Hmdb loader
You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Human Metabolome Database.
Record Information
Version5.0
StatusExpected but not Quantified
Creation Date2008-08-13 15:55:03 UTC
Update Date2021-09-14 15:44:46 UTC
HMDB IDHMDB0006857
Secondary Accession Numbers
  • HMDB06857
Metabolite Identification
Common NameDextrin
DescriptionDextrin, derived from dextrose (glucose), is a low-molecular-weight polysaccharide produced from the hydrolysis of starch or glycogen using enzymes such as amylases or via malting/mashing. Dextrin or dextrins are mixtures of polymers of D-glucose units linked by α-(1→4) or α-(1→6) glycosidic bonds. Dextrin is used in adhesives and sizing agents for the textile and paper industry. It is also used in many glue products due to its adhesive properties. Three forms of dextrins are now available; white dextrins, yellow (or canary) dextrins, and British gums (PMID: 19215668 ). Yellow dextrins are used s water-soluble glues and as printing thickeners or binders in paint. White dextrins are used as crispness enhancers in food batters, coatings and glazes. White dextrin is also used as a thickening and binding agent in pharmaceuticals and paper coatings. Dextrin is considered a prebiotic as it promotes healthy intestinal flora (PMID: 22429361 ). Dextrin has been reported to help maintain healthy cholesterol levels by reducing triglycerides (PMID: 16457989 ). Moreover, it eliminates wastes from the body through increased bowel movement frequency (PMID: 23326148 ). Dextrin can be used in combination with other dietary fibers to reduce the glycemic load of a meal, thereby helping to maintain healthy blood sugar levels (PMID: 19126874 , 25024710 ).
Structure
Data?1582752410
Synonyms
ValueSource
British gumHMDB
CaloreenHMDB
Corn dextrinHMDB
Crystal gumHMDB
DextridHMDB
Dextrina biancaHMDB
DextrineHMDB
DextrinsHMDB
FortodexHMDB
Chemical FormulaC18H32O16
Average Molecular Weight504.4371
Monoisotopic Molecular Weight504.169034976
IUPAC Name(3R,4S,5S,6R)-2-{[(2R,3S,4R,5R)-4,5-dihydroxy-2-(hydroxymethyl)-6-{[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}oxan-3-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol
Traditional Namemicrocrystalline cellulose
CAS Registry Number9004-53-9
SMILES
OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O)C(O[C@H]3[C@H](O)[C@@H](O)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O
InChI Identifier
InChI=1S/C18H32O16/c19-1-4-7(22)8(23)12(27)17(31-4)34-15-6(3-21)32-18(13(28)10(15)25)33-14-5(2-20)30-16(29)11(26)9(14)24/h4-29H,1-3H2/t4-,5-,6-,7-,8+,9-,10-,11-,12-,13-,14-,15-,16+,17?,18?/m1/s1
InChI KeyFYGDTMLNYKFZSV-MRCIVHHJSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as oligosaccharides. These are carbohydrates made up of 3 to 10 monosaccharide units linked to each other through glycosidic bonds.
KingdomOrganic compounds
Super ClassOrganic oxygen compounds
ClassOrganooxygen compounds
Sub ClassCarbohydrates and carbohydrate conjugates
Direct ParentOligosaccharides
Alternative Parents
Substituents
  • Oligosaccharide
  • O-glycosyl compound
  • Glycosyl compound
  • Oxane
  • Secondary alcohol
  • Hemiacetal
  • Oxacycle
  • Organoheterocyclic compound
  • Polyol
  • Acetal
  • Hydrocarbon derivative
  • Primary alcohol
  • Alcohol
  • Aliphatic heteromonocyclic compound
Molecular FrameworkAliphatic heteromonocyclic compounds
External DescriptorsNot Available
Ontology
Disposition

Source

Route of exposure

Process

Naturally occurring process

Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water SolubilityNot AvailableNot Available
LogPNot AvailableNot Available
Experimental Chromatographic PropertiesNot Available
Predicted Molecular Properties
PropertyValueSource
Water Solubility554 g/LALOGPS
logP10(-2.7) g/LALOGPS
logP10(-6.5) g/LChemAxon
logS10(0.04) g/LALOGPS
pKa (Strongest Acidic)11.22ChemAxon
pKa (Strongest Basic)-3.6ChemAxon
Physiological Charge0ChemAxon
Hydrogen Acceptor Count16ChemAxon
Hydrogen Donor Count11ChemAxon
Polar Surface Area268.68 ŲChemAxon
Rotatable Bond Count7ChemAxon
Refractivity100.75 m³·mol⁻¹ChemAxon
Polarizability46.19 ųChemAxon
Number of Rings3ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleYesChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DeepCCS[M+H]+202.48930932474
DeepCCS[M-H]-200.64330932474

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
DextrinOC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O)C(O[C@H]3[C@H](O)[C@@H](O)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3426.2Standard polar33892256
DextrinOC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O)C(O[C@H]3[C@H](O)[C@@H](O)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O4153.2Standard non polar33892256
DextrinOC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O)C(O[C@H]3[C@H](O)[C@@H](O)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O4212.4Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
Dextrin,1TMS,isomer #1C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3976.6Semi standard non polar33892256
Dextrin,1TMS,isomer #10C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3978.6Semi standard non polar33892256
Dextrin,1TMS,isomer #11C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3981.4Semi standard non polar33892256
Dextrin,1TMS,isomer #2C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3976.7Semi standard non polar33892256
Dextrin,1TMS,isomer #3C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O4016.4Semi standard non polar33892256
Dextrin,1TMS,isomer #4C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3975.6Semi standard non polar33892256
Dextrin,1TMS,isomer #5C[Si](C)(C)O[C@H]1[C@@H](O)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@@H]1O3974.0Semi standard non polar33892256
Dextrin,1TMS,isomer #6C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3997.9Semi standard non polar33892256
Dextrin,1TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3992.7Semi standard non polar33892256
Dextrin,1TMS,isomer #8C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3977.5Semi standard non polar33892256
Dextrin,1TMS,isomer #9C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4026.5Semi standard non polar33892256
Dextrin,2TMS,isomer #1C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3914.4Semi standard non polar33892256
Dextrin,2TMS,isomer #10C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3924.9Semi standard non polar33892256
Dextrin,2TMS,isomer #11C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3936.0Semi standard non polar33892256
Dextrin,2TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3910.9Semi standard non polar33892256
Dextrin,2TMS,isomer #13C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3913.4Semi standard non polar33892256
Dextrin,2TMS,isomer #14C[Si](C)(C)O[C@H]1[C@@H](O)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3891.4Semi standard non polar33892256
Dextrin,2TMS,isomer #15C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3884.5Semi standard non polar33892256
Dextrin,2TMS,isomer #16C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3899.0Semi standard non polar33892256
Dextrin,2TMS,isomer #17C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3902.5Semi standard non polar33892256
Dextrin,2TMS,isomer #18C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3893.6Semi standard non polar33892256
Dextrin,2TMS,isomer #19C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3929.6Semi standard non polar33892256
Dextrin,2TMS,isomer #2C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3926.1Semi standard non polar33892256
Dextrin,2TMS,isomer #20C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3942.9Semi standard non polar33892256
Dextrin,2TMS,isomer #21C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3948.2Semi standard non polar33892256
Dextrin,2TMS,isomer #22C[Si](C)(C)O[C@H]1C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3927.5Semi standard non polar33892256
Dextrin,2TMS,isomer #23C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3920.1Semi standard non polar33892256
Dextrin,2TMS,isomer #24C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3933.0Semi standard non polar33892256
Dextrin,2TMS,isomer #25C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@H]1O3937.4Semi standard non polar33892256
Dextrin,2TMS,isomer #26C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@H]1O3927.7Semi standard non polar33892256
Dextrin,2TMS,isomer #27C[Si](C)(C)O[C@H]1C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@@H](O)[C@@H]1O3971.2Semi standard non polar33892256
Dextrin,2TMS,isomer #28C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3902.2Semi standard non polar33892256
Dextrin,2TMS,isomer #29C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3896.6Semi standard non polar33892256
Dextrin,2TMS,isomer #3C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3924.3Semi standard non polar33892256
Dextrin,2TMS,isomer #30C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3908.3Semi standard non polar33892256
Dextrin,2TMS,isomer #31C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3892.6Semi standard non polar33892256
Dextrin,2TMS,isomer #32C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3899.0Semi standard non polar33892256
Dextrin,2TMS,isomer #33C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3894.8Semi standard non polar33892256
Dextrin,2TMS,isomer #34C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3929.5Semi standard non polar33892256
Dextrin,2TMS,isomer #35C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3913.4Semi standard non polar33892256
Dextrin,2TMS,isomer #36C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3916.9Semi standard non polar33892256
Dextrin,2TMS,isomer #37C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3903.4Semi standard non polar33892256
Dextrin,2TMS,isomer #38C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3906.9Semi standard non polar33892256
Dextrin,2TMS,isomer #39C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3902.3Semi standard non polar33892256
Dextrin,2TMS,isomer #4C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3905.1Semi standard non polar33892256
Dextrin,2TMS,isomer #40C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3938.4Semi standard non polar33892256
Dextrin,2TMS,isomer #41C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3927.6Semi standard non polar33892256
Dextrin,2TMS,isomer #42C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3922.4Semi standard non polar33892256
Dextrin,2TMS,isomer #43C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3930.1Semi standard non polar33892256
Dextrin,2TMS,isomer #44C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3927.8Semi standard non polar33892256
Dextrin,2TMS,isomer #45C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3959.3Semi standard non polar33892256
Dextrin,2TMS,isomer #46C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3923.0Semi standard non polar33892256
Dextrin,2TMS,isomer #47C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3926.8Semi standard non polar33892256
Dextrin,2TMS,isomer #48C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3921.3Semi standard non polar33892256
Dextrin,2TMS,isomer #49C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3952.9Semi standard non polar33892256
Dextrin,2TMS,isomer #5C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3895.0Semi standard non polar33892256
Dextrin,2TMS,isomer #50C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3914.7Semi standard non polar33892256
Dextrin,2TMS,isomer #51C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3904.5Semi standard non polar33892256
Dextrin,2TMS,isomer #52C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3938.3Semi standard non polar33892256
Dextrin,2TMS,isomer #53C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@@H]1CO3937.7Semi standard non polar33892256
Dextrin,2TMS,isomer #54C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3942.4Semi standard non polar33892256
Dextrin,2TMS,isomer #55C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3916.7Semi standard non polar33892256
Dextrin,2TMS,isomer #6C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3933.4Semi standard non polar33892256
Dextrin,2TMS,isomer #7C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3900.7Semi standard non polar33892256
Dextrin,2TMS,isomer #8C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3948.0Semi standard non polar33892256
Dextrin,2TMS,isomer #9C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3910.8Semi standard non polar33892256
Dextrin,3TMS,isomer #1C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3800.6Semi standard non polar33892256
Dextrin,3TMS,isomer #10C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3821.5Semi standard non polar33892256
Dextrin,3TMS,isomer #100C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3830.9Semi standard non polar33892256
Dextrin,3TMS,isomer #101C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@H]1O3850.8Semi standard non polar33892256
Dextrin,3TMS,isomer #102C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@H]1O3839.6Semi standard non polar33892256
Dextrin,3TMS,isomer #103C[Si](C)(C)O[C@H]1C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@@H](O)[C@@H]1O3870.4Semi standard non polar33892256
Dextrin,3TMS,isomer #104C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3865.6Semi standard non polar33892256
Dextrin,3TMS,isomer #105C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3847.0Semi standard non polar33892256
Dextrin,3TMS,isomer #106C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3888.3Semi standard non polar33892256
Dextrin,3TMS,isomer #107C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@@H]1CO3892.4Semi standard non polar33892256
Dextrin,3TMS,isomer #108C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3871.1Semi standard non polar33892256
Dextrin,3TMS,isomer #109C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@H]1O3889.0Semi standard non polar33892256
Dextrin,3TMS,isomer #11C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3816.4Semi standard non polar33892256
Dextrin,3TMS,isomer #110C[Si](C)(C)O[C@H]1[C@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3833.4Semi standard non polar33892256
Dextrin,3TMS,isomer #111C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3834.8Semi standard non polar33892256
Dextrin,3TMS,isomer #112C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3810.0Semi standard non polar33892256
Dextrin,3TMS,isomer #113C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3842.0Semi standard non polar33892256
Dextrin,3TMS,isomer #114C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3833.3Semi standard non polar33892256
Dextrin,3TMS,isomer #115C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3864.2Semi standard non polar33892256
Dextrin,3TMS,isomer #116C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3806.7Semi standard non polar33892256
Dextrin,3TMS,isomer #117C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3802.8Semi standard non polar33892256
Dextrin,3TMS,isomer #118C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3833.7Semi standard non polar33892256
Dextrin,3TMS,isomer #119C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3827.6Semi standard non polar33892256
Dextrin,3TMS,isomer #12C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3791.2Semi standard non polar33892256
Dextrin,3TMS,isomer #120C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3856.4Semi standard non polar33892256
Dextrin,3TMS,isomer #121C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3788.2Semi standard non polar33892256
Dextrin,3TMS,isomer #122C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3829.7Semi standard non polar33892256
Dextrin,3TMS,isomer #123C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3817.4Semi standard non polar33892256
Dextrin,3TMS,isomer #124C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3861.2Semi standard non polar33892256
Dextrin,3TMS,isomer #125C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3818.1Semi standard non polar33892256
Dextrin,3TMS,isomer #126C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3805.3Semi standard non polar33892256
Dextrin,3TMS,isomer #127C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3845.0Semi standard non polar33892256
Dextrin,3TMS,isomer #128C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1CO3855.8Semi standard non polar33892256
Dextrin,3TMS,isomer #129C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3832.9Semi standard non polar33892256
Dextrin,3TMS,isomer #13C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3856.0Semi standard non polar33892256
Dextrin,3TMS,isomer #130C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3851.0Semi standard non polar33892256
Dextrin,3TMS,isomer #131C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3821.6Semi standard non polar33892256
Dextrin,3TMS,isomer #132C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3820.6Semi standard non polar33892256
Dextrin,3TMS,isomer #133C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3854.7Semi standard non polar33892256
Dextrin,3TMS,isomer #134C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3848.5Semi standard non polar33892256
Dextrin,3TMS,isomer #135C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3877.1Semi standard non polar33892256
Dextrin,3TMS,isomer #136C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3809.3Semi standard non polar33892256
Dextrin,3TMS,isomer #137C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3848.6Semi standard non polar33892256
Dextrin,3TMS,isomer #138C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3835.8Semi standard non polar33892256
Dextrin,3TMS,isomer #139C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3874.4Semi standard non polar33892256
Dextrin,3TMS,isomer #14C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3803.2Semi standard non polar33892256
Dextrin,3TMS,isomer #140C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3833.7Semi standard non polar33892256
Dextrin,3TMS,isomer #141C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3820.3Semi standard non polar33892256
Dextrin,3TMS,isomer #142C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3857.0Semi standard non polar33892256
Dextrin,3TMS,isomer #143C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@@H]1CO3869.8Semi standard non polar33892256
Dextrin,3TMS,isomer #144C[Si](C)(C)O[C@H]1[C@@H](O)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O)[C@H]2O)[C@@H]1O3848.2Semi standard non polar33892256
Dextrin,3TMS,isomer #145C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3864.7Semi standard non polar33892256
Dextrin,3TMS,isomer #146C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3816.0Semi standard non polar33892256
Dextrin,3TMS,isomer #147C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3857.1Semi standard non polar33892256
Dextrin,3TMS,isomer #148C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3845.6Semi standard non polar33892256
Dextrin,3TMS,isomer #149C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3886.9Semi standard non polar33892256
Dextrin,3TMS,isomer #15C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3875.8Semi standard non polar33892256
Dextrin,3TMS,isomer #150C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3849.1Semi standard non polar33892256
Dextrin,3TMS,isomer #151C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3835.1Semi standard non polar33892256
Dextrin,3TMS,isomer #152C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3875.6Semi standard non polar33892256
Dextrin,3TMS,isomer #153C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@@H]1CO3884.1Semi standard non polar33892256
Dextrin,3TMS,isomer #154C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3861.0Semi standard non polar33892256
Dextrin,3TMS,isomer #155C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3879.5Semi standard non polar33892256
Dextrin,3TMS,isomer #156C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3828.4Semi standard non polar33892256
Dextrin,3TMS,isomer #157C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3812.3Semi standard non polar33892256
Dextrin,3TMS,isomer #158C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3869.2Semi standard non polar33892256
Dextrin,3TMS,isomer #159C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3845.3Semi standard non polar33892256
Dextrin,3TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3814.7Semi standard non polar33892256
Dextrin,3TMS,isomer #160C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3877.4Semi standard non polar33892256
Dextrin,3TMS,isomer #161C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3869.8Semi standard non polar33892256
Dextrin,3TMS,isomer #162C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3831.8Semi standard non polar33892256
Dextrin,3TMS,isomer #163C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3864.1Semi standard non polar33892256
Dextrin,3TMS,isomer #164C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3853.8Semi standard non polar33892256
Dextrin,3TMS,isomer #165C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O[Si](C)(C)C3876.2Semi standard non polar33892256
Dextrin,3TMS,isomer #17C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3835.6Semi standard non polar33892256
Dextrin,3TMS,isomer #18C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3826.7Semi standard non polar33892256
Dextrin,3TMS,isomer #19C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3808.1Semi standard non polar33892256
Dextrin,3TMS,isomer #2C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3813.6Semi standard non polar33892256
Dextrin,3TMS,isomer #20C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3864.3Semi standard non polar33892256
Dextrin,3TMS,isomer #21C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3823.8Semi standard non polar33892256
Dextrin,3TMS,isomer #22C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3884.3Semi standard non polar33892256
Dextrin,3TMS,isomer #23C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3836.7Semi standard non polar33892256
Dextrin,3TMS,isomer #24C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3852.6Semi standard non polar33892256
Dextrin,3TMS,isomer #25C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3814.9Semi standard non polar33892256
Dextrin,3TMS,isomer #26C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3847.7Semi standard non polar33892256
Dextrin,3TMS,isomer #27C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3809.9Semi standard non polar33892256
Dextrin,3TMS,isomer #28C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3867.6Semi standard non polar33892256
Dextrin,3TMS,isomer #29C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3821.9Semi standard non polar33892256
Dextrin,3TMS,isomer #3C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3792.0Semi standard non polar33892256
Dextrin,3TMS,isomer #30C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3835.9Semi standard non polar33892256
Dextrin,3TMS,isomer #31C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3830.7Semi standard non polar33892256
Dextrin,3TMS,isomer #32C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3793.6Semi standard non polar33892256
Dextrin,3TMS,isomer #33C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3852.9Semi standard non polar33892256
Dextrin,3TMS,isomer #34C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3807.6Semi standard non polar33892256
Dextrin,3TMS,isomer #35C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3819.5Semi standard non polar33892256
Dextrin,3TMS,isomer #36C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3852.0Semi standard non polar33892256
Dextrin,3TMS,isomer #37C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3894.1Semi standard non polar33892256
Dextrin,3TMS,isomer #38C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3850.4Semi standard non polar33892256
Dextrin,3TMS,isomer #39C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3871.3Semi standard non polar33892256
Dextrin,3TMS,isomer #4C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3780.0Semi standard non polar33892256
Dextrin,3TMS,isomer #40C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3858.5Semi standard non polar33892256
Dextrin,3TMS,isomer #41C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3812.2Semi standard non polar33892256
Dextrin,3TMS,isomer #42C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3832.5Semi standard non polar33892256
Dextrin,3TMS,isomer #43C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3870.6Semi standard non polar33892256
Dextrin,3TMS,isomer #44C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3879.4Semi standard non polar33892256
Dextrin,3TMS,isomer #45C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3842.8Semi standard non polar33892256
Dextrin,3TMS,isomer #46C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3857.4Semi standard non polar33892256
Dextrin,3TMS,isomer #47C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3863.5Semi standard non polar33892256
Dextrin,3TMS,isomer #48C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3851.5Semi standard non polar33892256
Dextrin,3TMS,isomer #49C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3836.2Semi standard non polar33892256
Dextrin,3TMS,isomer #5C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3846.3Semi standard non polar33892256
Dextrin,3TMS,isomer #50C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3852.9Semi standard non polar33892256
Dextrin,3TMS,isomer #51C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@H]1O3868.4Semi standard non polar33892256
Dextrin,3TMS,isomer #52C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@H]1O3856.2Semi standard non polar33892256
Dextrin,3TMS,isomer #53C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3888.8Semi standard non polar33892256
Dextrin,3TMS,isomer #54C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3824.5Semi standard non polar33892256
Dextrin,3TMS,isomer #55C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3818.4Semi standard non polar33892256
Dextrin,3TMS,isomer #56C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3803.4Semi standard non polar33892256
Dextrin,3TMS,isomer #57C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3788.9Semi standard non polar33892256
Dextrin,3TMS,isomer #58C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3838.9Semi standard non polar33892256
Dextrin,3TMS,isomer #59C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3822.5Semi standard non polar33892256
Dextrin,3TMS,isomer #6C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3780.6Semi standard non polar33892256
Dextrin,3TMS,isomer #60C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3862.2Semi standard non polar33892256
Dextrin,3TMS,isomer #61C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3813.8Semi standard non polar33892256
Dextrin,3TMS,isomer #62C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3849.4Semi standard non polar33892256
Dextrin,3TMS,isomer #63C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3842.7Semi standard non polar33892256
Dextrin,3TMS,isomer #64C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3870.0Semi standard non polar33892256
Dextrin,3TMS,isomer #65C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3808.5Semi standard non polar33892256
Dextrin,3TMS,isomer #66C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3829.4Semi standard non polar33892256
Dextrin,3TMS,isomer #67C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3796.9Semi standard non polar33892256
Dextrin,3TMS,isomer #68C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3837.1Semi standard non polar33892256
Dextrin,3TMS,isomer #69C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3828.5Semi standard non polar33892256
Dextrin,3TMS,isomer #7C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3861.2Semi standard non polar33892256
Dextrin,3TMS,isomer #70C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3854.0Semi standard non polar33892256
Dextrin,3TMS,isomer #71C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3819.9Semi standard non polar33892256
Dextrin,3TMS,isomer #72C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3786.8Semi standard non polar33892256
Dextrin,3TMS,isomer #73C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3822.4Semi standard non polar33892256
Dextrin,3TMS,isomer #74C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3812.8Semi standard non polar33892256
Dextrin,3TMS,isomer #75C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3840.4Semi standard non polar33892256
Dextrin,3TMS,isomer #76C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3827.1Semi standard non polar33892256
Dextrin,3TMS,isomer #77C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3806.6Semi standard non polar33892256
Dextrin,3TMS,isomer #78C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3849.8Semi standard non polar33892256
Dextrin,3TMS,isomer #79C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3862.6Semi standard non polar33892256
Dextrin,3TMS,isomer #8C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3794.0Semi standard non polar33892256
Dextrin,3TMS,isomer #80C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3840.2Semi standard non polar33892256
Dextrin,3TMS,isomer #81C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3854.9Semi standard non polar33892256
Dextrin,3TMS,isomer #82C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3867.6Semi standard non polar33892256
Dextrin,3TMS,isomer #83C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3858.0Semi standard non polar33892256
Dextrin,3TMS,isomer #84C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3839.0Semi standard non polar33892256
Dextrin,3TMS,isomer #85C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3858.6Semi standard non polar33892256
Dextrin,3TMS,isomer #86C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3874.9Semi standard non polar33892256
Dextrin,3TMS,isomer #87C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3860.1Semi standard non polar33892256
Dextrin,3TMS,isomer #88C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3897.8Semi standard non polar33892256
Dextrin,3TMS,isomer #89C[Si](C)(C)O[C@H]1C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3863.7Semi standard non polar33892256
Dextrin,3TMS,isomer #9C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3818.5Semi standard non polar33892256
Dextrin,3TMS,isomer #90C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3840.8Semi standard non polar33892256
Dextrin,3TMS,isomer #91C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3863.6Semi standard non polar33892256
Dextrin,3TMS,isomer #92C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@H]1O3879.6Semi standard non polar33892256
Dextrin,3TMS,isomer #93C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@H]1O3871.9Semi standard non polar33892256
Dextrin,3TMS,isomer #94C[Si](C)(C)O[C@H]1C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@@H](O)[C@@H]1O3899.2Semi standard non polar33892256
Dextrin,3TMS,isomer #95C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3851.8Semi standard non polar33892256
Dextrin,3TMS,isomer #96C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3844.3Semi standard non polar33892256
Dextrin,3TMS,isomer #97C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@H]1O3865.1Semi standard non polar33892256
Dextrin,3TMS,isomer #98C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@H]1O3855.9Semi standard non polar33892256
Dextrin,3TMS,isomer #99C[Si](C)(C)O[C@H]1C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@@H](O)[C@@H]1O3885.2Semi standard non polar33892256
Dextrin,4TMS,isomer #1C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3633.7Semi standard non polar33892256
Dextrin,4TMS,isomer #10C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3647.4Semi standard non polar33892256
Dextrin,4TMS,isomer #100C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3718.7Semi standard non polar33892256
Dextrin,4TMS,isomer #101C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3721.9Semi standard non polar33892256
Dextrin,4TMS,isomer #102C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3760.5Semi standard non polar33892256
Dextrin,4TMS,isomer #103C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3702.1Semi standard non polar33892256
Dextrin,4TMS,isomer #104C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3730.0Semi standard non polar33892256
Dextrin,4TMS,isomer #105C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3723.4Semi standard non polar33892256
Dextrin,4TMS,isomer #106C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3677.5Semi standard non polar33892256
Dextrin,4TMS,isomer #107C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3703.6Semi standard non polar33892256
Dextrin,4TMS,isomer #108C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3743.7Semi standard non polar33892256
Dextrin,4TMS,isomer #109C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3744.2Semi standard non polar33892256
Dextrin,4TMS,isomer #11C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3694.5Semi standard non polar33892256
Dextrin,4TMS,isomer #110C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3722.3Semi standard non polar33892256
Dextrin,4TMS,isomer #111C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3779.3Semi standard non polar33892256
Dextrin,4TMS,isomer #112C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3728.5Semi standard non polar33892256
Dextrin,4TMS,isomer #113C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3758.1Semi standard non polar33892256
Dextrin,4TMS,isomer #114C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3777.1Semi standard non polar33892256
Dextrin,4TMS,isomer #115C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3780.6Semi standard non polar33892256
Dextrin,4TMS,isomer #116C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3754.0Semi standard non polar33892256
Dextrin,4TMS,isomer #117C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3735.5Semi standard non polar33892256
Dextrin,4TMS,isomer #118C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3734.7Semi standard non polar33892256
Dextrin,4TMS,isomer #119C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3719.0Semi standard non polar33892256
Dextrin,4TMS,isomer #12C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3648.6Semi standard non polar33892256
Dextrin,4TMS,isomer #120C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3773.4Semi standard non polar33892256
Dextrin,4TMS,isomer #121C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3739.7Semi standard non polar33892256
Dextrin,4TMS,isomer #122C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3733.7Semi standard non polar33892256
Dextrin,4TMS,isomer #123C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3724.2Semi standard non polar33892256
Dextrin,4TMS,isomer #124C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3709.4Semi standard non polar33892256
Dextrin,4TMS,isomer #125C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3762.3Semi standard non polar33892256
Dextrin,4TMS,isomer #126C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3738.0Semi standard non polar33892256
Dextrin,4TMS,isomer #127C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3776.7Semi standard non polar33892256
Dextrin,4TMS,isomer #128C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3759.9Semi standard non polar33892256
Dextrin,4TMS,isomer #129C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3741.9Semi standard non polar33892256
Dextrin,4TMS,isomer #13C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3714.0Semi standard non polar33892256
Dextrin,4TMS,isomer #130C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3737.9Semi standard non polar33892256
Dextrin,4TMS,isomer #131C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@H]1O3793.3Semi standard non polar33892256
Dextrin,4TMS,isomer #132C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@H]1O3769.7Semi standard non polar33892256
Dextrin,4TMS,isomer #133C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3802.1Semi standard non polar33892256
Dextrin,4TMS,isomer #134C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3755.3Semi standard non polar33892256
Dextrin,4TMS,isomer #135C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3720.9Semi standard non polar33892256
Dextrin,4TMS,isomer #136C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@H]1O3765.6Semi standard non polar33892256
Dextrin,4TMS,isomer #137C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@H]1O3742.1Semi standard non polar33892256
Dextrin,4TMS,isomer #138C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3781.7Semi standard non polar33892256
Dextrin,4TMS,isomer #139C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3711.6Semi standard non polar33892256
Dextrin,4TMS,isomer #14C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3661.0Semi standard non polar33892256
Dextrin,4TMS,isomer #140C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@H]1O3771.8Semi standard non polar33892256
Dextrin,4TMS,isomer #141C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@H]1O3752.8Semi standard non polar33892256
Dextrin,4TMS,isomer #142C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3781.7Semi standard non polar33892256
Dextrin,4TMS,isomer #143C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3756.7Semi standard non polar33892256
Dextrin,4TMS,isomer #144C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3732.0Semi standard non polar33892256
Dextrin,4TMS,isomer #145C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3766.9Semi standard non polar33892256
Dextrin,4TMS,isomer #146C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@@H]1CO3805.6Semi standard non polar33892256
Dextrin,4TMS,isomer #147C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3783.5Semi standard non polar33892256
Dextrin,4TMS,isomer #148C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@H]1O3793.6Semi standard non polar33892256
Dextrin,4TMS,isomer #149C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3688.8Semi standard non polar33892256
Dextrin,4TMS,isomer #15C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3687.2Semi standard non polar33892256
Dextrin,4TMS,isomer #150C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3670.6Semi standard non polar33892256
Dextrin,4TMS,isomer #151C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3644.9Semi standard non polar33892256
Dextrin,4TMS,isomer #152C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3722.8Semi standard non polar33892256
Dextrin,4TMS,isomer #153C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3700.8Semi standard non polar33892256
Dextrin,4TMS,isomer #154C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3732.4Semi standard non polar33892256
Dextrin,4TMS,isomer #155C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3706.2Semi standard non polar33892256
Dextrin,4TMS,isomer #156C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3652.6Semi standard non polar33892256
Dextrin,4TMS,isomer #157C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3717.2Semi standard non polar33892256
Dextrin,4TMS,isomer #158C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3691.0Semi standard non polar33892256
Dextrin,4TMS,isomer #159C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3722.8Semi standard non polar33892256
Dextrin,4TMS,isomer #16C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3663.7Semi standard non polar33892256
Dextrin,4TMS,isomer #160C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3631.7Semi standard non polar33892256
Dextrin,4TMS,isomer #161C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3706.2Semi standard non polar33892256
Dextrin,4TMS,isomer #162C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3685.4Semi standard non polar33892256
Dextrin,4TMS,isomer #163C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3717.5Semi standard non polar33892256
Dextrin,4TMS,isomer #164C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3673.0Semi standard non polar33892256
Dextrin,4TMS,isomer #165C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3651.1Semi standard non polar33892256
Dextrin,4TMS,isomer #166C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3685.1Semi standard non polar33892256
Dextrin,4TMS,isomer #167C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3711.6Semi standard non polar33892256
Dextrin,4TMS,isomer #168C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3738.2Semi standard non polar33892256
Dextrin,4TMS,isomer #169C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3729.0Semi standard non polar33892256
Dextrin,4TMS,isomer #17C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3690.2Semi standard non polar33892256
Dextrin,4TMS,isomer #170C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3678.1Semi standard non polar33892256
Dextrin,4TMS,isomer #171C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3661.4Semi standard non polar33892256
Dextrin,4TMS,isomer #172C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3711.5Semi standard non polar33892256
Dextrin,4TMS,isomer #173C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3687.7Semi standard non polar33892256
Dextrin,4TMS,isomer #174C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3716.7Semi standard non polar33892256
Dextrin,4TMS,isomer #175C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3746.8Semi standard non polar33892256
Dextrin,4TMS,isomer #176C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3735.3Semi standard non polar33892256
Dextrin,4TMS,isomer #177C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3778.1Semi standard non polar33892256
Dextrin,4TMS,isomer #178C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3758.6Semi standard non polar33892256
Dextrin,4TMS,isomer #179C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3769.9Semi standard non polar33892256
Dextrin,4TMS,isomer #18C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3642.9Semi standard non polar33892256
Dextrin,4TMS,isomer #180C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3723.9Semi standard non polar33892256
Dextrin,4TMS,isomer #181C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3709.3Semi standard non polar33892256
Dextrin,4TMS,isomer #182C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3752.4Semi standard non polar33892256
Dextrin,4TMS,isomer #183C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3740.0Semi standard non polar33892256
Dextrin,4TMS,isomer #184C[Si](C)(C)O[C@H]1[C@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3727.3Semi standard non polar33892256
Dextrin,4TMS,isomer #185C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3677.5Semi standard non polar33892256
Dextrin,4TMS,isomer #186C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3695.1Semi standard non polar33892256
Dextrin,4TMS,isomer #187C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3671.6Semi standard non polar33892256
Dextrin,4TMS,isomer #188C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3698.6Semi standard non polar33892256
Dextrin,4TMS,isomer #189C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3745.6Semi standard non polar33892256
Dextrin,4TMS,isomer #19C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3702.3Semi standard non polar33892256
Dextrin,4TMS,isomer #190C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3743.6Semi standard non polar33892256
Dextrin,4TMS,isomer #191C[Si](C)(C)O[C@H]1[C@@H](O)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3728.3Semi standard non polar33892256
Dextrin,4TMS,isomer #192C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3742.5Semi standard non polar33892256
Dextrin,4TMS,isomer #193C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3723.1Semi standard non polar33892256
Dextrin,4TMS,isomer #194C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3752.0Semi standard non polar33892256
Dextrin,4TMS,isomer #195C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3695.3Semi standard non polar33892256
Dextrin,4TMS,isomer #196C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3673.9Semi standard non polar33892256
Dextrin,4TMS,isomer #197C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3701.3Semi standard non polar33892256
Dextrin,4TMS,isomer #198C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3758.7Semi standard non polar33892256
Dextrin,4TMS,isomer #199C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3739.4Semi standard non polar33892256
Dextrin,4TMS,isomer #2C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3637.1Semi standard non polar33892256
Dextrin,4TMS,isomer #20C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3651.9Semi standard non polar33892256
Dextrin,4TMS,isomer #200C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3755.8Semi standard non polar33892256
Dextrin,4TMS,isomer #201C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3699.2Semi standard non polar33892256
Dextrin,4TMS,isomer #202C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3723.7Semi standard non polar33892256
Dextrin,4TMS,isomer #203C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3714.4Semi standard non polar33892256
Dextrin,4TMS,isomer #204C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O[Si](C)(C)C3775.9Semi standard non polar33892256
Dextrin,4TMS,isomer #205C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3721.0Semi standard non polar33892256
Dextrin,4TMS,isomer #206C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3696.6Semi standard non polar33892256
Dextrin,4TMS,isomer #207C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3693.3Semi standard non polar33892256
Dextrin,4TMS,isomer #208C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3755.6Semi standard non polar33892256
Dextrin,4TMS,isomer #209C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3728.2Semi standard non polar33892256
Dextrin,4TMS,isomer #21C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3678.9Semi standard non polar33892256
Dextrin,4TMS,isomer #210C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3773.5Semi standard non polar33892256
Dextrin,4TMS,isomer #211C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3736.3Semi standard non polar33892256
Dextrin,4TMS,isomer #212C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3701.3Semi standard non polar33892256
Dextrin,4TMS,isomer #213C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3747.3Semi standard non polar33892256
Dextrin,4TMS,isomer #214C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3717.5Semi standard non polar33892256
Dextrin,4TMS,isomer #215C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3761.2Semi standard non polar33892256
Dextrin,4TMS,isomer #216C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3680.5Semi standard non polar33892256
Dextrin,4TMS,isomer #217C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3737.9Semi standard non polar33892256
Dextrin,4TMS,isomer #218C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3712.2Semi standard non polar33892256
Dextrin,4TMS,isomer #219C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3755.4Semi standard non polar33892256
Dextrin,4TMS,isomer #22C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3675.1Semi standard non polar33892256
Dextrin,4TMS,isomer #220C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3724.4Semi standard non polar33892256
Dextrin,4TMS,isomer #221C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3701.3Semi standard non polar33892256
Dextrin,4TMS,isomer #222C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3741.7Semi standard non polar33892256
Dextrin,4TMS,isomer #223C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3749.1Semi standard non polar33892256
Dextrin,4TMS,isomer #224C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3780.6Semi standard non polar33892256
Dextrin,4TMS,isomer #225C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3771.4Semi standard non polar33892256
Dextrin,4TMS,isomer #226C[Si](C)(C)O[C@H]1[C@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3753.3Semi standard non polar33892256
Dextrin,4TMS,isomer #227C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3719.8Semi standard non polar33892256
Dextrin,4TMS,isomer #228C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@H]1O3774.1Semi standard non polar33892256
Dextrin,4TMS,isomer #229C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@H]1O3747.1Semi standard non polar33892256
Dextrin,4TMS,isomer #23C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3636.2Semi standard non polar33892256
Dextrin,4TMS,isomer #230C[Si](C)(C)O[C@H]1C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@@H](O)[C@@H]1O3794.6Semi standard non polar33892256
Dextrin,4TMS,isomer #231C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3695.3Semi standard non polar33892256
Dextrin,4TMS,isomer #232C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@H]1O3759.0Semi standard non polar33892256
Dextrin,4TMS,isomer #233C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@H]1O3731.5Semi standard non polar33892256
Dextrin,4TMS,isomer #234C[Si](C)(C)O[C@H]1C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@@H](O)[C@@H]1O3779.8Semi standard non polar33892256
Dextrin,4TMS,isomer #235C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3754.4Semi standard non polar33892256
Dextrin,4TMS,isomer #236C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3726.2Semi standard non polar33892256
Dextrin,4TMS,isomer #237C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3771.7Semi standard non polar33892256
Dextrin,4TMS,isomer #238C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@@H]1CO3816.6Semi standard non polar33892256
Dextrin,4TMS,isomer #239C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3786.9Semi standard non polar33892256
Dextrin,4TMS,isomer #24C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3700.3Semi standard non polar33892256
Dextrin,4TMS,isomer #240C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@H]1O3805.7Semi standard non polar33892256
Dextrin,4TMS,isomer #241C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3715.0Semi standard non polar33892256
Dextrin,4TMS,isomer #242C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@H]1O3771.1Semi standard non polar33892256
Dextrin,4TMS,isomer #243C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@H]1O3747.5Semi standard non polar33892256
Dextrin,4TMS,isomer #244C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3791.2Semi standard non polar33892256
Dextrin,4TMS,isomer #245C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3735.9Semi standard non polar33892256
Dextrin,4TMS,isomer #246C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3712.3Semi standard non polar33892256
Dextrin,4TMS,isomer #247C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3748.7Semi standard non polar33892256
Dextrin,4TMS,isomer #248C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)O[C@@H]1CO3779.6Semi standard non polar33892256
Dextrin,4TMS,isomer #249C[Si](C)(C)O[C@H]1C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3758.2Semi standard non polar33892256
Dextrin,4TMS,isomer #25C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3649.1Semi standard non polar33892256
Dextrin,4TMS,isomer #250C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@H]1O3779.1Semi standard non polar33892256
Dextrin,4TMS,isomer #251C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3731.4Semi standard non polar33892256
Dextrin,4TMS,isomer #252C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3707.0Semi standard non polar33892256
Dextrin,4TMS,isomer #253C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3747.2Semi standard non polar33892256
Dextrin,4TMS,isomer #254C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@@H]1CO3797.4Semi standard non polar33892256
Dextrin,4TMS,isomer #255C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3766.6Semi standard non polar33892256
Dextrin,4TMS,isomer #256C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@H]1O3790.1Semi standard non polar33892256
Dextrin,4TMS,isomer #257C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3745.9Semi standard non polar33892256
Dextrin,4TMS,isomer #258C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3776.9Semi standard non polar33892256
Dextrin,4TMS,isomer #259C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3766.0Semi standard non polar33892256
Dextrin,4TMS,isomer #26C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3673.5Semi standard non polar33892256
Dextrin,4TMS,isomer #260C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@H]1O[Si](C)(C)C3814.5Semi standard non polar33892256
Dextrin,4TMS,isomer #261C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3697.5Semi standard non polar33892256
Dextrin,4TMS,isomer #262C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3760.5Semi standard non polar33892256
Dextrin,4TMS,isomer #263C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3742.4Semi standard non polar33892256
Dextrin,4TMS,isomer #264C[Si](C)(C)O[C@H]1[C@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3776.5Semi standard non polar33892256
Dextrin,4TMS,isomer #265C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3699.1Semi standard non polar33892256
Dextrin,4TMS,isomer #266C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3676.0Semi standard non polar33892256
Dextrin,4TMS,isomer #267C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3741.8Semi standard non polar33892256
Dextrin,4TMS,isomer #268C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3716.5Semi standard non polar33892256
Dextrin,4TMS,isomer #269C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3755.7Semi standard non polar33892256
Dextrin,4TMS,isomer #27C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3706.9Semi standard non polar33892256
Dextrin,4TMS,isomer #270C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3723.6Semi standard non polar33892256
Dextrin,4TMS,isomer #271C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3699.5Semi standard non polar33892256
Dextrin,4TMS,isomer #272C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3733.5Semi standard non polar33892256
Dextrin,4TMS,isomer #273C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@@H]1CO3779.3Semi standard non polar33892256
Dextrin,4TMS,isomer #274C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3756.5Semi standard non polar33892256
Dextrin,4TMS,isomer #275C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3776.6Semi standard non polar33892256
Dextrin,4TMS,isomer #276C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3637.1Semi standard non polar33892256
Dextrin,4TMS,isomer #277C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3709.2Semi standard non polar33892256
Dextrin,4TMS,isomer #278C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3683.9Semi standard non polar33892256
Dextrin,4TMS,isomer #279C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3720.7Semi standard non polar33892256
Dextrin,4TMS,isomer #28C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3741.9Semi standard non polar33892256
Dextrin,4TMS,isomer #280C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3709.1Semi standard non polar33892256
Dextrin,4TMS,isomer #281C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3683.2Semi standard non polar33892256
Dextrin,4TMS,isomer #282C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3718.4Semi standard non polar33892256
Dextrin,4TMS,isomer #283C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1CO3766.9Semi standard non polar33892256
Dextrin,4TMS,isomer #284C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3744.8Semi standard non polar33892256
Dextrin,4TMS,isomer #285C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3760.1Semi standard non polar33892256
Dextrin,4TMS,isomer #286C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3679.3Semi standard non polar33892256
Dextrin,4TMS,isomer #287C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3656.8Semi standard non polar33892256
Dextrin,4TMS,isomer #288C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3694.8Semi standard non polar33892256
Dextrin,4TMS,isomer #289C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3714.1Semi standard non polar33892256
Dextrin,4TMS,isomer #29C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3689.5Semi standard non polar33892256
Dextrin,4TMS,isomer #290C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3747.0Semi standard non polar33892256
Dextrin,4TMS,isomer #291C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3735.3Semi standard non polar33892256
Dextrin,4TMS,isomer #292C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3710.2Semi standard non polar33892256
Dextrin,4TMS,isomer #293C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3738.9Semi standard non polar33892256
Dextrin,4TMS,isomer #294C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3728.4Semi standard non polar33892256
Dextrin,4TMS,isomer #295C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O[Si](C)(C)C3784.0Semi standard non polar33892256
Dextrin,4TMS,isomer #296C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3652.6Semi standard non polar33892256
Dextrin,4TMS,isomer #297C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3723.7Semi standard non polar33892256
Dextrin,4TMS,isomer #298C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3702.5Semi standard non polar33892256
Dextrin,4TMS,isomer #299C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3737.6Semi standard non polar33892256
Dextrin,4TMS,isomer #3C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3619.5Semi standard non polar33892256
Dextrin,4TMS,isomer #30C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3717.1Semi standard non polar33892256
Dextrin,4TMS,isomer #300C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3720.8Semi standard non polar33892256
Dextrin,4TMS,isomer #301C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3696.3Semi standard non polar33892256
Dextrin,4TMS,isomer #302C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3732.1Semi standard non polar33892256
Dextrin,4TMS,isomer #303C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@@H]1CO3780.6Semi standard non polar33892256
Dextrin,4TMS,isomer #304C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3756.4Semi standard non polar33892256
Dextrin,4TMS,isomer #305C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3773.3Semi standard non polar33892256
Dextrin,4TMS,isomer #306C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3696.7Semi standard non polar33892256
Dextrin,4TMS,isomer #307C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3670.5Semi standard non polar33892256
Dextrin,4TMS,isomer #308C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3708.7Semi standard non polar33892256
Dextrin,4TMS,isomer #309C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3723.3Semi standard non polar33892256
Dextrin,4TMS,isomer #31C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3687.6Semi standard non polar33892256
Dextrin,4TMS,isomer #310C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3749.5Semi standard non polar33892256
Dextrin,4TMS,isomer #311C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3738.0Semi standard non polar33892256
Dextrin,4TMS,isomer #312C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3708.0Semi standard non polar33892256
Dextrin,4TMS,isomer #313C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3730.7Semi standard non polar33892256
Dextrin,4TMS,isomer #314C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3720.9Semi standard non polar33892256
Dextrin,4TMS,isomer #315C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O[Si](C)(C)C3770.7Semi standard non polar33892256
Dextrin,4TMS,isomer #316C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3694.3Semi standard non polar33892256
Dextrin,4TMS,isomer #317C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3669.0Semi standard non polar33892256
Dextrin,4TMS,isomer #318C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3707.3Semi standard non polar33892256
Dextrin,4TMS,isomer #319C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3728.0Semi standard non polar33892256
Dextrin,4TMS,isomer #32C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3643.4Semi standard non polar33892256
Dextrin,4TMS,isomer #320C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3761.8Semi standard non polar33892256
Dextrin,4TMS,isomer #321C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3750.2Semi standard non polar33892256
Dextrin,4TMS,isomer #322C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3721.6Semi standard non polar33892256
Dextrin,4TMS,isomer #323C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3755.5Semi standard non polar33892256
Dextrin,4TMS,isomer #324C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3742.8Semi standard non polar33892256
Dextrin,4TMS,isomer #325C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O[Si](C)(C)C3801.8Semi standard non polar33892256
Dextrin,4TMS,isomer #326C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3680.1Semi standard non polar33892256
Dextrin,4TMS,isomer #327C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3717.8Semi standard non polar33892256
Dextrin,4TMS,isomer #328C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3705.0Semi standard non polar33892256
Dextrin,4TMS,isomer #329C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3761.8Semi standard non polar33892256
Dextrin,4TMS,isomer #33C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3669.5Semi standard non polar33892256
Dextrin,4TMS,isomer #330C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3754.1Semi standard non polar33892256
Dextrin,4TMS,isomer #34C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3713.6Semi standard non polar33892256
Dextrin,4TMS,isomer #35C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3719.0Semi standard non polar33892256
Dextrin,4TMS,isomer #36C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3687.7Semi standard non polar33892256
Dextrin,4TMS,isomer #37C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3664.0Semi standard non polar33892256
Dextrin,4TMS,isomer #38C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3647.7Semi standard non polar33892256
Dextrin,4TMS,isomer #39C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3698.1Semi standard non polar33892256
Dextrin,4TMS,isomer #4C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3676.7Semi standard non polar33892256
Dextrin,4TMS,isomer #40C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3663.4Semi standard non polar33892256
Dextrin,4TMS,isomer #41C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3722.9Semi standard non polar33892256
Dextrin,4TMS,isomer #42C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3670.1Semi standard non polar33892256
Dextrin,4TMS,isomer #43C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3695.0Semi standard non polar33892256
Dextrin,4TMS,isomer #44C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3685.5Semi standard non polar33892256
Dextrin,4TMS,isomer #45C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3704.3Semi standard non polar33892256
Dextrin,4TMS,isomer #46C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3669.7Semi standard non polar33892256
Dextrin,4TMS,isomer #47C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3723.5Semi standard non polar33892256
Dextrin,4TMS,isomer #48C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3671.6Semi standard non polar33892256
Dextrin,4TMS,isomer #49C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3696.6Semi standard non polar33892256
Dextrin,4TMS,isomer #5C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3620.7Semi standard non polar33892256
Dextrin,4TMS,isomer #50C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3682.5Semi standard non polar33892256
Dextrin,4TMS,isomer #51C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3649.9Semi standard non polar33892256
Dextrin,4TMS,isomer #52C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3708.2Semi standard non polar33892256
Dextrin,4TMS,isomer #53C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3657.7Semi standard non polar33892256
Dextrin,4TMS,isomer #54C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3679.8Semi standard non polar33892256
Dextrin,4TMS,isomer #55C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3714.7Semi standard non polar33892256
Dextrin,4TMS,isomer #56C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3749.7Semi standard non polar33892256
Dextrin,4TMS,isomer #57C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3693.9Semi standard non polar33892256
Dextrin,4TMS,isomer #58C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3723.1Semi standard non polar33892256
Dextrin,4TMS,isomer #59C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3705.1Semi standard non polar33892256
Dextrin,4TMS,isomer #6C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3689.5Semi standard non polar33892256
Dextrin,4TMS,isomer #60C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3659.3Semi standard non polar33892256
Dextrin,4TMS,isomer #61C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3685.3Semi standard non polar33892256
Dextrin,4TMS,isomer #62C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3722.9Semi standard non polar33892256
Dextrin,4TMS,isomer #63C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3729.9Semi standard non polar33892256
Dextrin,4TMS,isomer #64C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3695.0Semi standard non polar33892256
Dextrin,4TMS,isomer #65C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3705.9Semi standard non polar33892256
Dextrin,4TMS,isomer #66C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3724.9Semi standard non polar33892256
Dextrin,4TMS,isomer #67C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3695.6Semi standard non polar33892256
Dextrin,4TMS,isomer #68C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3748.4Semi standard non polar33892256
Dextrin,4TMS,isomer #69C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3694.4Semi standard non polar33892256
Dextrin,4TMS,isomer #7C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3628.5Semi standard non polar33892256
Dextrin,4TMS,isomer #70C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3719.2Semi standard non polar33892256
Dextrin,4TMS,isomer #71C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3704.3Semi standard non polar33892256
Dextrin,4TMS,isomer #72C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3679.3Semi standard non polar33892256
Dextrin,4TMS,isomer #73C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3733.7Semi standard non polar33892256
Dextrin,4TMS,isomer #74C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3680.4Semi standard non polar33892256
Dextrin,4TMS,isomer #75C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3705.6Semi standard non polar33892256
Dextrin,4TMS,isomer #76C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3742.7Semi standard non polar33892256
Dextrin,4TMS,isomer #77C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3782.0Semi standard non polar33892256
Dextrin,4TMS,isomer #78C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3717.4Semi standard non polar33892256
Dextrin,4TMS,isomer #79C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3747.1Semi standard non polar33892256
Dextrin,4TMS,isomer #8C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3656.6Semi standard non polar33892256
Dextrin,4TMS,isomer #80C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3739.5Semi standard non polar33892256
Dextrin,4TMS,isomer #81C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3690.9Semi standard non polar33892256
Dextrin,4TMS,isomer #82C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3718.4Semi standard non polar33892256
Dextrin,4TMS,isomer #83C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3760.8Semi standard non polar33892256
Dextrin,4TMS,isomer #84C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3763.3Semi standard non polar33892256
Dextrin,4TMS,isomer #85C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3734.7Semi standard non polar33892256
Dextrin,4TMS,isomer #86C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3721.4Semi standard non polar33892256
Dextrin,4TMS,isomer #87C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3693.8Semi standard non polar33892256
Dextrin,4TMS,isomer #88C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3747.7Semi standard non polar33892256
Dextrin,4TMS,isomer #89C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3696.2Semi standard non polar33892256
Dextrin,4TMS,isomer #9C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3659.4Semi standard non polar33892256
Dextrin,4TMS,isomer #90C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3720.7Semi standard non polar33892256
Dextrin,4TMS,isomer #91C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3725.6Semi standard non polar33892256
Dextrin,4TMS,isomer #92C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3758.4Semi standard non polar33892256
Dextrin,4TMS,isomer #93C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3699.2Semi standard non polar33892256
Dextrin,4TMS,isomer #94C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3729.7Semi standard non polar33892256
Dextrin,4TMS,isomer #95C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3719.9Semi standard non polar33892256
Dextrin,4TMS,isomer #96C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3671.5Semi standard non polar33892256
Dextrin,4TMS,isomer #97C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3701.0Semi standard non polar33892256
Dextrin,4TMS,isomer #98C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3736.6Semi standard non polar33892256
Dextrin,4TMS,isomer #99C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3739.1Semi standard non polar33892256
Dextrin,5TMS,isomer #1C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3484.6Semi standard non polar33892256
Dextrin,5TMS,isomer #10C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3494.3Semi standard non polar33892256
Dextrin,5TMS,isomer #100C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3560.4Semi standard non polar33892256
Dextrin,5TMS,isomer #101C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3505.3Semi standard non polar33892256
Dextrin,5TMS,isomer #102C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3532.2Semi standard non polar33892256
Dextrin,5TMS,isomer #103C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3578.6Semi standard non polar33892256
Dextrin,5TMS,isomer #104C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3568.4Semi standard non polar33892256
Dextrin,5TMS,isomer #105C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3557.0Semi standard non polar33892256
Dextrin,5TMS,isomer #106C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3563.9Semi standard non polar33892256
Dextrin,5TMS,isomer #107C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3539.9Semi standard non polar33892256
Dextrin,5TMS,isomer #108C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3587.8Semi standard non polar33892256
Dextrin,5TMS,isomer #109C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3531.6Semi standard non polar33892256
Dextrin,5TMS,isomer #11C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3527.8Semi standard non polar33892256
Dextrin,5TMS,isomer #110C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3556.3Semi standard non polar33892256
Dextrin,5TMS,isomer #111C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3556.3Semi standard non polar33892256
Dextrin,5TMS,isomer #112C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3585.0Semi standard non polar33892256
Dextrin,5TMS,isomer #113C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3523.0Semi standard non polar33892256
Dextrin,5TMS,isomer #114C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3550.3Semi standard non polar33892256
Dextrin,5TMS,isomer #115C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3546.6Semi standard non polar33892256
Dextrin,5TMS,isomer #116C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3511.1Semi standard non polar33892256
Dextrin,5TMS,isomer #117C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3523.0Semi standard non polar33892256
Dextrin,5TMS,isomer #118C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3568.6Semi standard non polar33892256
Dextrin,5TMS,isomer #119C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3555.7Semi standard non polar33892256
Dextrin,5TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3489.4Semi standard non polar33892256
Dextrin,5TMS,isomer #120C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3545.7Semi standard non polar33892256
Dextrin,5TMS,isomer #121C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3560.4Semi standard non polar33892256
Dextrin,5TMS,isomer #122C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3594.9Semi standard non polar33892256
Dextrin,5TMS,isomer #123C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3526.3Semi standard non polar33892256
Dextrin,5TMS,isomer #124C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3562.0Semi standard non polar33892256
Dextrin,5TMS,isomer #125C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3559.2Semi standard non polar33892256
Dextrin,5TMS,isomer #126C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3508.2Semi standard non polar33892256
Dextrin,5TMS,isomer #127C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3531.4Semi standard non polar33892256
Dextrin,5TMS,isomer #128C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3578.1Semi standard non polar33892256
Dextrin,5TMS,isomer #129C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3565.1Semi standard non polar33892256
Dextrin,5TMS,isomer #13C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3505.3Semi standard non polar33892256
Dextrin,5TMS,isomer #130C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3555.5Semi standard non polar33892256
Dextrin,5TMS,isomer #131C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3618.3Semi standard non polar33892256
Dextrin,5TMS,isomer #132C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3551.9Semi standard non polar33892256
Dextrin,5TMS,isomer #133C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3588.9Semi standard non polar33892256
Dextrin,5TMS,isomer #134C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3608.1Semi standard non polar33892256
Dextrin,5TMS,isomer #135C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3599.1Semi standard non polar33892256
Dextrin,5TMS,isomer #136C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3584.1Semi standard non polar33892256
Dextrin,5TMS,isomer #137C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3573.1Semi standard non polar33892256
Dextrin,5TMS,isomer #138C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3557.9Semi standard non polar33892256
Dextrin,5TMS,isomer #139C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3552.8Semi standard non polar33892256
Dextrin,5TMS,isomer #14C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3507.7Semi standard non polar33892256
Dextrin,5TMS,isomer #140C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3603.1Semi standard non polar33892256
Dextrin,5TMS,isomer #141C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3587.9Semi standard non polar33892256
Dextrin,5TMS,isomer #142C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3568.6Semi standard non polar33892256
Dextrin,5TMS,isomer #143C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3616.8Semi standard non polar33892256
Dextrin,5TMS,isomer #144C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3559.5Semi standard non polar33892256
Dextrin,5TMS,isomer #145C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3579.6Semi standard non polar33892256
Dextrin,5TMS,isomer #146C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3599.9Semi standard non polar33892256
Dextrin,5TMS,isomer #147C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3629.5Semi standard non polar33892256
Dextrin,5TMS,isomer #148C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3557.2Semi standard non polar33892256
Dextrin,5TMS,isomer #149C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3594.4Semi standard non polar33892256
Dextrin,5TMS,isomer #15C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3492.1Semi standard non polar33892256
Dextrin,5TMS,isomer #150C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3596.9Semi standard non polar33892256
Dextrin,5TMS,isomer #151C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3533.7Semi standard non polar33892256
Dextrin,5TMS,isomer #152C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3565.8Semi standard non polar33892256
Dextrin,5TMS,isomer #153C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3620.7Semi standard non polar33892256
Dextrin,5TMS,isomer #154C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3602.5Semi standard non polar33892256
Dextrin,5TMS,isomer #155C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3596.8Semi standard non polar33892256
Dextrin,5TMS,isomer #156C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3584.5Semi standard non polar33892256
Dextrin,5TMS,isomer #157C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3616.7Semi standard non polar33892256
Dextrin,5TMS,isomer #158C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3543.4Semi standard non polar33892256
Dextrin,5TMS,isomer #159C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3581.1Semi standard non polar33892256
Dextrin,5TMS,isomer #16C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3530.3Semi standard non polar33892256
Dextrin,5TMS,isomer #160C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3584.1Semi standard non polar33892256
Dextrin,5TMS,isomer #161C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3524.4Semi standard non polar33892256
Dextrin,5TMS,isomer #162C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3554.3Semi standard non polar33892256
Dextrin,5TMS,isomer #163C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3607.8Semi standard non polar33892256
Dextrin,5TMS,isomer #164C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3588.1Semi standard non polar33892256
Dextrin,5TMS,isomer #165C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3584.4Semi standard non polar33892256
Dextrin,5TMS,isomer #166C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3648.2Semi standard non polar33892256
Dextrin,5TMS,isomer #167C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3575.6Semi standard non polar33892256
Dextrin,5TMS,isomer #168C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3615.6Semi standard non polar33892256
Dextrin,5TMS,isomer #169C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3640.1Semi standard non polar33892256
Dextrin,5TMS,isomer #17C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3483.3Semi standard non polar33892256
Dextrin,5TMS,isomer #170C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3624.8Semi standard non polar33892256
Dextrin,5TMS,isomer #171C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3619.6Semi standard non polar33892256
Dextrin,5TMS,isomer #172C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3611.8Semi standard non polar33892256
Dextrin,5TMS,isomer #173C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3593.5Semi standard non polar33892256
Dextrin,5TMS,isomer #174C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3595.2Semi standard non polar33892256
Dextrin,5TMS,isomer #175C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3637.6Semi standard non polar33892256
Dextrin,5TMS,isomer #176C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3605.2Semi standard non polar33892256
Dextrin,5TMS,isomer #177C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3637.8Semi standard non polar33892256
Dextrin,5TMS,isomer #178C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3565.3Semi standard non polar33892256
Dextrin,5TMS,isomer #179C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3600.2Semi standard non polar33892256
Dextrin,5TMS,isomer #18C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3504.4Semi standard non polar33892256
Dextrin,5TMS,isomer #180C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3602.0Semi standard non polar33892256
Dextrin,5TMS,isomer #181C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3545.8Semi standard non polar33892256
Dextrin,5TMS,isomer #182C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3572.7Semi standard non polar33892256
Dextrin,5TMS,isomer #183C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3627.6Semi standard non polar33892256
Dextrin,5TMS,isomer #184C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3606.0Semi standard non polar33892256
Dextrin,5TMS,isomer #185C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3604.0Semi standard non polar33892256
Dextrin,5TMS,isomer #186C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3618.8Semi standard non polar33892256
Dextrin,5TMS,isomer #187C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3552.7Semi standard non polar33892256
Dextrin,5TMS,isomer #188C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3587.1Semi standard non polar33892256
Dextrin,5TMS,isomer #189C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3609.3Semi standard non polar33892256
Dextrin,5TMS,isomer #19C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3540.8Semi standard non polar33892256
Dextrin,5TMS,isomer #190C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3591.8Semi standard non polar33892256
Dextrin,5TMS,isomer #191C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3586.8Semi standard non polar33892256
Dextrin,5TMS,isomer #192C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3580.5Semi standard non polar33892256
Dextrin,5TMS,isomer #193C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3560.6Semi standard non polar33892256
Dextrin,5TMS,isomer #194C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3564.2Semi standard non polar33892256
Dextrin,5TMS,isomer #195C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3603.9Semi standard non polar33892256
Dextrin,5TMS,isomer #196C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3639.7Semi standard non polar33892256
Dextrin,5TMS,isomer #197C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3572.3Semi standard non polar33892256
Dextrin,5TMS,isomer #198C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3610.2Semi standard non polar33892256
Dextrin,5TMS,isomer #199C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3637.3Semi standard non polar33892256
Dextrin,5TMS,isomer #2C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3473.5Semi standard non polar33892256
Dextrin,5TMS,isomer #20C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3576.0Semi standard non polar33892256
Dextrin,5TMS,isomer #200C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3621.3Semi standard non polar33892256
Dextrin,5TMS,isomer #201C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3614.2Semi standard non polar33892256
Dextrin,5TMS,isomer #202C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3605.3Semi standard non polar33892256
Dextrin,5TMS,isomer #203C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3586.0Semi standard non polar33892256
Dextrin,5TMS,isomer #204C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3587.8Semi standard non polar33892256
Dextrin,5TMS,isomer #205C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3631.8Semi standard non polar33892256
Dextrin,5TMS,isomer #206C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3660.4Semi standard non polar33892256
Dextrin,5TMS,isomer #207C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3640.2Semi standard non polar33892256
Dextrin,5TMS,isomer #208C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3637.0Semi standard non polar33892256
Dextrin,5TMS,isomer #209C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3662.6Semi standard non polar33892256
Dextrin,5TMS,isomer #21C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3503.2Semi standard non polar33892256
Dextrin,5TMS,isomer #210C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3623.1Semi standard non polar33892256
Dextrin,5TMS,isomer #211C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3586.5Semi standard non polar33892256
Dextrin,5TMS,isomer #212C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3563.0Semi standard non polar33892256
Dextrin,5TMS,isomer #213C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3547.2Semi standard non polar33892256
Dextrin,5TMS,isomer #214C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3619.5Semi standard non polar33892256
Dextrin,5TMS,isomer #215C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3575.0Semi standard non polar33892256
Dextrin,5TMS,isomer #216C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3634.1Semi standard non polar33892256
Dextrin,5TMS,isomer #217C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3602.4Semi standard non polar33892256
Dextrin,5TMS,isomer #218C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3548.6Semi standard non polar33892256
Dextrin,5TMS,isomer #219C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3601.2Semi standard non polar33892256
Dextrin,5TMS,isomer #22C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3540.8Semi standard non polar33892256
Dextrin,5TMS,isomer #220C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3559.3Semi standard non polar33892256
Dextrin,5TMS,isomer #221C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3615.4Semi standard non polar33892256
Dextrin,5TMS,isomer #222C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3547.3Semi standard non polar33892256
Dextrin,5TMS,isomer #223C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3613.8Semi standard non polar33892256
Dextrin,5TMS,isomer #224C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3574.4Semi standard non polar33892256
Dextrin,5TMS,isomer #225C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3626.2Semi standard non polar33892256
Dextrin,5TMS,isomer #226C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3587.7Semi standard non polar33892256
Dextrin,5TMS,isomer #227C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3543.8Semi standard non polar33892256
Dextrin,5TMS,isomer #228C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3600.5Semi standard non polar33892256
Dextrin,5TMS,isomer #229C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3624.8Semi standard non polar33892256
Dextrin,5TMS,isomer #23C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3526.9Semi standard non polar33892256
Dextrin,5TMS,isomer #230C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3644.3Semi standard non polar33892256
Dextrin,5TMS,isomer #231C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3643.1Semi standard non polar33892256
Dextrin,5TMS,isomer #232C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3627.9Semi standard non polar33892256
Dextrin,5TMS,isomer #233C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3584.3Semi standard non polar33892256
Dextrin,5TMS,isomer #234C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@H]1O3653.8Semi standard non polar33892256
Dextrin,5TMS,isomer #235C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@H]1O3610.4Semi standard non polar33892256
Dextrin,5TMS,isomer #236C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3668.7Semi standard non polar33892256
Dextrin,5TMS,isomer #237C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3562.1Semi standard non polar33892256
Dextrin,5TMS,isomer #238C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@H]1O3640.4Semi standard non polar33892256
Dextrin,5TMS,isomer #239C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@H]1O3597.6Semi standard non polar33892256
Dextrin,5TMS,isomer #24C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3489.1Semi standard non polar33892256
Dextrin,5TMS,isomer #240C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3652.5Semi standard non polar33892256
Dextrin,5TMS,isomer #241C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3618.4Semi standard non polar33892256
Dextrin,5TMS,isomer #242C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3572.9Semi standard non polar33892256
Dextrin,5TMS,isomer #243C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3628.9Semi standard non polar33892256
Dextrin,5TMS,isomer #244C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@@H]1CO3682.4Semi standard non polar33892256
Dextrin,5TMS,isomer #245C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3663.3Semi standard non polar33892256
Dextrin,5TMS,isomer #246C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@H]1O3681.8Semi standard non polar33892256
Dextrin,5TMS,isomer #247C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3585.0Semi standard non polar33892256
Dextrin,5TMS,isomer #248C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@H]1O3657.2Semi standard non polar33892256
Dextrin,5TMS,isomer #249C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@H]1O3617.9Semi standard non polar33892256
Dextrin,5TMS,isomer #25C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3508.2Semi standard non polar33892256
Dextrin,5TMS,isomer #250C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3673.0Semi standard non polar33892256
Dextrin,5TMS,isomer #251C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3587.1Semi standard non polar33892256
Dextrin,5TMS,isomer #252C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3552.3Semi standard non polar33892256
Dextrin,5TMS,isomer #253C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3600.0Semi standard non polar33892256
Dextrin,5TMS,isomer #254C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)O[C@@H]1CO3642.1Semi standard non polar33892256
Dextrin,5TMS,isomer #255C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3627.1Semi standard non polar33892256
Dextrin,5TMS,isomer #256C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@H]1O3643.2Semi standard non polar33892256
Dextrin,5TMS,isomer #257C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3606.6Semi standard non polar33892256
Dextrin,5TMS,isomer #258C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3564.4Semi standard non polar33892256
Dextrin,5TMS,isomer #259C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3616.4Semi standard non polar33892256
Dextrin,5TMS,isomer #26C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3545.8Semi standard non polar33892256
Dextrin,5TMS,isomer #260C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@@H]1CO3676.2Semi standard non polar33892256
Dextrin,5TMS,isomer #261C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3655.0Semi standard non polar33892256
Dextrin,5TMS,isomer #262C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@H]1O3675.2Semi standard non polar33892256
Dextrin,5TMS,isomer #263C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3624.0Semi standard non polar33892256
Dextrin,5TMS,isomer #264C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3643.8Semi standard non polar33892256
Dextrin,5TMS,isomer #265C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3643.2Semi standard non polar33892256
Dextrin,5TMS,isomer #266C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3696.4Semi standard non polar33892256
Dextrin,5TMS,isomer #267C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3561.3Semi standard non polar33892256
Dextrin,5TMS,isomer #268C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3503.5Semi standard non polar33892256
Dextrin,5TMS,isomer #269C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3573.2Semi standard non polar33892256
Dextrin,5TMS,isomer #27C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3541.3Semi standard non polar33892256
Dextrin,5TMS,isomer #270C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3536.6Semi standard non polar33892256
Dextrin,5TMS,isomer #271C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3581.2Semi standard non polar33892256
Dextrin,5TMS,isomer #272C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3492.0Semi standard non polar33892256
Dextrin,5TMS,isomer #273C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3560.4Semi standard non polar33892256
Dextrin,5TMS,isomer #274C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3525.9Semi standard non polar33892256
Dextrin,5TMS,isomer #275C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3567.0Semi standard non polar33892256
Dextrin,5TMS,isomer #276C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3533.9Semi standard non polar33892256
Dextrin,5TMS,isomer #277C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3505.6Semi standard non polar33892256
Dextrin,5TMS,isomer #278C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3537.3Semi standard non polar33892256
Dextrin,5TMS,isomer #279C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3584.5Semi standard non polar33892256
Dextrin,5TMS,isomer #28C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3526.9Semi standard non polar33892256
Dextrin,5TMS,isomer #280C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3603.5Semi standard non polar33892256
Dextrin,5TMS,isomer #281C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3594.4Semi standard non polar33892256
Dextrin,5TMS,isomer #282C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3530.5Semi standard non polar33892256
Dextrin,5TMS,isomer #283C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3590.4Semi standard non polar33892256
Dextrin,5TMS,isomer #284C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3555.0Semi standard non polar33892256
Dextrin,5TMS,isomer #285C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3599.4Semi standard non polar33892256
Dextrin,5TMS,isomer #286C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3527.5Semi standard non polar33892256
Dextrin,5TMS,isomer #287C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3513.8Semi standard non polar33892256
Dextrin,5TMS,isomer #288C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3529.6Semi standard non polar33892256
Dextrin,5TMS,isomer #289C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3565.6Semi standard non polar33892256
Dextrin,5TMS,isomer #29C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3534.0Semi standard non polar33892256
Dextrin,5TMS,isomer #290C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3580.5Semi standard non polar33892256
Dextrin,5TMS,isomer #291C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3574.1Semi standard non polar33892256
Dextrin,5TMS,isomer #292C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3532.5Semi standard non polar33892256
Dextrin,5TMS,isomer #293C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3509.3Semi standard non polar33892256
Dextrin,5TMS,isomer #294C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3538.4Semi standard non polar33892256
Dextrin,5TMS,isomer #295C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3583.0Semi standard non polar33892256
Dextrin,5TMS,isomer #296C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3599.6Semi standard non polar33892256
Dextrin,5TMS,isomer #297C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3592.8Semi standard non polar33892256
Dextrin,5TMS,isomer #298C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3539.5Semi standard non polar33892256
Dextrin,5TMS,isomer #299C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3560.9Semi standard non polar33892256
Dextrin,5TMS,isomer #3C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3506.7Semi standard non polar33892256
Dextrin,5TMS,isomer #30C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3537.6Semi standard non polar33892256
Dextrin,5TMS,isomer #300C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3549.2Semi standard non polar33892256
Dextrin,5TMS,isomer #301C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3616.2Semi standard non polar33892256
Dextrin,5TMS,isomer #302C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3552.8Semi standard non polar33892256
Dextrin,5TMS,isomer #303C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3567.7Semi standard non polar33892256
Dextrin,5TMS,isomer #304C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3535.6Semi standard non polar33892256
Dextrin,5TMS,isomer #305C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3573.4Semi standard non polar33892256
Dextrin,5TMS,isomer #306C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3555.4Semi standard non polar33892256
Dextrin,5TMS,isomer #307C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3525.1Semi standard non polar33892256
Dextrin,5TMS,isomer #308C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3559.1Semi standard non polar33892256
Dextrin,5TMS,isomer #309C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3581.4Semi standard non polar33892256
Dextrin,5TMS,isomer #31C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3512.2Semi standard non polar33892256
Dextrin,5TMS,isomer #310C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3599.0Semi standard non polar33892256
Dextrin,5TMS,isomer #311C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3586.5Semi standard non polar33892256
Dextrin,5TMS,isomer #312C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3616.4Semi standard non polar33892256
Dextrin,5TMS,isomer #313C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3636.7Semi standard non polar33892256
Dextrin,5TMS,isomer #314C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3623.5Semi standard non polar33892256
Dextrin,5TMS,isomer #315C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3623.5Semi standard non polar33892256
Dextrin,5TMS,isomer #316C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3611.5Semi standard non polar33892256
Dextrin,5TMS,isomer #317C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O[Si](C)(C)C3656.7Semi standard non polar33892256
Dextrin,5TMS,isomer #318C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3635.3Semi standard non polar33892256
Dextrin,5TMS,isomer #319C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3619.3Semi standard non polar33892256
Dextrin,5TMS,isomer #32C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3564.7Semi standard non polar33892256
Dextrin,5TMS,isomer #320C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3580.2Semi standard non polar33892256
Dextrin,5TMS,isomer #321C[Si](C)(C)O[C@H]1[C@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3625.1Semi standard non polar33892256
Dextrin,5TMS,isomer #322C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3573.0Semi standard non polar33892256
Dextrin,5TMS,isomer #323C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3546.3Semi standard non polar33892256
Dextrin,5TMS,isomer #324C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3579.0Semi standard non polar33892256
Dextrin,5TMS,isomer #325C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3553.3Semi standard non polar33892256
Dextrin,5TMS,isomer #326C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3565.4Semi standard non polar33892256
Dextrin,5TMS,isomer #327C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3559.7Semi standard non polar33892256
Dextrin,5TMS,isomer #328C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3638.6Semi standard non polar33892256
Dextrin,5TMS,isomer #329C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3625.8Semi standard non polar33892256
Dextrin,5TMS,isomer #33C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3504.1Semi standard non polar33892256
Dextrin,5TMS,isomer #330C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O[Si](C)(C)C3618.7Semi standard non polar33892256
Dextrin,5TMS,isomer #331C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3636.7Semi standard non polar33892256
Dextrin,5TMS,isomer #332C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3574.1Semi standard non polar33892256
Dextrin,5TMS,isomer #333C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3590.0Semi standard non polar33892256
Dextrin,5TMS,isomer #334C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3581.5Semi standard non polar33892256
Dextrin,5TMS,isomer #335C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O[Si](C)(C)C3647.9Semi standard non polar33892256
Dextrin,5TMS,isomer #336C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3610.4Semi standard non polar33892256
Dextrin,5TMS,isomer #337C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3575.4Semi standard non polar33892256
Dextrin,5TMS,isomer #338C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3530.9Semi standard non polar33892256
Dextrin,5TMS,isomer #339C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3601.5Semi standard non polar33892256
Dextrin,5TMS,isomer #34C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3531.2Semi standard non polar33892256
Dextrin,5TMS,isomer #340C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3563.2Semi standard non polar33892256
Dextrin,5TMS,isomer #341C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3616.6Semi standard non polar33892256
Dextrin,5TMS,isomer #342C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3507.5Semi standard non polar33892256
Dextrin,5TMS,isomer #343C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3583.7Semi standard non polar33892256
Dextrin,5TMS,isomer #344C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3546.8Semi standard non polar33892256
Dextrin,5TMS,isomer #345C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3595.7Semi standard non polar33892256
Dextrin,5TMS,isomer #346C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3566.4Semi standard non polar33892256
Dextrin,5TMS,isomer #347C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3525.6Semi standard non polar33892256
Dextrin,5TMS,isomer #348C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3582.4Semi standard non polar33892256
Dextrin,5TMS,isomer #349C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3611.1Semi standard non polar33892256
Dextrin,5TMS,isomer #35C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3519.6Semi standard non polar33892256
Dextrin,5TMS,isomer #350C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3630.2Semi standard non polar33892256
Dextrin,5TMS,isomer #351C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3623.2Semi standard non polar33892256
Dextrin,5TMS,isomer #352C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3548.8Semi standard non polar33892256
Dextrin,5TMS,isomer #353C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3617.1Semi standard non polar33892256
Dextrin,5TMS,isomer #354C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3577.5Semi standard non polar33892256
Dextrin,5TMS,isomer #355C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3631.1Semi standard non polar33892256
Dextrin,5TMS,isomer #356C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3556.7Semi standard non polar33892256
Dextrin,5TMS,isomer #357C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3524.2Semi standard non polar33892256
Dextrin,5TMS,isomer #358C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3572.3Semi standard non polar33892256
Dextrin,5TMS,isomer #359C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3589.5Semi standard non polar33892256
Dextrin,5TMS,isomer #36C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3500.1Semi standard non polar33892256
Dextrin,5TMS,isomer #360C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3608.3Semi standard non polar33892256
Dextrin,5TMS,isomer #361C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3603.8Semi standard non polar33892256
Dextrin,5TMS,isomer #362C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3562.3Semi standard non polar33892256
Dextrin,5TMS,isomer #363C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3523.9Semi standard non polar33892256
Dextrin,5TMS,isomer #364C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3578.3Semi standard non polar33892256
Dextrin,5TMS,isomer #365C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3608.7Semi standard non polar33892256
Dextrin,5TMS,isomer #366C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3627.9Semi standard non polar33892256
Dextrin,5TMS,isomer #367C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3623.1Semi standard non polar33892256
Dextrin,5TMS,isomer #368C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3572.8Semi standard non polar33892256
Dextrin,5TMS,isomer #369C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3602.5Semi standard non polar33892256
Dextrin,5TMS,isomer #37C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3551.0Semi standard non polar33892256
Dextrin,5TMS,isomer #370C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3589.5Semi standard non polar33892256
Dextrin,5TMS,isomer #371C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3651.6Semi standard non polar33892256
Dextrin,5TMS,isomer #372C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3569.8Semi standard non polar33892256
Dextrin,5TMS,isomer #373C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@H]1O3642.4Semi standard non polar33892256
Dextrin,5TMS,isomer #374C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@H]1O3604.9Semi standard non polar33892256
Dextrin,5TMS,isomer #375C[Si](C)(C)O[C@H]1[C@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3656.5Semi standard non polar33892256
Dextrin,5TMS,isomer #376C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3595.3Semi standard non polar33892256
Dextrin,5TMS,isomer #377C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3556.5Semi standard non polar33892256
Dextrin,5TMS,isomer #378C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3613.1Semi standard non polar33892256
Dextrin,5TMS,isomer #379C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)O[C@@H]1CO3659.4Semi standard non polar33892256
Dextrin,5TMS,isomer #38C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3493.4Semi standard non polar33892256
Dextrin,5TMS,isomer #380C[Si](C)(C)O[C@H]1C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3644.9Semi standard non polar33892256
Dextrin,5TMS,isomer #381C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@H]1O3659.5Semi standard non polar33892256
Dextrin,5TMS,isomer #382C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3578.4Semi standard non polar33892256
Dextrin,5TMS,isomer #383C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3538.7Semi standard non polar33892256
Dextrin,5TMS,isomer #384C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3593.2Semi standard non polar33892256
Dextrin,5TMS,isomer #385C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@@H]1CO3648.5Semi standard non polar33892256
Dextrin,5TMS,isomer #386C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3632.6Semi standard non polar33892256
Dextrin,5TMS,isomer #387C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@H]1O3647.3Semi standard non polar33892256
Dextrin,5TMS,isomer #388C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3605.0Semi standard non polar33892256
Dextrin,5TMS,isomer #389C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3627.5Semi standard non polar33892256
Dextrin,5TMS,isomer #39C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3517.9Semi standard non polar33892256
Dextrin,5TMS,isomer #390C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3619.5Semi standard non polar33892256
Dextrin,5TMS,isomer #391C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@H]1O[Si](C)(C)C3685.8Semi standard non polar33892256
Dextrin,5TMS,isomer #392C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3596.5Semi standard non polar33892256
Dextrin,5TMS,isomer #393C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3558.1Semi standard non polar33892256
Dextrin,5TMS,isomer #394C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3614.0Semi standard non polar33892256
Dextrin,5TMS,isomer #395C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)O[C@@H]1CO3667.9Semi standard non polar33892256
Dextrin,5TMS,isomer #396C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3651.8Semi standard non polar33892256
Dextrin,5TMS,isomer #397C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@H]1O3670.0Semi standard non polar33892256
Dextrin,5TMS,isomer #398C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3577.5Semi standard non polar33892256
Dextrin,5TMS,isomer #399C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3594.9Semi standard non polar33892256
Dextrin,5TMS,isomer #4C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3483.5Semi standard non polar33892256
Dextrin,5TMS,isomer #40C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3556.9Semi standard non polar33892256
Dextrin,5TMS,isomer #400C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3590.4Semi standard non polar33892256
Dextrin,5TMS,isomer #401C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@H]1O[Si](C)(C)C3648.8Semi standard non polar33892256
Dextrin,5TMS,isomer #402C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3597.6Semi standard non polar33892256
Dextrin,5TMS,isomer #403C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3618.4Semi standard non polar33892256
Dextrin,5TMS,isomer #404C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3614.3Semi standard non polar33892256
Dextrin,5TMS,isomer #405C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@H]1O[Si](C)(C)C3680.4Semi standard non polar33892256
Dextrin,5TMS,isomer #406C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3650.4Semi standard non polar33892256
Dextrin,5TMS,isomer #407C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3532.0Semi standard non polar33892256
Dextrin,5TMS,isomer #408C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3580.0Semi standard non polar33892256
Dextrin,5TMS,isomer #409C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3554.7Semi standard non polar33892256
Dextrin,5TMS,isomer #41C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3594.0Semi standard non polar33892256
Dextrin,5TMS,isomer #410C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3598.3Semi standard non polar33892256
Dextrin,5TMS,isomer #411C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3586.9Semi standard non polar33892256
Dextrin,5TMS,isomer #412C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@@H]1CO3651.6Semi standard non polar33892256
Dextrin,5TMS,isomer #413C[Si](C)(C)O[C@H]1[C@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O)[C@H]2O)[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3631.0Semi standard non polar33892256
Dextrin,5TMS,isomer #414C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3650.2Semi standard non polar33892256
Dextrin,5TMS,isomer #415C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3564.4Semi standard non polar33892256
Dextrin,5TMS,isomer #416C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3602.6Semi standard non polar33892256
Dextrin,5TMS,isomer #417C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3558.5Semi standard non polar33892256
Dextrin,5TMS,isomer #418C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3529.6Semi standard non polar33892256
Dextrin,5TMS,isomer #419C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3568.6Semi standard non polar33892256
Dextrin,5TMS,isomer #42C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3523.3Semi standard non polar33892256
Dextrin,5TMS,isomer #420C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3606.3Semi standard non polar33892256
Dextrin,5TMS,isomer #421C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3625.7Semi standard non polar33892256
Dextrin,5TMS,isomer #422C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3621.9Semi standard non polar33892256
Dextrin,5TMS,isomer #423C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3588.8Semi standard non polar33892256
Dextrin,5TMS,isomer #424C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3609.3Semi standard non polar33892256
Dextrin,5TMS,isomer #425C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3605.6Semi standard non polar33892256
Dextrin,5TMS,isomer #426C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O[Si](C)(C)C3668.6Semi standard non polar33892256
Dextrin,5TMS,isomer #427C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3523.2Semi standard non polar33892256
Dextrin,5TMS,isomer #428C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3496.5Semi standard non polar33892256
Dextrin,5TMS,isomer #429C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3531.1Semi standard non polar33892256
Dextrin,5TMS,isomer #43C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3559.8Semi standard non polar33892256
Dextrin,5TMS,isomer #430C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3574.6Semi standard non polar33892256
Dextrin,5TMS,isomer #431C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3593.3Semi standard non polar33892256
Dextrin,5TMS,isomer #432C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3586.4Semi standard non polar33892256
Dextrin,5TMS,isomer #433C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3568.6Semi standard non polar33892256
Dextrin,5TMS,isomer #434C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3591.7Semi standard non polar33892256
Dextrin,5TMS,isomer #435C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3583.0Semi standard non polar33892256
Dextrin,5TMS,isomer #436C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O[Si](C)(C)C3651.1Semi standard non polar33892256
Dextrin,5TMS,isomer #437C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3544.5Semi standard non polar33892256
Dextrin,5TMS,isomer #438C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3570.1Semi standard non polar33892256
Dextrin,5TMS,isomer #439C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3557.8Semi standard non polar33892256
Dextrin,5TMS,isomer #44C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3552.9Semi standard non polar33892256
Dextrin,5TMS,isomer #440C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3624.3Semi standard non polar33892256
Dextrin,5TMS,isomer #441C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3619.1Semi standard non polar33892256
Dextrin,5TMS,isomer #442C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3537.1Semi standard non polar33892256
Dextrin,5TMS,isomer #443C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3508.1Semi standard non polar33892256
Dextrin,5TMS,isomer #444C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3549.6Semi standard non polar33892256
Dextrin,5TMS,isomer #445C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3586.3Semi standard non polar33892256
Dextrin,5TMS,isomer #446C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3609.9Semi standard non polar33892256
Dextrin,5TMS,isomer #447C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3603.6Semi standard non polar33892256
Dextrin,5TMS,isomer #448C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3582.0Semi standard non polar33892256
Dextrin,5TMS,isomer #449C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3605.5Semi standard non polar33892256
Dextrin,5TMS,isomer #45C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3508.1Semi standard non polar33892256
Dextrin,5TMS,isomer #450C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3598.0Semi standard non polar33892256
Dextrin,5TMS,isomer #451C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O[Si](C)(C)C3665.2Semi standard non polar33892256
Dextrin,5TMS,isomer #452C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3536.1Semi standard non polar33892256
Dextrin,5TMS,isomer #453C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3556.3Semi standard non polar33892256
Dextrin,5TMS,isomer #454C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3548.6Semi standard non polar33892256
Dextrin,5TMS,isomer #455C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3610.2Semi standard non polar33892256
Dextrin,5TMS,isomer #456C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3596.2Semi standard non polar33892256
Dextrin,5TMS,isomer #457C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3545.4Semi standard non polar33892256
Dextrin,5TMS,isomer #458C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3572.5Semi standard non polar33892256
Dextrin,5TMS,isomer #459C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3556.6Semi standard non polar33892256
Dextrin,5TMS,isomer #46C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3529.5Semi standard non polar33892256
Dextrin,5TMS,isomer #460C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3626.2Semi standard non polar33892256
Dextrin,5TMS,isomer #461C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3623.2Semi standard non polar33892256
Dextrin,5TMS,isomer #462C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3592.6Semi standard non polar33892256
Dextrin,5TMS,isomer #47C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3577.0Semi standard non polar33892256
Dextrin,5TMS,isomer #48C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3568.7Semi standard non polar33892256
Dextrin,5TMS,isomer #49C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3555.3Semi standard non polar33892256
Dextrin,5TMS,isomer #5C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3530.6Semi standard non polar33892256
Dextrin,5TMS,isomer #50C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3544.1Semi standard non polar33892256
Dextrin,5TMS,isomer #51C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3528.0Semi standard non polar33892256
Dextrin,5TMS,isomer #52C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3575.2Semi standard non polar33892256
Dextrin,5TMS,isomer #53C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3520.2Semi standard non polar33892256
Dextrin,5TMS,isomer #54C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3543.8Semi standard non polar33892256
Dextrin,5TMS,isomer #55C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3544.3Semi standard non polar33892256
Dextrin,5TMS,isomer #56C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3574.6Semi standard non polar33892256
Dextrin,5TMS,isomer #57C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3517.4Semi standard non polar33892256
Dextrin,5TMS,isomer #58C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3540.6Semi standard non polar33892256
Dextrin,5TMS,isomer #59C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3530.1Semi standard non polar33892256
Dextrin,5TMS,isomer #6C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3480.2Semi standard non polar33892256
Dextrin,5TMS,isomer #60C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3507.8Semi standard non polar33892256
Dextrin,5TMS,isomer #61C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3515.6Semi standard non polar33892256
Dextrin,5TMS,isomer #62C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3553.4Semi standard non polar33892256
Dextrin,5TMS,isomer #63C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3542.8Semi standard non polar33892256
Dextrin,5TMS,isomer #64C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3534.3Semi standard non polar33892256
Dextrin,5TMS,isomer #65C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3552.4Semi standard non polar33892256
Dextrin,5TMS,isomer #66C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3587.0Semi standard non polar33892256
Dextrin,5TMS,isomer #67C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3518.2Semi standard non polar33892256
Dextrin,5TMS,isomer #68C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3552.4Semi standard non polar33892256
Dextrin,5TMS,isomer #69C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3550.0Semi standard non polar33892256
Dextrin,5TMS,isomer #7C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3503.7Semi standard non polar33892256
Dextrin,5TMS,isomer #70C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3509.3Semi standard non polar33892256
Dextrin,5TMS,isomer #71C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3527.1Semi standard non polar33892256
Dextrin,5TMS,isomer #72C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3574.4Semi standard non polar33892256
Dextrin,5TMS,isomer #73C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3563.2Semi standard non polar33892256
Dextrin,5TMS,isomer #74C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3550.0Semi standard non polar33892256
Dextrin,5TMS,isomer #75C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3611.0Semi standard non polar33892256
Dextrin,5TMS,isomer #76C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3548.7Semi standard non polar33892256
Dextrin,5TMS,isomer #77C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3583.0Semi standard non polar33892256
Dextrin,5TMS,isomer #78C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3607.3Semi standard non polar33892256
Dextrin,5TMS,isomer #79C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3598.5Semi standard non polar33892256
Dextrin,5TMS,isomer #8C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3516.9Semi standard non polar33892256
Dextrin,5TMS,isomer #80C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3582.3Semi standard non polar33892256
Dextrin,5TMS,isomer #81C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3569.6Semi standard non polar33892256
Dextrin,5TMS,isomer #82C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3556.3Semi standard non polar33892256
Dextrin,5TMS,isomer #83C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3554.8Semi standard non polar33892256
Dextrin,5TMS,isomer #84C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3601.8Semi standard non polar33892256
Dextrin,5TMS,isomer #85C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3539.8Semi standard non polar33892256
Dextrin,5TMS,isomer #86C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3541.9Semi standard non polar33892256
Dextrin,5TMS,isomer #87C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3513.5Semi standard non polar33892256
Dextrin,5TMS,isomer #88C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3566.3Semi standard non polar33892256
Dextrin,5TMS,isomer #89C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3507.9Semi standard non polar33892256
Dextrin,5TMS,isomer #9C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3513.2Semi standard non polar33892256
Dextrin,5TMS,isomer #90C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3534.2Semi standard non polar33892256
Dextrin,5TMS,isomer #91C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3522.1Semi standard non polar33892256
Dextrin,5TMS,isomer #92C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3501.6Semi standard non polar33892256
Dextrin,5TMS,isomer #93C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3548.6Semi standard non polar33892256
Dextrin,5TMS,isomer #94C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3497.9Semi standard non polar33892256
Dextrin,5TMS,isomer #95C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3520.4Semi standard non polar33892256
Dextrin,5TMS,isomer #96C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3562.5Semi standard non polar33892256
Dextrin,5TMS,isomer #97C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3597.8Semi standard non polar33892256
Dextrin,5TMS,isomer #98C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3526.9Semi standard non polar33892256
Dextrin,5TMS,isomer #99C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3564.6Semi standard non polar33892256
Dextrin,1TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4160.9Semi standard non polar33892256
Dextrin,1TBDMS,isomer #10CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O4183.0Semi standard non polar33892256
Dextrin,1TBDMS,isomer #11CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O4179.9Semi standard non polar33892256
Dextrin,1TBDMS,isomer #2CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O4170.5Semi standard non polar33892256
Dextrin,1TBDMS,isomer #3CC(C)(C)[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O4192.5Semi standard non polar33892256
Dextrin,1TBDMS,isomer #4CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O4168.6Semi standard non polar33892256
Dextrin,1TBDMS,isomer #5CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@@H]1O4161.3Semi standard non polar33892256
Dextrin,1TBDMS,isomer #6CC(C)(C)[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O4179.9Semi standard non polar33892256
Dextrin,1TBDMS,isomer #7CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O4172.9Semi standard non polar33892256
Dextrin,1TBDMS,isomer #8CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O4162.6Semi standard non polar33892256
Dextrin,1TBDMS,isomer #9CC(C)(C)[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4212.3Semi standard non polar33892256
Dextrin,2TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4282.8Semi standard non polar33892256
Dextrin,2TBDMS,isomer #10CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4295.4Semi standard non polar33892256
Dextrin,2TBDMS,isomer #11CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O4300.9Semi standard non polar33892256
Dextrin,2TBDMS,isomer #12CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4286.9Semi standard non polar33892256
Dextrin,2TBDMS,isomer #13CC(C)(C)[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@H]1O4293.4Semi standard non polar33892256
Dextrin,2TBDMS,isomer #14CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H]1O4279.3Semi standard non polar33892256
Dextrin,2TBDMS,isomer #15CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O4275.7Semi standard non polar33892256
Dextrin,2TBDMS,isomer #16CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O4282.7Semi standard non polar33892256
Dextrin,2TBDMS,isomer #17CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4297.0Semi standard non polar33892256
Dextrin,2TBDMS,isomer #18CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@H]1O4301.1Semi standard non polar33892256
Dextrin,2TBDMS,isomer #19CC(C)(C)[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O4306.4Semi standard non polar33892256
Dextrin,2TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4292.9Semi standard non polar33892256
Dextrin,2TBDMS,isomer #20CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4295.5Semi standard non polar33892256
Dextrin,2TBDMS,isomer #21CC(C)(C)[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O4301.7Semi standard non polar33892256
Dextrin,2TBDMS,isomer #22CC(C)(C)[Si](C)(C)O[C@H]1C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]2CO)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O4285.9Semi standard non polar33892256
Dextrin,2TBDMS,isomer #23CC(C)(C)[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O4282.0Semi standard non polar33892256
Dextrin,2TBDMS,isomer #24CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O4288.2Semi standard non polar33892256
Dextrin,2TBDMS,isomer #25CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@H]1O4304.9Semi standard non polar33892256
Dextrin,2TBDMS,isomer #26CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@H]1O4304.8Semi standard non polar33892256
Dextrin,2TBDMS,isomer #27CC(C)(C)[Si](C)(C)O[C@H]1C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@@H](O)[C@@H]1O4312.5Semi standard non polar33892256
Dextrin,2TBDMS,isomer #28CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O4284.4Semi standard non polar33892256
Dextrin,2TBDMS,isomer #29CC(C)(C)[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4267.7Semi standard non polar33892256
Dextrin,2TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4283.8Semi standard non polar33892256
Dextrin,2TBDMS,isomer #30CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O4283.7Semi standard non polar33892256
Dextrin,2TBDMS,isomer #31CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O4273.9Semi standard non polar33892256
Dextrin,2TBDMS,isomer #32CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O4288.2Semi standard non polar33892256
Dextrin,2TBDMS,isomer #33CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O4296.6Semi standard non polar33892256
Dextrin,2TBDMS,isomer #34CC(C)(C)[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4300.2Semi standard non polar33892256
Dextrin,2TBDMS,isomer #35CC(C)(C)[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4288.4Semi standard non polar33892256
Dextrin,2TBDMS,isomer #36CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O4283.3Semi standard non polar33892256
Dextrin,2TBDMS,isomer #37CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O4278.5Semi standard non polar33892256
Dextrin,2TBDMS,isomer #38CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O4294.8Semi standard non polar33892256
Dextrin,2TBDMS,isomer #39CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O4303.3Semi standard non polar33892256
Dextrin,2TBDMS,isomer #4CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4274.0Semi standard non polar33892256
Dextrin,2TBDMS,isomer #40CC(C)(C)[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4304.6Semi standard non polar33892256
Dextrin,2TBDMS,isomer #41CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O4293.1Semi standard non polar33892256
Dextrin,2TBDMS,isomer #42CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O4289.8Semi standard non polar33892256
Dextrin,2TBDMS,isomer #43CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O4304.0Semi standard non polar33892256
Dextrin,2TBDMS,isomer #44CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O4311.6Semi standard non polar33892256
Dextrin,2TBDMS,isomer #45CC(C)(C)[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4322.8Semi standard non polar33892256
Dextrin,2TBDMS,isomer #46CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O4295.9Semi standard non polar33892256
Dextrin,2TBDMS,isomer #47CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O4302.6Semi standard non polar33892256
Dextrin,2TBDMS,isomer #48CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@H]1O4305.2Semi standard non polar33892256
Dextrin,2TBDMS,isomer #49CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4313.0Semi standard non polar33892256
Dextrin,2TBDMS,isomer #5CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4269.7Semi standard non polar33892256
Dextrin,2TBDMS,isomer #50CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4294.0Semi standard non polar33892256
Dextrin,2TBDMS,isomer #51CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4294.7Semi standard non polar33892256
Dextrin,2TBDMS,isomer #52CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4301.8Semi standard non polar33892256
Dextrin,2TBDMS,isomer #53CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@@H]1CO4302.3Semi standard non polar33892256
Dextrin,2TBDMS,isomer #54CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O4313.4Semi standard non polar33892256
Dextrin,2TBDMS,isomer #55CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4303.4Semi standard non polar33892256
Dextrin,2TBDMS,isomer #6CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O4284.3Semi standard non polar33892256
Dextrin,2TBDMS,isomer #7CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4277.2Semi standard non polar33892256
Dextrin,2TBDMS,isomer #8CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O4307.0Semi standard non polar33892256
Dextrin,2TBDMS,isomer #9CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4295.1Semi standard non polar33892256
Dextrin,3TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4342.1Semi standard non polar33892256
Dextrin,3TBDMS,isomer #10CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4323.3Semi standard non polar33892256
Dextrin,3TBDMS,isomer #100CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O4333.8Semi standard non polar33892256
Dextrin,3TBDMS,isomer #101CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)O[C@@H]2CO)[C@H](O)[C@H]1O4345.8Semi standard non polar33892256
Dextrin,3TBDMS,isomer #102CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@H]1O4356.4Semi standard non polar33892256
Dextrin,3TBDMS,isomer #103CC(C)(C)[Si](C)(C)O[C@H]1C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@@H](O)[C@@H]1O4358.0Semi standard non polar33892256
Dextrin,3TBDMS,isomer #104CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4356.2Semi standard non polar33892256
Dextrin,3TBDMS,isomer #105CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4363.7Semi standard non polar33892256
Dextrin,3TBDMS,isomer #106CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4368.7Semi standard non polar33892256
Dextrin,3TBDMS,isomer #107CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@@H]1CO4364.9Semi standard non polar33892256
Dextrin,3TBDMS,isomer #108CC(C)(C)[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H]1O4361.1Semi standard non polar33892256
Dextrin,3TBDMS,isomer #109CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@H]1O4379.4Semi standard non polar33892256
Dextrin,3TBDMS,isomer #11CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4333.3Semi standard non polar33892256
Dextrin,3TBDMS,isomer #110CC(C)(C)[Si](C)(C)O[C@H]1[C@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4345.0Semi standard non polar33892256
Dextrin,3TBDMS,isomer #111CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O4340.4Semi standard non polar33892256
Dextrin,3TBDMS,isomer #112CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O4332.3Semi standard non polar33892256
Dextrin,3TBDMS,isomer #113CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O4342.2Semi standard non polar33892256
Dextrin,3TBDMS,isomer #114CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O4354.3Semi standard non polar33892256
Dextrin,3TBDMS,isomer #115CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4357.8Semi standard non polar33892256
Dextrin,3TBDMS,isomer #116CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O4308.8Semi standard non polar33892256
Dextrin,3TBDMS,isomer #117CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O4316.6Semi standard non polar33892256
Dextrin,3TBDMS,isomer #118CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O4327.8Semi standard non polar33892256
Dextrin,3TBDMS,isomer #119CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O4340.2Semi standard non polar33892256
Dextrin,3TBDMS,isomer #12CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4319.8Semi standard non polar33892256
Dextrin,3TBDMS,isomer #120CC(C)(C)[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4342.3Semi standard non polar33892256
Dextrin,3TBDMS,isomer #121CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O4333.1Semi standard non polar33892256
Dextrin,3TBDMS,isomer #122CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O4334.6Semi standard non polar33892256
Dextrin,3TBDMS,isomer #123CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@H]1O4345.3Semi standard non polar33892256
Dextrin,3TBDMS,isomer #124CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4348.8Semi standard non polar33892256
Dextrin,3TBDMS,isomer #125CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4335.7Semi standard non polar33892256
Dextrin,3TBDMS,isomer #126CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4345.8Semi standard non polar33892256
Dextrin,3TBDMS,isomer #127CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4347.0Semi standard non polar33892256
Dextrin,3TBDMS,isomer #128CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1CO4347.7Semi standard non polar33892256
Dextrin,3TBDMS,isomer #129CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4342.5Semi standard non polar33892256
Dextrin,3TBDMS,isomer #13CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O4343.9Semi standard non polar33892256
Dextrin,3TBDMS,isomer #130CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O4364.8Semi standard non polar33892256
Dextrin,3TBDMS,isomer #131CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O4322.6Semi standard non polar33892256
Dextrin,3TBDMS,isomer #132CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O4329.7Semi standard non polar33892256
Dextrin,3TBDMS,isomer #133CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O4342.2Semi standard non polar33892256
Dextrin,3TBDMS,isomer #134CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O4354.0Semi standard non polar33892256
Dextrin,3TBDMS,isomer #135CC(C)(C)[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4357.5Semi standard non polar33892256
Dextrin,3TBDMS,isomer #136CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O4345.2Semi standard non polar33892256
Dextrin,3TBDMS,isomer #137CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O4346.5Semi standard non polar33892256
Dextrin,3TBDMS,isomer #138CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@H]1O4358.3Semi standard non polar33892256
Dextrin,3TBDMS,isomer #139CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4362.2Semi standard non polar33892256
Dextrin,3TBDMS,isomer #14CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4332.7Semi standard non polar33892256
Dextrin,3TBDMS,isomer #140CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4341.8Semi standard non polar33892256
Dextrin,3TBDMS,isomer #141CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4350.8Semi standard non polar33892256
Dextrin,3TBDMS,isomer #142CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4353.7Semi standard non polar33892256
Dextrin,3TBDMS,isomer #143CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@@H]1CO4350.5Semi standard non polar33892256
Dextrin,3TBDMS,isomer #144CC(C)(C)[Si](C)(C)O[C@H]1[C@@H](O)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)[C@H](O)[C@H]2O)[C@@H]1O4348.4Semi standard non polar33892256
Dextrin,3TBDMS,isomer #145CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O4367.6Semi standard non polar33892256
Dextrin,3TBDMS,isomer #146CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O4336.5Semi standard non polar33892256
Dextrin,3TBDMS,isomer #147CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O4340.9Semi standard non polar33892256
Dextrin,3TBDMS,isomer #148CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@H]1O4354.9Semi standard non polar33892256
Dextrin,3TBDMS,isomer #149CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4355.9Semi standard non polar33892256
Dextrin,3TBDMS,isomer #15CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O4359.9Semi standard non polar33892256
Dextrin,3TBDMS,isomer #150CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4348.3Semi standard non polar33892256
Dextrin,3TBDMS,isomer #151CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4359.7Semi standard non polar33892256
Dextrin,3TBDMS,isomer #152CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4360.7Semi standard non polar33892256
Dextrin,3TBDMS,isomer #153CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@@H]1CO4361.3Semi standard non polar33892256
Dextrin,3TBDMS,isomer #154CC(C)(C)[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O4357.0Semi standard non polar33892256
Dextrin,3TBDMS,isomer #155CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O4378.1Semi standard non polar33892256
Dextrin,3TBDMS,isomer #156CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4348.9Semi standard non polar33892256
Dextrin,3TBDMS,isomer #157CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4359.7Semi standard non polar33892256
Dextrin,3TBDMS,isomer #158CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4361.0Semi standard non polar33892256
Dextrin,3TBDMS,isomer #159CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@H]1O4348.7Semi standard non polar33892256
Dextrin,3TBDMS,isomer #16CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@H]1O4348.0Semi standard non polar33892256
Dextrin,3TBDMS,isomer #160CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4352.9Semi standard non polar33892256
Dextrin,3TBDMS,isomer #161CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4369.9Semi standard non polar33892256
Dextrin,3TBDMS,isomer #162CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4346.1Semi standard non polar33892256
Dextrin,3TBDMS,isomer #163CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4351.0Semi standard non polar33892256
Dextrin,3TBDMS,isomer #164CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C4367.6Semi standard non polar33892256
Dextrin,3TBDMS,isomer #165CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O[Si](C)(C)C(C)(C)C4375.5Semi standard non polar33892256
Dextrin,3TBDMS,isomer #17CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4341.5Semi standard non polar33892256
Dextrin,3TBDMS,isomer #18CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4321.4Semi standard non polar33892256
Dextrin,3TBDMS,isomer #19CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4306.1Semi standard non polar33892256
Dextrin,3TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4332.2Semi standard non polar33892256
Dextrin,3TBDMS,isomer #20CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O4339.0Semi standard non polar33892256
Dextrin,3TBDMS,isomer #21CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4332.6Semi standard non polar33892256
Dextrin,3TBDMS,isomer #22CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O4361.8Semi standard non polar33892256
Dextrin,3TBDMS,isomer #23CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4350.3Semi standard non polar33892256
Dextrin,3TBDMS,isomer #24CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4340.5Semi standard non polar33892256
Dextrin,3TBDMS,isomer #25CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4324.4Semi standard non polar33892256
Dextrin,3TBDMS,isomer #26CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O4333.4Semi standard non polar33892256
Dextrin,3TBDMS,isomer #27CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4324.8Semi standard non polar33892256
Dextrin,3TBDMS,isomer #28CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O4357.2Semi standard non polar33892256
Dextrin,3TBDMS,isomer #29CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4344.6Semi standard non polar33892256
Dextrin,3TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4326.3Semi standard non polar33892256
Dextrin,3TBDMS,isomer #30CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4336.3Semi standard non polar33892256
Dextrin,3TBDMS,isomer #31CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O4323.7Semi standard non polar33892256
Dextrin,3TBDMS,isomer #32CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4318.3Semi standard non polar33892256
Dextrin,3TBDMS,isomer #33CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O4348.4Semi standard non polar33892256
Dextrin,3TBDMS,isomer #34CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4337.8Semi standard non polar33892256
Dextrin,3TBDMS,isomer #35CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4329.5Semi standard non polar33892256
Dextrin,3TBDMS,isomer #36CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O4352.0Semi standard non polar33892256
Dextrin,3TBDMS,isomer #37CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O4369.7Semi standard non polar33892256
Dextrin,3TBDMS,isomer #38CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4354.2Semi standard non polar33892256
Dextrin,3TBDMS,isomer #39CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4349.3Semi standard non polar33892256
Dextrin,3TBDMS,isomer #4CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O4318.9Semi standard non polar33892256
Dextrin,3TBDMS,isomer #40CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O4354.8Semi standard non polar33892256
Dextrin,3TBDMS,isomer #41CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4346.6Semi standard non polar33892256
Dextrin,3TBDMS,isomer #42CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4339.2Semi standard non polar33892256
Dextrin,3TBDMS,isomer #43CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4373.3Semi standard non polar33892256
Dextrin,3TBDMS,isomer #44CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4354.9Semi standard non polar33892256
Dextrin,3TBDMS,isomer #45CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4355.4Semi standard non polar33892256
Dextrin,3TBDMS,isomer #46CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C4364.4Semi standard non polar33892256
Dextrin,3TBDMS,isomer #47CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O4369.2Semi standard non polar33892256
Dextrin,3TBDMS,isomer #48CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]2CO)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O4358.3Semi standard non polar33892256
Dextrin,3TBDMS,isomer #49CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O4351.4Semi standard non polar33892256
Dextrin,3TBDMS,isomer #5CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4342.4Semi standard non polar33892256
Dextrin,3TBDMS,isomer #50CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O4366.4Semi standard non polar33892256
Dextrin,3TBDMS,isomer #51CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@H]1O4373.0Semi standard non polar33892256
Dextrin,3TBDMS,isomer #52CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@H]1O4378.3Semi standard non polar33892256
Dextrin,3TBDMS,isomer #53CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4384.4Semi standard non polar33892256
Dextrin,3TBDMS,isomer #54CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4335.4Semi standard non polar33892256
Dextrin,3TBDMS,isomer #55CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4337.3Semi standard non polar33892256
Dextrin,3TBDMS,isomer #56CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4326.3Semi standard non polar33892256
Dextrin,3TBDMS,isomer #57CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4343.1Semi standard non polar33892256
Dextrin,3TBDMS,isomer #58CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4348.1Semi standard non polar33892256
Dextrin,3TBDMS,isomer #59CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4358.0Semi standard non polar33892256
Dextrin,3TBDMS,isomer #6CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O4329.1Semi standard non polar33892256
Dextrin,3TBDMS,isomer #60CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4356.6Semi standard non polar33892256
Dextrin,3TBDMS,isomer #61CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O4340.7Semi standard non polar33892256
Dextrin,3TBDMS,isomer #62CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4355.1Semi standard non polar33892256
Dextrin,3TBDMS,isomer #63CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@H]1O4371.1Semi standard non polar33892256
Dextrin,3TBDMS,isomer #64CC(C)(C)[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O4365.9Semi standard non polar33892256
Dextrin,3TBDMS,isomer #65CC(C)(C)[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4317.1Semi standard non polar33892256
Dextrin,3TBDMS,isomer #66CC(C)(C)[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4333.4Semi standard non polar33892256
Dextrin,3TBDMS,isomer #67CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O4330.1Semi standard non polar33892256
Dextrin,3TBDMS,isomer #68CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4344.7Semi standard non polar33892256
Dextrin,3TBDMS,isomer #69CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@H]1O4355.9Semi standard non polar33892256
Dextrin,3TBDMS,isomer #7CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O4354.7Semi standard non polar33892256
Dextrin,3TBDMS,isomer #70CC(C)(C)[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O4353.8Semi standard non polar33892256
Dextrin,3TBDMS,isomer #71CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4331.4Semi standard non polar33892256
Dextrin,3TBDMS,isomer #72CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O4326.0Semi standard non polar33892256
Dextrin,3TBDMS,isomer #73CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4337.9Semi standard non polar33892256
Dextrin,3TBDMS,isomer #74CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@H]1O4351.5Semi standard non polar33892256
Dextrin,3TBDMS,isomer #75CC(C)(C)[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O4348.1Semi standard non polar33892256
Dextrin,3TBDMS,isomer #76CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4345.1Semi standard non polar33892256
Dextrin,3TBDMS,isomer #77CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4351.8Semi standard non polar33892256
Dextrin,3TBDMS,isomer #78CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4353.1Semi standard non polar33892256
Dextrin,3TBDMS,isomer #79CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@@H]1CO4352.3Semi standard non polar33892256
Dextrin,3TBDMS,isomer #8CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O4345.2Semi standard non polar33892256
Dextrin,3TBDMS,isomer #80CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4350.0Semi standard non polar33892256
Dextrin,3TBDMS,isomer #81CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@H]1O4370.9Semi standard non polar33892256
Dextrin,3TBDMS,isomer #82CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4343.3Semi standard non polar33892256
Dextrin,3TBDMS,isomer #83CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4348.1Semi standard non polar33892256
Dextrin,3TBDMS,isomer #84CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4332.6Semi standard non polar33892256
Dextrin,3TBDMS,isomer #85CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O4358.4Semi standard non polar33892256
Dextrin,3TBDMS,isomer #86CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4357.3Semi standard non polar33892256
Dextrin,3TBDMS,isomer #87CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4366.4Semi standard non polar33892256
Dextrin,3TBDMS,isomer #88CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4370.2Semi standard non polar33892256
Dextrin,3TBDMS,isomer #89CC(C)(C)[Si](C)(C)O[C@H]1C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O4342.6Semi standard non polar33892256
Dextrin,3TBDMS,isomer #9CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O4340.5Semi standard non polar33892256
Dextrin,3TBDMS,isomer #90CC(C)(C)[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O4323.8Semi standard non polar33892256
Dextrin,3TBDMS,isomer #91CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O4351.7Semi standard non polar33892256
Dextrin,3TBDMS,isomer #92CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@H]1O4362.5Semi standard non polar33892256
Dextrin,3TBDMS,isomer #93CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@H]1O4374.6Semi standard non polar33892256
Dextrin,3TBDMS,isomer #94CC(C)(C)[Si](C)(C)O[C@H]1C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@@H](O)[C@@H]1O4377.1Semi standard non polar33892256
Dextrin,3TBDMS,isomer #95CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C4341.4Semi standard non polar33892256
Dextrin,3TBDMS,isomer #96CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O4343.0Semi standard non polar33892256
Dextrin,3TBDMS,isomer #97CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@H]1O4353.6Semi standard non polar33892256
Dextrin,3TBDMS,isomer #98CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@H]1O4361.2Semi standard non polar33892256
Dextrin,3TBDMS,isomer #99CC(C)(C)[Si](C)(C)O[C@H]1C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@@H](O)[C@@H]1O4365.1Semi standard non polar33892256
Spectra

GC-MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted GC-MSPredicted GC-MS Spectrum - Dextrin GC-MS (Non-derivatized) - 70eV, Positivesplash10-000l-2321900000-2c06af6e8c61473ee7732017-09-01Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Dextrin GC-MS (2 TMS) - 70eV, Positivesplash10-001r-3113049000-cd5e67f8ea9a0f9b65932017-10-06Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Dextrin GC-MS (TMS_3_46) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Dextrin GC-MS (TMS_4_121) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Dextrin GC-MS (TMS_4_122) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Dextrin GC-MS (TMS_4_124) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Dextrin GC-MS (TMS_4_125) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Dextrin GC-MS (TMS_4_126) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Dextrin GC-MS (TMS_5_132) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Dextrin GC-MS (TMS_5_211) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Dextrin GC-MS (TMS_5_213) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Dextrin GC-MS (TMS_5_214) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Dextrin GC-MS (TMS_5_215) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Dextrin GC-MS (TMS_5_218) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Dextrin GC-MS (TMS_5_219) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Dextrin GC-MS (TMS_5_220) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Dextrin GC-MS (TMS_5_226) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Dextrin GC-MS (TMS_5_227) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Dextrin GC-MS (TMS_5_228) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Dextrin GC-MS (TMS_5_229) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Dextrin GC-MS (TBDMS_3_6) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Dextrin GC-MS (TBDMS_3_31) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Dextrin GC-MS (TBDMS_3_40) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Dextrin GC-MS (TBDMS_3_46) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Dextrin GC-MS (TBDMS_3_100) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum

MS/MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Dextrin 10V, Positive-QTOFsplash10-052r-0715940000-a611ddbf40f2815e56052016-08-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Dextrin 20V, Positive-QTOFsplash10-01u9-1905300000-0f116c16ce571966259c2016-08-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Dextrin 40V, Positive-QTOFsplash10-01q9-2911100000-4f0e93369480cd7300d42016-08-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Dextrin 10V, Negative-QTOFsplash10-0udr-1333940000-b5b747b8bf1b190df6582016-08-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Dextrin 20V, Negative-QTOFsplash10-00bi-2913400000-bc68d7c0e198689ae9582016-08-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Dextrin 40V, Negative-QTOFsplash10-004i-4921000000-e1c921124d0c30704c542016-08-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Dextrin 10V, Positive-QTOFsplash10-0a4i-0201490000-5516cf65275ea8244c0c2021-09-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Dextrin 20V, Positive-QTOFsplash10-0bvs-1607930000-133513553ba8d0cecb5a2021-09-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Dextrin 40V, Positive-QTOFsplash10-00bd-9310100000-5740681ad309d019462d2021-09-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Dextrin 10V, Negative-QTOFsplash10-0udi-1002980000-d8f6dba60506c768fd512021-09-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Dextrin 20V, Negative-QTOFsplash10-0pba-9315740000-73a320207e66cfc146e92021-09-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Dextrin 40V, Negative-QTOFsplash10-0a70-9633100000-824013b286e00d77f08c2021-09-24Wishart LabView Spectrum

NMR Spectra

Spectrum TypeDescriptionDeposition DateSourceView
Predicted 1D NMR13C NMR Spectrum (1D, 100 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 100 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 1000 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 1000 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 200 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 200 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 300 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 300 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 400 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 400 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 500 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 500 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 600 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 600 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 700 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 700 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 800 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 800 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 900 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 900 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Biological Properties
Cellular LocationsNot Available
Biospecimen LocationsNot Available
Tissue LocationsNot Available
Pathways
Normal Concentrations
Not Available
Abnormal Concentrations
Not Available
Associated Disorders and Diseases
Disease ReferencesNone
Associated OMIM IDsNone
DrugBank IDNot Available
Phenol Explorer Compound IDNot Available
FooDB IDFDB012148
KNApSAcK IDNot Available
Chemspider ID56445
KEGG Compound IDC00721
BioCyc IDNot Available
BiGG IDNot Available
Wikipedia LinkDextrin
METLIN IDNot Available
PubChem Compound62698
PDB IDNot Available
ChEBI IDNot Available
Food Biomarker OntologyNot Available
VMH IDDEXTRIN
MarkerDB IDNot Available
Good Scents IDNot Available
References
Synthesis ReferenceNot Available
Material Safety Data Sheet (MSDS)Download (PDF)
General References
  1. Slavin JL, Savarino V, Paredes-Diaz A, Fotopoulos G: A review of the role of soluble fiber in health with specific reference to wheat dextrin. J Int Med Res. 2009 Jan-Feb;37(1):1-17. doi: 10.1177/147323000903700101. [PubMed:19215668 ]
  2. Lefranc-Millot C, Guerin-Deremaux L, Wils D, Neut C, Miller LE, Saniez-Degrave MH: Impact of a resistant dextrin on intestinal ecology: how altering the digestive ecosystem with NUTRIOSE(R), a soluble fibre with prebiotic properties, may be beneficial for health. J Int Med Res. 2012;40(1):211-24. doi: 10.1177/147323001204000122. [PubMed:22429361 ]
  3. Nagata J, Saito M: Effects of simultaneous intakes of indigestible dextrin and diacylglycerol on lipid profiles in rats fed cholesterol diets. Nutrition. 2006 Apr;22(4):395-400. doi: 10.1016/j.nut.2005.08.008. Epub 2006 Feb 2. [PubMed:16457989 ]
  4. Yang J, Wang HP, Zhou L, Xu CF: Effect of dietary fiber on constipation: a meta analysis. World J Gastroenterol. 2012 Dec 28;18(48):7378-83. doi: 10.3748/wjg.v18.i48.7378. [PubMed:23326148 ]
  5. Livesey G, Tagami H: Interventions to lower the glycemic response to carbohydrate foods with a low-viscosity fiber (resistant maltodextrin): meta-analysis of randomized controlled trials. Am J Clin Nutr. 2009 Jan;89(1):114-25. doi: 10.3945/ajcn.2008.26842. [PubMed:19126874 ]
  6. Nader N, Weaver A, Eckert S, Lteif A: Effects of fiber supplementation on glycemic excursions and incidence of hypoglycemia in children with type 1 diabetes. Int J Pediatr Endocrinol. 2014;2014(1):13. doi: 10.1186/1687-9856-2014-13. Epub 2014 Jun 21. [PubMed:25024710 ]

Enzymes

General function:
Involved in catalytic activity
Specific function:
Plays an important role in the final stage of carbohydrate digestion. Isomaltase activity is specific for both alpha-1,4- and alpha-1,6-oligosaccharides.
Gene Name:
SI
Uniprot ID:
P14410
Molecular weight:
Not Available
General function:
Involved in catalytic activity
Specific function:
Multifunctional enzyme acting as 1,4-alpha-D-glucan:1,4-alpha-D-glucan 4-alpha-D-glycosyltransferase and amylo-1,6-glucosidase in glycogen degradation.
Gene Name:
AGL
Uniprot ID:
P35573
Molecular weight:
Not Available
General function:
Involved in catalytic activity
Specific function:
Not Available
Gene Name:
AMY1A
Uniprot ID:
P04745
Molecular weight:
Not Available
General function:
Involved in catalytic activity
Specific function:
Not Available
Gene Name:
AMY2A
Uniprot ID:
P04746
Molecular weight:
Not Available
General function:
Involved in catalytic activity
Specific function:
Not Available
Gene Name:
AMY2B
Uniprot ID:
P19961
Molecular weight:
Not Available
General function:
Involved in catalytic activity
Specific function:
May serve as an alternate pathway for starch digestion when luminal alpha-amylase activity is reduced because of immaturity or malnutrition. May play a unique role in the digestion of malted dietary oligosaccharides used in food manufacturing.
Gene Name:
MGAM
Uniprot ID:
O43451
Molecular weight:
Not Available
General function:
Involved in lysozyme activity
Specific function:
Hydrolysis of (1->4)-beta-linkages between N- acetylmuramic acid and N-acetyl-D-glucosamine residues in a peptidoglycan and between N-acetyl-D-glucosamine residues in chitodextrins
Gene Name:
LYZL1
Uniprot ID:
Q6UWQ5
Molecular weight:
16654.0