Hmdb loader
You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Human Metabolome Database.
Record Information
Version5.0
StatusExpected but not Quantified
Creation Date2007-05-24 11:57:11 UTC
Update Date2021-09-14 15:19:34 UTC
HMDB IDHMDB0006578
Secondary Accession Numbers
  • HMDB06578
Metabolite Identification
Common NameChitotriose
DescriptionChitotriose belongs to the class of organic compounds known as aminoglycosides. These are molecules or a portion of a molecule composed of amino-modified sugars. Chitotriose has been detected, but not quantified in, several different foods, such as green tea, winter squashes (Cucurbita maxima), moth beans (Vigna aconitifolia), tarragons (Artemisia dracunculus), and cherry tomatoes (Solanum lycopersicum var. cerasiforme). This could make chitotriose a potential biomarker for the consumption of these foods. Based on a literature review a significant number of articles have been published on Chitotriose.
Structure
Data?1582752392
Synonyms
ValueSource
O-2-amino-2-Deoxy-beta-D-glucopyranosyl-(1->4)-O-2-amino-2-deoxy-beta-D-glucopyranosyl-(1->4)-2-amino-2-deoxy-D-glucoseHMDB
O-2-amino-2-Deoxy-beta-delta-glucopyranosyl-(1->4)-O-2-amino-2-deoxy-beta-delta-glucopyranosyl-(1->4)-2-amino-2-deoxy-delta-glucoseHMDB
ChitotrisaccharideMeSH, HMDB
ChitintrioseMeSH, HMDB
ChitotrioseMeSH
Chemical FormulaC18H35N3O13
Average Molecular Weight501.4828
Monoisotopic Molecular Weight501.216988221
IUPAC Name(2R,3R,4S,5R)-2-amino-4-{[(2S,3R,4R,5S,6R)-3-amino-5-{[(2S,3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-4-hydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-3,5,6-trihydroxyhexanal
Traditional Namechitotrisaccharide
CAS Registry Number41708-93-4
SMILES
N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO
InChI Identifier
InChI=1S/C18H35N3O13/c19-5(1-22)11(27)15(6(26)2-23)33-18-10(21)14(30)16(8(4-25)32-18)34-17-9(20)13(29)12(28)7(3-24)31-17/h1,5-18,23-30H,2-4,19-21H2/t5-,6+,7+,8+,9+,10+,11+,12+,13+,14+,15+,16+,17-,18-/m0/s1
InChI KeyHBAVVSYNWHLVDB-UDAFUQIYSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as aminoglycosides. These are molecules or a portion of a molecule composed of amino-modified sugars.
KingdomOrganic compounds
Super ClassOrganic oxygen compounds
ClassOrganooxygen compounds
Sub ClassCarbohydrates and carbohydrate conjugates
Direct ParentAminoglycosides
Alternative Parents
Substituents
  • Aminoglycoside core
  • Disaccharide
  • Glycosyl compound
  • O-glycosyl compound
  • Beta-hydroxy aldehyde
  • Oxane
  • 1,2-aminoalcohol
  • Secondary alcohol
  • Oxacycle
  • Organoheterocyclic compound
  • Acetal
  • Polyol
  • Alcohol
  • Primary aliphatic amine
  • Hydrocarbon derivative
  • Organic oxide
  • Carbonyl group
  • Organopnictogen compound
  • Organic nitrogen compound
  • Amine
  • Organonitrogen compound
  • Primary amine
  • Aldehyde
  • Primary alcohol
  • Aliphatic heteromonocyclic compound
Molecular FrameworkAliphatic heteromonocyclic compounds
External DescriptorsNot Available
Ontology
Disposition

Source

Route of exposure

Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water SolubilityNot AvailableNot Available
LogPNot AvailableNot Available
Experimental Spectral PropertiesNot Available
Predicted Molecular Properties
PropertyValueSource
Water Solubility144 g/LALOGPS
logP10(-3) g/LALOGPS
logP10(-7.4) g/LChemAxon
logS10(-0.54) g/LALOGPS
pKa (Strongest Acidic)12.57ChemAxon
pKa (Strongest Basic)8.5ChemAxon
Physiological Charge3ChemAxon
Hydrogen Acceptor Count16ChemAxon
Hydrogen Donor Count11ChemAxon
Polar Surface Area293.89 ŲChemAxon
Rotatable Bond Count11ChemAxon
Refractivity107.14 m³·mol⁻¹ChemAxon
Polarizability47.27 ųChemAxon
Number of Rings2ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleNoChemAxon
Predicted Spectral Properties

Predicted Kovats Retention Indices

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
Chitotriose,1TMS,#1C[Si](C)(C)O[C@H]([C@@H](N)C=O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4010.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,1TMS,#2C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N3974.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,1TMS,#3C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3969.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,1TMS,#4C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@H]1O3953.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,1TMS,#5C[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@H]1O3935.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,1TMS,#6C[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N3951.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,1TMS,#7C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3990.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,1TMS,#8C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3977.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,1TMS,#9C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4125.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,1TMS,#10C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4172.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,1TMS,#11C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4049.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,1TMS,#12C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4047.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#1C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N3882.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#2C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3879.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#3C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@H]1O3869.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#4C[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@H]1O3869.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#5C[Si](C)(C)O[C@H]([C@@H](N)C=O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3877.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#6C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3879.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#7C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3873.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#8C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4061.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#9C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4048.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#10C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3947.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#11C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3952.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#12C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N3867.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#13C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3849.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#14C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N3838.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#15C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3850.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#16C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N3835.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#17C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N3833.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#18C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4042.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#19C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4067.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#20C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3905.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#21C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3922.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#22C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3862.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#23C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3845.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#24C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3832.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#25C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O3821.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#26C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C3840.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#27C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4042.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#28C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4064.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#29C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3911.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#30C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3900.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#31C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@H]1O3848.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#32C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3829.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#33C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O3829.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#34C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@H]1O[Si](C)(C)C3834.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#35C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4030.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#36C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4047.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#37C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3902.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#38C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3909.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#39C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3850.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#40C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3829.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#41C[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3830.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#42C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4028.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#43C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3908.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#44C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4037.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#45C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3900.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#46C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3862.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#47C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3844.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#48C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO4028.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#49C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3912.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#50C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO4040.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#51C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3912.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#52C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3852.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#53C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4046.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#54C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3920.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#55C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3924.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#56C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4066.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#57C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C4041.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#58C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3908.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#59C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3904.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#60C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C4054.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#61C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4250.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#62C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4105.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#63C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4097.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#64C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4138.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#65C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4136.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#66C[Si](C)(C)N([C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO)[Si](C)(C)C4217.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#67C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3993.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#68C[Si](C)(C)N([C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O)[Si](C)(C)C4053.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TMS,#69C[Si](C)(C)N([C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O)[Si](C)(C)C4059.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#1C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N3771.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#2C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N3761.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#3C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N3768.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#4C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3751.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#5C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N3761.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#6C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N3777.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#7C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3933.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#8C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3933.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#9C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3829.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#10C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3837.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#11C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3770.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#12C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3761.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#13C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3767.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#14C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O3773.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#15C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C3768.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#16C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3936.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#17C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3936.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#18C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3832.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#19C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3826.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#20C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@H]1O3784.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#21C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3776.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#22C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O3783.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#23C[Si](C)(C)O[C@H]([C@@H](N)C=O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3786.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#24C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3943.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#25C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3944.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#26C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3841.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#27C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3850.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#28C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3804.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#29C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3794.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#30C[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3795.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#31C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3951.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#32C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3848.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#33C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3938.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#34C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3853.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#35C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3798.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#36C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3787.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#37C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3958.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#38C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3942.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#39C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3853.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#40C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3839.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#41C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3751.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#42C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3952.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#43C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3847.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#44C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3843.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#45C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3938.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#46C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3949.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#47C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3839.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#48C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3835.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#49C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3932.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#50C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4131.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#51C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4001.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#52C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3999.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#53C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4010.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#54C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4019.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#55C[Si](C)(C)O[C@@H]([C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4146.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#56C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3916.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#57C[Si](C)(C)O[C@H]([C@@H](N)C=O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3951.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#58C[Si](C)(C)O[C@H]([C@@H](N)C=O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO3958.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#59C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3728.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#60C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N3754.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#61C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3747.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#62C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N3749.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#63C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N3763.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#64C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3945.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#65C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3948.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#66C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3809.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#67C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3818.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#68C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3731.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#69C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3737.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#70C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3750.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#71C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3737.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#72C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3939.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#73C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3803.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#74C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3794.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#75C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3937.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#76C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3711.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#77C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N3725.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#78C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N3737.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#79C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3927.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#80C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3946.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#81C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3786.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#82C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3810.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#83C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N3723.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#84C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N3723.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#85C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3925.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#86C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3943.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#87C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3792.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#88C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3791.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#89C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N3726.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#90C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3923.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#91C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3945.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#92C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3793.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#93C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3808.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#94C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3934.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#95C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3946.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#96C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3804.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#97C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3803.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#98C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4132.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#99C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3994.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#100C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3977.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#101C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4030.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#102C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4020.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#103C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4133.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#104C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3872.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#105C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N3919.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#106C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3917.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#107C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3727.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#108C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3753.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#109C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O3760.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#110C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C3758.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#111C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3944.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#112C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3951.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#113C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3813.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#114C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3804.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#115C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3745.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#116C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3750.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#117C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3740.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#118C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3936.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#119C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3790.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#120C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3796.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#121C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3940.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#122C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O3731.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#123C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C3732.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#124C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3927.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#125C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3942.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#126C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3788.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#127C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3796.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#128C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3741.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#129C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3931.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#130C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3945.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#131C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3806.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#132C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3799.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#133C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3933.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#134C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3950.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#135C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3804.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#136C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3808.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#137C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4130.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#138C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3979.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#139C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3983.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#140C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4018.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#141C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4033.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#142C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4140.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#143C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3866.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#144C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3925.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#145C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O3899.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#146C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3729.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#147C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O3764.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#148C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3766.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#149C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3944.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#150C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3956.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#151C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3817.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#152C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3823.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#153C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3761.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#154C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3757.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#155C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3940.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#156C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3814.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#157C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3805.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#158C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3951.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#159C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3751.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#160C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3930.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#161C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3946.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#162C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3791.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#163C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3821.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#164C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3936.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#165C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3945.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#166C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3816.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#167C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3791.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#168C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4116.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#169C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3992.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#170C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3981.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#171C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4033.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#172C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4032.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#173C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N)[C@H]1O4119.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#174C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@@H]1O3889.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#175C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)[C@H]1O3915.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#176C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O3908.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#177C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3742.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#178C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3774.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#179C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3953.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#180C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3821.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#181C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3830.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#182C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3955.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#183C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3767.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#184C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3948.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#185C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3815.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#186C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3820.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#187C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3950.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#188C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3943.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#189C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3819.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#190C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3942.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#191C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3804.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#192C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4114.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#193C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C4004.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#194C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3994.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#195C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4028.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#196C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3887.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#197C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@@H]1N([Si](C)(C)C)[Si](C)(C)C3945.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#198C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4028.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#199C[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@H]1O4112.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#200C[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@H]1O3923.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#201C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3734.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#202C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3952.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#203C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3833.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#204C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3815.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#205C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3955.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#206C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3947.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#207C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3821.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#208C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3802.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#209C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3949.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#210C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO4119.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#211C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3997.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#212C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3995.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#213C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO4020.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#214C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3873.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#215C[Si](C)(C)O[C@H]1[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@@H]1N([Si](C)(C)C)[Si](C)(C)C3968.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#216C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO4012.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#217C[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4110.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#218C[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3911.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#219C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3941.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#220C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3797.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#221C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3794.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#222C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3946.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#223C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4126.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#224C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4004.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#225C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3998.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#226C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4031.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#227C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3892.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#228C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3938.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#229C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4042.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#230C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3947.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#231C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4141.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#232C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C4119.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#233C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4000.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#234C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3991.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#235C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C4018.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#236C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3882.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#237C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3924.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#238C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C4026.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#239C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3932.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#240C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4138.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#241C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4190.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#242C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4196.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#243C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO)N([Si](C)(C)C)[Si](C)(C)C4170.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#244C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4047.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#245C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4128.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#246C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4118.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#247C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4114.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#248C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4213.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#249C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4168.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#250C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4211.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#251C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4182.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#252C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3987.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TMS,#253C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3999.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#1C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N3693.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#2C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N3734.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#3C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3712.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#4C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N3737.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#5C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N3756.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#6C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3867.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#7C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3873.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#8C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3790.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#9C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3796.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#10C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3727.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#11C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3710.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#12C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N3736.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#13C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N3750.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#14C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3860.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#15C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3861.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#16C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3782.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#17C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3786.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#18C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3698.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#19C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N3726.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#20C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N3740.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#21C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3858.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#22C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3867.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#23C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3760.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#24C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3788.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#25C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N3723.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#26C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N3713.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#27C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3836.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#28C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3856.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#29C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3766.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#30C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3764.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#31C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N3723.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#32C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3859.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#33C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3875.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#34C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3785.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#35C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3795.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#36C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3878.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#37C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3881.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#38C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3801.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#39C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3792.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#40C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4016.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#41C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3900.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#42C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3894.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#43C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3934.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#44C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3927.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#45C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4057.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#46C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3846.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#47C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N3888.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#48C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3893.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#49C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3696.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#50C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3726.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#51C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O3757.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#52C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C3747.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#53C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3870.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#54C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3876.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#55C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3789.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#56C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3790.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#57C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3719.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#58C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3750.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#59C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C3742.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#60C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3864.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#61C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3865.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#62C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3780.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#63C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3779.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#64C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O3734.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#65C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C3726.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#66C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3861.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#67C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3867.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#68C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3755.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#69C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3778.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#70C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3737.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#71C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3880.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#72C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3882.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#73C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3802.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#74C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3792.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#75C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3869.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#76C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3885.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#77C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3795.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#78C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3798.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#79C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4016.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#80C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3896.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#81C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3902.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#82C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3922.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#83C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3935.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#84C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4072.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#85C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3840.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#86C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3899.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#87C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O3876.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#88C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3728.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#89C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O3759.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#90C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3766.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#91C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3895.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#92C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3896.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#93C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3811.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#94C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3822.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#95C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3760.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#96C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3754.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#97C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3891.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#98C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3816.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#99C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3808.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#100C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3887.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#101C[Si](C)(C)O[C@H]([C@@H](N)C=O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3750.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#102C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3886.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#103C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3882.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#104C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3779.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#105C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3811.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#106C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3892.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#107C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3883.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#108C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3779.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#109C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3811.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#110C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4023.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#111C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3930.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#112C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3924.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#113C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3952.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#114C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3948.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#115C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N)[C@H]1O4068.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#116C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3865.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#117C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)[C@H]1O3898.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#118C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O3896.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#119C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3743.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#120C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3770.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#121C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3910.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#122C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3820.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#123C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3828.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#124C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3900.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#125C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3765.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#126C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3906.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#127C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3814.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#128C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3824.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#129C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3889.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#130C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3898.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#131C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3810.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#132C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3878.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#133C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3793.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#134C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4029.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#135C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3940.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#136C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3939.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#137C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3953.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#138C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3866.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#139C[Si](C)(C)O[C@H]([C@@H](N)C=O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3922.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#140C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3949.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#141C[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@H]1O4065.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#142C[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@H]1O3912.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#143C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3718.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#144C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3893.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#145C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3814.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#146C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3785.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#147C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3888.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#148C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3889.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#149C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3807.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#150C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3777.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#151C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3876.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#152C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO4023.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#153C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3932.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#154C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3920.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#155C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3934.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#156C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO3932.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#157C[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4063.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#158C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3841.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#159C[Si](C)(C)O[C@H]([C@@H](N)C=O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3895.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#160C[Si](C)(C)O[C@H]([C@@H](N)C=O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO3926.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#161C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3860.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#162C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3776.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#163C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3773.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#164C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3866.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#165C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4020.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#166C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3931.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#167C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3930.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#168C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3945.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#169C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3864.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#170C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3911.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#171C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C3945.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#172C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3907.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#173C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4091.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#174C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C4016.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#175C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3928.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#176C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3925.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#177C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3935.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#178C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3858.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#179C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3905.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#180C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3937.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#181C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3912.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#182C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4069.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#183C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4071.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#184C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4074.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#185C[Si](C)(C)OC=C([C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO)N([Si](C)(C)C)[Si](C)(C)C4040.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#186C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3968.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#187C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4022.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#188C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4029.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#189C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4010.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#190C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4131.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#191C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4058.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#192C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4121.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#193C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4061.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#194C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3961.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#195C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3974.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#196C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3656.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#197C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3672.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#198C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3687.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#199C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3666.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#200C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3832.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#201C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3734.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#202C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3736.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#203C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3866.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#204C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3680.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#205C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N3704.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#206C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N3718.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#207C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3858.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#208C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3895.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#209C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3752.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#210C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3772.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#211C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N3703.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#212C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N3694.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#213C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3846.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#214C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3877.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#215C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3755.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#216C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3750.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#217C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N3701.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#218C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3867.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#219C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3896.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#220C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3774.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#221C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3781.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#222C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3884.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#223C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3906.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#224C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3789.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#225C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3774.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#226C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4016.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#227C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3913.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#228C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3909.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#229C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3961.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#230C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C3959.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#231C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4032.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#232C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3830.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#233C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N3877.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#234C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3882.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#235C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3683.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#236C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3690.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#237C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3670.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#238C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3838.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#239C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3734.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#240C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3740.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#241C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3864.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#242C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3692.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#243C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3698.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#244C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3861.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#245C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3768.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#246C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3767.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#247C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3888.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#248C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3710.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#249C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3879.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#250C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3761.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#251C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3779.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#252C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3897.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#253C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3851.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#254C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3761.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#255C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3741.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#256C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3884.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#257C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C4006.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#258C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3908.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#259C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3902.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#260C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3951.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#261C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3820.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#262C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3870.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#263C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3947.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#264C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3868.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#265C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4031.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#266C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O3675.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#267C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C3672.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#268C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3826.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#269C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3867.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#270C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3718.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#271C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3731.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#272C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N3681.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#273C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3849.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#274C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3886.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#275C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3737.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#276C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3762.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#277C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3867.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#278C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3890.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#279C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3754.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#280C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3753.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#281C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO4013.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#282C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3905.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#283C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3891.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#284C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3942.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#285C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO3929.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#286C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4026.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#288C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N3865.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#289C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3857.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#290C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N3668.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#291C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3855.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#292C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3884.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#293C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3757.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#294C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3735.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#295C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3841.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#296C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3874.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#297C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3751.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#298C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3748.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#299C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4003.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#300C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3877.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#301C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3881.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#302C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3932.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#303C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3935.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#304C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4025.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#305C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3798.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#306C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3852.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#307C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3836.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#308C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3848.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#309C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3873.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#310C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3754.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#311C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3719.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#312C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4012.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#313C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3906.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#314C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3902.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#315C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3962.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#316C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3948.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#317C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N4023.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#318C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@@H]1O3824.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#319C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N3851.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#320C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3849.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#321C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4023.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#322C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3916.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#323C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3918.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#324C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3957.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#325C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3955.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#326C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N4030.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#327C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3817.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#328C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N3862.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#329C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3867.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#330C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4079.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#331C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4067.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#332C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO)N([Si](C)(C)C)[Si](C)(C)C4045.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#333C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3945.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#334C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4019.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#335C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4015.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#336C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4021.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#337C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4115.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#338C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4067.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#339C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4109.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#340C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4060.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#341C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3916.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#342C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3925.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#343C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3681.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#344C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3687.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#345C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3662.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#346C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3830.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#347C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3726.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#348C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3732.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#349C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3870.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#350C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O3711.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#351C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C3704.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#352C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3857.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#353C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3889.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#354C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3743.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#355C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3762.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#356C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3712.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#357C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3883.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#358C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3907.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#359C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3788.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#360C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3772.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#361C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3872.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#362C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3903.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#363C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3783.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#364C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3783.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#365C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4014.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#366C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3906.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#367C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3913.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#368C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3954.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#369C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C3964.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#370C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4040.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#371C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3822.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#372C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3885.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#373C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O3864.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#374C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3704.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#375C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3698.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#376C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3869.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#377C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3773.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#378C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3774.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#379C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3895.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#380C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3705.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#381C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3880.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#382C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3761.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#383C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3779.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#384C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3901.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#385C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3853.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#386C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3753.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#387C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3732.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#388C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3881.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#389C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C4004.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#390C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3903.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#391C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3908.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#392C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3947.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#393C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3813.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#394C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3855.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#395C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3955.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#396C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3875.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#397C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4039.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#398C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3688.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#399C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3862.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#400C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3885.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#401C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3742.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#402C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3750.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#403C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3853.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#404C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3884.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#405C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3738.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#406C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3760.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#407C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO4011.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#408C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3901.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#409C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3890.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#410C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3931.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#411C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO3935.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#412C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O4027.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#413C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3791.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#414C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3876.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#415C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O3835.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#416C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3864.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#417C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3892.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#418C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3774.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#419C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3737.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#420C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4024.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#421C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3918.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#422C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3923.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#423C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3959.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#424C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3963.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#425C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O4036.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#426C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3821.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#427C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O3873.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#428C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3858.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#429C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4014.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#430C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3912.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#431C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3910.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#432C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3957.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#433C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3962.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#434C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C4029.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#435C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@@H]1O3829.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#436C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C3864.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#437C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3846.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#438C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4066.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#439C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4079.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#440C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO)N([Si](C)(C)C)[Si](C)(C)C4047.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#441C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3946.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#442C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4007.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#443C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4023.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#444C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4018.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#445C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O4114.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#446C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4052.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#447C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4119.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#448C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4076.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#449C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3904.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#450C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3927.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#451C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3692.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#452C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3688.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#453C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3854.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#454C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3758.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#455C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3754.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#456C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3892.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#457C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3726.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#458C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3879.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#459C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3907.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#460C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3766.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#461C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3793.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#462C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3881.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#463C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3761.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#464C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3792.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#465C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3905.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#466C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4024.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#467C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3936.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#468C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3932.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#469C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3979.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#470C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C3975.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#471C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N)[C@H]1O4041.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#472C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@@H]1O3851.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#473C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)[C@H]1O3885.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#474C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O3882.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#475C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3721.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#476C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3880.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#477C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3752.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#478C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3785.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#479C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3900.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#480C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3878.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#481C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3788.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#482C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3758.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#483C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3904.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#484C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C4020.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#485C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3937.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#486C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3931.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#487C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3973.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#488C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@@H]1O3846.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#489C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3879.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#490C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3968.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#491C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3881.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#492C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4043.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#493C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3874.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#494C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3887.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#495C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3756.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#496C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3742.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#497C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO4017.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#498C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3929.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#499C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3908.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#500C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3963.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#501C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO3946.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#502C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O4026.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#503C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3824.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#504C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O3879.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#505C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O3859.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#506C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4012.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#507C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3906.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#508C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3925.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#509C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3942.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#510C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3962.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#511C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N)[C@H]1O[Si](C)(C)C4032.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#512C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3811.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#513C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)[C@H]1O[Si](C)(C)C3871.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#514C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O[Si](C)(C)C3867.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#515C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4084.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#516C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4078.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#517C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO)N([Si](C)(C)C)[Si](C)(C)C4031.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#518C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@@H]1O3975.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#519C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4021.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#520C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4021.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#521C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4045.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#522C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O4119.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#523C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4061.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#524C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O4107.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#525C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4066.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#526C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3945.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#527C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3926.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#528C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3699.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#529C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3870.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#530C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3751.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#531C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3769.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#532C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3895.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#533C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3891.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#534C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3788.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#535C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3780.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#536C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3904.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#537C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4032.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#538C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3941.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#539C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3948.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#540C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3969.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#541C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3848.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#542C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3902.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#543C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C3976.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#544C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3899.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#545C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4043.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#546C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3888.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#547C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3783.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#548C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3773.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#549C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3904.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#550C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C4026.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#551C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3943.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#552C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3948.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#553C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3966.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#554C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3842.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#555C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3895.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#556C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3970.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#557C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3896.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#558C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4043.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#559C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO4019.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#560C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3937.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#561C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3923.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#562C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3961.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#563C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3824.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#564C[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3890.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#565C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO3953.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#566C[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O4024.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#567C[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3892.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#568C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4086.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#569C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4083.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#570C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO)N([Si](C)(C)C)[Si](C)(C)C4045.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#571C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3986.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#572C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4044.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#573C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4038.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#574C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4038.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#575C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C4106.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#576C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4075.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#577C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3936.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#578C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3946.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#579C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O4105.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#580C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4069.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#581C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3844.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#582C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3749.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#583C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3724.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#584C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3882.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#585C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4020.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#586C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3933.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#587C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3919.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#588C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3962.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#589C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3828.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#590C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3881.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#591C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C3954.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#592C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3906.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#593C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4037.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#594C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C4016.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#595C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3933.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#596C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3914.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#597C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3954.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#598C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3819.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#599C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3872.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#600C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3945.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#601C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3891.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#602C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4036.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#603C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO4073.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#604C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO4070.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#605C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO)N([Si](C)(C)C)[Si](C)(C)C4045.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#606C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3962.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#607C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO4029.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#608C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4048.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#609C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO4020.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#610C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C4099.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#611C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4086.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#612C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3912.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#613C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3957.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#614C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O4103.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#615C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO4052.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#616C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C4003.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#617C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3901.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#618C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3900.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#619C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3953.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#620C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3810.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#621C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3851.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#622C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3954.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#623C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3859.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#624C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4027.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#625C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4082.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#626C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4082.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#627C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C4059.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#628C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3978.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#629C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4042.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#630C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4045.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#631C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4050.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#632C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4123.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#633C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4071.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#634C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3947.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#635C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3960.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#636C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4117.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#637C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4078.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#638C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C4075.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#639C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C4075.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#640C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C4042.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#641C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3975.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#642C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C4040.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#643C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C4043.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#644C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C4034.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#645C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4119.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#646C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C4063.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#647C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3939.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#648C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3955.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#649C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4115.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#650C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C4073.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#651C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4148.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#652C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(=CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4104.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#653C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4203.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#654C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(=CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4101.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#655C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4199.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#656C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4073.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#657C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4087.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#658C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4213.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#659C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4163.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#660C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4172.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#661C[Si](C)(C)N([C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO)[Si](C)(C)C4230.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#662C[Si](C)(C)N([C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO)[Si](C)(C)C4227.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#663C[Si](C)(C)N([C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O)[Si](C)(C)C4031.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3691.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#2C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3676.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#3C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N3700.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#4C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N3714.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#5C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3800.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#6C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3816.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#7C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3767.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#8C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3768.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#9C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3702.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#10C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N3729.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#11C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N3733.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#12C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3834.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#13C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3837.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#14C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3771.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#15C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3793.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#16C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N3727.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#17C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N3714.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#18C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3818.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#19C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3827.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#20C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3779.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#21C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3780.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#22C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N3722.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#23C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3845.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#24C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3851.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#25C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3796.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#26C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3800.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#27C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3861.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#28C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3853.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#29C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3806.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#30C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3791.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#31C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3950.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#32C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3894.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#33C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3895.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#34C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3915.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#35C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C3909.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#37C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3853.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#38C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N3875.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#39C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3896.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#40C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3698.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#41C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3724.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#42C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3728.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#43C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3823.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#44C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3785.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#45C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3763.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#46C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3825.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#47C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N3723.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#48C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N3706.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#49C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3807.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#50C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3815.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#51C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3775.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#52C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3773.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#53C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N3718.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#54C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3837.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#55C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3841.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#56C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3793.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#57C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3794.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#58C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3850.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#59C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3843.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#60C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3803.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#61C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3786.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#62C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3941.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#63C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3882.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#64C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3886.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#65C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3905.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#66C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3899.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#67C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4012.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#68C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3847.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#69C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N3877.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#70C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3886.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#71C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O3708.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#72C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C3701.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#73C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3806.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#74C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3815.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#75C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3744.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#76C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3767.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#77C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N3706.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#78C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3832.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#79C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3839.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#80C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3759.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#81C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3783.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#82C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3843.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#83C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3835.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#84C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3769.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#85C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3772.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#86C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3953.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#87C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3883.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#88C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3871.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#89C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3900.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#90C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO3883.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#93C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N3876.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#94C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3883.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#95C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N3696.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#96C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3834.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#97C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3835.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#98C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3785.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#99C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3766.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#100C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3822.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#101C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3833.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#102C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3779.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#103C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3779.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#104C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3945.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#105C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3864.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#106C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3870.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#107C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3889.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#108C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3889.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#109C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4008.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#110C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3832.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#111C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3869.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#112C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3869.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#113C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3832.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#114C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3835.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#115C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3777.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#116C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3750.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#117C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3954.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#118C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3891.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#119C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3893.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#120C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3915.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#121C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3908.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#122C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N4022.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#123C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3846.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#124C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N3872.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#125C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3876.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#126C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3964.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#127C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3891.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#128C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3907.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#129C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3908.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#130C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3906.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#131C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N4022.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#132C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3835.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#133C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N3880.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#134C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3888.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#135C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4003.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#136C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3994.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#137C[Si](C)(C)OC=C([C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO)N([Si](C)(C)C)[Si](C)(C)C3973.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#138C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3925.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#139C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3975.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#140C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO3976.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#141C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3965.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#142C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4080.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#143C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4010.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#144C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4074.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#145C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4002.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#146C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3944.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#147C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3939.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#148C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3686.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#149C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3716.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#150C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C3706.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#151C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3802.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#152C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3819.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#153C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3763.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#154C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3765.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#155C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O3730.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#156C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C3724.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#157C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3833.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#158C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3832.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#159C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3761.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#160C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3781.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#161C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3727.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#162C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3860.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#163C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3858.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#164C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3802.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#165C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3789.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#166C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3851.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#167C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3857.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#168C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3800.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#169C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3803.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#170C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3953.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#171C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3891.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#172C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3896.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#173C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3904.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#174C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C3910.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#176C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3847.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#177C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3885.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#178C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O3884.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#179C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3725.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#180C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C3717.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#181C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3821.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#182C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3819.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#183C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3753.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#184C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3774.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#185C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3720.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#186C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3850.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#187C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3783.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#188C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3798.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#189C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3847.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#190C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3842.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#191C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3845.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#192C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3795.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#193C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3797.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#194C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3941.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#195C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3879.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#196C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3884.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#197C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3892.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#198C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3901.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#199C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4023.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#200C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3840.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#201C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3885.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#202C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O3874.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#203C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3704.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#204C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3842.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#205C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3829.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#206C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3759.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#207C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3765.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#208C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3833.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#209C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3834.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#210C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3756.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#211C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3776.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#212C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3954.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#213C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3879.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#214C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3864.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#215C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3887.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#216C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO3878.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#217C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O4016.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#218C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3814.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#219C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3888.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#220C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O3863.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#221C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3843.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#222C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3848.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#223C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3791.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#224C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3761.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#225C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3963.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#226C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3895.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#227C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3903.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#228C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3907.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#229C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3914.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#230C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O4032.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#231C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3837.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#232C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O3895.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#233C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3880.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#234C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3959.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#235C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3901.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#236C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3899.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#237C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3915.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#238C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3921.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#239C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C4031.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#240C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3850.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#241C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C3886.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#242C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3867.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#243C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3995.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#244C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4003.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#245C[Si](C)(C)OC=C([C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO)N([Si](C)(C)C)[Si](C)(C)C3974.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#246C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3924.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#247C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3971.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#248C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO3984.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#249C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3961.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#250C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O4089.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#251C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4001.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#252C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4085.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#253C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4015.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#254C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3932.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#255C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3949.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#256C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3715.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#257C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3710.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#258C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3833.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#259C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3785.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#260C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3780.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#261C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3842.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#262C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3738.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#263C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3861.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#264C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3857.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#265C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3777.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#266C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3803.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#267C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3866.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#268C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3780.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#269C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3806.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#270C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3861.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#271C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3969.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#272C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3923.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#273C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3922.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#274C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3934.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#275C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C3932.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#277C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3864.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#278C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)[C@H]1O3893.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#279C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O3899.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#280C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3732.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#281C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3857.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#282C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3770.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#283C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3798.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#284C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3847.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#285C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3853.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#286C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3797.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#287C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3770.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#288C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3845.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#289C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3958.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#290C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3911.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#291C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3913.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#292C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3924.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#293C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3860.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#294C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3891.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#295C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3924.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#296C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3894.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#297C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4036.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#298C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3857.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#299C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3844.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#300C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3760.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#301C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3766.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#302C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3963.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#303C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3908.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#304C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3887.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#305C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3916.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#306C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO3904.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#307C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O4027.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#308C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3831.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#309C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O3895.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#310C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O3876.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#311C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3963.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#312C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3883.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#313C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3912.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#314C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3899.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#315C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3919.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#316C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N)[C@H]1O[Si](C)(C)C4035.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#317C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3825.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#318C[Si](C)(C)O[C@H]([C@@H](N)C=O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3887.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#319C[Si](C)(C)O[C@H]([C@@H](N)C=O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO3891.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#320C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4016.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#321C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4015.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#322C[Si](C)(C)OC=C([C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO)N([Si](C)(C)C)[Si](C)(C)C3962.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#323C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3952.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#324C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3993.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#325C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO3994.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#326C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3989.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#327C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O4101.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#328C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4016.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#329C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O4094.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#330C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4022.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#331C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3942.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#332C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3958.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#333C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3716.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#334C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3843.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#335C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3777.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#336C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3789.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#337C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3842.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#338C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3869.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#339C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3795.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#340C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3786.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#341C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3856.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#342C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3972.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#343C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3920.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#344C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3930.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#345C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3927.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#346C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3859.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#347C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3910.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#348C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C3932.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#349C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3901.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#350C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4052.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#351C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3860.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#352C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3787.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#353C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3778.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#354C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3843.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#355C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3963.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#356C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3910.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#357C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3922.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#358C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3915.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#359C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3854.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#360C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3899.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#361C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3926.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#362C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3903.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#363C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4035.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#364C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3966.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#365C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3910.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#366C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3898.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#367C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3913.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#368C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3835.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#369C[Si](C)(C)O[C@H]([C@@H](N)C=O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3894.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#370C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO3899.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#371C[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O4017.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#372C[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3895.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#373C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4018.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#374C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4019.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#375C[Si](C)(C)OC=C([C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO)N([Si](C)(C)C)[Si](C)(C)C3972.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#376C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3957.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#377C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4008.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#378C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4008.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#379C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3988.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#380C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C4095.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#381C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4027.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#382C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3947.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#383C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3964.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#384C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O4087.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#385C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4023.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#386C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3819.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#387C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3773.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#388C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3747.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#389C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3823.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#390C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3960.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#391C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3913.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#392C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3894.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#393C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3919.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#394C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3842.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#395C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3897.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#396C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C3904.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#397C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3898.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#398C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4041.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#399C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3949.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#400C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3902.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#401C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3885.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#402C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3905.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#403C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3832.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#404C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3886.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#405C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3890.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#406C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3889.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#407C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4020.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#408C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO4013.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#409C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO4003.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#410C[Si](C)(C)OC=C([C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO)N([Si](C)(C)C)[Si](C)(C)C3968.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#411C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3933.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#412C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3987.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#413C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4001.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#414C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO3964.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#415C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O4087.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#416C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO4013.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#417C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C4085.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#418C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4036.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#419C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3933.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#420C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3971.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#421C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3940.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#422C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3878.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#423C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3879.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#424C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3902.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#425C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3836.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#426C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3871.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#427C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3900.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#428C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O3861.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#429C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4032.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#430C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4019.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#431C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4018.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#432C[Si](C)(C)OC=C([C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C3984.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#433C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3954.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#434C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4000.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#435C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C3997.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#436C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C3988.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#438C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4025.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#439C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3964.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#440C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3956.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#442C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4017.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#443C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C4004.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#444C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C4005.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#445C[Si](C)(C)OC=C([C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C3962.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#446C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3944.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#447C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3995.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#448C[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C4001.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#449C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3977.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#450C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4091.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#451C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C4013.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#452C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3954.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#453C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3956.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#454C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4086.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#455C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C4015.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#456C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4063.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#457C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(=CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4027.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#458C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4118.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#459C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(=CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4028.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#460C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4125.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#461C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4033.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#462C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)C(N)=CO[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4040.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#463C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4163.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#464C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4088.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#465C[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4091.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#466C[Si](C)(C)O[C@@H]([C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4214.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#467C[Si](C)(C)O[C@@H]([C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4211.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#468C[Si](C)(C)O[C@H]([C@@H](N)C=O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4051.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#469C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3637.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#470C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3648.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#471C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3623.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#472C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3770.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#473C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3715.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#474C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3716.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#475C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3820.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#476C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3638.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#477C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3645.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#478C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3789.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#479C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3725.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#480C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3727.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#481C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3847.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#482C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3649.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#483C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3803.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#484C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3713.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#485C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3740.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#486C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3850.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#487C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3773.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#488C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3718.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#489C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3700.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#490C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3832.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#491C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3928.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#492C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3847.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#493C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3849.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#494C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3910.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#495C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3802.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#496C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3825.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#497C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3912.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#498C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3818.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#499C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N3975.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#500C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O3659.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#501C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C3657.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#502C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3793.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#503C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3840.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#504C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3713.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#505C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3733.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#506C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N3655.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#507C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3818.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#508C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3864.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#509C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3728.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#510C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3746.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#511C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3824.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#512C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3863.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#513C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3738.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#514C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3731.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#515C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3957.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#516C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3881.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#517C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3867.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#518C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3929.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#519C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C3914.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#520C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N3995.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#522C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N3846.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#523C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3852.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#524C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N3652.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#525C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3825.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#526C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3865.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#527C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3757.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#528C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3731.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#529C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3814.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#530C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3856.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#531C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3751.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#532C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3749.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#533C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3944.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#534C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3867.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#535C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3870.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#536C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3921.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#537C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C3924.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#538C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3990.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#539C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3817.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#540C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3846.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#541C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3846.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#542C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3812.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#543C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3854.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#544C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3744.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#545C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3714.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#546C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3960.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#547C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3891.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#548C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3890.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#549C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3945.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#550C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C3945.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#551C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N4001.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#552C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@@H]1O3831.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#553C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N3850.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#554C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3850.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#555C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3973.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#556C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3888.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#557C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3906.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#558C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3931.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#559C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C3944.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#560C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N4002.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#561C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3816.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#562C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N3858.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#563C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3856.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#564C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4025.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#565C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4018.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#566C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C4004.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#567C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3935.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#568C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3995.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#569C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C3987.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#570C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4006.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#571C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4068.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#572C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4033.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#573C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4063.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#574C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4029.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#575C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3923.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#576C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3920.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#577C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3642.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#578C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3648.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#579C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3802.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#580C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3739.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#581C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3744.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#582C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3846.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#583C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3652.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#584C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3814.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#585C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3722.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#586C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3751.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#587C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3856.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#588C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3783.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#589C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3725.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#590C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3707.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#591C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3831.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#592C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3932.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#593C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3854.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#594C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3858.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#595C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3910.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#596C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3807.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#597C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3829.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#598C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3912.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#599C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3835.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#600C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C3983.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#601C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3651.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#602C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3802.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#603C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3703.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#604C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3739.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#605C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3850.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#606C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3810.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#607C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3740.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#608C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3723.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#609C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3859.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#610C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3953.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#611C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3880.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#612C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3883.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#613C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3937.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#614C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@@H]1O3823.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#615C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3840.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#616C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3937.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#617C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3844.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#618C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C3996.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#619C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3817.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#620C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3724.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#621C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3733.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#622C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3860.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#623C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3964.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#624C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3878.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#625C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3898.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#626C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3923.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#627C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3808.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#628C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3841.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#629C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3935.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#630C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3853.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#631C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C3998.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#632C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3947.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#633C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3872.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#634C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3859.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#635C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3921.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#637C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3839.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#638C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3901.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#640C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C3990.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#641C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C4012.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#642C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C4005.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#643C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C3984.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#644C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3927.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#645C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3984.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#646C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3983.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#647C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3992.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#648C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4063.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#649C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C4022.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#650C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3912.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#651C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3914.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#652C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4061.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#653C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C4023.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#654C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N3638.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#655C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3805.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#656C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3847.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#657C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3720.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#658C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3714.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#659C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3797.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#660C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3842.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#661C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3714.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#662C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3734.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#663C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3947.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#664C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3855.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#665C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3843.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#666C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3899.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#667C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO3889.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#668C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3983.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#671C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O3824.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#672C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3806.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#673C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3845.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#674C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3713.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#675C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3698.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#676C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3961.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#677C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3880.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#678C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3864.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#679C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3926.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#680C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO3912.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#681C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N3993.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#682C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3796.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#683C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N3833.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#684C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3830.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#685C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3971.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#686C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3875.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#687C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3879.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#688C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3916.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#689C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO3910.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#690C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N3990.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#692C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N3839.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#693C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3843.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#694C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO4024.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#695C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO4005.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#696C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO)N([Si](C)(C)C)[Si](C)(C)C3984.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#698C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3982.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#700C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO3974.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#701C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O4061.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#702C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO4022.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#703C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C4050.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#705C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3886.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#707C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3797.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#708C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3840.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#709C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3739.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#710C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3708.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#711C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3962.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#712C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3866.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#713C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3884.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#714C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3912.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#715C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3923.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#716C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N3992.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#717C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3798.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#718C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N3841.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#719C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3823.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#720C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3950.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#721C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3872.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#722C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3872.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#723C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3920.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#724C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3923.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#725C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N3982.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#726C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@@H]1O3816.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#727C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C3831.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#728C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3824.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#729C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4003.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#730C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4004.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#731C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO)N([Si](C)(C)C)[Si](C)(C)C3989.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#732C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3913.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#733C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3962.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#734C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO3967.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#735C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3976.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#736C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O4057.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#737C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4005.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#738C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4054.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#739C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4010.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#740C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3885.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#741C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3897.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#742C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3952.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#743C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3846.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#744C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3877.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#745C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3895.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#746C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3916.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#747C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N3985.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#748C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3776.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#749C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N3828.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#750C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3825.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#751C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4023.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#752C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4016.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#753C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO)N([Si](C)(C)C)[Si](C)(C)C3968.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#754C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@@H]1O3935.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#755C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3973.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#756C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO3973.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#757C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4002.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#758C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O4073.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#759C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4017.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#760C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O4065.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#761C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4015.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#762C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3908.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#763C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3896.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#764C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4022.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#765C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4027.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#766C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO)N([Si](C)(C)C)[Si](C)(C)C3985.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#767C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3937.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#768C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3990.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#769C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO3989.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#770C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3993.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#771C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C4058.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#772C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4029.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#773C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O4062.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#774C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4019.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#775C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3893.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#776C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3910.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#777C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4067.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#778C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(=CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4046.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#779C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4113.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#780C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(=CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4044.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#781C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4107.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#782C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4027.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#783C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4030.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#784C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4143.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#785C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4098.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#786C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4096.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#787C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C4182.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#788C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4169.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#789C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C3996.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#790C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3646.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#791C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3639.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#792C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3796.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#793C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3731.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#794C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3730.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#795C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3851.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#796C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3647.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#797C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3804.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#798C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3715.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#799C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3737.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#800C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3854.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#801C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3775.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#802C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3711.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#803C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3689.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#804C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3825.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#805C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3930.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#806C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3846.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#807C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O3850.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#808C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3903.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#809C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3791.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#810C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3816.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#811C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3911.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#812C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3821.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#813C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3984.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#814C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3656.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#815C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3825.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#816C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3858.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#817C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3730.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#818C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3730.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#819C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3819.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#820C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3858.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#821C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3725.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#822C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3744.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#823C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3954.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#824C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3876.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#825C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3861.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#826C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3915.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#827C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C3907.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#828C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3989.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#829C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3796.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#830C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3857.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#831C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O3835.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#832C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3820.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#833C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3865.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#834C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3757.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#835C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3728.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#836C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3973.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#837C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3890.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#838C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3903.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#839C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3933.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#840C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C3948.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#841C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O4009.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#842C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3818.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#843C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O3868.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#844C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3849.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#845C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3962.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#846C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3900.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#847C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3896.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#848C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3947.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#849C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C3953.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#850C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C4006.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#851C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@@H]1O3835.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#852C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C3860.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#853C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3847.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#854C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4017.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#855C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4021.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#856C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C4003.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#857C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3934.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#858C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3989.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#859C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C3994.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#860C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4004.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#861C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O4074.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#862C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4026.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#863C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4073.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#864C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4038.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#865C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3911.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#866C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3928.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#867C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3653.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#868C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3812.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#869C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3719.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#870C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3751.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#871C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3863.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#872C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3810.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#873C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3739.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#874C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3719.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#875C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3855.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#876C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3954.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#877C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3890.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#878C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3888.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#879C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3939.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#880C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@@H]1O3828.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#881C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3841.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#882C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3946.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#883C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3853.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#884C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4002.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#885C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3818.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#886C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3725.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#887C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3725.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#888C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3858.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#889C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3965.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#890C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3882.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#891C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3896.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#892C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3926.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#893C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3810.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#894C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3837.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#895C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3944.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#896C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3863.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#897C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4007.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#898C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3944.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#899C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3869.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#900C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3853.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#901C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3908.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#902C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3787.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#903C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3823.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#904C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3897.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#905C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3841.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#906C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C3986.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#907C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C4003.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#908C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C4010.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#909C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C3985.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#910C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3928.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#911C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3979.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#912C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3989.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#913C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3994.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#914C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O4070.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#915C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C4016.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#916C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3899.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#917C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3920.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#918C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4071.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#919C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C4034.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#920C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3813.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#921C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3848.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#922C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3721.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#923C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3708.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#924C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3966.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#925C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3876.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#926C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3871.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#927C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3916.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#928C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO3908.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#929C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O3986.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#930C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3788.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#931C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O3850.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#932C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3826.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#933C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3956.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#934C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3882.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#935C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3862.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#936C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3919.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#937C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO3913.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#938C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C3984.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#939C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3796.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#940C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C3847.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#941C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3819.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#942C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO4012.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#943C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO4006.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#944C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO)N([Si](C)(C)C)[Si](C)(C)C3982.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#945C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3909.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#946C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3969.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#947C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO3990.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#948C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO3969.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#949C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O4056.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#950C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO4004.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#951C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C4052.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#952C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4036.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#953C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3870.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#954C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3919.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#955C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO3970.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#956C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3865.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#957C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3891.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#958C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3908.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#959C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3939.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#960C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4004.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#961C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3796.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#962C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3853.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#963C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3827.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#964C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4021.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#965C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4033.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#966C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO)N([Si](C)(C)C)[Si](C)(C)C3989.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#967C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3942.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#968C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3986.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#969C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4001.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#970C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4001.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#971C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C4072.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#972C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4025.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#973C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O4073.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#974C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4037.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#975C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3907.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#976C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3905.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#977C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4022.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#978C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4025.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#979C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO)N([Si](C)(C)C)[Si](C)(C)C3978.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#980C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@@H]1O3945.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#981C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3975.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#982C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO3985.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#983C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4004.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#984C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O4074.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#985C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4010.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#986C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O4071.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#987C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4025.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#988C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3920.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#989C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3894.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#990C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4069.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#991C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(=CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O4044.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#992C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4101.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#993C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(=CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4049.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#994C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4114.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#995C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4022.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#996C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O4035.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#997C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O4148.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#998C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4093.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#999C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4105.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1000C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O4186.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1001C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4190.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1002C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O4006.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1003C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3646.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1004C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3800.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1005C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3706.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1006C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3734.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1007C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3854.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1008C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3800.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1009C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3730.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1010C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3705.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1011C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3851.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1012C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3947.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1013C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3875.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1014C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O3875.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1015C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3934.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1016C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@@H]1O3813.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1017C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3822.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1018C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3936.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1019C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3831.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1020C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C3996.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1021C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3832.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1022C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3722.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1023C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3730.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1024C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3868.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1025C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3967.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1026C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3902.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1027C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3883.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1028C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3949.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1029C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C3934.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1030C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O4000.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1031C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3815.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1032C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O3864.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1033C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O3850.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1034C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3966.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1035C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3877.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1036C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3902.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1037C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3923.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1038C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3804.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1039C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3855.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1040C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C3948.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1041C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3865.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1042C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4007.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1043C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4039.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1044C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4035.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1045C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C3987.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1046C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@@H]1O3963.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1047C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4001.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1048C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4002.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1049C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4027.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1050C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O4088.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1051C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4041.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1052C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O4081.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1053C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4047.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1054C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3943.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1055C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3928.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1056C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3828.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1057C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3716.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1058C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3725.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1059C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3866.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1060C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3960.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1061C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3869.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1062C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3896.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1063C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3914.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1064C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3796.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1065C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3840.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1066C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3942.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1067C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3859.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1068C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4006.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1069C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3962.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1070C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3896.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1071C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3877.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1072C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3942.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1073C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3809.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1074C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3844.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1075C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3925.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1076C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3850.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1077C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C3998.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1078C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C4028.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1079C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C4027.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1080C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C3974.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1081C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@@H]1O3957.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1082C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C3998.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1083C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C4001.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1084C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C4021.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1085C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O4090.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1086C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C4038.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1087C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3937.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1088C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3922.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1089C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O4083.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1090C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C4044.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1091C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3969.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1092C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3865.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1093C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3876.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1094C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3908.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1095C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO3919.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1096C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3991.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1097C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3779.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1098C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3866.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1099C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O[Si](C)(C)C3847.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1100C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO4033.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1101C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO4023.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1102C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO)N([Si](C)(C)C)[Si](C)(C)C3970.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1103C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3941.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1104C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO3984.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1105C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO3995.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1106C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO4001.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1107C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O4074.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1108C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO4018.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1109C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C4064.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1110C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4047.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1111C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3884.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1112C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O3938.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1113C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4007.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1114C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4027.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1115C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO)N([Si](C)(C)C)[Si](C)(C)C3972.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1116C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3929.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1117C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO3987.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1118C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO3991.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1119C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO3986.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1120C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4063.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1121C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4028.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1122C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O4070.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1123C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4028.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1124C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3893.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1125C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3915.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1126C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4102.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1127C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(=CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O4048.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1128C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4116.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1129C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(=CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O4036.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1130C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4122.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1131C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O4053.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1132C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4039.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1133C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O4159.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1134C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4099.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1135C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4119.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1136C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4190.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1137C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)[C@H]1O4187.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1138C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4002.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1139C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3807.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1140C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3718.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1141C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3713.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1142C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3847.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1143C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3953.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1144C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3870.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1145C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O3885.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1146C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3922.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1147C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3799.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1148C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O3836.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1149C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3933.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1150C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3839.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1151C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C3992.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1152C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3973.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1153C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3900.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1154C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3895.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1155C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3938.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1156C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3808.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1157C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3863.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1158C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C3929.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1159C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3869.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1160C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C3990.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1161C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4033.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1162C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4044.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1163C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C4002.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1164C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3963.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1165C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4015.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1166C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4018.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1167C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4022.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1168C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C4076.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1169C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4043.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1170C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3929.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1171C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3944.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1172C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O4076.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1173C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4050.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1174C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3968.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1175C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3895.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1176C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C3890.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1177C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3932.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1178C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3799.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1179C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3852.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1180C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3924.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1181C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3856.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1182C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C3989.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1183C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C4023.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1184C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C4035.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1185C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C3988.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1186C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O3959.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1187C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C4010.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1188C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C4019.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1189C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C4017.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1190C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C4076.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1191C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C4038.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1192C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3923.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1193C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3936.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1194C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O4078.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1195C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C4050.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1196C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO4034.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1197C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO4026.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1198C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO)N([Si](C)(C)C)[Si](C)(C)C3977.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1199C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3944.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1200C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO4006.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1201C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4008.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1202C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO4000.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1203C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C4064.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1204C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO4034.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1205C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3914.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1206C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3936.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1207C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C4057.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1208C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4043.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1209C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4101.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1210C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(=CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C4040.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1211C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4136.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1212C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(=CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H]1O4051.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1213C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4131.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1214C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C4056.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1215C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4059.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1216C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@@H]1O4144.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1217C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4113.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1218C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4105.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1219C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H]1N([Si](C)(C)C)[Si](C)(C)C4211.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1220C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H]1N([Si](C)(C)C)[Si](C)(C)C4035.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1221C[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@H]1O4181.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1222C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3937.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1223C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3862.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1224C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C3843.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1225C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3912.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1226C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3785.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1227C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O3823.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1228C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3898.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1229C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3838.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1230C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C3977.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1231C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4033.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1232C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4020.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1233C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C3996.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1234C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3941.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1235C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C3998.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1236C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4004.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1237C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4003.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1238C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O4068.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1239C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4035.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1240C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3913.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1241C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3947.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1242C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C4058.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1243C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4053.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1244C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C4021.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1245C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C4008.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1246C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C3979.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1247C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3935.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1248C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C3991.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1249C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3996.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1250C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C3992.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1251C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O4068.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1252C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C4027.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1253C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3897.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1254C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3934.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1255C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C4056.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1256C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C4045.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1257C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO4083.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1258C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(=CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O4040.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1259C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N)[C@H](O)CO4123.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1260C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(=CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C4032.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1261C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4144.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1262C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4030.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1263C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O4061.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1264C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O4139.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1265C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C)[C@H](O)CO4086.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1266C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4123.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1267C[Si](C)(C)O[C@H]1[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1N([Si](C)(C)C)[Si](C)(C)C4216.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1268C[Si](C)(C)O[C@H]1[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@@H]1N([Si](C)(C)C)[Si](C)(C)C4045.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1269C[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C4178.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1270C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C4007.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1271C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C4006.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1272C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C3985.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1273C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3918.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1274C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3971.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1275C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3972.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1276C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C3995.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1277C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4059.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1278C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C4021.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1279C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3899.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1280C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3904.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1281C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4057.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1282C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C4022.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1283C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4096.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1284C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(=CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4060.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1285C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C4131.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1286C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(=CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4064.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1287C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4132.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1288C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4056.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1289C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4062.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1290C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4151.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1291C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4114.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1292C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C4116.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1293C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4199.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1294C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O4023.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1295C[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4193.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1296C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C4083.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1297C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(=CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4040.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1298C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C4117.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1299C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(=CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4044.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1300C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C4121.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1301C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4049.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1302C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4055.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1303C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4145.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1304C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C4103.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1305C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C4110.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1306C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4195.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1307C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O4018.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1308C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C4191.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1309C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(=CO[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4119.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1310C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C)[C@H](O)CO4190.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1311C[Si](C)(C)NC(=CO[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4193.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1312C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO)N([Si](C)(C)C)[Si](C)(C)C4185.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1313C[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO)N([Si](C)(C)C)[Si](C)(C)C4180.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1314C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4130.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1315C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4265.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1316C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4266.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,5TMS,#1317C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4201.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,1TBDMS,#1CC(C)(C)[Si](C)(C)O[C@H]([C@@H](N)C=O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4233.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,1TBDMS,#2CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4187.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,1TBDMS,#3CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4183.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,1TBDMS,#4CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@H]1O4178.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,1TBDMS,#5CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@H]1O4169.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,1TBDMS,#6CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4169.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,1TBDMS,#7CC(C)(C)[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O4210.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,1TBDMS,#8CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O4210.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,1TBDMS,#9CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4370.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,1TBDMS,#10CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4394.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,1TBDMS,#11CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4253.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,1TBDMS,#12CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4244.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#1CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4328.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#2CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4329.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#3CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@H]1O4307.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#4CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@H]1O4312.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#5CC(C)(C)[Si](C)(C)O[C@H]([C@@H](N)C=O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O)CO4313.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#6CC(C)(C)[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O4342.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#7CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O4339.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#8CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4497.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#9CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4480.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#10CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4328.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#11CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4326.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#12CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4303.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#13CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O4298.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#14CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4271.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#15CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4289.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#16CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N4264.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#17CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N4265.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#18CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4467.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#19CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4466.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#20CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4278.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#21CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4297.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#22CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4303.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#23CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O4300.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#24CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O4267.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#25CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4266.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#26CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4263.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#27CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4472.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#28CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4462.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#29CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4279.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#30CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O4282.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#31CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@H]1O4281.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#32CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O4277.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#33CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]1O4246.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#34CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@H]1O[Si](C)(C)C(C)(C)C4243.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#35CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4465.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#36CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4454.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#37CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O4268.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#38CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4285.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#39CC(C)(C)[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O4285.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#40CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O4280.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#41CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@H]1O4247.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#42CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4461.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#43CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4280.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#44CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4454.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#45CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H]1O4274.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#46CC(C)(C)[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O4290.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#47CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O4285.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#48CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O)CO4460.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#49CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C(C)(C)C4279.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#50CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O)CO4442.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#51CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O4277.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#52CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O4305.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#53CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C(C)(C)C4486.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#54CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4310.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#55CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4303.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#56CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C(C)(C)C4481.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#57CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C(C)(C)C4483.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#58CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4316.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#59CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4304.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#60CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C(C)(C)C4482.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#61CC(C)(C)[Si](C)(C)NC(=CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4633.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#62CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4510.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#63CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4500.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#64CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4509.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#65CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C(C)(C)C)[C@H](O)CO4509.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#66CC(C)(C)[Si](C)(C)N([C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO)[Si](C)(C)C(C)(C)C4612.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#67CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4320.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#68CC(C)(C)[Si](C)(C)N([C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O)[Si](C)(C)C(C)(C)C4495.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,2TBDMS,#69CC(C)(C)[Si](C)(C)N([C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O)[Si](C)(C)C(C)(C)C4487.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#1CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4457.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#2CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4460.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#3CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4434.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#4CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4446.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#5CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N4436.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#6CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N4441.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#7CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4568.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#8CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4561.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#9CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4427.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#10CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4438.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#11CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4460.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#12CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4462.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#13CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O4430.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#14CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4444.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#15CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4434.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#16CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4572.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#17CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4563.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#18CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4425.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#19CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O4432.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#20CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@H]1O4460.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#21CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O4463.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#22CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]1O4428.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#23CC(C)(C)[Si](C)(C)O[C@H]([C@@H](N)C=O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4428.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#24CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4560.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#25CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4563.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#26CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O4431.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#27CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4444.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#28CC(C)(C)[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O4466.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#29CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O4471.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#30CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@H]1O4432.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#31CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4568.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#32CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4438.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#33CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4561.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#34CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H]1O4436.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#35CC(C)(C)[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O4451.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#36CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O4450.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#37CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O)CO4569.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#38CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O)CO4546.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#39CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O4432.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#40CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C(C)(C)C4417.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#41CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O4469.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#42CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C(C)(C)C4586.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#43CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4465.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#44CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4457.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#45CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C(C)(C)C4576.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#46CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C(C)(C)C4585.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#47CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4470.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#48CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4458.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#49CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C(C)(C)C4583.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#50CC(C)(C)[Si](C)(C)NC(=CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4661.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#51CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)C(N)=CO[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4559.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#52CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)C(N)=CO[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4550.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#53CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4575.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#54CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C(C)(C)C)[C@H](O)CO4568.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#55CC(C)(C)[Si](C)(C)O[C@@H]([C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO)[C@H](C=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4733.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#56CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N)C=O)[C@H](N[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4445.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#57CC(C)(C)[Si](C)(C)O[C@H]([C@@H](N)C=O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4626.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#58CC(C)(C)[Si](C)(C)O[C@H]([C@@H](N)C=O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)CO4620.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#59CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O4425.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#61CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4428.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#62CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N4418.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#63CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N4420.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#64CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C(C)(C)C4568.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#65CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C(C)(C)C4566.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#66CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4413.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#67CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4425.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#68CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O4427.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#69CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O4418.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#70CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O4418.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#71CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O4412.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#72CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C(C)(C)C4563.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#73CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4430.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#74CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4415.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#75CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C(C)(C)C4574.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#77CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N4390.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#78CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N4395.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#79CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O)CO4540.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#80CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O)CO4539.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#81CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C(C)(C)C4376.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#82CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O4397.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#83CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N4404.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#84CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N4397.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#85CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4552.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#86CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4555.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#87CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4390.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#88CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O4400.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#89CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N4381.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#90CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4532.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#91CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4547.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#92CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O4390.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#93CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4405.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#94CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4537.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#95CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4547.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#96CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H]1O4393.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#97CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4394.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#98CC(C)(C)[Si](C)(C)NC(=CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4664.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#99CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4543.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#100CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4528.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#101CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4569.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#102CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C(C)(C)C)[C@H](O)CO4553.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#103CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4723.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#104CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4401.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#105CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4581.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#106CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4587.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#107CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O4427.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#108CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O4412.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#109CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4425.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#110CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4416.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#111CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C(C)(C)C4571.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#112CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C(C)(C)C4566.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#113CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4411.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#114CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O4420.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#115CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O4415.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#116CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O4424.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#117CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O4412.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#118CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C(C)(C)C4566.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#119CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O4425.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#120CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4415.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#121CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C(C)(C)C4572.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#122CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4391.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#123CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4382.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#124CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O)CO4540.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#125CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O)CO4532.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#126CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C(C)(C)C4371.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#127CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O4388.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#128CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4399.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#129CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4537.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#130CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4545.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#131CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H]1O4393.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#132CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4394.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#133CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4534.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#134CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4541.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#135CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O4387.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#136CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4398.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#137CC(C)(C)[Si](C)(C)NC(=CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4662.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#138CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O4542.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#139CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4528.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#140CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4552.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#141CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C(C)(C)C)[C@H](O)CO4550.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#142CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4723.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#143CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O4389.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#144CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4585.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#145CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O4582.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#146CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O4417.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#147CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]1O4406.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#148CC(C)(C)[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O4404.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#149CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C(C)(C)C4554.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#150CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C(C)(C)C4564.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#151CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O4410.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#152CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4423.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#153CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O4404.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#154CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O4406.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#155CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C(C)(C)C4552.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#156CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4431.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#157CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O4416.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#158CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C(C)(C)C4571.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#159CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C(C)(C)C4374.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#160CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O)CO4527.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#161CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O)CO4533.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#162CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C(C)(C)C4373.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#163CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4394.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#164CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4523.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#165CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4527.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#166CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H]1O4373.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#167CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4370.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#168CC(C)(C)[Si](C)(C)NC(=CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4652.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#169CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4540.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#170CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@@H]1O4522.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#171CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4572.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#172CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C(C)(C)C)[C@H](O)CO4558.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#173CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]2O)[C@H](N)[C@H]1O4713.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#174CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C(C)(C)C)[C@@H]1O4411.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#175CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](N)[C@H]1O4579.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#176CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]1O4581.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#177CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O4418.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#178CC(C)(C)[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O4408.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#179CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C(C)(C)C4562.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#180CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4415.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#181CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H]1O4416.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#182CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C(C)(C)C4564.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#183CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O4410.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#184CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C(C)(C)C4558.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#185CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4421.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#186CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H]1O4422.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#187CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C(C)(C)C4569.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#188CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O)CO4531.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#189CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4387.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#190CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O)CO4535.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#191CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H]1O[Si](C)(C)C(C)(C)C4380.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#192CC(C)(C)[Si](C)(C)NC(=CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO4654.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#193CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4544.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#194CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H]1O4531.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#195CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4560.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#196CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N[Si](C)(C)C(C)(C)C)[C@@H]1O4399.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#197CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)[C@@H]1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4582.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#198CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C(C)(C)C)[C@H](O)CO4562.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#199CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@H]1O4703.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#200CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@H](CO)[C@H]1O4574.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#201CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O)[C@@H](N)C=O4409.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#202CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C(C)(C)C4561.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#203CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O4416.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#204CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C(C)(C)C4393.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#205CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@@H](CO)O[Si](C)(C)C(C)(C)C4554.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#206CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C(C)(C)C4558.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#207CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O4420.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#208CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C(C)(C)C4397.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#209CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O)CO[Si](C)(C)C(C)(C)C4558.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#210CC(C)(C)[Si](C)(C)NC(=CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O)CO4652.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#211CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O4540.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#212CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O[Si](C)(C)C(C)(C)C4532.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#213CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N[Si](C)(C)C(C)(C)C)[C@H](O)CO4538.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#214CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O4385.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#215CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@@H]1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4590.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#216CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N)[C@H](O)CO4552.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#217CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4690.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#218CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](N)[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4573.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#219CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C4569.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#220CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4421.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#221CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4406.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#222CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C4567.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#223CC(C)(C)[Si](C)(C)NC(=CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C(C)(C)C4678.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#224CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4570.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#225CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4554.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#226CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N)[C@@H](CO)O[Si](C)(C)C(C)(C)C4587.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#227CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4432.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#228CC(C)(C)[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O4611.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#229CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C4581.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#230CC(C)(C)[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O4601.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#231CC(C)(C)[Si](C)(C)O[C@H](CO)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4729.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#232CC(C)(C)[Si](C)(C)NC(=CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C(C)(C)C4674.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#233CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C(C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4573.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#234CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO[Si](C)(C)C(C)(C)C)[C@H](O)C(N)=CO[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4554.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#235CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO[Si](C)(C)C(C)(C)C4598.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#236CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4442.3Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#237CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N)[C@H](O)[C@@H](N)C=O4613.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#238CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C(C)(C)C)[C@H](O)CO[Si](C)(C)C(C)(C)C4587.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#239CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O4601.9Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#240CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)[C@H](C=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4739.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#241CC(C)(C)[Si](C)(C)NC(=CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4676.6Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#242CC(C)(C)[Si](C)(C)NC(=CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N[Si](C)(C)C(C)(C)C)[C@H](O)CO4673.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#243CC(C)(C)[Si](C)(C)OC=C([C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N)[C@H](O)CO)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C4785.4Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#244CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C(C)(C)C)[C@H](N[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4539.5Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#245CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4726.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#246CC(C)(C)[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)CO4715.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#247CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C(C)(C)C)[C@H](O)CO4597.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#248CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4743.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#249CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N)[C@H](O)CO4772.7Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#250CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@H](C=O)N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4733.8Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#251CC(C)(C)[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H](O)CO4765.1Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#252CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@@H]1O4588.0Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,3TBDMS,#253CC(C)(C)[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4593.2Semi standard non polarhttps://arxiv.org/abs/1905.12712
Chitotriose,4TMS,#287C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3800.1Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
Chitotriose,5TMS,#36C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4036.0Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
Chitotriose,5TMS,#91C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4019.9Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
Chitotriose,5TMS,#92C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O[Si](C)(C)C)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3821.0Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
Chitotriose,5TMS,#175C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4045.5Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
Chitotriose,5TMS,#276C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N)[C@H]1O4055.4Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
Chitotriose,5TMS,#437C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)[C@H](N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4115.1Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
Chitotriose,5TMS,#441C[Si](C)(C)N[C@H]1[C@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](C=O)N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H]1O4105.4Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
Chitotriose,5TMS,#521C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3803.7Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
Chitotriose,5TMS,#636C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO[Si](C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3794.7Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
Chitotriose,5TMS,#639C[Si](C)(C)OC[C@@H](O)[C@@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)C=O3835.4Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
Chitotriose,5TMS,#669C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O3781.5Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
Chitotriose,5TMS,#670C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O3831.3Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
Chitotriose,5TMS,#691C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C3789.2Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
Chitotriose,5TMS,#697C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)C(N)=CO[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3915.3Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
Chitotriose,5TMS,#699C[Si](C)(C)OC=C(N)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO3979.8Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
Chitotriose,5TMS,#704C[Si](C)(C)N[C@@H](C=O)[C@@H](O)[C@H](O[C@@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)CO4027.1Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
Chitotriose,5TMS,#706C[Si](C)(C)N[C@H]1[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3910.2Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
Chitotriose,3TBDMS,#60CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4413.7Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
Chitotriose,3TBDMS,#76CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@H]([C@H](O)CO)[C@H](O)[C@@H](N)C=O)[C@H](N)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O4398.9Semi standard non polarLange, M. and Fedorova, M. (2020) Evaluation of lipid quantification accuracy using HILIC and RPLC MS on the example of NIST SRM 1950 metabolites in human plasma. Anal. Bioanal. Chem. 412(15), 3573-3584.
Spectra

GC-MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted GC-MSPredicted GC-MS Spectrum - Chitotriose GC-MS (Non-derivatized) - 70eV, Positivesplash10-03l0-9111600000-2b8f5d4b06f979234ef42017-09-01Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Chitotriose GC-MS (2 TMS) - 70eV, Positivesplash10-08i0-9022025000-3b5e925de2d293ab6e542017-10-06Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Chitotriose GC-MS (TMS_4_287) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Chitotriose GC-MS (TMS_5_36) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Chitotriose GC-MS (TMS_5_91) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Chitotriose GC-MS (TMS_5_92) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Chitotriose GC-MS (TMS_5_175) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Chitotriose GC-MS (TMS_5_276) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Chitotriose GC-MS (TMS_5_437) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Chitotriose GC-MS (TMS_5_441) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Chitotriose GC-MS (TMS_5_521) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Chitotriose GC-MS (TMS_5_636) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Chitotriose GC-MS (TMS_5_639) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Chitotriose GC-MS (TMS_5_669) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Chitotriose GC-MS (TMS_5_670) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Chitotriose GC-MS (TMS_5_691) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Chitotriose GC-MS (TMS_5_697) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Chitotriose GC-MS (TMS_5_699) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Chitotriose GC-MS (TMS_5_704) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Chitotriose GC-MS (TMS_5_706) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Chitotriose GC-MS (TBDMS_3_60) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Chitotriose GC-MS (TBDMS_3_76) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Chitotriose GC-MS ("Chitotriose,4TMS,#287" TMS) - 70eV, PositiveNot Available2021-10-14Wishart LabView Spectrum

MS/MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Chitotriose 10V, Positive-QTOFsplash10-0fsr-1202920000-07cd9cc082808b9a183c2017-09-01Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Chitotriose 20V, Positive-QTOFsplash10-0bu0-9504300000-4371ac53c246062dec592017-09-01Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Chitotriose 40V, Positive-QTOFsplash10-08fs-9512200000-482dc6f7b1ae078a994d2017-09-01Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Chitotriose 10V, Negative-QTOFsplash10-0udr-9678520000-14eb12263ea002959b2e2017-09-01Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Chitotriose 20V, Negative-QTOFsplash10-0569-8933400000-53a601fd6cab060780472017-09-01Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Chitotriose 40V, Negative-QTOFsplash10-05rr-7941100000-84d5c9c0eb1a59ab0f382017-09-01Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Chitotriose 10V, Negative-QTOFsplash10-0udi-2101980000-1d48a4d56ebab6d5dff62021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Chitotriose 20V, Negative-QTOFsplash10-0a4l-9302810000-27d04aa33a5d7f0c68b22021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Chitotriose 40V, Negative-QTOFsplash10-0a4l-9210000000-c876c56bb39d66c9e9642021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Chitotriose 10V, Positive-QTOFsplash10-0w33-0903840000-7959ddb18ea4a4a10c772021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Chitotriose 20V, Positive-QTOFsplash10-000x-2901200000-4474ecc0c0995609dc112021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Chitotriose 40V, Positive-QTOFsplash10-006x-9601000000-f799f7e08206010bfef02021-09-22Wishart LabView Spectrum

NMR Spectra

Spectrum TypeDescriptionDeposition DateSourceView
Predicted 1D NMR13C NMR Spectrum (1D, 100 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 100 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 1000 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 1000 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 200 MHz, D2O, predicted)2021-09-25Wishart Lab