Hmdb loader
You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Human Metabolome Database.
Record Information
Version5.0
StatusDetected and Quantified
Creation Date2009-03-03 10:06:33 UTC
Update Date2021-10-13 05:30:55 UTC
HMDB IDHMDB0011730
Secondary Accession Numbers
  • HMDB11730
Metabolite Identification
Common NameMelezitose
DescriptionMelezitose, also spelled melicitose, is a nonreducing trisaccharide sugar that is produced by many plant sap eating insects, including aphids such as Cinara pilicornis by an enzyme reaction. This is beneficial to the insects, as it reduces the stress of osmosis by reducing their own water potential. The melezitose is part of the honeydew which acts as an attractant for ants and also as a food for bees. This is useful to the lice as they have a symbiotic relationship with ants. Melezitose can be partially hydrolyzed to glucose and turanose the latter of which is an isomer of sucrose (Wikipedia ).
Structure
Data?1582752945
Synonyms
ValueSource
MelizitoseChEBI
O-alpha-D-Glucopyranosyl-(1-3)-beta-D-fructofuranosyl-alpha-D-glucopyranosideChEBI
O-a-D-Glucopyranosyl-(1-3)-b-D-fructofuranosyl-a-D-glucopyranosideGenerator
O-Α-D-glucopyranosyl-(1-3)-β-D-fructofuranosyl-α-D-glucopyranosideGenerator
D-(+)-MelezitoseHMDB
D-MelezitoseHMDB
MelicitoseHMDB
O alpha-D-Glucopyranosyl-(1,3)-O beta-D-fructofuranosyl-(2,1) alpha-D-glucopyranosideHMDB
Chemical FormulaC18H32O16
Average Molecular Weight504.4371
Monoisotopic Molecular Weight504.169034976
IUPAC Name(2R,3R,4S,5S,6R)-2-{[(2S,3S,4R,5R)-4-hydroxy-2,5-bis(hydroxymethyl)-3-{[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxolan-2-yl]oxy}-6-(hydroxymethyl)oxane-3,4,5-triol
Traditional Namemelezitose
CAS Registry Number597-12-6
SMILES
OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O
InChI Identifier
InChI=1S/C18H32O16/c19-1-5-8(23)11(26)13(28)16(30-5)32-15-10(25)7(3-21)33-18(15,4-22)34-17-14(29)12(27)9(24)6(2-20)31-17/h5-17,19-29H,1-4H2/t5-,6-,7-,8-,9-,10-,11+,12+,13-,14-,15+,16-,17-,18+/m1/s1
InChI KeyQWIZNVHXZXRPDR-WSCXOGSTSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as oligosaccharides. These are carbohydrates made up of 3 to 10 monosaccharide units linked to each other through glycosidic bonds.
KingdomOrganic compounds
Super ClassOrganic oxygen compounds
ClassOrganooxygen compounds
Sub ClassCarbohydrates and carbohydrate conjugates
Direct ParentOligosaccharides
Alternative Parents
Substituents
  • Oligosaccharide
  • C-glycosyl compound
  • Glycosyl compound
  • O-glycosyl compound
  • Ketal
  • Oxane
  • Tetrahydrofuran
  • Secondary alcohol
  • Acetal
  • Oxacycle
  • Organoheterocyclic compound
  • Polyol
  • Alcohol
  • Primary alcohol
  • Hydrocarbon derivative
  • Aliphatic heteromonocyclic compound
Molecular FrameworkAliphatic heteromonocyclic compounds
External Descriptors
Ontology
Disposition

Source

Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting Point153 °CNot Available
Boiling Point881.80 °C. @ 760.00 mm Hg (est)The Good Scents Company Information System
Water Solubility1000000 mg/L @ 25 °C (est)The Good Scents Company Information System
LogP-5.790 (est)The Good Scents Company Information System
Experimental Chromatographic Properties

Experimental Collision Cross Sections

Adduct TypeData SourceCCS Value (Å2)Reference
[M-H]-Baker203.52130932474
[M-H]-Not Available203.521http://allccs.zhulab.cn/database/detail?ID=AllCCS00001819
Predicted Molecular Properties
PropertyValueSource
Water Solubility781 g/LALOGPS
logP-3.3ALOGPS
logP-6.3ChemAxon
logS0.19ALOGPS
pKa (Strongest Acidic)11.86ChemAxon
pKa (Strongest Basic)-3.5ChemAxon
Physiological Charge0ChemAxon
Hydrogen Acceptor Count16ChemAxon
Hydrogen Donor Count11ChemAxon
Polar Surface Area268.68 ŲChemAxon
Rotatable Bond Count8ChemAxon
Refractivity101.19 m³·mol⁻¹ChemAxon
Polarizability46.29 ųChemAxon
Number of Rings3ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleYesChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DeepCCS[M+H]+196.93230932474
DeepCCS[M-H]-195.10730932474
DeepCCS[M-2H]-229.0630932474
DeepCCS[M+Na]+202.83430932474

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
MelezitoseOC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3258.9Standard polar33892256
MelezitoseOC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O4158.9Standard non polar33892256
MelezitoseOC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O4124.5Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
Melezitose,1TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3902.6Semi standard non polar33892256
Melezitose,1TMS,isomer #10C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3911.3Semi standard non polar33892256
Melezitose,1TMS,isomer #11C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H]1CO3892.1Semi standard non polar33892256
Melezitose,1TMS,isomer #2C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3953.2Semi standard non polar33892256
Melezitose,1TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3898.1Semi standard non polar33892256
Melezitose,1TMS,isomer #4C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3890.8Semi standard non polar33892256
Melezitose,1TMS,isomer #5C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3890.1Semi standard non polar33892256
Melezitose,1TMS,isomer #6C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@]1(CO)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3915.9Semi standard non polar33892256
Melezitose,1TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3901.1Semi standard non polar33892256
Melezitose,1TMS,isomer #8C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3897.3Semi standard non polar33892256
Melezitose,1TMS,isomer #9C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3884.1Semi standard non polar33892256
Melezitose,2TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3856.5Semi standard non polar33892256
Melezitose,2TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3801.7Semi standard non polar33892256
Melezitose,2TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3861.5Semi standard non polar33892256
Melezitose,2TMS,isomer #12C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3846.4Semi standard non polar33892256
Melezitose,2TMS,isomer #13C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3844.6Semi standard non polar33892256
Melezitose,2TMS,isomer #14C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3864.1Semi standard non polar33892256
Melezitose,2TMS,isomer #15C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3838.9Semi standard non polar33892256
Melezitose,2TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3866.9Semi standard non polar33892256
Melezitose,2TMS,isomer #17C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3854.1Semi standard non polar33892256
Melezitose,2TMS,isomer #18C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3840.7Semi standard non polar33892256
Melezitose,2TMS,isomer #19C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3865.6Semi standard non polar33892256
Melezitose,2TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3826.1Semi standard non polar33892256
Melezitose,2TMS,isomer #20C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3800.8Semi standard non polar33892256
Melezitose,2TMS,isomer #21C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3828.6Semi standard non polar33892256
Melezitose,2TMS,isomer #22C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3816.6Semi standard non polar33892256
Melezitose,2TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3804.3Semi standard non polar33892256
Melezitose,2TMS,isomer #24C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3822.8Semi standard non polar33892256
Melezitose,2TMS,isomer #25C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3829.4Semi standard non polar33892256
Melezitose,2TMS,isomer #26C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3812.7Semi standard non polar33892256
Melezitose,2TMS,isomer #27C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3827.2Semi standard non polar33892256
Melezitose,2TMS,isomer #28C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3788.1Semi standard non polar33892256
Melezitose,2TMS,isomer #29C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3816.4Semi standard non polar33892256
Melezitose,2TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3814.9Semi standard non polar33892256
Melezitose,2TMS,isomer #30C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3808.2Semi standard non polar33892256
Melezitose,2TMS,isomer #31C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3800.1Semi standard non polar33892256
Melezitose,2TMS,isomer #32C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3813.5Semi standard non polar33892256
Melezitose,2TMS,isomer #33C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H]1CO3806.1Semi standard non polar33892256
Melezitose,2TMS,isomer #34C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3807.6Semi standard non polar33892256
Melezitose,2TMS,isomer #35C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3790.6Semi standard non polar33892256
Melezitose,2TMS,isomer #36C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3814.2Semi standard non polar33892256
Melezitose,2TMS,isomer #37C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3809.2Semi standard non polar33892256
Melezitose,2TMS,isomer #38C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3801.9Semi standard non polar33892256
Melezitose,2TMS,isomer #39C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3816.2Semi standard non polar33892256
Melezitose,2TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3813.8Semi standard non polar33892256
Melezitose,2TMS,isomer #40C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3823.0Semi standard non polar33892256
Melezitose,2TMS,isomer #41C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3805.5Semi standard non polar33892256
Melezitose,2TMS,isomer #42C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3832.3Semi standard non polar33892256
Melezitose,2TMS,isomer #43C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3821.7Semi standard non polar33892256
Melezitose,2TMS,isomer #44C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3813.5Semi standard non polar33892256
Melezitose,2TMS,isomer #45C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3828.6Semi standard non polar33892256
Melezitose,2TMS,isomer #46C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3804.8Semi standard non polar33892256
Melezitose,2TMS,isomer #47C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3832.0Semi standard non polar33892256
Melezitose,2TMS,isomer #48C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3810.1Semi standard non polar33892256
Melezitose,2TMS,isomer #49C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3841.3Semi standard non polar33892256
Melezitose,2TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3831.2Semi standard non polar33892256
Melezitose,2TMS,isomer #50C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3794.8Semi standard non polar33892256
Melezitose,2TMS,isomer #51C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H]1CO3813.9Semi standard non polar33892256
Melezitose,2TMS,isomer #52C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3807.1Semi standard non polar33892256
Melezitose,2TMS,isomer #53C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3785.8Semi standard non polar33892256
Melezitose,2TMS,isomer #54C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3813.8Semi standard non polar33892256
Melezitose,2TMS,isomer #55C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H]1CO3803.7Semi standard non polar33892256
Melezitose,2TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3830.8Semi standard non polar33892256
Melezitose,2TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3822.4Semi standard non polar33892256
Melezitose,2TMS,isomer #8C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3809.3Semi standard non polar33892256
Melezitose,2TMS,isomer #9C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3829.0Semi standard non polar33892256
Melezitose,3TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3716.8Semi standard non polar33892256
Melezitose,3TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3709.5Semi standard non polar33892256
Melezitose,3TMS,isomer #100C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3721.1Semi standard non polar33892256
Melezitose,3TMS,isomer #101C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3717.2Semi standard non polar33892256
Melezitose,3TMS,isomer #102C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3709.9Semi standard non polar33892256
Melezitose,3TMS,isomer #103C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3718.4Semi standard non polar33892256
Melezitose,3TMS,isomer #104C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3734.8Semi standard non polar33892256
Melezitose,3TMS,isomer #105C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3724.3Semi standard non polar33892256
Melezitose,3TMS,isomer #106C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3736.4Semi standard non polar33892256
Melezitose,3TMS,isomer #107C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3734.3Semi standard non polar33892256
Melezitose,3TMS,isomer #108C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3730.3Semi standard non polar33892256
Melezitose,3TMS,isomer #109C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3732.3Semi standard non polar33892256
Melezitose,3TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3694.9Semi standard non polar33892256
Melezitose,3TMS,isomer #110C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3713.7Semi standard non polar33892256
Melezitose,3TMS,isomer #111C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3717.1Semi standard non polar33892256
Melezitose,3TMS,isomer #112C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3703.3Semi standard non polar33892256
Melezitose,3TMS,isomer #113C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3717.0Semi standard non polar33892256
Melezitose,3TMS,isomer #114C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H]1CO3714.5Semi standard non polar33892256
Melezitose,3TMS,isomer #115C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3711.7Semi standard non polar33892256
Melezitose,3TMS,isomer #116C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3721.9Semi standard non polar33892256
Melezitose,3TMS,isomer #117C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3721.6Semi standard non polar33892256
Melezitose,3TMS,isomer #118C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3734.2Semi standard non polar33892256
Melezitose,3TMS,isomer #119C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3706.4Semi standard non polar33892256
Melezitose,3TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3712.7Semi standard non polar33892256
Melezitose,3TMS,isomer #120C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3739.6Semi standard non polar33892256
Melezitose,3TMS,isomer #121C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3730.8Semi standard non polar33892256
Melezitose,3TMS,isomer #122C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1CO3727.8Semi standard non polar33892256
Melezitose,3TMS,isomer #123C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1CO3732.7Semi standard non polar33892256
Melezitose,3TMS,isomer #124C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3723.2Semi standard non polar33892256
Melezitose,3TMS,isomer #125C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3717.5Semi standard non polar33892256
Melezitose,3TMS,isomer #126C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3715.2Semi standard non polar33892256
Melezitose,3TMS,isomer #127C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3722.6Semi standard non polar33892256
Melezitose,3TMS,isomer #128C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3728.2Semi standard non polar33892256
Melezitose,3TMS,isomer #129C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@H]1[C@H](O)[C@@H](CO)O[C@@]1(CO)O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3729.0Semi standard non polar33892256
Melezitose,3TMS,isomer #13C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3695.3Semi standard non polar33892256
Melezitose,3TMS,isomer #130C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3728.1Semi standard non polar33892256
Melezitose,3TMS,isomer #131C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3714.7Semi standard non polar33892256
Melezitose,3TMS,isomer #132C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3718.8Semi standard non polar33892256
Melezitose,3TMS,isomer #133C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3708.4Semi standard non polar33892256
Melezitose,3TMS,isomer #134C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3718.6Semi standard non polar33892256
Melezitose,3TMS,isomer #135C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3720.5Semi standard non polar33892256
Melezitose,3TMS,isomer #136C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3728.3Semi standard non polar33892256
Melezitose,3TMS,isomer #137C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3733.6Semi standard non polar33892256
Melezitose,3TMS,isomer #138C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3709.8Semi standard non polar33892256
Melezitose,3TMS,isomer #139C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3739.1Semi standard non polar33892256
Melezitose,3TMS,isomer #14C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3713.5Semi standard non polar33892256
Melezitose,3TMS,isomer #140C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3724.7Semi standard non polar33892256
Melezitose,3TMS,isomer #141C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3734.2Semi standard non polar33892256
Melezitose,3TMS,isomer #142C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3736.3Semi standard non polar33892256
Melezitose,3TMS,isomer #143C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3723.7Semi standard non polar33892256
Melezitose,3TMS,isomer #144C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3724.9Semi standard non polar33892256
Melezitose,3TMS,isomer #145C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3735.8Semi standard non polar33892256
Melezitose,3TMS,isomer #146C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3722.1Semi standard non polar33892256
Melezitose,3TMS,isomer #147C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3723.9Semi standard non polar33892256
Melezitose,3TMS,isomer #148C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3709.0Semi standard non polar33892256
Melezitose,3TMS,isomer #149C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3723.3Semi standard non polar33892256
Melezitose,3TMS,isomer #15C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3712.8Semi standard non polar33892256
Melezitose,3TMS,isomer #150C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3738.3Semi standard non polar33892256
Melezitose,3TMS,isomer #151C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3710.2Semi standard non polar33892256
Melezitose,3TMS,isomer #152C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3744.3Semi standard non polar33892256
Melezitose,3TMS,isomer #153C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3735.0Semi standard non polar33892256
Melezitose,3TMS,isomer #154C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@]1(CO)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3722.3Semi standard non polar33892256
Melezitose,3TMS,isomer #155C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3723.9Semi standard non polar33892256
Melezitose,3TMS,isomer #156C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3725.2Semi standard non polar33892256
Melezitose,3TMS,isomer #157C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3700.4Semi standard non polar33892256
Melezitose,3TMS,isomer #158C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3737.7Semi standard non polar33892256
Melezitose,3TMS,isomer #159C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3731.5Semi standard non polar33892256
Melezitose,3TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3699.8Semi standard non polar33892256
Melezitose,3TMS,isomer #160C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3750.3Semi standard non polar33892256
Melezitose,3TMS,isomer #161C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3736.1Semi standard non polar33892256
Melezitose,3TMS,isomer #162C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H]1CO3719.0Semi standard non polar33892256
Melezitose,3TMS,isomer #163C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H]1CO3709.2Semi standard non polar33892256
Melezitose,3TMS,isomer #164C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3723.0Semi standard non polar33892256
Melezitose,3TMS,isomer #165C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3707.2Semi standard non polar33892256
Melezitose,3TMS,isomer #17C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3715.4Semi standard non polar33892256
Melezitose,3TMS,isomer #18C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3711.6Semi standard non polar33892256
Melezitose,3TMS,isomer #19C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3710.7Semi standard non polar33892256
Melezitose,3TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3730.6Semi standard non polar33892256
Melezitose,3TMS,isomer #20C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3707.0Semi standard non polar33892256
Melezitose,3TMS,isomer #21C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3719.1Semi standard non polar33892256
Melezitose,3TMS,isomer #22C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3702.6Semi standard non polar33892256
Melezitose,3TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3720.0Semi standard non polar33892256
Melezitose,3TMS,isomer #24C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3714.3Semi standard non polar33892256
Melezitose,3TMS,isomer #25C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3716.9Semi standard non polar33892256
Melezitose,3TMS,isomer #26C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3705.8Semi standard non polar33892256
Melezitose,3TMS,isomer #27C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3717.7Semi standard non polar33892256
Melezitose,3TMS,isomer #28C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3706.5Semi standard non polar33892256
Melezitose,3TMS,isomer #29C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3718.8Semi standard non polar33892256
Melezitose,3TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3726.2Semi standard non polar33892256
Melezitose,3TMS,isomer #30C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3708.7Semi standard non polar33892256
Melezitose,3TMS,isomer #31C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3712.7Semi standard non polar33892256
Melezitose,3TMS,isomer #32C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3724.3Semi standard non polar33892256
Melezitose,3TMS,isomer #33C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3707.5Semi standard non polar33892256
Melezitose,3TMS,isomer #34C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3725.1Semi standard non polar33892256
Melezitose,3TMS,isomer #35C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3720.9Semi standard non polar33892256
Melezitose,3TMS,isomer #36C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3709.5Semi standard non polar33892256
Melezitose,3TMS,isomer #37C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3720.9Semi standard non polar33892256
Melezitose,3TMS,isomer #38C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3691.3Semi standard non polar33892256
Melezitose,3TMS,isomer #39C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3729.3Semi standard non polar33892256
Melezitose,3TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3729.6Semi standard non polar33892256
Melezitose,3TMS,isomer #40C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3708.1Semi standard non polar33892256
Melezitose,3TMS,isomer #41C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3722.8Semi standard non polar33892256
Melezitose,3TMS,isomer #42C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3721.4Semi standard non polar33892256
Melezitose,3TMS,isomer #43C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3709.6Semi standard non polar33892256
Melezitose,3TMS,isomer #44C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3699.5Semi standard non polar33892256
Melezitose,3TMS,isomer #45C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3718.9Semi standard non polar33892256
Melezitose,3TMS,isomer #46C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3738.6Semi standard non polar33892256
Melezitose,3TMS,isomer #47C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3740.9Semi standard non polar33892256
Melezitose,3TMS,isomer #48C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3760.8Semi standard non polar33892256
Melezitose,3TMS,isomer #49C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3740.7Semi standard non polar33892256
Melezitose,3TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3719.0Semi standard non polar33892256
Melezitose,3TMS,isomer #50C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3763.7Semi standard non polar33892256
Melezitose,3TMS,isomer #51C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3755.2Semi standard non polar33892256
Melezitose,3TMS,isomer #52C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3744.3Semi standard non polar33892256
Melezitose,3TMS,isomer #53C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3763.6Semi standard non polar33892256
Melezitose,3TMS,isomer #54C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3752.6Semi standard non polar33892256
Melezitose,3TMS,isomer #55C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3749.0Semi standard non polar33892256
Melezitose,3TMS,isomer #56C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3745.9Semi standard non polar33892256
Melezitose,3TMS,isomer #57C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3755.5Semi standard non polar33892256
Melezitose,3TMS,isomer #58C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3759.8Semi standard non polar33892256
Melezitose,3TMS,isomer #59C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3744.0Semi standard non polar33892256
Melezitose,3TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3736.6Semi standard non polar33892256
Melezitose,3TMS,isomer #60C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3762.8Semi standard non polar33892256
Melezitose,3TMS,isomer #61C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3756.9Semi standard non polar33892256
Melezitose,3TMS,isomer #62C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3739.2Semi standard non polar33892256
Melezitose,3TMS,isomer #63C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3751.2Semi standard non polar33892256
Melezitose,3TMS,isomer #64C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3757.8Semi standard non polar33892256
Melezitose,3TMS,isomer #65C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3745.3Semi standard non polar33892256
Melezitose,3TMS,isomer #66C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3760.1Semi standard non polar33892256
Melezitose,3TMS,isomer #67C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3745.1Semi standard non polar33892256
Melezitose,3TMS,isomer #68C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3755.6Semi standard non polar33892256
Melezitose,3TMS,isomer #69C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3761.6Semi standard non polar33892256
Melezitose,3TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3718.9Semi standard non polar33892256
Melezitose,3TMS,isomer #70C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3746.6Semi standard non polar33892256
Melezitose,3TMS,isomer #71C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3765.9Semi standard non polar33892256
Melezitose,3TMS,isomer #72C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3739.3Semi standard non polar33892256
Melezitose,3TMS,isomer #73C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3751.2Semi standard non polar33892256
Melezitose,3TMS,isomer #74C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3730.2Semi standard non polar33892256
Melezitose,3TMS,isomer #75C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3751.9Semi standard non polar33892256
Melezitose,3TMS,isomer #76C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3769.5Semi standard non polar33892256
Melezitose,3TMS,isomer #77C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3734.2Semi standard non polar33892256
Melezitose,3TMS,isomer #78C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3775.7Semi standard non polar33892256
Melezitose,3TMS,isomer #79C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3749.9Semi standard non polar33892256
Melezitose,3TMS,isomer #8C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3737.2Semi standard non polar33892256
Melezitose,3TMS,isomer #80C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3764.6Semi standard non polar33892256
Melezitose,3TMS,isomer #81C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3751.1Semi standard non polar33892256
Melezitose,3TMS,isomer #82C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3707.5Semi standard non polar33892256
Melezitose,3TMS,isomer #83C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3720.0Semi standard non polar33892256
Melezitose,3TMS,isomer #84C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3704.0Semi standard non polar33892256
Melezitose,3TMS,isomer #85C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3720.0Semi standard non polar33892256
Melezitose,3TMS,isomer #86C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3723.8Semi standard non polar33892256
Melezitose,3TMS,isomer #87C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3710.7Semi standard non polar33892256
Melezitose,3TMS,isomer #88C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3725.0Semi standard non polar33892256
Melezitose,3TMS,isomer #89C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3718.1Semi standard non polar33892256
Melezitose,3TMS,isomer #9C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3743.0Semi standard non polar33892256
Melezitose,3TMS,isomer #90C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3704.6Semi standard non polar33892256
Melezitose,3TMS,isomer #91C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3715.3Semi standard non polar33892256
Melezitose,3TMS,isomer #92C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3724.3Semi standard non polar33892256
Melezitose,3TMS,isomer #93C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3695.5Semi standard non polar33892256
Melezitose,3TMS,isomer #94C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3731.1Semi standard non polar33892256
Melezitose,3TMS,isomer #95C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3720.8Semi standard non polar33892256
Melezitose,3TMS,isomer #96C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3733.7Semi standard non polar33892256
Melezitose,3TMS,isomer #97C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3732.7Semi standard non polar33892256
Melezitose,3TMS,isomer #98C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3723.5Semi standard non polar33892256
Melezitose,3TMS,isomer #99C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3734.0Semi standard non polar33892256
Melezitose,4TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3625.5Semi standard non polar33892256
Melezitose,4TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3614.3Semi standard non polar33892256
Melezitose,4TMS,isomer #100C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3608.3Semi standard non polar33892256
Melezitose,4TMS,isomer #101C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3602.6Semi standard non polar33892256
Melezitose,4TMS,isomer #102C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3603.9Semi standard non polar33892256
Melezitose,4TMS,isomer #103C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3579.7Semi standard non polar33892256
Melezitose,4TMS,isomer #104C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3615.0Semi standard non polar33892256
Melezitose,4TMS,isomer #105C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3607.6Semi standard non polar33892256
Melezitose,4TMS,isomer #106C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3611.9Semi standard non polar33892256
Melezitose,4TMS,isomer #107C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3619.9Semi standard non polar33892256
Melezitose,4TMS,isomer #108C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3607.2Semi standard non polar33892256
Melezitose,4TMS,isomer #109C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3592.1Semi standard non polar33892256
Melezitose,4TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3615.2Semi standard non polar33892256
Melezitose,4TMS,isomer #110C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3612.6Semi standard non polar33892256
Melezitose,4TMS,isomer #111C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3611.1Semi standard non polar33892256
Melezitose,4TMS,isomer #112C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3581.5Semi standard non polar33892256
Melezitose,4TMS,isomer #113C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3625.2Semi standard non polar33892256
Melezitose,4TMS,isomer #114C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3605.0Semi standard non polar33892256
Melezitose,4TMS,isomer #115C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3621.1Semi standard non polar33892256
Melezitose,4TMS,isomer #116C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3613.3Semi standard non polar33892256
Melezitose,4TMS,isomer #117C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3626.5Semi standard non polar33892256
Melezitose,4TMS,isomer #118C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3612.6Semi standard non polar33892256
Melezitose,4TMS,isomer #119C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3617.1Semi standard non polar33892256
Melezitose,4TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3635.2Semi standard non polar33892256
Melezitose,4TMS,isomer #120C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3611.7Semi standard non polar33892256
Melezitose,4TMS,isomer #121C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3628.9Semi standard non polar33892256
Melezitose,4TMS,isomer #122C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3648.7Semi standard non polar33892256
Melezitose,4TMS,isomer #123C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3622.0Semi standard non polar33892256
Melezitose,4TMS,isomer #124C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3644.1Semi standard non polar33892256
Melezitose,4TMS,isomer #125C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3637.3Semi standard non polar33892256
Melezitose,4TMS,isomer #126C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3628.3Semi standard non polar33892256
Melezitose,4TMS,isomer #127C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3651.1Semi standard non polar33892256
Melezitose,4TMS,isomer #128C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3643.8Semi standard non polar33892256
Melezitose,4TMS,isomer #129C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3622.5Semi standard non polar33892256
Melezitose,4TMS,isomer #13C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3610.8Semi standard non polar33892256
Melezitose,4TMS,isomer #130C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3630.4Semi standard non polar33892256
Melezitose,4TMS,isomer #131C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3642.2Semi standard non polar33892256
Melezitose,4TMS,isomer #132C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3613.1Semi standard non polar33892256
Melezitose,4TMS,isomer #133C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3653.6Semi standard non polar33892256
Melezitose,4TMS,isomer #134C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3646.8Semi standard non polar33892256
Melezitose,4TMS,isomer #135C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3653.1Semi standard non polar33892256
Melezitose,4TMS,isomer #136C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3652.0Semi standard non polar33892256
Melezitose,4TMS,isomer #137C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3644.1Semi standard non polar33892256
Melezitose,4TMS,isomer #138C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3660.6Semi standard non polar33892256
Melezitose,4TMS,isomer #139C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3645.0Semi standard non polar33892256
Melezitose,4TMS,isomer #14C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3630.5Semi standard non polar33892256
Melezitose,4TMS,isomer #140C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3630.2Semi standard non polar33892256
Melezitose,4TMS,isomer #141C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3622.3Semi standard non polar33892256
Melezitose,4TMS,isomer #142C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3636.0Semi standard non polar33892256
Melezitose,4TMS,isomer #143C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3646.4Semi standard non polar33892256
Melezitose,4TMS,isomer #144C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3640.0Semi standard non polar33892256
Melezitose,4TMS,isomer #145C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3655.9Semi standard non polar33892256
Melezitose,4TMS,isomer #146C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3655.6Semi standard non polar33892256
Melezitose,4TMS,isomer #147C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3640.6Semi standard non polar33892256
Melezitose,4TMS,isomer #148C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3661.8Semi standard non polar33892256
Melezitose,4TMS,isomer #149C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3670.5Semi standard non polar33892256
Melezitose,4TMS,isomer #15C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3639.7Semi standard non polar33892256
Melezitose,4TMS,isomer #150C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3649.3Semi standard non polar33892256
Melezitose,4TMS,isomer #151C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3648.8Semi standard non polar33892256
Melezitose,4TMS,isomer #152C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3670.3Semi standard non polar33892256
Melezitose,4TMS,isomer #153C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3647.4Semi standard non polar33892256
Melezitose,4TMS,isomer #154C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3664.5Semi standard non polar33892256
Melezitose,4TMS,isomer #155C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3639.1Semi standard non polar33892256
Melezitose,4TMS,isomer #156C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3638.2Semi standard non polar33892256
Melezitose,4TMS,isomer #157C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3656.9Semi standard non polar33892256
Melezitose,4TMS,isomer #158C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3634.5Semi standard non polar33892256
Melezitose,4TMS,isomer #159C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3651.7Semi standard non polar33892256
Melezitose,4TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3626.2Semi standard non polar33892256
Melezitose,4TMS,isomer #160C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3641.1Semi standard non polar33892256
Melezitose,4TMS,isomer #161C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3655.0Semi standard non polar33892256
Melezitose,4TMS,isomer #162C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3629.1Semi standard non polar33892256
Melezitose,4TMS,isomer #163C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3652.5Semi standard non polar33892256
Melezitose,4TMS,isomer #164C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3655.2Semi standard non polar33892256
Melezitose,4TMS,isomer #165C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3624.6Semi standard non polar33892256
Melezitose,4TMS,isomer #166C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3661.8Semi standard non polar33892256
Melezitose,4TMS,isomer #167C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3660.9Semi standard non polar33892256
Melezitose,4TMS,isomer #168C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3663.0Semi standard non polar33892256
Melezitose,4TMS,isomer #169C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3660.0Semi standard non polar33892256
Melezitose,4TMS,isomer #17C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3605.1Semi standard non polar33892256
Melezitose,4TMS,isomer #170C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3650.6Semi standard non polar33892256
Melezitose,4TMS,isomer #171C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3649.1Semi standard non polar33892256
Melezitose,4TMS,isomer #172C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3671.4Semi standard non polar33892256
Melezitose,4TMS,isomer #173C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3653.5Semi standard non polar33892256
Melezitose,4TMS,isomer #174C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3666.9Semi standard non polar33892256
Melezitose,4TMS,isomer #175C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3629.7Semi standard non polar33892256
Melezitose,4TMS,isomer #176C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3644.8Semi standard non polar33892256
Melezitose,4TMS,isomer #177C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3622.2Semi standard non polar33892256
Melezitose,4TMS,isomer #178C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3642.4Semi standard non polar33892256
Melezitose,4TMS,isomer #179C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3650.7Semi standard non polar33892256
Melezitose,4TMS,isomer #18C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3624.7Semi standard non polar33892256
Melezitose,4TMS,isomer #180C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3620.3Semi standard non polar33892256
Melezitose,4TMS,isomer #181C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3654.3Semi standard non polar33892256
Melezitose,4TMS,isomer #182C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3659.9Semi standard non polar33892256
Melezitose,4TMS,isomer #183C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3658.0Semi standard non polar33892256
Melezitose,4TMS,isomer #184C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3658.8Semi standard non polar33892256
Melezitose,4TMS,isomer #185C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3631.6Semi standard non polar33892256
Melezitose,4TMS,isomer #186C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3645.7Semi standard non polar33892256
Melezitose,4TMS,isomer #187C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3621.2Semi standard non polar33892256
Melezitose,4TMS,isomer #188C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3643.7Semi standard non polar33892256
Melezitose,4TMS,isomer #189C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3646.0Semi standard non polar33892256
Melezitose,4TMS,isomer #19C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3605.2Semi standard non polar33892256
Melezitose,4TMS,isomer #190C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3619.1Semi standard non polar33892256
Melezitose,4TMS,isomer #191C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3655.0Semi standard non polar33892256
Melezitose,4TMS,isomer #192C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3648.7Semi standard non polar33892256
Melezitose,4TMS,isomer #193C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3652.6Semi standard non polar33892256
Melezitose,4TMS,isomer #194C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3650.8Semi standard non polar33892256
Melezitose,4TMS,isomer #195C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3647.7Semi standard non polar33892256
Melezitose,4TMS,isomer #196C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3614.1Semi standard non polar33892256
Melezitose,4TMS,isomer #197C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3657.7Semi standard non polar33892256
Melezitose,4TMS,isomer #198C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3643.1Semi standard non polar33892256
Melezitose,4TMS,isomer #199C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3650.7Semi standard non polar33892256
Melezitose,4TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3597.7Semi standard non polar33892256
Melezitose,4TMS,isomer #20C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3621.0Semi standard non polar33892256
Melezitose,4TMS,isomer #200C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3644.3Semi standard non polar33892256
Melezitose,4TMS,isomer #201C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3651.9Semi standard non polar33892256
Melezitose,4TMS,isomer #202C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3665.3Semi standard non polar33892256
Melezitose,4TMS,isomer #203C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3659.2Semi standard non polar33892256
Melezitose,4TMS,isomer #204C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3668.0Semi standard non polar33892256
Melezitose,4TMS,isomer #205C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3620.0Semi standard non polar33892256
Melezitose,4TMS,isomer #206C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3603.2Semi standard non polar33892256
Melezitose,4TMS,isomer #207C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3614.3Semi standard non polar33892256
Melezitose,4TMS,isomer #208C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3621.1Semi standard non polar33892256
Melezitose,4TMS,isomer #209C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3592.6Semi standard non polar33892256
Melezitose,4TMS,isomer #21C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3624.7Semi standard non polar33892256
Melezitose,4TMS,isomer #210C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3631.0Semi standard non polar33892256
Melezitose,4TMS,isomer #211C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3623.9Semi standard non polar33892256
Melezitose,4TMS,isomer #212C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3629.0Semi standard non polar33892256
Melezitose,4TMS,isomer #213C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3633.0Semi standard non polar33892256
Melezitose,4TMS,isomer #214C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3622.3Semi standard non polar33892256
Melezitose,4TMS,isomer #215C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3636.6Semi standard non polar33892256
Melezitose,4TMS,isomer #216C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3622.9Semi standard non polar33892256
Melezitose,4TMS,isomer #217C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3610.0Semi standard non polar33892256
Melezitose,4TMS,isomer #218C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3599.2Semi standard non polar33892256
Melezitose,4TMS,isomer #219C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3612.4Semi standard non polar33892256
Melezitose,4TMS,isomer #22C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3605.9Semi standard non polar33892256
Melezitose,4TMS,isomer #220C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3627.5Semi standard non polar33892256
Melezitose,4TMS,isomer #221C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3616.5Semi standard non polar33892256
Melezitose,4TMS,isomer #222C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3631.5Semi standard non polar33892256
Melezitose,4TMS,isomer #223C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3636.3Semi standard non polar33892256
Melezitose,4TMS,isomer #224C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3622.2Semi standard non polar33892256
Melezitose,4TMS,isomer #225C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3638.2Semi standard non polar33892256
Melezitose,4TMS,isomer #226C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3632.7Semi standard non polar33892256
Melezitose,4TMS,isomer #227C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3614.9Semi standard non polar33892256
Melezitose,4TMS,isomer #228C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3628.3Semi standard non polar33892256
Melezitose,4TMS,isomer #229C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3601.3Semi standard non polar33892256
Melezitose,4TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3626.5Semi standard non polar33892256
Melezitose,4TMS,isomer #230C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3635.3Semi standard non polar33892256
Melezitose,4TMS,isomer #231C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3629.3Semi standard non polar33892256
Melezitose,4TMS,isomer #232C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3615.7Semi standard non polar33892256
Melezitose,4TMS,isomer #233C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3587.8Semi standard non polar33892256
Melezitose,4TMS,isomer #234C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3621.2Semi standard non polar33892256
Melezitose,4TMS,isomer #235C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3623.8Semi standard non polar33892256
Melezitose,4TMS,isomer #236C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3599.5Semi standard non polar33892256
Melezitose,4TMS,isomer #237C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3632.0Semi standard non polar33892256
Melezitose,4TMS,isomer #238C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3638.7Semi standard non polar33892256
Melezitose,4TMS,isomer #239C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3623.5Semi standard non polar33892256
Melezitose,4TMS,isomer #24C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3603.8Semi standard non polar33892256
Melezitose,4TMS,isomer #240C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3633.4Semi standard non polar33892256
Melezitose,4TMS,isomer #241C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3641.6Semi standard non polar33892256
Melezitose,4TMS,isomer #242C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3632.5Semi standard non polar33892256
Melezitose,4TMS,isomer #243C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3629.1Semi standard non polar33892256
Melezitose,4TMS,isomer #244C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3636.5Semi standard non polar33892256
Melezitose,4TMS,isomer #245C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3633.9Semi standard non polar33892256
Melezitose,4TMS,isomer #246C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3627.6Semi standard non polar33892256
Melezitose,4TMS,isomer #247C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3638.2Semi standard non polar33892256
Melezitose,4TMS,isomer #248C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3650.1Semi standard non polar33892256
Melezitose,4TMS,isomer #249C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3632.1Semi standard non polar33892256
Melezitose,4TMS,isomer #25C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3621.3Semi standard non polar33892256
Melezitose,4TMS,isomer #250C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3653.6Semi standard non polar33892256
Melezitose,4TMS,isomer #251C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3629.7Semi standard non polar33892256
Melezitose,4TMS,isomer #252C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3626.8Semi standard non polar33892256
Melezitose,4TMS,isomer #253C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3633.5Semi standard non polar33892256
Melezitose,4TMS,isomer #254C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3634.0Semi standard non polar33892256
Melezitose,4TMS,isomer #255C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3609.1Semi standard non polar33892256
Melezitose,4TMS,isomer #256C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3633.1Semi standard non polar33892256
Melezitose,4TMS,isomer #257C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3644.7Semi standard non polar33892256
Melezitose,4TMS,isomer #258C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3626.0Semi standard non polar33892256
Melezitose,4TMS,isomer #259C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3646.2Semi standard non polar33892256
Melezitose,4TMS,isomer #26C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3630.7Semi standard non polar33892256
Melezitose,4TMS,isomer #260C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3652.3Semi standard non polar33892256
Melezitose,4TMS,isomer #261C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3625.9Semi standard non polar33892256
Melezitose,4TMS,isomer #262C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3620.7Semi standard non polar33892256
Melezitose,4TMS,isomer #263C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3630.0Semi standard non polar33892256
Melezitose,4TMS,isomer #264C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3602.2Semi standard non polar33892256
Melezitose,4TMS,isomer #265C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3637.3Semi standard non polar33892256
Melezitose,4TMS,isomer #266C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3642.6Semi standard non polar33892256
Melezitose,4TMS,isomer #267C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1CO3635.7Semi standard non polar33892256
Melezitose,4TMS,isomer #268C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1CO3635.8Semi standard non polar33892256
Melezitose,4TMS,isomer #269C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3632.8Semi standard non polar33892256
Melezitose,4TMS,isomer #27C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3621.4Semi standard non polar33892256
Melezitose,4TMS,isomer #270C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3622.0Semi standard non polar33892256
Melezitose,4TMS,isomer #271C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3612.3Semi standard non polar33892256
Melezitose,4TMS,isomer #272C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3632.6Semi standard non polar33892256
Melezitose,4TMS,isomer #273C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3630.3Semi standard non polar33892256
Melezitose,4TMS,isomer #274C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3637.7Semi standard non polar33892256
Melezitose,4TMS,isomer #275C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3646.5Semi standard non polar33892256
Melezitose,4TMS,isomer #276C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3644.4Semi standard non polar33892256
Melezitose,4TMS,isomer #277C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3640.8Semi standard non polar33892256
Melezitose,4TMS,isomer #278C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3615.4Semi standard non polar33892256
Melezitose,4TMS,isomer #279C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3646.4Semi standard non polar33892256
Melezitose,4TMS,isomer #28C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3619.0Semi standard non polar33892256
Melezitose,4TMS,isomer #280C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3630.8Semi standard non polar33892256
Melezitose,4TMS,isomer #281C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3606.7Semi standard non polar33892256
Melezitose,4TMS,isomer #282C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3638.7Semi standard non polar33892256
Melezitose,4TMS,isomer #283C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3637.1Semi standard non polar33892256
Melezitose,4TMS,isomer #284C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3645.8Semi standard non polar33892256
Melezitose,4TMS,isomer #285C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3645.7Semi standard non polar33892256
Melezitose,4TMS,isomer #286C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3661.0Semi standard non polar33892256
Melezitose,4TMS,isomer #287C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3653.3Semi standard non polar33892256
Melezitose,4TMS,isomer #288C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3655.7Semi standard non polar33892256
Melezitose,4TMS,isomer #289C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3642.7Semi standard non polar33892256
Melezitose,4TMS,isomer #29C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3591.9Semi standard non polar33892256
Melezitose,4TMS,isomer #290C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3641.0Semi standard non polar33892256
Melezitose,4TMS,isomer #291C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3652.0Semi standard non polar33892256
Melezitose,4TMS,isomer #292C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3644.5Semi standard non polar33892256
Melezitose,4TMS,isomer #293C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3651.5Semi standard non polar33892256
Melezitose,4TMS,isomer #294C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3640.6Semi standard non polar33892256
Melezitose,4TMS,isomer #295C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3655.7Semi standard non polar33892256
Melezitose,4TMS,isomer #296C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3630.0Semi standard non polar33892256
Melezitose,4TMS,isomer #297C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3626.8Semi standard non polar33892256
Melezitose,4TMS,isomer #298C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3598.0Semi standard non polar33892256
Melezitose,4TMS,isomer #299C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3632.2Semi standard non polar33892256
Melezitose,4TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3622.5Semi standard non polar33892256
Melezitose,4TMS,isomer #30C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3632.8Semi standard non polar33892256
Melezitose,4TMS,isomer #300C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3633.1Semi standard non polar33892256
Melezitose,4TMS,isomer #301C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3632.0Semi standard non polar33892256
Melezitose,4TMS,isomer #302C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3647.0Semi standard non polar33892256
Melezitose,4TMS,isomer #303C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3628.5Semi standard non polar33892256
Melezitose,4TMS,isomer #304C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3633.5Semi standard non polar33892256
Melezitose,4TMS,isomer #305C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3643.0Semi standard non polar33892256
Melezitose,4TMS,isomer #306C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3643.6Semi standard non polar33892256
Melezitose,4TMS,isomer #307C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3620.5Semi standard non polar33892256
Melezitose,4TMS,isomer #308C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3648.5Semi standard non polar33892256
Melezitose,4TMS,isomer #309C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3640.6Semi standard non polar33892256
Melezitose,4TMS,isomer #31C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3619.5Semi standard non polar33892256
Melezitose,4TMS,isomer #310C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3645.2Semi standard non polar33892256
Melezitose,4TMS,isomer #311C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3647.5Semi standard non polar33892256
Melezitose,4TMS,isomer #312C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3651.5Semi standard non polar33892256
Melezitose,4TMS,isomer #313C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3656.7Semi standard non polar33892256
Melezitose,4TMS,isomer #314C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3655.6Semi standard non polar33892256
Melezitose,4TMS,isomer #315C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3654.5Semi standard non polar33892256
Melezitose,4TMS,isomer #316C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3626.1Semi standard non polar33892256
Melezitose,4TMS,isomer #317C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3599.1Semi standard non polar33892256
Melezitose,4TMS,isomer #318C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3634.2Semi standard non polar33892256
Melezitose,4TMS,isomer #319C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3631.4Semi standard non polar33892256
Melezitose,4TMS,isomer #32C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3626.0Semi standard non polar33892256
Melezitose,4TMS,isomer #320C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3626.5Semi standard non polar33892256
Melezitose,4TMS,isomer #321C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3628.7Semi standard non polar33892256
Melezitose,4TMS,isomer #322C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3633.0Semi standard non polar33892256
Melezitose,4TMS,isomer #323C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3641.7Semi standard non polar33892256
Melezitose,4TMS,isomer #324C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3639.9Semi standard non polar33892256
Melezitose,4TMS,isomer #325C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3644.7Semi standard non polar33892256
Melezitose,4TMS,isomer #326C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3628.7Semi standard non polar33892256
Melezitose,4TMS,isomer #327C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3637.5Semi standard non polar33892256
Melezitose,4TMS,isomer #328C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3635.7Semi standard non polar33892256
Melezitose,4TMS,isomer #329C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3658.5Semi standard non polar33892256
Melezitose,4TMS,isomer #33C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3644.6Semi standard non polar33892256
Melezitose,4TMS,isomer #330C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3642.1Semi standard non polar33892256
Melezitose,4TMS,isomer #34C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3620.5Semi standard non polar33892256
Melezitose,4TMS,isomer #35C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3611.4Semi standard non polar33892256
Melezitose,4TMS,isomer #36C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3639.6Semi standard non polar33892256
Melezitose,4TMS,isomer #37C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3597.5Semi standard non polar33892256
Melezitose,4TMS,isomer #38C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3616.1Semi standard non polar33892256
Melezitose,4TMS,isomer #39C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3586.6Semi standard non polar33892256
Melezitose,4TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3598.4Semi standard non polar33892256
Melezitose,4TMS,isomer #40C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3607.4Semi standard non polar33892256
Melezitose,4TMS,isomer #41C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3609.1Semi standard non polar33892256
Melezitose,4TMS,isomer #42C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3595.4Semi standard non polar33892256
Melezitose,4TMS,isomer #43C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3617.1Semi standard non polar33892256
Melezitose,4TMS,isomer #44C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3601.7Semi standard non polar33892256
Melezitose,4TMS,isomer #45C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3580.7Semi standard non polar33892256
Melezitose,4TMS,isomer #46C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3592.5Semi standard non polar33892256
Melezitose,4TMS,isomer #47C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3599.7Semi standard non polar33892256
Melezitose,4TMS,isomer #48C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3572.5Semi standard non polar33892256
Melezitose,4TMS,isomer #49C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3611.7Semi standard non polar33892256
Melezitose,4TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3615.5Semi standard non polar33892256
Melezitose,4TMS,isomer #50C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3599.3Semi standard non polar33892256
Melezitose,4TMS,isomer #51C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3606.2Semi standard non polar33892256
Melezitose,4TMS,isomer #52C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3609.9Semi standard non polar33892256
Melezitose,4TMS,isomer #53C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3600.5Semi standard non polar33892256
Melezitose,4TMS,isomer #54C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3615.7Semi standard non polar33892256
Melezitose,4TMS,isomer #55C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3596.6Semi standard non polar33892256
Melezitose,4TMS,isomer #56C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3590.2Semi standard non polar33892256
Melezitose,4TMS,isomer #57C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3581.5Semi standard non polar33892256
Melezitose,4TMS,isomer #58C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3595.7Semi standard non polar33892256
Melezitose,4TMS,isomer #59C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3603.2Semi standard non polar33892256
Melezitose,4TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3609.4Semi standard non polar33892256
Melezitose,4TMS,isomer #60C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3594.1Semi standard non polar33892256
Melezitose,4TMS,isomer #61C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3611.0Semi standard non polar33892256
Melezitose,4TMS,isomer #62C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3610.8Semi standard non polar33892256
Melezitose,4TMS,isomer #63C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3599.3Semi standard non polar33892256
Melezitose,4TMS,isomer #64C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3615.5Semi standard non polar33892256
Melezitose,4TMS,isomer #65C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3629.1Semi standard non polar33892256
Melezitose,4TMS,isomer #66C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3602.9Semi standard non polar33892256
Melezitose,4TMS,isomer #67C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3625.5Semi standard non polar33892256
Melezitose,4TMS,isomer #68C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3604.6Semi standard non polar33892256
Melezitose,4TMS,isomer #69C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3618.1Semi standard non polar33892256
Melezitose,4TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3603.7Semi standard non polar33892256
Melezitose,4TMS,isomer #70C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3619.3Semi standard non polar33892256
Melezitose,4TMS,isomer #71C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3597.8Semi standard non polar33892256
Melezitose,4TMS,isomer #72C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3617.0Semi standard non polar33892256
Melezitose,4TMS,isomer #73C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3594.6Semi standard non polar33892256
Melezitose,4TMS,isomer #74C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3609.5Semi standard non polar33892256
Melezitose,4TMS,isomer #75C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3612.0Semi standard non polar33892256
Melezitose,4TMS,isomer #76C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3607.7Semi standard non polar33892256
Melezitose,4TMS,isomer #77C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3609.0Semi standard non polar33892256
Melezitose,4TMS,isomer #78C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3583.2Semi standard non polar33892256
Melezitose,4TMS,isomer #79C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3617.6Semi standard non polar33892256
Melezitose,4TMS,isomer #8C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3624.8Semi standard non polar33892256
Melezitose,4TMS,isomer #80C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3616.3Semi standard non polar33892256
Melezitose,4TMS,isomer #81C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3619.3Semi standard non polar33892256
Melezitose,4TMS,isomer #82C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3628.5Semi standard non polar33892256
Melezitose,4TMS,isomer #83C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3613.4Semi standard non polar33892256
Melezitose,4TMS,isomer #84C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3599.5Semi standard non polar33892256
Melezitose,4TMS,isomer #85C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3618.6Semi standard non polar33892256
Melezitose,4TMS,isomer #86C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3604.7Semi standard non polar33892256
Melezitose,4TMS,isomer #87C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3625.7Semi standard non polar33892256
Melezitose,4TMS,isomer #88C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3608.4Semi standard non polar33892256
Melezitose,4TMS,isomer #89C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3620.3Semi standard non polar33892256
Melezitose,4TMS,isomer #9C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3626.0Semi standard non polar33892256
Melezitose,4TMS,isomer #90C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3622.0Semi standard non polar33892256
Melezitose,4TMS,isomer #91C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3596.7Semi standard non polar33892256
Melezitose,4TMS,isomer #92C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3605.3Semi standard non polar33892256
Melezitose,4TMS,isomer #93C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3579.5Semi standard non polar33892256
Melezitose,4TMS,isomer #94C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3611.6Semi standard non polar33892256
Melezitose,4TMS,isomer #95C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3613.6Semi standard non polar33892256
Melezitose,4TMS,isomer #96C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3613.4Semi standard non polar33892256
Melezitose,4TMS,isomer #97C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3616.7Semi standard non polar33892256
Melezitose,4TMS,isomer #98C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3612.2Semi standard non polar33892256
Melezitose,4TMS,isomer #99C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3594.1Semi standard non polar33892256
Melezitose,5TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3496.4Semi standard non polar33892256
Melezitose,5TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3479.5Semi standard non polar33892256
Melezitose,5TMS,isomer #100C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3488.5Semi standard non polar33892256
Melezitose,5TMS,isomer #101C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3482.9Semi standard non polar33892256
Melezitose,5TMS,isomer #102C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3494.1Semi standard non polar33892256
Melezitose,5TMS,isomer #103C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3501.3Semi standard non polar33892256
Melezitose,5TMS,isomer #104C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3475.8Semi standard non polar33892256
Melezitose,5TMS,isomer #105C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3501.8Semi standard non polar33892256
Melezitose,5TMS,isomer #106C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3506.7Semi standard non polar33892256
Melezitose,5TMS,isomer #107C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3474.8Semi standard non polar33892256
Melezitose,5TMS,isomer #108C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3491.9Semi standard non polar33892256
Melezitose,5TMS,isomer #109C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3481.7Semi standard non polar33892256
Melezitose,5TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3490.5Semi standard non polar33892256
Melezitose,5TMS,isomer #110C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3499.1Semi standard non polar33892256
Melezitose,5TMS,isomer #111C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3501.9Semi standard non polar33892256
Melezitose,5TMS,isomer #112C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3492.3Semi standard non polar33892256
Melezitose,5TMS,isomer #113C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3491.5Semi standard non polar33892256
Melezitose,5TMS,isomer #114C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3498.5Semi standard non polar33892256
Melezitose,5TMS,isomer #115C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3485.5Semi standard non polar33892256
Melezitose,5TMS,isomer #116C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3477.8Semi standard non polar33892256
Melezitose,5TMS,isomer #117C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3493.2Semi standard non polar33892256
Melezitose,5TMS,isomer #118C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3492.6Semi standard non polar33892256
Melezitose,5TMS,isomer #119C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3499.3Semi standard non polar33892256
Melezitose,5TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3463.8Semi standard non polar33892256
Melezitose,5TMS,isomer #120C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3505.5Semi standard non polar33892256
Melezitose,5TMS,isomer #121C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3521.5Semi standard non polar33892256
Melezitose,5TMS,isomer #122C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3504.0Semi standard non polar33892256
Melezitose,5TMS,isomer #123C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3516.6Semi standard non polar33892256
Melezitose,5TMS,isomer #124C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3509.9Semi standard non polar33892256
Melezitose,5TMS,isomer #125C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3495.9Semi standard non polar33892256
Melezitose,5TMS,isomer #126C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3504.2Semi standard non polar33892256
Melezitose,5TMS,isomer #127C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3502.9Semi standard non polar33892256
Melezitose,5TMS,isomer #128C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3519.5Semi standard non polar33892256
Melezitose,5TMS,isomer #129C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3490.7Semi standard non polar33892256
Melezitose,5TMS,isomer #13C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3494.0Semi standard non polar33892256
Melezitose,5TMS,isomer #130C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3524.1Semi standard non polar33892256
Melezitose,5TMS,isomer #131C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3502.9Semi standard non polar33892256
Melezitose,5TMS,isomer #132C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3515.5Semi standard non polar33892256
Melezitose,5TMS,isomer #133C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3509.1Semi standard non polar33892256
Melezitose,5TMS,isomer #134C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3517.2Semi standard non polar33892256
Melezitose,5TMS,isomer #135C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3486.8Semi standard non polar33892256
Melezitose,5TMS,isomer #136C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3518.4Semi standard non polar33892256
Melezitose,5TMS,isomer #137C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3515.6Semi standard non polar33892256
Melezitose,5TMS,isomer #138C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3486.9Semi standard non polar33892256
Melezitose,5TMS,isomer #139C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3520.5Semi standard non polar33892256
Melezitose,5TMS,isomer #14C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3505.8Semi standard non polar33892256
Melezitose,5TMS,isomer #140C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3524.4Semi standard non polar33892256
Melezitose,5TMS,isomer #141C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3522.2Semi standard non polar33892256
Melezitose,5TMS,isomer #142C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3536.5Semi standard non polar33892256
Melezitose,5TMS,isomer #143C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3529.7Semi standard non polar33892256
Melezitose,5TMS,isomer #144C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3531.2Semi standard non polar33892256
Melezitose,5TMS,isomer #145C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3513.0Semi standard non polar33892256
Melezitose,5TMS,isomer #146C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3497.4Semi standard non polar33892256
Melezitose,5TMS,isomer #147C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3516.4Semi standard non polar33892256
Melezitose,5TMS,isomer #148C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3507.8Semi standard non polar33892256
Melezitose,5TMS,isomer #149C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3521.2Semi standard non polar33892256
Melezitose,5TMS,isomer #15C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3501.6Semi standard non polar33892256
Melezitose,5TMS,isomer #150C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3539.2Semi standard non polar33892256
Melezitose,5TMS,isomer #151C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3528.1Semi standard non polar33892256
Melezitose,5TMS,isomer #152C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3517.5Semi standard non polar33892256
Melezitose,5TMS,isomer #153C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3534.3Semi standard non polar33892256
Melezitose,5TMS,isomer #154C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3496.8Semi standard non polar33892256
Melezitose,5TMS,isomer #155C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3509.1Semi standard non polar33892256
Melezitose,5TMS,isomer #156C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3484.7Semi standard non polar33892256
Melezitose,5TMS,isomer #157C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3497.7Semi standard non polar33892256
Melezitose,5TMS,isomer #158C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3489.1Semi standard non polar33892256
Melezitose,5TMS,isomer #159C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3505.4Semi standard non polar33892256
Melezitose,5TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3506.4Semi standard non polar33892256
Melezitose,5TMS,isomer #160C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3516.7Semi standard non polar33892256
Melezitose,5TMS,isomer #161C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3506.0Semi standard non polar33892256
Melezitose,5TMS,isomer #162C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3500.7Semi standard non polar33892256
Melezitose,5TMS,isomer #163C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3512.7Semi standard non polar33892256
Melezitose,5TMS,isomer #164C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3480.1Semi standard non polar33892256
Melezitose,5TMS,isomer #165C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3493.4Semi standard non polar33892256
Melezitose,5TMS,isomer #166C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3496.8Semi standard non polar33892256
Melezitose,5TMS,isomer #167C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3472.4Semi standard non polar33892256
Melezitose,5TMS,isomer #168C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3500.3Semi standard non polar33892256
Melezitose,5TMS,isomer #169C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3514.4Semi standard non polar33892256
Melezitose,5TMS,isomer #17C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3497.8Semi standard non polar33892256
Melezitose,5TMS,isomer #170C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3507.1Semi standard non polar33892256
Melezitose,5TMS,isomer #171C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3519.8Semi standard non polar33892256
Melezitose,5TMS,isomer #172C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3533.1Semi standard non polar33892256
Melezitose,5TMS,isomer #173C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3511.7Semi standard non polar33892256
Melezitose,5TMS,isomer #174C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3508.0Semi standard non polar33892256
Melezitose,5TMS,isomer #175C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3500.6Semi standard non polar33892256
Melezitose,5TMS,isomer #176C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3498.5Semi standard non polar33892256
Melezitose,5TMS,isomer #177C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3516.2Semi standard non polar33892256
Melezitose,5TMS,isomer #178C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3510.6Semi standard non polar33892256
Melezitose,5TMS,isomer #179C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3521.4Semi standard non polar33892256
Melezitose,5TMS,isomer #18C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3513.7Semi standard non polar33892256
Melezitose,5TMS,isomer #180C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3535.8Semi standard non polar33892256
Melezitose,5TMS,isomer #181C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3524.3Semi standard non polar33892256
Melezitose,5TMS,isomer #182C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3508.9Semi standard non polar33892256
Melezitose,5TMS,isomer #183C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3533.6Semi standard non polar33892256
Melezitose,5TMS,isomer #184C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3496.6Semi standard non polar33892256
Melezitose,5TMS,isomer #185C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3505.1Semi standard non polar33892256
Melezitose,5TMS,isomer #186C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3490.3Semi standard non polar33892256
Melezitose,5TMS,isomer #187C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3479.3Semi standard non polar33892256
Melezitose,5TMS,isomer #188C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3497.9Semi standard non polar33892256
Melezitose,5TMS,isomer #189C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3530.2Semi standard non polar33892256
Melezitose,5TMS,isomer #19C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3497.9Semi standard non polar33892256
Melezitose,5TMS,isomer #190C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3520.3Semi standard non polar33892256
Melezitose,5TMS,isomer #191C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3534.3Semi standard non polar33892256
Melezitose,5TMS,isomer #192C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3543.5Semi standard non polar33892256
Melezitose,5TMS,isomer #193C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3505.8Semi standard non polar33892256
Melezitose,5TMS,isomer #194C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3496.3Semi standard non polar33892256
Melezitose,5TMS,isomer #195C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3500.2Semi standard non polar33892256
Melezitose,5TMS,isomer #196C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3487.1Semi standard non polar33892256
Melezitose,5TMS,isomer #197C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3470.7Semi standard non polar33892256
Melezitose,5TMS,isomer #198C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3494.3Semi standard non polar33892256
Melezitose,5TMS,isomer #199C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3510.5Semi standard non polar33892256
Melezitose,5TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3517.5Semi standard non polar33892256
Melezitose,5TMS,isomer #20C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3482.2Semi standard non polar33892256
Melezitose,5TMS,isomer #200C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3504.5Semi standard non polar33892256
Melezitose,5TMS,isomer #201C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3515.3Semi standard non polar33892256
Melezitose,5TMS,isomer #202C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3524.5Semi standard non polar33892256
Melezitose,5TMS,isomer #203C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3496.3Semi standard non polar33892256
Melezitose,5TMS,isomer #204C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3492.2Semi standard non polar33892256
Melezitose,5TMS,isomer #205C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3490.8Semi standard non polar33892256
Melezitose,5TMS,isomer #206C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3494.3Semi standard non polar33892256
Melezitose,5TMS,isomer #207C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3490.8Semi standard non polar33892256
Melezitose,5TMS,isomer #208C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3501.0Semi standard non polar33892256
Melezitose,5TMS,isomer #209C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3536.4Semi standard non polar33892256
Melezitose,5TMS,isomer #21C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3488.5Semi standard non polar33892256
Melezitose,5TMS,isomer #210C[Si](C)(C)OC[C@H]1O[C@@](CO)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3509.6Semi standard non polar33892256
Melezitose,5TMS,isomer #211C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3524.8Semi standard non polar33892256
Melezitose,5TMS,isomer #212C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3497.3Semi standard non polar33892256
Melezitose,5TMS,isomer #213C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3515.6Semi standard non polar33892256
Melezitose,5TMS,isomer #214C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3530.5Semi standard non polar33892256
Melezitose,5TMS,isomer #215C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3487.1Semi standard non polar33892256
Melezitose,5TMS,isomer #216C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3531.9Semi standard non polar33892256
Melezitose,5TMS,isomer #217C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3537.5Semi standard non polar33892256
Melezitose,5TMS,isomer #218C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3538.4Semi standard non polar33892256
Melezitose,5TMS,isomer #219C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3534.7Semi standard non polar33892256
Melezitose,5TMS,isomer #22C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3488.7Semi standard non polar33892256
Melezitose,5TMS,isomer #220C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3521.9Semi standard non polar33892256
Melezitose,5TMS,isomer #221C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3544.8Semi standard non polar33892256
Melezitose,5TMS,isomer #222C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3529.4Semi standard non polar33892256
Melezitose,5TMS,isomer #223C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3502.3Semi standard non polar33892256
Melezitose,5TMS,isomer #224C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3499.5Semi standard non polar33892256
Melezitose,5TMS,isomer #225C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3510.8Semi standard non polar33892256
Melezitose,5TMS,isomer #226C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3527.6Semi standard non polar33892256
Melezitose,5TMS,isomer #227C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3516.4Semi standard non polar33892256
Melezitose,5TMS,isomer #228C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3538.8Semi standard non polar33892256
Melezitose,5TMS,isomer #229C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3532.1Semi standard non polar33892256
Melezitose,5TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3498.1Semi standard non polar33892256
Melezitose,5TMS,isomer #230C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3507.9Semi standard non polar33892256
Melezitose,5TMS,isomer #231C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3537.0Semi standard non polar33892256
Melezitose,5TMS,isomer #232C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3530.6Semi standard non polar33892256
Melezitose,5TMS,isomer #233C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3497.8Semi standard non polar33892256
Melezitose,5TMS,isomer #234C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3524.7Semi standard non polar33892256
Melezitose,5TMS,isomer #235C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3500.5Semi standard non polar33892256
Melezitose,5TMS,isomer #236C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3524.7Semi standard non polar33892256
Melezitose,5TMS,isomer #237C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3526.9Semi standard non polar33892256
Melezitose,5TMS,isomer #238C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3516.5Semi standard non polar33892256
Melezitose,5TMS,isomer #239C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3512.2Semi standard non polar33892256
Melezitose,5TMS,isomer #24C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3492.3Semi standard non polar33892256
Melezitose,5TMS,isomer #240C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3518.4Semi standard non polar33892256
Melezitose,5TMS,isomer #241C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3518.1Semi standard non polar33892256
Melezitose,5TMS,isomer #242C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3500.5Semi standard non polar33892256
Melezitose,5TMS,isomer #243C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3521.7Semi standard non polar33892256
Melezitose,5TMS,isomer #244C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3523.8Semi standard non polar33892256
Melezitose,5TMS,isomer #245C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3527.3Semi standard non polar33892256
Melezitose,5TMS,isomer #246C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3531.7Semi standard non polar33892256
Melezitose,5TMS,isomer #247C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3552.9Semi standard non polar33892256
Melezitose,5TMS,isomer #248C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3541.0Semi standard non polar33892256
Melezitose,5TMS,isomer #249C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3542.2Semi standard non polar33892256
Melezitose,5TMS,isomer #25C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3506.4Semi standard non polar33892256
Melezitose,5TMS,isomer #250C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3546.4Semi standard non polar33892256
Melezitose,5TMS,isomer #251C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3532.8Semi standard non polar33892256
Melezitose,5TMS,isomer #252C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3530.6Semi standard non polar33892256
Melezitose,5TMS,isomer #253C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3540.2Semi standard non polar33892256
Melezitose,5TMS,isomer #254C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3550.4Semi standard non polar33892256
Melezitose,5TMS,isomer #255C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3523.3Semi standard non polar33892256
Melezitose,5TMS,isomer #256C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3556.9Semi standard non polar33892256
Melezitose,5TMS,isomer #257C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3532.3Semi standard non polar33892256
Melezitose,5TMS,isomer #258C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3538.8Semi standard non polar33892256
Melezitose,5TMS,isomer #259C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3537.9Semi standard non polar33892256
Melezitose,5TMS,isomer #26C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3505.3Semi standard non polar33892256
Melezitose,5TMS,isomer #260C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3541.6Semi standard non polar33892256
Melezitose,5TMS,isomer #261C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3509.0Semi standard non polar33892256
Melezitose,5TMS,isomer #262C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3539.2Semi standard non polar33892256
Melezitose,5TMS,isomer #263C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3545.1Semi standard non polar33892256
Melezitose,5TMS,isomer #264C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3516.8Semi standard non polar33892256
Melezitose,5TMS,isomer #265C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3551.3Semi standard non polar33892256
Melezitose,5TMS,isomer #266C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3547.2Semi standard non polar33892256
Melezitose,5TMS,isomer #267C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3539.4Semi standard non polar33892256
Melezitose,5TMS,isomer #268C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3548.8Semi standard non polar33892256
Melezitose,5TMS,isomer #269C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3566.7Semi standard non polar33892256
Melezitose,5TMS,isomer #27C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3476.9Semi standard non polar33892256
Melezitose,5TMS,isomer #270C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3552.8Semi standard non polar33892256
Melezitose,5TMS,isomer #271C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3558.8Semi standard non polar33892256
Melezitose,5TMS,isomer #272C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3535.1Semi standard non polar33892256
Melezitose,5TMS,isomer #273C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3556.6Semi standard non polar33892256
Melezitose,5TMS,isomer #274C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3529.4Semi standard non polar33892256
Melezitose,5TMS,isomer #275C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3549.7Semi standard non polar33892256
Melezitose,5TMS,isomer #276C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3552.2Semi standard non polar33892256
Melezitose,5TMS,isomer #277C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3529.2Semi standard non polar33892256
Melezitose,5TMS,isomer #278C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3550.8Semi standard non polar33892256
Melezitose,5TMS,isomer #279C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3579.2Semi standard non polar33892256
Melezitose,5TMS,isomer #28C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3508.8Semi standard non polar33892256
Melezitose,5TMS,isomer #280C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3568.7Semi standard non polar33892256
Melezitose,5TMS,isomer #281C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3568.9Semi standard non polar33892256
Melezitose,5TMS,isomer #282C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3521.7Semi standard non polar33892256
Melezitose,5TMS,isomer #283C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3539.6Semi standard non polar33892256
Melezitose,5TMS,isomer #284C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3511.8Semi standard non polar33892256
Melezitose,5TMS,isomer #285C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3530.7Semi standard non polar33892256
Melezitose,5TMS,isomer #286C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3532.2Semi standard non polar33892256
Melezitose,5TMS,isomer #287C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3509.8Semi standard non polar33892256
Melezitose,5TMS,isomer #288C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3535.2Semi standard non polar33892256
Melezitose,5TMS,isomer #289C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3555.9Semi standard non polar33892256
Melezitose,5TMS,isomer #29C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3527.1Semi standard non polar33892256
Melezitose,5TMS,isomer #290C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3545.4Semi standard non polar33892256
Melezitose,5TMS,isomer #291C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3544.7Semi standard non polar33892256
Melezitose,5TMS,isomer #292C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3542.6Semi standard non polar33892256
Melezitose,5TMS,isomer #293C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3502.6Semi standard non polar33892256
Melezitose,5TMS,isomer #294C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3543.2Semi standard non polar33892256
Melezitose,5TMS,isomer #295C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3552.3Semi standard non polar33892256
Melezitose,5TMS,isomer #296C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3549.3Semi standard non polar33892256
Melezitose,5TMS,isomer #297C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3541.5Semi standard non polar33892256
Melezitose,5TMS,isomer #298C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3545.1Semi standard non polar33892256
Melezitose,5TMS,isomer #299C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3542.4Semi standard non polar33892256
Melezitose,5TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3482.0Semi standard non polar33892256
Melezitose,5TMS,isomer #30C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3502.6Semi standard non polar33892256
Melezitose,5TMS,isomer #300C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3550.8Semi standard non polar33892256
Melezitose,5TMS,isomer #301C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3567.0Semi standard non polar33892256
Melezitose,5TMS,isomer #302C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3525.6Semi standard non polar33892256
Melezitose,5TMS,isomer #303C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O3545.4Semi standard non polar33892256
Melezitose,5TMS,isomer #304C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O3520.9Semi standard non polar33892256
Melezitose,5TMS,isomer #305C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3540.3Semi standard non polar33892256
Melezitose,5TMS,isomer #306C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3543.6Semi standard non polar33892256
Melezitose,5TMS,isomer #307C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3534.4Semi standard non polar33892256
Melezitose,5TMS,isomer #308C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3545.0Semi standard non polar33892256
Melezitose,5TMS,isomer #309C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3570.4Semi standard non polar33892256
Melezitose,5TMS,isomer #31C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3535.1Semi standard non polar33892256
Melezitose,5TMS,isomer #310C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3558.6Semi standard non polar33892256
Melezitose,5TMS,isomer #311C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3561.3Semi standard non polar33892256
Melezitose,5TMS,isomer #312C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3524.3Semi standard non polar33892256
Melezitose,5TMS,isomer #313C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3495.1Semi standard non polar33892256
Melezitose,5TMS,isomer #314C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3525.7Semi standard non polar33892256
Melezitose,5TMS,isomer #315C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3541.8Semi standard non polar33892256
Melezitose,5TMS,isomer #316C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3535.8Semi standard non polar33892256
Melezitose,5TMS,isomer #317C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3531.0Semi standard non polar33892256
Melezitose,5TMS,isomer #318C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3554.3Semi standard non polar33892256
Melezitose,5TMS,isomer #319C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3543.3Semi standard non polar33892256
Melezitose,5TMS,isomer #32C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3510.5Semi standard non polar33892256
Melezitose,5TMS,isomer #320C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3556.0Semi standard non polar33892256
Melezitose,5TMS,isomer #321C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3568.3Semi standard non polar33892256
Melezitose,5TMS,isomer #322C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3525.4Semi standard non polar33892256
Melezitose,5TMS,isomer #323C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3492.2Semi standard non polar33892256
Melezitose,5TMS,isomer #324C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3529.5Semi standard non polar33892256
Melezitose,5TMS,isomer #325C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3533.7Semi standard non polar33892256
Melezitose,5TMS,isomer #326C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C3529.1Semi standard non polar33892256
Melezitose,5TMS,isomer #327C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3523.6Semi standard non polar33892256
Melezitose,5TMS,isomer #328C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3534.9Semi standard non polar33892256
Melezitose,5TMS,isomer #329C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3532.0Semi standard non polar33892256
Melezitose,5TMS,isomer #33C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3527.4Semi standard non polar33892256
Melezitose,5TMS,isomer #330C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3539.7Semi standard non polar33892256
Melezitose,5TMS,isomer #331C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3550.9Semi standard non polar33892256
Melezitose,5TMS,isomer #332C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3530.8Semi standard non polar33892256
Melezitose,5TMS,isomer #333C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3532.6Semi standard non polar33892256
Melezitose,5TMS,isomer #334C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3535.6Semi standard non polar33892256
Melezitose,5TMS,isomer #335C[Si](C)(C)OC[C@@]1(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3545.2Semi standard non polar33892256
Melezitose,5TMS,isomer #336C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3560.5Semi standard non polar33892256
Melezitose,5TMS,isomer #337C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3521.4Semi standard non polar33892256
Melezitose,5TMS,isomer #338C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3489.5Semi standard non polar33892256
Melezitose,5TMS,isomer #339C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3518.6Semi standard non polar33892256
Melezitose,5TMS,isomer #34C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3520.1Semi standard non polar33892256
Melezitose,5TMS,isomer #340C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3484.8Semi standard non polar33892256
Melezitose,5TMS,isomer #341C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3519.1Semi standard non polar33892256
Melezitose,5TMS,isomer #342C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3520.3Semi standard non polar33892256
Melezitose,5TMS,isomer #343C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3501.5Semi standard non polar33892256
Melezitose,5TMS,isomer #344C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3486.4Semi standard non polar33892256
Melezitose,5TMS,isomer #345C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3504.3Semi standard non polar33892256
Melezitose,5TMS,isomer #346C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3514.3Semi standard non polar33892256
Melezitose,5TMS,isomer #347C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3481.4Semi standard non polar33892256
Melezitose,5TMS,isomer #348C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3514.8Semi standard non polar33892256
Melezitose,5TMS,isomer #349C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3511.5Semi standard non polar33892256
Melezitose,5TMS,isomer #35C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3487.8Semi standard non polar33892256
Melezitose,5TMS,isomer #350C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3515.9Semi standard non polar33892256
Melezitose,5TMS,isomer #351C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3522.1Semi standard non polar33892256
Melezitose,5TMS,isomer #352C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3534.7Semi standard non polar33892256
Melezitose,5TMS,isomer #353C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3524.4Semi standard non polar33892256
Melezitose,5TMS,isomer #354C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3520.7Semi standard non polar33892256
Melezitose,5TMS,isomer #355C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3528.7Semi standard non polar33892256
Melezitose,5TMS,isomer #356C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3520.3Semi standard non polar33892256
Melezitose,5TMS,isomer #357C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3512.3Semi standard non polar33892256
Melezitose,5TMS,isomer #358C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3525.6Semi standard non polar33892256
Melezitose,5TMS,isomer #359C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3534.9Semi standard non polar33892256
Melezitose,5TMS,isomer #36C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3516.9Semi standard non polar33892256
Melezitose,5TMS,isomer #360C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3503.7Semi standard non polar33892256
Melezitose,5TMS,isomer #361C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3539.1Semi standard non polar33892256
Melezitose,5TMS,isomer #362C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3514.6Semi standard non polar33892256
Melezitose,5TMS,isomer #363C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3514.3Semi standard non polar33892256
Melezitose,5TMS,isomer #364C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3519.5Semi standard non polar33892256
Melezitose,5TMS,isomer #365C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3517.7Semi standard non polar33892256
Melezitose,5TMS,isomer #366C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3483.3Semi standard non polar33892256
Melezitose,5TMS,isomer #367C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3516.5Semi standard non polar33892256
Melezitose,5TMS,isomer #368C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3530.0Semi standard non polar33892256
Melezitose,5TMS,isomer #369C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3498.4Semi standard non polar33892256
Melezitose,5TMS,isomer #37C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3492.3Semi standard non polar33892256
Melezitose,5TMS,isomer #370C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3532.7Semi standard non polar33892256
Melezitose,5TMS,isomer #371C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3528.6Semi standard non polar33892256
Melezitose,5TMS,isomer #372C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3549.9Semi standard non polar33892256
Melezitose,5TMS,isomer #373C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3542.5Semi standard non polar33892256
Melezitose,5TMS,isomer #374C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3534.0Semi standard non polar33892256
Melezitose,5TMS,isomer #375C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3547.6Semi standard non polar33892256
Melezitose,5TMS,isomer #376C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3508.3Semi standard non polar33892256
Melezitose,5TMS,isomer #377C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3502.5Semi standard non polar33892256
Melezitose,5TMS,isomer #378C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3516.1Semi standard non polar33892256
Melezitose,5TMS,isomer #379C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3535.3Semi standard non polar33892256
Melezitose,5TMS,isomer #38C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3508.7Semi standard non polar33892256
Melezitose,5TMS,isomer #380C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3523.8Semi standard non polar33892256
Melezitose,5TMS,isomer #381C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3540.9Semi standard non polar33892256
Melezitose,5TMS,isomer #382C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3541.1Semi standard non polar33892256
Melezitose,5TMS,isomer #383C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3536.4Semi standard non polar33892256
Melezitose,5TMS,isomer #384C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3546.4Semi standard non polar33892256
Melezitose,5TMS,isomer #385C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3544.9Semi standard non polar33892256
Melezitose,5TMS,isomer #386C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3532.8Semi standard non polar33892256
Melezitose,5TMS,isomer #387C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3549.3Semi standard non polar33892256
Melezitose,5TMS,isomer #388C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3533.0Semi standard non polar33892256
Melezitose,5TMS,isomer #389C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3521.9Semi standard non polar33892256
Melezitose,5TMS,isomer #39C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3509.0Semi standard non polar33892256
Melezitose,5TMS,isomer #390C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3538.4Semi standard non polar33892256
Melezitose,5TMS,isomer #391C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3556.7Semi standard non polar33892256
Melezitose,5TMS,isomer #392C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3548.0Semi standard non polar33892256
Melezitose,5TMS,isomer #393C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3562.9Semi standard non polar33892256
Melezitose,5TMS,isomer #394C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3556.3Semi standard non polar33892256
Melezitose,5TMS,isomer #395C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3570.3Semi standard non polar33892256
Melezitose,5TMS,isomer #396C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3536.4Semi standard non polar33892256
Melezitose,5TMS,isomer #397C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3573.3Semi standard non polar33892256
Melezitose,5TMS,isomer #398C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3554.8Semi standard non polar33892256
Melezitose,5TMS,isomer #399C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3519.8Semi standard non polar33892256
Melezitose,5TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3512.5Semi standard non polar33892256
Melezitose,5TMS,isomer #40C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3507.8Semi standard non polar33892256
Melezitose,5TMS,isomer #400C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3556.6Semi standard non polar33892256
Melezitose,5TMS,isomer #401C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3561.9Semi standard non polar33892256
Melezitose,5TMS,isomer #402C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3565.1Semi standard non polar33892256
Melezitose,5TMS,isomer #403C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3530.3Semi standard non polar33892256
Melezitose,5TMS,isomer #404C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3566.4Semi standard non polar33892256
Melezitose,5TMS,isomer #405C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3557.1Semi standard non polar33892256
Melezitose,5TMS,isomer #406C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3553.2Semi standard non polar33892256
Melezitose,5TMS,isomer #407C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3534.3Semi standard non polar33892256
Melezitose,5TMS,isomer #408C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3535.9Semi standard non polar33892256
Melezitose,5TMS,isomer #409C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3507.5Semi standard non polar33892256
Melezitose,5TMS,isomer #41C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3510.0Semi standard non polar33892256
Melezitose,5TMS,isomer #410C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3533.7Semi standard non polar33892256
Melezitose,5TMS,isomer #411C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3517.7Semi standard non polar33892256
Melezitose,5TMS,isomer #412C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3488.0Semi standard non polar33892256
Melezitose,5TMS,isomer #413C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3518.1Semi standard non polar33892256
Melezitose,5TMS,isomer #414C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3526.3Semi standard non polar33892256
Melezitose,5TMS,isomer #415C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3522.1Semi standard non polar33892256
Melezitose,5TMS,isomer #416C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3531.9Semi standard non polar33892256
Melezitose,5TMS,isomer #417C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3542.6Semi standard non polar33892256
Melezitose,5TMS,isomer #418C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3550.8Semi standard non polar33892256
Melezitose,5TMS,isomer #419C[Si](C)(C)O[C@H]1[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@](CO)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3560.1Semi standard non polar33892256
Melezitose,5TMS,isomer #42C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3478.9Semi standard non polar33892256
Melezitose,5TMS,isomer #420C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3535.1Semi standard non polar33892256
Melezitose,5TMS,isomer #421C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3528.4Semi standard non polar33892256
Melezitose,5TMS,isomer #422C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3544.1Semi standard non polar33892256
Melezitose,5TMS,isomer #423C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3529.9Semi standard non polar33892256
Melezitose,5TMS,isomer #424C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3547.2Semi standard non polar33892256
Melezitose,5TMS,isomer #425C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3523.9Semi standard non polar33892256
Melezitose,5TMS,isomer #426C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3535.0Semi standard non polar33892256
Melezitose,5TMS,isomer #427C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3557.6Semi standard non polar33892256
Melezitose,5TMS,isomer #428C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3553.8Semi standard non polar33892256
Melezitose,5TMS,isomer #429C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3567.2Semi standard non polar33892256
Melezitose,5TMS,isomer #43C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3512.2Semi standard non polar33892256
Melezitose,5TMS,isomer #430C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3569.3Semi standard non polar33892256
Melezitose,5TMS,isomer #431C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3557.1Semi standard non polar33892256
Melezitose,5TMS,isomer #432C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3576.6Semi standard non polar33892256
Melezitose,5TMS,isomer #433C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3546.3Semi standard non polar33892256
Melezitose,5TMS,isomer #434C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3533.8Semi standard non polar33892256
Melezitose,5TMS,isomer #435C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3552.9Semi standard non polar33892256
Melezitose,5TMS,isomer #436C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3565.6Semi standard non polar33892256
Melezitose,5TMS,isomer #437C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3570.4Semi standard non polar33892256
Melezitose,5TMS,isomer #438C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3586.4Semi standard non polar33892256
Melezitose,5TMS,isomer #439C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3587.7Semi standard non polar33892256
Melezitose,5TMS,isomer #44C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3530.5Semi standard non polar33892256
Melezitose,5TMS,isomer #440C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3560.9Semi standard non polar33892256
Melezitose,5TMS,isomer #441C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3576.4Semi standard non polar33892256
Melezitose,5TMS,isomer #442C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3528.5Semi standard non polar33892256
Melezitose,5TMS,isomer #443C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3509.7Semi standard non polar33892256
Melezitose,5TMS,isomer #444C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3528.4Semi standard non polar33892256
Melezitose,5TMS,isomer #445C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3526.8Semi standard non polar33892256
Melezitose,5TMS,isomer #446C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3518.5Semi standard non polar33892256
Melezitose,5TMS,isomer #447C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3533.2Semi standard non polar33892256
Melezitose,5TMS,isomer #448C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3544.6Semi standard non polar33892256
Melezitose,5TMS,isomer #449C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3548.4Semi standard non polar33892256
Melezitose,5TMS,isomer #45C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3524.0Semi standard non polar33892256
Melezitose,5TMS,isomer #450C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3538.8Semi standard non polar33892256
Melezitose,5TMS,isomer #451C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3539.3Semi standard non polar33892256
Melezitose,5TMS,isomer #452C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3568.3Semi standard non polar33892256
Melezitose,5TMS,isomer #453C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3557.2Semi standard non polar33892256
Melezitose,5TMS,isomer #454C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3573.7Semi standard non polar33892256
Melezitose,5TMS,isomer #455C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3580.7Semi standard non polar33892256
Melezitose,5TMS,isomer #456C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@]2(CO)O[C@H](CO)[C@@H](O)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3579.6Semi standard non polar33892256
Melezitose,5TMS,isomer #457C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3514.4Semi standard non polar33892256
Melezitose,5TMS,isomer #458C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3509.6Semi standard non polar33892256
Melezitose,5TMS,isomer #459C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3520.5Semi standard non polar33892256
Melezitose,5TMS,isomer #46C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3533.8Semi standard non polar33892256
Melezitose,5TMS,isomer #460C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3524.2Semi standard non polar33892256
Melezitose,5TMS,isomer #461C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3558.7Semi standard non polar33892256
Melezitose,5TMS,isomer #462C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@@]2(CO)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3537.7Semi standard non polar33892256
Melezitose,5TMS,isomer #47C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3518.1Semi standard non polar33892256
Melezitose,5TMS,isomer #48C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3501.5Semi standard non polar33892256
Melezitose,5TMS,isomer #49C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3525.8Semi standard non polar33892256
Melezitose,5TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3504.7Semi standard non polar33892256
Melezitose,5TMS,isomer #50C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3500.7Semi standard non polar33892256
Melezitose,5TMS,isomer #51C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3524.5Semi standard non polar33892256
Melezitose,5TMS,isomer #52C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3509.4Semi standard non polar33892256
Melezitose,5TMS,isomer #53C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3519.0Semi standard non polar33892256
Melezitose,5TMS,isomer #54C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3512.6Semi standard non polar33892256
Melezitose,5TMS,isomer #55C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3489.1Semi standard non polar33892256
Melezitose,5TMS,isomer #56C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3501.5Semi standard non polar33892256
Melezitose,5TMS,isomer #57C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3487.1Semi standard non polar33892256
Melezitose,5TMS,isomer #58C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3504.0Semi standard non polar33892256
Melezitose,5TMS,isomer #59C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3523.2Semi standard non polar33892256
Melezitose,5TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3485.6Semi standard non polar33892256
Melezitose,5TMS,isomer #60C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3514.4Semi standard non polar33892256
Melezitose,5TMS,isomer #61C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3517.0Semi standard non polar33892256
Melezitose,5TMS,isomer #62C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3514.7Semi standard non polar33892256
Melezitose,5TMS,isomer #63C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3498.1Semi standard non polar33892256
Melezitose,5TMS,isomer #64C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3509.9Semi standard non polar33892256
Melezitose,5TMS,isomer #65C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3497.4Semi standard non polar33892256
Melezitose,5TMS,isomer #66C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3496.0Semi standard non polar33892256
Melezitose,5TMS,isomer #67C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3475.6Semi standard non polar33892256
Melezitose,5TMS,isomer #68C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@@]2(CO[Si](C)(C)C)O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3500.6Semi standard non polar33892256
Melezitose,5TMS,isomer #69C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3513.9Semi standard non polar33892256
Melezitose,5TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@H](O[C@]2(CO[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3511.4Semi standard non polar33892256
Melezitose,5TMS,isomer #70C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3507.5Semi standard non polar33892256
Melezitose,5TMS,isomer #71C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3517.4Semi standard non polar33892256
Melezitose,5TMS,isomer #72C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3503.0Semi standard non polar33892256
Melezitose,5TMS,isomer #73C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3489.3Semi standard non polar33892256
Melezitose,5TMS,isomer #74C[Si](C)(C)OC[C@H]1O[C@@](CO[Si](C)(C)C)(O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3510.4Semi standard non polar33892256
Melezitose,5TMS,isomer #75