| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2005-11-16 15:48:42 UTC |
|---|
| Update Date | 2021-09-14 15:17:58 UTC |
|---|
| HMDB ID | HMDB0001125 |
|---|
| Secondary Accession Numbers | - HMDB0011748
- HMDB01125
- HMDB11748
|
|---|
| Metabolite Identification |
|---|
| Common Name | Inositol cyclic phosphate |
|---|
| Description | Inositol cyclic phosphate belongs to the class of organic compounds known as organic phosphoric acids and derivatives. These are organic compounds containing phosphoric acid or a derivative thereof. Inositol cyclic phosphate is an extremely weak basic (essentially neutral) compound (based on its pKa). |
|---|
| Structure | O[C@H]1[C@H]2OP(O)(=O)O[C@H]2[C@H](O)[C@@H](O)[C@@H]1O InChI=1S/C6H11O8P/c7-1-2(8)4(10)6-5(3(1)9)13-15(11,12)14-6/h1-10H,(H,11,12)/t1-,2-,3+,4+,5-,6+/m0/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| D-Myo-inositol 1,2-cyclic phosphate | ChEBI | | Myo-inositol 1,2-cyclic phosphate | ChEBI | | 1D-Myo-inositol 1,2-cyclic phosphate | Kegg | | D-Myo-inositol 1,2-cyclic phosphoric acid | Generator | | Myo-inositol 1,2-cyclic phosphoric acid | Generator | | 1D-Myo-inositol 1,2-cyclic phosphoric acid | Generator | | Inositol cyclic phosphoric acid | Generator | | Inositol 1,2-cyclic phosphate | HMDB | | Inositol cyclic-1,2-monophosphate | HMDB | | Inositol cyclic phosphate, (D)-isomer | HMDB | | Myoinositol 1,2-cyclic phosphate | HMDB | | Inositol cyclic phosphate | MeSH |
|
|---|
| Chemical Formula | C6H11O8P |
|---|
| Average Molecular Weight | 242.1205 |
|---|
| Monoisotopic Molecular Weight | 242.01915384 |
|---|
| IUPAC Name | (3aR,4R,5S,6S,7R,7aS)-2,4,5,6,7-pentahydroxy-hexahydro-2H-1,3,2λ⁵-benzodioxaphosphol-2-one |
|---|
| Traditional Name | inositol 1,2-cyclic phosphate |
|---|
| CAS Registry Number | 43119-57-9 |
|---|
| SMILES | O[C@H]1[C@H]2OP(O)(=O)O[C@H]2[C@H](O)[C@@H](O)[C@@H]1O |
|---|
| InChI Identifier | InChI=1S/C6H11O8P/c7-1-2(8)4(10)6-5(3(1)9)13-15(11,12)14-6/h1-10H,(H,11,12)/t1-,2-,3+,4+,5-,6+/m0/s1 |
|---|
| InChI Key | SXHMVNXROAUURW-FTYOSCRSSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as organic phosphoric acids and derivatives. These are organic compounds containing phosphoric acid or a derivative thereof. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organic acids and derivatives |
|---|
| Class | Organic phosphoric acids and derivatives |
|---|
| Sub Class | Not Available |
|---|
| Direct Parent | Organic phosphoric acids and derivatives |
|---|
| Alternative Parents | |
|---|
| Substituents | - Organic phosphoric acid derivative
- Cyclitol or derivatives
- 1,3_dioxaphospholane
- Cyclic alcohol
- Secondary alcohol
- Oxacycle
- Organoheterocyclic compound
- Polyol
- Organic oxygen compound
- Organic oxide
- Hydrocarbon derivative
- Organooxygen compound
- Alcohol
- Aliphatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aliphatic heteropolycyclic compounds |
|---|
| External Descriptors | |
|---|
| Ontology |
|---|
| Not Available | Not Available |
|---|
| Physical Properties |
|---|
| State | Solid |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 1.83 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 9.4992 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 8.3 minutes | 32390414 | | AjsUoB = Accucore 150 Amide HILIC with 10mM Ammonium Formate, 0.1% Formic Acid | 428.6 seconds | 40023050 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 534.2 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 316.2 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 23.3 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 191.6 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 82.9 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 304.1 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 230.4 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 747.2 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 566.8 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 42.3 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 715.7 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 192.8 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 332.6 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 792.6 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 454.8 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 437.6 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Inositol cyclic phosphate,1TMS,isomer #1 | C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2OP(=O)(O)O[C@@H]21 | 2099.6 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,1TMS,isomer #2 | C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H]2OP(=O)(O)O[C@@H]12 | 2099.6 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,1TMS,isomer #3 | C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H]2OP(=O)(O)O[C@@H]2[C@H](O)[C@H]1O | 2079.3 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,1TMS,isomer #4 | C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@@H]2OP(=O)(O)O[C@@H]2[C@@H]1O | 2079.3 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,1TMS,isomer #5 | C[Si](C)(C)OP1(=O)O[C@H]2[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@H]2O1 | 2108.6 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,2TMS,isomer #1 | C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@@H]2OP(=O)(O)O[C@@H]2[C@@H]1O[Si](C)(C)C | 2118.7 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,2TMS,isomer #10 | C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@@H]2OP(=O)(O[Si](C)(C)C)O[C@@H]2[C@@H]1O | 2147.3 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,2TMS,isomer #2 | C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]2OP(=O)(O)O[C@H]2[C@@H]1O | 2123.5 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,2TMS,isomer #3 | C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]2OP(=O)(O)O[C@@H]12 | 2121.3 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,2TMS,isomer #4 | C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2OP(=O)(O[Si](C)(C)C)O[C@@H]21 | 2139.0 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,2TMS,isomer #5 | C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@@H]2OP(=O)(O)O[C@@H]2[C@H](O)[C@H]1O | 2118.7 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,2TMS,isomer #6 | C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2OP(=O)(O)O[C@@H]2[C@@H]1O | 2123.5 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,2TMS,isomer #7 | C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H]2OP(=O)(O[Si](C)(C)C)O[C@@H]12 | 2139.0 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,2TMS,isomer #8 | C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H]2OP(=O)(O)O[C@@H]2[C@H](O)[C@H]1O[Si](C)(C)C | 2095.0 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,2TMS,isomer #9 | C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H]2OP(=O)(O[Si](C)(C)C)O[C@@H]2[C@H](O)[C@H]1O | 2147.3 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,3TMS,isomer #1 | C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2OP(=O)(O)O[C@@H]2[C@@H]1O[Si](C)(C)C | 2181.1 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,3TMS,isomer #10 | C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H]2OP(=O)(O[Si](C)(C)C)O[C@@H]2[C@H](O)[C@H]1O[Si](C)(C)C | 2174.7 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,3TMS,isomer #2 | C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2OP(=O)(O)O[C@@H]2[C@@H]1O[Si](C)(C)C | 2200.2 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,3TMS,isomer #3 | C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@@H]2OP(=O)(O[Si](C)(C)C)O[C@@H]2[C@@H]1O[Si](C)(C)C | 2181.0 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,3TMS,isomer #4 | C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]2OP(=O)(O)O[C@H]2[C@@H]1O[Si](C)(C)C | 2200.2 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,3TMS,isomer #5 | C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]2OP(=O)(O[Si](C)(C)C)O[C@H]2[C@@H]1O | 2208.0 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,3TMS,isomer #6 | C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]2OP(=O)(O[Si](C)(C)C)O[C@@H]12 | 2193.3 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,3TMS,isomer #7 | C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@@H]2OP(=O)(O)O[C@@H]2[C@H](O)[C@H]1O[Si](C)(C)C | 2181.1 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,3TMS,isomer #8 | C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@@H]2OP(=O)(O[Si](C)(C)C)O[C@@H]2[C@H](O)[C@H]1O | 2181.0 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,3TMS,isomer #9 | C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2OP(=O)(O[Si](C)(C)C)O[C@@H]2[C@@H]1O | 2208.0 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,4TMS,isomer #1 | C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2OP(=O)(O)O[C@H]2[C@@H]1O[Si](C)(C)C | 2263.8 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,4TMS,isomer #2 | C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2OP(=O)(O[Si](C)(C)C)O[C@@H]2[C@@H]1O[Si](C)(C)C | 2244.8 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,4TMS,isomer #3 | C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2OP(=O)(O[Si](C)(C)C)O[C@@H]2[C@@H]1O[Si](C)(C)C | 2258.5 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,4TMS,isomer #4 | C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]2OP(=O)(O[Si](C)(C)C)O[C@H]2[C@@H]1O[Si](C)(C)C | 2258.5 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,4TMS,isomer #5 | C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@@H]2OP(=O)(O[Si](C)(C)C)O[C@@H]2[C@H](O)[C@H]1O[Si](C)(C)C | 2244.8 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,5TMS,isomer #1 | C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2OP(=O)(O[Si](C)(C)C)O[C@H]2[C@@H]1O[Si](C)(C)C | 2283.2 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,5TMS,isomer #1 | C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2OP(=O)(O[Si](C)(C)C)O[C@H]2[C@@H]1O[Si](C)(C)C | 2235.0 | Standard non polar | 33892256 | | Inositol cyclic phosphate,5TMS,isomer #1 | C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]2OP(=O)(O[Si](C)(C)C)O[C@H]2[C@@H]1O[Si](C)(C)C | 2272.2 | Standard polar | 33892256 | | Inositol cyclic phosphate,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2OP(=O)(O)O[C@@H]21 | 2373.1 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H]2OP(=O)(O)O[C@@H]12 | 2373.1 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H]2OP(=O)(O)O[C@@H]2[C@H](O)[C@H]1O | 2363.0 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,1TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@@H]2OP(=O)(O)O[C@@H]2[C@@H]1O | 2363.0 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,1TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)OP1(=O)O[C@H]2[C@H](O)[C@@H](O)[C@H](O)[C@@H](O)[C@H]2O1 | 2372.4 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@@H]2OP(=O)(O)O[C@@H]2[C@@H]1O[Si](C)(C)C(C)(C)C | 2591.6 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,2TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@@H]2OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@@H]2[C@@H]1O | 2603.2 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2OP(=O)(O)O[C@H]2[C@@H]1O | 2602.5 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2OP(=O)(O)O[C@@H]12 | 2603.6 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@@H]2OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@@H]21 | 2594.0 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,2TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2OP(=O)(O)O[C@@H]2[C@H](O)[C@H]1O | 2591.6 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,2TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2OP(=O)(O)O[C@@H]2[C@@H]1O | 2602.5 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,2TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O)[C@H]2OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@@H]12 | 2594.0 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,2TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H]2OP(=O)(O)O[C@@H]2[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 2581.1 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,2TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H]2OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@@H]2[C@H](O)[C@H]1O | 2603.2 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]2OP(=O)(O)O[C@@H]2[C@@H]1O[Si](C)(C)C(C)(C)C | 2817.4 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,3TBDMS,isomer #10 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H]2OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@@H]2[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 2790.8 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2OP(=O)(O)O[C@@H]2[C@@H]1O[Si](C)(C)C(C)(C)C | 2845.8 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O)[C@@H]2OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@@H]2[C@@H]1O[Si](C)(C)C(C)(C)C | 2809.8 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,3TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2OP(=O)(O)O[C@H]2[C@@H]1O[Si](C)(C)C(C)(C)C | 2845.8 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,3TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@H]2[C@@H]1O | 2816.6 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,3TBDMS,isomer #6 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@@H]12 | 2830.2 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,3TBDMS,isomer #7 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2OP(=O)(O)O[C@@H]2[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 2817.4 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,3TBDMS,isomer #8 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@@H]2[C@H](O)[C@H]1O | 2809.8 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,3TBDMS,isomer #9 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@@H]2[C@@H]1O | 2816.6 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2OP(=O)(O)O[C@H]2[C@@H]1O[Si](C)(C)C(C)(C)C | 3027.2 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,4TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]2OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@@H]2[C@@H]1O[Si](C)(C)C(C)(C)C | 2985.3 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,4TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@@H]2[C@@H]1O[Si](C)(C)C(C)(C)C | 3004.6 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,4TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@H]2[C@@H]1O[Si](C)(C)C(C)(C)C | 3004.6 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,4TBDMS,isomer #5 | CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@@H]2[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C | 2985.3 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@H]2[C@@H]1O[Si](C)(C)C(C)(C)C | 3200.5 | Semi standard non polar | 33892256 | | Inositol cyclic phosphate,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@H]2[C@@H]1O[Si](C)(C)C(C)(C)C | 3148.7 | Standard non polar | 33892256 | | Inositol cyclic phosphate,5TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2OP(=O)(O[Si](C)(C)C(C)(C)C)O[C@H]2[C@@H]1O[Si](C)(C)C(C)(C)C | 2794.5 | Standard polar | 33892256 |
|
|---|