Hmdb loader
Survey
You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Human Metabolome Database.
Record Information
Version5.0
StatusDetected and Quantified
Creation Date2006-05-22 15:12:41 UTC
Update Date2022-09-22 17:43:49 UTC
HMDB IDHMDB0003213
Secondary Accession Numbers
  • HMDB03213
Metabolite Identification
Common NameRaffinose
DescriptionRaffinose is a complex carbohydrate. It is a trisaccharide composed of galactose, fructose, and glucose. It can be found in beans, cabbage, brussels sprouts, broccoli, asparagus, other vegetables, and whole grains. Raffinose is hydrolyzed to D-galactose and sucrose by D-galactosidase (D-GAL). D-GAL also hydrolyzes other D-galactosides such as stachyose, verbascose, and galactinol [1-O-(D-galactosyl)-myoinositol], if present. The enzyme does not cleave linked galactose, as in lactose. Raffinose is also known as melitose and may be thought of as galactose and sucrose connected via an alpha(1->6) glycosidic linkage. Thus, raffinose can be broken down into galactose and sucrose via the enzyme alpha-galactosidase. Human intestines do not contain this enzyme. Raffinose is a trisaccharide occurring in Australian manna (from Eucalyptus spp, Myrtaceae) and in cottonseed meal.
Structure
Data?1582752266
Synonyms
ValueSource
6g-alpha-D-GalactosylsucroseChEBI
alpha-D-Galactopyranosyl-(1->6)-alpha-D-glucopyranosyl beta-D-fructofuranosideChEBI
alpha-D-Galp-(1->6)-alpha-D-GLCP-(12)-beta-D-frufChEBI
GossyposeChEBI
MelitoseChEBI
MelitrioseChEBI
RafinoseChEBI
RaflinoseChEBI
6g-a-D-GalactosylsucroseGenerator
6g-Α-D-galactosylsucroseGenerator
a-D-Galactopyranosyl-(1->6)-a-D-glucopyranosyl b-D-fructofuranosideGenerator
Α-D-galactopyranosyl-(1->6)-α-D-glucopyranosyl β-D-fructofuranosideGenerator
a-D-Galp-(1->6)-a-D-GLCP-(12)-b-D-frufGenerator
Α-D-galp-(1->6)-α-D-GLCP-(12)-β-D-frufGenerator
D-(+)-RaffinoseHMDB
D-RaffinoseHMDB
beta-D-Fructofuranosyl O-alpha-D-galactopyranosyl-(1→6)-alpha-D-glucopyranosideHMDB
Β-D-fructofuranosyl O-α-D-galactopyranosyl-(1→6)-α-D-glucopyranosideHMDB
RaffinoseHMDB
Chemical FormulaC18H32O16
Average Molecular Weight504.4371
Monoisotopic Molecular Weight504.169034976
IUPAC Name(2R,3R,4S,5S,6R)-2-{[(2S,3S,4S,5R)-3,4-dihydroxy-2,5-bis(hydroxymethyl)oxolan-2-yl]oxy}-6-({[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}methyl)oxane-3,4,5-triol
Traditional Nameraffinose
CAS Registry Number512-69-6
SMILES
OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O
InChI Identifier
InChI=1S/C18H32O16/c19-1-5-8(22)11(25)13(27)16(31-5)30-3-7-9(23)12(26)14(28)17(32-7)34-18(4-21)15(29)10(24)6(2-20)33-18/h5-17,19-29H,1-4H2/t5-,6-,7-,8+,9-,10-,11+,12+,13-,14-,15+,16+,17-,18+/m1/s1
InChI KeyMUPFEKGTMRGPLJ-ZQSKZDJDSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as oligosaccharides. These are carbohydrates made up of 3 to 10 monosaccharide units linked to each other through glycosidic bonds.
KingdomOrganic compounds
Super ClassOrganic oxygen compounds
ClassOrganooxygen compounds
Sub ClassCarbohydrates and carbohydrate conjugates
Direct ParentOligosaccharides
Alternative Parents
Substituents
  • Oligosaccharide
  • C-glycosyl compound
  • Glycosyl compound
  • O-glycosyl compound
  • Ketal
  • Oxane
  • Tetrahydrofuran
  • Secondary alcohol
  • Acetal
  • Oxacycle
  • Organoheterocyclic compound
  • Polyol
  • Alcohol
  • Primary alcohol
  • Hydrocarbon derivative
  • Aliphatic heteromonocyclic compound
Molecular FrameworkAliphatic heteromonocyclic compounds
External Descriptors
Ontology
Not AvailableNot Available
Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting Point80 °CNot Available
Boiling Point884.79 °C. @ 760.00 mm Hg (est)The Good Scents Company Information System
Water Solubility203 mg/mLNot Available
LogP-5.104 (est)The Good Scents Company Information System
Experimental Chromatographic Properties

Experimental Collision Cross Sections

Adduct TypeData SourceCCS Value (Å2)Reference
[M-H]-Astarita_neg201.030932474
[M-H]-Baker197.5930932474
[M-H]-MetCCS_test_neg194.730932474
[M+H]+MetCCS_test_pos208.97830932474
[M-H]-Not Available194.7http://allccs.zhulab.cn/database/detail?ID=AllCCS00000422
[M+H]+Not Available209.605http://allccs.zhulab.cn/database/detail?ID=AllCCS00000422
Predicted Molecular Properties
PropertyValueSource
Water Solubility669 g/LALOGPS
logP-3.4ALOGPS
logP-6.3ChemAxon
logS0.12ALOGPS
pKa (Strongest Acidic)11.7ChemAxon
pKa (Strongest Basic)-3.6ChemAxon
Physiological Charge0ChemAxon
Hydrogen Acceptor Count16ChemAxon
Hydrogen Donor Count11ChemAxon
Polar Surface Area268.68 ŲChemAxon
Rotatable Bond Count8ChemAxon
Refractivity101.19 m³·mol⁻¹ChemAxon
Polarizability46.17 ųChemAxon
Number of Rings3ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleYesChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DeepCCS[M+H]+203.34430932474
DeepCCS[M-H]-201.46530932474
DeepCCS[M-2H]-235.31530932474
DeepCCS[M+Na]+209.14630932474
AllCCS[M+H]+208.332859911
AllCCS[M+H-H2O]+206.832859911
AllCCS[M+NH4]+209.732859911
AllCCS[M+Na]+210.132859911
AllCCS[M-H]-206.532859911
AllCCS[M+Na-2H]-206.532859911
AllCCS[M+HCOO]-206.732859911

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
RaffinoseOC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3550.5Standard polar33892256
RaffinoseOC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O4131.5Standard non polar33892256
RaffinoseOC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O4138.1Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
Raffinose,1TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3906.8Semi standard non polar33892256
Raffinose,1TMS,isomer #10C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O3960.1Semi standard non polar33892256
Raffinose,1TMS,isomer #11C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H]1CO3910.1Semi standard non polar33892256
Raffinose,1TMS,isomer #2C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3941.0Semi standard non polar33892256
Raffinose,1TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3908.5Semi standard non polar33892256
Raffinose,1TMS,isomer #4C[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@H]1O3901.9Semi standard non polar33892256
Raffinose,1TMS,isomer #5C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@@H]1O3891.1Semi standard non polar33892256
Raffinose,1TMS,isomer #6C[Si](C)(C)O[C@H]1[C@@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)O[C@H](CO)[C@H](O)[C@@H]1O3914.1Semi standard non polar33892256
Raffinose,1TMS,isomer #7C[Si](C)(C)O[C@@H]1[C@@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@H](O)[C@H]1O3917.0Semi standard non polar33892256
Raffinose,1TMS,isomer #8C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@@H]1O3901.5Semi standard non polar33892256
Raffinose,1TMS,isomer #9C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)O[C@@H]1O[C@]1(CO)O[C@H](CO)[C@@H](O)[C@@H]1O3924.1Semi standard non polar33892256
Raffinose,2TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3858.6Semi standard non polar33892256
Raffinose,2TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3821.2Semi standard non polar33892256
Raffinose,2TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3860.4Semi standard non polar33892256
Raffinose,2TMS,isomer #12C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3847.7Semi standard non polar33892256
Raffinose,2TMS,isomer #13C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3833.2Semi standard non polar33892256
Raffinose,2TMS,isomer #14C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3857.9Semi standard non polar33892256
Raffinose,2TMS,isomer #15C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3860.3Semi standard non polar33892256
Raffinose,2TMS,isomer #16C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3842.4Semi standard non polar33892256
Raffinose,2TMS,isomer #17C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3863.6Semi standard non polar33892256
Raffinose,2TMS,isomer #18C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3855.7Semi standard non polar33892256
Raffinose,2TMS,isomer #19C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3883.0Semi standard non polar33892256
Raffinose,2TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3838.7Semi standard non polar33892256
Raffinose,2TMS,isomer #20C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3832.0Semi standard non polar33892256
Raffinose,2TMS,isomer #21C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3860.3Semi standard non polar33892256
Raffinose,2TMS,isomer #22C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3841.7Semi standard non polar33892256
Raffinose,2TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3822.7Semi standard non polar33892256
Raffinose,2TMS,isomer #24C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3840.5Semi standard non polar33892256
Raffinose,2TMS,isomer #25C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3837.8Semi standard non polar33892256
Raffinose,2TMS,isomer #26C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3815.6Semi standard non polar33892256
Raffinose,2TMS,isomer #27C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3848.0Semi standard non polar33892256
Raffinose,2TMS,isomer #28C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H]1CO3821.2Semi standard non polar33892256
Raffinose,2TMS,isomer #29C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O3851.3Semi standard non polar33892256
Raffinose,2TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3825.7Semi standard non polar33892256
Raffinose,2TMS,isomer #30C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1O[C@]1(CO)O[C@H](CO)[C@@H](O)[C@@H]1O3830.9Semi standard non polar33892256
Raffinose,2TMS,isomer #31C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@@H]1O3813.3Semi standard non polar33892256
Raffinose,2TMS,isomer #32C[Si](C)(C)O[C@@H]1[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@H](O)[C@H]1O3832.3Semi standard non polar33892256
Raffinose,2TMS,isomer #33C[Si](C)(C)O[C@H]1[C@@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)O[C@H](CO)[C@H](O[Si](C)(C)C)[C@@H]1O3814.4Semi standard non polar33892256
Raffinose,2TMS,isomer #34C[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3807.2Semi standard non polar33892256
Raffinose,2TMS,isomer #35C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H]1CO3809.5Semi standard non polar33892256
Raffinose,2TMS,isomer #36C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@@H]1O3836.5Semi standard non polar33892256
Raffinose,2TMS,isomer #37C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@@H]1O3820.8Semi standard non polar33892256
Raffinose,2TMS,isomer #38C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3803.9Semi standard non polar33892256
Raffinose,2TMS,isomer #39C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3822.1Semi standard non polar33892256
Raffinose,2TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3811.4Semi standard non polar33892256
Raffinose,2TMS,isomer #40C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3826.6Semi standard non polar33892256
Raffinose,2TMS,isomer #41C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H]1CO3829.3Semi standard non polar33892256
Raffinose,2TMS,isomer #42C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O3860.0Semi standard non polar33892256
Raffinose,2TMS,isomer #43C[Si](C)(C)O[C@H]1[C@@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)O[C@H](CO)[C@H](O)[C@@H]1O3837.5Semi standard non polar33892256
Raffinose,2TMS,isomer #44C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@@H]1O3819.3Semi standard non polar33892256
Raffinose,2TMS,isomer #45C[Si](C)(C)O[C@@H]1[C@@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@H](O)[C@H]1O3838.2Semi standard non polar33892256
Raffinose,2TMS,isomer #46C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1CO3836.1Semi standard non polar33892256
Raffinose,2TMS,isomer #47C[Si](C)(C)O[C@@H]1[C@@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3863.6Semi standard non polar33892256
Raffinose,2TMS,isomer #48C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)O[C@@H]1CO[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O3832.3Semi standard non polar33892256
Raffinose,2TMS,isomer #49C[Si](C)(C)O[C@@H]1[C@@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3832.7Semi standard non polar33892256
Raffinose,2TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3832.3Semi standard non polar33892256
Raffinose,2TMS,isomer #50C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3817.3Semi standard non polar33892256
Raffinose,2TMS,isomer #51C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3845.8Semi standard non polar33892256
Raffinose,2TMS,isomer #52C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3833.7Semi standard non polar33892256
Raffinose,2TMS,isomer #53C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3835.7Semi standard non polar33892256
Raffinose,2TMS,isomer #54C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3863.9Semi standard non polar33892256
Raffinose,2TMS,isomer #55C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O3834.3Semi standard non polar33892256
Raffinose,2TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3838.8Semi standard non polar33892256
Raffinose,2TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3823.6Semi standard non polar33892256
Raffinose,2TMS,isomer #8C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3840.3Semi standard non polar33892256
Raffinose,2TMS,isomer #9C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3861.5Semi standard non polar33892256
Raffinose,3TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3747.5Semi standard non polar33892256
Raffinose,3TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3742.2Semi standard non polar33892256
Raffinose,3TMS,isomer #100C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3731.9Semi standard non polar33892256
Raffinose,3TMS,isomer #101C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3721.1Semi standard non polar33892256
Raffinose,3TMS,isomer #102C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3701.4Semi standard non polar33892256
Raffinose,3TMS,isomer #103C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3736.2Semi standard non polar33892256
Raffinose,3TMS,isomer #104C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3733.9Semi standard non polar33892256
Raffinose,3TMS,isomer #105C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3713.7Semi standard non polar33892256
Raffinose,3TMS,isomer #106C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3751.8Semi standard non polar33892256
Raffinose,3TMS,isomer #107C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3733.3Semi standard non polar33892256
Raffinose,3TMS,isomer #108C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3742.5Semi standard non polar33892256
Raffinose,3TMS,isomer #109C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3734.9Semi standard non polar33892256
Raffinose,3TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3698.4Semi standard non polar33892256
Raffinose,3TMS,isomer #110C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O3761.9Semi standard non polar33892256
Raffinose,3TMS,isomer #111C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H]1CO3725.9Semi standard non polar33892256
Raffinose,3TMS,isomer #112C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H]1CO3729.7Semi standard non polar33892256
Raffinose,3TMS,isomer #113C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1CO3751.5Semi standard non polar33892256
Raffinose,3TMS,isomer #114C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3738.7Semi standard non polar33892256
Raffinose,3TMS,isomer #115C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3749.0Semi standard non polar33892256
Raffinose,3TMS,isomer #116C[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3763.5Semi standard non polar33892256
Raffinose,3TMS,isomer #117C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O3766.8Semi standard non polar33892256
Raffinose,3TMS,isomer #118C[Si](C)(C)O[C@@H]1[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3782.6Semi standard non polar33892256
Raffinose,3TMS,isomer #119C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3769.6Semi standard non polar33892256
Raffinose,3TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3721.7Semi standard non polar33892256
Raffinose,3TMS,isomer #120C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3779.5Semi standard non polar33892256
Raffinose,3TMS,isomer #121C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3731.1Semi standard non polar33892256
Raffinose,3TMS,isomer #122C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)O[C@@H]1CO[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3732.1Semi standard non polar33892256
Raffinose,3TMS,isomer #123C[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3716.4Semi standard non polar33892256
Raffinose,3TMS,isomer #124C[Si](C)(C)O[C@H]1[C@@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)O[C@H](CO)[C@H](O[Si](C)(C)C)[C@@H]1O3718.8Semi standard non polar33892256
Raffinose,3TMS,isomer #125C[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3731.5Semi standard non polar33892256
Raffinose,3TMS,isomer #126C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@@H]1O3707.4Semi standard non polar33892256
Raffinose,3TMS,isomer #127C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@@H]1O3706.2Semi standard non polar33892256
Raffinose,3TMS,isomer #128C[Si](C)(C)O[C@@H]1[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@H](O)[C@H]1O3720.0Semi standard non polar33892256
Raffinose,3TMS,isomer #129C[Si](C)(C)O[C@@H]1[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@H](O)[C@H]1O3721.9Semi standard non polar33892256
Raffinose,3TMS,isomer #13C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3727.7Semi standard non polar33892256
Raffinose,3TMS,isomer #130C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)O[C@@H]1CO3717.9Semi standard non polar33892256
Raffinose,3TMS,isomer #131C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@@H]1O3742.8Semi standard non polar33892256
Raffinose,3TMS,isomer #132C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H]1CO3734.8Semi standard non polar33892256
Raffinose,3TMS,isomer #133C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1CO3735.1Semi standard non polar33892256
Raffinose,3TMS,isomer #134C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3721.7Semi standard non polar33892256
Raffinose,3TMS,isomer #135C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3731.5Semi standard non polar33892256
Raffinose,3TMS,isomer #136C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@@H]1O3761.1Semi standard non polar33892256
Raffinose,3TMS,isomer #137C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3751.6Semi standard non polar33892256
Raffinose,3TMS,isomer #138C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3764.6Semi standard non polar33892256
Raffinose,3TMS,isomer #139C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3774.3Semi standard non polar33892256
Raffinose,3TMS,isomer #14C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3712.1Semi standard non polar33892256
Raffinose,3TMS,isomer #140C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3716.1Semi standard non polar33892256
Raffinose,3TMS,isomer #141C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)O[C@@H]1CO[C@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3716.5Semi standard non polar33892256
Raffinose,3TMS,isomer #142C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3724.3Semi standard non polar33892256
Raffinose,3TMS,isomer #143C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3717.9Semi standard non polar33892256
Raffinose,3TMS,isomer #144C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C3713.9Semi standard non polar33892256
Raffinose,3TMS,isomer #145C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3727.3Semi standard non polar33892256
Raffinose,3TMS,isomer #146C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O3755.0Semi standard non polar33892256
Raffinose,3TMS,isomer #147C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1CO3741.3Semi standard non polar33892256
Raffinose,3TMS,isomer #148C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3727.7Semi standard non polar33892256
Raffinose,3TMS,isomer #149C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3741.7Semi standard non polar33892256
Raffinose,3TMS,isomer #15C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3723.0Semi standard non polar33892256
Raffinose,3TMS,isomer #150C[Si](C)(C)O[C@@H]1[C@@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3776.2Semi standard non polar33892256
Raffinose,3TMS,isomer #151C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3761.1Semi standard non polar33892256
Raffinose,3TMS,isomer #152C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3774.2Semi standard non polar33892256
Raffinose,3TMS,isomer #153C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3723.2Semi standard non polar33892256
Raffinose,3TMS,isomer #154C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)O[C@@H]1CO[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3722.2Semi standard non polar33892256
Raffinose,3TMS,isomer #155C[Si](C)(C)O[C@H]1[C@@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@H](O)[C@@H]1O3723.7Semi standard non polar33892256
Raffinose,3TMS,isomer #156C[Si](C)(C)O[C@@H]1[C@@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3770.9Semi standard non polar33892256
Raffinose,3TMS,isomer #157C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3748.1Semi standard non polar33892256
Raffinose,3TMS,isomer #158C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O3750.6Semi standard non polar33892256
Raffinose,3TMS,isomer #159C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O3781.7Semi standard non polar33892256
Raffinose,3TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3778.6Semi standard non polar33892256
Raffinose,3TMS,isomer #160C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3785.7Semi standard non polar33892256
Raffinose,3TMS,isomer #161C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3732.4Semi standard non polar33892256
Raffinose,3TMS,isomer #162C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3755.4Semi standard non polar33892256
Raffinose,3TMS,isomer #163C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3747.7Semi standard non polar33892256
Raffinose,3TMS,isomer #164C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3783.3Semi standard non polar33892256
Raffinose,3TMS,isomer #165C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3766.7Semi standard non polar33892256
Raffinose,3TMS,isomer #17C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3722.1Semi standard non polar33892256
Raffinose,3TMS,isomer #18C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3707.6Semi standard non polar33892256
Raffinose,3TMS,isomer #19C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3712.6Semi standard non polar33892256
Raffinose,3TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3749.7Semi standard non polar33892256
Raffinose,3TMS,isomer #20C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3734.1Semi standard non polar33892256
Raffinose,3TMS,isomer #21C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3721.3Semi standard non polar33892256
Raffinose,3TMS,isomer #22C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3732.8Semi standard non polar33892256
Raffinose,3TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3781.0Semi standard non polar33892256
Raffinose,3TMS,isomer #24C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3733.9Semi standard non polar33892256
Raffinose,3TMS,isomer #25C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3713.8Semi standard non polar33892256
Raffinose,3TMS,isomer #26C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3716.9Semi standard non polar33892256
Raffinose,3TMS,isomer #27C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3704.4Semi standard non polar33892256
Raffinose,3TMS,isomer #28C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3715.7Semi standard non polar33892256
Raffinose,3TMS,isomer #29C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3752.4Semi standard non polar33892256
Raffinose,3TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3723.2Semi standard non polar33892256
Raffinose,3TMS,isomer #30C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3712.1Semi standard non polar33892256
Raffinose,3TMS,isomer #31C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3725.6Semi standard non polar33892256
Raffinose,3TMS,isomer #32C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3712.3Semi standard non polar33892256
Raffinose,3TMS,isomer #33C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3725.4Semi standard non polar33892256
Raffinose,3TMS,isomer #34C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3770.5Semi standard non polar33892256
Raffinose,3TMS,isomer #35C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3723.6Semi standard non polar33892256
Raffinose,3TMS,isomer #36C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3728.4Semi standard non polar33892256
Raffinose,3TMS,isomer #37C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3732.2Semi standard non polar33892256
Raffinose,3TMS,isomer #38C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3784.7Semi standard non polar33892256
Raffinose,3TMS,isomer #39C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3741.6Semi standard non polar33892256
Raffinose,3TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3744.8Semi standard non polar33892256
Raffinose,3TMS,isomer #40C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3729.6Semi standard non polar33892256
Raffinose,3TMS,isomer #41C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3765.5Semi standard non polar33892256
Raffinose,3TMS,isomer #42C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3727.4Semi standard non polar33892256
Raffinose,3TMS,isomer #43C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3783.3Semi standard non polar33892256
Raffinose,3TMS,isomer #44C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3740.4Semi standard non polar33892256
Raffinose,3TMS,isomer #45C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3777.0Semi standard non polar33892256
Raffinose,3TMS,isomer #46C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3781.1Semi standard non polar33892256
Raffinose,3TMS,isomer #47C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3814.9Semi standard non polar33892256
Raffinose,3TMS,isomer #48C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3766.7Semi standard non polar33892256
Raffinose,3TMS,isomer #49C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3753.6Semi standard non polar33892256
Raffinose,3TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3760.8Semi standard non polar33892256
Raffinose,3TMS,isomer #50C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3776.7Semi standard non polar33892256
Raffinose,3TMS,isomer #51C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3772.3Semi standard non polar33892256
Raffinose,3TMS,isomer #52C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3741.6Semi standard non polar33892256
Raffinose,3TMS,isomer #53C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3788.1Semi standard non polar33892256
Raffinose,3TMS,isomer #54C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3747.1Semi standard non polar33892256
Raffinose,3TMS,isomer #55C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3753.4Semi standard non polar33892256
Raffinose,3TMS,isomer #56C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3773.9Semi standard non polar33892256
Raffinose,3TMS,isomer #57C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3753.3Semi standard non polar33892256
Raffinose,3TMS,isomer #58C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3769.0Semi standard non polar33892256
Raffinose,3TMS,isomer #59C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3780.0Semi standard non polar33892256
Raffinose,3TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3738.3Semi standard non polar33892256
Raffinose,3TMS,isomer #60C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3806.8Semi standard non polar33892256
Raffinose,3TMS,isomer #61C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3757.9Semi standard non polar33892256
Raffinose,3TMS,isomer #62C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3752.2Semi standard non polar33892256
Raffinose,3TMS,isomer #63C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3733.5Semi standard non polar33892256
Raffinose,3TMS,isomer #64C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3747.5Semi standard non polar33892256
Raffinose,3TMS,isomer #65C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3755.6Semi standard non polar33892256
Raffinose,3TMS,isomer #66C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3783.5Semi standard non polar33892256
Raffinose,3TMS,isomer #67C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3769.1Semi standard non polar33892256
Raffinose,3TMS,isomer #68C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3747.3Semi standard non polar33892256
Raffinose,3TMS,isomer #69C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3764.6Semi standard non polar33892256
Raffinose,3TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3755.1Semi standard non polar33892256
Raffinose,3TMS,isomer #70C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3773.7Semi standard non polar33892256
Raffinose,3TMS,isomer #71C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3806.6Semi standard non polar33892256
Raffinose,3TMS,isomer #72C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3768.0Semi standard non polar33892256
Raffinose,3TMS,isomer #73C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3770.8Semi standard non polar33892256
Raffinose,3TMS,isomer #74C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3790.4Semi standard non polar33892256
Raffinose,3TMS,isomer #75C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3817.4Semi standard non polar33892256
Raffinose,3TMS,isomer #76C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3766.2Semi standard non polar33892256
Raffinose,3TMS,isomer #77C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3768.5Semi standard non polar33892256
Raffinose,3TMS,isomer #78C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3795.1Semi standard non polar33892256
Raffinose,3TMS,isomer #79C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3784.2Semi standard non polar33892256
Raffinose,3TMS,isomer #8C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3794.3Semi standard non polar33892256
Raffinose,3TMS,isomer #80C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3808.6Semi standard non polar33892256
Raffinose,3TMS,isomer #81C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3801.5Semi standard non polar33892256
Raffinose,3TMS,isomer #82C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3767.5Semi standard non polar33892256
Raffinose,3TMS,isomer #83C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3748.2Semi standard non polar33892256
Raffinose,3TMS,isomer #84C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3735.7Semi standard non polar33892256
Raffinose,3TMS,isomer #85C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3749.6Semi standard non polar33892256
Raffinose,3TMS,isomer #86C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3741.1Semi standard non polar33892256
Raffinose,3TMS,isomer #87C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3723.4Semi standard non polar33892256
Raffinose,3TMS,isomer #88C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3760.3Semi standard non polar33892256
Raffinose,3TMS,isomer #89C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3782.7Semi standard non polar33892256
Raffinose,3TMS,isomer #9C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3756.3Semi standard non polar33892256
Raffinose,3TMS,isomer #90C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3769.8Semi standard non polar33892256
Raffinose,3TMS,isomer #91C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3785.1Semi standard non polar33892256
Raffinose,3TMS,isomer #92C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3782.9Semi standard non polar33892256
Raffinose,3TMS,isomer #93C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3757.5Semi standard non polar33892256
Raffinose,3TMS,isomer #94C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3800.3Semi standard non polar33892256
Raffinose,3TMS,isomer #95C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3732.1Semi standard non polar33892256
Raffinose,3TMS,isomer #96C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3734.9Semi standard non polar33892256
Raffinose,3TMS,isomer #97C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3733.0Semi standard non polar33892256
Raffinose,3TMS,isomer #98C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3713.6Semi standard non polar33892256
Raffinose,3TMS,isomer #99C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3751.4Semi standard non polar33892256
Raffinose,4TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3653.8Semi standard non polar33892256
Raffinose,4TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3625.6Semi standard non polar33892256
Raffinose,4TMS,isomer #100C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3663.3Semi standard non polar33892256
Raffinose,4TMS,isomer #101C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3620.1Semi standard non polar33892256
Raffinose,4TMS,isomer #102C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3609.8Semi standard non polar33892256
Raffinose,4TMS,isomer #103C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3677.4Semi standard non polar33892256
Raffinose,4TMS,isomer #104C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3631.2Semi standard non polar33892256
Raffinose,4TMS,isomer #105C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3619.4Semi standard non polar33892256
Raffinose,4TMS,isomer #106C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3663.8Semi standard non polar33892256
Raffinose,4TMS,isomer #107C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3618.3Semi standard non polar33892256
Raffinose,4TMS,isomer #108C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3671.2Semi standard non polar33892256
Raffinose,4TMS,isomer #109C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3626.5Semi standard non polar33892256
Raffinose,4TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3657.3Semi standard non polar33892256
Raffinose,4TMS,isomer #110C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3679.1Semi standard non polar33892256
Raffinose,4TMS,isomer #111C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3641.5Semi standard non polar33892256
Raffinose,4TMS,isomer #112C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3697.4Semi standard non polar33892256
Raffinose,4TMS,isomer #113C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3645.1Semi standard non polar33892256
Raffinose,4TMS,isomer #114C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3681.1Semi standard non polar33892256
Raffinose,4TMS,isomer #115C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3635.4Semi standard non polar33892256
Raffinose,4TMS,isomer #116C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3698.8Semi standard non polar33892256
Raffinose,4TMS,isomer #117C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3693.6Semi standard non polar33892256
Raffinose,4TMS,isomer #118C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3643.5Semi standard non polar33892256
Raffinose,4TMS,isomer #119C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3679.8Semi standard non polar33892256
Raffinose,4TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3639.8Semi standard non polar33892256
Raffinose,4TMS,isomer #120C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3692.2Semi standard non polar33892256
Raffinose,4TMS,isomer #121C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3714.8Semi standard non polar33892256
Raffinose,4TMS,isomer #122C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3677.8Semi standard non polar33892256
Raffinose,4TMS,isomer #123C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3665.4Semi standard non polar33892256
Raffinose,4TMS,isomer #124C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3687.0Semi standard non polar33892256
Raffinose,4TMS,isomer #125C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3673.9Semi standard non polar33892256
Raffinose,4TMS,isomer #126C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3646.6Semi standard non polar33892256
Raffinose,4TMS,isomer #127C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3697.2Semi standard non polar33892256
Raffinose,4TMS,isomer #128C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3705.8Semi standard non polar33892256
Raffinose,4TMS,isomer #129C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3701.5Semi standard non polar33892256
Raffinose,4TMS,isomer #13C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3649.9Semi standard non polar33892256
Raffinose,4TMS,isomer #130C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3718.4Semi standard non polar33892256
Raffinose,4TMS,isomer #131C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3710.3Semi standard non polar33892256
Raffinose,4TMS,isomer #132C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3682.3Semi standard non polar33892256
Raffinose,4TMS,isomer #133C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3731.0Semi standard non polar33892256
Raffinose,4TMS,isomer #134C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3658.1Semi standard non polar33892256
Raffinose,4TMS,isomer #135C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3653.3Semi standard non polar33892256
Raffinose,4TMS,isomer #136C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3652.6Semi standard non polar33892256
Raffinose,4TMS,isomer #137C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3629.5Semi standard non polar33892256
Raffinose,4TMS,isomer #138C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3674.8Semi standard non polar33892256
Raffinose,4TMS,isomer #139C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3662.3Semi standard non polar33892256
Raffinose,4TMS,isomer #14C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3699.9Semi standard non polar33892256
Raffinose,4TMS,isomer #140C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3642.8Semi standard non polar33892256
Raffinose,4TMS,isomer #141C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3618.9Semi standard non polar33892256
Raffinose,4TMS,isomer #142C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3663.0Semi standard non polar33892256
Raffinose,4TMS,isomer #143C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3660.0Semi standard non polar33892256
Raffinose,4TMS,isomer #144C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3633.2Semi standard non polar33892256
Raffinose,4TMS,isomer #145C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3681.8Semi standard non polar33892256
Raffinose,4TMS,isomer #146C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3663.9Semi standard non polar33892256
Raffinose,4TMS,isomer #147C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3671.7Semi standard non polar33892256
Raffinose,4TMS,isomer #148C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3663.1Semi standard non polar33892256
Raffinose,4TMS,isomer #149C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3669.4Semi standard non polar33892256
Raffinose,4TMS,isomer #15C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3661.0Semi standard non polar33892256
Raffinose,4TMS,isomer #150C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3657.7Semi standard non polar33892256
Raffinose,4TMS,isomer #151C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3649.9Semi standard non polar33892256
Raffinose,4TMS,isomer #152C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3650.6Semi standard non polar33892256
Raffinose,4TMS,isomer #153C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3672.9Semi standard non polar33892256
Raffinose,4TMS,isomer #154C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3708.6Semi standard non polar33892256
Raffinose,4TMS,isomer #155C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3657.3Semi standard non polar33892256
Raffinose,4TMS,isomer #156C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3644.1Semi standard non polar33892256
Raffinose,4TMS,isomer #157C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3650.7Semi standard non polar33892256
Raffinose,4TMS,isomer #158C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3669.4Semi standard non polar33892256
Raffinose,4TMS,isomer #159C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3707.1Semi standard non polar33892256
Raffinose,4TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3626.5Semi standard non polar33892256
Raffinose,4TMS,isomer #160C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3677.1Semi standard non polar33892256
Raffinose,4TMS,isomer #161C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3665.4Semi standard non polar33892256
Raffinose,4TMS,isomer #162C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3700.8Semi standard non polar33892256
Raffinose,4TMS,isomer #163C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3731.5Semi standard non polar33892256
Raffinose,4TMS,isomer #164C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3673.6Semi standard non polar33892256
Raffinose,4TMS,isomer #165C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3679.8Semi standard non polar33892256
Raffinose,4TMS,isomer #166C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3715.1Semi standard non polar33892256
Raffinose,4TMS,isomer #167C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3690.6Semi standard non polar33892256
Raffinose,4TMS,isomer #168C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3720.1Semi standard non polar33892256
Raffinose,4TMS,isomer #169C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3724.9Semi standard non polar33892256
Raffinose,4TMS,isomer #17C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3627.2Semi standard non polar33892256
Raffinose,4TMS,isomer #170C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3663.0Semi standard non polar33892256
Raffinose,4TMS,isomer #171C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3654.3Semi standard non polar33892256
Raffinose,4TMS,isomer #172C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3659.9Semi standard non polar33892256
Raffinose,4TMS,isomer #173C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3680.5Semi standard non polar33892256
Raffinose,4TMS,isomer #174C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3719.8Semi standard non polar33892256
Raffinose,4TMS,isomer #175C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3654.7Semi standard non polar33892256
Raffinose,4TMS,isomer #176C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3639.0Semi standard non polar33892256
Raffinose,4TMS,isomer #177C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3671.1Semi standard non polar33892256
Raffinose,4TMS,isomer #178C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3703.1Semi standard non polar33892256
Raffinose,4TMS,isomer #179C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3651.2Semi standard non polar33892256
Raffinose,4TMS,isomer #18C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3614.7Semi standard non polar33892256
Raffinose,4TMS,isomer #180C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3652.3Semi standard non polar33892256
Raffinose,4TMS,isomer #181C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3690.5Semi standard non polar33892256
Raffinose,4TMS,isomer #182C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3660.6Semi standard non polar33892256
Raffinose,4TMS,isomer #183C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3692.6Semi standard non polar33892256
Raffinose,4TMS,isomer #184C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3693.3Semi standard non polar33892256
Raffinose,4TMS,isomer #185C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3656.8Semi standard non polar33892256
Raffinose,4TMS,isomer #186C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3646.3Semi standard non polar33892256
Raffinose,4TMS,isomer #187C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3682.6Semi standard non polar33892256
Raffinose,4TMS,isomer #188C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3713.5Semi standard non polar33892256
Raffinose,4TMS,isomer #189C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3654.9Semi standard non polar33892256
Raffinose,4TMS,isomer #19C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3621.2Semi standard non polar33892256
Raffinose,4TMS,isomer #190C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3662.8Semi standard non polar33892256
Raffinose,4TMS,isomer #191C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3696.9Semi standard non polar33892256
Raffinose,4TMS,isomer #192C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3673.8Semi standard non polar33892256
Raffinose,4TMS,isomer #193C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3704.6Semi standard non polar33892256
Raffinose,4TMS,isomer #194C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3711.5Semi standard non polar33892256
Raffinose,4TMS,isomer #195C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3677.5Semi standard non polar33892256
Raffinose,4TMS,isomer #196C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3698.0Semi standard non polar33892256
Raffinose,4TMS,isomer #197C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3730.8Semi standard non polar33892256
Raffinose,4TMS,isomer #198C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3683.8Semi standard non polar33892256
Raffinose,4TMS,isomer #199C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3714.6Semi standard non polar33892256
Raffinose,4TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3602.2Semi standard non polar33892256
Raffinose,4TMS,isomer #20C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3662.8Semi standard non polar33892256
Raffinose,4TMS,isomer #200C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3732.6Semi standard non polar33892256
Raffinose,4TMS,isomer #201C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3691.2Semi standard non polar33892256
Raffinose,4TMS,isomer #202C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3724.0Semi standard non polar33892256
Raffinose,4TMS,isomer #203C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3707.3Semi standard non polar33892256
Raffinose,4TMS,isomer #204C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3719.2Semi standard non polar33892256
Raffinose,4TMS,isomer #205C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3686.2Semi standard non polar33892256
Raffinose,4TMS,isomer #206C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3682.5Semi standard non polar33892256
Raffinose,4TMS,isomer #207C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3690.9Semi standard non polar33892256
Raffinose,4TMS,isomer #208C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3683.6Semi standard non polar33892256
Raffinose,4TMS,isomer #209C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3666.7Semi standard non polar33892256
Raffinose,4TMS,isomer #21C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3624.3Semi standard non polar33892256
Raffinose,4TMS,isomer #210C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3706.5Semi standard non polar33892256
Raffinose,4TMS,isomer #211C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3660.5Semi standard non polar33892256
Raffinose,4TMS,isomer #212C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3652.5Semi standard non polar33892256
Raffinose,4TMS,isomer #213C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3650.2Semi standard non polar33892256
Raffinose,4TMS,isomer #214C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3634.7Semi standard non polar33892256
Raffinose,4TMS,isomer #215C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3672.6Semi standard non polar33892256
Raffinose,4TMS,isomer #216C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3662.5Semi standard non polar33892256
Raffinose,4TMS,isomer #217C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3644.5Semi standard non polar33892256
Raffinose,4TMS,isomer #218C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3629.6Semi standard non polar33892256
Raffinose,4TMS,isomer #219C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3666.4Semi standard non polar33892256
Raffinose,4TMS,isomer #22C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3640.3Semi standard non polar33892256
Raffinose,4TMS,isomer #220C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3654.3Semi standard non polar33892256
Raffinose,4TMS,isomer #221C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3637.0Semi standard non polar33892256
Raffinose,4TMS,isomer #222C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3676.6Semi standard non polar33892256
Raffinose,4TMS,isomer #223C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3660.3Semi standard non polar33892256
Raffinose,4TMS,isomer #224C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3664.2Semi standard non polar33892256
Raffinose,4TMS,isomer #225C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3659.6Semi standard non polar33892256
Raffinose,4TMS,isomer #226C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3704.6Semi standard non polar33892256
Raffinose,4TMS,isomer #227C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3689.1Semi standard non polar33892256
Raffinose,4TMS,isomer #228C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3688.1Semi standard non polar33892256
Raffinose,4TMS,isomer #229C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3669.0Semi standard non polar33892256
Raffinose,4TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3623.2Semi standard non polar33892256
Raffinose,4TMS,isomer #230C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3708.2Semi standard non polar33892256
Raffinose,4TMS,isomer #231C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3703.8Semi standard non polar33892256
Raffinose,4TMS,isomer #232C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3680.7Semi standard non polar33892256
Raffinose,4TMS,isomer #233C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3665.3Semi standard non polar33892256
Raffinose,4TMS,isomer #234C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3700.9Semi standard non polar33892256
Raffinose,4TMS,isomer #235C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3690.1Semi standard non polar33892256
Raffinose,4TMS,isomer #236C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3670.7Semi standard non polar33892256
Raffinose,4TMS,isomer #237C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3711.6Semi standard non polar33892256
Raffinose,4TMS,isomer #238C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3709.8Semi standard non polar33892256
Raffinose,4TMS,isomer #239C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3707.7Semi standard non polar33892256
Raffinose,4TMS,isomer #24C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3632.5Semi standard non polar33892256
Raffinose,4TMS,isomer #240C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3706.4Semi standard non polar33892256
Raffinose,4TMS,isomer #241C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3640.2Semi standard non polar33892256
Raffinose,4TMS,isomer #242C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3630.2Semi standard non polar33892256
Raffinose,4TMS,isomer #243C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3614.6Semi standard non polar33892256
Raffinose,4TMS,isomer #244C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3650.3Semi standard non polar33892256
Raffinose,4TMS,isomer #245C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3618.2Semi standard non polar33892256
Raffinose,4TMS,isomer #246C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3599.6Semi standard non polar33892256
Raffinose,4TMS,isomer #247C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3639.7Semi standard non polar33892256
Raffinose,4TMS,isomer #248C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3638.8Semi standard non polar33892256
Raffinose,4TMS,isomer #249C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3641.9Semi standard non polar33892256
Raffinose,4TMS,isomer #25C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3682.8Semi standard non polar33892256
Raffinose,4TMS,isomer #250C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3636.8Semi standard non polar33892256
Raffinose,4TMS,isomer #251C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3631.9Semi standard non polar33892256
Raffinose,4TMS,isomer #252C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3616.6Semi standard non polar33892256
Raffinose,4TMS,isomer #253C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3652.8Semi standard non polar33892256
Raffinose,4TMS,isomer #254C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3634.5Semi standard non polar33892256
Raffinose,4TMS,isomer #255C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3635.5Semi standard non polar33892256
Raffinose,4TMS,isomer #256C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3634.2Semi standard non polar33892256
Raffinose,4TMS,isomer #257C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3640.4Semi standard non polar33892256
Raffinose,4TMS,isomer #258C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3647.4Semi standard non polar33892256
Raffinose,4TMS,isomer #259C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3640.8Semi standard non polar33892256
Raffinose,4TMS,isomer #26C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3641.2Semi standard non polar33892256
Raffinose,4TMS,isomer #260C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3668.2Semi standard non polar33892256
Raffinose,4TMS,isomer #261C[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3683.8Semi standard non polar33892256
Raffinose,4TMS,isomer #262C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O3681.8Semi standard non polar33892256
Raffinose,4TMS,isomer #263C[Si](C)(C)O[C@@H]1[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3703.7Semi standard non polar33892256
Raffinose,4TMS,isomer #264C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3690.4Semi standard non polar33892256
Raffinose,4TMS,isomer #265C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3695.5Semi standard non polar33892256
Raffinose,4TMS,isomer #266C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)O[C@@H]1CO3665.8Semi standard non polar33892256
Raffinose,4TMS,isomer #267C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1CO3658.9Semi standard non polar33892256
Raffinose,4TMS,isomer #268C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3653.8Semi standard non polar33892256
Raffinose,4TMS,isomer #269C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3654.2Semi standard non polar33892256
Raffinose,4TMS,isomer #27C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3647.6Semi standard non polar33892256
Raffinose,4TMS,isomer #270C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1CO3654.1Semi standard non polar33892256
Raffinose,4TMS,isomer #271C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3642.7Semi standard non polar33892256
Raffinose,4TMS,isomer #272C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3648.3Semi standard non polar33892256
Raffinose,4TMS,isomer #273C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3677.5Semi standard non polar33892256
Raffinose,4TMS,isomer #274C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3664.3Semi standard non polar33892256
Raffinose,4TMS,isomer #275C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3674.4Semi standard non polar33892256
Raffinose,4TMS,isomer #276C[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3693.5Semi standard non polar33892256
Raffinose,4TMS,isomer #277C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3692.1Semi standard non polar33892256
Raffinose,4TMS,isomer #278C[Si](C)(C)O[C@@H]1[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3698.1Semi standard non polar33892256
Raffinose,4TMS,isomer #279C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)O[C@@H]1CO3709.5Semi standard non polar33892256
Raffinose,4TMS,isomer #28C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3637.6Semi standard non polar33892256
Raffinose,4TMS,isomer #280C[Si](C)(C)O[C@@H]1[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3691.1Semi standard non polar33892256
Raffinose,4TMS,isomer #281C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3681.5Semi standard non polar33892256
Raffinose,4TMS,isomer #282C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3687.5Semi standard non polar33892256
Raffinose,4TMS,isomer #283C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3700.6Semi standard non polar33892256
Raffinose,4TMS,isomer #284C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3717.8Semi standard non polar33892256
Raffinose,4TMS,isomer #285C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3712.5Semi standard non polar33892256
Raffinose,4TMS,isomer #286C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3650.1Semi standard non polar33892256
Raffinose,4TMS,isomer #287C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3640.9Semi standard non polar33892256
Raffinose,4TMS,isomer #288C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3633.6Semi standard non polar33892256
Raffinose,4TMS,isomer #289C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)O[C@@H]1CO[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3626.9Semi standard non polar33892256
Raffinose,4TMS,isomer #29C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3704.3Semi standard non polar33892256
Raffinose,4TMS,isomer #290C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)O[C@@H]1CO[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3618.4Semi standard non polar33892256
Raffinose,4TMS,isomer #291C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)O[C@@H]1CO3639.7Semi standard non polar33892256
Raffinose,4TMS,isomer #292C[Si](C)(C)O[C@H]1[C@@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@H](O[Si](C)(C)C)[C@@H]1O3636.9Semi standard non polar33892256
Raffinose,4TMS,isomer #293C[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3642.5Semi standard non polar33892256
Raffinose,4TMS,isomer #294C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO3635.9Semi standard non polar33892256
Raffinose,4TMS,isomer #295C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO3647.1Semi standard non polar33892256
Raffinose,4TMS,isomer #296C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@@H]1O3673.3Semi standard non polar33892256
Raffinose,4TMS,isomer #297C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3670.3Semi standard non polar33892256
Raffinose,4TMS,isomer #298C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@@H]1O3679.9Semi standard non polar33892256
Raffinose,4TMS,isomer #299C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3692.0Semi standard non polar33892256
Raffinose,4TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3629.2Semi standard non polar33892256
Raffinose,4TMS,isomer #30C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3666.1Semi standard non polar33892256
Raffinose,4TMS,isomer #300C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1CO3664.6Semi standard non polar33892256
Raffinose,4TMS,isomer #301C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3658.3Semi standard non polar33892256
Raffinose,4TMS,isomer #302C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3661.6Semi standard non polar33892256
Raffinose,4TMS,isomer #303C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3660.2Semi standard non polar33892256
Raffinose,4TMS,isomer #304C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO[C@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3641.6Semi standard non polar33892256
Raffinose,4TMS,isomer #305C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3658.1Semi standard non polar33892256
Raffinose,4TMS,isomer #306C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3691.8Semi standard non polar33892256
Raffinose,4TMS,isomer #307C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO[C@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3677.1Semi standard non polar33892256
Raffinose,4TMS,isomer #308C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3699.4Semi standard non polar33892256
Raffinose,4TMS,isomer #309C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3696.8Semi standard non polar33892256
Raffinose,4TMS,isomer #31C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3641.3Semi standard non polar33892256
Raffinose,4TMS,isomer #310C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C3696.5Semi standard non polar33892256
Raffinose,4TMS,isomer #311C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3703.5Semi standard non polar33892256
Raffinose,4TMS,isomer #312C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3630.4Semi standard non polar33892256
Raffinose,4TMS,isomer #313C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C3648.4Semi standard non polar33892256
Raffinose,4TMS,isomer #314C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)O[C@@H]1CO[C@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3633.1Semi standard non polar33892256
Raffinose,4TMS,isomer #315C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3649.7Semi standard non polar33892256
Raffinose,4TMS,isomer #316C[Si](C)(C)O[C@@H]1[C@@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3686.3Semi standard non polar33892256
Raffinose,4TMS,isomer #317C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3673.3Semi standard non polar33892256
Raffinose,4TMS,isomer #318C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3679.8Semi standard non polar33892256
Raffinose,4TMS,isomer #319C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3657.1Semi standard non polar33892256
Raffinose,4TMS,isomer #32C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3680.3Semi standard non polar33892256
Raffinose,4TMS,isomer #320C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3643.4Semi standard non polar33892256
Raffinose,4TMS,isomer #321C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3656.4Semi standard non polar33892256
Raffinose,4TMS,isomer #322C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3678.9Semi standard non polar33892256
Raffinose,4TMS,isomer #323C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3696.0Semi standard non polar33892256
Raffinose,4TMS,isomer #324C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3694.2Semi standard non polar33892256
Raffinose,4TMS,isomer #325C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3632.8Semi standard non polar33892256
Raffinose,4TMS,isomer #326C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O3693.9Semi standard non polar33892256
Raffinose,4TMS,isomer #327C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3704.7Semi standard non polar33892256
Raffinose,4TMS,isomer #328C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3674.1Semi standard non polar33892256
Raffinose,4TMS,isomer #329C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3712.4Semi standard non polar33892256
Raffinose,4TMS,isomer #33C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3643.4Semi standard non polar33892256
Raffinose,4TMS,isomer #330C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3699.1Semi standard non polar33892256
Raffinose,4TMS,isomer #34C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3692.6Semi standard non polar33892256
Raffinose,4TMS,isomer #35C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3658.6Semi standard non polar33892256
Raffinose,4TMS,isomer #36C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3726.8Semi standard non polar33892256
Raffinose,4TMS,isomer #37C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3625.1Semi standard non polar33892256
Raffinose,4TMS,isomer #38C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3634.0Semi standard non polar33892256
Raffinose,4TMS,isomer #39C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3644.6Semi standard non polar33892256
Raffinose,4TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3643.8Semi standard non polar33892256
Raffinose,4TMS,isomer #40C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3631.8Semi standard non polar33892256
Raffinose,4TMS,isomer #41C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3639.8Semi standard non polar33892256
Raffinose,4TMS,isomer #42C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3692.0Semi standard non polar33892256
Raffinose,4TMS,isomer #43C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3644.0Semi standard non polar33892256
Raffinose,4TMS,isomer #44C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3599.4Semi standard non polar33892256
Raffinose,4TMS,isomer #45C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3646.0Semi standard non polar33892256
Raffinose,4TMS,isomer #46C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3599.8Semi standard non polar33892256
Raffinose,4TMS,isomer #47C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3593.8Semi standard non polar33892256
Raffinose,4TMS,isomer #48C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3601.6Semi standard non polar33892256
Raffinose,4TMS,isomer #49C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3623.8Semi standard non polar33892256
Raffinose,4TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3619.8Semi standard non polar33892256
Raffinose,4TMS,isomer #50C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3621.7Semi standard non polar33892256
Raffinose,4TMS,isomer #51C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3609.5Semi standard non polar33892256
Raffinose,4TMS,isomer #52C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3616.6Semi standard non polar33892256
Raffinose,4TMS,isomer #53C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3669.3Semi standard non polar33892256
Raffinose,4TMS,isomer #54C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3618.4Semi standard non polar33892256
Raffinose,4TMS,isomer #55C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3623.3Semi standard non polar33892256
Raffinose,4TMS,isomer #56C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3617.1Semi standard non polar33892256
Raffinose,4TMS,isomer #57C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3678.9Semi standard non polar33892256
Raffinose,4TMS,isomer #58C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3631.6Semi standard non polar33892256
Raffinose,4TMS,isomer #59C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3621.8Semi standard non polar33892256
Raffinose,4TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3631.6Semi standard non polar33892256
Raffinose,4TMS,isomer #60C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3664.8Semi standard non polar33892256
Raffinose,4TMS,isomer #61C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3617.7Semi standard non polar33892256
Raffinose,4TMS,isomer #62C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3672.5Semi standard non polar33892256
Raffinose,4TMS,isomer #63C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3627.5Semi standard non polar33892256
Raffinose,4TMS,isomer #64C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3681.3Semi standard non polar33892256
Raffinose,4TMS,isomer #65C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3632.7Semi standard non polar33892256
Raffinose,4TMS,isomer #66C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3621.7Semi standard non polar33892256
Raffinose,4TMS,isomer #67C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3618.7Semi standard non polar33892256
Raffinose,4TMS,isomer #68C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3618.3Semi standard non polar33892256
Raffinose,4TMS,isomer #69C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3674.7Semi standard non polar33892256
Raffinose,4TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3678.1Semi standard non polar33892256
Raffinose,4TMS,isomer #70C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3622.2Semi standard non polar33892256
Raffinose,4TMS,isomer #71C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3621.5Semi standard non polar33892256
Raffinose,4TMS,isomer #72C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3612.5Semi standard non polar33892256
Raffinose,4TMS,isomer #73C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3615.5Semi standard non polar33892256
Raffinose,4TMS,isomer #74C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3671.1Semi standard non polar33892256
Raffinose,4TMS,isomer #75C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3619.7Semi standard non polar33892256
Raffinose,4TMS,isomer #76C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3641.8Semi standard non polar33892256
Raffinose,4TMS,isomer #77C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3630.8Semi standard non polar33892256
Raffinose,4TMS,isomer #78C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3697.1Semi standard non polar33892256
Raffinose,4TMS,isomer #79C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3649.8Semi standard non polar33892256
Raffinose,4TMS,isomer #8C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3639.9Semi standard non polar33892256
Raffinose,4TMS,isomer #80C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3640.2Semi standard non polar33892256
Raffinose,4TMS,isomer #81C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3683.5Semi standard non polar33892256
Raffinose,4TMS,isomer #82C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3638.4Semi standard non polar33892256
Raffinose,4TMS,isomer #83C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3691.3Semi standard non polar33892256
Raffinose,4TMS,isomer #84C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3646.0Semi standard non polar33892256
Raffinose,4TMS,isomer #85C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3696.4Semi standard non polar33892256
Raffinose,4TMS,isomer #86C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3625.0Semi standard non polar33892256
Raffinose,4TMS,isomer #87C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3621.6Semi standard non polar33892256
Raffinose,4TMS,isomer #88C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3622.6Semi standard non polar33892256
Raffinose,4TMS,isomer #89C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3681.7Semi standard non polar33892256
Raffinose,4TMS,isomer #9C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3623.7Semi standard non polar33892256
Raffinose,4TMS,isomer #90C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3626.1Semi standard non polar33892256
Raffinose,4TMS,isomer #91C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3623.5Semi standard non polar33892256
Raffinose,4TMS,isomer #92C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3607.1Semi standard non polar33892256
Raffinose,4TMS,isomer #93C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3669.2Semi standard non polar33892256
Raffinose,4TMS,isomer #94C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3625.5Semi standard non polar33892256
Raffinose,4TMS,isomer #95C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3620.9Semi standard non polar33892256
Raffinose,4TMS,isomer #96C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3657.7Semi standard non polar33892256
Raffinose,4TMS,isomer #97C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3614.4Semi standard non polar33892256
Raffinose,4TMS,isomer #98C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3663.4Semi standard non polar33892256
Raffinose,4TMS,isomer #99C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3621.6Semi standard non polar33892256
Raffinose,5TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3526.7Semi standard non polar33892256
Raffinose,5TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3498.3Semi standard non polar33892256
Raffinose,5TMS,isomer #100C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3544.5Semi standard non polar33892256
Raffinose,5TMS,isomer #101C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3580.7Semi standard non polar33892256
Raffinose,5TMS,isomer #102C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3529.9Semi standard non polar33892256
Raffinose,5TMS,isomer #103C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3586.7Semi standard non polar33892256
Raffinose,5TMS,isomer #104C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3525.4Semi standard non polar33892256
Raffinose,5TMS,isomer #105C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3591.9Semi standard non polar33892256
Raffinose,5TMS,isomer #106C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3545.4Semi standard non polar33892256
Raffinose,5TMS,isomer #107C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3500.6Semi standard non polar33892256
Raffinose,5TMS,isomer #108C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3506.9Semi standard non polar33892256
Raffinose,5TMS,isomer #109C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3511.9Semi standard non polar33892256
Raffinose,5TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3510.7Semi standard non polar33892256
Raffinose,5TMS,isomer #110C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3530.9Semi standard non polar33892256
Raffinose,5TMS,isomer #111C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3543.6Semi standard non polar33892256
Raffinose,5TMS,isomer #112C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3544.2Semi standard non polar33892256
Raffinose,5TMS,isomer #113C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3547.0Semi standard non polar33892256
Raffinose,5TMS,isomer #114C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3586.0Semi standard non polar33892256
Raffinose,5TMS,isomer #115C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3525.8Semi standard non polar33892256
Raffinose,5TMS,isomer #116C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3512.2Semi standard non polar33892256
Raffinose,5TMS,isomer #117C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3538.5Semi standard non polar33892256
Raffinose,5TMS,isomer #118C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3540.8Semi standard non polar33892256
Raffinose,5TMS,isomer #119C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3554.5Semi standard non polar33892256
Raffinose,5TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3508.6Semi standard non polar33892256
Raffinose,5TMS,isomer #120C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3548.7Semi standard non polar33892256
Raffinose,5TMS,isomer #121C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3544.9Semi standard non polar33892256
Raffinose,5TMS,isomer #122C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3516.8Semi standard non polar33892256
Raffinose,5TMS,isomer #123C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3570.0Semi standard non polar33892256
Raffinose,5TMS,isomer #124C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3521.9Semi standard non polar33892256
Raffinose,5TMS,isomer #125C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3531.5Semi standard non polar33892256
Raffinose,5TMS,isomer #126C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3562.9Semi standard non polar33892256
Raffinose,5TMS,isomer #127C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3517.2Semi standard non polar33892256
Raffinose,5TMS,isomer #128C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3567.3Semi standard non polar33892256
Raffinose,5TMS,isomer #129C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3509.9Semi standard non polar33892256
Raffinose,5TMS,isomer #13C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3528.2Semi standard non polar33892256
Raffinose,5TMS,isomer #130C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3573.8Semi standard non polar33892256
Raffinose,5TMS,isomer #131C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3551.9Semi standard non polar33892256
Raffinose,5TMS,isomer #132C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3585.8Semi standard non polar33892256
Raffinose,5TMS,isomer #133C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3538.2Semi standard non polar33892256
Raffinose,5TMS,isomer #134C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3554.9Semi standard non polar33892256
Raffinose,5TMS,isomer #135C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3512.9Semi standard non polar33892256
Raffinose,5TMS,isomer #136C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3576.8Semi standard non polar33892256
Raffinose,5TMS,isomer #137C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3578.7Semi standard non polar33892256
Raffinose,5TMS,isomer #138C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3528.7Semi standard non polar33892256
Raffinose,5TMS,isomer #139C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3566.8Semi standard non polar33892256
Raffinose,5TMS,isomer #14C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3523.3Semi standard non polar33892256
Raffinose,5TMS,isomer #140C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3573.0Semi standard non polar33892256
Raffinose,5TMS,isomer #141C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3556.8Semi standard non polar33892256
Raffinose,5TMS,isomer #142C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3561.2Semi standard non polar33892256
Raffinose,5TMS,isomer #143C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3541.9Semi standard non polar33892256
Raffinose,5TMS,isomer #144C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3594.8Semi standard non polar33892256
Raffinose,5TMS,isomer #145C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3540.2Semi standard non polar33892256
Raffinose,5TMS,isomer #146C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3561.2Semi standard non polar33892256
Raffinose,5TMS,isomer #147C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3529.0Semi standard non polar33892256
Raffinose,5TMS,isomer #148C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3585.2Semi standard non polar33892256
Raffinose,5TMS,isomer #149C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3531.7Semi standard non polar33892256
Raffinose,5TMS,isomer #15C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3517.8Semi standard non polar33892256
Raffinose,5TMS,isomer #150C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3546.2Semi standard non polar33892256
Raffinose,5TMS,isomer #151C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3583.2Semi standard non polar33892256
Raffinose,5TMS,isomer #152C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3527.7Semi standard non polar33892256
Raffinose,5TMS,isomer #153C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3580.3Semi standard non polar33892256
Raffinose,5TMS,isomer #154C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3518.0Semi standard non polar33892256
Raffinose,5TMS,isomer #155C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3586.1Semi standard non polar33892256
Raffinose,5TMS,isomer #156C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3543.7Semi standard non polar33892256
Raffinose,5TMS,isomer #157C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3513.0Semi standard non polar33892256
Raffinose,5TMS,isomer #158C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3571.1Semi standard non polar33892256
Raffinose,5TMS,isomer #159C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3519.6Semi standard non polar33892256
Raffinose,5TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3511.2Semi standard non polar33892256
Raffinose,5TMS,isomer #160C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3530.1Semi standard non polar33892256
Raffinose,5TMS,isomer #161C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3562.8Semi standard non polar33892256
Raffinose,5TMS,isomer #162C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3510.7Semi standard non polar33892256
Raffinose,5TMS,isomer #163C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3567.3Semi standard non polar33892256
Raffinose,5TMS,isomer #164C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3504.3Semi standard non polar33892256
Raffinose,5TMS,isomer #165C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3573.8Semi standard non polar33892256
Raffinose,5TMS,isomer #166C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3556.8Semi standard non polar33892256
Raffinose,5TMS,isomer #167C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3603.2Semi standard non polar33892256
Raffinose,5TMS,isomer #168C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3548.8Semi standard non polar33892256
Raffinose,5TMS,isomer #169C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3570.5Semi standard non polar33892256
Raffinose,5TMS,isomer #17C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3582.8Semi standard non polar33892256
Raffinose,5TMS,isomer #170C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3520.2Semi standard non polar33892256
Raffinose,5TMS,isomer #171C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3593.3Semi standard non polar33892256
Raffinose,5TMS,isomer #172C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3595.3Semi standard non polar33892256
Raffinose,5TMS,isomer #173C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3535.2Semi standard non polar33892256
Raffinose,5TMS,isomer #174C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3581.7Semi standard non polar33892256
Raffinose,5TMS,isomer #175C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3586.1Semi standard non polar33892256
Raffinose,5TMS,isomer #176C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3567.5Semi standard non polar33892256
Raffinose,5TMS,isomer #177C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3537.2Semi standard non polar33892256
Raffinose,5TMS,isomer #178C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3586.8Semi standard non polar33892256
Raffinose,5TMS,isomer #179C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3539.3Semi standard non polar33892256
Raffinose,5TMS,isomer #18C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3514.1Semi standard non polar33892256
Raffinose,5TMS,isomer #180C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3554.5Semi standard non polar33892256
Raffinose,5TMS,isomer #181C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3584.3Semi standard non polar33892256
Raffinose,5TMS,isomer #182C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3535.5Semi standard non polar33892256
Raffinose,5TMS,isomer #183C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3581.4Semi standard non polar33892256
Raffinose,5TMS,isomer #184C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3525.5Semi standard non polar33892256
Raffinose,5TMS,isomer #185C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3586.9Semi standard non polar33892256
Raffinose,5TMS,isomer #186C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3554.0Semi standard non polar33892256
Raffinose,5TMS,isomer #187C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3578.7Semi standard non polar33892256
Raffinose,5TMS,isomer #188C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3537.7Semi standard non polar33892256
Raffinose,5TMS,isomer #189C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3544.2Semi standard non polar33892256
Raffinose,5TMS,isomer #19C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3538.7Semi standard non polar33892256
Raffinose,5TMS,isomer #190C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3507.5Semi standard non polar33892256
Raffinose,5TMS,isomer #191C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3560.6Semi standard non polar33892256
Raffinose,5TMS,isomer #192C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3571.3Semi standard non polar33892256
Raffinose,5TMS,isomer #193C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3525.0Semi standard non polar33892256
Raffinose,5TMS,isomer #194C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3552.5Semi standard non polar33892256
Raffinose,5TMS,isomer #195C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3557.0Semi standard non polar33892256
Raffinose,5TMS,isomer #196C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3541.2Semi standard non polar33892256
Raffinose,5TMS,isomer #197C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3581.4Semi standard non polar33892256
Raffinose,5TMS,isomer #198C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3533.5Semi standard non polar33892256
Raffinose,5TMS,isomer #199C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3548.3Semi standard non polar33892256
Raffinose,5TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3521.2Semi standard non polar33892256
Raffinose,5TMS,isomer #20C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3511.8Semi standard non polar33892256
Raffinose,5TMS,isomer #200C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3507.4Semi standard non polar33892256
Raffinose,5TMS,isomer #201C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3570.8Semi standard non polar33892256
Raffinose,5TMS,isomer #202C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3574.8Semi standard non polar33892256
Raffinose,5TMS,isomer #203C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3522.3Semi standard non polar33892256
Raffinose,5TMS,isomer #204C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3561.3Semi standard non polar33892256
Raffinose,5TMS,isomer #205C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3564.7Semi standard non polar33892256
Raffinose,5TMS,isomer #206C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3593.1Semi standard non polar33892256
Raffinose,5TMS,isomer #207C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3548.2Semi standard non polar33892256
Raffinose,5TMS,isomer #208C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3596.1Semi standard non polar33892256
Raffinose,5TMS,isomer #209C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3566.8Semi standard non polar33892256
Raffinose,5TMS,isomer #21C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3586.0Semi standard non polar33892256
Raffinose,5TMS,isomer #210C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3591.7Semi standard non polar33892256
Raffinose,5TMS,isomer #211C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3610.0Semi standard non polar33892256
Raffinose,5TMS,isomer #212C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3603.3Semi standard non polar33892256
Raffinose,5TMS,isomer #213C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3617.7Semi standard non polar33892256
Raffinose,5TMS,isomer #214C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3613.5Semi standard non polar33892256
Raffinose,5TMS,isomer #215C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3581.2Semi standard non polar33892256
Raffinose,5TMS,isomer #216C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3631.9Semi standard non polar33892256
Raffinose,5TMS,isomer #217C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3549.8Semi standard non polar33892256
Raffinose,5TMS,isomer #218C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3532.2Semi standard non polar33892256
Raffinose,5TMS,isomer #219C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3542.7Semi standard non polar33892256
Raffinose,5TMS,isomer #22C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3524.1Semi standard non polar33892256
Raffinose,5TMS,isomer #220C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3513.7Semi standard non polar33892256
Raffinose,5TMS,isomer #221C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3561.8Semi standard non polar33892256
Raffinose,5TMS,isomer #222C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3560.8Semi standard non polar33892256
Raffinose,5TMS,isomer #223C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3536.5Semi standard non polar33892256
Raffinose,5TMS,isomer #224C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3521.4Semi standard non polar33892256
Raffinose,5TMS,isomer #225C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3554.0Semi standard non polar33892256
Raffinose,5TMS,isomer #226C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3549.6Semi standard non polar33892256
Raffinose,5TMS,isomer #227C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3525.7Semi standard non polar33892256
Raffinose,5TMS,isomer #228C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3569.2Semi standard non polar33892256
Raffinose,5TMS,isomer #229C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3557.4Semi standard non polar33892256
Raffinose,5TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3523.2Semi standard non polar33892256
Raffinose,5TMS,isomer #230C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3557.8Semi standard non polar33892256
Raffinose,5TMS,isomer #231C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3558.1Semi standard non polar33892256
Raffinose,5TMS,isomer #232C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3615.7Semi standard non polar33892256
Raffinose,5TMS,isomer #233C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3591.3Semi standard non polar33892256
Raffinose,5TMS,isomer #234C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3603.4Semi standard non polar33892256
Raffinose,5TMS,isomer #235C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3578.4Semi standard non polar33892256
Raffinose,5TMS,isomer #236C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3621.2Semi standard non polar33892256
Raffinose,5TMS,isomer #237C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3622.7Semi standard non polar33892256
Raffinose,5TMS,isomer #238C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3600.0Semi standard non polar33892256
Raffinose,5TMS,isomer #239C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3573.5Semi standard non polar33892256
Raffinose,5TMS,isomer #24C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3568.9Semi standard non polar33892256
Raffinose,5TMS,isomer #240C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3617.8Semi standard non polar33892256
Raffinose,5TMS,isomer #241C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3608.5Semi standard non polar33892256
Raffinose,5TMS,isomer #242C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3581.1Semi standard non polar33892256
Raffinose,5TMS,isomer #243C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3627.5Semi standard non polar33892256
Raffinose,5TMS,isomer #244C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3628.5Semi standard non polar33892256
Raffinose,5TMS,isomer #245C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3624.2Semi standard non polar33892256
Raffinose,5TMS,isomer #246C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3626.6Semi standard non polar33892256
Raffinose,5TMS,isomer #247C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3565.7Semi standard non polar33892256
Raffinose,5TMS,isomer #248C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3543.9Semi standard non polar33892256
Raffinose,5TMS,isomer #249C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3533.6Semi standard non polar33892256
Raffinose,5TMS,isomer #25C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3512.3Semi standard non polar33892256
Raffinose,5TMS,isomer #250C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3555.2Semi standard non polar33892256
Raffinose,5TMS,isomer #251C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3529.7Semi standard non polar33892256
Raffinose,5TMS,isomer #252C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3521.6Semi standard non polar33892256
Raffinose,5TMS,isomer #253C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3544.1Semi standard non polar33892256
Raffinose,5TMS,isomer #254C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3552.7Semi standard non polar33892256
Raffinose,5TMS,isomer #255C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3539.8Semi standard non polar33892256
Raffinose,5TMS,isomer #256C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3546.7Semi standard non polar33892256
Raffinose,5TMS,isomer #257C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3556.3Semi standard non polar33892256
Raffinose,5TMS,isomer #258C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3547.8Semi standard non polar33892256
Raffinose,5TMS,isomer #259C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3569.4Semi standard non polar33892256
Raffinose,5TMS,isomer #26C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3580.4Semi standard non polar33892256
Raffinose,5TMS,isomer #260C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3563.7Semi standard non polar33892256
Raffinose,5TMS,isomer #261C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3550.6Semi standard non polar33892256
Raffinose,5TMS,isomer #262C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3556.1Semi standard non polar33892256
Raffinose,5TMS,isomer #263C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3562.7Semi standard non polar33892256
Raffinose,5TMS,isomer #264C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3552.0Semi standard non polar33892256
Raffinose,5TMS,isomer #265C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3557.9Semi standard non polar33892256
Raffinose,5TMS,isomer #266C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3585.9Semi standard non polar33892256
Raffinose,5TMS,isomer #267C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3572.7Semi standard non polar33892256
Raffinose,5TMS,isomer #268C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3571.7Semi standard non polar33892256
Raffinose,5TMS,isomer #269C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3559.4Semi standard non polar33892256
Raffinose,5TMS,isomer #27C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3516.4Semi standard non polar33892256
Raffinose,5TMS,isomer #270C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3566.0Semi standard non polar33892256
Raffinose,5TMS,isomer #271C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3641.4Semi standard non polar33892256
Raffinose,5TMS,isomer #272C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3570.5Semi standard non polar33892256
Raffinose,5TMS,isomer #273C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3539.1Semi standard non polar33892256
Raffinose,5TMS,isomer #274C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3556.6Semi standard non polar33892256
Raffinose,5TMS,isomer #275C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3625.2Semi standard non polar33892256
Raffinose,5TMS,isomer #276C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3557.9Semi standard non polar33892256
Raffinose,5TMS,isomer #277C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3552.9Semi standard non polar33892256
Raffinose,5TMS,isomer #278C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3621.4Semi standard non polar33892256
Raffinose,5TMS,isomer #279C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3548.7Semi standard non polar33892256
Raffinose,5TMS,isomer #28C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3600.3Semi standard non polar33892256
Raffinose,5TMS,isomer #280C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3618.6Semi standard non polar33892256
Raffinose,5TMS,isomer #281C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3624.1Semi standard non polar33892256
Raffinose,5TMS,isomer #282C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3552.4Semi standard non polar33892256
Raffinose,5TMS,isomer #283C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3524.8Semi standard non polar33892256
Raffinose,5TMS,isomer #284C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3542.1Semi standard non polar33892256
Raffinose,5TMS,isomer #285C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3609.3Semi standard non polar33892256
Raffinose,5TMS,isomer #286C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3542.6Semi standard non polar33892256
Raffinose,5TMS,isomer #287C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3533.6Semi standard non polar33892256
Raffinose,5TMS,isomer #288C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3601.6Semi standard non polar33892256
Raffinose,5TMS,isomer #289C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3534.2Semi standard non polar33892256
Raffinose,5TMS,isomer #29C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3537.5Semi standard non polar33892256
Raffinose,5TMS,isomer #290C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3604.5Semi standard non polar33892256
Raffinose,5TMS,isomer #291C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3611.9Semi standard non polar33892256
Raffinose,5TMS,isomer #292C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3570.1Semi standard non polar33892256
Raffinose,5TMS,isomer #293C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3572.7Semi standard non polar33892256
Raffinose,5TMS,isomer #294C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3642.3Semi standard non polar33892256
Raffinose,5TMS,isomer #295C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3541.2Semi standard non polar33892256
Raffinose,5TMS,isomer #296C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3608.7Semi standard non polar33892256
Raffinose,5TMS,isomer #297C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3628.2Semi standard non polar33892256
Raffinose,5TMS,isomer #298C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3560.7Semi standard non polar33892256
Raffinose,5TMS,isomer #299C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3633.7Semi standard non polar33892256
Raffinose,5TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3540.3Semi standard non polar33892256
Raffinose,5TMS,isomer #30C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3524.1Semi standard non polar33892256
Raffinose,5TMS,isomer #300C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3614.4Semi standard non polar33892256
Raffinose,5TMS,isomer #301C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3618.3Semi standard non polar33892256
Raffinose,5TMS,isomer #302C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3577.4Semi standard non polar33892256
Raffinose,5TMS,isomer #303C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3550.0Semi standard non polar33892256
Raffinose,5TMS,isomer #304C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3556.4Semi standard non polar33892256
Raffinose,5TMS,isomer #305C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3625.0Semi standard non polar33892256
Raffinose,5TMS,isomer #306C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3565.3Semi standard non polar33892256
Raffinose,5TMS,isomer #307C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3552.0Semi standard non polar33892256
Raffinose,5TMS,isomer #308C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3621.6Semi standard non polar33892256
Raffinose,5TMS,isomer #309C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3549.5Semi standard non polar33892256
Raffinose,5TMS,isomer #31C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3524.9Semi standard non polar33892256
Raffinose,5TMS,isomer #310C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3620.0Semi standard non polar33892256
Raffinose,5TMS,isomer #311C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3624.1Semi standard non polar33892256
Raffinose,5TMS,isomer #312C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3563.5Semi standard non polar33892256
Raffinose,5TMS,isomer #313C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3550.8Semi standard non polar33892256
Raffinose,5TMS,isomer #314C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3615.0Semi standard non polar33892256
Raffinose,5TMS,isomer #315C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3519.5Semi standard non polar33892256
Raffinose,5TMS,isomer #316C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3580.5Semi standard non polar33892256
Raffinose,5TMS,isomer #317C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3591.4Semi standard non polar33892256
Raffinose,5TMS,isomer #318C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3539.4Semi standard non polar33892256
Raffinose,5TMS,isomer #319C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3609.5Semi standard non polar33892256
Raffinose,5TMS,isomer #32C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3510.8Semi standard non polar33892256
Raffinose,5TMS,isomer #320C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3580.0Semi standard non polar33892256
Raffinose,5TMS,isomer #321C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3586.1Semi standard non polar33892256
Raffinose,5TMS,isomer #322C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3556.3Semi standard non polar33892256
Raffinose,5TMS,isomer #323C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3550.9Semi standard non polar33892256
Raffinose,5TMS,isomer #324C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3618.1Semi standard non polar33892256
Raffinose,5TMS,isomer #325C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3521.8Semi standard non polar33892256
Raffinose,5TMS,isomer #326C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3584.8Semi standard non polar33892256
Raffinose,5TMS,isomer #327C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3603.7Semi standard non polar33892256
Raffinose,5TMS,isomer #328C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3541.5Semi standard non polar33892256
Raffinose,5TMS,isomer #329C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3611.8Semi standard non polar33892256
Raffinose,5TMS,isomer #33C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3588.9Semi standard non polar33892256
Raffinose,5TMS,isomer #330C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3589.9Semi standard non polar33892256
Raffinose,5TMS,isomer #331C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3596.2Semi standard non polar33892256
Raffinose,5TMS,isomer #332C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3566.9Semi standard non polar33892256
Raffinose,5TMS,isomer #333C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3626.5Semi standard non polar33892256
Raffinose,5TMS,isomer #334C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3631.5Semi standard non polar33892256
Raffinose,5TMS,isomer #335C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3600.6Semi standard non polar33892256
Raffinose,5TMS,isomer #336C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3624.1Semi standard non polar33892256
Raffinose,5TMS,isomer #337C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O3611.0Semi standard non polar33892256
Raffinose,5TMS,isomer #338C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3586.9Semi standard non polar33892256
Raffinose,5TMS,isomer #339C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3592.2Semi standard non polar33892256
Raffinose,5TMS,isomer #34C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3522.1Semi standard non polar33892256
Raffinose,5TMS,isomer #340C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3570.4Semi standard non polar33892256
Raffinose,5TMS,isomer #341C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3611.3Semi standard non polar33892256
Raffinose,5TMS,isomer #342C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3614.4Semi standard non polar33892256
Raffinose,5TMS,isomer #343C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3590.1Semi standard non polar33892256
Raffinose,5TMS,isomer #344C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3568.4Semi standard non polar33892256
Raffinose,5TMS,isomer #345C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3609.1Semi standard non polar33892256
Raffinose,5TMS,isomer #346C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3595.1Semi standard non polar33892256
Raffinose,5TMS,isomer #347C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3572.5Semi standard non polar33892256
Raffinose,5TMS,isomer #348C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3615.8Semi standard non polar33892256
Raffinose,5TMS,isomer #349C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3616.5Semi standard non polar33892256
Raffinose,5TMS,isomer #35C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3514.4Semi standard non polar33892256
Raffinose,5TMS,isomer #350C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3610.9Semi standard non polar33892256
Raffinose,5TMS,isomer #351C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3615.3Semi standard non polar33892256
Raffinose,5TMS,isomer #352C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3572.4Semi standard non polar33892256
Raffinose,5TMS,isomer #353C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3552.9Semi standard non polar33892256
Raffinose,5TMS,isomer #354C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3543.6Semi standard non polar33892256
Raffinose,5TMS,isomer #355C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3566.5Semi standard non polar33892256
Raffinose,5TMS,isomer #356C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3535.0Semi standard non polar33892256
Raffinose,5TMS,isomer #357C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3526.2Semi standard non polar33892256
Raffinose,5TMS,isomer #358C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3551.4Semi standard non polar33892256
Raffinose,5TMS,isomer #359C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3560.5Semi standard non polar33892256
Raffinose,5TMS,isomer #36C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3509.8Semi standard non polar33892256
Raffinose,5TMS,isomer #360C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3540.9Semi standard non polar33892256
Raffinose,5TMS,isomer #361C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3552.6Semi standard non polar33892256
Raffinose,5TMS,isomer #362C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3564.4Semi standard non polar33892256
Raffinose,5TMS,isomer #363C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3556.6Semi standard non polar33892256
Raffinose,5TMS,isomer #364C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3578.7Semi standard non polar33892256
Raffinose,5TMS,isomer #365C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3571.3Semi standard non polar33892256
Raffinose,5TMS,isomer #366C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3549.6Semi standard non polar33892256
Raffinose,5TMS,isomer #367C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3563.6Semi standard non polar33892256
Raffinose,5TMS,isomer #368C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3571.9Semi standard non polar33892256
Raffinose,5TMS,isomer #369C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3555.4Semi standard non polar33892256
Raffinose,5TMS,isomer #37C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3498.9Semi standard non polar33892256
Raffinose,5TMS,isomer #370C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3566.7Semi standard non polar33892256
Raffinose,5TMS,isomer #371C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3587.3Semi standard non polar33892256
Raffinose,5TMS,isomer #372C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O3613.3Semi standard non polar33892256
Raffinose,5TMS,isomer #373C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3609.3Semi standard non polar33892256
Raffinose,5TMS,isomer #374C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3592.7Semi standard non polar33892256
Raffinose,5TMS,isomer #375C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3626.9Semi standard non polar33892256
Raffinose,5TMS,isomer #376C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3582.2Semi standard non polar33892256
Raffinose,5TMS,isomer #377C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3563.3Semi standard non polar33892256
Raffinose,5TMS,isomer #378C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3602.5Semi standard non polar33892256
Raffinose,5TMS,isomer #379C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3619.3Semi standard non polar33892256
Raffinose,5TMS,isomer #38C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3578.7Semi standard non polar33892256
Raffinose,5TMS,isomer #380C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3610.7Semi standard non polar33892256
Raffinose,5TMS,isomer #381C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3616.9Semi standard non polar33892256
Raffinose,5TMS,isomer #382C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3612.2Semi standard non polar33892256
Raffinose,5TMS,isomer #383C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3596.7Semi standard non polar33892256
Raffinose,5TMS,isomer #384C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3630.7Semi standard non polar33892256
Raffinose,5TMS,isomer #385C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3620.2Semi standard non polar33892256
Raffinose,5TMS,isomer #386C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3610.1Semi standard non polar33892256
Raffinose,5TMS,isomer #387C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3619.7Semi standard non polar33892256
Raffinose,5TMS,isomer #388C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3619.3Semi standard non polar33892256
Raffinose,5TMS,isomer #389C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3612.6Semi standard non polar33892256
Raffinose,5TMS,isomer #39C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3512.1Semi standard non polar33892256
Raffinose,5TMS,isomer #390C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3618.8Semi standard non polar33892256
Raffinose,5TMS,isomer #391C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3649.1Semi standard non polar33892256
Raffinose,5TMS,isomer #392C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O3558.1Semi standard non polar33892256
Raffinose,5TMS,isomer #393C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3556.2Semi standard non polar33892256
Raffinose,5TMS,isomer #394C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@H]1O[Si](C)(C)C3572.9Semi standard non polar33892256
Raffinose,5TMS,isomer #395C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3573.7Semi standard non polar33892256
Raffinose,5TMS,isomer #396C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3556.0Semi standard non polar33892256
Raffinose,5TMS,isomer #397C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3568.2Semi standard non polar33892256
Raffinose,5TMS,isomer #398C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3558.7Semi standard non polar33892256
Raffinose,5TMS,isomer #399C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3542.9Semi standard non polar33892256
Raffinose,5TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3530.4Semi standard non polar33892256
Raffinose,5TMS,isomer #40C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3542.3Semi standard non polar33892256
Raffinose,5TMS,isomer #400C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3553.6Semi standard non polar33892256
Raffinose,5TMS,isomer #401C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3573.9Semi standard non polar33892256
Raffinose,5TMS,isomer #402C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O3585.3Semi standard non polar33892256
Raffinose,5TMS,isomer #403C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@H]1O[Si](C)(C)C3569.9Semi standard non polar33892256
Raffinose,5TMS,isomer #404C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3582.5Semi standard non polar33892256
Raffinose,5TMS,isomer #405C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3585.9Semi standard non polar33892256
Raffinose,5TMS,isomer #406C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3587.4Semi standard non polar33892256
Raffinose,5TMS,isomer #407C[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3607.6Semi standard non polar33892256
Raffinose,5TMS,isomer #408C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3613.9Semi standard non polar33892256
Raffinose,5TMS,isomer #409C[Si](C)(C)O[C@@H]1[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3612.3Semi standard non polar33892256
Raffinose,5TMS,isomer #41C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3512.8Semi standard non polar33892256
Raffinose,5TMS,isomer #410C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)O[C@@H]1CO3623.0Semi standard non polar33892256
Raffinose,5TMS,isomer #411C[Si](C)(C)O[C@@H]1[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3594.6Semi standard non polar33892256
Raffinose,5TMS,isomer #412C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3592.8Semi standard non polar33892256
Raffinose,5TMS,isomer #413C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3591.8Semi standard non polar33892256
Raffinose,5TMS,isomer #414C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3595.6Semi standard non polar33892256
Raffinose,5TMS,isomer #415C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3625.8Semi standard non polar33892256
Raffinose,5TMS,isomer #416C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3621.5Semi standard non polar33892256
Raffinose,5TMS,isomer #417C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)O[C@@H]1CO3561.7Semi standard non polar33892256
Raffinose,5TMS,isomer #418C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO3577.2Semi standard non polar33892256
Raffinose,5TMS,isomer #419C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO3575.9Semi standard non polar33892256
Raffinose,5TMS,isomer #42C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3603.1Semi standard non polar33892256
Raffinose,5TMS,isomer #420C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3585.1Semi standard non polar33892256
Raffinose,5TMS,isomer #421C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3551.8Semi standard non polar33892256
Raffinose,5TMS,isomer #422C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3570.7Semi standard non polar33892256
Raffinose,5TMS,isomer #423C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3563.3Semi standard non polar33892256
Raffinose,5TMS,isomer #424C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3530.5Semi standard non polar33892256
Raffinose,5TMS,isomer #425C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3549.2Semi standard non polar33892256
Raffinose,5TMS,isomer #426C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3572.8Semi standard non polar33892256
Raffinose,5TMS,isomer #427C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3634.7Semi standard non polar33892256
Raffinose,5TMS,isomer #428C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3608.8Semi standard non polar33892256
Raffinose,5TMS,isomer #429C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)O[C@@H]1CO3623.8Semi standard non polar33892256
Raffinose,5TMS,isomer #43C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3538.0Semi standard non polar33892256
Raffinose,5TMS,isomer #430C[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3641.4Semi standard non polar33892256
Raffinose,5TMS,isomer #431C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO3628.5Semi standard non polar33892256
Raffinose,5TMS,isomer #432C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO3629.3Semi standard non polar33892256
Raffinose,5TMS,isomer #433C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO[C@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3589.4Semi standard non polar33892256
Raffinose,5TMS,isomer #434C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3622.4Semi standard non polar33892256
Raffinose,5TMS,isomer #435C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3617.0Semi standard non polar33892256
Raffinose,5TMS,isomer #436C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3624.3Semi standard non polar33892256
Raffinose,5TMS,isomer #437C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3574.2Semi standard non polar33892256
Raffinose,5TMS,isomer #438C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3560.4Semi standard non polar33892256
Raffinose,5TMS,isomer #439C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO3577.4Semi standard non polar33892256
Raffinose,5TMS,isomer #44C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3528.0Semi standard non polar33892256
Raffinose,5TMS,isomer #440C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO3565.0Semi standard non polar33892256
Raffinose,5TMS,isomer #441C[Si](C)(C)O[C@@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO3592.9Semi standard non polar33892256
Raffinose,5TMS,isomer #442C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O3600.7Semi standard non polar33892256
Raffinose,5TMS,isomer #443C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO[C@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3570.5Semi standard non polar33892256
Raffinose,5TMS,isomer #444C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]2O)[C@@H]1O[Si](C)(C)C3606.1Semi standard non polar33892256
Raffinose,5TMS,isomer #445C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3605.5Semi standard non polar33892256
Raffinose,5TMS,isomer #446C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C3610.5Semi standard non polar33892256
Raffinose,5TMS,isomer #447C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3608.4Semi standard non polar33892256
Raffinose,5TMS,isomer #448C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3590.5Semi standard non polar33892256
Raffinose,5TMS,isomer #449C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O)O[C@@H]1CO[C@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3558.4Semi standard non polar33892256
Raffinose,5TMS,isomer #45C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3587.3Semi standard non polar33892256
Raffinose,5TMS,isomer #450C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3576.9Semi standard non polar33892256
Raffinose,5TMS,isomer #451C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3568.9Semi standard non polar33892256
Raffinose,5TMS,isomer #452C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O3607.1Semi standard non polar33892256
Raffinose,5TMS,isomer #453C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C3632.2Semi standard non polar33892256
Raffinose,5TMS,isomer #454C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO[C@H]1O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3605.8Semi standard non polar33892256
Raffinose,5TMS,isomer #455C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3637.9Semi standard non polar33892256
Raffinose,5TMS,isomer #456C[Si](C)(C)O[C@H]1[C@@H](O)[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3579.9Semi standard non polar33892256
Raffinose,5TMS,isomer #457C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3569.6Semi standard non polar33892256
Raffinose,5TMS,isomer #458C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3602.4Semi standard non polar33892256
Raffinose,5TMS,isomer #459C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3599.3Semi standard non polar33892256
Raffinose,5TMS,isomer #46C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3524.7Semi standard non polar33892256
Raffinose,5TMS,isomer #460C[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3556.9Semi standard non polar33892256
Raffinose,5TMS,isomer #461C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3601.0Semi standard non polar33892256
Raffinose,5TMS,isomer #462C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3606.6Semi standard non polar33892256
Raffinose,5TMS,isomer #47C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3594.1Semi standard non polar33892256
Raffinose,5TMS,isomer #48C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3531.2Semi standard non polar33892256
Raffinose,5TMS,isomer #49C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3609.9Semi standard non polar33892256
Raffinose,5TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3528.1Semi standard non polar33892256
Raffinose,5TMS,isomer #50C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3533.2Semi standard non polar33892256
Raffinose,5TMS,isomer #51C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3535.6Semi standard non polar33892256
Raffinose,5TMS,isomer #52C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3520.9Semi standard non polar33892256
Raffinose,5TMS,isomer #53C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3590.9Semi standard non polar33892256
Raffinose,5TMS,isomer #54C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3521.6Semi standard non polar33892256
Raffinose,5TMS,isomer #55C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3535.0Semi standard non polar33892256
Raffinose,5TMS,isomer #56C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3504.4Semi standard non polar33892256
Raffinose,5TMS,isomer #57C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3564.5Semi standard non polar33892256
Raffinose,5TMS,isomer #58C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3510.1Semi standard non polar33892256
Raffinose,5TMS,isomer #59C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3520.8Semi standard non polar33892256
Raffinose,5TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3603.5Semi standard non polar33892256
Raffinose,5TMS,isomer #60C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3551.8Semi standard non polar33892256
Raffinose,5TMS,isomer #61C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3504.1Semi standard non polar33892256
Raffinose,5TMS,isomer #62C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3556.9Semi standard non polar33892256
Raffinose,5TMS,isomer #63C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3500.1Semi standard non polar33892256
Raffinose,5TMS,isomer #64C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3571.5Semi standard non polar33892256
Raffinose,5TMS,isomer #65C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3529.1Semi standard non polar33892256
Raffinose,5TMS,isomer #66C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3503.7Semi standard non polar33892256
Raffinose,5TMS,isomer #67C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3577.2Semi standard non polar33892256
Raffinose,5TMS,isomer #68C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3517.4Semi standard non polar33892256
Raffinose,5TMS,isomer #69C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3517.7Semi standard non polar33892256
Raffinose,5TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3535.9Semi standard non polar33892256
Raffinose,5TMS,isomer #70C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3563.4Semi standard non polar33892256
Raffinose,5TMS,isomer #71C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3507.5Semi standard non polar33892256
Raffinose,5TMS,isomer #72C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3570.9Semi standard non polar33892256
Raffinose,5TMS,isomer #73C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3509.6Semi standard non polar33892256
Raffinose,5TMS,isomer #74C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3588.3Semi standard non polar33892256
Raffinose,5TMS,isomer #75C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3545.0Semi standard non polar33892256
Raffinose,5TMS,isomer #76C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3602.0Semi standard non polar33892256
Raffinose,5TMS,isomer #77C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3540.0Semi standard non polar33892256
Raffinose,5TMS,isomer #78C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3571.2Semi standard non polar33892256
Raffinose,5TMS,isomer #79C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3515.0Semi standard non polar33892256
Raffinose,5TMS,isomer #8C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3492.3Semi standard non polar33892256
Raffinose,5TMS,isomer #80C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3608.2Semi standard non polar33892256
Raffinose,5TMS,isomer #81C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3596.3Semi standard non polar33892256
Raffinose,5TMS,isomer #82C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3531.4Semi standard non polar33892256
Raffinose,5TMS,isomer #83C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3587.9Semi standard non polar33892256
Raffinose,5TMS,isomer #84C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3599.5Semi standard non polar33892256
Raffinose,5TMS,isomer #85C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3571.0Semi standard non polar33892256
Raffinose,5TMS,isomer #86C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3545.9Semi standard non polar33892256
Raffinose,5TMS,isomer #87C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3549.8Semi standard non polar33892256
Raffinose,5TMS,isomer #88C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3535.2Semi standard non polar33892256
Raffinose,5TMS,isomer #89C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3586.5Semi standard non polar33892256
Raffinose,5TMS,isomer #9C[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]3O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@H]1O3546.6Semi standard non polar33892256
Raffinose,5TMS,isomer #90C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3526.1Semi standard non polar33892256
Raffinose,5TMS,isomer #91C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O3540.3Semi standard non polar33892256
Raffinose,5TMS,isomer #92C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3540.1Semi standard non polar33892256
Raffinose,5TMS,isomer #93C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3525.0Semi standard non polar33892256
Raffinose,5TMS,isomer #94C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3582.6Semi standard non polar33892256
Raffinose,5TMS,isomer #95C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3517.7Semi standard non polar33892256
Raffinose,5TMS,isomer #96C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O3560.2Semi standard non polar33892256
Raffinose,5TMS,isomer #97C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O3533.3Semi standard non polar33892256
Raffinose,5TMS,isomer #98C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O3589.9Semi standard non polar33892256
Raffinose,5TMS,isomer #99C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O[Si](C)(C)C3538.1Semi standard non polar33892256
Raffinose,1TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O4081.1Semi standard non polar33892256
Raffinose,1TBDMS,isomer #10CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO[C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O4114.7Semi standard non polar33892256
Raffinose,1TBDMS,isomer #11CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@](CO)(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H]1CO4099.0Semi standard non polar33892256
Raffinose,1TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO[C@H]3O[C@H](CO)[C@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4091.1Semi standard non polar33892256
Raffinose,1TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@@H](O)[C@H]1O4077.7Semi standard non polar33892256
Raffinose,1TBDMS,isomer #4CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](CO)O[C@H](OC[C@H]2O[C@H](O[C@]3(CO)O[C@H](CO)[C@@H](O)[C@@H]3O)[C@H](O)[C@@H](O)[C@@H]2O)[C@H](O)[C@H]1O4091.8Semi standard non polar33892256
Raffinose,1TBDMS,isomer #5