Hmdb loader
You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Human Metabolome Database.
Record Information
Version5.0
StatusExpected but not Quantified
Creation Date2008-08-13 15:55:03 UTC
Update Date2021-09-14 15:44:46 UTC
HMDB IDHMDB0006857
Secondary Accession Numbers
  • HMDB06857
Metabolite Identification
Common NameDextrin
DescriptionDextrin, derived from dextrose (glucose), is a low-molecular-weight polysaccharide produced from the hydrolysis of starch or glycogen using enzymes such as amylases or via malting/mashing. Dextrin or dextrins are mixtures of polymers of D-glucose units linked by α-(1→4) or α-(1→6) glycosidic bonds. Dextrin is used in adhesives and sizing agents for the textile and paper industry. It is also used in many glue products due to its adhesive properties. Three forms of dextrins are now available; white dextrins, yellow (or canary) dextrins, and British gums (PMID: 19215668 ). Yellow dextrins are used s water-soluble glues and as printing thickeners or binders in paint. White dextrins are used as crispness enhancers in food batters, coatings and glazes. White dextrin is also used as a thickening and binding agent in pharmaceuticals and paper coatings. Dextrin is considered a prebiotic as it promotes healthy intestinal flora (PMID: 22429361 ). Dextrin has been reported to help maintain healthy cholesterol levels by reducing triglycerides (PMID: 16457989 ). Moreover, it eliminates wastes from the body through increased bowel movement frequency (PMID: 23326148 ). Dextrin can be used in combination with other dietary fibers to reduce the glycemic load of a meal, thereby helping to maintain healthy blood sugar levels (PMID: 19126874 , 25024710 ).
Structure
Data?1582752410
Synonyms
ValueSource
British gumHMDB
CaloreenHMDB
Corn dextrinHMDB
Crystal gumHMDB
DextridHMDB
Dextrina biancaHMDB
DextrineHMDB
DextrinsHMDB
FortodexHMDB
Chemical FormulaC18H32O16
Average Molecular Weight504.4371
Monoisotopic Molecular Weight504.169034976
IUPAC Name(3R,4S,5S,6R)-2-{[(2R,3S,4R,5R)-4,5-dihydroxy-2-(hydroxymethyl)-6-{[(2R,3S,4R,5R,6S)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}oxan-3-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol
Traditional Namemicrocrystalline cellulose
CAS Registry Number9004-53-9
SMILES
OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O)C(O[C@H]3[C@H](O)[C@@H](O)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O
InChI Identifier
InChI=1S/C18H32O16/c19-1-4-7(22)8(23)12(27)17(31-4)34-15-6(3-21)32-18(13(28)10(15)25)33-14-5(2-20)30-16(29)11(26)9(14)24/h4-29H,1-3H2/t4-,5-,6-,7-,8+,9-,10-,11-,12-,13-,14-,15-,16+,17?,18?/m1/s1
InChI KeyFYGDTMLNYKFZSV-MRCIVHHJSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as oligosaccharides. These are carbohydrates made up of 3 to 10 monosaccharide units linked to each other through glycosidic bonds.
KingdomOrganic compounds
Super ClassOrganic oxygen compounds
ClassOrganooxygen compounds
Sub ClassCarbohydrates and carbohydrate conjugates
Direct ParentOligosaccharides
Alternative Parents
Substituents
  • Oligosaccharide
  • O-glycosyl compound
  • Glycosyl compound
  • Oxane
  • Secondary alcohol
  • Hemiacetal
  • Oxacycle
  • Organoheterocyclic compound
  • Polyol
  • Acetal
  • Hydrocarbon derivative
  • Primary alcohol
  • Alcohol
  • Aliphatic heteromonocyclic compound
Molecular FrameworkAliphatic heteromonocyclic compounds
External DescriptorsNot Available
Ontology
Disposition

Source

Process

Naturally occurring process

Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water SolubilityNot AvailableNot Available
LogPNot AvailableNot Available
Experimental Chromatographic PropertiesNot Available
Predicted Molecular Properties
PropertyValueSource
Water Solubility554 g/LALOGPS
logP-2.7ALOGPS
logP-6.5ChemAxon
logS0.04ALOGPS
pKa (Strongest Acidic)11.22ChemAxon
pKa (Strongest Basic)-3.6ChemAxon
Physiological Charge0ChemAxon
Hydrogen Acceptor Count16ChemAxon
Hydrogen Donor Count11ChemAxon
Polar Surface Area268.68 ŲChemAxon
Rotatable Bond Count7ChemAxon
Refractivity100.75 m³·mol⁻¹ChemAxon
Polarizability46.19 ųChemAxon
Number of Rings3ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleYesChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DeepCCS[M+H]+202.48930932474
DeepCCS[M-H]-200.64330932474
DeepCCS[M-2H]-234.55730932474
DeepCCS[M+Na]+208.42730932474

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
DextrinOC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O)C(O[C@H]3[C@H](O)[C@@H](O)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3426.2Standard polar33892256
DextrinOC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O)C(O[C@H]3[C@H](O)[C@@H](O)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O4153.2Standard non polar33892256
DextrinOC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O)C(O[C@H]3[C@H](O)[C@@H](O)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O4212.4Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
Dextrin,1TMS,isomer #1C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3976.6Semi standard non polar33892256
Dextrin,1TMS,isomer #10C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3978.6Semi standard non polar33892256
Dextrin,1TMS,isomer #11C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3981.4Semi standard non polar33892256
Dextrin,1TMS,isomer #2C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3976.7Semi standard non polar33892256
Dextrin,1TMS,isomer #3C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O4016.4Semi standard non polar33892256
Dextrin,1TMS,isomer #4C[Si](C)(C)O[C@@H]1[C@@H](O)[C@@H](O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3975.6Semi standard non polar33892256
Dextrin,1TMS,isomer #5C[Si](C)(C)O[C@H]1[C@@H](O)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@@H]1O3974.0Semi standard non polar33892256
Dextrin,1TMS,isomer #6C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3997.9Semi standard non polar33892256
Dextrin,1TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3992.7Semi standard non polar33892256
Dextrin,1TMS,isomer #8C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3977.5Semi standard non polar33892256
Dextrin,1TMS,isomer #9C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4026.5Semi standard non polar33892256
Dextrin,2TMS,isomer #1C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3914.4Semi standard non polar33892256
Dextrin,2TMS,isomer #10C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3924.9Semi standard non polar33892256
Dextrin,2TMS,isomer #11C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3936.0Semi standard non polar33892256
Dextrin,2TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3910.9Semi standard non polar33892256
Dextrin,2TMS,isomer #13C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3913.4Semi standard non polar33892256
Dextrin,2TMS,isomer #14C[Si](C)(C)O[C@H]1[C@@H](O)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3891.4Semi standard non polar33892256
Dextrin,2TMS,isomer #15C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3884.5Semi standard non polar33892256
Dextrin,2TMS,isomer #16C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3899.0Semi standard non polar33892256
Dextrin,2TMS,isomer #17C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3902.5Semi standard non polar33892256
Dextrin,2TMS,isomer #18C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3893.6Semi standard non polar33892256
Dextrin,2TMS,isomer #19C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3929.6Semi standard non polar33892256
Dextrin,2TMS,isomer #2C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3926.1Semi standard non polar33892256
Dextrin,2TMS,isomer #20C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3942.9Semi standard non polar33892256
Dextrin,2TMS,isomer #21C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3948.2Semi standard non polar33892256
Dextrin,2TMS,isomer #22C[Si](C)(C)O[C@H]1C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3927.5Semi standard non polar33892256
Dextrin,2TMS,isomer #23C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3920.1Semi standard non polar33892256
Dextrin,2TMS,isomer #24C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3933.0Semi standard non polar33892256
Dextrin,2TMS,isomer #25C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@H]1O3937.4Semi standard non polar33892256
Dextrin,2TMS,isomer #26C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@H]1O3927.7Semi standard non polar33892256
Dextrin,2TMS,isomer #27C[Si](C)(C)O[C@H]1C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@@H](O)[C@@H]1O3971.2Semi standard non polar33892256
Dextrin,2TMS,isomer #28C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3902.2Semi standard non polar33892256
Dextrin,2TMS,isomer #29C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3896.6Semi standard non polar33892256
Dextrin,2TMS,isomer #3C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3924.3Semi standard non polar33892256
Dextrin,2TMS,isomer #30C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3908.3Semi standard non polar33892256
Dextrin,2TMS,isomer #31C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3892.6Semi standard non polar33892256
Dextrin,2TMS,isomer #32C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3899.0Semi standard non polar33892256
Dextrin,2TMS,isomer #33C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3894.8Semi standard non polar33892256
Dextrin,2TMS,isomer #34C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3929.5Semi standard non polar33892256
Dextrin,2TMS,isomer #35C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3913.4Semi standard non polar33892256
Dextrin,2TMS,isomer #36C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3916.9Semi standard non polar33892256
Dextrin,2TMS,isomer #37C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3903.4Semi standard non polar33892256
Dextrin,2TMS,isomer #38C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3906.9Semi standard non polar33892256
Dextrin,2TMS,isomer #39C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3902.3Semi standard non polar33892256
Dextrin,2TMS,isomer #4C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3905.1Semi standard non polar33892256
Dextrin,2TMS,isomer #40C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3938.4Semi standard non polar33892256
Dextrin,2TMS,isomer #41C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3927.6Semi standard non polar33892256
Dextrin,2TMS,isomer #42C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3922.4Semi standard non polar33892256
Dextrin,2TMS,isomer #43C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3930.1Semi standard non polar33892256
Dextrin,2TMS,isomer #44C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3927.8Semi standard non polar33892256
Dextrin,2TMS,isomer #45C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3959.3Semi standard non polar33892256
Dextrin,2TMS,isomer #46C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3923.0Semi standard non polar33892256
Dextrin,2TMS,isomer #47C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3926.8Semi standard non polar33892256
Dextrin,2TMS,isomer #48C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3921.3Semi standard non polar33892256
Dextrin,2TMS,isomer #49C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3952.9Semi standard non polar33892256
Dextrin,2TMS,isomer #5C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3895.0Semi standard non polar33892256
Dextrin,2TMS,isomer #50C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3914.7Semi standard non polar33892256
Dextrin,2TMS,isomer #51C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3904.5Semi standard non polar33892256
Dextrin,2TMS,isomer #52C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3938.3Semi standard non polar33892256
Dextrin,2TMS,isomer #53C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@@H]1CO3937.7Semi standard non polar33892256
Dextrin,2TMS,isomer #54C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3942.4Semi standard non polar33892256
Dextrin,2TMS,isomer #55C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3916.7Semi standard non polar33892256
Dextrin,2TMS,isomer #6C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3933.4Semi standard non polar33892256
Dextrin,2TMS,isomer #7C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3900.7Semi standard non polar33892256
Dextrin,2TMS,isomer #8C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3948.0Semi standard non polar33892256
Dextrin,2TMS,isomer #9C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3910.8Semi standard non polar33892256
Dextrin,3TMS,isomer #1C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3800.6Semi standard non polar33892256
Dextrin,3TMS,isomer #10C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3821.5Semi standard non polar33892256
Dextrin,3TMS,isomer #100C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3830.9Semi standard non polar33892256
Dextrin,3TMS,isomer #101C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@H]1O3850.8Semi standard non polar33892256
Dextrin,3TMS,isomer #102C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@H]1O3839.6Semi standard non polar33892256
Dextrin,3TMS,isomer #103C[Si](C)(C)O[C@H]1C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@@H](O)[C@@H]1O3870.4Semi standard non polar33892256
Dextrin,3TMS,isomer #104C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3865.6Semi standard non polar33892256
Dextrin,3TMS,isomer #105C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3847.0Semi standard non polar33892256
Dextrin,3TMS,isomer #106C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3888.3Semi standard non polar33892256
Dextrin,3TMS,isomer #107C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@@H]1CO3892.4Semi standard non polar33892256
Dextrin,3TMS,isomer #108C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3871.1Semi standard non polar33892256
Dextrin,3TMS,isomer #109C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@H]1O3889.0Semi standard non polar33892256
Dextrin,3TMS,isomer #11C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3816.4Semi standard non polar33892256
Dextrin,3TMS,isomer #110C[Si](C)(C)O[C@H]1[C@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3833.4Semi standard non polar33892256
Dextrin,3TMS,isomer #111C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3834.8Semi standard non polar33892256
Dextrin,3TMS,isomer #112C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3810.0Semi standard non polar33892256
Dextrin,3TMS,isomer #113C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3842.0Semi standard non polar33892256
Dextrin,3TMS,isomer #114C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3833.3Semi standard non polar33892256
Dextrin,3TMS,isomer #115C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3864.2Semi standard non polar33892256
Dextrin,3TMS,isomer #116C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3806.7Semi standard non polar33892256
Dextrin,3TMS,isomer #117C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3802.8Semi standard non polar33892256
Dextrin,3TMS,isomer #118C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3833.7Semi standard non polar33892256
Dextrin,3TMS,isomer #119C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3827.6Semi standard non polar33892256
Dextrin,3TMS,isomer #12C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3791.2Semi standard non polar33892256
Dextrin,3TMS,isomer #120C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3856.4Semi standard non polar33892256
Dextrin,3TMS,isomer #121C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3788.2Semi standard non polar33892256
Dextrin,3TMS,isomer #122C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3829.7Semi standard non polar33892256
Dextrin,3TMS,isomer #123C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3817.4Semi standard non polar33892256
Dextrin,3TMS,isomer #124C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3861.2Semi standard non polar33892256
Dextrin,3TMS,isomer #125C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3818.1Semi standard non polar33892256
Dextrin,3TMS,isomer #126C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3805.3Semi standard non polar33892256
Dextrin,3TMS,isomer #127C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3845.0Semi standard non polar33892256
Dextrin,3TMS,isomer #128C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1CO3855.8Semi standard non polar33892256
Dextrin,3TMS,isomer #129C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3832.9Semi standard non polar33892256
Dextrin,3TMS,isomer #13C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3856.0Semi standard non polar33892256
Dextrin,3TMS,isomer #130C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3851.0Semi standard non polar33892256
Dextrin,3TMS,isomer #131C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3821.6Semi standard non polar33892256
Dextrin,3TMS,isomer #132C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3820.6Semi standard non polar33892256
Dextrin,3TMS,isomer #133C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3854.7Semi standard non polar33892256
Dextrin,3TMS,isomer #134C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3848.5Semi standard non polar33892256
Dextrin,3TMS,isomer #135C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O3877.1Semi standard non polar33892256
Dextrin,3TMS,isomer #136C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3809.3Semi standard non polar33892256
Dextrin,3TMS,isomer #137C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3848.6Semi standard non polar33892256
Dextrin,3TMS,isomer #138C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3835.8Semi standard non polar33892256
Dextrin,3TMS,isomer #139C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3874.4Semi standard non polar33892256
Dextrin,3TMS,isomer #14C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3803.2Semi standard non polar33892256
Dextrin,3TMS,isomer #140C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3833.7Semi standard non polar33892256
Dextrin,3TMS,isomer #141C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3820.3Semi standard non polar33892256
Dextrin,3TMS,isomer #142C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3857.0Semi standard non polar33892256
Dextrin,3TMS,isomer #143C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@@H]1CO3869.8Semi standard non polar33892256
Dextrin,3TMS,isomer #144C[Si](C)(C)O[C@H]1[C@@H](O)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O)[C@H]2O)[C@@H]1O3848.2Semi standard non polar33892256
Dextrin,3TMS,isomer #145C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3864.7Semi standard non polar33892256
Dextrin,3TMS,isomer #146C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3816.0Semi standard non polar33892256
Dextrin,3TMS,isomer #147C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3857.1Semi standard non polar33892256
Dextrin,3TMS,isomer #148C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3845.6Semi standard non polar33892256
Dextrin,3TMS,isomer #149C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3886.9Semi standard non polar33892256
Dextrin,3TMS,isomer #15C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3875.8Semi standard non polar33892256
Dextrin,3TMS,isomer #150C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3849.1Semi standard non polar33892256
Dextrin,3TMS,isomer #151C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3835.1Semi standard non polar33892256
Dextrin,3TMS,isomer #152C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3875.6Semi standard non polar33892256
Dextrin,3TMS,isomer #153C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@@H]1CO3884.1Semi standard non polar33892256
Dextrin,3TMS,isomer #154C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3861.0Semi standard non polar33892256
Dextrin,3TMS,isomer #155C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3879.5Semi standard non polar33892256
Dextrin,3TMS,isomer #156C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3828.4Semi standard non polar33892256
Dextrin,3TMS,isomer #157C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3812.3Semi standard non polar33892256
Dextrin,3TMS,isomer #158C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3869.2Semi standard non polar33892256
Dextrin,3TMS,isomer #159C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3845.3Semi standard non polar33892256
Dextrin,3TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3814.7Semi standard non polar33892256
Dextrin,3TMS,isomer #160C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3877.4Semi standard non polar33892256
Dextrin,3TMS,isomer #161C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3869.8Semi standard non polar33892256
Dextrin,3TMS,isomer #162C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3831.8Semi standard non polar33892256
Dextrin,3TMS,isomer #163C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3864.1Semi standard non polar33892256
Dextrin,3TMS,isomer #164C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3853.8Semi standard non polar33892256
Dextrin,3TMS,isomer #165C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O[Si](C)(C)C3876.2Semi standard non polar33892256
Dextrin,3TMS,isomer #17C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3835.6Semi standard non polar33892256
Dextrin,3TMS,isomer #18C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3826.7Semi standard non polar33892256
Dextrin,3TMS,isomer #19C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3808.1Semi standard non polar33892256
Dextrin,3TMS,isomer #2C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3813.6Semi standard non polar33892256
Dextrin,3TMS,isomer #20C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3864.3Semi standard non polar33892256
Dextrin,3TMS,isomer #21C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3823.8Semi standard non polar33892256
Dextrin,3TMS,isomer #22C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3884.3Semi standard non polar33892256
Dextrin,3TMS,isomer #23C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3836.7Semi standard non polar33892256
Dextrin,3TMS,isomer #24C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3852.6Semi standard non polar33892256
Dextrin,3TMS,isomer #25C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3814.9Semi standard non polar33892256
Dextrin,3TMS,isomer #26C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3847.7Semi standard non polar33892256
Dextrin,3TMS,isomer #27C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3809.9Semi standard non polar33892256
Dextrin,3TMS,isomer #28C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3867.6Semi standard non polar33892256
Dextrin,3TMS,isomer #29C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3821.9Semi standard non polar33892256
Dextrin,3TMS,isomer #3C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3792.0Semi standard non polar33892256
Dextrin,3TMS,isomer #30C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3835.9Semi standard non polar33892256
Dextrin,3TMS,isomer #31C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3830.7Semi standard non polar33892256
Dextrin,3TMS,isomer #32C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3793.6Semi standard non polar33892256
Dextrin,3TMS,isomer #33C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3852.9Semi standard non polar33892256
Dextrin,3TMS,isomer #34C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3807.6Semi standard non polar33892256
Dextrin,3TMS,isomer #35C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3819.5Semi standard non polar33892256
Dextrin,3TMS,isomer #36C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3852.0Semi standard non polar33892256
Dextrin,3TMS,isomer #37C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3894.1Semi standard non polar33892256
Dextrin,3TMS,isomer #38C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3850.4Semi standard non polar33892256
Dextrin,3TMS,isomer #39C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3871.3Semi standard non polar33892256
Dextrin,3TMS,isomer #4C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3780.0Semi standard non polar33892256
Dextrin,3TMS,isomer #40C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3858.5Semi standard non polar33892256
Dextrin,3TMS,isomer #41C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3812.2Semi standard non polar33892256
Dextrin,3TMS,isomer #42C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3832.5Semi standard non polar33892256
Dextrin,3TMS,isomer #43C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3870.6Semi standard non polar33892256
Dextrin,3TMS,isomer #44C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3879.4Semi standard non polar33892256
Dextrin,3TMS,isomer #45C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3842.8Semi standard non polar33892256
Dextrin,3TMS,isomer #46C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3857.4Semi standard non polar33892256
Dextrin,3TMS,isomer #47C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3863.5Semi standard non polar33892256
Dextrin,3TMS,isomer #48C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3851.5Semi standard non polar33892256
Dextrin,3TMS,isomer #49C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3836.2Semi standard non polar33892256
Dextrin,3TMS,isomer #5C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3846.3Semi standard non polar33892256
Dextrin,3TMS,isomer #50C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3852.9Semi standard non polar33892256
Dextrin,3TMS,isomer #51C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@H]1O3868.4Semi standard non polar33892256
Dextrin,3TMS,isomer #52C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@H]1O3856.2Semi standard non polar33892256
Dextrin,3TMS,isomer #53C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3888.8Semi standard non polar33892256
Dextrin,3TMS,isomer #54C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3824.5Semi standard non polar33892256
Dextrin,3TMS,isomer #55C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3818.4Semi standard non polar33892256
Dextrin,3TMS,isomer #56C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3803.4Semi standard non polar33892256
Dextrin,3TMS,isomer #57C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3788.9Semi standard non polar33892256
Dextrin,3TMS,isomer #58C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3838.9Semi standard non polar33892256
Dextrin,3TMS,isomer #59C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3822.5Semi standard non polar33892256
Dextrin,3TMS,isomer #6C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3780.6Semi standard non polar33892256
Dextrin,3TMS,isomer #60C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3862.2Semi standard non polar33892256
Dextrin,3TMS,isomer #61C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3813.8Semi standard non polar33892256
Dextrin,3TMS,isomer #62C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3849.4Semi standard non polar33892256
Dextrin,3TMS,isomer #63C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3842.7Semi standard non polar33892256
Dextrin,3TMS,isomer #64C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3870.0Semi standard non polar33892256
Dextrin,3TMS,isomer #65C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3808.5Semi standard non polar33892256
Dextrin,3TMS,isomer #66C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3829.4Semi standard non polar33892256
Dextrin,3TMS,isomer #67C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3796.9Semi standard non polar33892256
Dextrin,3TMS,isomer #68C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3837.1Semi standard non polar33892256
Dextrin,3TMS,isomer #69C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3828.5Semi standard non polar33892256
Dextrin,3TMS,isomer #7C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3861.2Semi standard non polar33892256
Dextrin,3TMS,isomer #70C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3854.0Semi standard non polar33892256
Dextrin,3TMS,isomer #71C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3819.9Semi standard non polar33892256
Dextrin,3TMS,isomer #72C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3786.8Semi standard non polar33892256
Dextrin,3TMS,isomer #73C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3822.4Semi standard non polar33892256
Dextrin,3TMS,isomer #74C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3812.8Semi standard non polar33892256
Dextrin,3TMS,isomer #75C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3840.4Semi standard non polar33892256
Dextrin,3TMS,isomer #76C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3827.1Semi standard non polar33892256
Dextrin,3TMS,isomer #77C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3806.6Semi standard non polar33892256
Dextrin,3TMS,isomer #78C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3849.8Semi standard non polar33892256
Dextrin,3TMS,isomer #79C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3862.6Semi standard non polar33892256
Dextrin,3TMS,isomer #8C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3794.0Semi standard non polar33892256
Dextrin,3TMS,isomer #80C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3840.2Semi standard non polar33892256
Dextrin,3TMS,isomer #81C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3854.9Semi standard non polar33892256
Dextrin,3TMS,isomer #82C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3867.6Semi standard non polar33892256
Dextrin,3TMS,isomer #83C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3858.0Semi standard non polar33892256
Dextrin,3TMS,isomer #84C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3839.0Semi standard non polar33892256
Dextrin,3TMS,isomer #85C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3858.6Semi standard non polar33892256
Dextrin,3TMS,isomer #86C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3874.9Semi standard non polar33892256
Dextrin,3TMS,isomer #87C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3860.1Semi standard non polar33892256
Dextrin,3TMS,isomer #88C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3897.8Semi standard non polar33892256
Dextrin,3TMS,isomer #89C[Si](C)(C)O[C@H]1C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3863.7Semi standard non polar33892256
Dextrin,3TMS,isomer #9C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3818.5Semi standard non polar33892256
Dextrin,3TMS,isomer #90C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3840.8Semi standard non polar33892256
Dextrin,3TMS,isomer #91C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3863.6Semi standard non polar33892256
Dextrin,3TMS,isomer #92C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@H]1O3879.6Semi standard non polar33892256
Dextrin,3TMS,isomer #93C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@H]1O3871.9Semi standard non polar33892256
Dextrin,3TMS,isomer #94C[Si](C)(C)O[C@H]1C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@@H](O)[C@@H]1O3899.2Semi standard non polar33892256
Dextrin,3TMS,isomer #95C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3851.8Semi standard non polar33892256
Dextrin,3TMS,isomer #96C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3844.3Semi standard non polar33892256
Dextrin,3TMS,isomer #97C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@H]1O3865.1Semi standard non polar33892256
Dextrin,3TMS,isomer #98C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@H]1O3855.9Semi standard non polar33892256
Dextrin,3TMS,isomer #99C[Si](C)(C)O[C@H]1C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@@H](O)[C@@H]1O3885.2Semi standard non polar33892256
Dextrin,4TMS,isomer #1C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3633.7Semi standard non polar33892256
Dextrin,4TMS,isomer #10C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3647.4Semi standard non polar33892256
Dextrin,4TMS,isomer #100C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3718.7Semi standard non polar33892256
Dextrin,4TMS,isomer #101C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3721.9Semi standard non polar33892256
Dextrin,4TMS,isomer #102C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3760.5Semi standard non polar33892256
Dextrin,4TMS,isomer #103C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3702.1Semi standard non polar33892256
Dextrin,4TMS,isomer #104C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3730.0Semi standard non polar33892256
Dextrin,4TMS,isomer #105C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3723.4Semi standard non polar33892256
Dextrin,4TMS,isomer #106C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3677.5Semi standard non polar33892256
Dextrin,4TMS,isomer #107C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3703.6Semi standard non polar33892256
Dextrin,4TMS,isomer #108C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3743.7Semi standard non polar33892256
Dextrin,4TMS,isomer #109C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3744.2Semi standard non polar33892256
Dextrin,4TMS,isomer #11C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3694.5Semi standard non polar33892256
Dextrin,4TMS,isomer #110C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3722.3Semi standard non polar33892256
Dextrin,4TMS,isomer #111C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3779.3Semi standard non polar33892256
Dextrin,4TMS,isomer #112C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3728.5Semi standard non polar33892256
Dextrin,4TMS,isomer #113C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3758.1Semi standard non polar33892256
Dextrin,4TMS,isomer #114C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3777.1Semi standard non polar33892256
Dextrin,4TMS,isomer #115C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3780.6Semi standard non polar33892256
Dextrin,4TMS,isomer #116C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3754.0Semi standard non polar33892256
Dextrin,4TMS,isomer #117C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3735.5Semi standard non polar33892256
Dextrin,4TMS,isomer #118C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3734.7Semi standard non polar33892256
Dextrin,4TMS,isomer #119C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3719.0Semi standard non polar33892256
Dextrin,4TMS,isomer #12C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3648.6Semi standard non polar33892256
Dextrin,4TMS,isomer #120C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3773.4Semi standard non polar33892256
Dextrin,4TMS,isomer #121C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3739.7Semi standard non polar33892256
Dextrin,4TMS,isomer #122C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3733.7Semi standard non polar33892256
Dextrin,4TMS,isomer #123C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3724.2Semi standard non polar33892256
Dextrin,4TMS,isomer #124C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3709.4Semi standard non polar33892256
Dextrin,4TMS,isomer #125C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3762.3Semi standard non polar33892256
Dextrin,4TMS,isomer #126C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3738.0Semi standard non polar33892256
Dextrin,4TMS,isomer #127C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3776.7Semi standard non polar33892256
Dextrin,4TMS,isomer #128C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3759.9Semi standard non polar33892256
Dextrin,4TMS,isomer #129C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3741.9Semi standard non polar33892256
Dextrin,4TMS,isomer #13C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3714.0Semi standard non polar33892256
Dextrin,4TMS,isomer #130C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3737.9Semi standard non polar33892256
Dextrin,4TMS,isomer #131C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@H]1O3793.3Semi standard non polar33892256
Dextrin,4TMS,isomer #132C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@H]1O3769.7Semi standard non polar33892256
Dextrin,4TMS,isomer #133C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3802.1Semi standard non polar33892256
Dextrin,4TMS,isomer #134C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3755.3Semi standard non polar33892256
Dextrin,4TMS,isomer #135C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3720.9Semi standard non polar33892256
Dextrin,4TMS,isomer #136C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@H]1O3765.6Semi standard non polar33892256
Dextrin,4TMS,isomer #137C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@H]1O3742.1Semi standard non polar33892256
Dextrin,4TMS,isomer #138C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3781.7Semi standard non polar33892256
Dextrin,4TMS,isomer #139C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3711.6Semi standard non polar33892256
Dextrin,4TMS,isomer #14C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3661.0Semi standard non polar33892256
Dextrin,4TMS,isomer #140C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@H]1O3771.8Semi standard non polar33892256
Dextrin,4TMS,isomer #141C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@H]1O3752.8Semi standard non polar33892256
Dextrin,4TMS,isomer #142C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3781.7Semi standard non polar33892256
Dextrin,4TMS,isomer #143C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3756.7Semi standard non polar33892256
Dextrin,4TMS,isomer #144C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3732.0Semi standard non polar33892256
Dextrin,4TMS,isomer #145C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3766.9Semi standard non polar33892256
Dextrin,4TMS,isomer #146C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@@H]1CO3805.6Semi standard non polar33892256
Dextrin,4TMS,isomer #147C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3783.5Semi standard non polar33892256
Dextrin,4TMS,isomer #148C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@H]1O3793.6Semi standard non polar33892256
Dextrin,4TMS,isomer #149C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3688.8Semi standard non polar33892256
Dextrin,4TMS,isomer #15C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3687.2Semi standard non polar33892256
Dextrin,4TMS,isomer #150C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3670.6Semi standard non polar33892256
Dextrin,4TMS,isomer #151C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3644.9Semi standard non polar33892256
Dextrin,4TMS,isomer #152C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3722.8Semi standard non polar33892256
Dextrin,4TMS,isomer #153C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3700.8Semi standard non polar33892256
Dextrin,4TMS,isomer #154C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3732.4Semi standard non polar33892256
Dextrin,4TMS,isomer #155C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3706.2Semi standard non polar33892256
Dextrin,4TMS,isomer #156C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3652.6Semi standard non polar33892256
Dextrin,4TMS,isomer #157C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3717.2Semi standard non polar33892256
Dextrin,4TMS,isomer #158C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3691.0Semi standard non polar33892256
Dextrin,4TMS,isomer #159C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3722.8Semi standard non polar33892256
Dextrin,4TMS,isomer #16C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3663.7Semi standard non polar33892256
Dextrin,4TMS,isomer #160C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3631.7Semi standard non polar33892256
Dextrin,4TMS,isomer #161C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3706.2Semi standard non polar33892256
Dextrin,4TMS,isomer #162C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3685.4Semi standard non polar33892256
Dextrin,4TMS,isomer #163C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3717.5Semi standard non polar33892256
Dextrin,4TMS,isomer #164C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3673.0Semi standard non polar33892256
Dextrin,4TMS,isomer #165C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3651.1Semi standard non polar33892256
Dextrin,4TMS,isomer #166C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3685.1Semi standard non polar33892256
Dextrin,4TMS,isomer #167C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3711.6Semi standard non polar33892256
Dextrin,4TMS,isomer #168C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3738.2Semi standard non polar33892256
Dextrin,4TMS,isomer #169C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3729.0Semi standard non polar33892256
Dextrin,4TMS,isomer #17C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3690.2Semi standard non polar33892256
Dextrin,4TMS,isomer #170C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3678.1Semi standard non polar33892256
Dextrin,4TMS,isomer #171C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3661.4Semi standard non polar33892256
Dextrin,4TMS,isomer #172C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3711.5Semi standard non polar33892256
Dextrin,4TMS,isomer #173C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3687.7Semi standard non polar33892256
Dextrin,4TMS,isomer #174C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3716.7Semi standard non polar33892256
Dextrin,4TMS,isomer #175C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3746.8Semi standard non polar33892256
Dextrin,4TMS,isomer #176C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3735.3Semi standard non polar33892256
Dextrin,4TMS,isomer #177C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3778.1Semi standard non polar33892256
Dextrin,4TMS,isomer #178C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3758.6Semi standard non polar33892256
Dextrin,4TMS,isomer #179C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3769.9Semi standard non polar33892256
Dextrin,4TMS,isomer #18C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3642.9Semi standard non polar33892256
Dextrin,4TMS,isomer #180C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3723.9Semi standard non polar33892256
Dextrin,4TMS,isomer #181C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3709.3Semi standard non polar33892256
Dextrin,4TMS,isomer #182C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3752.4Semi standard non polar33892256
Dextrin,4TMS,isomer #183C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O3740.0Semi standard non polar33892256
Dextrin,4TMS,isomer #184C[Si](C)(C)O[C@H]1[C@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3727.3Semi standard non polar33892256
Dextrin,4TMS,isomer #185C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3677.5Semi standard non polar33892256
Dextrin,4TMS,isomer #186C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3695.1Semi standard non polar33892256
Dextrin,4TMS,isomer #187C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3671.6Semi standard non polar33892256
Dextrin,4TMS,isomer #188C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3698.6Semi standard non polar33892256
Dextrin,4TMS,isomer #189C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3745.6Semi standard non polar33892256
Dextrin,4TMS,isomer #19C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3702.3Semi standard non polar33892256
Dextrin,4TMS,isomer #190C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3743.6Semi standard non polar33892256
Dextrin,4TMS,isomer #191C[Si](C)(C)O[C@H]1[C@@H](O)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3728.3Semi standard non polar33892256
Dextrin,4TMS,isomer #192C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3742.5Semi standard non polar33892256
Dextrin,4TMS,isomer #193C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3723.1Semi standard non polar33892256
Dextrin,4TMS,isomer #194C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3752.0Semi standard non polar33892256
Dextrin,4TMS,isomer #195C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3695.3Semi standard non polar33892256
Dextrin,4TMS,isomer #196C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3673.9Semi standard non polar33892256
Dextrin,4TMS,isomer #197C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3701.3Semi standard non polar33892256
Dextrin,4TMS,isomer #198C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3758.7Semi standard non polar33892256
Dextrin,4TMS,isomer #199C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3739.4Semi standard non polar33892256
Dextrin,4TMS,isomer #2C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3637.1Semi standard non polar33892256
Dextrin,4TMS,isomer #20C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3651.9Semi standard non polar33892256
Dextrin,4TMS,isomer #200C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3755.8Semi standard non polar33892256
Dextrin,4TMS,isomer #201C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3699.2Semi standard non polar33892256
Dextrin,4TMS,isomer #202C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3723.7Semi standard non polar33892256
Dextrin,4TMS,isomer #203C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3714.4Semi standard non polar33892256
Dextrin,4TMS,isomer #204C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O[Si](C)(C)C3775.9Semi standard non polar33892256
Dextrin,4TMS,isomer #205C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3721.0Semi standard non polar33892256
Dextrin,4TMS,isomer #206C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3696.6Semi standard non polar33892256
Dextrin,4TMS,isomer #207C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3693.3Semi standard non polar33892256
Dextrin,4TMS,isomer #208C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3755.6Semi standard non polar33892256
Dextrin,4TMS,isomer #209C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3728.2Semi standard non polar33892256
Dextrin,4TMS,isomer #21C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3678.9Semi standard non polar33892256
Dextrin,4TMS,isomer #210C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3773.5Semi standard non polar33892256
Dextrin,4TMS,isomer #211C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3736.3Semi standard non polar33892256
Dextrin,4TMS,isomer #212C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3701.3Semi standard non polar33892256
Dextrin,4TMS,isomer #213C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3747.3Semi standard non polar33892256
Dextrin,4TMS,isomer #214C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3717.5Semi standard non polar33892256
Dextrin,4TMS,isomer #215C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3761.2Semi standard non polar33892256
Dextrin,4TMS,isomer #216C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3680.5Semi standard non polar33892256
Dextrin,4TMS,isomer #217C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3737.9Semi standard non polar33892256
Dextrin,4TMS,isomer #218C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3712.2Semi standard non polar33892256
Dextrin,4TMS,isomer #219C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3755.4Semi standard non polar33892256
Dextrin,4TMS,isomer #22C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3675.1Semi standard non polar33892256
Dextrin,4TMS,isomer #220C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3724.4Semi standard non polar33892256
Dextrin,4TMS,isomer #221C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3701.3Semi standard non polar33892256
Dextrin,4TMS,isomer #222C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3741.7Semi standard non polar33892256
Dextrin,4TMS,isomer #223C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3749.1Semi standard non polar33892256
Dextrin,4TMS,isomer #224C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3780.6Semi standard non polar33892256
Dextrin,4TMS,isomer #225C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3771.4Semi standard non polar33892256
Dextrin,4TMS,isomer #226C[Si](C)(C)O[C@H]1[C@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3753.3Semi standard non polar33892256
Dextrin,4TMS,isomer #227C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3719.8Semi standard non polar33892256
Dextrin,4TMS,isomer #228C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@H]1O3774.1Semi standard non polar33892256
Dextrin,4TMS,isomer #229C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@H]1O3747.1Semi standard non polar33892256
Dextrin,4TMS,isomer #23C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3636.2Semi standard non polar33892256
Dextrin,4TMS,isomer #230C[Si](C)(C)O[C@H]1C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@@H](O)[C@@H]1O3794.6Semi standard non polar33892256
Dextrin,4TMS,isomer #231C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3695.3Semi standard non polar33892256
Dextrin,4TMS,isomer #232C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@H]1O3759.0Semi standard non polar33892256
Dextrin,4TMS,isomer #233C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@H]1O3731.5Semi standard non polar33892256
Dextrin,4TMS,isomer #234C[Si](C)(C)O[C@H]1C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@@H](O)[C@@H]1O3779.8Semi standard non polar33892256
Dextrin,4TMS,isomer #235C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3754.4Semi standard non polar33892256
Dextrin,4TMS,isomer #236C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3726.2Semi standard non polar33892256
Dextrin,4TMS,isomer #237C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3771.7Semi standard non polar33892256
Dextrin,4TMS,isomer #238C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@@H]1CO3816.6Semi standard non polar33892256
Dextrin,4TMS,isomer #239C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3786.9Semi standard non polar33892256
Dextrin,4TMS,isomer #24C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3700.3Semi standard non polar33892256
Dextrin,4TMS,isomer #240C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@H]1O3805.7Semi standard non polar33892256
Dextrin,4TMS,isomer #241C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3715.0Semi standard non polar33892256
Dextrin,4TMS,isomer #242C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@H]1O3771.1Semi standard non polar33892256
Dextrin,4TMS,isomer #243C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@H]1O3747.5Semi standard non polar33892256
Dextrin,4TMS,isomer #244C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3791.2Semi standard non polar33892256
Dextrin,4TMS,isomer #245C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3735.9Semi standard non polar33892256
Dextrin,4TMS,isomer #246C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3712.3Semi standard non polar33892256
Dextrin,4TMS,isomer #247C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3748.7Semi standard non polar33892256
Dextrin,4TMS,isomer #248C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)O[C@@H]1CO3779.6Semi standard non polar33892256
Dextrin,4TMS,isomer #249C[Si](C)(C)O[C@H]1C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3758.2Semi standard non polar33892256
Dextrin,4TMS,isomer #25C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3649.1Semi standard non polar33892256
Dextrin,4TMS,isomer #250C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@H]1O3779.1Semi standard non polar33892256
Dextrin,4TMS,isomer #251C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3731.4Semi standard non polar33892256
Dextrin,4TMS,isomer #252C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3707.0Semi standard non polar33892256
Dextrin,4TMS,isomer #253C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3747.2Semi standard non polar33892256
Dextrin,4TMS,isomer #254C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@@H]1CO3797.4Semi standard non polar33892256
Dextrin,4TMS,isomer #255C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3766.6Semi standard non polar33892256
Dextrin,4TMS,isomer #256C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@H]1O3790.1Semi standard non polar33892256
Dextrin,4TMS,isomer #257C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3745.9Semi standard non polar33892256
Dextrin,4TMS,isomer #258C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3776.9Semi standard non polar33892256
Dextrin,4TMS,isomer #259C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3766.0Semi standard non polar33892256
Dextrin,4TMS,isomer #26C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3673.5Semi standard non polar33892256
Dextrin,4TMS,isomer #260C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@H]1O[Si](C)(C)C3814.5Semi standard non polar33892256
Dextrin,4TMS,isomer #261C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3697.5Semi standard non polar33892256
Dextrin,4TMS,isomer #262C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3760.5Semi standard non polar33892256
Dextrin,4TMS,isomer #263C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3742.4Semi standard non polar33892256
Dextrin,4TMS,isomer #264C[Si](C)(C)O[C@H]1[C@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3776.5Semi standard non polar33892256
Dextrin,4TMS,isomer #265C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3699.1Semi standard non polar33892256
Dextrin,4TMS,isomer #266C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3676.0Semi standard non polar33892256
Dextrin,4TMS,isomer #267C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3741.8Semi standard non polar33892256
Dextrin,4TMS,isomer #268C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3716.5Semi standard non polar33892256
Dextrin,4TMS,isomer #269C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3755.7Semi standard non polar33892256
Dextrin,4TMS,isomer #27C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3706.9Semi standard non polar33892256
Dextrin,4TMS,isomer #270C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3723.6Semi standard non polar33892256
Dextrin,4TMS,isomer #271C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3699.5Semi standard non polar33892256
Dextrin,4TMS,isomer #272C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3733.5Semi standard non polar33892256
Dextrin,4TMS,isomer #273C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@@H]1CO3779.3Semi standard non polar33892256
Dextrin,4TMS,isomer #274C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3756.5Semi standard non polar33892256
Dextrin,4TMS,isomer #275C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3776.6Semi standard non polar33892256
Dextrin,4TMS,isomer #276C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3637.1Semi standard non polar33892256
Dextrin,4TMS,isomer #277C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3709.2Semi standard non polar33892256
Dextrin,4TMS,isomer #278C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3683.9Semi standard non polar33892256
Dextrin,4TMS,isomer #279C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3720.7Semi standard non polar33892256
Dextrin,4TMS,isomer #28C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3741.9Semi standard non polar33892256
Dextrin,4TMS,isomer #280C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3709.1Semi standard non polar33892256
Dextrin,4TMS,isomer #281C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3683.2Semi standard non polar33892256
Dextrin,4TMS,isomer #282C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3718.4Semi standard non polar33892256
Dextrin,4TMS,isomer #283C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1CO3766.9Semi standard non polar33892256
Dextrin,4TMS,isomer #284C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3744.8Semi standard non polar33892256
Dextrin,4TMS,isomer #285C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3760.1Semi standard non polar33892256
Dextrin,4TMS,isomer #286C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3679.3Semi standard non polar33892256
Dextrin,4TMS,isomer #287C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3656.8Semi standard non polar33892256
Dextrin,4TMS,isomer #288C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3694.8Semi standard non polar33892256
Dextrin,4TMS,isomer #289C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3714.1Semi standard non polar33892256
Dextrin,4TMS,isomer #29C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3689.5Semi standard non polar33892256
Dextrin,4TMS,isomer #290C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3747.0Semi standard non polar33892256
Dextrin,4TMS,isomer #291C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3735.3Semi standard non polar33892256
Dextrin,4TMS,isomer #292C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3710.2Semi standard non polar33892256
Dextrin,4TMS,isomer #293C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3738.9Semi standard non polar33892256
Dextrin,4TMS,isomer #294C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3728.4Semi standard non polar33892256
Dextrin,4TMS,isomer #295C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O[Si](C)(C)C3784.0Semi standard non polar33892256
Dextrin,4TMS,isomer #296C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3652.6Semi standard non polar33892256
Dextrin,4TMS,isomer #297C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3723.7Semi standard non polar33892256
Dextrin,4TMS,isomer #298C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3702.5Semi standard non polar33892256
Dextrin,4TMS,isomer #299C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3737.6Semi standard non polar33892256
Dextrin,4TMS,isomer #3C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3619.5Semi standard non polar33892256
Dextrin,4TMS,isomer #30C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3717.1Semi standard non polar33892256
Dextrin,4TMS,isomer #300C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3720.8Semi standard non polar33892256
Dextrin,4TMS,isomer #301C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3696.3Semi standard non polar33892256
Dextrin,4TMS,isomer #302C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3732.1Semi standard non polar33892256
Dextrin,4TMS,isomer #303C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@@H]1CO3780.6Semi standard non polar33892256
Dextrin,4TMS,isomer #304C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3756.4Semi standard non polar33892256
Dextrin,4TMS,isomer #305C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3773.3Semi standard non polar33892256
Dextrin,4TMS,isomer #306C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3696.7Semi standard non polar33892256
Dextrin,4TMS,isomer #307C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3670.5Semi standard non polar33892256
Dextrin,4TMS,isomer #308C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3708.7Semi standard non polar33892256
Dextrin,4TMS,isomer #309C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3723.3Semi standard non polar33892256
Dextrin,4TMS,isomer #31C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3687.6Semi standard non polar33892256
Dextrin,4TMS,isomer #310C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3749.5Semi standard non polar33892256
Dextrin,4TMS,isomer #311C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3738.0Semi standard non polar33892256
Dextrin,4TMS,isomer #312C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3708.0Semi standard non polar33892256
Dextrin,4TMS,isomer #313C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3730.7Semi standard non polar33892256
Dextrin,4TMS,isomer #314C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3720.9Semi standard non polar33892256
Dextrin,4TMS,isomer #315C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O[Si](C)(C)C3770.7Semi standard non polar33892256
Dextrin,4TMS,isomer #316C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3694.3Semi standard non polar33892256
Dextrin,4TMS,isomer #317C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3669.0Semi standard non polar33892256
Dextrin,4TMS,isomer #318C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3707.3Semi standard non polar33892256
Dextrin,4TMS,isomer #319C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3728.0Semi standard non polar33892256
Dextrin,4TMS,isomer #32C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3643.4Semi standard non polar33892256
Dextrin,4TMS,isomer #320C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3761.8Semi standard non polar33892256
Dextrin,4TMS,isomer #321C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3750.2Semi standard non polar33892256
Dextrin,4TMS,isomer #322C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3721.6Semi standard non polar33892256
Dextrin,4TMS,isomer #323C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3755.5Semi standard non polar33892256
Dextrin,4TMS,isomer #324C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3742.8Semi standard non polar33892256
Dextrin,4TMS,isomer #325C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O[Si](C)(C)C3801.8Semi standard non polar33892256
Dextrin,4TMS,isomer #326C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3680.1Semi standard non polar33892256
Dextrin,4TMS,isomer #327C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3717.8Semi standard non polar33892256
Dextrin,4TMS,isomer #328C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3705.0Semi standard non polar33892256
Dextrin,4TMS,isomer #329C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3761.8Semi standard non polar33892256
Dextrin,4TMS,isomer #33C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3669.5Semi standard non polar33892256
Dextrin,4TMS,isomer #330C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3754.1Semi standard non polar33892256
Dextrin,4TMS,isomer #34C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3713.6Semi standard non polar33892256
Dextrin,4TMS,isomer #35C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3719.0Semi standard non polar33892256
Dextrin,4TMS,isomer #36C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3687.7Semi standard non polar33892256
Dextrin,4TMS,isomer #37C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3664.0Semi standard non polar33892256
Dextrin,4TMS,isomer #38C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3647.7Semi standard non polar33892256
Dextrin,4TMS,isomer #39C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3698.1Semi standard non polar33892256
Dextrin,4TMS,isomer #4C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3676.7Semi standard non polar33892256
Dextrin,4TMS,isomer #40C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3663.4Semi standard non polar33892256
Dextrin,4TMS,isomer #41C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3722.9Semi standard non polar33892256
Dextrin,4TMS,isomer #42C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3670.1Semi standard non polar33892256
Dextrin,4TMS,isomer #43C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3695.0Semi standard non polar33892256
Dextrin,4TMS,isomer #44C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3685.5Semi standard non polar33892256
Dextrin,4TMS,isomer #45C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3704.3Semi standard non polar33892256
Dextrin,4TMS,isomer #46C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3669.7Semi standard non polar33892256
Dextrin,4TMS,isomer #47C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3723.5Semi standard non polar33892256
Dextrin,4TMS,isomer #48C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3671.6Semi standard non polar33892256
Dextrin,4TMS,isomer #49C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3696.6Semi standard non polar33892256
Dextrin,4TMS,isomer #5C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3620.7Semi standard non polar33892256
Dextrin,4TMS,isomer #50C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3682.5Semi standard non polar33892256
Dextrin,4TMS,isomer #51C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3649.9Semi standard non polar33892256
Dextrin,4TMS,isomer #52C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3708.2Semi standard non polar33892256
Dextrin,4TMS,isomer #53C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3657.7Semi standard non polar33892256
Dextrin,4TMS,isomer #54C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3679.8Semi standard non polar33892256
Dextrin,4TMS,isomer #55C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3714.7Semi standard non polar33892256
Dextrin,4TMS,isomer #56C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3749.7Semi standard non polar33892256
Dextrin,4TMS,isomer #57C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3693.9Semi standard non polar33892256
Dextrin,4TMS,isomer #58C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3723.1Semi standard non polar33892256
Dextrin,4TMS,isomer #59C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3705.1Semi standard non polar33892256
Dextrin,4TMS,isomer #6C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3689.5Semi standard non polar33892256
Dextrin,4TMS,isomer #60C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3659.3Semi standard non polar33892256
Dextrin,4TMS,isomer #61C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3685.3Semi standard non polar33892256
Dextrin,4TMS,isomer #62C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3722.9Semi standard non polar33892256
Dextrin,4TMS,isomer #63C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3729.9Semi standard non polar33892256
Dextrin,4TMS,isomer #64C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3695.0Semi standard non polar33892256
Dextrin,4TMS,isomer #65C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3705.9Semi standard non polar33892256
Dextrin,4TMS,isomer #66C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3724.9Semi standard non polar33892256
Dextrin,4TMS,isomer #67C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3695.6Semi standard non polar33892256
Dextrin,4TMS,isomer #68C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3748.4Semi standard non polar33892256
Dextrin,4TMS,isomer #69C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3694.4Semi standard non polar33892256
Dextrin,4TMS,isomer #7C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3628.5Semi standard non polar33892256
Dextrin,4TMS,isomer #70C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3719.2Semi standard non polar33892256
Dextrin,4TMS,isomer #71C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3704.3Semi standard non polar33892256
Dextrin,4TMS,isomer #72C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3679.3Semi standard non polar33892256
Dextrin,4TMS,isomer #73C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3733.7Semi standard non polar33892256
Dextrin,4TMS,isomer #74C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3680.4Semi standard non polar33892256
Dextrin,4TMS,isomer #75C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3705.6Semi standard non polar33892256
Dextrin,4TMS,isomer #76C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3742.7Semi standard non polar33892256
Dextrin,4TMS,isomer #77C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3782.0Semi standard non polar33892256
Dextrin,4TMS,isomer #78C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3717.4Semi standard non polar33892256
Dextrin,4TMS,isomer #79C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3747.1Semi standard non polar33892256
Dextrin,4TMS,isomer #8C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3656.6Semi standard non polar33892256
Dextrin,4TMS,isomer #80C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3739.5Semi standard non polar33892256
Dextrin,4TMS,isomer #81C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3690.9Semi standard non polar33892256
Dextrin,4TMS,isomer #82C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3718.4Semi standard non polar33892256
Dextrin,4TMS,isomer #83C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3760.8Semi standard non polar33892256
Dextrin,4TMS,isomer #84C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3763.3Semi standard non polar33892256
Dextrin,4TMS,isomer #85C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3734.7Semi standard non polar33892256
Dextrin,4TMS,isomer #86C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3721.4Semi standard non polar33892256
Dextrin,4TMS,isomer #87C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3693.8Semi standard non polar33892256
Dextrin,4TMS,isomer #88C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3747.7Semi standard non polar33892256
Dextrin,4TMS,isomer #89C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3696.2Semi standard non polar33892256
Dextrin,4TMS,isomer #9C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3659.4Semi standard non polar33892256
Dextrin,4TMS,isomer #90C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3720.7Semi standard non polar33892256
Dextrin,4TMS,isomer #91C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3725.6Semi standard non polar33892256
Dextrin,4TMS,isomer #92C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3758.4Semi standard non polar33892256
Dextrin,4TMS,isomer #93C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3699.2Semi standard non polar33892256
Dextrin,4TMS,isomer #94C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3729.7Semi standard non polar33892256
Dextrin,4TMS,isomer #95C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3719.9Semi standard non polar33892256
Dextrin,4TMS,isomer #96C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3671.5Semi standard non polar33892256
Dextrin,4TMS,isomer #97C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3701.0Semi standard non polar33892256
Dextrin,4TMS,isomer #98C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3736.6Semi standard non polar33892256
Dextrin,4TMS,isomer #99C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3739.1Semi standard non polar33892256
Dextrin,5TMS,isomer #1C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3484.6Semi standard non polar33892256
Dextrin,5TMS,isomer #10C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3494.3Semi standard non polar33892256
Dextrin,5TMS,isomer #100C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3560.4Semi standard non polar33892256
Dextrin,5TMS,isomer #101C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3505.3Semi standard non polar33892256
Dextrin,5TMS,isomer #102C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3532.2Semi standard non polar33892256
Dextrin,5TMS,isomer #103C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3578.6Semi standard non polar33892256
Dextrin,5TMS,isomer #104C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3568.4Semi standard non polar33892256
Dextrin,5TMS,isomer #105C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3557.0Semi standard non polar33892256
Dextrin,5TMS,isomer #106C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3563.9Semi standard non polar33892256
Dextrin,5TMS,isomer #107C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3539.9Semi standard non polar33892256
Dextrin,5TMS,isomer #108C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3587.8Semi standard non polar33892256
Dextrin,5TMS,isomer #109C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3531.6Semi standard non polar33892256
Dextrin,5TMS,isomer #11C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3527.8Semi standard non polar33892256
Dextrin,5TMS,isomer #110C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3556.3Semi standard non polar33892256
Dextrin,5TMS,isomer #111C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3556.3Semi standard non polar33892256
Dextrin,5TMS,isomer #112C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3585.0Semi standard non polar33892256
Dextrin,5TMS,isomer #113C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3523.0Semi standard non polar33892256
Dextrin,5TMS,isomer #114C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3550.3Semi standard non polar33892256
Dextrin,5TMS,isomer #115C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3546.6Semi standard non polar33892256
Dextrin,5TMS,isomer #116C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3511.1Semi standard non polar33892256
Dextrin,5TMS,isomer #117C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3523.0Semi standard non polar33892256
Dextrin,5TMS,isomer #118C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3568.6Semi standard non polar33892256
Dextrin,5TMS,isomer #119C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3555.7Semi standard non polar33892256
Dextrin,5TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3489.4Semi standard non polar33892256
Dextrin,5TMS,isomer #120C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3545.7Semi standard non polar33892256
Dextrin,5TMS,isomer #121C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3560.4Semi standard non polar33892256
Dextrin,5TMS,isomer #122C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3594.9Semi standard non polar33892256
Dextrin,5TMS,isomer #123C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3526.3Semi standard non polar33892256
Dextrin,5TMS,isomer #124C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3562.0Semi standard non polar33892256
Dextrin,5TMS,isomer #125C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3559.2Semi standard non polar33892256
Dextrin,5TMS,isomer #126C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3508.2Semi standard non polar33892256
Dextrin,5TMS,isomer #127C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3531.4Semi standard non polar33892256
Dextrin,5TMS,isomer #128C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3578.1Semi standard non polar33892256
Dextrin,5TMS,isomer #129C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3565.1Semi standard non polar33892256
Dextrin,5TMS,isomer #13C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3505.3Semi standard non polar33892256
Dextrin,5TMS,isomer #130C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3555.5Semi standard non polar33892256
Dextrin,5TMS,isomer #131C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3618.3Semi standard non polar33892256
Dextrin,5TMS,isomer #132C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3551.9Semi standard non polar33892256
Dextrin,5TMS,isomer #133C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3588.9Semi standard non polar33892256
Dextrin,5TMS,isomer #134C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3608.1Semi standard non polar33892256
Dextrin,5TMS,isomer #135C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3599.1Semi standard non polar33892256
Dextrin,5TMS,isomer #136C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3584.1Semi standard non polar33892256
Dextrin,5TMS,isomer #137C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3573.1Semi standard non polar33892256
Dextrin,5TMS,isomer #138C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3557.9Semi standard non polar33892256
Dextrin,5TMS,isomer #139C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3552.8Semi standard non polar33892256
Dextrin,5TMS,isomer #14C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3507.7Semi standard non polar33892256
Dextrin,5TMS,isomer #140C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3603.1Semi standard non polar33892256
Dextrin,5TMS,isomer #141C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3587.9Semi standard non polar33892256
Dextrin,5TMS,isomer #142C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3568.6Semi standard non polar33892256
Dextrin,5TMS,isomer #143C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3616.8Semi standard non polar33892256
Dextrin,5TMS,isomer #144C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3559.5Semi standard non polar33892256
Dextrin,5TMS,isomer #145C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3579.6Semi standard non polar33892256
Dextrin,5TMS,isomer #146C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3599.9Semi standard non polar33892256
Dextrin,5TMS,isomer #147C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3629.5Semi standard non polar33892256
Dextrin,5TMS,isomer #148C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3557.2Semi standard non polar33892256
Dextrin,5TMS,isomer #149C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3594.4Semi standard non polar33892256
Dextrin,5TMS,isomer #15C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3492.1Semi standard non polar33892256
Dextrin,5TMS,isomer #150C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3596.9Semi standard non polar33892256
Dextrin,5TMS,isomer #151C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3533.7Semi standard non polar33892256
Dextrin,5TMS,isomer #152C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3565.8Semi standard non polar33892256
Dextrin,5TMS,isomer #153C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3620.7Semi standard non polar33892256
Dextrin,5TMS,isomer #154C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3602.5Semi standard non polar33892256
Dextrin,5TMS,isomer #155C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3596.8Semi standard non polar33892256
Dextrin,5TMS,isomer #156C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3584.5Semi standard non polar33892256
Dextrin,5TMS,isomer #157C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3616.7Semi standard non polar33892256
Dextrin,5TMS,isomer #158C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3543.4Semi standard non polar33892256
Dextrin,5TMS,isomer #159C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3581.1Semi standard non polar33892256
Dextrin,5TMS,isomer #16C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3530.3Semi standard non polar33892256
Dextrin,5TMS,isomer #160C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3584.1Semi standard non polar33892256
Dextrin,5TMS,isomer #161C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3524.4Semi standard non polar33892256
Dextrin,5TMS,isomer #162C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3554.3Semi standard non polar33892256
Dextrin,5TMS,isomer #163C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3607.8Semi standard non polar33892256
Dextrin,5TMS,isomer #164C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3588.1Semi standard non polar33892256
Dextrin,5TMS,isomer #165C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3584.4Semi standard non polar33892256
Dextrin,5TMS,isomer #166C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3648.2Semi standard non polar33892256
Dextrin,5TMS,isomer #167C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3575.6Semi standard non polar33892256
Dextrin,5TMS,isomer #168C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3615.6Semi standard non polar33892256
Dextrin,5TMS,isomer #169C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3640.1Semi standard non polar33892256
Dextrin,5TMS,isomer #17C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3483.3Semi standard non polar33892256
Dextrin,5TMS,isomer #170C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3624.8Semi standard non polar33892256
Dextrin,5TMS,isomer #171C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3619.6Semi standard non polar33892256
Dextrin,5TMS,isomer #172C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3611.8Semi standard non polar33892256
Dextrin,5TMS,isomer #173C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3593.5Semi standard non polar33892256
Dextrin,5TMS,isomer #174C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3595.2Semi standard non polar33892256
Dextrin,5TMS,isomer #175C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3637.6Semi standard non polar33892256
Dextrin,5TMS,isomer #176C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O3605.2Semi standard non polar33892256
Dextrin,5TMS,isomer #177C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3637.8Semi standard non polar33892256
Dextrin,5TMS,isomer #178C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3565.3Semi standard non polar33892256
Dextrin,5TMS,isomer #179C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3600.2Semi standard non polar33892256
Dextrin,5TMS,isomer #18C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3504.4Semi standard non polar33892256
Dextrin,5TMS,isomer #180C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3602.0Semi standard non polar33892256
Dextrin,5TMS,isomer #181C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3545.8Semi standard non polar33892256
Dextrin,5TMS,isomer #182C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3572.7Semi standard non polar33892256
Dextrin,5TMS,isomer #183C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3627.6Semi standard non polar33892256
Dextrin,5TMS,isomer #184C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3606.0Semi standard non polar33892256
Dextrin,5TMS,isomer #185C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3604.0Semi standard non polar33892256
Dextrin,5TMS,isomer #186C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3618.8Semi standard non polar33892256
Dextrin,5TMS,isomer #187C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3552.7Semi standard non polar33892256
Dextrin,5TMS,isomer #188C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3587.1Semi standard non polar33892256
Dextrin,5TMS,isomer #189C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3609.3Semi standard non polar33892256
Dextrin,5TMS,isomer #19C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3540.8Semi standard non polar33892256
Dextrin,5TMS,isomer #190C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3591.8Semi standard non polar33892256
Dextrin,5TMS,isomer #191C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3586.8Semi standard non polar33892256
Dextrin,5TMS,isomer #192C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3580.5Semi standard non polar33892256
Dextrin,5TMS,isomer #193C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3560.6Semi standard non polar33892256
Dextrin,5TMS,isomer #194C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3564.2Semi standard non polar33892256
Dextrin,5TMS,isomer #195C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3603.9Semi standard non polar33892256
Dextrin,5TMS,isomer #196C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3639.7Semi standard non polar33892256
Dextrin,5TMS,isomer #197C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3572.3Semi standard non polar33892256
Dextrin,5TMS,isomer #198C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3610.2Semi standard non polar33892256
Dextrin,5TMS,isomer #199C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3637.3Semi standard non polar33892256
Dextrin,5TMS,isomer #2C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3473.5Semi standard non polar33892256
Dextrin,5TMS,isomer #20C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3576.0Semi standard non polar33892256
Dextrin,5TMS,isomer #200C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3621.3Semi standard non polar33892256
Dextrin,5TMS,isomer #201C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3614.2Semi standard non polar33892256
Dextrin,5TMS,isomer #202C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3605.3Semi standard non polar33892256
Dextrin,5TMS,isomer #203C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3586.0Semi standard non polar33892256
Dextrin,5TMS,isomer #204C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3587.8Semi standard non polar33892256
Dextrin,5TMS,isomer #205C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3631.8Semi standard non polar33892256
Dextrin,5TMS,isomer #206C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3660.4Semi standard non polar33892256
Dextrin,5TMS,isomer #207C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3640.2Semi standard non polar33892256
Dextrin,5TMS,isomer #208C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3637.0Semi standard non polar33892256
Dextrin,5TMS,isomer #209C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3662.6Semi standard non polar33892256
Dextrin,5TMS,isomer #21C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3503.2Semi standard non polar33892256
Dextrin,5TMS,isomer #210C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3623.1Semi standard non polar33892256
Dextrin,5TMS,isomer #211C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3586.5Semi standard non polar33892256
Dextrin,5TMS,isomer #212C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3563.0Semi standard non polar33892256
Dextrin,5TMS,isomer #213C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3547.2Semi standard non polar33892256
Dextrin,5TMS,isomer #214C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3619.5Semi standard non polar33892256
Dextrin,5TMS,isomer #215C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3575.0Semi standard non polar33892256
Dextrin,5TMS,isomer #216C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3634.1Semi standard non polar33892256
Dextrin,5TMS,isomer #217C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3602.4Semi standard non polar33892256
Dextrin,5TMS,isomer #218C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3548.6Semi standard non polar33892256
Dextrin,5TMS,isomer #219C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3601.2Semi standard non polar33892256
Dextrin,5TMS,isomer #22C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3540.8Semi standard non polar33892256
Dextrin,5TMS,isomer #220C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3559.3Semi standard non polar33892256
Dextrin,5TMS,isomer #221C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3615.4Semi standard non polar33892256
Dextrin,5TMS,isomer #222C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3547.3Semi standard non polar33892256
Dextrin,5TMS,isomer #223C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3613.8Semi standard non polar33892256
Dextrin,5TMS,isomer #224C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3574.4Semi standard non polar33892256
Dextrin,5TMS,isomer #225C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3626.2Semi standard non polar33892256
Dextrin,5TMS,isomer #226C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3587.7Semi standard non polar33892256
Dextrin,5TMS,isomer #227C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3543.8Semi standard non polar33892256
Dextrin,5TMS,isomer #228C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3600.5Semi standard non polar33892256
Dextrin,5TMS,isomer #229C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3624.8Semi standard non polar33892256
Dextrin,5TMS,isomer #23C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3526.9Semi standard non polar33892256
Dextrin,5TMS,isomer #230C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3644.3Semi standard non polar33892256
Dextrin,5TMS,isomer #231C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3643.1Semi standard non polar33892256
Dextrin,5TMS,isomer #232C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3627.9Semi standard non polar33892256
Dextrin,5TMS,isomer #233C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3584.3Semi standard non polar33892256
Dextrin,5TMS,isomer #234C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@H]1O3653.8Semi standard non polar33892256
Dextrin,5TMS,isomer #235C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@H]1O3610.4Semi standard non polar33892256
Dextrin,5TMS,isomer #236C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3668.7Semi standard non polar33892256
Dextrin,5TMS,isomer #237C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3562.1Semi standard non polar33892256
Dextrin,5TMS,isomer #238C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@H]1O3640.4Semi standard non polar33892256
Dextrin,5TMS,isomer #239C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@H]1O3597.6Semi standard non polar33892256
Dextrin,5TMS,isomer #24C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3489.1Semi standard non polar33892256
Dextrin,5TMS,isomer #240C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3652.5Semi standard non polar33892256
Dextrin,5TMS,isomer #241C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3618.4Semi standard non polar33892256
Dextrin,5TMS,isomer #242C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3572.9Semi standard non polar33892256
Dextrin,5TMS,isomer #243C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3628.9Semi standard non polar33892256
Dextrin,5TMS,isomer #244C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@@H]1CO3682.4Semi standard non polar33892256
Dextrin,5TMS,isomer #245C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3663.3Semi standard non polar33892256
Dextrin,5TMS,isomer #246C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@H]1O3681.8Semi standard non polar33892256
Dextrin,5TMS,isomer #247C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3585.0Semi standard non polar33892256
Dextrin,5TMS,isomer #248C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@H]1O3657.2Semi standard non polar33892256
Dextrin,5TMS,isomer #249C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@H]1O3617.9Semi standard non polar33892256
Dextrin,5TMS,isomer #25C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3508.2Semi standard non polar33892256
Dextrin,5TMS,isomer #250C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3673.0Semi standard non polar33892256
Dextrin,5TMS,isomer #251C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3587.1Semi standard non polar33892256
Dextrin,5TMS,isomer #252C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3552.3Semi standard non polar33892256
Dextrin,5TMS,isomer #253C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3600.0Semi standard non polar33892256
Dextrin,5TMS,isomer #254C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)O[C@@H]1CO3642.1Semi standard non polar33892256
Dextrin,5TMS,isomer #255C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3627.1Semi standard non polar33892256
Dextrin,5TMS,isomer #256C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@H]1O3643.2Semi standard non polar33892256
Dextrin,5TMS,isomer #257C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3606.6Semi standard non polar33892256
Dextrin,5TMS,isomer #258C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3564.4Semi standard non polar33892256
Dextrin,5TMS,isomer #259C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3616.4Semi standard non polar33892256
Dextrin,5TMS,isomer #26C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3545.8Semi standard non polar33892256
Dextrin,5TMS,isomer #260C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@@H]1CO3676.2Semi standard non polar33892256
Dextrin,5TMS,isomer #261C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3655.0Semi standard non polar33892256
Dextrin,5TMS,isomer #262C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@H]1O3675.2Semi standard non polar33892256
Dextrin,5TMS,isomer #263C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3624.0Semi standard non polar33892256
Dextrin,5TMS,isomer #264C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3643.8Semi standard non polar33892256
Dextrin,5TMS,isomer #265C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3643.2Semi standard non polar33892256
Dextrin,5TMS,isomer #266C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3696.4Semi standard non polar33892256
Dextrin,5TMS,isomer #267C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3561.3Semi standard non polar33892256
Dextrin,5TMS,isomer #268C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3503.5Semi standard non polar33892256
Dextrin,5TMS,isomer #269C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3573.2Semi standard non polar33892256
Dextrin,5TMS,isomer #27C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3541.3Semi standard non polar33892256
Dextrin,5TMS,isomer #270C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3536.6Semi standard non polar33892256
Dextrin,5TMS,isomer #271C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3581.2Semi standard non polar33892256
Dextrin,5TMS,isomer #272C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3492.0Semi standard non polar33892256
Dextrin,5TMS,isomer #273C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3560.4Semi standard non polar33892256
Dextrin,5TMS,isomer #274C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3525.9Semi standard non polar33892256
Dextrin,5TMS,isomer #275C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3567.0Semi standard non polar33892256
Dextrin,5TMS,isomer #276C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3533.9Semi standard non polar33892256
Dextrin,5TMS,isomer #277C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3505.6Semi standard non polar33892256
Dextrin,5TMS,isomer #278C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3537.3Semi standard non polar33892256
Dextrin,5TMS,isomer #279C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3584.5Semi standard non polar33892256
Dextrin,5TMS,isomer #28C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3526.9Semi standard non polar33892256
Dextrin,5TMS,isomer #280C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3603.5Semi standard non polar33892256
Dextrin,5TMS,isomer #281C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3594.4Semi standard non polar33892256
Dextrin,5TMS,isomer #282C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3530.5Semi standard non polar33892256
Dextrin,5TMS,isomer #283C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3590.4Semi standard non polar33892256
Dextrin,5TMS,isomer #284C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3555.0Semi standard non polar33892256
Dextrin,5TMS,isomer #285C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3599.4Semi standard non polar33892256
Dextrin,5TMS,isomer #286C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3527.5Semi standard non polar33892256
Dextrin,5TMS,isomer #287C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3513.8Semi standard non polar33892256
Dextrin,5TMS,isomer #288C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3529.6Semi standard non polar33892256
Dextrin,5TMS,isomer #289C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3565.6Semi standard non polar33892256
Dextrin,5TMS,isomer #29C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3534.0Semi standard non polar33892256
Dextrin,5TMS,isomer #290C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3580.5Semi standard non polar33892256
Dextrin,5TMS,isomer #291C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3574.1Semi standard non polar33892256
Dextrin,5TMS,isomer #292C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3532.5Semi standard non polar33892256
Dextrin,5TMS,isomer #293C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3509.3Semi standard non polar33892256
Dextrin,5TMS,isomer #294C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3538.4Semi standard non polar33892256
Dextrin,5TMS,isomer #295C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3583.0Semi standard non polar33892256
Dextrin,5TMS,isomer #296C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3599.6Semi standard non polar33892256
Dextrin,5TMS,isomer #297C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3592.8Semi standard non polar33892256
Dextrin,5TMS,isomer #298C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3539.5Semi standard non polar33892256
Dextrin,5TMS,isomer #299C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3560.9Semi standard non polar33892256
Dextrin,5TMS,isomer #3C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3506.7Semi standard non polar33892256
Dextrin,5TMS,isomer #30C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3537.6Semi standard non polar33892256
Dextrin,5TMS,isomer #300C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3549.2Semi standard non polar33892256
Dextrin,5TMS,isomer #301C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3616.2Semi standard non polar33892256
Dextrin,5TMS,isomer #302C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3552.8Semi standard non polar33892256
Dextrin,5TMS,isomer #303C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3567.7Semi standard non polar33892256
Dextrin,5TMS,isomer #304C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3535.6Semi standard non polar33892256
Dextrin,5TMS,isomer #305C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3573.4Semi standard non polar33892256
Dextrin,5TMS,isomer #306C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3555.4Semi standard non polar33892256
Dextrin,5TMS,isomer #307C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3525.1Semi standard non polar33892256
Dextrin,5TMS,isomer #308C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3559.1Semi standard non polar33892256
Dextrin,5TMS,isomer #309C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3581.4Semi standard non polar33892256
Dextrin,5TMS,isomer #31C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3512.2Semi standard non polar33892256
Dextrin,5TMS,isomer #310C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3599.0Semi standard non polar33892256
Dextrin,5TMS,isomer #311C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3586.5Semi standard non polar33892256
Dextrin,5TMS,isomer #312C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3616.4Semi standard non polar33892256
Dextrin,5TMS,isomer #313C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3636.7Semi standard non polar33892256
Dextrin,5TMS,isomer #314C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3623.5Semi standard non polar33892256
Dextrin,5TMS,isomer #315C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3623.5Semi standard non polar33892256
Dextrin,5TMS,isomer #316C[Si](C)(C)O[C@H]1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3611.5Semi standard non polar33892256
Dextrin,5TMS,isomer #317C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O[Si](C)(C)C3656.7Semi standard non polar33892256
Dextrin,5TMS,isomer #318C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3635.3Semi standard non polar33892256
Dextrin,5TMS,isomer #319C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3619.3Semi standard non polar33892256
Dextrin,5TMS,isomer #32C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3564.7Semi standard non polar33892256
Dextrin,5TMS,isomer #320C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3580.2Semi standard non polar33892256
Dextrin,5TMS,isomer #321C[Si](C)(C)O[C@H]1[C@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3625.1Semi standard non polar33892256
Dextrin,5TMS,isomer #322C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3573.0Semi standard non polar33892256
Dextrin,5TMS,isomer #323C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3546.3Semi standard non polar33892256
Dextrin,5TMS,isomer #324C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3579.0Semi standard non polar33892256
Dextrin,5TMS,isomer #325C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3553.3Semi standard non polar33892256
Dextrin,5TMS,isomer #326C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3565.4Semi standard non polar33892256
Dextrin,5TMS,isomer #327C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3559.7Semi standard non polar33892256
Dextrin,5TMS,isomer #328C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3638.6Semi standard non polar33892256
Dextrin,5TMS,isomer #329C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O3625.8Semi standard non polar33892256
Dextrin,5TMS,isomer #33C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3504.1Semi standard non polar33892256
Dextrin,5TMS,isomer #330C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O[Si](C)(C)C3618.7Semi standard non polar33892256
Dextrin,5TMS,isomer #331C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O3636.7Semi standard non polar33892256
Dextrin,5TMS,isomer #332C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3574.1Semi standard non polar33892256
Dextrin,5TMS,isomer #333C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3590.0Semi standard non polar33892256
Dextrin,5TMS,isomer #334C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3581.5Semi standard non polar33892256
Dextrin,5TMS,isomer #335C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@H]1O[Si](C)(C)C3647.9Semi standard non polar33892256
Dextrin,5TMS,isomer #336C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3610.4Semi standard non polar33892256
Dextrin,5TMS,isomer #337C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3575.4Semi standard non polar33892256
Dextrin,5TMS,isomer #338C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3530.9Semi standard non polar33892256
Dextrin,5TMS,isomer #339C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3601.5Semi standard non polar33892256
Dextrin,5TMS,isomer #34C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3531.2Semi standard non polar33892256
Dextrin,5TMS,isomer #340C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3563.2Semi standard non polar33892256
Dextrin,5TMS,isomer #341C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3616.6Semi standard non polar33892256
Dextrin,5TMS,isomer #342C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3507.5Semi standard non polar33892256
Dextrin,5TMS,isomer #343C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3583.7Semi standard non polar33892256
Dextrin,5TMS,isomer #344C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3546.8Semi standard non polar33892256
Dextrin,5TMS,isomer #345C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3595.7Semi standard non polar33892256
Dextrin,5TMS,isomer #346C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3566.4Semi standard non polar33892256
Dextrin,5TMS,isomer #347C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3525.6Semi standard non polar33892256
Dextrin,5TMS,isomer #348C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3582.4Semi standard non polar33892256
Dextrin,5TMS,isomer #349C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3611.1Semi standard non polar33892256
Dextrin,5TMS,isomer #35C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3519.6Semi standard non polar33892256
Dextrin,5TMS,isomer #350C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3630.2Semi standard non polar33892256
Dextrin,5TMS,isomer #351C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3623.2Semi standard non polar33892256
Dextrin,5TMS,isomer #352C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3548.8Semi standard non polar33892256
Dextrin,5TMS,isomer #353C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3617.1Semi standard non polar33892256
Dextrin,5TMS,isomer #354C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3577.5Semi standard non polar33892256
Dextrin,5TMS,isomer #355C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3631.1Semi standard non polar33892256
Dextrin,5TMS,isomer #356C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3556.7Semi standard non polar33892256
Dextrin,5TMS,isomer #357C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3524.2Semi standard non polar33892256
Dextrin,5TMS,isomer #358C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3572.3Semi standard non polar33892256
Dextrin,5TMS,isomer #359C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3589.5Semi standard non polar33892256
Dextrin,5TMS,isomer #36C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3500.1Semi standard non polar33892256
Dextrin,5TMS,isomer #360C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3608.3Semi standard non polar33892256
Dextrin,5TMS,isomer #361C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3603.8Semi standard non polar33892256
Dextrin,5TMS,isomer #362C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3562.3Semi standard non polar33892256
Dextrin,5TMS,isomer #363C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3523.9Semi standard non polar33892256
Dextrin,5TMS,isomer #364C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3578.3Semi standard non polar33892256
Dextrin,5TMS,isomer #365C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3608.7Semi standard non polar33892256
Dextrin,5TMS,isomer #366C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3627.9Semi standard non polar33892256
Dextrin,5TMS,isomer #367C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3623.1Semi standard non polar33892256
Dextrin,5TMS,isomer #368C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3572.8Semi standard non polar33892256
Dextrin,5TMS,isomer #369C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3602.5Semi standard non polar33892256
Dextrin,5TMS,isomer #37C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3551.0Semi standard non polar33892256
Dextrin,5TMS,isomer #370C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3589.5Semi standard non polar33892256
Dextrin,5TMS,isomer #371C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3651.6Semi standard non polar33892256
Dextrin,5TMS,isomer #372C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3569.8Semi standard non polar33892256
Dextrin,5TMS,isomer #373C[Si](C)(C)O[C@@H]1[C@@H](CO)OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)[C@H](O)[C@H]1O3642.4Semi standard non polar33892256
Dextrin,5TMS,isomer #374C[Si](C)(C)O[C@@H]1[C@@H](O)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@H]1O3604.9Semi standard non polar33892256
Dextrin,5TMS,isomer #375C[Si](C)(C)O[C@H]1[C@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3656.5Semi standard non polar33892256
Dextrin,5TMS,isomer #376C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3595.3Semi standard non polar33892256
Dextrin,5TMS,isomer #377C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3556.5Semi standard non polar33892256
Dextrin,5TMS,isomer #378C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3613.1Semi standard non polar33892256
Dextrin,5TMS,isomer #379C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)O[C@@H]1CO3659.4Semi standard non polar33892256
Dextrin,5TMS,isomer #38C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3493.4Semi standard non polar33892256
Dextrin,5TMS,isomer #380C[Si](C)(C)O[C@H]1C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3644.9Semi standard non polar33892256
Dextrin,5TMS,isomer #381C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@H]1O3659.5Semi standard non polar33892256
Dextrin,5TMS,isomer #382C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3578.4Semi standard non polar33892256
Dextrin,5TMS,isomer #383C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3538.7Semi standard non polar33892256
Dextrin,5TMS,isomer #384C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3593.2Semi standard non polar33892256
Dextrin,5TMS,isomer #385C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@@H]1CO3648.5Semi standard non polar33892256
Dextrin,5TMS,isomer #386C[Si](C)(C)O[C@H]1C(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3632.6Semi standard non polar33892256
Dextrin,5TMS,isomer #387C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@H]1O3647.3Semi standard non polar33892256
Dextrin,5TMS,isomer #388C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3605.0Semi standard non polar33892256
Dextrin,5TMS,isomer #389C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3627.5Semi standard non polar33892256
Dextrin,5TMS,isomer #39C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3517.9Semi standard non polar33892256
Dextrin,5TMS,isomer #390C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3619.5Semi standard non polar33892256
Dextrin,5TMS,isomer #391C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO)O[C@H](CO)[C@H]1O[Si](C)(C)C3685.8Semi standard non polar33892256
Dextrin,5TMS,isomer #392C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3596.5Semi standard non polar33892256
Dextrin,5TMS,isomer #393C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3558.1Semi standard non polar33892256
Dextrin,5TMS,isomer #394C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3614.0Semi standard non polar33892256
Dextrin,5TMS,isomer #395C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)O[C@@H]1CO3667.9Semi standard non polar33892256
Dextrin,5TMS,isomer #396C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@H](CO)[C@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3651.8Semi standard non polar33892256
Dextrin,5TMS,isomer #397C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@H]1O3670.0Semi standard non polar33892256
Dextrin,5TMS,isomer #398C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3577.5Semi standard non polar33892256
Dextrin,5TMS,isomer #399C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3594.9Semi standard non polar33892256
Dextrin,5TMS,isomer #4C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3483.5Semi standard non polar33892256
Dextrin,5TMS,isomer #40C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3556.9Semi standard non polar33892256
Dextrin,5TMS,isomer #400C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3590.4Semi standard non polar33892256
Dextrin,5TMS,isomer #401C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO)O[C@H](CO)[C@H]1O[Si](C)(C)C3648.8Semi standard non polar33892256
Dextrin,5TMS,isomer #402C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3597.6Semi standard non polar33892256
Dextrin,5TMS,isomer #403C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3618.4Semi standard non polar33892256
Dextrin,5TMS,isomer #404C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3614.3Semi standard non polar33892256
Dextrin,5TMS,isomer #405C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@H]1O[Si](C)(C)C3680.4Semi standard non polar33892256
Dextrin,5TMS,isomer #406C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3650.4Semi standard non polar33892256
Dextrin,5TMS,isomer #407C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3532.0Semi standard non polar33892256
Dextrin,5TMS,isomer #408C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3580.0Semi standard non polar33892256
Dextrin,5TMS,isomer #409C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3554.7Semi standard non polar33892256
Dextrin,5TMS,isomer #41C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3594.0Semi standard non polar33892256
Dextrin,5TMS,isomer #410C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3598.3Semi standard non polar33892256
Dextrin,5TMS,isomer #411C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3586.9Semi standard non polar33892256
Dextrin,5TMS,isomer #412C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@@H]1CO3651.6Semi standard non polar33892256
Dextrin,5TMS,isomer #413C[Si](C)(C)O[C@H]1[C@H](OC2O[C@H](CO)[C@@H](OC3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)[C@H](O)[C@H]2O)[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3631.0Semi standard non polar33892256
Dextrin,5TMS,isomer #414C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O3650.2Semi standard non polar33892256
Dextrin,5TMS,isomer #415C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3564.4Semi standard non polar33892256
Dextrin,5TMS,isomer #416C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3602.6Semi standard non polar33892256
Dextrin,5TMS,isomer #417C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3558.5Semi standard non polar33892256
Dextrin,5TMS,isomer #418C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3529.6Semi standard non polar33892256
Dextrin,5TMS,isomer #419C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3568.6Semi standard non polar33892256
Dextrin,5TMS,isomer #42C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3523.3Semi standard non polar33892256
Dextrin,5TMS,isomer #420C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3606.3Semi standard non polar33892256
Dextrin,5TMS,isomer #421C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3625.7Semi standard non polar33892256
Dextrin,5TMS,isomer #422C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3621.9Semi standard non polar33892256
Dextrin,5TMS,isomer #423C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3588.8Semi standard non polar33892256
Dextrin,5TMS,isomer #424C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3609.3Semi standard non polar33892256
Dextrin,5TMS,isomer #425C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3605.6Semi standard non polar33892256
Dextrin,5TMS,isomer #426C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O[Si](C)(C)C3668.6Semi standard non polar33892256
Dextrin,5TMS,isomer #427C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3523.2Semi standard non polar33892256
Dextrin,5TMS,isomer #428C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3496.5Semi standard non polar33892256
Dextrin,5TMS,isomer #429C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3531.1Semi standard non polar33892256
Dextrin,5TMS,isomer #43C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3559.8Semi standard non polar33892256
Dextrin,5TMS,isomer #430C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3574.6Semi standard non polar33892256
Dextrin,5TMS,isomer #431C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3593.3Semi standard non polar33892256
Dextrin,5TMS,isomer #432C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3586.4Semi standard non polar33892256
Dextrin,5TMS,isomer #433C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3568.6Semi standard non polar33892256
Dextrin,5TMS,isomer #434C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3591.7Semi standard non polar33892256
Dextrin,5TMS,isomer #435C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3583.0Semi standard non polar33892256
Dextrin,5TMS,isomer #436C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O[Si](C)(C)C3651.1Semi standard non polar33892256
Dextrin,5TMS,isomer #437C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3544.5Semi standard non polar33892256
Dextrin,5TMS,isomer #438C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3570.1Semi standard non polar33892256
Dextrin,5TMS,isomer #439C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3557.8Semi standard non polar33892256
Dextrin,5TMS,isomer #44C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3552.9Semi standard non polar33892256
Dextrin,5TMS,isomer #440C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3624.3Semi standard non polar33892256
Dextrin,5TMS,isomer #441C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3619.1Semi standard non polar33892256
Dextrin,5TMS,isomer #442C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3537.1Semi standard non polar33892256
Dextrin,5TMS,isomer #443C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3508.1Semi standard non polar33892256
Dextrin,5TMS,isomer #444C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3549.6Semi standard non polar33892256
Dextrin,5TMS,isomer #445C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3586.3Semi standard non polar33892256
Dextrin,5TMS,isomer #446C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3609.9Semi standard non polar33892256
Dextrin,5TMS,isomer #447C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3603.6Semi standard non polar33892256
Dextrin,5TMS,isomer #448C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3582.0Semi standard non polar33892256
Dextrin,5TMS,isomer #449C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3605.5Semi standard non polar33892256
Dextrin,5TMS,isomer #45C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3508.1Semi standard non polar33892256
Dextrin,5TMS,isomer #450C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3598.0Semi standard non polar33892256
Dextrin,5TMS,isomer #451C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O[C@@H]2[C@@H](CO)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)O[C@@H]3CO)[C@H](O)[C@H]2O)O[C@H](CO)[C@H]1O[Si](C)(C)C3665.2Semi standard non polar33892256
Dextrin,5TMS,isomer #452C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3536.1Semi standard non polar33892256
Dextrin,5TMS,isomer #453C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3556.3Semi standard non polar33892256
Dextrin,5TMS,isomer #454C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](OC2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3548.6Semi standard non polar33892256
Dextrin,5TMS,isomer #455C[Si](C)(C)OC[C@H]1O[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3610.2Semi standard non polar33892256
Dextrin,5TMS,isomer #456C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3596.2Semi standard non polar33892256
Dextrin,5TMS,isomer #457C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3545.4Semi standard non polar33892256
Dextrin,5TMS,isomer #458C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3572.5Semi standard non polar33892256
Dextrin,5TMS,isomer #459C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3556.6Semi standard non polar33892256
Dextrin,5TMS,isomer #46C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3529.5Semi standard non polar33892256
Dextrin,5TMS,isomer #460C[Si](C)(C)OC[C@H]1O[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](OC2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3626.2Semi standard non polar33892256
Dextrin,5TMS,isomer #461C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3623.2Semi standard non polar33892256
Dextrin,5TMS,isomer #462C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3592.6Semi standard non polar33892256
Dextrin,5TMS,isomer #47C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3577.0Semi standard non polar33892256
Dextrin,5TMS,isomer #48C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3568.7Semi standard non polar33892256
Dextrin,5TMS,isomer #49C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3555.3Semi standard non polar33892256
Dextrin,5TMS,isomer #5C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3530.6Semi standard non polar33892256
Dextrin,5TMS,isomer #50C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3544.1Semi standard non polar33892256
Dextrin,5TMS,isomer #51C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3528.0Semi standard non polar33892256
Dextrin,5TMS,isomer #52C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3575.2Semi standard non polar33892256
Dextrin,5TMS,isomer #53C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3520.2Semi standard non polar33892256
Dextrin,5TMS,isomer #54C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3543.8Semi standard non polar33892256
Dextrin,5TMS,isomer #55C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3544.3Semi standard non polar33892256
Dextrin,5TMS,isomer #56C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3574.6Semi standard non polar33892256
Dextrin,5TMS,isomer #57C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3517.4Semi standard non polar33892256
Dextrin,5TMS,isomer #58C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3540.6Semi standard non polar33892256
Dextrin,5TMS,isomer #59C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3530.1Semi standard non polar33892256
Dextrin,5TMS,isomer #6C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3480.2Semi standard non polar33892256
Dextrin,5TMS,isomer #60C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3507.8Semi standard non polar33892256
Dextrin,5TMS,isomer #61C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3515.6Semi standard non polar33892256
Dextrin,5TMS,isomer #62C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3553.4Semi standard non polar33892256
Dextrin,5TMS,isomer #63C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3542.8Semi standard non polar33892256
Dextrin,5TMS,isomer #64C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]2CO)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3534.3Semi standard non polar33892256
Dextrin,5TMS,isomer #65C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3552.4Semi standard non polar33892256
Dextrin,5TMS,isomer #66C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3587.0Semi standard non polar33892256
Dextrin,5TMS,isomer #67C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3518.2Semi standard non polar33892256
Dextrin,5TMS,isomer #68C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3552.4Semi standard non polar33892256
Dextrin,5TMS,isomer #69C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3550.0Semi standard non polar33892256
Dextrin,5TMS,isomer #7C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3503.7Semi standard non polar33892256
Dextrin,5TMS,isomer #70C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3509.3Semi standard non polar33892256
Dextrin,5TMS,isomer #71C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3527.1Semi standard non polar33892256
Dextrin,5TMS,isomer #72C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3574.4Semi standard non polar33892256
Dextrin,5TMS,isomer #73C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3563.2Semi standard non polar33892256
Dextrin,5TMS,isomer #74C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3550.0Semi standard non polar33892256
Dextrin,5TMS,isomer #75C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3611.0Semi standard non polar33892256
Dextrin,5TMS,isomer #76C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3548.7Semi standard non polar33892256
Dextrin,5TMS,isomer #77C[Si](C)(C)OC[C@H]1OC(O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3583.0Semi standard non polar33892256
Dextrin,5TMS,isomer #78C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3607.3Semi standard non polar33892256
Dextrin,5TMS,isomer #79C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3598.5Semi standard non polar33892256
Dextrin,5TMS,isomer #8C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)O[C@@H]3CO[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3516.9Semi standard non polar33892256
Dextrin,5TMS,isomer #80C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO)O[C@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3582.3Semi standard non polar33892256
Dextrin,5TMS,isomer #81C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3569.6Semi standard non polar33892256
Dextrin,5TMS,isomer #82C[Si](C)(C)OC[C@H]1OC(O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[C@@H]3[C@@H](CO)O[C@H](O)[C@H](O)[C@H]3O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3556.3Semi standard non polar33892256
Dextrin,5TMS,isomer #83