | | 5-Methylcytidine,2TBDMS,isomer #2 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N=C1N | 2940.4 | Semi standard non polar | 33892256 | | 5-Methylcytidine,2TBDMS,isomer #3 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)C(=O)N=C1N[Si](C)(C)C(C)(C)C | 2973.0 | Semi standard non polar | 33892256 | | 5-Methylcytidine,2TBDMS,isomer #4 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N=C1N | 2926.7 | Semi standard non polar | 33892256 | | 5-Methylcytidine,2TBDMS,isomer #5 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)C(=O)N=C1N[Si](C)(C)C(C)(C)C | 2968.8 | Semi standard non polar | 33892256 | | 5-Methylcytidine,2TBDMS,isomer #6 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N=C1N[Si](C)(C)C(C)(C)C | 2952.7 | Semi standard non polar | 33892256 | | 5-Methylcytidine,2TBDMS,isomer #7 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)C(=O)N=C1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2944.6 | Semi standard non polar | 33892256 | | 5-Methylcytidine,3TBDMS,isomer #1 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N=C1N | 3151.1 | Semi standard non polar | 33892256 | | 5-Methylcytidine,3TBDMS,isomer #2 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)C(=O)N=C1N[Si](C)(C)C(C)(C)C | 3171.0 | Semi standard non polar | 33892256 | | 5-Methylcytidine,3TBDMS,isomer #3 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N=C1N[Si](C)(C)C(C)(C)C | 3176.7 | Semi standard non polar | 33892256 | | 5-Methylcytidine,3TBDMS,isomer #4 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O)C(=O)N=C1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3144.6 | Semi standard non polar | 33892256 | | 5-Methylcytidine,3TBDMS,isomer #5 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N=C1N[Si](C)(C)C(C)(C)C | 3161.3 | Semi standard non polar | 33892256 | | 5-Methylcytidine,3TBDMS,isomer #6 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)C(=O)N=C1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3158.0 | Semi standard non polar | 33892256 | | 5-Methylcytidine,3TBDMS,isomer #7 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N=C1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3144.0 | Semi standard non polar | 33892256 | | 5-Methylcytidine,4TBDMS,isomer #1 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N=C1N[Si](C)(C)C(C)(C)C | 3348.3 | Semi standard non polar | 33892256 | | 5-Methylcytidine,4TBDMS,isomer #1 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N=C1N[Si](C)(C)C(C)(C)C | 3320.5 | Standard non polar | 33892256 | | 5-Methylcytidine,4TBDMS,isomer #1 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N=C1N[Si](C)(C)C(C)(C)C | 3363.6 | Standard polar | 33892256 | | 5-Methylcytidine,4TBDMS,isomer #2 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)C(=O)N=C1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3349.1 | Semi standard non polar | 33892256 | | 5-Methylcytidine,4TBDMS,isomer #2 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)C(=O)N=C1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3375.0 | Standard non polar | 33892256 | | 5-Methylcytidine,4TBDMS,isomer #2 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)C(=O)N=C1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3222.2 | Standard polar | 33892256 | | 5-Methylcytidine,4TBDMS,isomer #3 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N=C1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3356.8 | Semi standard non polar | 33892256 | | 5-Methylcytidine,4TBDMS,isomer #3 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N=C1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3387.2 | Standard non polar | 33892256 | | 5-Methylcytidine,4TBDMS,isomer #3 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N=C1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3256.5 | Standard polar | 33892256 | | 5-Methylcytidine,4TBDMS,isomer #4 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N=C1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3344.4 | Semi standard non polar | 33892256 | | 5-Methylcytidine,4TBDMS,isomer #4 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N=C1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3374.1 | Standard non polar | 33892256 | | 5-Methylcytidine,4TBDMS,isomer #4 | CC1=CN([C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N=C1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3204.0 | Standard polar | 33892256 | | 5-Methylcytidine,5TBDMS,isomer #1 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N=C1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3538.6 | Semi standard non polar | 33892256 | | 5-Methylcytidine,5TBDMS,isomer #1 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N=C1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3490.8 | Standard non polar | 33892256 | | 5-Methylcytidine,5TBDMS,isomer #1 | CC1=CN([C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)C(=O)N=C1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3189.8 | Standard polar | 33892256 |
|
|---|
| Disease References | | Crohn's disease |
|---|
- Lee T, Clavel T, Smirnov K, Schmidt A, Lagkouvardos I, Walker A, Lucio M, Michalke B, Schmitt-Kopplin P, Fedorak R, Haller D: Oral versus intravenous iron replacement therapy distinctly alters the gut microbiota and metabolome in patients with IBD. Gut. 2017 May;66(5):863-871. doi: 10.1136/gutjnl-2015-309940. Epub 2016 Feb 4. [PubMed:26848182 ]
| | Iron deficiency |
|---|
- Lee T, Clavel T, Smirnov K, Schmidt A, Lagkouvardos I, Walker A, Lucio M, Michalke B, Schmitt-Kopplin P, Fedorak R, Haller D: Oral versus intravenous iron replacement therapy distinctly alters the gut microbiota and metabolome in patients with IBD. Gut. 2017 May;66(5):863-871. doi: 10.1136/gutjnl-2015-309940. Epub 2016 Feb 4. [PubMed:26848182 ]
|
|
|---|