Hmdb loader
You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Human Metabolome Database.
Record Information
Version5.0
StatusExpected but not Quantified
Creation Date2008-08-12 15:06:41 UTC
Update Date2021-09-14 14:58:49 UTC
HMDB IDHMDB0006823
Secondary Accession Numbers
  • HMDB06823
Metabolite Identification
Common Name2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine
Description2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine belongs to the class of organic compounds known as pentose phosphates. These are carbohydrate derivatives containing a pentose substituted by one or more phosphate groups. 2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine exists in all living organisms, ranging from bacteria to humans. In humans, 2,5-diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine is involved in the metabolic disorder called hyperphenylalaninemia due to 6-pyruvoyltetrahydropterin synthase deficiency (ptps). 2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine has been detected, but not quantified in, a few different foods, such as anatidaes (Anatidae), chickens (Gallus gallus), and domestic pigs (Sus scrofa domestica). This could make 2,5-diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine a potential biomarker for the consumption of these foods. 2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine is a primary metabolite. Primary metabolites are metabolically or physiologically essential metabolites. They are directly involved in an organism’s growth, development or reproduction. Based on a literature review very few articles have been published on 2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine.
Structure
Data?1582752408
SynonymsNot Available
Chemical FormulaC9H18N5O14P3
Average Molecular Weight513.1856
Monoisotopic Molecular Weight513.006309845
IUPAC Name[({[({5-[(2,5-diamino-6-oxo-3,6-dihydropyrimidin-4-yl)amino]-2,3-dihydroxy-4-oxopentyl}oxy)(hydroxy)phosphoryl]oxy}(hydroxy)phosphoryl)oxy]phosphonic acid
Traditional Name[({5-[(2,5-diamino-6-oxo-3H-pyrimidin-4-yl)amino]-2,3-dihydroxy-4-oxopentyl}oxy(hydroxy)phosphoryl)oxy(hydroxy)phosphoryl]oxyphosphonic acid
CAS Registry NumberNot Available
SMILES
NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(O)(=O)OP(O)(=O)OP(O)(O)=O)N1
InChI Identifier
InChI=1S/C9H18N5O14P3/c10-5-7(13-9(11)14-8(5)18)12-1-3(15)6(17)4(16)2-26-30(22,23)28-31(24,25)27-29(19,20)21/h4,6,16-17H,1-2,10H2,(H,22,23)(H,24,25)(H2,19,20,21)(H4,11,12,13,14,18)
InChI KeyZJYBJXKSWQPKFW-UHFFFAOYSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as pentose phosphates. These are carbohydrate derivatives containing a pentose substituted by one or more phosphate groups.
KingdomOrganic compounds
Super ClassOrganic oxygen compounds
ClassOrganooxygen compounds
Sub ClassCarbohydrates and carbohydrate conjugates
Direct ParentPentose phosphates
Alternative Parents
Substituents
  • Pentose-5-phosphate
  • Monosaccharide phosphate
  • Pyrimidone
  • Secondary aliphatic/aromatic amine
  • Aminopyrimidine
  • Monoalkyl phosphate
  • Hydropyrimidine
  • Phosphoric acid ester
  • Beta-hydroxy ketone
  • Pyrimidine
  • Acyloin
  • Organic phosphoric acid derivative
  • Alkyl phosphate
  • Alpha-hydroxy ketone
  • Heteroaromatic compound
  • Vinylogous amide
  • 1,2-diol
  • Secondary alcohol
  • Ketone
  • Secondary amine
  • Organoheterocyclic compound
  • Azacycle
  • Organic nitrogen compound
  • Organonitrogen compound
  • Carbonyl group
  • Primary amine
  • Hydrocarbon derivative
  • Amine
  • Organic oxide
  • Alcohol
  • Organopnictogen compound
  • Aromatic heteromonocyclic compound
Molecular FrameworkAromatic heteromonocyclic compounds
External DescriptorsNot Available
Ontology
Physiological effect

Adverse health effect

Disposition

Source

Process

Naturally occurring process

Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water SolubilityNot AvailableNot Available
LogPNot AvailableNot Available
Experimental Chromatographic PropertiesNot Available
Predicted Molecular Properties
PropertyValueSource
Water Solubility6.42 g/LALOGPS
logP-0.86ALOGPS
logP-6.2ChemAxon
logS-1.9ALOGPS
pKa (Strongest Acidic)0.89ChemAxon
pKa (Strongest Basic)3.72ChemAxon
Physiological Charge-3ChemAxon
Hydrogen Acceptor Count16ChemAxon
Hydrogen Donor Count10ChemAxon
Polar Surface Area322.88 ŲChemAxon
Rotatable Bond Count12ChemAxon
Refractivity105.24 m³·mol⁻¹ChemAxon
Polarizability38.94 ųChemAxon
Number of Rings1ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleNoChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DarkChem[M+H]+214.2931661259
DarkChem[M-H]-202.86231661259
DeepCCS[M+H]+186.86430932474
DeepCCS[M-H]-183.33330932474
DeepCCS[M-2H]-219.26630932474
DeepCCS[M+Na]+195.4330932474

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidineNC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(O)(=O)OP(O)(=O)OP(O)(O)=O)N14597.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidineNC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(O)(=O)OP(O)(=O)OP(O)(O)=O)N13597.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidineNC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(O)(=O)OP(O)(=O)OP(O)(O)=O)N14771.1Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,1TMS,isomer #1C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4412.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,1TMS,isomer #10C[Si](C)(C)N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C1=C(N)C(=O)N=C(N)[NH]14336.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,1TMS,isomer #11C[Si](C)(C)N1C(N)=NC(=O)C(N)=C1NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4303.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,1TMS,isomer #2C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]14424.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,1TMS,isomer #3C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)OP(=O)(O)OP(=O)(O)O4431.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,1TMS,isomer #4C[Si](C)(C)OP(=O)(OP(=O)(O)O)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]14439.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,1TMS,isomer #5C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]14446.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,1TMS,isomer #6C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4496.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,1TMS,isomer #7C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4505.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,1TMS,isomer #8C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]14375.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,1TMS,isomer #9C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]C(N)=NC1=O4465.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #1C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]14345.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #10C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4242.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #11C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]14369.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #12C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]14377.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #13C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]14374.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #14C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C4462.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #15C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C4439.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #16C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]14334.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #17C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O4423.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #18C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C4290.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #19C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C4236.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #2C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O4366.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #20C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O4375.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #21C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)O[Si](C)(C)C4390.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #22C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O4473.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #23C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O4444.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #24C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[NH]14345.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #25C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[NH]C(N)=NC1=O4435.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #26C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O4314.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #27C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O4269.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #28C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]14389.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #29C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O4476.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #3C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O4374.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #30C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O4446.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #31C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]14349.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #32C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]C(N)=NC1=O4432.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #33C[Si](C)(C)OP(=O)(OP(=O)(O)O)OP(=O)(O)OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C4329.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #34C[Si](C)(C)OP(=O)(OP(=O)(O)O)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C4278.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #35C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]14380.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #36C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C4488.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #37C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C4459.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #38C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]14359.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #39C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]C(N)=NC1=O4443.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #4C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C4365.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #40C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(O)OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C4311.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #41C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C4277.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #42C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]14423.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #43C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]C(N)=NC1=O4524.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #44C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4364.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #45C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4365.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #46C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]14418.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #47C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]C(N)=NC1=O4509.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #48C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4365.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #49C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4355.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #5C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4395.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #50C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]14417.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #51C[Si](C)(C)N(C1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]1)[Si](C)(C)C4285.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #52C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]14293.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #53C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N1[Si](C)(C)C4292.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #54C[Si](C)(C)N(C1=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]C(N)=NC1=O)[Si](C)(C)C4489.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #55C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]C(N)=NC1=O4340.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #56C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O4295.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #57C[Si](C)(C)N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C4245.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #6C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4421.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #7C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]14331.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #8C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]C(N)=NC1=O4416.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,2TMS,isomer #9C[Si](C)(C)OC(C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4287.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #1C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]14275.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #1C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]13565.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #1C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]17511.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #10C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O4273.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #10C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O3615.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #10C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O7370.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #100C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[NH]14383.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #100C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[NH]13746.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #100C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[NH]17596.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #101C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[NH]C(N)=NC1=O4487.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #101C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[NH]C(N)=NC1=O3763.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #101C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[NH]C(N)=NC1=O7051.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #102C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O4314.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #102C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O3735.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #102C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O7490.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #103C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O4325.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #103C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O3788.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #103C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O7718.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #104C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[NH]14395.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #104C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[NH]13793.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #104C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[NH]17621.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #105C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[NH]C(N)=NC1=O4478.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #105C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[NH]C(N)=NC1=O3798.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #105C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[NH]C(N)=NC1=O7090.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #106C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O4345.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #106C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O3606.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #106C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O7480.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #107C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O4325.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #107C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O3780.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #107C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O7725.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #108C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[NH]14374.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #108C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[NH]13847.4Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #108C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[NH]17018.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #109C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)OP(=O)(O)OP(=O)(O)O4263.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #109C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)OP(=O)(O)OP(=O)(O)O3831.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #109C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)OP(=O)(O)OP(=O)(O)O7571.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #11C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C4253.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #11C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C3601.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #11C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C7313.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #110C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]14274.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #110C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]13774.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #110C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]17383.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #111C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)N1[Si](C)(C)C4256.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #111C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)N1[Si](C)(C)C3815.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #111C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)N1[Si](C)(C)C7506.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #112C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)OP(=O)(O)OP(=O)(O)O4418.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #112C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)OP(=O)(O)OP(=O)(O)O3848.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #112C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)OP(=O)(O)OP(=O)(O)O6911.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #113C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]C(N)=NC1=O4305.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #113C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]C(N)=NC1=O3807.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #113C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]C(N)=NC1=O6928.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #114C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O4260.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #114C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O3849.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #114C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O7142.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #115C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O4225.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #115C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O3797.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #115C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O7501.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #116C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]14252.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #116C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]13678.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #116C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]17262.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #117C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C4377.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #117C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C3690.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #117C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C7485.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #118C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C4381.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #118C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C3721.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #118C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C7499.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #119C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)[NH]14275.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #119C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)[NH]13764.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #119C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)[NH]17382.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #12C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O[Si](C)(C)C)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O4309.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #12C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O[Si](C)(C)C)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O3539.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #12C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O[Si](C)(C)C)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O7569.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #120C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)[NH]C(N)=NC1=O4353.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #120C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)[NH]C(N)=NC1=O3779.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #120C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)[NH]C(N)=NC1=O6823.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #121C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C4251.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #121C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C3708.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #121C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C7297.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #122C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C4195.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #122C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C3785.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #122C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C7528.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #123C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]14359.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #123C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]13756.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #123C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]17675.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #124C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]C(N)=NC1=O4472.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #124C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]C(N)=NC1=O3774.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #124C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]C(N)=NC1=O7113.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #125C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O4322.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #125C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O3745.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #125C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O7574.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #126C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O4316.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #126C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O3798.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #126C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O7808.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #127C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]14382.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #127C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]13809.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #127C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]17701.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #128C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]C(N)=NC1=O4467.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #128C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]C(N)=NC1=O3813.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #128C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]C(N)=NC1=O7154.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #129C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O4352.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #129C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O3617.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #129C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O7564.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #13C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O[Si](C)(C)C)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O4377.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #13C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O[Si](C)(C)C)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O3626.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #13C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O[Si](C)(C)C)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O7559.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #130C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O4317.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #130C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O3796.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #130C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O7814.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #131C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]14358.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #131C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]13857.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #131C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]17043.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #132C[Si](C)(C)OP(=O)(OP(=O)(O)O)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]14265.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #132C[Si](C)(C)OP(=O)(OP(=O)(O)O)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]13839.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #132C[Si](C)(C)OP(=O)(OP(=O)(O)O)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]17646.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #133C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[Si](C)(C)C)[NH]14281.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #133C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[Si](C)(C)C)[NH]13778.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #133C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[Si](C)(C)C)[NH]17456.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #134C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)N1[Si](C)(C)C4250.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #134C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)N1[Si](C)(C)C3821.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #134C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)N1[Si](C)(C)C7582.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #135C[Si](C)(C)OP(=O)(OP(=O)(O)O)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]14427.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #135C[Si](C)(C)OP(=O)(OP(=O)(O)O)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]13861.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #135C[Si](C)(C)OP(=O)(OP(=O)(O)O)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]16969.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #136C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[Si](C)(C)C)[NH]C(N)=NC1=O4316.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #136C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[Si](C)(C)C)[NH]C(N)=NC1=O3814.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #136C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[Si](C)(C)C)[NH]C(N)=NC1=O6985.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #137C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O4255.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #137C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O3857.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #137C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O7207.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #138C[Si](C)(C)OP(=O)(OP(=O)(O)O)OP(=O)(O)OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C4232.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #138C[Si](C)(C)OP(=O)(OP(=O)(O)O)OP(=O)(O)OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C3802.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #138C[Si](C)(C)OP(=O)(OP(=O)(O)O)OP(=O)(O)OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C7586.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #139C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4360.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #139C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3673.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #139C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C7456.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #14C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[NH]14273.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #14C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[NH]13666.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #14C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[NH]17458.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #140C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4365.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #140C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3701.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #140C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C7469.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #141C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]14276.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #141C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]13743.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #141C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]17351.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #142C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(N)=NC1=O4341.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #142C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(N)=NC1=O3757.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #142C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(N)=NC1=O6806.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #143C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C4225.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #143C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C3693.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #143C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C7269.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #144C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C4191.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #144C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C3769.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #144C[Si](C)(C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C7497.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #145C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]14375.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #145C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]13735.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #145C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]17611.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #146C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]C(N)=NC1=O4471.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #146C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]C(N)=NC1=O3756.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #146C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]C(N)=NC1=O7068.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #147C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C4307.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #147C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C3725.4Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #147C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C7496.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #148C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C4313.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #148C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C3780.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #148C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C7725.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #149C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]14399.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #149C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]13788.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #149C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]17636.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #15C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[NH]C(N)=NC1=O4371.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #15C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[NH]C(N)=NC1=O3685.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #15C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)[NH]C(N)=NC1=O6910.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #150C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]C(N)=NC1=O4475.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #150C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]C(N)=NC1=O3797.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #150C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]C(N)=NC1=O7108.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #151C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C4341.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #151C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C3599.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #151C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C7487.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #152C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C4320.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #152C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C3776.4Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #152C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C7732.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #153C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]14351.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #153C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]13841.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #153C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]17045.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #154C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]14270.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #154C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]13825.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #154C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]17586.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #155C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]14265.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #155C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]13767.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #155C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]17399.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #156C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)N1[Si](C)(C)C4250.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #156C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)N1[Si](C)(C)C3810.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #156C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)N1[Si](C)(C)C7522.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #157C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]14423.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #157C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]13839.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #157C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(O)OCC(O)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]16929.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #158C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(N)=NC1=O4292.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #158C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(N)=NC1=O3804.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #158C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(N)=NC1=O6946.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #159C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O4248.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #159C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O3847.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #159C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O7159.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #16C[Si](C)(C)OC(C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O4224.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #16C[Si](C)(C)OC(C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O3654.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #16C[Si](C)(C)OC(C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O7364.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #160C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(O)OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C4215.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #160C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(O)OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C3793.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #160C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(O)OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C7508.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #161C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]14482.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #161C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]13821.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #161C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]17380.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #162C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4337.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #162C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O3824.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #162C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O7893.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #163C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]14324.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #163C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]13791.4Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #163C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]17696.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #164C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N1[Si](C)(C)C4349.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #164C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N1[Si](C)(C)C3804.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #164C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N1[Si](C)(C)C7823.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #165C[Si](C)(C)OC(CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4503.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #165C[Si](C)(C)OC(CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O3846.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #165C[Si](C)(C)OC(CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O7234.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #166C[Si](C)(C)NC1=C(N(CC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]C(N)=NC1=O4376.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #166C[Si](C)(C)NC1=C(N(CC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]C(N)=NC1=O3812.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #166C[Si](C)(C)NC1=C(N(CC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]C(N)=NC1=O7240.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #167C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O4373.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #167C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O3850.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #167C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O7462.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #168C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4284.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #168C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O3827.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #168C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)=C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O7801.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #169C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]14491.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #169C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]13886.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #169C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]17424.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #17C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O4208.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #17C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O3710.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #17C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O7593.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #170C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4376.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #170C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O3875.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #170C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O7917.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #171C[Si](C)(C)NC1=NC(=O)C(N)=C(N(C=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]14361.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #171C[Si](C)(C)NC1=NC(=O)C(N)=C(N(C=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]13668.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #171C[Si](C)(C)NC1=NC(=O)C(N)=C(N(C=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]17695.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #172C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N1[Si](C)(C)C4344.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #172C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N1[Si](C)(C)C3843.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #172C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N1[Si](C)(C)C7839.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #173C[Si](C)(C)OC(=CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4518.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #173C[Si](C)(C)OC(=CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O3874.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #173C[Si](C)(C)OC(=CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O7280.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #174C[Si](C)(C)NC1=C(N(C=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]C(N)=NC1=O4392.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #174C[Si](C)(C)NC1=C(N(C=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]C(N)=NC1=O3674.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #174C[Si](C)(C)NC1=C(N(C=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]C(N)=NC1=O7239.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #175C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O4379.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #175C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O3843.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #175C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O7489.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #176C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4297.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #176C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O3715.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #176C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O7795.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #177C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC1=O4357.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #177C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC1=O3906.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #177C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC1=O7250.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #178C[Si](C)(C)NC1=NC(=O)C(N([Si](C)(C)C)[Si](C)(C)C)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]14420.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #178C[Si](C)(C)NC1=NC(=O)C(N([Si](C)(C)C)[Si](C)(C)C)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]13925.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #178C[Si](C)(C)NC1=NC(=O)C(N([Si](C)(C)C)[Si](C)(C)C)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]17104.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #179C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]14324.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #179C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]13886.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #179C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]17193.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #18C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C4256.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #18C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C3611.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #18C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C7372.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #180C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N[Si](C)(C)C)=NC1=O4306.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #180C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N[Si](C)(C)C)=NC1=O3907.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #180C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N[Si](C)(C)C)=NC1=O7285.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #181C[Si](C)(C)N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]14258.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #181C[Si](C)(C)N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]13836.4Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #181C[Si](C)(C)N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]17664.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #182C[Si](C)(C)N(C1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N1[Si](C)(C)C)[Si](C)(C)C4251.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #182C[Si](C)(C)N(C1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N1[Si](C)(C)C)[Si](C)(C)C3893.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #182C[Si](C)(C)N(C1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N1[Si](C)(C)C)[Si](C)(C)C7789.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #183C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)N1[Si](C)(C)C4277.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #183C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)N1[Si](C)(C)C3843.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #183C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)N1[Si](C)(C)C7567.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #184C[Si](C)(C)N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]14363.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #184C[Si](C)(C)N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]13816.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #184C[Si](C)(C)N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]17124.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #185C[Si](C)(C)N(C1=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O)[Si](C)(C)C4315.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #185C[Si](C)(C)N(C1=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O)[Si](C)(C)C3934.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #185C[Si](C)(C)N(C1=C(NCC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O)[Si](C)(C)C7336.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #186C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O4248.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #186C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O3894.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #186C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O7294.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #19C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O4308.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #19C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O3550.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #19C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O7655.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #2C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]14287.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #2C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]13572.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #2C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]17596.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #20C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O4372.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #20C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O3640.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #20C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O7644.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #21C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]14260.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #21C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]13676.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #21C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]17535.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #22C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]C(N)=NC1=O4364.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #22C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]C(N)=NC1=O3697.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #22C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]C(N)=NC1=O6970.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #23C[Si](C)(C)OC(C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O4239.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #23C[Si](C)(C)OC(C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O3663.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #23C[Si](C)(C)OC(C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O7445.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #24C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O4209.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #24C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O3720.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #24C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O7680.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #25C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4246.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #25C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3590.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #25C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C7342.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #26C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C4300.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #26C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C3534.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #26C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C7570.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #27C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C4371.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #27C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C3622.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #27C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C7560.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #28C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]14254.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #28C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]13660.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #28C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]17473.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #29C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]C(N)=NC1=O4344.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #29C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]C(N)=NC1=O3682.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #29C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]C(N)=NC1=O6928.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #3C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]14261.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #3C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]13561.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #3C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]17509.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #30C[Si](C)(C)OC(C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C4207.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #30C[Si](C)(C)OC(C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C3650.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #30C[Si](C)(C)OC(C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C7366.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #31C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C4184.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #31C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C3706.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #31C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C7595.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #32C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]14302.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #32C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]13579.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #32C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]17779.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #33C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]C(N)=NC1=O4416.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #33C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]C(N)=NC1=O3606.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #33C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]C(N)=NC1=O7223.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #34C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4240.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #34C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O3598.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #34C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O7653.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #35C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4258.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #35C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O3643.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #35C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O7887.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #36C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]14378.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #36C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]13695.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #36C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]17784.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #37C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]C(N)=NC1=O4459.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #37C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]C(N)=NC1=O3708.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #37C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]C(N)=NC1=O7249.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #38C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4323.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #38C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O3530.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #38C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O7619.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #39C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4302.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #39C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O3700.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #39C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O7869.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #4C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C4335.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #4C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C3498.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #4C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C7798.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #40C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]14368.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #40C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]13747.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #40C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]17220.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #41C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4238.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #41C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O3747.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #41C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O7740.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #42C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]14247.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #42C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]13709.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #42C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]17541.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #43C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N1[Si](C)(C)C4232.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #43C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N1[Si](C)(C)C3733.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #43C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N1[Si](C)(C)C7667.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #44C[Si](C)(C)OC(C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4396.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #44C[Si](C)(C)OC(C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O3762.4Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #44C[Si](C)(C)OC(C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O7078.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #45C[Si](C)(C)NC1=C(N(CC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]C(N)=NC1=O4283.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #45C[Si](C)(C)NC1=C(N(CC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]C(N)=NC1=O3745.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #45C[Si](C)(C)NC1=C(N(CC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]C(N)=NC1=O7084.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #46C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O4254.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #46C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O3777.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #46C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O7303.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #47C[Si](C)(C)OC(C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4204.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #47C[Si](C)(C)OC(C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O3752.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #47C[Si](C)(C)OC(C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O7648.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #48C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]14278.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #48C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]13632.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #48C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]17403.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #49C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]14266.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #49C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]13619.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #49C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]17345.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #5C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C4378.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #5C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C3602.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #5C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C7774.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #50C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C4377.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #50C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C3644.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #50C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C7590.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #51C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C4399.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #51C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C3679.4Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #51C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C7603.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #52C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]14276.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #52C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]13682.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #52C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]17505.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #53C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O4374.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #53C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O3704.4Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #53C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O6956.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #54C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C4228.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #54C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C3658.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #54C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C7397.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #55C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C4206.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #55C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C3724.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #55C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C7628.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #56C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]14269.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #56C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]13627.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #56C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]17408.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #57C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C4374.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #57C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C3652.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #57C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C7680.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #58C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C4394.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #58C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C3692.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #58C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C7693.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #59C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]14264.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #59C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]13690.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #59C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]17584.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #6C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]14273.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #6C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]13602.4Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #6C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]17701.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #60C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O4368.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #60C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O3712.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #60C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O7018.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #61C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C4246.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #61C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C3664.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #61C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C7482.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #62C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C4203.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #62C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C3732.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #62C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C7718.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #63C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]14261.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #63C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]13605.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #63C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]17378.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #64C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C4376.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #64C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3636.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #64C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C7594.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #65C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C4399.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #65C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3674.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #65C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C7608.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #66C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]14259.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #66C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]13674.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #66C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]17521.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #67C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(N)=NC1=O4352.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #67C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(N)=NC1=O3698.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #67C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(N)=NC1=O6974.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #68C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C4215.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #68C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C3652.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #68C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C7402.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #69C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C4183.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #69C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C3718.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #69C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C7633.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #7C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O4377.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #7C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O3641.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #7C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O7153.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #70C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]14384.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #70C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]13688.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #70C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]17815.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #71C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O4482.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #71C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O3712.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #71C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O7265.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #72C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C4302.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #72C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C3696.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #72C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C7679.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #73C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C4320.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #73C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C3745.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #73C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C7914.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #74C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]14404.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #74C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]13748.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #74C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]17843.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #75C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O4485.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #75C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O3759.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #75C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O7308.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #76C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C4334.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #76C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C3581.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #76C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C7668.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #77C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C4318.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #77C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C3753.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #77C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C7920.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #78C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]14373.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #78C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]13762.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #78C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]17277.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #79C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]14239.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #79C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]13758.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #79C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]17792.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #8C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O[Si](C)(C)C)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C4241.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #8C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O[Si](C)(C)C)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C3630.4Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #8C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O[Si](C)(C)C)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C7573.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #80C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]14243.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #80C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]13703.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #80C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]17589.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #81C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N1[Si](C)(C)C4233.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #81C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N1[Si](C)(C)C3741.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #81C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N1[Si](C)(C)C7719.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #82C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]14399.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #82C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]13780.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #82C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]17127.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #83C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(N)=NC1=O4286.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #83C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(N)=NC1=O3745.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #83C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(N)=NC1=O7131.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #84C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O4247.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #84C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O3788.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #84C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O7353.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #85C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C4188.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #85C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C3754.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #85C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C7689.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #86C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)O[Si](C)(C)C4272.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #86C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)O[Si](C)(C)C3691.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #86C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)O[Si](C)(C)C7223.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #87C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O4376.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #87C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O3701.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #87C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O7478.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #88C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O4377.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #88C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O3728.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #88C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O7491.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #89C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]14275.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #89C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]13771.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #89C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]17361.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #9C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C4211.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #9C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C3670.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #9C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C7808.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #90C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]C(N)=NC1=O4364.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #90C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]C(N)=NC1=O3782.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #90C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]C(N)=NC1=O6799.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #91C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O4256.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #91C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O3715.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #91C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O7289.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #92C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O4211.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #92C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O3793.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #92C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O7522.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #93C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4255.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #93C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3673.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #93C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C7231.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #94C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C4388.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #94C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C3681.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #94C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C7423.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #95C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C4392.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #95C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C3711.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #95C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C7437.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #96C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]14292.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #96C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]13752.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #96C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]17330.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #97C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]C(N)=NC1=O4356.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #97C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]C(N)=NC1=O3766.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #97C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]C(N)=NC1=O6782.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #98C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)O[Si](C)(C)C4241.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #98C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)O[Si](C)(C)C3701.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #98C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)O[Si](C)(C)C7239.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #99C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)O[Si](C)(C)C4198.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #99C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)O[Si](C)(C)C3777.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,3TMS,isomer #99C[Si](C)(C)OP(=O)(O)OP(=O)(O)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)O[Si](C)(C)C7465.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #1C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]14138.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #1C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]13555.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #1C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]17241.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #10C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C4199.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #10C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C3489.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #10C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C7482.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #100C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C4116.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #100C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C3580.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #100C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C7263.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #101C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C4158.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #101C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C3630.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #101C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C7473.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #102C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]14238.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #102C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]13673.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #102C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]17336.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #103C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]C(N)=NC1=O4306.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #103C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]C(N)=NC1=O3694.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #103C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]C(N)=NC1=O6829.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #104C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C4187.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #104C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C3500.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #104C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C7230.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #105C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C4196.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #105C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C3677.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #105C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C7453.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #106C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]14207.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #106C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]13730.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #106C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[NH]16752.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #107C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C4149.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #107C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C3736.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #107C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C7288.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #108C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]14122.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #108C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]13691.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #108C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]17125.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #109C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)N1[Si](C)(C)C4145.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #109C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)N1[Si](C)(C)C3705.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #109C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)N1[Si](C)(C)C7239.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #11C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C4244.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #11C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C3591.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #11C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C7454.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #110C[Si](C)(C)OC(C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C4273.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #110C[Si](C)(C)OC(C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C3743.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #110C[Si](C)(C)OC(C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C6661.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #111C[Si](C)(C)NC1=C(N(CC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(N)=NC1=O4162.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #111C[Si](C)(C)NC1=C(N(CC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(N)=NC1=O3726.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #111C[Si](C)(C)NC1=C(N(CC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(N)=NC1=O6696.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #112C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O4203.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #112C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O3754.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #112C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O6886.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #113C[Si](C)(C)OC(C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C4116.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #113C[Si](C)(C)OC(C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C3732.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #113C[Si](C)(C)OC(C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C7262.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #114C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]14280.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #114C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]13655.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #114C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]17049.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #115C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4186.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #115C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O3667.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #115C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O7545.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #116C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]14153.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #116C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]13641.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #116C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]17376.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #117C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N1[Si](C)(C)C4197.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #117C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N1[Si](C)(C)C3643.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #117C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N1[Si](C)(C)C7489.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #118C[Si](C)(C)OC(CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4314.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #118C[Si](C)(C)OC(CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O3690.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #118C[Si](C)(C)OC(CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O6908.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #119C[Si](C)(C)NC1=C(N(CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]C(N)=NC1=O4217.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #119C[Si](C)(C)NC1=C(N(CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]C(N)=NC1=O3663.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #119C[Si](C)(C)NC1=C(N(CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]C(N)=NC1=O6941.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #12C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]14149.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #12C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]13600.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #12C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]17331.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #120C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O4264.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #120C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O3688.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #120C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O7138.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #121C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4160.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #121C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O3681.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #121C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O7508.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #122C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]14350.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #122C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]13773.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #122C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]17080.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #123C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4254.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #123C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O3780.4Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #123C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O7551.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #124C[Si](C)(C)NC1=NC(=O)C(N)=C(N(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]14255.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #124C[Si](C)(C)NC1=NC(=O)C(N)=C(N(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]13558.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #124C[Si](C)(C)NC1=NC(=O)C(N)=C(N(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]17364.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #125C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N1[Si](C)(C)C4262.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #125C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N1[Si](C)(C)C3731.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #125C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N1[Si](C)(C)C7491.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #126C[Si](C)(C)OC(=CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4377.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #126C[Si](C)(C)OC(=CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O3779.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #126C[Si](C)(C)OC(=CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O6939.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #127C[Si](C)(C)NC1=C(N(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]C(N)=NC1=O4308.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #127C[Si](C)(C)NC1=C(N(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]C(N)=NC1=O3572.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #127C[Si](C)(C)NC1=C(N(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]C(N)=NC1=O6932.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #128C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O4306.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #128C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O3743.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #128C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O7152.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #129C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4209.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #129C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O3616.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #129C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O7479.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #13C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O4230.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #13C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O3634.4Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #13C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O6791.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #130C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC1=O4260.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #130C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC1=O3827.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #130C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC1=O6894.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #131C[Si](C)(C)NC1=NC(=O)C(N([Si](C)(C)C)[Si](C)(C)C)=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]14292.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #131C[Si](C)(C)NC1=NC(=O)C(N([Si](C)(C)C)[Si](C)(C)C)=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]13816.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #131C[Si](C)(C)NC1=NC(=O)C(N([Si](C)(C)C)[Si](C)(C)C)=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[NH]16747.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #132C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(N(CC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]14233.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #132C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(N(CC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]13800.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #132C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(N(CC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)[NH]16865.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #133C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N[Si](C)(C)C)=NC1=O4249.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #133C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N[Si](C)(C)C)=NC1=O3805.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #133C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)N([Si](C)(C)C)C(N[Si](C)(C)C)=NC1=O6935.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #134C[Si](C)(C)OC(C(=O)CN(C1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4121.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #134C[Si](C)(C)OC(C(=O)CN(C1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O3793.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #134C[Si](C)(C)OC(C(=O)CN(C1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O7329.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #135C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4152.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #135C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O3806.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #135C[Si](C)(C)OC(C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O7432.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #136C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)N1[Si](C)(C)C4194.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #136C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)N1[Si](C)(C)C3771.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #136C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)N1[Si](C)(C)C7240.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #137C[Si](C)(C)OC(C(=O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4216.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #137C[Si](C)(C)OC(C(=O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O3767.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #137C[Si](C)(C)OC(C(=O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O6816.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #138C[Si](C)(C)OC(C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)N1[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O4240.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #138C[Si](C)(C)OC(C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)N1[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O3855.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #138C[Si](C)(C)OC(C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)N1[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O7002.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #139C[Si](C)(C)NC1=C(N(CC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O4211.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #139C[Si](C)(C)NC1=C(N(CC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O3833.4Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #139C[Si](C)(C)NC1=C(N(CC(=O)C(O[Si](C)(C)C)C(O)COP(=O)(O)OP(=O)(O)OP(=O)(O)O)[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O6986.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #14C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O[Si](C)(C)C)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C4107.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #14C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O[Si](C)(C)C)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C3617.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #14C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O[Si](C)(C)C)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C7286.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #140C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]14153.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #140C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]13605.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #140C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]17070.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #141C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C4221.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #141C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C3626.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #141C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C7295.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #142C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C4250.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #142C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C3672.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #142C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C7294.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #143C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]14149.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #143C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]13669.4Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #143C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]17140.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #144C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O4204.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #144C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O3690.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #144C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O6596.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #145C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C4099.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #145C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C3649.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #145C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C7117.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #146C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C4109.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #146C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C3708.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #146C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C7331.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #147C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]14154.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #147C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]13580.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #147C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]17083.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #148C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C4216.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #148C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3610.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #148C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C7249.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #149C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C4250.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #149C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3658.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #149C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C7248.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #15C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C4120.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #15C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C3654.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #15C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C7503.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #150C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]14149.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #150C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]13654.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #150C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]17118.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #151C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(N)=NC1=O4184.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #151C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(N)=NC1=O3676.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #151C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(N)=NC1=O6593.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #152C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C4083.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #152C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C3634.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #152C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C7074.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #153C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C4098.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #153C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C3694.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #153C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C7283.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #154C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]14233.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #154C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]13666.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #154C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]17358.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #155C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O4319.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #155C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O3693.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #155C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O6837.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #156C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C4162.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #156C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C3668.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #156C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C7289.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #157C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C4205.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #157C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C3717.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #157C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C7500.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #158C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]14279.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #158C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]13736.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #158C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]17372.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #159C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O4363.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #159C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O3753.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #159C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O6865.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #16C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]14125.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #16C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]13525.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #16C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]17214.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #160C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C4218.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #160C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C3563.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #160C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C7268.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #161C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C4236.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #161C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C3739.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #161C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C7494.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #162C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]14232.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #162C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]13750.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #162C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]16768.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #163C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]14140.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #163C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]13751.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #163C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]17315.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #164C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]14133.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #164C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]13691.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #164C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]17150.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #165C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N1[Si](C)(C)C4163.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #165C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N1[Si](C)(C)C3715.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #165C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N1[Si](C)(C)C7265.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #166C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]14268.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #166C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]13767.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #166C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]16684.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #167C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(N)=NC1=O4187.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #167C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(N)=NC1=O3728.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #167C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(N)=NC1=O6719.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #168C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O4209.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #168C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O3764.4Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #168C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O6912.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #169C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C4113.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #169C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C3734.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #169C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C7293.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #17C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C4181.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #17C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3480.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #17C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C7406.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #170C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]14154.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #170C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]13585.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #170C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]17106.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #171C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C4215.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #171C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3617.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #171C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C7300.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #172C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C4241.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #172C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3666.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #172C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C7298.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #173C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]14140.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #173C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]13663.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #173C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]17159.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #174C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(N)=NC1=O4189.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #174C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(N)=NC1=O3686.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #174C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(N)=NC1=O6618.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #175C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C4089.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #175C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C3642.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #175C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C7121.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #176C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C4100.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #176C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C3702.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #176C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C7334.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #177C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]14217.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #177C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]13673.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #177C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]17420.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #178C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O4305.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #178C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O3700.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #178C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O6882.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #179C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C4161.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #179C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C3676.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #179C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C7361.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #18C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C4224.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #18C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3580.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #18C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C7379.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #180C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C4198.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #180C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C3724.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #180C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C7576.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #181C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]14266.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #181C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]13747.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #181C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]17437.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #182C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O4350.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #182C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O3764.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #182C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O6913.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #183C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C4225.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #183C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C3572.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #183C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C7339.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #184C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C4226.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #184C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C3750.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #184C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C7570.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #185C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]14226.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #185C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]13755.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #185C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[NH]16772.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #186C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]14134.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #186C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]13756.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #186C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]17375.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #187C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]14129.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #187C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]13696.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #187C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]17207.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #188C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)N1[Si](C)(C)C4156.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #188C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)N1[Si](C)(C)C3720.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #188C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)N1[Si](C)(C)C7323.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #189C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]14276.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #189C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]13776.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #189C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]16717.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #19C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]14132.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #19C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]13588.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #19C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]17281.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #190C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(N)=NC1=O4193.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #190C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(N)=NC1=O3734.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #190C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(N)=NC1=O6757.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #191C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O4205.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #191C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O3770.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #191C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O6959.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #192C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C4116.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #192C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C3741.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #192C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C7366.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #193C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C4214.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #193C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3598.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #193C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C7274.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #194C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C4247.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #194C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C3649.4Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #194C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C7273.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #195C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]14152.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #195C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]13638.4Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #195C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]17137.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #196C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(N)=NC1=O4186.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #196C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(N)=NC1=O3662.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #196C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(N)=NC1=O6613.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #197C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C4084.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #197C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C3622.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #197C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C7098.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #198C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C4101.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #198C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C3681.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #198C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C7307.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #199C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]14219.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #199C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]13660.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #199C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]17370.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #2C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]14124.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #2C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]13541.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #2C[Si](C)(C)OC(COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]17193.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #20C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(N)=NC1=O4198.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #20C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(N)=NC1=O3623.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #20C[Si](C)(C)NC1=C(NCC(=O)C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(N)=NC1=O6761.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #200C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(N)=NC1=O4294.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #200C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(N)=NC1=O3689.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #200C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(N)=NC1=O6849.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #201C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C4154.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #201C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3663.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #201C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C7292.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #202C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C4190.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #202C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3713.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #202C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C7503.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #203C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]14265.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #203C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]13731.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #203C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]17386.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #204C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(N)=NC1=O4338.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #204C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(N)=NC1=O3750.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #204C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]C(N)=NC1=O6878.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #205C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C4209.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #205C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3560.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #205C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C7271.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #206C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C4216.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #206C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C3736.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #206C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C7497.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #207C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]14204.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #207C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]13747.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #207C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[NH]16797.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #208C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]14134.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #208C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]13747.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #208C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]17328.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #209C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]14114.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #209C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]13687.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #209C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]17164.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #21C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C4075.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #21C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C3608.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #21C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C7215.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #210C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N1[Si](C)(C)C4141.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #210C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N1[Si](C)(C)C3713.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #210C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N1[Si](C)(C)C7279.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #211C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]14261.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #211C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]13761.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #211C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]16699.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #212C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(N)=NC1=O4168.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #212C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(N)=NC1=O3727.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #212C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(N)=NC1=O6733.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #213C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O4194.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #213C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O3763.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #213C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)O[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O6925.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #214C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C4098.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #214C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C3732.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #214C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C7295.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #215C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]14346.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #215C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]13751.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #215C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]17101.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #216C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C4232.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #216C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C3759.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #216C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C7586.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #217C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]14208.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #217C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]13725.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #217C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]17419.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #218C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N1[Si](C)(C)C4260.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #218C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N1[Si](C)(C)C3730.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #218C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N1[Si](C)(C)C7533.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #219C[Si](C)(C)OC(CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C4361.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #219C[Si](C)(C)OC(CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C3790.4Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #219C[Si](C)(C)OC(CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C6954.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #22C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C4100.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #22C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C3645.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #22C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O[Si](C)(C)C)C(O[Si](C)(C)C)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C7428.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #220C[Si](C)(C)NC1=C(N(CC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(N)=NC1=O4266.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #220C[Si](C)(C)NC1=C(N(CC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(N)=NC1=O3747.4Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #220C[Si](C)(C)NC1=C(N(CC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(N)=NC1=O6986.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #221C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O4319.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #221C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O3779.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #221C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O7185.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #222C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C4198.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #222C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C3762.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #222C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)=C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C7537.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #223C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]14378.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #223C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]13833.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #223C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]17137.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #224C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C4280.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #224C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C3838.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #224C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C7601.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #225C[Si](C)(C)NC1=NC(=O)C(N)=C(N(C=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]14272.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #225C[Si](C)(C)NC1=NC(=O)C(N)=C(N(C=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]13615.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #225C[Si](C)(C)NC1=NC(=O)C(N)=C(N(C=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]17411.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #226C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N1[Si](C)(C)C4278.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #226C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N1[Si](C)(C)C3793.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #226C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N1[Si](C)(C)C7541.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #227C[Si](C)(C)OC(=CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C4410.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #227C[Si](C)(C)OC(=CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C3836.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #227C[Si](C)(C)OC(=CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C6989.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #228C[Si](C)(C)NC1=C(N(C=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(N)=NC1=O4327.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #228C[Si](C)(C)NC1=C(N(C=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(N)=NC1=O3628.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #228C[Si](C)(C)NC1=C(N(C=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]C(N)=NC1=O6979.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #229C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O4325.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #229C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O3803.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #229C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O7203.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #23C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]14220.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #23C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]13525.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #23C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]17536.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #230C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C4219.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #230C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C3673.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #230C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C7521.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #231C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC1=O4264.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #231C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC1=O3839.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #231C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N([Si](C)(C)C)[Si](C)(C)C)=NC1=O6942.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #232C[Si](C)(C)NC1=NC(=O)C(N([Si](C)(C)C)[Si](C)(C)C)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]14290.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #232C[Si](C)(C)NC1=NC(=O)C(N([Si](C)(C)C)[Si](C)(C)C)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]13833.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #232C[Si](C)(C)NC1=NC(=O)C(N([Si](C)(C)C)[Si](C)(C)C)=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]16796.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #233C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]14231.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #233C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]13791.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #233C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)[NH]16911.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #234C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(N[Si](C)(C)C)=NC1=O4246.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #234C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(N[Si](C)(C)C)=NC1=O3814.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #234C[Si](C)(C)NC1=C(NCC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)N([Si](C)(C)C)C(N[Si](C)(C)C)=NC1=O6987.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #235C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)[Si](C)(C)C4120.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #235C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)[Si](C)(C)C3789.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #235C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)[Si](C)(C)C7369.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #236C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C4154.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #236C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C3812.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #236C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C7474.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #237C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C4177.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #237C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C3764.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #237C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N1[Si](C)(C)C7282.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #238C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)[Si](C)(C)C4215.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #238C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)[Si](C)(C)C3766.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #238C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CN(C1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)[Si](C)(C)C6855.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #239C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)N1[Si](C)(C)C4223.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #239C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)N1[Si](C)(C)C3866.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #239C[Si](C)(C)OC(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)N1[Si](C)(C)C7044.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #24C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O4304.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #24C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O3560.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #24C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[NH]C(N)=NC1=O7010.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #240C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O4195.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #240C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O3831.4Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #240C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C(N)=NC1=O7027.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #241C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4173.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #241C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3648.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #241C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)[NH]1)OP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C6946.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #242C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C4238.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #242C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C3660.4Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #242C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C7133.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #243C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C4257.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #243C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C3700.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #243C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C7132.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #244C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)[NH]14172.6Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #244C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)[NH]13740.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #244C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)[NH]16970.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #245C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)[NH]C(N)=NC1=O4211.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #245C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)[NH]C(N)=NC1=O3747.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #245C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O[Si](C)(C)C)[NH]C(N)=NC1=O6428.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #246C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)O[Si](C)(C)C4111.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #246C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)O[Si](C)(C)C3685.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #246C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)O[Si](C)(C)C6957.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #247C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)O[Si](C)(C)C4111.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #247C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)O[Si](C)(C)C3758.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #247C[Si](C)(C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)O[Si](C)(C)C7170.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #248C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]14218.5Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #248C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]13729.4Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #248C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]17224.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #249C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]C(N)=NC1=O4314.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #249C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]C(N)=NC1=O3749.5Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #249C[Si](C)(C)NC1=C(NCC(O[Si](C)(C)C)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]C(N)=NC1=O6687.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #25C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C4151.3Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #25C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C3549.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #25C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C7455.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #250C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O4161.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #250C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O3714.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #250C[Si](C)(C)OC(CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O7189.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #251C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O4198.0Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #251C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O3769.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #251C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O7400.8Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #252C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]14255.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #252C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]13789.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #252C[Si](C)(C)NC1=NC(=O)C(N)=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]17239.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #253C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]C(N)=NC1=O4348.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #253C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]C(N)=NC1=O3795.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #253C[Si](C)(C)NC1=C(NC=C(O[Si](C)(C)C)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]C(N)=NC1=O6716.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #254C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O4215.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #254C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O3590.7Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #254C[Si](C)(C)OC(=CN(C1=C(N)C(=O)N=C(N)[NH]1)[Si](C)(C)C)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O7169.3Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #255C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O4209.4Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #255C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O3776.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #255C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O7394.9Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #256C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]14232.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #256C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]13838.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #256C[Si](C)(C)NC1=NC(=O)C(N[Si](C)(C)C)=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[NH]16535.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #257C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O4144.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #257C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O3832.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #257C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N)C(=O)N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]1)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O7183.5Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #258C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[Si](C)(C)C)[NH]14150.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #258C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[Si](C)(C)C)[NH]13757.6Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #258C[Si](C)(C)NC1=NC(=O)C(N)=C(N(CC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[Si](C)(C)C)[NH]17022.2Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #259C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)N1[Si](C)(C)C4173.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #259C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)N1[Si](C)(C)C3795.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #259C[Si](C)(C)NC1=NC(=O)C(N)=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)N1[Si](C)(C)C7134.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #26C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C4188.1Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #26C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C3591.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #26C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)=C(O[Si](C)(C)C)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[Si](C)(C)C7669.1Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #260C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O4292.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #260C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O3847.3Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #260C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CNC1=C(N([Si](C)(C)C)[Si](C)(C)C)C(=O)N=C(N)[NH]1)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O6522.6Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #261C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[Si](C)(C)C)[NH]C(N)=NC1=O4199.8Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #261C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[Si](C)(C)C)[NH]C(N)=NC1=O3791.9Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #261C[Si](C)(C)NC1=C(N(CC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)[Si](C)(C)C)[NH]C(N)=NC1=O6570.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #262C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O4199.2Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #262C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O3834.2Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #262C[Si](C)(C)NC1=C(NCC(=O)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O)N([Si](C)(C)C)C(N)=NC1=O6766.0Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #263C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O4128.9Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #263C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O3786.0Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #263C[Si](C)(C)OP(=O)(OCC(O)C(O)C(=O)CN(C1=C(N)C(=O)N=C(N)N1[Si](C)(C)C)[Si](C)(C)C)OP(=O)(O[Si](C)(C)C)OP(=O)(O)O7195.4Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #264C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4234.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #264C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3639.1Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #264C[Si](C)(C)OC(CNC1=C(N)C(=O)N=C(N)[NH]1)=C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C7144.7Standard polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #265C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C4259.7Semi standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #265C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3680.8Standard non polar33892256
2,5-Diamino-6-(5'-triphosphoryl-3',4'-trihydroxy-2'-oxopentyl)-amino-4-oxopyrimidine,4TMS,isomer #265C[Si](C)(C)OC(=CNC1=C(N)C(=O)N=C(N)[NH]1)C(O)C(O)COP(=O)(O[Si](C)(C)C)OP(=O)(O)OP(=O)(O[Si](C)(C)C)O[Si](C)(C)C7143.9Standard polar