Hmdb loader
You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Human Metabolome Database.
Record Information
Version5.0
StatusDetected and Quantified
Creation Date2005-11-16 15:48:42 UTC
Update Date2021-10-13 04:34:07 UTC
HMDB IDHMDB0001262
Secondary Accession Numbers
  • HMDB01262
Metabolite Identification
Common NameMaltotriose
DescriptionMaltotriose is a trisaccharide (three-part sugar) consisting of three glucose molecules linked with α-1,4 glycosidic bonds. It is most commonly produced by the digestive enzyme alpha-amylase (a common enzyme in human saliva) on amylose in starch. The creation of both maltotriose and maltose during this process is due to the random manner in which alpha amylase hydrolyses α-1,4 glycosidic bonds. It is the shortest chain oligosaccharide that can be classified as maltodextrin. Maltotriose belongs to the class of organic compounds known as oligosaccharides. These are carbohydrates made up of 3 to 10 monosaccharide units linked to each other through glycosidic bonds. Maltotriose is a common oligosaccharide metabolite found in human urine after maltose ingestion or infusion (PMID:6645121 ). Maltotriose is increased in glycogen storage disease II (OMIM: 232300 ) due to a mutation of the enzyme alpha-1,4-glucosidase (EC 3.2.1.20) (PMID:4286143 ).
Structure
Data?1582752187
Synonyms
ValueSource
(2R,3R,4S,5S,6R)-2-{[(2R,3S,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-{[(2R,3S,4R,5R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}oxan-3-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triolChEBI
alpha-D-GLC-(1->4)-alpha-D-GLC-(1->4)-D-GLCChEBI
alpha-D-Glucosyl-(1->4)-alpha-D-glucosyl-(1->4)-D-glucooseChEBI
AmylotrioseChEBI
D-MaltotrioseChEBI
Glcalpha1-4glcalpha1-4GLCChEBI
WURCS=2.0/2,3,2/[a2122h-1x_1-5][a2122h-1a_1-5]/1-2-2/a4-b1_b4-C1ChEBI
a-D-GLC-(1->4)-a-D-GLC-(1->4)-D-GLCGenerator
Α-D-GLC-(1->4)-α-D-GLC-(1->4)-D-GLCGenerator
a-D-Glucosyl-(1->4)-a-D-glucosyl-(1->4)-D-glucooseGenerator
Α-D-glucosyl-(1->4)-α-D-glucosyl-(1->4)-D-glucooseGenerator
4-O-(4-O-Hexopyranosylhexopyranosyl)hexoseHMDB
D-(+)-MaltotrioseHMDB
delta-(+)-MaltotrioseHMDB
O-alpha-D-Glucopyranosyl-(1beta94)-O-alpha-D-glucopyranosyl-(1beta94)-O-alpha-D-glucoseHMDB
O-alpha-delta-Glucopyranosyl-(1beta94)-O-alpha-delta-glucopyranosyl-(1beta94)-O-alpha-delta-glucoseHMDB
Chemical FormulaC18H32O16
Average Molecular Weight504.4371
Monoisotopic Molecular Weight504.169034976
IUPAC Name(2R,3R,4S,5S,6R)-2-{[(2R,3S,4R,5R,6R)-4,5-dihydroxy-2-(hydroxymethyl)-6-{[(2R,3S,4R,5R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}oxan-3-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol
Traditional Namemaltotriose
CAS Registry Number1109-28-0
SMILES
OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@@H](O[C@H]3[C@H](O)[C@@H](O)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O
InChI Identifier
InChI=1S/C18H32O16/c19-1-4-7(22)8(23)12(27)17(31-4)34-15-6(3-21)32-18(13(28)10(15)25)33-14-5(2-20)30-16(29)11(26)9(14)24/h4-29H,1-3H2/t4-,5-,6-,7-,8+,9-,10-,11-,12-,13-,14-,15-,16?,17-,18-/m1/s1
InChI KeyFYGDTMLNYKFZSV-DZOUCCHMSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as oligosaccharides. These are carbohydrates made up of 3 to 10 monosaccharide units linked to each other through glycosidic bonds.
KingdomOrganic compounds
Super ClassOrganic oxygen compounds
ClassOrganooxygen compounds
Sub ClassCarbohydrates and carbohydrate conjugates
Direct ParentOligosaccharides
Alternative Parents
Substituents
  • Oligosaccharide
  • O-glycosyl compound
  • Glycosyl compound
  • Oxane
  • Secondary alcohol
  • Hemiacetal
  • Oxacycle
  • Organoheterocyclic compound
  • Polyol
  • Acetal
  • Hydrocarbon derivative
  • Primary alcohol
  • Alcohol
  • Aliphatic heteromonocyclic compound
Molecular FrameworkAliphatic heteromonocyclic compounds
External DescriptorsNot Available
Ontology
Physiological effect

Adverse health effect

Disposition

Biological location

Source

Process

Naturally occurring process

Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling Point958.89 °C. @ 760.00 mm Hg (est)The Good Scents Company Information System
Water Solubility1000000 mg/L @ 25 °C (est)The Good Scents Company Information System
LogP-4.137 (est)The Good Scents Company Information System
Experimental Chromatographic Properties

Experimental Collision Cross Sections

Adduct TypeData SourceCCS Value (Å2)Reference
[M-H]-Baker213.00630932474
Predicted Molecular Properties
PropertyValueSource
Water Solubility554 g/LALOGPS
logP-2.7ALOGPS
logP-6.5ChemAxon
logS0.04ALOGPS
pKa (Strongest Acidic)11.22ChemAxon
pKa (Strongest Basic)-3.6ChemAxon
Physiological Charge0ChemAxon
Hydrogen Acceptor Count16ChemAxon
Hydrogen Donor Count11ChemAxon
Polar Surface Area268.68 ŲChemAxon
Rotatable Bond Count7ChemAxon
Refractivity100.75 m³·mol⁻¹ChemAxon
Polarizability46.65 ųChemAxon
Number of Rings3ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleYesChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
AllCCS[M+H]+208.67532859911
AllCCS[M-H]-206.25132859911
DeepCCS[M+H]+204.6530932474
DeepCCS[M-H]-202.75530932474
DeepCCS[M-2H]-236.78230932474
DeepCCS[M+Na]+210.7330932474

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
MaltotrioseOC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@@H](O[C@H]3[C@H](O)[C@@H](O)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3391.9Standard polar33892256
MaltotrioseOC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@@H](O[C@H]3[C@H](O)[C@@H](O)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O4169.8Standard non polar33892256
MaltotrioseOC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O)[C@@H](O[C@H]3[C@H](O)[C@@H](O)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O4233.6Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
Maltotriose,1TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3929.4Semi standard non polar33892256
Maltotriose,1TMS,isomer #10C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@@H]1O3930.3Semi standard non polar33892256
Maltotriose,1TMS,isomer #11C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3935.1Semi standard non polar33892256
Maltotriose,1TMS,isomer #2C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3932.3Semi standard non polar33892256
Maltotriose,1TMS,isomer #3C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O3932.4Semi standard non polar33892256
Maltotriose,1TMS,isomer #4C[Si](C)(C)O[C@@H]1[C@@H](O)C(O)O[C@H](CO)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3940.1Semi standard non polar33892256
Maltotriose,1TMS,isomer #5C[Si](C)(C)O[C@H]1C(O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@@H]1O3966.9Semi standard non polar33892256
Maltotriose,1TMS,isomer #6C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3982.7Semi standard non polar33892256
Maltotriose,1TMS,isomer #7C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3937.7Semi standard non polar33892256
Maltotriose,1TMS,isomer #8C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3936.8Semi standard non polar33892256
Maltotriose,1TMS,isomer #9C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3944.3Semi standard non polar33892256
Maltotriose,2TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3879.9Semi standard non polar33892256
Maltotriose,2TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3889.3Semi standard non polar33892256
Maltotriose,2TMS,isomer #11C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3865.8Semi standard non polar33892256
Maltotriose,2TMS,isomer #12C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3862.4Semi standard non polar33892256
Maltotriose,2TMS,isomer #13C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3888.2Semi standard non polar33892256
Maltotriose,2TMS,isomer #14C[Si](C)(C)O[C@H]1C(O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3876.0Semi standard non polar33892256
Maltotriose,2TMS,isomer #15C[Si](C)(C)O[C@@H]1[C@@H](O)C(O)O[C@H](CO)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3854.5Semi standard non polar33892256
Maltotriose,2TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3867.1Semi standard non polar33892256
Maltotriose,2TMS,isomer #17C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3861.0Semi standard non polar33892256
Maltotriose,2TMS,isomer #18C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3846.8Semi standard non polar33892256
Maltotriose,2TMS,isomer #19C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3860.6Semi standard non polar33892256
Maltotriose,2TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3880.4Semi standard non polar33892256
Maltotriose,2TMS,isomer #20C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@H]1O3864.7Semi standard non polar33892256
Maltotriose,2TMS,isomer #21C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@@H]1O3851.4Semi standard non polar33892256
Maltotriose,2TMS,isomer #22C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)O[C@@H]1CO3862.7Semi standard non polar33892256
Maltotriose,2TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3870.6Semi standard non polar33892256
Maltotriose,2TMS,isomer #24C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3865.5Semi standard non polar33892256
Maltotriose,2TMS,isomer #25C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3896.0Semi standard non polar33892256
Maltotriose,2TMS,isomer #26C[Si](C)(C)O[C@H]1C(O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3879.8Semi standard non polar33892256
Maltotriose,2TMS,isomer #27C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O[Si](C)(C)C3858.9Semi standard non polar33892256
Maltotriose,2TMS,isomer #28C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O)O[C@H](CO)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3900.8Semi standard non polar33892256
Maltotriose,2TMS,isomer #29C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3880.7Semi standard non polar33892256
Maltotriose,2TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3907.5Semi standard non polar33892256
Maltotriose,2TMS,isomer #30C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3865.5Semi standard non polar33892256
Maltotriose,2TMS,isomer #31C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3872.5Semi standard non polar33892256
Maltotriose,2TMS,isomer #32C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3871.0Semi standard non polar33892256
Maltotriose,2TMS,isomer #33C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3858.1Semi standard non polar33892256
Maltotriose,2TMS,isomer #34C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3871.7Semi standard non polar33892256
Maltotriose,2TMS,isomer #35C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3921.0Semi standard non polar33892256
Maltotriose,2TMS,isomer #36C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3890.4Semi standard non polar33892256
Maltotriose,2TMS,isomer #37C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3894.7Semi standard non polar33892256
Maltotriose,2TMS,isomer #38C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3896.2Semi standard non polar33892256
Maltotriose,2TMS,isomer #39C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@@H]1O3882.5Semi standard non polar33892256
Maltotriose,2TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3893.0Semi standard non polar33892256
Maltotriose,2TMS,isomer #40C[Si](C)(C)O[C@H]1C(O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3896.6Semi standard non polar33892256
Maltotriose,2TMS,isomer #41C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3896.1Semi standard non polar33892256
Maltotriose,2TMS,isomer #42C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3908.7Semi standard non polar33892256
Maltotriose,2TMS,isomer #43C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3913.5Semi standard non polar33892256
Maltotriose,2TMS,isomer #44C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3899.7Semi standard non polar33892256
Maltotriose,2TMS,isomer #45C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3912.6Semi standard non polar33892256
Maltotriose,2TMS,isomer #46C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3885.4Semi standard non polar33892256
Maltotriose,2TMS,isomer #47C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3880.8Semi standard non polar33892256
Maltotriose,2TMS,isomer #48C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3865.8Semi standard non polar33892256
Maltotriose,2TMS,isomer #49C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3876.6Semi standard non polar33892256
Maltotriose,2TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3872.0Semi standard non polar33892256
Maltotriose,2TMS,isomer #50C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3878.8Semi standard non polar33892256
Maltotriose,2TMS,isomer #51C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3865.2Semi standard non polar33892256
Maltotriose,2TMS,isomer #52C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3875.9Semi standard non polar33892256
Maltotriose,2TMS,isomer #53C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3870.8Semi standard non polar33892256
Maltotriose,2TMS,isomer #54C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@@H]1CO3862.9Semi standard non polar33892256
Maltotriose,2TMS,isomer #55C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3870.2Semi standard non polar33892256
Maltotriose,2TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3863.8Semi standard non polar33892256
Maltotriose,2TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3860.1Semi standard non polar33892256
Maltotriose,2TMS,isomer #8C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3876.3Semi standard non polar33892256
Maltotriose,2TMS,isomer #9C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3861.9Semi standard non polar33892256
Maltotriose,3TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3783.1Semi standard non polar33892256
Maltotriose,3TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3801.8Semi standard non polar33892256
Maltotriose,3TMS,isomer #100C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3782.5Semi standard non polar33892256
Maltotriose,3TMS,isomer #101C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3824.2Semi standard non polar33892256
Maltotriose,3TMS,isomer #102C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3813.7Semi standard non polar33892256
Maltotriose,3TMS,isomer #103C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3777.1Semi standard non polar33892256
Maltotriose,3TMS,isomer #104C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3802.8Semi standard non polar33892256
Maltotriose,3TMS,isomer #105C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3800.3Semi standard non polar33892256
Maltotriose,3TMS,isomer #106C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3757.0Semi standard non polar33892256
Maltotriose,3TMS,isomer #107C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3797.1Semi standard non polar33892256
Maltotriose,3TMS,isomer #108C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3832.6Semi standard non polar33892256
Maltotriose,3TMS,isomer #109C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O)O[C@H](CO)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3817.9Semi standard non polar33892256
Maltotriose,3TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3813.3Semi standard non polar33892256
Maltotriose,3TMS,isomer #110C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3853.3Semi standard non polar33892256
Maltotriose,3TMS,isomer #111C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3819.9Semi standard non polar33892256
Maltotriose,3TMS,isomer #112C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3826.3Semi standard non polar33892256
Maltotriose,3TMS,isomer #113C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3830.4Semi standard non polar33892256
Maltotriose,3TMS,isomer #114C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@@H]1O3817.6Semi standard non polar33892256
Maltotriose,3TMS,isomer #115C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O)O[C@H](CO)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3828.4Semi standard non polar33892256
Maltotriose,3TMS,isomer #116C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3792.1Semi standard non polar33892256
Maltotriose,3TMS,isomer #117C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3808.7Semi standard non polar33892256
Maltotriose,3TMS,isomer #118C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3813.9Semi standard non polar33892256
Maltotriose,3TMS,isomer #119C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3801.2Semi standard non polar33892256
Maltotriose,3TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3761.0Semi standard non polar33892256
Maltotriose,3TMS,isomer #120C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3811.6Semi standard non polar33892256
Maltotriose,3TMS,isomer #121C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3765.2Semi standard non polar33892256
Maltotriose,3TMS,isomer #122C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3782.5Semi standard non polar33892256
Maltotriose,3TMS,isomer #123C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3761.5Semi standard non polar33892256
Maltotriose,3TMS,isomer #124C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3778.6Semi standard non polar33892256
Maltotriose,3TMS,isomer #125C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3796.6Semi standard non polar33892256
Maltotriose,3TMS,isomer #126C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3779.5Semi standard non polar33892256
Maltotriose,3TMS,isomer #127C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3793.9Semi standard non polar33892256
Maltotriose,3TMS,isomer #128C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1CO3791.9Semi standard non polar33892256
Maltotriose,3TMS,isomer #129C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3791.3Semi standard non polar33892256
Maltotriose,3TMS,isomer #13C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3774.5Semi standard non polar33892256
Maltotriose,3TMS,isomer #130C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3793.7Semi standard non polar33892256
Maltotriose,3TMS,isomer #131C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3827.9Semi standard non polar33892256
Maltotriose,3TMS,isomer #132C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3847.4Semi standard non polar33892256
Maltotriose,3TMS,isomer #133C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3846.2Semi standard non polar33892256
Maltotriose,3TMS,isomer #134C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3834.4Semi standard non polar33892256
Maltotriose,3TMS,isomer #135C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3845.6Semi standard non polar33892256
Maltotriose,3TMS,isomer #136C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3819.4Semi standard non polar33892256
Maltotriose,3TMS,isomer #137C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3813.9Semi standard non polar33892256
Maltotriose,3TMS,isomer #138C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3794.1Semi standard non polar33892256
Maltotriose,3TMS,isomer #139C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3810.5Semi standard non polar33892256
Maltotriose,3TMS,isomer #14C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3770.8Semi standard non polar33892256
Maltotriose,3TMS,isomer #140C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3826.3Semi standard non polar33892256
Maltotriose,3TMS,isomer #141C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3806.0Semi standard non polar33892256
Maltotriose,3TMS,isomer #142C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3822.5Semi standard non polar33892256
Maltotriose,3TMS,isomer #143C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@@H]1CO3813.0Semi standard non polar33892256
Maltotriose,3TMS,isomer #144C[Si](C)(C)O[C@H]1C(O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O)[C@H]2O)[C@@H]1O3814.6Semi standard non polar33892256
Maltotriose,3TMS,isomer #145C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3817.4Semi standard non polar33892256
Maltotriose,3TMS,isomer #146C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3807.3Semi standard non polar33892256
Maltotriose,3TMS,isomer #147C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3820.5Semi standard non polar33892256
Maltotriose,3TMS,isomer #148C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3803.9Semi standard non polar33892256
Maltotriose,3TMS,isomer #149C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3816.8Semi standard non polar33892256
Maltotriose,3TMS,isomer #15C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3792.9Semi standard non polar33892256
Maltotriose,3TMS,isomer #150C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3839.2Semi standard non polar33892256
Maltotriose,3TMS,isomer #151C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3822.1Semi standard non polar33892256
Maltotriose,3TMS,isomer #152C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3834.1Semi standard non polar33892256
Maltotriose,3TMS,isomer #153C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3827.3Semi standard non polar33892256
Maltotriose,3TMS,isomer #154C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3828.8Semi standard non polar33892256
Maltotriose,3TMS,isomer #155C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3829.6Semi standard non polar33892256
Maltotriose,3TMS,isomer #156C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3798.1Semi standard non polar33892256
Maltotriose,3TMS,isomer #157C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3778.3Semi standard non polar33892256
Maltotriose,3TMS,isomer #158C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3792.7Semi standard non polar33892256
Maltotriose,3TMS,isomer #159C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3791.7Semi standard non polar33892256
Maltotriose,3TMS,isomer #16C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3765.0Semi standard non polar33892256
Maltotriose,3TMS,isomer #160C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3793.9Semi standard non polar33892256
Maltotriose,3TMS,isomer #161C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3787.9Semi standard non polar33892256
Maltotriose,3TMS,isomer #162C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3798.2Semi standard non polar33892256
Maltotriose,3TMS,isomer #163C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3800.2Semi standard non polar33892256
Maltotriose,3TMS,isomer #164C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3796.4Semi standard non polar33892256
Maltotriose,3TMS,isomer #165C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3812.7Semi standard non polar33892256
Maltotriose,3TMS,isomer #17C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3803.1Semi standard non polar33892256
Maltotriose,3TMS,isomer #18C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3847.6Semi standard non polar33892256
Maltotriose,3TMS,isomer #19C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3809.9Semi standard non polar33892256
Maltotriose,3TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3819.6Semi standard non polar33892256
Maltotriose,3TMS,isomer #20C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3820.6Semi standard non polar33892256
Maltotriose,3TMS,isomer #21C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3813.7Semi standard non polar33892256
Maltotriose,3TMS,isomer #22C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3837.4Semi standard non polar33892256
Maltotriose,3TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3814.5Semi standard non polar33892256
Maltotriose,3TMS,isomer #24C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3847.4Semi standard non polar33892256
Maltotriose,3TMS,isomer #25C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3827.0Semi standard non polar33892256
Maltotriose,3TMS,isomer #26C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3810.7Semi standard non polar33892256
Maltotriose,3TMS,isomer #27C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3805.2Semi standard non polar33892256
Maltotriose,3TMS,isomer #28C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3825.9Semi standard non polar33892256
Maltotriose,3TMS,isomer #29C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3802.4Semi standard non polar33892256
Maltotriose,3TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3819.9Semi standard non polar33892256
Maltotriose,3TMS,isomer #30C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3835.7Semi standard non polar33892256
Maltotriose,3TMS,isomer #31C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3774.9Semi standard non polar33892256
Maltotriose,3TMS,isomer #32C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3775.4Semi standard non polar33892256
Maltotriose,3TMS,isomer #33C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3797.2Semi standard non polar33892256
Maltotriose,3TMS,isomer #34C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3772.3Semi standard non polar33892256
Maltotriose,3TMS,isomer #35C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3804.6Semi standard non polar33892256
Maltotriose,3TMS,isomer #36C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3787.0Semi standard non polar33892256
Maltotriose,3TMS,isomer #37C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3797.1Semi standard non polar33892256
Maltotriose,3TMS,isomer #38C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3772.8Semi standard non polar33892256
Maltotriose,3TMS,isomer #39C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3806.6Semi standard non polar33892256
Maltotriose,3TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3776.7Semi standard non polar33892256
Maltotriose,3TMS,isomer #40C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3785.6Semi standard non polar33892256
Maltotriose,3TMS,isomer #41C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3769.1Semi standard non polar33892256
Maltotriose,3TMS,isomer #42C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3802.9Semi standard non polar33892256
Maltotriose,3TMS,isomer #43C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3804.0Semi standard non polar33892256
Maltotriose,3TMS,isomer #44C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3811.7Semi standard non polar33892256
Maltotriose,3TMS,isomer #45C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3807.3Semi standard non polar33892256
Maltotriose,3TMS,isomer #46C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@H]1O3807.5Semi standard non polar33892256
Maltotriose,3TMS,isomer #47C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@@H]1O3785.7Semi standard non polar33892256
Maltotriose,3TMS,isomer #48C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3792.1Semi standard non polar33892256
Maltotriose,3TMS,isomer #49C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3790.6Semi standard non polar33892256
Maltotriose,3TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3785.5Semi standard non polar33892256
Maltotriose,3TMS,isomer #50C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3780.1Semi standard non polar33892256
Maltotriose,3TMS,isomer #51C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3817.2Semi standard non polar33892256
Maltotriose,3TMS,isomer #52C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@@H]1O[Si](C)(C)C3812.1Semi standard non polar33892256
Maltotriose,3TMS,isomer #53C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3779.9Semi standard non polar33892256
Maltotriose,3TMS,isomer #54C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3798.1Semi standard non polar33892256
Maltotriose,3TMS,isomer #55C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3794.1Semi standard non polar33892256
Maltotriose,3TMS,isomer #56C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3759.9Semi standard non polar33892256
Maltotriose,3TMS,isomer #57C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3768.2Semi standard non polar33892256
Maltotriose,3TMS,isomer #58C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3790.4Semi standard non polar33892256
Maltotriose,3TMS,isomer #59C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3768.8Semi standard non polar33892256
Maltotriose,3TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3769.9Semi standard non polar33892256
Maltotriose,3TMS,isomer #60C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3776.2Semi standard non polar33892256
Maltotriose,3TMS,isomer #61C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3813.5Semi standard non polar33892256
Maltotriose,3TMS,isomer #62C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3819.6Semi standard non polar33892256
Maltotriose,3TMS,isomer #63C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3804.0Semi standard non polar33892256
Maltotriose,3TMS,isomer #64C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3811.7Semi standard non polar33892256
Maltotriose,3TMS,isomer #65C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3791.7Semi standard non polar33892256
Maltotriose,3TMS,isomer #66C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3827.0Semi standard non polar33892256
Maltotriose,3TMS,isomer #67C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3804.7Semi standard non polar33892256
Maltotriose,3TMS,isomer #68C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3807.4Semi standard non polar33892256
Maltotriose,3TMS,isomer #69C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3792.0Semi standard non polar33892256
Maltotriose,3TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3796.7Semi standard non polar33892256
Maltotriose,3TMS,isomer #70C[Si](C)(C)O[C@H]1C(O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3803.0Semi standard non polar33892256
Maltotriose,3TMS,isomer #71C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O)O[C@H](CO)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3812.7Semi standard non polar33892256
Maltotriose,3TMS,isomer #72C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3771.0Semi standard non polar33892256
Maltotriose,3TMS,isomer #73C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3784.7Semi standard non polar33892256
Maltotriose,3TMS,isomer #74C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3769.1Semi standard non polar33892256
Maltotriose,3TMS,isomer #75C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3779.2Semi standard non polar33892256
Maltotriose,3TMS,isomer #76C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3795.3Semi standard non polar33892256
Maltotriose,3TMS,isomer #77C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3773.3Semi standard non polar33892256
Maltotriose,3TMS,isomer #78C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3780.4Semi standard non polar33892256
Maltotriose,3TMS,isomer #79C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3790.4Semi standard non polar33892256
Maltotriose,3TMS,isomer #8C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3770.9Semi standard non polar33892256
Maltotriose,3TMS,isomer #80C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3790.0Semi standard non polar33892256
Maltotriose,3TMS,isomer #81C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3788.7Semi standard non polar33892256
Maltotriose,3TMS,isomer #82C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3794.0Semi standard non polar33892256
Maltotriose,3TMS,isomer #83C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3828.9Semi standard non polar33892256
Maltotriose,3TMS,isomer #84C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@H]1O3812.6Semi standard non polar33892256
Maltotriose,3TMS,isomer #85C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@H]1O3789.0Semi standard non polar33892256
Maltotriose,3TMS,isomer #86C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3802.7Semi standard non polar33892256
Maltotriose,3TMS,isomer #87C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@@H]1CO3797.3Semi standard non polar33892256
Maltotriose,3TMS,isomer #88C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O3797.1Semi standard non polar33892256
Maltotriose,3TMS,isomer #89C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3773.7Semi standard non polar33892256
Maltotriose,3TMS,isomer #9C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3806.9Semi standard non polar33892256
Maltotriose,3TMS,isomer #90C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3813.2Semi standard non polar33892256
Maltotriose,3TMS,isomer #91C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@@H]1O3797.6Semi standard non polar33892256
Maltotriose,3TMS,isomer #92C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@@H]1O3775.8Semi standard non polar33892256
Maltotriose,3TMS,isomer #93C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3783.0Semi standard non polar33892256
Maltotriose,3TMS,isomer #94C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@@H]1O[Si](C)(C)C3797.5Semi standard non polar33892256
Maltotriose,3TMS,isomer #95C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3784.6Semi standard non polar33892256
Maltotriose,3TMS,isomer #96C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3822.3Semi standard non polar33892256
Maltotriose,3TMS,isomer #97C[Si](C)(C)O[C@H]1C(O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3808.5Semi standard non polar33892256
Maltotriose,3TMS,isomer #98C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3784.0Semi standard non polar33892256
Maltotriose,3TMS,isomer #99C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3795.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3651.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3669.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #100C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3717.4Semi standard non polar33892256
Maltotriose,4TMS,isomer #101C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3678.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #102C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3665.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #103C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3644.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #104C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3681.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #105C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3667.7Semi standard non polar33892256
Maltotriose,4TMS,isomer #106C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3647.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #107C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3686.4Semi standard non polar33892256
Maltotriose,4TMS,isomer #108C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3691.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #109C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3694.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3688.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #110C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3699.7Semi standard non polar33892256
Maltotriose,4TMS,isomer #111C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3691.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #112C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3676.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #113C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3713.7Semi standard non polar33892256
Maltotriose,4TMS,isomer #114C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3688.4Semi standard non polar33892256
Maltotriose,4TMS,isomer #115C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3688.4Semi standard non polar33892256
Maltotriose,4TMS,isomer #116C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3697.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #117C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3685.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #118C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3683.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #119C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3698.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3671.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #120C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3728.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #121C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3694.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #122C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3751.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #123C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@H]1O3731.7Semi standard non polar33892256
Maltotriose,4TMS,isomer #124C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@H]1O3715.7Semi standard non polar33892256
Maltotriose,4TMS,isomer #125C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3712.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #126C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@@H]1CO3706.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #127C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3718.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #128C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3662.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #129C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3718.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #13C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3696.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #130C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@@H]1O3697.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #131C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@@H]1O3686.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #132C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3680.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #133C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@@H]1O[Si](C)(C)C3709.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #134C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3684.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #135C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3670.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #136C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3723.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #137C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@@H]1O[Si](C)(C)C3709.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #138C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3689.4Semi standard non polar33892256
Maltotriose,4TMS,isomer #139C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3659.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #14C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3674.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #140C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3713.7Semi standard non polar33892256
Maltotriose,4TMS,isomer #141C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3707.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #142C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3675.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #143C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3687.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #144C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3692.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #145C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3655.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #146C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3713.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #147C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3743.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #148C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O)O[C@H](CO)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3747.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #149C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3672.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #15C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3709.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #150C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3656.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #151C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3645.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #152C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3691.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #153C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3660.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #154C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3668.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #155C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3700.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #156C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3653.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #157C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3687.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #158C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3651.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #159C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3666.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3706.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #160C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3618.7Semi standard non polar33892256
Maltotriose,4TMS,isomer #161C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3663.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #162C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3630.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #163C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3643.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #164C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3660.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #165C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3629.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #166C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3637.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #167C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3671.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #168C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3664.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #169C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3661.7Semi standard non polar33892256
Maltotriose,4TMS,isomer #17C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3678.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #170C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3692.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #171C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3672.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #172C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3708.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #173C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3677.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #174C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3682.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #175C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3726.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #176C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3715.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #177C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3720.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #178C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3743.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #179C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3718.4Semi standard non polar33892256
Maltotriose,4TMS,isomer #18C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3663.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #180C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3688.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #181C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3709.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #182C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3695.7Semi standard non polar33892256
Maltotriose,4TMS,isomer #183C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3717.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #184C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3744.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #185C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3705.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #186C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3692.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #187C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3659.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #188C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3672.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #189C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3746.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #19C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3687.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #190C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3695.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #191C[Si](C)(C)O[C@H]1C(O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3706.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #192C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3711.7Semi standard non polar33892256
Maltotriose,4TMS,isomer #193C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3702.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #194C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O)O[C@H](CO)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3726.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #195C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3675.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #196C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3645.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #197C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3654.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #198C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3684.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #199C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3695.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3664.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #20C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3661.7Semi standard non polar33892256
Maltotriose,4TMS,isomer #200C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3690.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #201C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3678.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #202C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3672.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #203C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3668.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #204C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3713.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #205C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3689.4Semi standard non polar33892256
Maltotriose,4TMS,isomer #206C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3684.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #207C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3657.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #208C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3674.4Semi standard non polar33892256
Maltotriose,4TMS,isomer #209C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3671.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #21C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3701.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #210C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3664.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #211C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3719.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #212C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3724.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #213C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3716.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #214C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3713.4Semi standard non polar33892256
Maltotriose,4TMS,isomer #215C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3738.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #216C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@H]1O3740.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #217C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3700.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #218C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)O[C@@H]1CO3690.7Semi standard non polar33892256
Maltotriose,4TMS,isomer #219C[Si](C)(C)O[C@H]1C(O)O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3703.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #22C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3643.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #220C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3676.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #221C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@@H]1CO3681.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #222C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](CO)O[C@@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O[Si](C)(C)C3690.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #223C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3685.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #224C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3679.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #225C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@@H]1O[Si](C)(C)C3714.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #226C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3659.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #227C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3649.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #228C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3624.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #229C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3641.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3636.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #230C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3663.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #231C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3687.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #232C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3719.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #233C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3684.4Semi standard non polar33892256
Maltotriose,4TMS,isomer #234C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3707.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #235C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@@H]1O3708.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #236C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3668.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #237C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@@H]1O[Si](C)(C)C3700.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #238C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3645.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #239C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@@H]1O[Si](C)(C)C3684.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #24C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3660.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #240C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3678.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #241C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3671.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #242C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3664.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #243C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3638.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #244C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3653.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #245C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3697.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #246C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3690.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #247C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3714.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #248C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3680.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #249C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O)O[C@H](CO)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3718.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #25C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3640.4Semi standard non polar33892256
Maltotriose,4TMS,isomer #250C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3655.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #251C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3661.7Semi standard non polar33892256
Maltotriose,4TMS,isomer #252C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3667.4Semi standard non polar33892256
Maltotriose,4TMS,isomer #253C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3628.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #254C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3704.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #255C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3675.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #256C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3707.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #257C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3670.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #258C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3649.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #259C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3695.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #26C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3674.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #260C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3736.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #261C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3707.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #262C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3729.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #263C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3771.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #264C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3743.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #265C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3753.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #266C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3697.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #267C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3729.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #268C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3694.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #269C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3712.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #27C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3675.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #270C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3738.7Semi standard non polar33892256
Maltotriose,4TMS,isomer #271C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3708.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #272C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3721.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #273C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@@H]1CO3744.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #274C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O)O[C@H](CO)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3754.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #275C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O)O[C@H](CO)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3753.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #276C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3642.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #277C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3685.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #278C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3657.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #279C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3667.4Semi standard non polar33892256
Maltotriose,4TMS,isomer #28C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3669.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #280C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3709.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #281C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3680.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #282C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3690.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #283C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3729.7Semi standard non polar33892256
Maltotriose,4TMS,isomer #284C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3720.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #285C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3723.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #286C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3652.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #287C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3625.7Semi standard non polar33892256
Maltotriose,4TMS,isomer #288C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3638.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #289C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3667.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #29C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3648.7Semi standard non polar33892256
Maltotriose,4TMS,isomer #290C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3662.7Semi standard non polar33892256
Maltotriose,4TMS,isomer #291C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3661.4Semi standard non polar33892256
Maltotriose,4TMS,isomer #292C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3684.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #293C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3679.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #294C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3679.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #295C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3726.4Semi standard non polar33892256
Maltotriose,4TMS,isomer #296C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3658.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #297C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3701.7Semi standard non polar33892256
Maltotriose,4TMS,isomer #298C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3676.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #299C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3683.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3619.4Semi standard non polar33892256
Maltotriose,4TMS,isomer #30C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3686.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #300C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3726.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #301C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3701.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #302C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3708.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #303C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3751.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #304C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3741.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #305C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3746.4Semi standard non polar33892256
Maltotriose,4TMS,isomer #306C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3689.7Semi standard non polar33892256
Maltotriose,4TMS,isomer #307C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3658.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #308C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3673.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #309C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3694.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #31C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3652.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #310C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3687.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #311C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3688.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #312C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3702.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #313C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3694.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #314C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3698.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #315C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3738.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #316C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3684.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #317C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3657.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #318C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3667.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #319C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3694.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #32C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3635.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #320C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3692.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #321C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3688.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #322C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3713.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #323C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3713.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #324C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3710.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #325C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3755.7Semi standard non polar33892256
Maltotriose,4TMS,isomer #326C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3665.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #327C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3667.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #328C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3660.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #329C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3697.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #33C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3671.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #330C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3708.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #34C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3678.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #35C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3687.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #36C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3685.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #37C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3660.7Semi standard non polar33892256
Maltotriose,4TMS,isomer #38C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3645.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #39C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3657.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3642.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #40C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3656.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #41C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3674.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #42C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3651.4Semi standard non polar33892256
Maltotriose,4TMS,isomer #43C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3688.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #44C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3698.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #45C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3663.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #46C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3663.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #47C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3680.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #48C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3652.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #49C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3692.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3626.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #50C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3622.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #51C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3627.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #52C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3643.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #53C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3622.4Semi standard non polar33892256
Maltotriose,4TMS,isomer #54C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3656.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #55C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3658.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #56C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3655.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #57C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3634.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #58C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3670.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #59C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3648.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3652.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #60C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3633.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #61C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3668.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #62C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3670.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #63C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3679.4Semi standard non polar33892256
Maltotriose,4TMS,isomer #64C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3676.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #65C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3737.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #66C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3705.4Semi standard non polar33892256
Maltotriose,4TMS,isomer #67C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3708.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #68C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3720.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #69C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3696.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #7C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3629.4Semi standard non polar33892256
Maltotriose,4TMS,isomer #70C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3733.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #71C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3680.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #72C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3687.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #73C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3701.7Semi standard non polar33892256
Maltotriose,4TMS,isomer #74C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3677.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #75C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3714.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #76C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3714.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #77C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3705.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #78C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3679.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #79C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3718.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #8C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3665.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #80C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3698.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #81C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3678.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #82C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3719.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #83C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3723.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #84C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3729.3Semi standard non polar33892256
Maltotriose,4TMS,isomer #85C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3729.7Semi standard non polar33892256
Maltotriose,4TMS,isomer #86C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3711.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #87C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3717.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #88C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3732.2Semi standard non polar33892256
Maltotriose,4TMS,isomer #89C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3704.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #9C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3688.5Semi standard non polar33892256
Maltotriose,4TMS,isomer #90C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3745.6Semi standard non polar33892256
Maltotriose,4TMS,isomer #91C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3706.8Semi standard non polar33892256
Maltotriose,4TMS,isomer #92C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3687.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #93C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3657.1Semi standard non polar33892256
Maltotriose,4TMS,isomer #94C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3700.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #95C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3686.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #96C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3658.9Semi standard non polar33892256
Maltotriose,4TMS,isomer #97C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3703.7Semi standard non polar33892256
Maltotriose,4TMS,isomer #98C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3710.0Semi standard non polar33892256
Maltotriose,4TMS,isomer #99C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3709.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3497.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3497.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #100C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3512.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #101C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3478.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #102C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3525.6Semi standard non polar33892256
Maltotriose,5TMS,isomer #103C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3531.6Semi standard non polar33892256
Maltotriose,5TMS,isomer #104C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3522.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #105C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3547.7Semi standard non polar33892256
Maltotriose,5TMS,isomer #106C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3540.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #107C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3551.0Semi standard non polar33892256
Maltotriose,5TMS,isomer #108C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3562.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #109C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3524.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3510.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #110C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3576.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #111C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3529.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #112C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3506.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #113C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3483.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #114C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3520.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #115C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3516.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #116C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3490.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #117C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3527.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #118C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3535.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #119C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3526.0Semi standard non polar33892256
Maltotriose,5TMS,isomer #12C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3485.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #120C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3549.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #121C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3511.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #122C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3487.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #123C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3470.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #124C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3500.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #125C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3494.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #126C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3475.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #127C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3505.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #128C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3513.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #129C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3500.6Semi standard non polar33892256
Maltotriose,5TMS,isomer #13C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3524.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #130C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3525.6Semi standard non polar33892256
Maltotriose,5TMS,isomer #131C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3522.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #132C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3508.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #133C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3537.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #134C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3508.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #135C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3497.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #136C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3517.0Semi standard non polar33892256
Maltotriose,5TMS,isomer #137C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3515.7Semi standard non polar33892256
Maltotriose,5TMS,isomer #138C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3500.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #139C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3525.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #14C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3470.0Semi standard non polar33892256
Maltotriose,5TMS,isomer #140C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3554.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #141C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3574.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #142C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3586.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #143C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3596.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #144C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3561.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #145C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3610.6Semi standard non polar33892256
Maltotriose,5TMS,isomer #146C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3576.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #147C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3552.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #148C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3522.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #149C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3566.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #15C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3481.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #150C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3560.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #151C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3524.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #152C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3573.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #153C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3586.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #154C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3573.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #155C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3603.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #156C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3562.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #157C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3541.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #158C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3512.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #159C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3555.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3484.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #160C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3548.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #161C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3511.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #162C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3559.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #163C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3573.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #164C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3557.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #165C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3588.6Semi standard non polar33892256
Maltotriose,5TMS,isomer #166C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3568.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #167C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3535.6Semi standard non polar33892256
Maltotriose,5TMS,isomer #168C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3583.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #169C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3561.0Semi standard non polar33892256
Maltotriose,5TMS,isomer #17C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3465.0Semi standard non polar33892256
Maltotriose,5TMS,isomer #170C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3547.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #171C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3575.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #172C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3568.6Semi standard non polar33892256
Maltotriose,5TMS,isomer #173C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3550.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #174C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3581.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #175C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3605.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #176C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3607.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #177C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3579.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #178C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3545.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #179C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3593.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #18C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3497.6Semi standard non polar33892256
Maltotriose,5TMS,isomer #180C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3588.7Semi standard non polar33892256
Maltotriose,5TMS,isomer #181C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3546.0Semi standard non polar33892256
Maltotriose,5TMS,isomer #182C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3598.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #183C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3612.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #184C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3592.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #185C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3629.7Semi standard non polar33892256
Maltotriose,5TMS,isomer #186C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3558.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #187C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3531.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #188C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3572.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #189C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3549.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #19C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3521.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #190C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3533.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #191C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3563.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #192C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3561.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #193C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3541.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #194C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3571.7Semi standard non polar33892256
Maltotriose,5TMS,isomer #195C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3592.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #196C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3543.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #197C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3528.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #198C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3563.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #199C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3539.6Semi standard non polar33892256
Maltotriose,5TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3484.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #20C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3492.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #200C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3524.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #201C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3554.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #202C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3547.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #203C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3527.7Semi standard non polar33892256
Maltotriose,5TMS,isomer #204C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3559.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #205C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3585.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #206C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3571.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #207C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3547.7Semi standard non polar33892256
Maltotriose,5TMS,isomer #208C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3583.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #209C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3570.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #21C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3481.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #210C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3580.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #211C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3562.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #212C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3562.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #213C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3541.7Semi standard non polar33892256
Maltotriose,5TMS,isomer #214C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3537.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #215C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3549.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #216C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3531.0Semi standard non polar33892256
Maltotriose,5TMS,isomer #217C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3585.0Semi standard non polar33892256
Maltotriose,5TMS,isomer #218C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3610.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #219C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3590.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #22C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3506.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #220C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3602.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #221C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3615.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #222C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@H]1O3638.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #223C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3571.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #224C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)O[C@@H]1CO3574.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #225C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@@H]1O[Si](C)(C)C3596.0Semi standard non polar33892256
Maltotriose,5TMS,isomer #226C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3560.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #227C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@@H]1CO3566.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #228C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3590.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #229C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3570.0Semi standard non polar33892256
Maltotriose,5TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3498.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #230C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3547.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #231C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3597.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #232C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3515.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #233C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3519.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #234C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3510.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #235C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3512.0Semi standard non polar33892256
Maltotriose,5TMS,isomer #236C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3544.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #237C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3535.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #238C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3592.6Semi standard non polar33892256
Maltotriose,5TMS,isomer #239C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3552.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #24C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3482.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #240C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3565.7Semi standard non polar33892256
Maltotriose,5TMS,isomer #241C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@@H]1O3589.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #242C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3531.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #243C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@@H]1O[Si](C)(C)C3579.7Semi standard non polar33892256
Maltotriose,5TMS,isomer #244C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3526.7Semi standard non polar33892256
Maltotriose,5TMS,isomer #245C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@@H]1O[Si](C)(C)C3574.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #246C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3562.0Semi standard non polar33892256
Maltotriose,5TMS,isomer #247C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3523.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #248C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3548.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #249C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3541.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #25C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3511.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #250C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3530.6Semi standard non polar33892256
Maltotriose,5TMS,isomer #251C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3532.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #252C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3536.7Semi standard non polar33892256
Maltotriose,5TMS,isomer #253C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3521.0Semi standard non polar33892256
Maltotriose,5TMS,isomer #254C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3564.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #255C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3582.6Semi standard non polar33892256
Maltotriose,5TMS,isomer #256C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O)O[C@H](CO)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3604.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #257C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3507.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #258C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3524.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #259C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3509.6Semi standard non polar33892256
Maltotriose,5TMS,isomer #26C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3512.6Semi standard non polar33892256
Maltotriose,5TMS,isomer #260C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3560.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #261C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3542.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #262C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3587.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #263C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3535.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #264C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3526.6Semi standard non polar33892256
Maltotriose,5TMS,isomer #265C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3574.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #266C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3612.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #267C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3555.0Semi standard non polar33892256
Maltotriose,5TMS,isomer #268C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3497.0Semi standard non polar33892256
Maltotriose,5TMS,isomer #269C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3551.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #27C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3506.7Semi standard non polar33892256
Maltotriose,5TMS,isomer #270C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3502.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #271C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3520.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #272C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3483.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #273C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3544.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #274C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3493.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #275C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3513.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #276C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3522.6Semi standard non polar33892256
Maltotriose,5TMS,isomer #277C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3476.7Semi standard non polar33892256
Maltotriose,5TMS,isomer #278C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3494.6Semi standard non polar33892256
Maltotriose,5TMS,isomer #279C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3548.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #28C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3522.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #280C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3533.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #281C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3528.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #282C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3533.0Semi standard non polar33892256
Maltotriose,5TMS,isomer #283C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3584.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #284C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3530.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #285C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3558.6Semi standard non polar33892256
Maltotriose,5TMS,isomer #286C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3524.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #287C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3493.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #288C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3502.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #289C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3549.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #29C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3564.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #290C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3533.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #291C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3531.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #292C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3503.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #293C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3479.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #294C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3488.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #295C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3528.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #296C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3511.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #297C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3517.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #298C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3512.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #299C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3499.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3488.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #30C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3526.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #300C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3509.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #301C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3550.6Semi standard non polar33892256
Maltotriose,5TMS,isomer #302C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3565.7Semi standard non polar33892256
Maltotriose,5TMS,isomer #303C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3569.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #304C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3522.7Semi standard non polar33892256
Maltotriose,5TMS,isomer #305C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3538.7Semi standard non polar33892256
Maltotriose,5TMS,isomer #306C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3555.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #307C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3507.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #308C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3524.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #309C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3563.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #31C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3529.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #310C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3548.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #311C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3544.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #312C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3608.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #313C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3591.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #314C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3605.0Semi standard non polar33892256
Maltotriose,5TMS,isomer #315C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3573.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #316C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3586.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #317C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3622.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #318C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3572.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #319C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3589.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #32C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3543.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #320C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3573.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #321C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3591.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #322C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3592.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #323C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3541.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #324C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3566.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #325C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3554.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #326C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3539.0Semi standard non polar33892256
Maltotriose,5TMS,isomer #327C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3539.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #328C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3604.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #329C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O)O[C@H](CO)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3627.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #33C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3510.0Semi standard non polar33892256
Maltotriose,5TMS,isomer #330C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3596.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #331C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O)O[C@H](CO)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3614.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #332C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3538.6Semi standard non polar33892256
Maltotriose,5TMS,isomer #333C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3523.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #334C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3529.7Semi standard non polar33892256
Maltotriose,5TMS,isomer #335C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](CO)O[C@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3588.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #336C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3563.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #337C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3541.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #338C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3538.0Semi standard non polar33892256
Maltotriose,5TMS,isomer #339C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3523.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #34C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3559.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #340C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3541.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #341C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3523.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #342C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3574.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #343C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3522.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #344C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3540.7Semi standard non polar33892256
Maltotriose,5TMS,isomer #345C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3521.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #346C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3498.0Semi standard non polar33892256
Maltotriose,5TMS,isomer #347C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3521.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #348C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3503.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #349C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3505.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #35C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3506.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #350C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3492.7Semi standard non polar33892256
Maltotriose,5TMS,isomer #351C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3536.6Semi standard non polar33892256
Maltotriose,5TMS,isomer #352C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3566.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #353C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3549.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #354C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3559.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #355C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3542.0Semi standard non polar33892256
Maltotriose,5TMS,isomer #356C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3597.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #357C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3584.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #358C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3596.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #359C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3564.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #36C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3512.7Semi standard non polar33892256
Maltotriose,5TMS,isomer #360C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3574.2Semi standard non polar33892256
Maltotriose,5TMS,isomer #361C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3614.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #362C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3582.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #363C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)O[C@@H]1CO3592.7Semi standard non polar33892256
Maltotriose,5TMS,isomer #364C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O)O[C@H](CO)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3618.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #365C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3547.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #366C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3527.7Semi standard non polar33892256
Maltotriose,5TMS,isomer #367C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)O[C@@H]2CO)[C@@H]1O[Si](C)(C)C3581.0Semi standard non polar33892256
Maltotriose,5TMS,isomer #368C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3532.1Semi standard non polar33892256
Maltotriose,5TMS,isomer #369C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3514.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #37C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3528.9Semi standard non polar33892256
Maltotriose,5TMS,isomer #370C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@@H]1O[Si](C)(C)C3571.5Semi standard non polar33892256
Maltotriose,5TMS,isomer #371C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3547.4Semi standard non polar33892256
Maltotriose,5TMS,isomer #372C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3498.8Semi standard non polar33892256
Maltotriose,5TMS,isomer #373C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3493.0Semi standard non polar33892256
Maltotriose,5TMS,isomer #374C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3478.3Semi standard non polar33892256
Maltotriose,5TMS,isomer #375C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[C@H]2O[C@