Hmdb loader
Record Information
Version5.0
StatusExpected but not Quantified
Creation Date2012-09-06 15:16:50 UTC
Update Date2022-03-07 02:51:45 UTC
HMDB IDHMDB0014822
Secondary Accession Numbers
  • HMDB14822
Metabolite Identification
Common NameTobramycin
DescriptionTobramycin is only found in individuals that have used or taken this drug. It is an aminoglycoside, broad-spectrum antibiotic produced by Streptomyces tenebrarius. It is effective against gram-negative bacteria, especially the pseudomonas species. It is a 10% component of the antibiotic complex, nebramycin, produced by the same species. [PubChem]Tobramycin binds irreversibly to one of two aminoglycoside binding sites on the 30 S ribosomal subunit, inhibiting bacterial protein synthesis. Tobramycin may also destabilize bacterial memebrane by binding to 16 S 16 S r-RNA. An active transport mechanism for aminoglycoside uptake is necessary in the bacteria in order to attain a significant intracellular concentration of tobramycin.
Structure
Data?1582753224
Synonyms
ValueSource
3'-Deoxykanamycin bChEBI
Nebramycin 6ChEBI
Nebramycin factir 6ChEBI
O-3-Amino-3-deoxy-alpha-D-glucopyranosyl-(1-4)-O-(2,6-diamino-2,3,6-trideoxy-alpha-D-ribohexopyranosyl-(1-4))-2-deoxy-D-streptamineChEBI
TobracinChEBI
TobrexChEBI
Nebramycin factor 6Kegg
TobiKegg
BethkisKegg
O-3-Amino-3-deoxy-a-D-glucopyranosyl-(1-4)-O-(2,6-diamino-2,3,6-trideoxy-a-D-ribohexopyranosyl-(1-4))-2-deoxy-D-streptamineGenerator
O-3-Amino-3-deoxy-α-D-glucopyranosyl-(1-4)-O-(2,6-diamino-2,3,6-trideoxy-α-D-ribohexopyranosyl-(1-4))-2-deoxy-D-streptamineGenerator
TOBHMDB
SPRC-AB01HMDB
Tobramycin solution for inhalationHMDB
Tobramycin sulfateHMDB
ObracinHMDB
NebcinHMDB
NebicinHMDB
BrulamycinHMDB
Sulfate, tobramycinHMDB
Chemical FormulaC18H37N5O9
Average Molecular Weight467.5145
Monoisotopic Molecular Weight467.259127807
IUPAC Name(2S,3R,4S,5S,6R)-4-amino-2-{[(1S,2S,3R,4S,6R)-4,6-diamino-3-{[(2R,3R,5S,6R)-3-amino-6-(aminomethyl)-5-hydroxyoxan-2-yl]oxy}-2-hydroxycyclohexyl]oxy}-6-(hydroxymethyl)oxane-3,5-diol
Traditional Nametobramycin
CAS Registry Number32986-56-4
SMILES
NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O
InChI Identifier
InChI=1S/C18H37N5O9/c19-3-9-8(25)2-7(22)17(29-9)31-15-5(20)1-6(21)16(14(15)28)32-18-13(27)11(23)12(26)10(4-24)30-18/h5-18,24-28H,1-4,19-23H2/t5-,6+,7+,8-,9+,10+,11-,12+,13+,14-,15+,16-,17+,18+/m0/s1
InChI KeyNLVFBUXFDBBNBW-PBSUHMDJSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as 4,6-disubstituted 2-deoxystreptamines. These are 2-deoxystreptamine aminoglycosides that are glycosidically linked to a pyranose of furanose unit at the C4- and C6-positions.
KingdomOrganic compounds
Super ClassOrganic oxygen compounds
ClassOrganooxygen compounds
Sub ClassCarbohydrates and carbohydrate conjugates
Direct Parent4,6-disubstituted 2-deoxystreptamines
Alternative Parents
Substituents
  • 4,6-disubstituted 2-deoxystreptamine
  • Glycosyl compound
  • O-glycosyl compound
  • Aminocyclitol or derivatives
  • Cyclohexanol
  • Cyclohexylamine
  • Cyclitol or derivatives
  • Monosaccharide
  • Oxane
  • Cyclic alcohol
  • 1,2-aminoalcohol
  • Secondary alcohol
  • Organoheterocyclic compound
  • Acetal
  • Oxacycle
  • Alcohol
  • Organonitrogen compound
  • Primary aliphatic amine
  • Hydrocarbon derivative
  • Organopnictogen compound
  • Organic nitrogen compound
  • Amine
  • Primary alcohol
  • Primary amine
  • Aliphatic heteromonocyclic compound
Molecular FrameworkAliphatic heteromonocyclic compounds
External Descriptors
Ontology
Physiological effectNot Available
Disposition
Process
RoleNot Available
Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water Solubility53.7 g/LNot Available
LogP-5.8Not Available
Experimental Chromatographic PropertiesNot Available
Predicted Molecular Properties
PropertyValueSource
Water Solubility53.7 g/LALOGPS
logP-3ALOGPS
logP-6.5ChemAxon
logS-0.94ALOGPS
pKa (Strongest Acidic)12.54ChemAxon
pKa (Strongest Basic)9.83ChemAxon
Physiological Charge5ChemAxon
Hydrogen Acceptor Count14ChemAxon
Hydrogen Donor Count10ChemAxon
Polar Surface Area268.17 ŲChemAxon
Rotatable Bond Count6ChemAxon
Refractivity106.69 m³·mol⁻¹ChemAxon
Polarizability47.18 ųChemAxon
Number of Rings3ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleYesChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DeepCCS[M+H]+205.33630932474
DeepCCS[M-H]-203.45630932474
DeepCCS[M-2H]-237.42230932474
DeepCCS[M+Na]+211.35630932474
AllCCS[M+H]+209.332859911
AllCCS[M+H-H2O]+207.632859911
AllCCS[M+NH4]+211.032859911
AllCCS[M+Na]+211.432859911
AllCCS[M-H]-199.632859911
AllCCS[M+Na-2H]-199.032859911
AllCCS[M+HCOO]-198.532859911

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
TobramycinNC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O3147.4Standard polar33892256
TobramycinNC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4572.8Standard non polar33892256
TobramycinNC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4083.9Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
Tobramycin,1TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N)[C@@H]1O4094.3Semi standard non polar33892256
Tobramycin,1TMS,isomer #10C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O4164.6Semi standard non polar33892256
Tobramycin,1TMS,isomer #2C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O)[C@H]1N4070.8Semi standard non polar33892256
Tobramycin,1TMS,isomer #3C[Si](C)(C)O[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)O[C@H](CO)[C@@H](O)[C@@H]1N4072.3Semi standard non polar33892256
Tobramycin,1TMS,isomer #4C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4099.5Semi standard non polar33892256
Tobramycin,1TMS,isomer #5C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)O[C@@H]1CN4091.4Semi standard non polar33892256
Tobramycin,1TMS,isomer #6C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4164.5Semi standard non polar33892256
Tobramycin,1TMS,isomer #7C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4134.1Semi standard non polar33892256
Tobramycin,1TMS,isomer #8C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4129.5Semi standard non polar33892256
Tobramycin,1TMS,isomer #9C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O4162.1Semi standard non polar33892256
Tobramycin,2TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N)[C@@H]1O4032.0Semi standard non polar33892256
Tobramycin,2TMS,isomer #10C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4024.1Semi standard non polar33892256
Tobramycin,2TMS,isomer #11C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)O[C@@H]1CN4001.7Semi standard non polar33892256
Tobramycin,2TMS,isomer #12C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)O[C@@H]1CO4000.7Semi standard non polar33892256
Tobramycin,2TMS,isomer #13C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4057.7Semi standard non polar33892256
Tobramycin,2TMS,isomer #14C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H]1O4070.9Semi standard non polar33892256
Tobramycin,2TMS,isomer #15C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4059.0Semi standard non polar33892256
Tobramycin,2TMS,isomer #16C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O4055.3Semi standard non polar33892256
Tobramycin,2TMS,isomer #17C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O4063.2Semi standard non polar33892256
Tobramycin,2TMS,isomer #18C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4021.2Semi standard non polar33892256
Tobramycin,2TMS,isomer #19C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)O[C@@H]1CN3998.8Semi standard non polar33892256
Tobramycin,2TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N)[C@@H]1O4012.4Semi standard non polar33892256
Tobramycin,2TMS,isomer #20C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O4053.0Semi standard non polar33892256
Tobramycin,2TMS,isomer #21C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H]1O4072.3Semi standard non polar33892256
Tobramycin,2TMS,isomer #22C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4063.8Semi standard non polar33892256
Tobramycin,2TMS,isomer #23C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C4060.0Semi standard non polar33892256
Tobramycin,2TMS,isomer #24C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C4067.7Semi standard non polar33892256
Tobramycin,2TMS,isomer #25C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)O[C@@H]1CN4024.6Semi standard non polar33892256
Tobramycin,2TMS,isomer #26C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O4109.0Semi standard non polar33892256
Tobramycin,2TMS,isomer #27C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4067.8Semi standard non polar33892256
Tobramycin,2TMS,isomer #28C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4067.6Semi standard non polar33892256
Tobramycin,2TMS,isomer #29C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O4073.8Semi standard non polar33892256
Tobramycin,2TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O4019.9Semi standard non polar33892256
Tobramycin,2TMS,isomer #30C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O[Si](C)(C)C4093.5Semi standard non polar33892256
Tobramycin,2TMS,isomer #31C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O4074.2Semi standard non polar33892256
Tobramycin,2TMS,isomer #32C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N4071.9Semi standard non polar33892256
Tobramycin,2TMS,isomer #33C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4067.5Semi standard non polar33892256
Tobramycin,2TMS,isomer #34C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O4086.2Semi standard non polar33892256
Tobramycin,2TMS,isomer #35C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C4054.9Semi standard non polar33892256
Tobramycin,2TMS,isomer #36C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4098.9Semi standard non polar33892256
Tobramycin,2TMS,isomer #37C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4095.4Semi standard non polar33892256
Tobramycin,2TMS,isomer #38C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4137.9Semi standard non polar33892256
Tobramycin,2TMS,isomer #39C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O4096.7Semi standard non polar33892256
Tobramycin,2TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C4018.7Semi standard non polar33892256
Tobramycin,2TMS,isomer #40C[Si](C)(C)N(C[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O)[Si](C)(C)C4224.5Semi standard non polar33892256
Tobramycin,2TMS,isomer #41C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4096.3Semi standard non polar33892256
Tobramycin,2TMS,isomer #42C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@@H]1O4134.7Semi standard non polar33892256
Tobramycin,2TMS,isomer #43C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C4115.9Semi standard non polar33892256
Tobramycin,2TMS,isomer #44C[Si](C)(C)N([C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N)[Si](C)(C)C4131.4Semi standard non polar33892256
Tobramycin,2TMS,isomer #45C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4118.5Semi standard non polar33892256
Tobramycin,2TMS,isomer #46C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O4130.2Semi standard non polar33892256
Tobramycin,2TMS,isomer #47C[Si](C)(C)N([C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O)[Si](C)(C)C4123.8Semi standard non polar33892256
Tobramycin,2TMS,isomer #48C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O4151.3Semi standard non polar33892256
Tobramycin,2TMS,isomer #49C[Si](C)(C)N([C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O)[Si](C)(C)C4143.0Semi standard non polar33892256
Tobramycin,2TMS,isomer #5C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4062.6Semi standard non polar33892256
Tobramycin,2TMS,isomer #50C[Si](C)(C)N([C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O)[Si](C)(C)C4158.7Semi standard non polar33892256
Tobramycin,2TMS,isomer #6C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O4075.3Semi standard non polar33892256
Tobramycin,2TMS,isomer #7C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4071.4Semi standard non polar33892256
Tobramycin,2TMS,isomer #8C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O4067.8Semi standard non polar33892256
Tobramycin,2TMS,isomer #9C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O4087.1Semi standard non polar33892256
Tobramycin,3TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N)[C@@H]1O3931.2Semi standard non polar33892256
Tobramycin,3TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3934.4Semi standard non polar33892256
Tobramycin,3TMS,isomer #100C[Si](C)(C)O[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)O[C@H](CO)[C@@H](O)[C@@H]1N([Si](C)(C)C)[Si](C)(C)C4089.0Semi standard non polar33892256
Tobramycin,3TMS,isomer #101C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O[Si](C)(C)C3974.8Semi standard non polar33892256
Tobramycin,3TMS,isomer #102C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3963.1Semi standard non polar33892256
Tobramycin,3TMS,isomer #103C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O3959.4Semi standard non polar33892256
Tobramycin,3TMS,isomer #104C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O4013.6Semi standard non polar33892256
Tobramycin,3TMS,isomer #105C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O[Si](C)(C)C3968.8Semi standard non polar33892256
Tobramycin,3TMS,isomer #106C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O4056.2Semi standard non polar33892256
Tobramycin,3TMS,isomer #107C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O4068.4Semi standard non polar33892256
Tobramycin,3TMS,isomer #108C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O[Si](C)(C)C)[C@@H]1O4051.2Semi standard non polar33892256
Tobramycin,3TMS,isomer #109C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O4052.2Semi standard non polar33892256
Tobramycin,3TMS,isomer #11C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3965.0Semi standard non polar33892256
Tobramycin,3TMS,isomer #110C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4093.8Semi standard non polar33892256
Tobramycin,3TMS,isomer #111C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4002.1Semi standard non polar33892256
Tobramycin,3TMS,isomer #112C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3994.1Semi standard non polar33892256
Tobramycin,3TMS,isomer #113C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4020.4Semi standard non polar33892256
Tobramycin,3TMS,isomer #114C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4045.7Semi standard non polar33892256
Tobramycin,3TMS,isomer #115C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3997.5Semi standard non polar33892256
Tobramycin,3TMS,isomer #116C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C4020.2Semi standard non polar33892256
Tobramycin,3TMS,isomer #117C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4055.7Semi standard non polar33892256
Tobramycin,3TMS,isomer #118C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N[Si](C)(C)C)C[C@@H]1O4003.1Semi standard non polar33892256
Tobramycin,3TMS,isomer #119C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]1N4171.3Semi standard non polar33892256
Tobramycin,3TMS,isomer #12C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O3968.6Semi standard non polar33892256
Tobramycin,3TMS,isomer #120C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N([Si](C)(C)C)[Si](C)(C)C4101.1Semi standard non polar33892256
Tobramycin,3TMS,isomer #121C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C3978.2Semi standard non polar33892256
Tobramycin,3TMS,isomer #122C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N[Si](C)(C)C4012.8Semi standard non polar33892256
Tobramycin,3TMS,isomer #123C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4012.3Semi standard non polar33892256
Tobramycin,3TMS,isomer #124C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O4039.3Semi standard non polar33892256
Tobramycin,3TMS,isomer #125C[Si](C)(C)O[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)O[C@@H]1CN4078.2Semi standard non polar33892256
Tobramycin,3TMS,isomer #126C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N4003.7Semi standard non polar33892256
Tobramycin,3TMS,isomer #127C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H]2O)[C@@H]1O4044.9Semi standard non polar33892256
Tobramycin,3TMS,isomer #128C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3993.6Semi standard non polar33892256
Tobramycin,3TMS,isomer #129C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)O[C@@H]1CN4052.6Semi standard non polar33892256
Tobramycin,3TMS,isomer #13C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3969.3Semi standard non polar33892256
Tobramycin,3TMS,isomer #130C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3988.4Semi standard non polar33892256
Tobramycin,3TMS,isomer #131C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O4040.1Semi standard non polar33892256
Tobramycin,3TMS,isomer #132C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)O[C@@H]1CN4048.0Semi standard non polar33892256
Tobramycin,3TMS,isomer #133C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C4036.0Semi standard non polar33892256
Tobramycin,3TMS,isomer #134C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)O[C@@H]1CN4077.5Semi standard non polar33892256
Tobramycin,3TMS,isomer #135C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)O[C@@H]1CN([Si](C)(C)C)[Si](C)(C)C4156.7Semi standard non polar33892256
Tobramycin,3TMS,isomer #136C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4040.0Semi standard non polar33892256
Tobramycin,3TMS,isomer #137C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4087.3Semi standard non polar33892256
Tobramycin,3TMS,isomer #138C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O4038.1Semi standard non polar33892256
Tobramycin,3TMS,isomer #139C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]1N4203.1Semi standard non polar33892256
Tobramycin,3TMS,isomer #14C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O3964.7Semi standard non polar33892256
Tobramycin,3TMS,isomer #140C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4116.0Semi standard non polar33892256
Tobramycin,3TMS,isomer #141C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4086.5Semi standard non polar33892256
Tobramycin,3TMS,isomer #142C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O4038.6Semi standard non polar33892256
Tobramycin,3TMS,isomer #143C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4203.7Semi standard non polar33892256
Tobramycin,3TMS,isomer #144C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4112.4Semi standard non polar33892256
Tobramycin,3TMS,isomer #145C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O4079.2Semi standard non polar33892256
Tobramycin,3TMS,isomer #146C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O4233.2Semi standard non polar33892256
Tobramycin,3TMS,isomer #147C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4153.5Semi standard non polar33892256
Tobramycin,3TMS,isomer #148C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O4216.6Semi standard non polar33892256
Tobramycin,3TMS,isomer #149C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H]1O4129.8Semi standard non polar33892256
Tobramycin,3TMS,isomer #15C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O3985.6Semi standard non polar33892256
Tobramycin,3TMS,isomer #150C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N[Si](C)(C)C)C[C@H]2N[Si](C)(C)C)[C@@H]1O4089.1Semi standard non polar33892256
Tobramycin,3TMS,isomer #151C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C4064.4Semi standard non polar33892256
Tobramycin,3TMS,isomer #152C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4115.8Semi standard non polar33892256
Tobramycin,3TMS,isomer #153C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4111.5Semi standard non polar33892256
Tobramycin,3TMS,isomer #154C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H]2O)[C@@H]1O4097.1Semi standard non polar33892256
Tobramycin,3TMS,isomer #155C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4132.6Semi standard non polar33892256
Tobramycin,3TMS,isomer #156C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@@H]1O4137.9Semi standard non polar33892256
Tobramycin,3TMS,isomer #157C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O4122.7Semi standard non polar33892256
Tobramycin,3TMS,isomer #158C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N([Si](C)(C)C)[Si](C)(C)C4134.9Semi standard non polar33892256
Tobramycin,3TMS,isomer #159C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O4096.5Semi standard non polar33892256
Tobramycin,3TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O[Si](C)(C)C3959.3Semi standard non polar33892256
Tobramycin,3TMS,isomer #160C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O4118.1Semi standard non polar33892256
Tobramycin,3TMS,isomer #161C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4135.7Semi standard non polar33892256
Tobramycin,3TMS,isomer #162C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4132.0Semi standard non polar33892256
Tobramycin,3TMS,isomer #163C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4131.8Semi standard non polar33892256
Tobramycin,3TMS,isomer #164C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H]1O4147.8Semi standard non polar33892256
Tobramycin,3TMS,isomer #165C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O4163.0Semi standard non polar33892256
Tobramycin,3TMS,isomer #17C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O3980.0Semi standard non polar33892256
Tobramycin,3TMS,isomer #18C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H]1O3993.6Semi standard non polar33892256
Tobramycin,3TMS,isomer #19C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3993.2Semi standard non polar33892256
Tobramycin,3TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3955.7Semi standard non polar33892256
Tobramycin,3TMS,isomer #20C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3987.5Semi standard non polar33892256
Tobramycin,3TMS,isomer #21C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3977.7Semi standard non polar33892256
Tobramycin,3TMS,isomer #22C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O3988.5Semi standard non polar33892256
Tobramycin,3TMS,isomer #23C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H]1O3994.9Semi standard non polar33892256
Tobramycin,3TMS,isomer #24C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3993.5Semi standard non polar33892256
Tobramycin,3TMS,isomer #25C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3986.9Semi standard non polar33892256
Tobramycin,3TMS,isomer #26C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O3980.5Semi standard non polar33892256
Tobramycin,3TMS,isomer #27C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O3999.7Semi standard non polar33892256
Tobramycin,3TMS,isomer #28C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O3995.4Semi standard non polar33892256
Tobramycin,3TMS,isomer #29C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4034.4Semi standard non polar33892256
Tobramycin,3TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3954.1Semi standard non polar33892256
Tobramycin,3TMS,isomer #30C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3993.9Semi standard non polar33892256
Tobramycin,3TMS,isomer #31C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N)[C@@H]1O4167.5Semi standard non polar33892256
Tobramycin,3TMS,isomer #32C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C4019.5Semi standard non polar33892256
Tobramycin,3TMS,isomer #33C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O4017.8Semi standard non polar33892256
Tobramycin,3TMS,isomer #34C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O4042.2Semi standard non polar33892256
Tobramycin,3TMS,isomer #35C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N)[C@@H]1O4093.7Semi standard non polar33892256
Tobramycin,3TMS,isomer #36C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4004.7Semi standard non polar33892256
Tobramycin,3TMS,isomer #37C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@@H]1O4041.2Semi standard non polar33892256
Tobramycin,3TMS,isomer #38C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O4067.3Semi standard non polar33892256
Tobramycin,3TMS,isomer #39C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O4037.6Semi standard non polar33892256
Tobramycin,3TMS,isomer #4C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3984.3Semi standard non polar33892256
Tobramycin,3TMS,isomer #40C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O4060.6Semi standard non polar33892256
Tobramycin,3TMS,isomer #41C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4093.0Semi standard non polar33892256
Tobramycin,3TMS,isomer #42C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)O[C@@H]1CO3933.2Semi standard non polar33892256
Tobramycin,3TMS,isomer #43C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)O[C@@H]1CN3916.8Semi standard non polar33892256
Tobramycin,3TMS,isomer #44C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O3987.3Semi standard non polar33892256
Tobramycin,3TMS,isomer #45C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3971.0Semi standard non polar33892256
Tobramycin,3TMS,isomer #46C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3970.4Semi standard non polar33892256
Tobramycin,3TMS,isomer #47C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3982.6Semi standard non polar33892256
Tobramycin,3TMS,isomer #48C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H]1O[Si](C)(C)C3993.6Semi standard non polar33892256
Tobramycin,3TMS,isomer #49C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)O[C@@H]1CN3914.5Semi standard non polar33892256
Tobramycin,3TMS,isomer #5C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O[Si](C)(C)C3999.7Semi standard non polar33892256
Tobramycin,3TMS,isomer #50C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H]1O3959.7Semi standard non polar33892256
Tobramycin,3TMS,isomer #51C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3964.4Semi standard non polar33892256
Tobramycin,3TMS,isomer #52C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3959.7Semi standard non polar33892256
Tobramycin,3TMS,isomer #53C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O3959.8Semi standard non polar33892256
Tobramycin,3TMS,isomer #54C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3960.1Semi standard non polar33892256
Tobramycin,3TMS,isomer #55C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3956.4Semi standard non polar33892256
Tobramycin,3TMS,isomer #56C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O3970.4Semi standard non polar33892256
Tobramycin,3TMS,isomer #57C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H]1O3981.4Semi standard non polar33892256
Tobramycin,3TMS,isomer #58C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3982.3Semi standard non polar33892256
Tobramycin,3TMS,isomer #59C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3978.4Semi standard non polar33892256
Tobramycin,3TMS,isomer #6C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3974.7Semi standard non polar33892256
Tobramycin,3TMS,isomer #60C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4004.4Semi standard non polar33892256
Tobramycin,3TMS,isomer #61C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4002.2Semi standard non polar33892256
Tobramycin,3TMS,isomer #62C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4015.2Semi standard non polar33892256
Tobramycin,3TMS,isomer #63C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3998.0Semi standard non polar33892256
Tobramycin,3TMS,isomer #64C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O)[C@H]1N4150.8Semi standard non polar33892256
Tobramycin,3TMS,isomer #65C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C4016.8Semi standard non polar33892256
Tobramycin,3TMS,isomer #66C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O4015.7Semi standard non polar33892256
Tobramycin,3TMS,isomer #67C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@H]1O4020.4Semi standard non polar33892256
Tobramycin,3TMS,isomer #68C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@H](O)[C@H]1N4082.0Semi standard non polar33892256
Tobramycin,3TMS,isomer #69C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4007.3Semi standard non polar33892256
Tobramycin,3TMS,isomer #7C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O3972.0Semi standard non polar33892256
Tobramycin,3TMS,isomer #70C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4021.6Semi standard non polar33892256
Tobramycin,3TMS,isomer #71C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@H](O)[C@H]1N4057.9Semi standard non polar33892256
Tobramycin,3TMS,isomer #72C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O4020.5Semi standard non polar33892256
Tobramycin,3TMS,isomer #73C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N4051.5Semi standard non polar33892256
Tobramycin,3TMS,isomer #74C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C4077.2Semi standard non polar33892256
Tobramycin,3TMS,isomer #75C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1CN3920.0Semi standard non polar33892256
Tobramycin,3TMS,isomer #76C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3988.4Semi standard non polar33892256
Tobramycin,3TMS,isomer #77C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3972.9Semi standard non polar33892256
Tobramycin,3TMS,isomer #78C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3972.9Semi standard non polar33892256
Tobramycin,3TMS,isomer #79C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3982.5Semi standard non polar33892256
Tobramycin,3TMS,isomer #8C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O4013.2Semi standard non polar33892256
Tobramycin,3TMS,isomer #80C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3999.3Semi standard non polar33892256
Tobramycin,3TMS,isomer #81C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H]1O3961.0Semi standard non polar33892256
Tobramycin,3TMS,isomer #82C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3971.0Semi standard non polar33892256
Tobramycin,3TMS,isomer #83C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3967.3Semi standard non polar33892256
Tobramycin,3TMS,isomer #84C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3961.6Semi standard non polar33892256
Tobramycin,3TMS,isomer #85C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3955.7Semi standard non polar33892256
Tobramycin,3TMS,isomer #86C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O4008.4Semi standard non polar33892256
Tobramycin,3TMS,isomer #87C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O4003.5Semi standard non polar33892256
Tobramycin,3TMS,isomer #88C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O4012.7Semi standard non polar33892256
Tobramycin,3TMS,isomer #89C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3998.0Semi standard non polar33892256
Tobramycin,3TMS,isomer #9C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3934.0Semi standard non polar33892256
Tobramycin,3TMS,isomer #90C[Si](C)(C)O[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)O[C@H](CO)[C@@H](O)[C@@H]1N4155.9Semi standard non polar33892256
Tobramycin,3TMS,isomer #91C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C4026.5Semi standard non polar33892256
Tobramycin,3TMS,isomer #92C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C4023.2Semi standard non polar33892256
Tobramycin,3TMS,isomer #93C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C4026.3Semi standard non polar33892256
Tobramycin,3TMS,isomer #94C[Si](C)(C)O[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)O[C@H](CO)[C@@H](O)[C@@H]1N4087.1Semi standard non polar33892256
Tobramycin,3TMS,isomer #95C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4015.7Semi standard non polar33892256
Tobramycin,3TMS,isomer #96C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@@H]1O[Si](C)(C)C4026.1Semi standard non polar33892256
Tobramycin,3TMS,isomer #97C[Si](C)(C)O[C@H]1[C@@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1N4058.0Semi standard non polar33892256
Tobramycin,3TMS,isomer #98C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4022.7Semi standard non polar33892256
Tobramycin,3TMS,isomer #99C[Si](C)(C)O[C@H]1[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1N4051.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3840.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #10C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3934.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #100C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4011.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #101C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3959.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #102C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O4118.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #103C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4016.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #104C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O4009.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #105C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O4149.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #106C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4082.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #107C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O4139.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #108C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H]1O4060.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #109C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C3975.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #11C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3896.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #110C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H]2O)[C@@H]1O4026.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #111C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O4023.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #112C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N([Si](C)(C)C)[Si](C)(C)C4050.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #113C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O4021.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #114C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O4016.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #115C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O4048.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #116C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H]1O4077.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #117C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O4083.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #118C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N[Si](C)(C)C)C[C@H]2N[Si](C)(C)C)[C@@H]1O4013.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #119C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O4023.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #12C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3896.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #120C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4018.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #121C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4058.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #122C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@@H]1O4044.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #123C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4057.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #124C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4041.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #125C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1CN3830.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #126C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3885.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #127C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3913.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #128C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3924.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #129C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3891.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #13C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3921.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #130C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3892.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #131C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H]1O[Si](C)(C)C3893.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #132C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3877.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #133C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3871.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #134C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O3907.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #135C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O[Si](C)(C)C3895.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #136C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3967.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #137C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@H]1O[Si](C)(C)C3973.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #138C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3950.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #139C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O3950.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #14C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3923.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #140C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4016.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #141C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3915.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #142C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3925.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #143C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3940.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #144C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3973.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #145C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3928.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #146C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C3942.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #147C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@H]1N3977.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #148C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N[Si](C)(C)C)C[C@@H]1O3948.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #149C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]1N4084.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #15C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H]1O[Si](C)(C)C3933.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #150C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N([Si](C)(C)C)[Si](C)(C)C4026.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #151C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H]1O3889.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #152C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3900.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #153C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3896.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #154C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3861.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #155C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3884.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #156C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C3908.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #157C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N[Si](C)(C)C3929.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #158C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3925.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #159C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@H]1O3932.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #16C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3896.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #160C[Si](C)(C)O[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)O[C@@H]1CN3997.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #161C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3919.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #162C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3946.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #163C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3925.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #164C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)O[C@@H]1CN3968.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #165C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3918.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #166C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O3943.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #167C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)O[C@@H]1CN3963.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #168C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3943.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #169C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)O[C@@H]1CN3999.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #17C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3893.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #170C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)O[C@@H]1CN([Si](C)(C)C)[Si](C)(C)C4068.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #171C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O3926.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #172C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3928.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #173C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@@H]1O[Si](C)(C)C3929.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #174C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3934.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #175C[Si](C)(C)O[C@H]1[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)O[C@@H]1CO4021.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #176C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O3949.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #177C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O3947.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #178C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3941.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #179C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)O[C@@H]1CO4084.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #18C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O3924.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #180C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C3963.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #181C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3958.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #182C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)O[C@@H]1CO4026.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #183C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3940.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #184C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O)O[C@@H]1CO3988.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #185C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)O[C@@H]1CO3988.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #186C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O3961.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #187C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O3994.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #188C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3973.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #189C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]1N4115.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #19C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3912.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #190C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4026.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #191C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O3995.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #192C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3966.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #193C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O4114.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #194C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4023.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #195C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3989.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #196C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O4126.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #197C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4071.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #198C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H]1O4132.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #199C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H]1O4062.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3849.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #20C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3905.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #200C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C3979.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #201C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C4006.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #202C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H]1O4030.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #203C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N([Si](C)(C)C)[Si](C)(C)C4051.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #204C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O4003.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #205C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H]1O4023.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #206C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O4048.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #207C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O4066.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #208C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H]1O4064.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #209C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3997.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #21C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3989.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #210C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O4026.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #211C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4021.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #212C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@@H]1O4029.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #213C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4053.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #214C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4028.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #215C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4053.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #216C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3890.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #217C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3875.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #218C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3875.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #219C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3906.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #22C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N[Si](C)(C)C)C[C@@H]1O3937.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #220C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O[Si](C)(C)C3883.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #221C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3956.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #222C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3969.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #223C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3946.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #224C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3947.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #225C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4030.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #226C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3918.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #227C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3927.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #228C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3945.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #229C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3975.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N)[C@@H]1O4081.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #230C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3927.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #231C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C3946.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #232C[Si](C)(C)O[C@H]1[C@@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1N3980.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #233C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N[Si](C)(C)C)C[C@@H]1O3945.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #234C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]1N4091.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #235C[Si](C)(C)O[C@@H]1[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N([Si](C)(C)C)[Si](C)(C)C4031.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #236C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C3904.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #237C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N[Si](C)(C)C3936.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #238C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3933.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #239C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3928.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #24C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C3934.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #240C[Si](C)(C)O[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)O[C@@H]1CN4003.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #241C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3925.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #242C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H]2O)[C@@H]1O[Si](C)(C)C3944.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #243C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3929.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #244C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)O[C@@H]1CN3971.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #245C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3923.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #246C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3942.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #247C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)O[C@@H]1CN3970.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #248C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3934.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #249C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)O[C@@H]1CN4008.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #25C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O3929.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #250C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)O[C@@H]1CN([Si](C)(C)C)[Si](C)(C)C4072.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #251C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O3965.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #252C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O3993.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #253C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3979.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #254C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]1N4124.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #255C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O4027.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #256C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O3993.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #257C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3973.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #258C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C4122.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #259C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O4025.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #26C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O3998.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #260C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3983.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #261C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C4125.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #262C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O4078.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #263C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H]1O4138.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #264C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H]1O4065.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #265C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C3987.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #266C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C4009.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #267C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H]1O4032.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #268C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N([Si](C)(C)C)[Si](C)(C)C4061.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #269C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4006.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #27C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N)[C@@H]1O4019.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #270C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H]1O4028.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #271C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C4060.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #272C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H]1O4071.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #273C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C4065.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #274C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3999.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #275C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C4034.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #276C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4026.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #277C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4064.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #278C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@@H]1O[Si](C)(C)C4026.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #279C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O[Si](C)(C)C4064.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #28C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3902.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #280C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4024.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #281C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C3911.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #282C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N[Si](C)(C)C3914.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #283C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O3908.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #284C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O3987.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #285C[Si](C)(C)O[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)O[C@@H]1CN4002.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #286C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3895.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #287C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H]2O[Si](C)(C)C)[C@@H]1O3974.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #288C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O[Si](C)(C)C3905.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #289C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)O[C@@H]1CN3966.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #29C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O[Si](C)(C)C)[C@@H]1O3971.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #290C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O[Si](C)(C)C3894.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #291C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O3970.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #292C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)O[C@@H]1CN3955.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #293C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O[Si](C)(C)C3997.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #294C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)O[C@@H]1CN4024.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #295C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)O[C@@H]1CN([Si](C)(C)C)[Si](C)(C)C4075.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #296C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O4018.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #297C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O4015.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #298C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N[Si](C)(C)C)C[C@@H]1O4025.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #299C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O4163.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #3C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O[Si](C)(C)C3875.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #30C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3967.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #300C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O4089.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #301C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H]1O4030.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #302C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O4029.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #303C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H]1O[Si](C)(C)C4087.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #304C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O4105.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #305C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N[Si](C)(C)C)C[C@H]2N[Si](C)(C)C)[C@@H]1O4010.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #306C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4058.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #307C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O[Si](C)(C)C)[C@@H]1O4054.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #308C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4057.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #309C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4049.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #31C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O3969.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #310C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3936.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #311C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C3962.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #312C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4006.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #313C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4002.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #314C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N[Si](C)(C)C)C[C@@H]1O3952.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #315C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4107.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #316C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O4003.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #317C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O[Si](C)(C)C4016.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #318C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4039.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #319C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N[Si](C)(C)C)C[C@@H]1O3962.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #32C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3956.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #320C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]1N4109.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #321C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O4011.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #322C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O[Si](C)(C)C4023.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #323C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N([Si](C)(C)C)[Si](C)(C)C4041.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #324C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O[Si](C)(C)C4139.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #325C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H]1O4063.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #326C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C3942.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #327C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C3937.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #328C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C3996.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #329C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O4129.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #33C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4030.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #330C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C4027.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #331C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N[Si](C)(C)C3966.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #332C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N[Si](C)(C)C)[C@@H]2O)[C@@H]1O4020.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #333C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O4021.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #334C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N([Si](C)(C)C)[Si](C)(C)C4044.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #335C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O4018.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #336C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O4012.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #337C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4042.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #338C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H]1O4067.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #339C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O4084.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #34C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O[Si](C)(C)C3848.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #340C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N[Si](C)(C)C)C[C@H]2N[Si](C)(C)C)[C@@H]1O4016.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #341C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3947.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #342C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4023.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #343C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N4018.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #344C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C4015.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #345C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N4058.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #346C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H]2O)[C@@H]1O4056.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #347C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C[C@H]1N4123.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #348C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C4006.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #349C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C4007.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #35C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3883.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #350C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4121.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #351C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C4002.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #352C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4054.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #353C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4052.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #354C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O4163.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #355C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C4079.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #356C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4066.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #357C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O4015.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #358C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]1N4159.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #359C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4066.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #36C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H]1O3900.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #360C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4063.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #361C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O4068.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #362C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@@H]1O4199.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #363C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4108.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #364C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4117.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #365C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]1N[Si](C)(C)C4180.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #366C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O4065.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #367C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H]1O4091.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #368C[Si](C)(C)N(C[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O)[Si](C)(C)C4216.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #369C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O4064.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #37C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3904.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #370C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O4197.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #371C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4106.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #372C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4117.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #373C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4183.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #374C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O4062.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #375C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H]1O4090.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #376C[Si](C)(C)N(C[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O)[Si](C)(C)C4213.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #377C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O4210.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #378C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O4125.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #379C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H]1O4138.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #38C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3899.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #380C[Si](C)(C)N(C[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O)[Si](C)(C)C4237.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #381C[Si](C)(C)N(C[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H]1O)[Si](C)(C)C4254.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #382C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H](N[Si](C)(C)C)C[C@H]2N[Si](C)(C)C)[C@@H]1O4092.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #383C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4102.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #384C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@@H]1O4111.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #385C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N[Si](C)(C)C)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4108.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #386C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O4085.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #387C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C4082.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #388C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N([Si](C)(C)C)[Si](C)(C)C4093.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #389C[Si](C)(C)N([C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N)[Si](C)(C)C4151.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #39C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3897.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #390C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C4115.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #391C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H]2O)[C@@H]1O4111.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #392C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H]2O)[C@@H]1O4132.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #393C[Si](C)(C)N([C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@@H]1O)[Si](C)(C)C4150.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #394C[Si](C)(C)N([C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C4159.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #395C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4113.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #396C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O4133.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #397C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4107.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #398C[Si](C)(C)N([C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](N)[C@H]1O)[Si](C)(C)C4156.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #399C[Si](C)(C)N([C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O)[Si](C)(C)C4145.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #4C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O[Si](C)(C)C3890.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #40C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3892.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #400C[Si](C)(C)N([C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O)[Si](C)(C)C4176.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #41C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H]1O3902.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #42C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3901.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #43C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3895.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #44C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O3898.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #45C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3914.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #46C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3906.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #47C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3971.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #48C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C3900.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #49C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N)[C@@H]1O4070.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #5C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3867.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #50C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N[Si](C)(C)C3925.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #51C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O3922.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #52C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O3965.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #53C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N)[C@@H]1O3998.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #54C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3909.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #55C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H]2O)[C@@H]1O3971.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #56C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O3964.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #57C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O3966.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #58C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3958.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #59C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4011.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #6C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O3856.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #60C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O3927.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #61C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H]1O3934.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #62C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3928.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #63C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3925.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #64C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3889.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #65C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O3947.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #66C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O3943.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #67C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O3949.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #68C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3944.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #69C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O4093.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #7C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O3940.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #70C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C3966.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #71C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3961.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #72C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3957.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #73C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O4026.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #74C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3942.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #75C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@@H]1O[Si](C)(C)C3957.1Semi standard non polar33892256
Tobramycin,4TMS,isomer #76C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3988.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #77C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3955.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #78C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3988.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #79C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4018.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #8C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O[Si](C)(C)C3874.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #80C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O3947.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #81C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O3942.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #82C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O3959.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #83C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3951.7Semi standard non polar33892256
Tobramycin,4TMS,isomer #84C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C4094.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #85C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C3962.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #86C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3956.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #87C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@H]1O3961.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #88C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C4029.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #89C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3939.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #9C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3918.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #90C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3960.3Semi standard non polar33892256
Tobramycin,4TMS,isomer #91C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3994.5Semi standard non polar33892256
Tobramycin,4TMS,isomer #92C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O3959.0Semi standard non polar33892256
Tobramycin,4TMS,isomer #93C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3990.2Semi standard non polar33892256
Tobramycin,4TMS,isomer #94C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4015.9Semi standard non polar33892256
Tobramycin,4TMS,isomer #95C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O3952.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #96C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4013.8Semi standard non polar33892256
Tobramycin,4TMS,isomer #97C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3964.6Semi standard non polar33892256
Tobramycin,4TMS,isomer #98C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]1N4120.4Semi standard non polar33892256
Tobramycin,4TMS,isomer #99C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4019.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O[Si](C)(C)C3773.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #10C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3807.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #100C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C3844.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #101C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3988.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #102C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N[Si](C)(C)C3888.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #103C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3877.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #104C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3875.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #105C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3929.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #106C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3873.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #107C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H]2O)[C@@H]1O[Si](C)(C)C3902.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #108C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3899.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #109C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3893.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #11C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O3835.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #110C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3889.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #111C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3943.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #112C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3884.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #113C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3872.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #114C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3880.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #115C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C3856.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #116C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3994.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #117C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N[Si](C)(C)C3891.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #118C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3880.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #119C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@H]1O3878.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #12C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O[Si](C)(C)C3843.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #120C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3935.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #121C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3877.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #122C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3906.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #123C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3899.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #124C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O3897.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #125C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O[Si](C)(C)C3894.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #126C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3945.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #127C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3897.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #128C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3974.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #129C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C3892.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #13C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O[Si](C)(C)C3831.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #130C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C[C@H]1N4040.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #131C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3933.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #132C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3969.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #133C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C3880.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #134C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O4036.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #135C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3925.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #136C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C3942.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #137C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O4089.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #138C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C4018.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #139C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O4039.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #14C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O[Si](C)(C)C3942.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #140C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C3950.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #141C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N[Si](C)(C)C3905.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #142C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N[Si](C)(C)C)[C@@H]2O)[C@@H]1O3972.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #143C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O3933.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #144C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N([Si](C)(C)C)[Si](C)(C)C3977.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #145C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O3964.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #146C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@H]1O3926.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #147C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O3971.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #148C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H]1O4013.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #149C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O4022.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #15C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C3843.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #150C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N[Si](C)(C)C)C[C@H]2N[Si](C)(C)C)[C@@H]1O3969.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #151C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O3944.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #152C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3945.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #153C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N4010.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #154C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H]2O)[C@@H]1O3988.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #155C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4003.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #156C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3990.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #157C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O3904.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #158C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O3898.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #159C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O3863.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N)[C@@H]1O3974.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #160C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3895.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #161C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O[Si](C)(C)C4029.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #162C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C3926.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #163C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3915.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #164C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3874.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #165C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O[Si](C)(C)C3981.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #166C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3891.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #167C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@@H]1O[Si](C)(C)C3883.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #168C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O[Si](C)(C)C3939.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #169C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3880.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #17C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N[Si](C)(C)C3850.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #170C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O[Si](C)(C)C3931.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #171C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3959.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #172C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O3919.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #173C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O3950.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #174C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3941.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #175C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]1N4053.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #176C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O3953.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #177C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O3948.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #178C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3932.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #179C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C4055.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #18C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O3839.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #180C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O3953.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #181C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3941.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #182C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C4059.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #183C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O4008.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #184C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H]1O4070.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #185C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H]1O3999.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #186C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C3938.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #187C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C3966.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #188C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H]1O3971.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #189C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N([Si](C)(C)C)[Si](C)(C)C4016.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #19C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O3932.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #190C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3956.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #191C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H]1O3964.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #192C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C4013.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #193C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H]1O4012.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #194C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C4012.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #195C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3941.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #196C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3971.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #197C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3965.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #198C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4007.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #199C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@@H]1O[Si](C)(C)C3967.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #2C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O[Si](C)(C)C3808.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #20C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N)[C@@H]1O3918.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #200C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O[Si](C)(C)C4009.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #201C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3970.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #202C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O3928.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #203C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O3957.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #204C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3952.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #205C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]1N4056.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #206C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O3962.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #207C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O3956.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #208C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3941.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #209C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O4056.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #21C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3823.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #210C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O3961.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #211C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3949.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #212C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O4059.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #213C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4008.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #214C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H]1O4077.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #215C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H]1O4010.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #216C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C3944.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #217C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C3970.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #218C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H]1O3981.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #219C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N([Si](C)(C)C)[Si](C)(C)C4017.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #22C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H]2O[Si](C)(C)C)[C@@H]1O3925.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #220C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O3961.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #221C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H]1O3974.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #222C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O4011.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #223C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O4013.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #224C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H]1O4013.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #225C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3948.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #226C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3976.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #227C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3976.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #228C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@@H]1O3970.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #229C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4003.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H]2O[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3880.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #230C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3977.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #231C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4003.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #232C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4011.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #233C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3964.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #234C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]1N4070.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #235C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O3993.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #236C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O3990.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #237C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O4025.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #238C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@@H]1O4124.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #239C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4036.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #24C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O3918.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #240C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4054.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #241C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]1N[Si](C)(C)C4101.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #242C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3997.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #243C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H]1O4031.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #244C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O4158.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #245C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O4019.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #246C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O4127.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #247C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4040.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #248C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4053.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #249C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O4100.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #25C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O3865.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #250C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3988.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #251C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H]1O4028.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #252C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O4155.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #253C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O4142.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #254C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O4071.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #255C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H]1O4080.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #256C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4192.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #257C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N)[C@@H]1O4201.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #258C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H](N[Si](C)(C)C)C[C@H]2N[Si](C)(C)C)[C@@H]1O4039.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #259C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O4007.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #26C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3966.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #260C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C4009.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #261C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N([Si](C)(C)C)[Si](C)(C)C4020.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #262C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C4067.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #263C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H]2O)[C@@H]1O4048.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #264C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H]2O)[C@@H]1O4079.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #265C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@@H](N)[C@@H]1O4100.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #266C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4060.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #267C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O4079.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #268C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4044.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #269C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O4095.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #27C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3840.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #270C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4131.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #271C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4053.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #272C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N[Si](C)(C)C)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@@H]1O4047.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #273C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N[Si](C)(C)C)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4045.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #274C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N)[C@@H]1O4091.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #275C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4090.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #276C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O4088.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #277C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3810.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #278C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3801.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #279C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3792.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #28C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3858.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #280C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3784.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #281C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O[Si](C)(C)C3795.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #282C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3877.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #283C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3885.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #284C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3867.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #285C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3866.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #286C[Si](C)(C)O[C@H]1[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)O[C@@H]1CO3958.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #287C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3878.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #288C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3873.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #289C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N[Si](C)(C)C)C[C@@H]1O3895.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #29C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3828.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #290C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)O[C@@H]1CO4020.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #291C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C3898.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #292C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3893.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #293C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)O[C@@H]1CO3980.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #294C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3859.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #295C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O[Si](C)(C)C)O[C@@H]1CO3924.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #296C[Si](C)(C)O[C@H]1[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)O[C@@H]1CO3913.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #297C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C3863.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #298C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N[Si](C)(C)C3870.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #299C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3863.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #3C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H]1O[Si](C)(C)C3821.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #30C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3822.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #300C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@H]1O[Si](C)(C)C3893.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #301C[Si](C)(C)O[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)O[C@@H]1CN3940.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #302C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3851.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #303C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3893.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #304C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O[Si](C)(C)C3866.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #305C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)O[C@@H]1CN3909.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #306C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O[Si](C)(C)C3856.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #307C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O3892.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #308C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)O[C@@H]1CN3897.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #309C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O[Si](C)(C)C3902.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #31C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3809.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #310C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)O[C@@H]1CN3952.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #311C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)O[C@@H]1CN([Si](C)(C)C)[Si](C)(C)C4003.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #312C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3946.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #313C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3947.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #314C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N[Si](C)(C)C)C[C@@H]1O3959.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #315C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O4066.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #316C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O4013.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #317C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C3958.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #318C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O3956.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #319C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O4026.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #32C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3877.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #320C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H]1O[Si](C)(C)C4016.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #321C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3937.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #322C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O[Si](C)(C)C)[C@@H]1O3973.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #323C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3986.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #324C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3974.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #325C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O3987.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #326C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3901.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #327C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C3918.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #328C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3947.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #329C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3943.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #33C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3874.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #330C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N[Si](C)(C)C)C[C@@H]1O3920.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #331C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O4029.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #332C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3953.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #333C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H]1O[Si](C)(C)C3970.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #334C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3988.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #335C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N[Si](C)(C)C)C[C@@H]1O3929.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #336C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]1N4029.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #337C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3961.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #338C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H]1O[Si](C)(C)C3978.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #339C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N([Si](C)(C)C)[Si](C)(C)C3990.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #34C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N)C[C@@H]1O3908.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #340C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H]1O[Si](C)(C)C4071.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #341C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H]1O4019.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #342C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C3837.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #343C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N[Si](C)(C)C3882.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #344C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3871.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #345C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3832.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #346C[Si](C)(C)O[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)O[C@@H]1CN3940.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #347C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3868.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #348C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H]2O)[C@@H]1O[Si](C)(C)C3862.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #349C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3873.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #35C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](N[Si](C)(C)C)C[C@@H]1O3902.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #350C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)O[C@@H]1CN3909.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #351C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3861.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #352C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3862.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #353C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)O[C@@H]1CN3903.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #354C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3832.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #355C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)O[C@@H]1CN3935.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #356C[Si](C)(C)O[C@H]1C[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)O[C@@H]1CN([Si](C)(C)C)[Si](C)(C)C4003.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #357C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C3906.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #358C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C3897.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #359C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C3909.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #36C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O4011.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #360C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H]1O4047.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #361C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H]1O[Si](C)(C)C3971.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #362C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N[Si](C)(C)C3919.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #363C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N[Si](C)(C)C3944.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #364C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H]1O3948.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #365C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N([Si](C)(C)C)[Si](C)(C)C3988.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #366C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O3940.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #367C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@H]1O3945.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #368C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3986.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #369C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O3987.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #37C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C3900.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #370C[Si](C)(C)N[C@@H]1C[C@H](O[Si](C)(C)C)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H]1O3989.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #371C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3949.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #372C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3914.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #373C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O3970.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #374C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3967.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #375C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3949.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #376C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H]2O)[C@@H]1O3962.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #377C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3997.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #378C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C[C@H]1N4053.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #379C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3952.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #38C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]1O[Si](C)(C)C3898.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #380C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3946.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #381C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O4052.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #382C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3949.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #383C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3966.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #384C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O3996.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #385C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O4057.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #386C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O[Si](C)(C)C3996.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #387C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O3923.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #388C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O3927.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #389C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3908.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #39C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3921.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #390C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C4027.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #391C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O3996.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #392C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H]2O)[C@@H]1O[Si](C)(C)C3941.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #393C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N[Si](C)(C)C)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3937.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #394C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H]1O4000.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #395C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@@H]1O[Si](C)(C)C3978.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #396C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3927.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #397C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3998.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #398C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@@H]1O[Si](C)(C)C3942.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #399C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O[Si](C)(C)C4002.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #4C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O[Si](C)(C)C)C[C@H]1N3810.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #40C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3970.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #400C[Si](C)(C)N[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3949.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #401C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O3918.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #402C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3941.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #403C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]1N4061.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #404C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O3968.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #405C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3930.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #406C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C4063.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #407C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N)C[C@@H]1O3966.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #408C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H]1O4074.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #409C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O[Si](C)(C)C)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H]1O4011.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #41C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3862.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #410C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C3944.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #411C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H]1O3984.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #412C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N([Si](C)(C)C)[Si](C)(C)C4018.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #413C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@H]1O3979.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #414C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C4016.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #415C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O[Si](C)(C)C3986.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #416C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N3983.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #417C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4000.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #418C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O3979.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #419C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]1N4070.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #42C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@H]2[C@H](N)C[C@H](N[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3900.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #420C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4011.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #421C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4008.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #422C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O4013.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #423C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]1N4093.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #424C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4014.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #425C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4041.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #426C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]1N[Si](C)(C)C4099.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #427C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O4009.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #428C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H]1O4040.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #429C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@H](O)[C@H]1N4161.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #43C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3909.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #430C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O4006.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #431C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O4098.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #432C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4021.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #433C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N)C[C@@H]1O4045.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #434C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O4099.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #435C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O4003.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #436C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]3O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H]1O4039.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #437C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N4160.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #438C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@H]1O4115.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #439C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N[Si](C)(C)C)C[C@@H]1O4048.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #44C[Si](C)(C)N[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3899.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #440C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]3O)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H]1O4055.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #441C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C4188.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #442C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@H](O)[C@H]1N4203.1Semi standard non polar33892256
Tobramycin,5TMS,isomer #443C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C4025.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #444C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]1O4020.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #445C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C4019.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #446C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N([Si](C)(C)C)[Si](C)(C)C4031.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #447C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@H]1O4027.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #448C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N[Si](C)(C)C4053.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #449C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N([Si](C)(C)C)[Si](C)(C)C4053.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #45C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](N)[C@@H]1O3895.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #450C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H]2O)[C@H](O)[C@H]1N4111.7Semi standard non polar33892256
Tobramycin,5TMS,isomer #451C[Si](C)(C)N[C@@H]1C[C@H](O)[C@@H](CN)O[C@@H]1O[C@@H]1[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@H]1O4026.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #452C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O4055.5Semi standard non polar33892256
Tobramycin,5TMS,isomer #453C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N[Si](C)(C)C)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4051.2Semi standard non polar33892256
Tobramycin,5TMS,isomer #454C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N4108.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #455C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]2N)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C4136.4Semi standard non polar33892256
Tobramycin,5TMS,isomer #456C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CN)[C@@H](O)C[C@H]2N)[C@H](O)[C@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]1O4026.6Semi standard non polar33892256
Tobramycin,5TMS,isomer #457C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4023.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #458C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H](O)[C@@H]1O[C@H]1O[C@H](CN)[C@@H](O)C[C@H]1N4039.3Semi standard non polar33892256
Tobramycin,5TMS,isomer #459C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N4103.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #46C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H]1O3961.0Semi standard non polar33892256
Tobramycin,5TMS,isomer #460C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H]2O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C4106.9Semi standard non polar33892256
Tobramycin,5TMS,isomer #461C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](O)[C@H](O[C@H]3O[C@H](CN)[C@@H](O)C[C@H]3N)[C@@H](N)C[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C4105.8Semi standard non polar33892256
Tobramycin,5TMS,isomer #462C[Si](C)(C)NC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[C@H]3O[C@H](CO