Hmdb loader
You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Human Metabolome Database.
Record Information
Version5.0
StatusExpected but not Quantified
Creation Date2006-08-12 23:41:28 UTC
Update Date2021-09-14 15:45:59 UTC
HMDB IDHMDB0003556
Secondary Accession Numbers
  • HMDB03556
Metabolite Identification
Common NameChitobiose
DescriptionChitobiose belongs to the class of organic compounds known as acylaminosugars. These are organic compounds containing a sugar linked to a chain through N-acyl group. Chitobiose has been detected, but not quantified in, a few different foods, such as anatidaes (Anatidae), chickens (Gallus gallus), and domestic pigs (Sus scrofa domestica). This could make chitobiose a potential biomarker for the consumption of these foods. Chitobiose is a primary metabolite. Primary metabolites are metabolically or physiologically essential metabolites. They are directly involved in an organism’s growth, development or reproduction. Based on a literature review a significant number of articles have been published on Chitobiose.
Structure
Data?1594316725
Synonyms
ValueSource
CBSHMDB
ChitodextrinHMDB
DiacetylchitobioseHMDB
Chemical FormulaC15H26N2O12
Average Molecular Weight426.3731
Monoisotopic Molecular Weight426.148574306
IUPAC Name[(2S,3R,4R,5S,6R)-2-{[(2R,3S,4R,5R,6R)-5-acetamido-4,6-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]carbamic acid
Traditional Name(2S,3R,4R,5S,6R)-2-{[(2R,3S,4R,5R,6R)-5-acetamido-4,6-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-ylcarbamic acid
CAS Registry Number577-76-4
SMILES
CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(O)=O)[C@@H]1O
InChI Identifier
InChI=1S/C15H26N2O12/c1-4(20)16-7-11(23)12(6(3-19)27-13(7)24)29-14-8(17-15(25)26)10(22)9(21)5(2-18)28-14/h5-14,17-19,21-24H,2-3H2,1H3,(H,16,20)(H,25,26)/t5-,6-,7-,8-,9-,10-,11-,12-,13-,14+/m1/s1
InChI KeyHSRZMOSQMYFZBL-CGKOVJDHSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as acylaminosugars. These are organic compounds containing a sugar linked to a chain through N-acyl group.
KingdomOrganic compounds
Super ClassOrganic oxygen compounds
ClassOrganooxygen compounds
Sub ClassCarbohydrates and carbohydrate conjugates
Direct ParentAcylaminosugars
Alternative Parents
Substituents
  • Acylaminosugar
  • N-acyl-alpha-hexosamine
  • Disaccharide
  • Glycosyl compound
  • O-glycosyl compound
  • Oxane
  • Acetamide
  • Carbamic acid
  • Carbamic acid derivative
  • Carboxamide group
  • Hemiacetal
  • Carbonic acid derivative
  • Secondary alcohol
  • Secondary carboxylic acid amide
  • Carboxylic acid derivative
  • Oxacycle
  • Acetal
  • Organoheterocyclic compound
  • Hydrocarbon derivative
  • Organic oxide
  • Organopnictogen compound
  • Alcohol
  • Organonitrogen compound
  • Primary alcohol
  • Organic nitrogen compound
  • Carbonyl group
  • Aliphatic heteromonocyclic compound
Molecular FrameworkAliphatic heteromonocyclic compounds
External DescriptorsNot Available
Ontology
Physiological effect

Adverse health effect

Disposition

Biological location

Source

Process

Naturally occurring process

Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water SolubilityNot AvailableNot Available
LogPNot AvailableNot Available
Experimental Chromatographic Properties

Experimental Collision Cross Sections

Adduct TypeData SourceCCS Value (Å2)Reference
[M+H]+MetCCS_train_pos192.94930932474
Predicted Molecular Properties
PropertyValueSource
Water Solubility101 g/LALOGPS
logP-2.9ALOGPS
logP-4.8ChemAxon
logS-0.62ALOGPS
pKa (Strongest Acidic)3.51ChemAxon
pKa (Strongest Basic)-3ChemAxon
Physiological Charge-1ChemAxon
Hydrogen Acceptor Count12ChemAxon
Hydrogen Donor Count9ChemAxon
Polar Surface Area227.5 ŲChemAxon
Rotatable Bond Count6ChemAxon
Refractivity87.39 m³·mol⁻¹ChemAxon
Polarizability39.64 ųChemAxon
Number of Rings2ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleNoChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DarkChem[M+H]+193.51431661259
DarkChem[M-H]-185.91431661259
DeepCCS[M+H]+189.42530932474
DeepCCS[M-H]-187.630932474
DeepCCS[M-2H]-221.130932474
DeepCCS[M+Na]+195.13730932474

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
ChitobioseCC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(O)=O)[C@@H]1O4626.7Standard polar33892256
ChitobioseCC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(O)=O)[C@@H]1O3244.5Standard non polar33892256
ChitobioseCC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(O)=O)[C@@H]1O3780.8Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
Chitobiose,1TMS,isomer #1CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3404.6Semi standard non polar33892256
Chitobiose,1TMS,isomer #2CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3398.0Semi standard non polar33892256
Chitobiose,1TMS,isomer #3CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3387.8Semi standard non polar33892256
Chitobiose,1TMS,isomer #4CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3416.3Semi standard non polar33892256
Chitobiose,1TMS,isomer #5CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3407.4Semi standard non polar33892256
Chitobiose,1TMS,isomer #6CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3399.1Semi standard non polar33892256
Chitobiose,1TMS,isomer #7CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3408.8Semi standard non polar33892256
Chitobiose,1TMS,isomer #8CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3373.9Semi standard non polar33892256
Chitobiose,1TMS,isomer #9CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3412.4Semi standard non polar33892256
Chitobiose,2TMS,isomer #1CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3308.9Semi standard non polar33892256
Chitobiose,2TMS,isomer #10CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3336.2Semi standard non polar33892256
Chitobiose,2TMS,isomer #11CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3327.7Semi standard non polar33892256
Chitobiose,2TMS,isomer #12CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3313.2Semi standard non polar33892256
Chitobiose,2TMS,isomer #13CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3319.4Semi standard non polar33892256
Chitobiose,2TMS,isomer #14CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3329.0Semi standard non polar33892256
Chitobiose,2TMS,isomer #15CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3347.3Semi standard non polar33892256
Chitobiose,2TMS,isomer #16CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3341.5Semi standard non polar33892256
Chitobiose,2TMS,isomer #17CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3322.9Semi standard non polar33892256
Chitobiose,2TMS,isomer #18CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3308.1Semi standard non polar33892256
Chitobiose,2TMS,isomer #19CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3320.0Semi standard non polar33892256
Chitobiose,2TMS,isomer #2CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3327.2Semi standard non polar33892256
Chitobiose,2TMS,isomer #20CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3319.1Semi standard non polar33892256
Chitobiose,2TMS,isomer #21CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3342.5Semi standard non polar33892256
Chitobiose,2TMS,isomer #22CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3321.1Semi standard non polar33892256
Chitobiose,2TMS,isomer #23CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3313.7Semi standard non polar33892256
Chitobiose,2TMS,isomer #24CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3322.1Semi standard non polar33892256
Chitobiose,2TMS,isomer #25CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3310.3Semi standard non polar33892256
Chitobiose,2TMS,isomer #26CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3342.8Semi standard non polar33892256
Chitobiose,2TMS,isomer #27CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3310.0Semi standard non polar33892256
Chitobiose,2TMS,isomer #28CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3311.6Semi standard non polar33892256
Chitobiose,2TMS,isomer #29CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3307.1Semi standard non polar33892256
Chitobiose,2TMS,isomer #3CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3329.8Semi standard non polar33892256
Chitobiose,2TMS,isomer #30CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3364.5Semi standard non polar33892256
Chitobiose,2TMS,isomer #31CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3312.9Semi standard non polar33892256
Chitobiose,2TMS,isomer #32CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3317.5Semi standard non polar33892256
Chitobiose,2TMS,isomer #33CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3241.9Semi standard non polar33892256
Chitobiose,2TMS,isomer #34CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3318.8Semi standard non polar33892256
Chitobiose,2TMS,isomer #35CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3349.7Semi standard non polar33892256
Chitobiose,2TMS,isomer #36CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3292.2Semi standard non polar33892256
Chitobiose,2TMS,isomer #4CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3320.7Semi standard non polar33892256
Chitobiose,2TMS,isomer #5CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3318.4Semi standard non polar33892256
Chitobiose,2TMS,isomer #6CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3308.4Semi standard non polar33892256
Chitobiose,2TMS,isomer #7CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3310.6Semi standard non polar33892256
Chitobiose,2TMS,isomer #8CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3339.6Semi standard non polar33892256
Chitobiose,2TMS,isomer #9CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3340.2Semi standard non polar33892256
Chitobiose,3TMS,isomer #1CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3246.9Semi standard non polar33892256
Chitobiose,3TMS,isomer #10CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3222.3Semi standard non polar33892256
Chitobiose,3TMS,isomer #11CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3247.9Semi standard non polar33892256
Chitobiose,3TMS,isomer #12CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3244.4Semi standard non polar33892256
Chitobiose,3TMS,isomer #13CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3254.5Semi standard non polar33892256
Chitobiose,3TMS,isomer #14CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3285.3Semi standard non polar33892256
Chitobiose,3TMS,isomer #15CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3267.9Semi standard non polar33892256
Chitobiose,3TMS,isomer #16CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3285.1Semi standard non polar33892256
Chitobiose,3TMS,isomer #17CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3263.9Semi standard non polar33892256
Chitobiose,3TMS,isomer #18CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3283.1Semi standard non polar33892256
Chitobiose,3TMS,isomer #19CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3254.1Semi standard non polar33892256
Chitobiose,3TMS,isomer #2CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3289.6Semi standard non polar33892256
Chitobiose,3TMS,isomer #20CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3279.5Semi standard non polar33892256
Chitobiose,3TMS,isomer #21CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3263.9Semi standard non polar33892256
Chitobiose,3TMS,isomer #22CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3293.9Semi standard non polar33892256
Chitobiose,3TMS,isomer #23CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3215.9Semi standard non polar33892256
Chitobiose,3TMS,isomer #24CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3244.1Semi standard non polar33892256
Chitobiose,3TMS,isomer #25CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3184.2Semi standard non polar33892256
Chitobiose,3TMS,isomer #26CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3270.3Semi standard non polar33892256
Chitobiose,3TMS,isomer #27CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3259.7Semi standard non polar33892256
Chitobiose,3TMS,isomer #28CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3220.4Semi standard non polar33892256
Chitobiose,3TMS,isomer #29CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3305.0Semi standard non polar33892256
Chitobiose,3TMS,isomer #3CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3282.8Semi standard non polar33892256
Chitobiose,3TMS,isomer #30CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3284.9Semi standard non polar33892256
Chitobiose,3TMS,isomer #31CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3220.0Semi standard non polar33892256
Chitobiose,3TMS,isomer #32CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3246.5Semi standard non polar33892256
Chitobiose,3TMS,isomer #33CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3272.2Semi standard non polar33892256
Chitobiose,3TMS,isomer #34CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3254.2Semi standard non polar33892256
Chitobiose,3TMS,isomer #35CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3287.0Semi standard non polar33892256
Chitobiose,3TMS,isomer #36CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3247.9Semi standard non polar33892256
Chitobiose,3TMS,isomer #37CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3283.1Semi standard non polar33892256
Chitobiose,3TMS,isomer #38CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3268.5Semi standard non polar33892256
Chitobiose,3TMS,isomer #39CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3270.4Semi standard non polar33892256
Chitobiose,3TMS,isomer #4CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3216.5Semi standard non polar33892256
Chitobiose,3TMS,isomer #40CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3234.9Semi standard non polar33892256
Chitobiose,3TMS,isomer #41CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3275.2Semi standard non polar33892256
Chitobiose,3TMS,isomer #42CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3270.2Semi standard non polar33892256
Chitobiose,3TMS,isomer #43CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3281.2Semi standard non polar33892256
Chitobiose,3TMS,isomer #44CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3209.1Semi standard non polar33892256
Chitobiose,3TMS,isomer #45CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3246.8Semi standard non polar33892256
Chitobiose,3TMS,isomer #46CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3160.1Semi standard non polar33892256
Chitobiose,3TMS,isomer #47CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3253.4Semi standard non polar33892256
Chitobiose,3TMS,isomer #48CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3267.9Semi standard non polar33892256
Chitobiose,3TMS,isomer #49CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3225.4Semi standard non polar33892256
Chitobiose,3TMS,isomer #5CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3232.2Semi standard non polar33892256
Chitobiose,3TMS,isomer #50CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3291.5Semi standard non polar33892256
Chitobiose,3TMS,isomer #51CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3242.7Semi standard non polar33892256
Chitobiose,3TMS,isomer #52CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3292.6Semi standard non polar33892256
Chitobiose,3TMS,isomer #53CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3276.0Semi standard non polar33892256
Chitobiose,3TMS,isomer #54CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3280.2Semi standard non polar33892256
Chitobiose,3TMS,isomer #55CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3223.7Semi standard non polar33892256
Chitobiose,3TMS,isomer #56CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3276.6Semi standard non polar33892256
Chitobiose,3TMS,isomer #57CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3268.1Semi standard non polar33892256
Chitobiose,3TMS,isomer #58CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3278.6Semi standard non polar33892256
Chitobiose,3TMS,isomer #59CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3209.4Semi standard non polar33892256
Chitobiose,3TMS,isomer #6CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3242.0Semi standard non polar33892256
Chitobiose,3TMS,isomer #60CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3237.9Semi standard non polar33892256
Chitobiose,3TMS,isomer #61CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3162.0Semi standard non polar33892256
Chitobiose,3TMS,isomer #62CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3244.6Semi standard non polar33892256
Chitobiose,3TMS,isomer #63CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3254.7Semi standard non polar33892256
Chitobiose,3TMS,isomer #64CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3213.4Semi standard non polar33892256
Chitobiose,3TMS,isomer #65CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3241.8Semi standard non polar33892256
Chitobiose,3TMS,isomer #66CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3270.4Semi standard non polar33892256
Chitobiose,3TMS,isomer #67CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3268.3Semi standard non polar33892256
Chitobiose,3TMS,isomer #68CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3310.2Semi standard non polar33892256
Chitobiose,3TMS,isomer #69CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3253.9Semi standard non polar33892256
Chitobiose,3TMS,isomer #7CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3249.0Semi standard non polar33892256
Chitobiose,3TMS,isomer #70CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3252.7Semi standard non polar33892256
Chitobiose,3TMS,isomer #71CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3209.1Semi standard non polar33892256
Chitobiose,3TMS,isomer #72CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3266.9Semi standard non polar33892256
Chitobiose,3TMS,isomer #73CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3287.7Semi standard non polar33892256
Chitobiose,3TMS,isomer #74CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3217.2Semi standard non polar33892256
Chitobiose,3TMS,isomer #75CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3238.1Semi standard non polar33892256
Chitobiose,3TMS,isomer #76CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3243.4Semi standard non polar33892256
Chitobiose,3TMS,isomer #77CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3205.3Semi standard non polar33892256
Chitobiose,3TMS,isomer #78CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3265.3Semi standard non polar33892256
Chitobiose,3TMS,isomer #79CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3298.2Semi standard non polar33892256
Chitobiose,3TMS,isomer #8CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3310.0Semi standard non polar33892256
Chitobiose,3TMS,isomer #80CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3233.0Semi standard non polar33892256
Chitobiose,3TMS,isomer #81CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3244.1Semi standard non polar33892256
Chitobiose,3TMS,isomer #82CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3181.6Semi standard non polar33892256
Chitobiose,3TMS,isomer #83CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3185.9Semi standard non polar33892256
Chitobiose,3TMS,isomer #84CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3230.0Semi standard non polar33892256
Chitobiose,3TMS,isomer #9CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3294.6Semi standard non polar33892256
Chitobiose,4TMS,isomer #1CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3263.0Semi standard non polar33892256
Chitobiose,4TMS,isomer #10CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3241.4Semi standard non polar33892256
Chitobiose,4TMS,isomer #100CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3267.1Semi standard non polar33892256
Chitobiose,4TMS,isomer #101CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3219.3Semi standard non polar33892256
Chitobiose,4TMS,isomer #102CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3210.6Semi standard non polar33892256
Chitobiose,4TMS,isomer #103CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3232.1Semi standard non polar33892256
Chitobiose,4TMS,isomer #104CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3205.4Semi standard non polar33892256
Chitobiose,4TMS,isomer #105CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3254.3Semi standard non polar33892256
Chitobiose,4TMS,isomer #106CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3267.3Semi standard non polar33892256
Chitobiose,4TMS,isomer #107CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3219.3Semi standard non polar33892256
Chitobiose,4TMS,isomer #108CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3197.3Semi standard non polar33892256
Chitobiose,4TMS,isomer #109CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3163.3Semi standard non polar33892256
Chitobiose,4TMS,isomer #11CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3264.1Semi standard non polar33892256
Chitobiose,4TMS,isomer #110CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3166.6Semi standard non polar33892256
Chitobiose,4TMS,isomer #111CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3209.0Semi standard non polar33892256
Chitobiose,4TMS,isomer #112CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3217.0Semi standard non polar33892256
Chitobiose,4TMS,isomer #113CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3230.4Semi standard non polar33892256
Chitobiose,4TMS,isomer #114CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3227.0Semi standard non polar33892256
Chitobiose,4TMS,isomer #115CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3246.0Semi standard non polar33892256
Chitobiose,4TMS,isomer #116CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3286.9Semi standard non polar33892256
Chitobiose,4TMS,isomer #117CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3236.5Semi standard non polar33892256
Chitobiose,4TMS,isomer #118CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3240.7Semi standard non polar33892256
Chitobiose,4TMS,isomer #119CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3218.8Semi standard non polar33892256
Chitobiose,4TMS,isomer #12CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3217.7Semi standard non polar33892256
Chitobiose,4TMS,isomer #120CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3169.7Semi standard non polar33892256
Chitobiose,4TMS,isomer #121CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3234.0Semi standard non polar33892256
Chitobiose,4TMS,isomer #122CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3222.8Semi standard non polar33892256
Chitobiose,4TMS,isomer #123CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3219.0Semi standard non polar33892256
Chitobiose,4TMS,isomer #124CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3178.7Semi standard non polar33892256
Chitobiose,4TMS,isomer #125CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3237.8Semi standard non polar33892256
Chitobiose,4TMS,isomer #126CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3172.1Semi standard non polar33892256
Chitobiose,4TMS,isomer #13CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3241.1Semi standard non polar33892256
Chitobiose,4TMS,isomer #14CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3242.4Semi standard non polar33892256
Chitobiose,4TMS,isomer #15CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3267.6Semi standard non polar33892256
Chitobiose,4TMS,isomer #16CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3172.8Semi standard non polar33892256
Chitobiose,4TMS,isomer #17CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3190.7Semi standard non polar33892256
Chitobiose,4TMS,isomer #18CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3166.0Semi standard non polar33892256
Chitobiose,4TMS,isomer #19CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3234.0Semi standard non polar33892256
Chitobiose,4TMS,isomer #2CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3250.0Semi standard non polar33892256
Chitobiose,4TMS,isomer #20CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3238.2Semi standard non polar33892256
Chitobiose,4TMS,isomer #21CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3203.6Semi standard non polar33892256
Chitobiose,4TMS,isomer #22CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3261.9Semi standard non polar33892256
Chitobiose,4TMS,isomer #23CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3240.0Semi standard non polar33892256
Chitobiose,4TMS,isomer #24CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3260.3Semi standard non polar33892256
Chitobiose,4TMS,isomer #25CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3258.4Semi standard non polar33892256
Chitobiose,4TMS,isomer #26CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3266.9Semi standard non polar33892256
Chitobiose,4TMS,isomer #27CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3223.5Semi standard non polar33892256
Chitobiose,4TMS,isomer #28CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3246.1Semi standard non polar33892256
Chitobiose,4TMS,isomer #29CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3254.2Semi standard non polar33892256
Chitobiose,4TMS,isomer #3CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3174.2Semi standard non polar33892256
Chitobiose,4TMS,isomer #30CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3268.3Semi standard non polar33892256
Chitobiose,4TMS,isomer #31CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3168.2Semi standard non polar33892256
Chitobiose,4TMS,isomer #32CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3195.6Semi standard non polar33892256
Chitobiose,4TMS,isomer #33CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3168.2Semi standard non polar33892256
Chitobiose,4TMS,isomer #34CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3244.5Semi standard non polar33892256
Chitobiose,4TMS,isomer #35CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3230.0Semi standard non polar33892256
Chitobiose,4TMS,isomer #36CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3201.8Semi standard non polar33892256
Chitobiose,4TMS,isomer #37CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3229.5Semi standard non polar33892256
Chitobiose,4TMS,isomer #38CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3244.4Semi standard non polar33892256
Chitobiose,4TMS,isomer #39CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3246.4Semi standard non polar33892256
Chitobiose,4TMS,isomer #4CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3192.5Semi standard non polar33892256
Chitobiose,4TMS,isomer #40CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3286.4Semi standard non polar33892256
Chitobiose,4TMS,isomer #41CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3228.3Semi standard non polar33892256
Chitobiose,4TMS,isomer #42CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3240.9Semi standard non polar33892256
Chitobiose,4TMS,isomer #43CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3218.7Semi standard non polar33892256
Chitobiose,4TMS,isomer #44CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3275.5Semi standard non polar33892256
Chitobiose,4TMS,isomer #45CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3268.5Semi standard non polar33892256
Chitobiose,4TMS,isomer #46CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3223.3Semi standard non polar33892256
Chitobiose,4TMS,isomer #47CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3216.7Semi standard non polar33892256
Chitobiose,4TMS,isomer #48CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3223.2Semi standard non polar33892256
Chitobiose,4TMS,isomer #49CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3218.5Semi standard non polar33892256
Chitobiose,4TMS,isomer #5CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3213.3Semi standard non polar33892256
Chitobiose,4TMS,isomer #50CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3268.0Semi standard non polar33892256
Chitobiose,4TMS,isomer #51CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3278.8Semi standard non polar33892256
Chitobiose,4TMS,isomer #52CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3230.1Semi standard non polar33892256
Chitobiose,4TMS,isomer #53CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3237.1Semi standard non polar33892256
Chitobiose,4TMS,isomer #54CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3163.4Semi standard non polar33892256
Chitobiose,4TMS,isomer #55CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3167.2Semi standard non polar33892256
Chitobiose,4TMS,isomer #56CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3249.5Semi standard non polar33892256
Chitobiose,4TMS,isomer #57CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3268.1Semi standard non polar33892256
Chitobiose,4TMS,isomer #58CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3226.0Semi standard non polar33892256
Chitobiose,4TMS,isomer #59CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3257.8Semi standard non polar33892256
Chitobiose,4TMS,isomer #6CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3220.4Semi standard non polar33892256
Chitobiose,4TMS,isomer #60CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3279.7Semi standard non polar33892256
Chitobiose,4TMS,isomer #61CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3265.9Semi standard non polar33892256
Chitobiose,4TMS,isomer #62CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3206.3Semi standard non polar33892256
Chitobiose,4TMS,isomer #63CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3245.8Semi standard non polar33892256
Chitobiose,4TMS,isomer #64CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3274.3Semi standard non polar33892256
Chitobiose,4TMS,isomer #65CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3254.3Semi standard non polar33892256
Chitobiose,4TMS,isomer #66CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3173.1Semi standard non polar33892256
Chitobiose,4TMS,isomer #67CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3210.1Semi standard non polar33892256
Chitobiose,4TMS,isomer #68CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3164.1Semi standard non polar33892256
Chitobiose,4TMS,isomer #69CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3224.9Semi standard non polar33892256
Chitobiose,4TMS,isomer #7CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3248.8Semi standard non polar33892256
Chitobiose,4TMS,isomer #70CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3228.6Semi standard non polar33892256
Chitobiose,4TMS,isomer #71CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3215.0Semi standard non polar33892256
Chitobiose,4TMS,isomer #72CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3219.7Semi standard non polar33892256
Chitobiose,4TMS,isomer #73CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3245.5Semi standard non polar33892256
Chitobiose,4TMS,isomer #74CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3260.7Semi standard non polar33892256
Chitobiose,4TMS,isomer #75CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3274.8Semi standard non polar33892256
Chitobiose,4TMS,isomer #76CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3230.6Semi standard non polar33892256
Chitobiose,4TMS,isomer #77CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3235.9Semi standard non polar33892256
Chitobiose,4TMS,isomer #78CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3206.7Semi standard non polar33892256
Chitobiose,4TMS,isomer #79CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3250.1Semi standard non polar33892256
Chitobiose,4TMS,isomer #8CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3235.3Semi standard non polar33892256
Chitobiose,4TMS,isomer #80CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3268.6Semi standard non polar33892256
Chitobiose,4TMS,isomer #81CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3222.8Semi standard non polar33892256
Chitobiose,4TMS,isomer #82CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3213.1Semi standard non polar33892256
Chitobiose,4TMS,isomer #83CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3227.1Semi standard non polar33892256
Chitobiose,4TMS,isomer #84CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3203.2Semi standard non polar33892256
Chitobiose,4TMS,isomer #85CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3248.3Semi standard non polar33892256
Chitobiose,4TMS,isomer #86CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3273.7Semi standard non polar33892256
Chitobiose,4TMS,isomer #87CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3229.1Semi standard non polar33892256
Chitobiose,4TMS,isomer #88CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3195.6Semi standard non polar33892256
Chitobiose,4TMS,isomer #89CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3169.4Semi standard non polar33892256
Chitobiose,4TMS,isomer #9CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3247.6Semi standard non polar33892256
Chitobiose,4TMS,isomer #90CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3169.1Semi standard non polar33892256
Chitobiose,4TMS,isomer #91CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3219.8Semi standard non polar33892256
Chitobiose,4TMS,isomer #92CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3220.6Semi standard non polar33892256
Chitobiose,4TMS,isomer #93CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3254.9Semi standard non polar33892256
Chitobiose,4TMS,isomer #94CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3270.8Semi standard non polar33892256
Chitobiose,4TMS,isomer #95CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3279.4Semi standard non polar33892256
Chitobiose,4TMS,isomer #96CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3228.9Semi standard non polar33892256
Chitobiose,4TMS,isomer #97CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3238.6Semi standard non polar33892256
Chitobiose,4TMS,isomer #98CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3221.7Semi standard non polar33892256
Chitobiose,4TMS,isomer #99CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3262.0Semi standard non polar33892256
Chitobiose,5TMS,isomer #1CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3193.6Semi standard non polar33892256
Chitobiose,5TMS,isomer #10CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3142.1Semi standard non polar33892256
Chitobiose,5TMS,isomer #100CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3251.1Semi standard non polar33892256
Chitobiose,5TMS,isomer #101CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3209.5Semi standard non polar33892256
Chitobiose,5TMS,isomer #102CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3196.2Semi standard non polar33892256
Chitobiose,5TMS,isomer #103CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3199.2Semi standard non polar33892256
Chitobiose,5TMS,isomer #104CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3248.2Semi standard non polar33892256
Chitobiose,5TMS,isomer #105CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3200.6Semi standard non polar33892256
Chitobiose,5TMS,isomer #106CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3177.9Semi standard non polar33892256
Chitobiose,5TMS,isomer #107CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3223.3Semi standard non polar33892256
Chitobiose,5TMS,isomer #108CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3212.0Semi standard non polar33892256
Chitobiose,5TMS,isomer #109CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3248.4Semi standard non polar33892256
Chitobiose,5TMS,isomer #11CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3206.5Semi standard non polar33892256
Chitobiose,5TMS,isomer #110CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3250.0Semi standard non polar33892256
Chitobiose,5TMS,isomer #111CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3243.6Semi standard non polar33892256
Chitobiose,5TMS,isomer #112CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3225.5Semi standard non polar33892256
Chitobiose,5TMS,isomer #113CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3206.5Semi standard non polar33892256
Chitobiose,5TMS,isomer #114CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3196.8Semi standard non polar33892256
Chitobiose,5TMS,isomer #115CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3239.4Semi standard non polar33892256
Chitobiose,5TMS,isomer #116CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3214.9Semi standard non polar33892256
Chitobiose,5TMS,isomer #117CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3193.5Semi standard non polar33892256
Chitobiose,5TMS,isomer #118CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3195.1Semi standard non polar33892256
Chitobiose,5TMS,isomer #119CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3238.2Semi standard non polar33892256
Chitobiose,5TMS,isomer #12CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3171.2Semi standard non polar33892256
Chitobiose,5TMS,isomer #120CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3194.6Semi standard non polar33892256
Chitobiose,5TMS,isomer #121CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3210.0Semi standard non polar33892256
Chitobiose,5TMS,isomer #122CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3197.5Semi standard non polar33892256
Chitobiose,5TMS,isomer #123CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3198.4Semi standard non polar33892256
Chitobiose,5TMS,isomer #124CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3256.2Semi standard non polar33892256
Chitobiose,5TMS,isomer #125CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3198.0Semi standard non polar33892256
Chitobiose,5TMS,isomer #126CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3202.6Semi standard non polar33892256
Chitobiose,5TMS,isomer #13CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3237.7Semi standard non polar33892256
Chitobiose,5TMS,isomer #14CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3229.4Semi standard non polar33892256
Chitobiose,5TMS,isomer #15CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3235.3Semi standard non polar33892256
Chitobiose,5TMS,isomer #16CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3161.9Semi standard non polar33892256
Chitobiose,5TMS,isomer #17CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3171.1Semi standard non polar33892256
Chitobiose,5TMS,isomer #18CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3231.3Semi standard non polar33892256
Chitobiose,5TMS,isomer #19CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3252.1Semi standard non polar33892256
Chitobiose,5TMS,isomer #2CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3185.3Semi standard non polar33892256
Chitobiose,5TMS,isomer #20CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3178.3Semi standard non polar33892256
Chitobiose,5TMS,isomer #21CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3222.9Semi standard non polar33892256
Chitobiose,5TMS,isomer #22CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3205.7Semi standard non polar33892256
Chitobiose,5TMS,isomer #23CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3249.7Semi standard non polar33892256
Chitobiose,5TMS,isomer #24CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3255.2Semi standard non polar33892256
Chitobiose,5TMS,isomer #25CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3241.1Semi standard non polar33892256
Chitobiose,5TMS,isomer #26CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3161.0Semi standard non polar33892256
Chitobiose,5TMS,isomer #27CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3210.5Semi standard non polar33892256
Chitobiose,5TMS,isomer #28CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3192.6Semi standard non polar33892256
Chitobiose,5TMS,isomer #29CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3239.2Semi standard non polar33892256
Chitobiose,5TMS,isomer #3CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3201.5Semi standard non polar33892256
Chitobiose,5TMS,isomer #30CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3246.1Semi standard non polar33892256
Chitobiose,5TMS,isomer #31CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3241.6Semi standard non polar33892256
Chitobiose,5TMS,isomer #32CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3214.7Semi standard non polar33892256
Chitobiose,5TMS,isomer #33CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3172.6Semi standard non polar33892256
Chitobiose,5TMS,isomer #34CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3192.1Semi standard non polar33892256
Chitobiose,5TMS,isomer #35CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3263.6Semi standard non polar33892256
Chitobiose,5TMS,isomer #36CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3176.5Semi standard non polar33892256
Chitobiose,5TMS,isomer #37CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3184.4Semi standard non polar33892256
Chitobiose,5TMS,isomer #38CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3241.6Semi standard non polar33892256
Chitobiose,5TMS,isomer #39CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3243.2Semi standard non polar33892256
Chitobiose,5TMS,isomer #4CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3245.4Semi standard non polar33892256
Chitobiose,5TMS,isomer #40CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3176.6Semi standard non polar33892256
Chitobiose,5TMS,isomer #41CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3222.4Semi standard non polar33892256
Chitobiose,5TMS,isomer #42CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3206.6Semi standard non polar33892256
Chitobiose,5TMS,isomer #43CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3259.5Semi standard non polar33892256
Chitobiose,5TMS,isomer #44CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3241.1Semi standard non polar33892256
Chitobiose,5TMS,isomer #45CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3236.0Semi standard non polar33892256
Chitobiose,5TMS,isomer #46CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3162.7Semi standard non polar33892256
Chitobiose,5TMS,isomer #47CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3212.6Semi standard non polar33892256
Chitobiose,5TMS,isomer #48CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3194.2Semi standard non polar33892256
Chitobiose,5TMS,isomer #49CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3242.5Semi standard non polar33892256
Chitobiose,5TMS,isomer #5CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3248.0Semi standard non polar33892256
Chitobiose,5TMS,isomer #50CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3232.5Semi standard non polar33892256
Chitobiose,5TMS,isomer #51CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3233.2Semi standard non polar33892256
Chitobiose,5TMS,isomer #52CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3217.4Semi standard non polar33892256
Chitobiose,5TMS,isomer #53CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3161.3Semi standard non polar33892256
Chitobiose,5TMS,isomer #54CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3191.2Semi standard non polar33892256
Chitobiose,5TMS,isomer #55CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3258.9Semi standard non polar33892256
Chitobiose,5TMS,isomer #56CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3165.0Semi standard non polar33892256
Chitobiose,5TMS,isomer #57CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3210.6Semi standard non polar33892256
Chitobiose,5TMS,isomer #58CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3199.6Semi standard non polar33892256
Chitobiose,5TMS,isomer #59CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3245.8Semi standard non polar33892256
Chitobiose,5TMS,isomer #6CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3168.3Semi standard non polar33892256
Chitobiose,5TMS,isomer #60CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3258.9Semi standard non polar33892256
Chitobiose,5TMS,isomer #61CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3251.4Semi standard non polar33892256
Chitobiose,5TMS,isomer #62CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3244.7Semi standard non polar33892256
Chitobiose,5TMS,isomer #63CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3198.6Semi standard non polar33892256
Chitobiose,5TMS,isomer #64CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3191.7Semi standard non polar33892256
Chitobiose,5TMS,isomer #65CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3270.4Semi standard non polar33892256
Chitobiose,5TMS,isomer #66CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3225.1Semi standard non polar33892256
Chitobiose,5TMS,isomer #67CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3184.6Semi standard non polar33892256
Chitobiose,5TMS,isomer #68CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3197.9Semi standard non polar33892256
Chitobiose,5TMS,isomer #69CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3273.2Semi standard non polar33892256
Chitobiose,5TMS,isomer #7CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3181.3Semi standard non polar33892256
Chitobiose,5TMS,isomer #70CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3230.3Semi standard non polar33892256
Chitobiose,5TMS,isomer #71CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3185.5Semi standard non polar33892256
Chitobiose,5TMS,isomer #72CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3200.4Semi standard non polar33892256
Chitobiose,5TMS,isomer #73CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3265.9Semi standard non polar33892256
Chitobiose,5TMS,isomer #74CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3249.9Semi standard non polar33892256
Chitobiose,5TMS,isomer #75CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3190.0Semi standard non polar33892256
Chitobiose,5TMS,isomer #76CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3241.0Semi standard non polar33892256
Chitobiose,5TMS,isomer #77CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3215.5Semi standard non polar33892256
Chitobiose,5TMS,isomer #78CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3256.9Semi standard non polar33892256
Chitobiose,5TMS,isomer #79CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3252.9Semi standard non polar33892256
Chitobiose,5TMS,isomer #8CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3235.2Semi standard non polar33892256
Chitobiose,5TMS,isomer #80CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3249.4Semi standard non polar33892256
Chitobiose,5TMS,isomer #81CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3172.1Semi standard non polar33892256
Chitobiose,5TMS,isomer #82CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3234.5Semi standard non polar33892256
Chitobiose,5TMS,isomer #83CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3205.0Semi standard non polar33892256
Chitobiose,5TMS,isomer #84CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3244.0Semi standard non polar33892256
Chitobiose,5TMS,isomer #85CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3242.9Semi standard non polar33892256
Chitobiose,5TMS,isomer #86CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3244.3Semi standard non polar33892256
Chitobiose,5TMS,isomer #87CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3211.0Semi standard non polar33892256
Chitobiose,5TMS,isomer #88CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3172.8Semi standard non polar33892256
Chitobiose,5TMS,isomer #89CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3199.4Semi standard non polar33892256
Chitobiose,5TMS,isomer #9CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3240.6Semi standard non polar33892256
Chitobiose,5TMS,isomer #90CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3245.2Semi standard non polar33892256
Chitobiose,5TMS,isomer #91CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3164.7Semi standard non polar33892256
Chitobiose,5TMS,isomer #92CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3219.2Semi standard non polar33892256
Chitobiose,5TMS,isomer #93CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3209.6Semi standard non polar33892256
Chitobiose,5TMS,isomer #94CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3234.6Semi standard non polar33892256
Chitobiose,5TMS,isomer #95CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3257.4Semi standard non polar33892256
Chitobiose,5TMS,isomer #96CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3250.5Semi standard non polar33892256
Chitobiose,5TMS,isomer #97CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3222.6Semi standard non polar33892256
Chitobiose,5TMS,isomer #98CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3209.8Semi standard non polar33892256
Chitobiose,5TMS,isomer #99CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3194.0Semi standard non polar33892256
Chitobiose,6TMS,isomer #1CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O3140.4Semi standard non polar33892256
Chitobiose,6TMS,isomer #10CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3263.2Semi standard non polar33892256
Chitobiose,6TMS,isomer #11CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3129.7Semi standard non polar33892256
Chitobiose,6TMS,isomer #12CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3223.0Semi standard non polar33892256
Chitobiose,6TMS,isomer #13CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3187.3Semi standard non polar33892256
Chitobiose,6TMS,isomer #14CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3229.0Semi standard non polar33892256
Chitobiose,6TMS,isomer #15CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3222.1Semi standard non polar33892256
Chitobiose,6TMS,isomer #16CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3258.4Semi standard non polar33892256
Chitobiose,6TMS,isomer #17CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3224.6Semi standard non polar33892256
Chitobiose,6TMS,isomer #18CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3169.7Semi standard non polar33892256
Chitobiose,6TMS,isomer #19CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3221.6Semi standard non polar33892256
Chitobiose,6TMS,isomer #2CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C3168.5Semi standard non polar33892256
Chitobiose,6TMS,isomer #20CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3281.4Semi standard non polar33892256
Chitobiose,6TMS,isomer #21CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3126.7Semi standard non polar33892256
Chitobiose,6TMS,isomer #22CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3226.3Semi standard non polar33892256
Chitobiose,6TMS,isomer #23CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3188.5Semi standard non polar33892256
Chitobiose,6TMS,isomer #24CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3229.3Semi standard non polar33892256
Chitobiose,6TMS,isomer #25CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3242.5Semi standard non polar33892256
Chitobiose,6TMS,isomer #26CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3268.9Semi standard non polar33892256
Chitobiose,6TMS,isomer #27CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3235.2Semi standard non polar33892256
Chitobiose,6TMS,isomer #28CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3188.0Semi standard non polar33892256
Chitobiose,6TMS,isomer #29CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3229.8Semi standard non polar33892256
Chitobiose,6TMS,isomer #3CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C3238.4Semi standard non polar33892256
Chitobiose,6TMS,isomer #30CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3283.4Semi standard non polar33892256
Chitobiose,6TMS,isomer #31CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3215.7Semi standard non polar33892256
Chitobiose,6TMS,isomer #32CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3168.4Semi standard non polar33892256
Chitobiose,6TMS,isomer #33CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3223.7Semi standard non polar33892256
Chitobiose,6TMS,isomer #34CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3279.5Semi standard non polar33892256
Chitobiose,6TMS,isomer #35CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3246.3Semi standard non polar33892256
Chitobiose,6TMS,isomer #36CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3136.4Semi standard non polar33892256
Chitobiose,6TMS,isomer #37CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3225.2Semi standard non polar33892256
Chitobiose,6TMS,isomer #38CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3180.4Semi standard non polar33892256
Chitobiose,6TMS,isomer #39CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3236.0Semi standard non polar33892256
Chitobiose,6TMS,isomer #4CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O3232.6Semi standard non polar33892256
Chitobiose,6TMS,isomer #40CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3233.7Semi standard non polar33892256
Chitobiose,6TMS,isomer #41CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3261.9Semi standard non polar33892256
Chitobiose,6TMS,isomer #42CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3229.6Semi standard non polar33892256
Chitobiose,6TMS,isomer #43CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3171.0Semi standard non polar33892256
Chitobiose,6TMS,isomer #44CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3219.2Semi standard non polar33892256
Chitobiose,6TMS,isomer #45CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3272.1Semi standard non polar33892256
Chitobiose,6TMS,isomer #46CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3211.2Semi standard non polar33892256
Chitobiose,6TMS,isomer #47CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3159.9Semi standard non polar33892256
Chitobiose,6TMS,isomer #48CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3217.8Semi standard non polar33892256
Chitobiose,6TMS,isomer #49CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3270.1Semi standard non polar33892256
Chitobiose,6TMS,isomer #5CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3145.3Semi standard non polar33892256
Chitobiose,6TMS,isomer #50CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3236.7Semi standard non polar33892256
Chitobiose,6TMS,isomer #51CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3221.0Semi standard non polar33892256
Chitobiose,6TMS,isomer #52CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3169.8Semi standard non polar33892256
Chitobiose,6TMS,isomer #53CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3235.1Semi standard non polar33892256
Chitobiose,6TMS,isomer #54CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3291.7Semi standard non polar33892256
Chitobiose,6TMS,isomer #55CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3257.6Semi standard non polar33892256
Chitobiose,6TMS,isomer #56CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3248.2Semi standard non polar33892256
Chitobiose,6TMS,isomer #57CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3139.5Semi standard non polar33892256
Chitobiose,6TMS,isomer #58CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3235.4Semi standard non polar33892256
Chitobiose,6TMS,isomer #59CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3195.2Semi standard non polar33892256
Chitobiose,6TMS,isomer #6CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3237.2Semi standard non polar33892256
Chitobiose,6TMS,isomer #60CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3242.0Semi standard non polar33892256
Chitobiose,6TMS,isomer #61CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3236.7Semi standard non polar33892256
Chitobiose,6TMS,isomer #62CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3271.4Semi standard non polar33892256
Chitobiose,6TMS,isomer #63CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3234.1Semi standard non polar33892256
Chitobiose,6TMS,isomer #64CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3194.6Semi standard non polar33892256
Chitobiose,6TMS,isomer #65CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3231.6Semi standard non polar33892256
Chitobiose,6TMS,isomer #66CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3273.5Semi standard non polar33892256
Chitobiose,6TMS,isomer #67CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3215.5Semi standard non polar33892256
Chitobiose,6TMS,isomer #68CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3182.7Semi standard non polar33892256
Chitobiose,6TMS,isomer #69CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3229.6Semi standard non polar33892256
Chitobiose,6TMS,isomer #7CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3194.8Semi standard non polar33892256
Chitobiose,6TMS,isomer #70CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3265.8Semi standard non polar33892256
Chitobiose,6TMS,isomer #71CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3227.3Semi standard non polar33892256
Chitobiose,6TMS,isomer #72CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3218.2Semi standard non polar33892256
Chitobiose,6TMS,isomer #73CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3180.9Semi standard non polar33892256
Chitobiose,6TMS,isomer #74CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3232.9Semi standard non polar33892256
Chitobiose,6TMS,isomer #75CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3276.5Semi standard non polar33892256
Chitobiose,6TMS,isomer #76CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3233.7Semi standard non polar33892256
Chitobiose,6TMS,isomer #77CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3229.8Semi standard non polar33892256
Chitobiose,6TMS,isomer #78CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3223.4Semi standard non polar33892256
Chitobiose,6TMS,isomer #79CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3174.9Semi standard non polar33892256
Chitobiose,6TMS,isomer #8CC(=O)N([C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3251.1Semi standard non polar33892256
Chitobiose,6TMS,isomer #80CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C3221.2Semi standard non polar33892256
Chitobiose,6TMS,isomer #81CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3268.8Semi standard non polar33892256
Chitobiose,6TMS,isomer #82CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3223.0Semi standard non polar33892256
Chitobiose,6TMS,isomer #83CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3222.0Semi standard non polar33892256
Chitobiose,6TMS,isomer #84CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C)[Si](C)(C)C3237.7Semi standard non polar33892256
Chitobiose,6TMS,isomer #9CC(=O)N[C@H]1[C@H](O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3223.4Semi standard non polar33892256
Chitobiose,1TBDMS,isomer #1CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3613.4Semi standard non polar33892256
Chitobiose,1TBDMS,isomer #2CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3633.6Semi standard non polar33892256
Chitobiose,1TBDMS,isomer #3CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3630.1Semi standard non polar33892256
Chitobiose,1TBDMS,isomer #4CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3642.2Semi standard non polar33892256
Chitobiose,1TBDMS,isomer #5CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3642.3Semi standard non polar33892256
Chitobiose,1TBDMS,isomer #6CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O3634.5Semi standard non polar33892256
Chitobiose,1TBDMS,isomer #7CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C3627.0Semi standard non polar33892256
Chitobiose,1TBDMS,isomer #8CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C(C)(C)C3615.2Semi standard non polar33892256
Chitobiose,1TBDMS,isomer #9CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O3655.3Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #1CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3750.2Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #10CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3781.8Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #11CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3777.6Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #12CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O3753.2Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #13CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C3763.3Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #14CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C(C)(C)C3773.8Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #15CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O3781.3Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #16CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3774.2Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #17CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3772.2Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #18CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O3749.5Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #19CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C3759.8Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #2CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3761.4Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #20CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C(C)(C)C3762.6Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #21CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O3781.6Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #22CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3754.9Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #23CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O3752.4Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #24CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C3760.7Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #25CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C(C)(C)C3762.5Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #26CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O3774.5Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #27CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O3752.8Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #28CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C3762.9Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #29CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C(C)(C)C3764.3Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #3CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3757.4Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #30CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O3786.1Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #31CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3752.0Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #32CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C3770.2Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #33CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O3771.1Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #34CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3765.9Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #35CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3779.6Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #36CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C3745.6Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #4CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3760.6Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #5CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O3743.3Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #6CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C3739.2Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #7CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C(C)(C)C3754.4Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #8CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O3767.1Semi standard non polar33892256
Chitobiose,2TBDMS,isomer #9CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3794.0Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #1CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3911.4Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #10CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O3897.7Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #11CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C3883.4Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #12CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C(C)(C)C3911.1Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #13CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O3918.2Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #14CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3899.7Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #15CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O3908.8Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #16CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C3890.8Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #17CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C(C)(C)C3924.7Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #18CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O3935.5Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #19CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O3902.8Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #2CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3902.3Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #20CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C3901.0Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #21CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C(C)(C)C3916.6Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #22CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O3930.2Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #23CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3867.5Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #24CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C3908.7Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #25CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O3906.2Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #26CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3921.7Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #27CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3912.6Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #28CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C3901.3Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #29CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3934.6Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #3CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3907.2Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #30CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3928.4Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #31CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O3914.7Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #32CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C3913.2Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #33CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C(C)(C)C3932.6Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #34CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O3925.7Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #35CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3906.9Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #36CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O3909.9Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #37CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C3905.9Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #38CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C(C)(C)C3938.2Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #39CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O3931.7Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #4CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O3887.5Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #40CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O3903.3Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #41CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C3912.6Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #42CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C(C)(C)C3929.1Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #43CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O3926.4Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #44CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3894.5Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #45CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C3921.2Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #46CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O3909.1Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #47CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3922.7Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #48CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3922.8Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #49CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C3910.3Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #5CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C3881.7Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #50CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3913.3Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #51CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O3902.3Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #52CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C3909.5Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #53CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C(C)(C)C3929.1Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #54CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O3923.0Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #55CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O3893.5Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #56CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C3905.1Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #57CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C(C)(C)C3925.3Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #58CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O3916.8Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #59CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3892.3Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #6CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C(C)(C)C3905.0Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #60CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C3915.8Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #61CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O3903.1Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #62CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3912.4Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #63CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3915.6Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #64CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C3900.7Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #65CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O3881.8Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #66CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C3890.9Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #67CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C(C)(C)C3913.9Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #68CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O3921.3Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #69CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3907.8Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #7CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O3915.1Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #70CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C3933.8Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #71CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O3921.0Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #72CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3930.4Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #73CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3933.1Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #74CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C3905.0Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #75CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3901.8Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #76CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C3919.0Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #77CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O3912.0Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #78CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3920.9Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #79CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3930.8Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #8CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O3917.8Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #80CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C3906.2Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #81CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3908.7Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #82CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3902.8Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #83CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C3893.7Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #84CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3903.5Semi standard non polar33892256
Chitobiose,3TBDMS,isomer #9CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O3911.7Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #1CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O4083.8Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #10CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C(C)(C)C4087.8Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #100CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4095.4Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #101CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4086.7Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #102CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4044.4Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #103CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4089.9Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #104CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O4068.1Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #105CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4082.8Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #106CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4086.9Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #107CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4080.6Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #108CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4067.2Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #109CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4057.1Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #11CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O4099.5Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #110CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4062.0Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #111CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4070.5Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #112CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4035.1Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #113CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4074.1Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #114CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O4066.5Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #115CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4066.4Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #116CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4084.2Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #117CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4076.9Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #118CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4090.9Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #119CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4082.1Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #12CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O4039.0Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #120CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4080.5Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #121CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4089.5Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #122CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4075.0Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #123CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4062.3Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #124CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4064.8Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #125CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4083.5Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #126CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4059.0Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #13CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C4043.0Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #14CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C(C)(C)C4068.2Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #15CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O4086.5Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #16CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4016.0Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #17CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4066.1Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #18CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O4055.8Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #19CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4081.6Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #2CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O4065.9Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #20CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4070.4Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #21CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4067.4Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #22CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O4071.1Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #23CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O4059.0Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #24CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C4058.2Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #25CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C(C)(C)C4093.9Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #26CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O4098.4Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #27CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O4046.8Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #28CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C4046.8Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #29CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C(C)(C)C4081.9Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #3CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O4037.3Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #30CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O4089.4Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #31CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4018.1Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #32CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4072.8Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #33CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O4062.9Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #34CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4080.1Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #35CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4068.5Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #36CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4070.8Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #37CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O4034.6Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #38CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C4035.5Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #39CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C(C)(C)C4065.7Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #4CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C4042.0Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #40CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O4089.7Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #41CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4034.5Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #42CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4096.8Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #43CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O4085.7Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #44CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4094.2Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #45CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4087.6Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #46CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4087.9Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #47CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4027.9Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #48CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4078.5Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #49CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O4063.2Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #5CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C(C)(C)C4074.9Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #50CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4079.3Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #51CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4077.4Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #52CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4078.7Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #53CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4074.6Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #54CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4040.5Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #55CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4059.3Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #56CC(=O)N([C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4080.8Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #57CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O4091.8Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #58CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O4075.0Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #59CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C4088.5Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #6CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O4086.8Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #60CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C(C)(C)C4114.6Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #61CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O4113.9Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #62CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O4058.4Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #63CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C4070.3Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #64CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C(C)(C)C4097.6Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #65CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O4098.3Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #66CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4038.3Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #67CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4092.9Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #68CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O4077.0Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #69CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4093.0Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #7CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O4048.3Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #70CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4090.9Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #71CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4083.6Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #72CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O4044.8Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #73CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C4053.4Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #74CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C(C)(C)C4079.5Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #75CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O4097.3Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #76CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4056.3Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #77CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4111.8Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #78CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O4093.7Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #79CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4104.8Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #8CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O4050.4Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #80CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4106.5Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #81CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4101.4Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #82CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4045.0Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #83CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4088.3Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #84CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O4070.1Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #85CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4086.5Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #86CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4093.1Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #87CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4090.6Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #88CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4077.7Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #89CC(=O)N[C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4060.2Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #9CC(=O)N[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C4045.2Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #90CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4070.4Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #91CC(=O)N([C@H]1[C@H](O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4084.2Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #92CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O4051.1Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #93CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C4067.7Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #94CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2NC(=O)O)[C@@H]1O)[Si](C)(C)C(C)(C)C4084.5Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #95CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N(C(=O)O)[Si](C)(C)C(C)(C)C)[C@@H]1O4099.7Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #96CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4055.5Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #97CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O[Si](C)(C)C(C)(C)C)[C@@H]1O)[Si](C)(C)C(C)(C)C4099.9Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #98CC(=O)N[C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N(C(=O)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O4084.1Semi standard non polar33892256
Chitobiose,4TBDMS,isomer #99CC(=O)N([C@H]1[C@H](O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2NC(=O)O)[C@@H]1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4091.7Semi standard non polar33892256
Spectra

GC-MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted GC-MSPredicted GC-MS Spectrum - Chitobiose GC-MS (Non-derivatized) - 70eV, Positivesplash10-0pvj-8639200000-6c3347b5dbe3b3f9c2c32017-09-01Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Chitobiose GC-MS (3 TMS) - 70eV, Positivesplash10-004i-4431129000-6a66b04ba8ecc3e96ae22017-10-06Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Chitobiose GC-MS (Non-derivatized) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum

MS/MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Chitobiose 10V, Positive-QTOFsplash10-0kyr-1029500000-cd23e338ffeece93c8d22015-09-14Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Chitobiose 20V, Positive-QTOFsplash10-0l6r-1596200000-dfb00a2cbc9b167897ce2015-09-14Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Chitobiose 40V, Positive-QTOFsplash10-03xu-8879000000-3e843b304076403ca7ad2015-09-14Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Chitobiose 10V, Negative-QTOFsplash10-0f6x-2291000000-09b27f575d21cfe148822015-09-15Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Chitobiose 20V, Negative-QTOFsplash10-0pi0-7595200000-da369f627875da3f63d62015-09-15Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Chitobiose 40V, Negative-QTOFsplash10-114i-9720000000-64ac9bbabb821260cc032015-09-15Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Chitobiose 10V, Negative-QTOFsplash10-00b9-0019200000-24a05e9c2b0aef9d97c22021-09-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Chitobiose 20V, Negative-QTOFsplash10-0acc-4229100000-ea4966254c54c4e1c6712021-09-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Chitobiose 40V, Negative-QTOFsplash10-054o-9342000000-d67950a39552019821412021-09-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Chitobiose 10V, Positive-QTOFsplash10-0a6r-0140900000-421220daa6be82144fb92021-09-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Chitobiose 20V, Positive-QTOFsplash10-0a4i-1984300000-1dd32aad758490afc6462021-09-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Chitobiose 40V, Positive-QTOFsplash10-0wmu-9710000000-b4b4aee4a3748673917c2021-09-25Wishart LabView Spectrum

NMR Spectra

Spectrum TypeDescriptionDeposition DateSourceView
Predicted 1D NMR1H NMR Spectrum (1D, 100 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 100 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 1000 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 1000 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 200 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 200 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 300 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 300 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 400 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 400 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 500 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 500 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 600 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 600 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 700 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 700 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 800 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 800 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 900 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 900 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Biological Properties
Cellular Locations
  • Cytoplasm (predicted from logP)
Biospecimen LocationsNot Available
Tissue Locations
  • Testis
Pathways
Normal Concentrations
Not Available
Abnormal Concentrations
Not Available
Associated Disorders and Diseases
Disease ReferencesNone
Associated OMIM IDsNone
DrugBank IDNot Available
Phenol Explorer Compound IDNot Available
FooDB IDFDB023196
KNApSAcK IDNot Available
Chemspider ID17216232
KEGG Compound IDC01674
BioCyc IDCHITOBIOSE
BiGG IDNot Available
Wikipedia LinkChitobiose
METLIN ID6953
PubChem Compound22833609
PDB IDNot Available
ChEBI IDNot Available
Food Biomarker OntologyNot Available
VMH IDHC00822
MarkerDB IDNot Available
Good Scents IDNot Available
References
Synthesis ReferenceCottaz, Sylvain; Samain, Eric. Genetic engineering of Escherichia coli for the production of NI,NII-diacetylchitobiose (chitinbiose) and its utilization as a primer for the synthesis of complex carbohydrates. Metabolic Engineering (2005), 7(4), 311-317.
Material Safety Data Sheet (MSDS)Not Available
General References
  1. van Pelt J, Hard K, Kamerling JP, Vliegenthart JF, Reuser AJ, Galjaard H: Isolation and structural characterization of twenty-one sialyloligosaccharides from galactosialidosis urine. An intact N,N'-diacetylchitobiose unit at the reducing end of a diantennary structure. Biol Chem Hoppe Seyler. 1989 Mar;370(3):191-203. [PubMed:2713102 ]
  2. Collin M, Olsen A: EndoS, a novel secreted protein from Streptococcus pyogenes with endoglycosidase activity on human IgG. EMBO J. 2001 Jun 15;20(12):3046-55. [PubMed:11406581 ]
  3. Nimtz M, Grabenhorst E, Gambert U, Costa J, Wray V, Morr M, Thiem J, Conradt HS: In vitro alpha1-3 or alpha1-4 fucosylation of type I and II oligosaccharides with secreted forms of recombinant human fucosyltransferases III and VI. Glycoconj J. 1998 Sep;15(9):873-83. [PubMed:10052591 ]

Enzymes

General function:
Involved in beta-N-acetylhexosaminidase activity
Specific function:
Responsible for the degradation of GM2 gangliosides, and a variety of other molecules containing terminal N-acetyl hexosamines, in the brain and other tissues.
Gene Name:
HEXB
Uniprot ID:
P07686
Molecular weight:
Not Available
General function:
Involved in beta-N-acetylhexosaminidase activity
Specific function:
Responsible for the degradation of GM2 gangliosides, and a variety of other molecules containing terminal N-acetyl hexosamines, in the brain and other tissues. The form B is active against certain oligosaccharides. The form S has no measurable activity.
Gene Name:
HEXA
Uniprot ID:
P06865
Molecular weight:
Not Available
General function:
Involved in chitin binding
Specific function:
Degrades chitin, chitotriose and chitobiose. May participate in the defense against nematodes and other pathogens. Isoform 3 has no enzymatic activity.
Gene Name:
CHIT1
Uniprot ID:
Q13231
Molecular weight:
Not Available