Hmdb loader
You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Human Metabolome Database.
Record Information
Version5.0
StatusExpected but not Quantified
Creation Date2012-09-06 15:16:52 UTC
Update Date2022-03-07 02:52:00 UTC
HMDB IDHMDB0015490
Secondary Accession Numbers
  • HMDB15490
Metabolite Identification
Common NameParomomycin
DescriptionParomomycin is only found in individuals that have used or taken this drug. It is an oligosaccharide antibiotic produced by various streptomyces. [PubChem]Paromomycin inhibits protein synthesis by binding to 16S ribosomal RNA. Bacterial proteins are synthesized by ribosomal RNA complexes which are composed of 2 subunits, a large subunit (50s) and small (30s) subunit, which forms a 70s ribosomal subunit. tRNA binds to the top of this ribosomal structure. Paramomycin binds to the A site, which causes defective polypeptide chains to be produced. Continuous production of defective proteins eventually leads to bacterial death.
Structure
Data?1582753302
Synonyms
ValueSource
(1R,2R,3S,4R,6S)-4,6-Diamino-2-{[3-O-(2,6-diamino-2,6-dideoxy-beta-L-idopyranosyl)-beta-D-ribofuranosyl]oxy}-3-hydroxycyclohexyl 2-amino-2-deoxy-alpha-D-glucopyranosideChEBI
AminosidinChEBI
AminosidineChEBI
CatenulinChEBI
CrestomycinChEBI
EstomycinChEBI
HydroxymycinChEBI
Monomycin aChEBI
Neomycin eChEBI
ParomomicinaChEBI
Paromomycin IChEBI
ParomomycineChEBI
ParomomycinumChEBI
PaucimycinChEBI
PaucimycinumChEBI
R 400ChEBI
R-400ChEBI
Zygomycin a1ChEBI
(1R,2R,3S,4R,6S)-4,6-Diamino-2-{[3-O-(2,6-diamino-2,6-dideoxy-b-L-idopyranosyl)-b-D-ribofuranosyl]oxy}-3-hydroxycyclohexyl 2-amino-2-deoxy-a-D-glucopyranosideGenerator
(1R,2R,3S,4R,6S)-4,6-Diamino-2-{[3-O-(2,6-diamino-2,6-dideoxy-β-L-idopyranosyl)-β-D-ribofuranosyl]oxy}-3-hydroxycyclohexyl 2-amino-2-deoxy-α-D-glucopyranosideGenerator
PRMHMDB
Paramomycin sulfateHMDB
Paramomycin sulphateHMDB
GabbromycinHMDB
Parke davis brand OF paromomycin sulfateHMDB
Paromomycin, beta-D-glucopyranosyl-isomerHMDB
Sulfate, paromomycinHMDB
HumatinHMDB
Phosphate, paromomycinHMDB
Cheminova brand OF paromomycin sulfateHMDB
Paromomycin sulfate (1:1)HMDB
Pfizer brand OF paromomycin sulfateHMDB
beta-D-Glucopyranosyl-isomer paromomycinHMDB
Monarch brand OF paromomycin sulfateHMDB
ParamomycinHMDB
Paromomycin phosphateHMDB
Paromomycin sulfateHMDB
Paromomycin sulfate (2:5)HMDB
Paromomycin, beta D glucopyranosyl isomerHMDB
Chemical FormulaC23H45N5O14
Average Molecular Weight615.6285
Monoisotopic Molecular Weight615.296301173
IUPAC Name(2S,3S,4R,5R,6R)-5-amino-2-(aminomethyl)-6-{[(2R,3S,4R,5S)-5-{[(1R,2R,3S,5R,6S)-3,5-diamino-2-{[(2S,3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-6-hydroxycyclohexyl]oxy}-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxy}oxane-3,4-diol
Traditional Nameparomomycin
CAS Registry Number1263-89-4
SMILES
NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O
InChI Identifier
InChI=1S/C23H45N5O14/c24-2-7-13(32)15(34)10(27)21(37-7)41-19-9(4-30)39-23(17(19)36)42-20-12(31)5(25)1-6(26)18(20)40-22-11(28)16(35)14(33)8(3-29)38-22/h5-23,29-36H,1-4,24-28H2/t5-,6+,7+,8-,9-,10-,11-,12+,13-,14-,15-,16-,17-,18-,19-,20-,21-,22-,23+/m1/s1
InChI KeyUOZODPSAJZTQNH-LSWIJEOBSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as 4,5-disubstituted 2-deoxystreptamines. These are 2-deoxystreptamine aminoglycosides that are glycosidically linked to a pyranose of furanose unit at the C4- and C5-positions.
KingdomOrganic compounds
Super ClassOrganic oxygen compounds
ClassOrganooxygen compounds
Sub ClassCarbohydrates and carbohydrate conjugates
Direct Parent4,5-disubstituted 2-deoxystreptamines
Alternative Parents
Substituents
  • 4,5-disubstituted 2-deoxystreptamine
  • Disaccharide
  • Glycosyl compound
  • O-glycosyl compound
  • Aminocyclitol or derivatives
  • Cyclohexanol
  • Cyclohexylamine
  • Cyclitol or derivatives
  • Oxane
  • Tetrahydrofuran
  • Cyclic alcohol
  • Secondary alcohol
  • 1,2-aminoalcohol
  • Acetal
  • Organoheterocyclic compound
  • Oxacycle
  • Primary alcohol
  • Hydrocarbon derivative
  • Organopnictogen compound
  • Primary aliphatic amine
  • Organonitrogen compound
  • Organic nitrogen compound
  • Amine
  • Alcohol
  • Primary amine
  • Aliphatic heteromonocyclic compound
Molecular FrameworkAliphatic heteromonocyclic compounds
External Descriptors
Ontology
Disposition

Biological location

Process

Naturally occurring process

Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water Solubility79.7 g/LNot Available
LogPNot AvailableNot Available
Experimental Chromatographic PropertiesNot Available
Predicted Molecular Properties
PropertyValueSource
Water Solubility79.7 g/LALOGPS
logP-2.9ALOGPS
logP-8.3ChemAxon
logS-0.89ALOGPS
pKa (Strongest Acidic)12.23ChemAxon
pKa (Strongest Basic)9.94ChemAxon
Physiological Charge5ChemAxon
Hydrogen Acceptor Count19ChemAxon
Hydrogen Donor Count13ChemAxon
Polar Surface Area347.32 ŲChemAxon
Rotatable Bond Count9ChemAxon
Refractivity134.24 m³·mol⁻¹ChemAxon
Polarizability60.4 ųChemAxon
Number of Rings4ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleYesChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DeepCCS[M+H]+236.30830932474
DeepCCS[M-H]-234.54430932474
DeepCCS[M-2H]-268.57730932474
DeepCCS[M+Na]+242.53530932474

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
ParomomycinNC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O3268.7Standard polar33892256
ParomomycinNC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O5506.2Standard non polar33892256
ParomomycinNC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O5325.6Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
Paromomycin,1TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N5043.9Semi standard non polar33892256
Paromomycin,1TMS,isomer #10C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O5102.6Semi standard non polar33892256
Paromomycin,1TMS,isomer #11C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N5093.9Semi standard non polar33892256
Paromomycin,1TMS,isomer #12C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O5092.0Semi standard non polar33892256
Paromomycin,1TMS,isomer #13C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O5085.6Semi standard non polar33892256
Paromomycin,1TMS,isomer #2C[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](N)C[C@H]1N5025.6Semi standard non polar33892256
Paromomycin,1TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O5053.6Semi standard non polar33892256
Paromomycin,1TMS,isomer #4C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@H]1O5027.8Semi standard non polar33892256
Paromomycin,1TMS,isomer #5C[Si](C)(C)O[C@@H]1[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@H]1O5017.6Semi standard non polar33892256
Paromomycin,1TMS,isomer #6C[Si](C)(C)O[C@H]1[C@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)O[C@H](CO)[C@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N5038.4Semi standard non polar33892256
Paromomycin,1TMS,isomer #7C[Si](C)(C)O[C@H]1[C@H](O)[C@H](CN)O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@@H]1N5011.7Semi standard non polar33892256
Paromomycin,1TMS,isomer #8C[Si](C)(C)O[C@@H]1[C@H](CN)O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@H]1O5016.2Semi standard non polar33892256
Paromomycin,1TMS,isomer #9C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O5116.7Semi standard non polar33892256
Paromomycin,2TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N4891.6Semi standard non polar33892256
Paromomycin,2TMS,isomer #10C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4960.2Semi standard non polar33892256
Paromomycin,2TMS,isomer #11C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4974.0Semi standard non polar33892256
Paromomycin,2TMS,isomer #12C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O4951.8Semi standard non polar33892256
Paromomycin,2TMS,isomer #13C[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](N)C[C@H]1N4864.6Semi standard non polar33892256
Paromomycin,2TMS,isomer #14C[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](N)C[C@H]1N4868.9Semi standard non polar33892256
Paromomycin,2TMS,isomer #15C[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](N)C[C@H]1N4896.7Semi standard non polar33892256
Paromomycin,2TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[Si](C)(C)C)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4902.2Semi standard non polar33892256
Paromomycin,2TMS,isomer #17C[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H](N)C[C@H]1N4878.7Semi standard non polar33892256
Paromomycin,2TMS,isomer #18C[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](N)C[C@H]1N4872.5Semi standard non polar33892256
Paromomycin,2TMS,isomer #19C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4944.1Semi standard non polar33892256
Paromomycin,2TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N4925.5Semi standard non polar33892256
Paromomycin,2TMS,isomer #20C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O4934.0Semi standard non polar33892256
Paromomycin,2TMS,isomer #21C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[Si](C)(C)C)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4941.6Semi standard non polar33892256
Paromomycin,2TMS,isomer #22C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4975.7Semi standard non polar33892256
Paromomycin,2TMS,isomer #23C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O[Si](C)(C)C4980.0Semi standard non polar33892256
Paromomycin,2TMS,isomer #24C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4891.1Semi standard non polar33892256
Paromomycin,2TMS,isomer #25C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4893.4Semi standard non polar33892256
Paromomycin,2TMS,isomer #26C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O4915.9Semi standard non polar33892256
Paromomycin,2TMS,isomer #27C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O4897.5Semi standard non polar33892256
Paromomycin,2TMS,isomer #28C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C4913.7Semi standard non polar33892256
Paromomycin,2TMS,isomer #29C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1N4996.8Semi standard non polar33892256
Paromomycin,2TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N4898.7Semi standard non polar33892256
Paromomycin,2TMS,isomer #30C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O5023.2Semi standard non polar33892256
Paromomycin,2TMS,isomer #31C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4988.2Semi standard non polar33892256
Paromomycin,2TMS,isomer #32C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O4971.8Semi standard non polar33892256
Paromomycin,2TMS,isomer #33C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O4960.4Semi standard non polar33892256
Paromomycin,2TMS,isomer #34C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@H]1O4866.6Semi standard non polar33892256
Paromomycin,2TMS,isomer #35C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@H](N)[C@H]1O4868.3Semi standard non polar33892256
Paromomycin,2TMS,isomer #36C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O4894.3Semi standard non polar33892256
Paromomycin,2TMS,isomer #37C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@H]1O[Si](C)(C)C4878.0Semi standard non polar33892256
Paromomycin,2TMS,isomer #38C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N4964.5Semi standard non polar33892256
Paromomycin,2TMS,isomer #39C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O4986.7Semi standard non polar33892256
Paromomycin,2TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N4891.0Semi standard non polar33892256
Paromomycin,2TMS,isomer #40C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4952.8Semi standard non polar33892256
Paromomycin,2TMS,isomer #41C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O4941.4Semi standard non polar33892256
Paromomycin,2TMS,isomer #42C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O4951.5Semi standard non polar33892256
Paromomycin,2TMS,isomer #43C[Si](C)(C)O[C@@H]1[C@H](CN)O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@@H]2O)[C@H](N)[C@H]1O4863.1Semi standard non polar33892256
Paromomycin,2TMS,isomer #44C[Si](C)(C)O[C@H]1[C@H](O)[C@H](CN)O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@@H]2O)[C@@H]1N4868.2Semi standard non polar33892256
Paromomycin,2TMS,isomer #45C[Si](C)(C)O[C@H]1[C@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)O[C@H](CO)[C@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N4887.2Semi standard non polar33892256
Paromomycin,2TMS,isomer #46C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C4944.2Semi standard non polar33892256
Paromomycin,2TMS,isomer #47C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N4953.8Semi standard non polar33892256
Paromomycin,2TMS,isomer #48C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O4975.1Semi standard non polar33892256
Paromomycin,2TMS,isomer #49C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4936.4Semi standard non polar33892256
Paromomycin,2TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N4903.1Semi standard non polar33892256
Paromomycin,2TMS,isomer #50C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O4927.7Semi standard non polar33892256
Paromomycin,2TMS,isomer #51C[Si](C)(C)O[C@@H]1[C@H](CN)O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O4878.3Semi standard non polar33892256
Paromomycin,2TMS,isomer #52C[Si](C)(C)O[C@H]1[C@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)O[C@H](CO)[C@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N4883.4Semi standard non polar33892256
Paromomycin,2TMS,isomer #53C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@H]1O4996.3Semi standard non polar33892256
Paromomycin,2TMS,isomer #54C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4977.2Semi standard non polar33892256
Paromomycin,2TMS,isomer #55C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O4949.7Semi standard non polar33892256
Paromomycin,2TMS,isomer #56C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O4958.3Semi standard non polar33892256
Paromomycin,2TMS,isomer #57C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O[Si](C)(C)C)O[C@@H](CN)[C@@H](O)[C@@H]1O4938.2Semi standard non polar33892256
Paromomycin,2TMS,isomer #58C[Si](C)(C)O[C@@H]1[C@H](CN)O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@H]1O[Si](C)(C)C4863.1Semi standard non polar33892256
Paromomycin,2TMS,isomer #59C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O4938.8Semi standard non polar33892256
Paromomycin,2TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N4883.8Semi standard non polar33892256
Paromomycin,2TMS,isomer #60C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@H]1O4968.2Semi standard non polar33892256
Paromomycin,2TMS,isomer #61C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4947.0Semi standard non polar33892256
Paromomycin,2TMS,isomer #62C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4929.9Semi standard non polar33892256
Paromomycin,2TMS,isomer #63C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O[Si](C)(C)C4934.1Semi standard non polar33892256
Paromomycin,2TMS,isomer #64C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C4959.0Semi standard non polar33892256
Paromomycin,2TMS,isomer #65C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O4974.8Semi standard non polar33892256
Paromomycin,2TMS,isomer #66C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4953.3Semi standard non polar33892256
Paromomycin,2TMS,isomer #67C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4934.3Semi standard non polar33892256
Paromomycin,2TMS,isomer #68C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@@H]1O4936.0Semi standard non polar33892256
Paromomycin,2TMS,isomer #69C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N[Si](C)(C)C)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O5063.5Semi standard non polar33892256
Paromomycin,2TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N4886.3Semi standard non polar33892256
Paromomycin,2TMS,isomer #70C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N[Si](C)(C)C)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O5040.9Semi standard non polar33892256
Paromomycin,2TMS,isomer #71C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O5021.8Semi standard non polar33892256
Paromomycin,2TMS,isomer #72C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N[Si](C)(C)C)[C@@H](O)[C@@H]1O5003.2Semi standard non polar33892256
Paromomycin,2TMS,isomer #73C[Si](C)(C)N(C[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O)[Si](C)(C)C5191.2Semi standard non polar33892256
Paromomycin,2TMS,isomer #74C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N5061.9Semi standard non polar33892256
Paromomycin,2TMS,isomer #75C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O5058.8Semi standard non polar33892256
Paromomycin,2TMS,isomer #76C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O)[C@H]1O5049.7Semi standard non polar33892256
Paromomycin,2TMS,isomer #77C[Si](C)(C)N([C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O)[Si](C)(C)C5076.1Semi standard non polar33892256
Paromomycin,2TMS,isomer #78C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N5024.8Semi standard non polar33892256
Paromomycin,2TMS,isomer #79C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N[Si](C)(C)C5032.0Semi standard non polar33892256
Paromomycin,2TMS,isomer #8C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O5000.8Semi standard non polar33892256
Paromomycin,2TMS,isomer #80C[Si](C)(C)N([C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N)[Si](C)(C)C5061.5Semi standard non polar33892256
Paromomycin,2TMS,isomer #81C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O5002.0Semi standard non polar33892256
Paromomycin,2TMS,isomer #82C[Si](C)(C)N([C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O)[Si](C)(C)C5089.3Semi standard non polar33892256
Paromomycin,2TMS,isomer #83C[Si](C)(C)N([C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O)[Si](C)(C)C5072.7Semi standard non polar33892256
Paromomycin,2TMS,isomer #9C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4979.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N4785.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #10C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4803.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #100C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[Si](C)(C)C)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C4781.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #101C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1N4848.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #102C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O[Si](C)(C)C4851.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #103C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4821.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #104C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O4825.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #105C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[Si](C)(C)C)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O4815.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #106C[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](N)C[C@H]1N4752.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #107C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4795.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #108C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O4801.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #109C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[Si](C)(C)C)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O4812.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #11C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O4802.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #110C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N4827.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #111C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O[Si](C)(C)C4828.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #112C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4795.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #113C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O4804.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #114C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[Si](C)(C)C)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C4811.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #115C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N4825.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #116C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O[Si](C)(C)C4827.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #117C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O[Si](C)(C)C)[C@H](N[Si](C)(C)C)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4882.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #118C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O[Si](C)(C)C)[C@H](N)C[C@H](N[Si](C)(C)C)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4882.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #119C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4857.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N4793.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #120C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N[Si](C)(C)C)[C@@H](O)[C@@H]1O4841.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #121C[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](N)C[C@H]1N5056.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #122C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O)[C@H]1O[Si](C)(C)C4893.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #123C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4888.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #124C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[Si](C)(C)C)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4858.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #125C[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](N)C[C@H]1N4937.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #126C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N[Si](C)(C)C4894.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #127C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O[Si](C)(C)C4903.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #128C[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@@H](N)C[C@H]1N4952.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #129C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4923.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #13C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N4786.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #130C[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H]1N4922.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #131C[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](N)C[C@H]1N([Si](C)(C)C)[Si](C)(C)C4943.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #132C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4759.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #133C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O4766.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #134C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O4759.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #135C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C4762.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #136C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1N4827.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #137C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O4853.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #138C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C4823.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #139C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@@H]1O4818.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #14C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O4780.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #140C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O4801.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #141C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O4780.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #142C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O4770.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #143C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C4773.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #144C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1N4828.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #145C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@H]1O4855.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #146C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O4815.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #147C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O[Si](C)(C)C4819.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #148C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O4809.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #149C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O4782.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #15C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N4772.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #150C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C4786.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #151C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1N4851.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #152C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@H]1O4874.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #153C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O4821.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #154C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O[Si](C)(C)C)O[C@@H](CN)[C@@H](O)[C@@H]1O4820.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #155C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O4809.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #156C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4786.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #157C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N4835.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #158C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O4861.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #159C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4814.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N4785.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #160C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O4821.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #161C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C4819.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #162C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N4842.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #163C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O4865.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #164C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4820.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #165C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O4825.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #166C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O4819.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #167C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1N4953.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #168C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N[Si](C)(C)C)[C@H]3O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4901.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #169C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1N4903.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #17C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O4879.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #170C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1N[Si](C)(C)C4889.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #171C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4940.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #172C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O4921.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #173C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N[Si](C)(C)C)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4929.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #174C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O)[C@H]1O4935.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #175C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4946.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #176C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4865.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #177C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N[Si](C)(C)C)[C@@H](O)[C@@H]1O4868.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #178C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O5089.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #179C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O4860.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #18C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1N4853.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #180C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4966.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #181C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O4971.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #182C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@H](N)[C@H]1O4735.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #183C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O4741.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #184C[Si](C)(C)O[C@@H]1[C@H](CN)O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3N)[C@@H]2O)[C@H](N)[C@H]1O4735.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #185C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N4801.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #186C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O4825.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #187C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C4798.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #188C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@@H]1O4793.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #189C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O4796.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #19C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@@H]1O4823.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #190C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O4758.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #191C[Si](C)(C)O[C@H]1[C@H](O)[C@H](CN)O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3N)[C@@H]2O)[C@@H]1N4746.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #192C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N4801.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #193C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@H]1O4829.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #194C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O4792.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #195C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O[Si](C)(C)C4795.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #196C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O4804.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #197C[Si](C)(C)O[C@H]1[C@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)O[C@H](CO)[C@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N4756.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #198C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N4824.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #199C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@H]1O4846.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N4759.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #20C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4835.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #200C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O4798.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #201C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@@H]2O[Si](C)(C)C)O[C@@H](CN)[C@@H](O)[C@@H]1O4796.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #202C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O4809.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #203C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N4817.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #204C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O4839.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #205C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4794.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #206C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O4797.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #207C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4799.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #208C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N4923.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #209C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N[Si](C)(C)C)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4871.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #21C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O4834.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #210C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N4875.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #211C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N[Si](C)(C)C4889.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #212C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@H]1O4920.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #213C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O4918.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #214C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N[Si](C)(C)C)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4896.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #215C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O)[C@H]1O4903.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #216C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@H]1O4923.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #217C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4861.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #218C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N[Si](C)(C)C)[C@@H](O)[C@@H]1O4843.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #219C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@H]1O5059.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #22C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N4757.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #220C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O4860.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #221C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H](N)[C@H]1O4933.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #222C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4936.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #223C[Si](C)(C)O[C@@H]1[C@H](CN)O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@H]1O4746.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #224C[Si](C)(C)O[C@@H]1[C@H](CN)O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@@H]2O)[C@H](N)[C@H]1O[Si](C)(C)C4735.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #225C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C4798.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #226C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O4827.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #227C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N4800.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #228C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C4793.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #229C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@@H]1O4796.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N4757.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #230C[Si](C)(C)O[C@H]1[C@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)O[C@H](CO)[C@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N4762.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #231C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O4794.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #232C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@H]1O4832.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #233C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N4803.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #234C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C4804.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #235C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O[Si](C)(C)C4800.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #236C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@H]1O4846.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #237C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N4823.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #238C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C4807.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #239C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O4797.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #24C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N4745.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #240C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@@H]2O[Si](C)(C)C)O[C@@H](CN)[C@@H](O)[C@@H]1O4798.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #241C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N[Si](C)(C)C4887.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #242C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N[Si](C)(C)C)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O4915.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #243C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4857.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #244C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C4860.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #245C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1N([Si](C)(C)C)[Si](C)(C)C4957.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #246C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N4916.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #247C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N[Si](C)(C)C)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4866.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #248C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N4871.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #249C[Si](C)(C)O[C@@H]1[C@@H](N)[C@@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@H]1O4908.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #25C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N4761.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #250C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N[Si](C)(C)C)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4892.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #251C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O)[C@H]1O4900.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #252C[Si](C)(C)O[C@@H]1[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@H]1O4916.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #253C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@@H]2O)[C@H](N[Si](C)(C)C)[C@@H](O)[C@@H]1O4835.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #254C[Si](C)(C)O[C@@H]1[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@H]1O5055.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #255C[Si](C)(C)O[C@@H]1[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@H]1O4926.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #256C[Si](C)(C)O[C@H]1[C@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)O[C@H](CO)[C@H]1O[C@H]1O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N4743.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #257C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C4800.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #258C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@H]1O4834.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #259C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4811.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #26C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O4844.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #260C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O4793.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #261C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O[Si](C)(C)C)O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@@H]1O4792.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #262C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@H]1O4843.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #263C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4818.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #264C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O4804.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #265C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O4797.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #266C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O[Si](C)(C)C)O[C@@H](CN)[C@@H](O)[C@@H]1O[Si](C)(C)C4799.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #267C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4931.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #268C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@H]1O4908.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #269C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N[Si](C)(C)C)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O4893.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #27C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N4822.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #270C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H]1O4894.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #271C[Si](C)(C)O[C@H]1[C@H](O[C@@H]2[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)O[C@H](CO)[C@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N4931.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #272C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N[Si](C)(C)C)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O4872.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #273C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4869.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #274C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N[Si](C)(C)C4880.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #275C[Si](C)(C)O[C@H]1[C@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)O[C@H](CO)[C@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N4929.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #276C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O4849.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #277C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O4839.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #278C[Si](C)(C)O[C@H]1[C@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)O[C@H](CO)[C@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N4954.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #279C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O[Si](C)(C)C)[C@H](N[Si](C)(C)C)[C@@H](O)[C@@H]1O4833.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #28C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]1O4813.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #280C[Si](C)(C)O[C@H]1[C@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)O[C@H](CO)[C@H]1O[C@H]1O[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1N5061.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #281C[Si](C)(C)O[C@H]1[C@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)O[C@H](CO)[C@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C4946.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #282C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4794.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #283C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@H]1O4827.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #284C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4804.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #285C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4795.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #286C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4787.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #287C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N[Si](C)(C)C)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O4891.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #288C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N[Si](C)(C)C)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O4865.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #289C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O4850.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #29C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4804.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #290C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O4846.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #291C[Si](C)(C)O[C@H]1[C@H](O)[C@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@@H]1N5052.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #292C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4910.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #293C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@H]1O4902.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #294C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N[Si](C)(C)C)[C@H]2O)[C@H]1O4902.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #295C[Si](C)(C)O[C@H]1[C@H](O)[C@H](CN)O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@@H]1N4912.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #296C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N[Si](C)(C)C)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4874.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #297C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N[Si](C)(C)C4871.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #298C[Si](C)(C)O[C@H]1[C@H](O)[C@H](CN)O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@@H]1N4905.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #299C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4857.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N4762.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #30C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O4804.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #300C[Si](C)(C)O[C@H]1[C@H](O)[C@H](CN)O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H]2O)[C@@H]1N4938.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #301C[Si](C)(C)O[C@H]1[C@H](O)[C@H](CN)O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@@H]1N([Si](C)(C)C)[Si](C)(C)C4941.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #302C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N[Si](C)(C)C)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C4897.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #303C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N[Si](C)(C)C)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C4874.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #304C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C4857.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #305C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C4851.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #306C[Si](C)(C)O[C@@H]1[C@H](CN([Si](C)(C)C)[Si](C)(C)C)O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@H]1O5064.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #307C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4913.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #308C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O4904.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #309C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O)[C@H]1O4905.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #31C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N4761.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #310C[Si](C)(C)O[C@@H]1[C@H](CN)O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@H]1O4906.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #311C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4876.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #312C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N[Si](C)(C)C4873.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #313C[Si](C)(C)O[C@@H]1[C@H](CN)O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@H]1O4903.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #314C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4855.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #315C[Si](C)(C)O[C@@H]1[C@H](CN)O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@H]1O4933.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #316C[Si](C)(C)O[C@@H]1[C@H](CN)O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]1O4915.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #317C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N[Si](C)(C)C)C[C@H](N[Si](C)(C)C)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4987.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #318C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N[Si](C)(C)C)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4972.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #319C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N[Si](C)(C)C)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N[Si](C)(C)C)[C@@H](O)[C@@H]1O4949.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #32C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N4751.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #320C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O5158.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #321C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O5012.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #322C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N[Si](C)(C)C)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4937.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #323C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N[Si](C)(C)C)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N[Si](C)(C)C)[C@@H](O)[C@@H]1O4917.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #324C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N5136.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #325C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O5000.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #326C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@@H]2O)[C@H](N[Si](C)(C)C)[C@@H](O)[C@@H]1O4892.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #327C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O5121.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #328C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O5035.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #329C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O5115.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #33C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N4766.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #330C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@@H]1O5021.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #331C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4988.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #332C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N[Si](C)(C)C4994.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #333C[Si](C)(C)N[C@@H]1C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O5034.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #334C[Si](C)(C)N[C@H]1C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N5036.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #335C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O)[C@H]1O4977.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #336C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O5001.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #337C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O5061.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #338C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O4989.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #339C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@H]1O5046.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #34C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O4845.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #340C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N[Si](C)(C)C4936.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #341C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O4980.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #342C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N5024.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #343C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4988.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #344C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C5036.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #345C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O5007.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #346C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O5003.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #35C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N4824.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #36C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C4813.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #37C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4804.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #38C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O4809.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #39C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N4740.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N4754.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #40C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N4760.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #41C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@H]1O4849.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #42C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4824.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #43C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O4803.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #44C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O4802.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #45C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O[Si](C)(C)C)O[C@@H](CN)[C@@H](O)[C@@H]1O4792.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #46C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1N4742.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #47C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O4833.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #48C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4810.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #49C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4801.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]1N4745.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #50C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C4808.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #51C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@@H]1O4798.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #52C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@H]1O4840.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #53C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4815.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #54C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4811.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #55C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O4800.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #56C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O[Si](C)(C)C4806.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #57C[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4925.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #58C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C)[C@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O4915.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #59C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N[Si](C)(C)C)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4903.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]1N4758.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #60C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O)[C@H]1O4905.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #61C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N([Si](C)(C)C)[Si](C)(C)C)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N4929.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #62C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N[Si](C)(C)C)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4876.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #63C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4875.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #64C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N[Si](C)(C)C4884.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #65C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N([Si](C)(C)C)[Si](C)(C)C)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N4926.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #66C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4859.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #67C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4853.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #68C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N([Si](C)(C)C)[Si](C)(C)C)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N4955.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #69C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N[Si](C)(C)C)[C@@H](O)[C@@H]1O4842.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #7C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O[Si](C)(C)C4830.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #70C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN([Si](C)(C)C)[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1N5071.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #71C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N([Si](C)(C)C)[Si](C)(C)C4942.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #72C[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](N)C[C@H]1N4737.5Semi standard non polar33892256
Paromomycin,3TMS,isomer #73C[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](N)C[C@H]1N4746.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #74C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[Si](C)(C)C)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4762.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #75C[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H](N)C[C@H]1N4741.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #76C[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](N)C[C@H]1N4745.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #77C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C4798.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #78C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@@H]1O4796.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #79C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[Si](C)(C)C)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4800.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #8C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4832.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #80C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4818.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #81C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O[Si](C)(C)C4818.1Semi standard non polar33892256
Paromomycin,3TMS,isomer #82C[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](N)C[C@H]1N4760.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #83C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[Si](C)(C)C)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O4774.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #84C[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H](N)C[C@H]1N4755.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #85C[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](N)C[C@H]1N4756.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #86C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O4794.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #87C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O[Si](C)(C)C4800.3Semi standard non polar33892256
Paromomycin,3TMS,isomer #88C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[Si](C)(C)C)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4808.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #89C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4819.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #9C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[Si](C)(C)C)[C@H]2O[C@@H]2O[C@H](CO[Si](C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O4813.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #90C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3N)[C@H]2O)[C@H]1O[Si](C)(C)C4821.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #91C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[Si](C)(C)C)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O4786.6Semi standard non polar33892256
Paromomycin,3TMS,isomer #92C[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2N)[C@@H](N)C[C@H]1N4761.9Semi standard non polar33892256
Paromomycin,3TMS,isomer #93C[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2N)[C@@H](N)C[C@H]1N4764.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #94C[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O[Si](C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O4806.2Semi standard non polar33892256
Paromomycin,3TMS,isomer #95C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O[Si](C)(C)C)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O[Si](C)(C)C)O[C@@H](CN)[C@@H](O)[C@@H]1O4803.8Semi standard non polar33892256
Paromomycin,3TMS,isomer #96C[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[Si](C)(C)C)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O4816.4Semi standard non polar33892256
Paromomycin,3TMS,isomer #97C[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[Si](C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N4844.0Semi standard non polar33892256
Paromomycin,3TMS,isomer #98C[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C)[C@H]1O[Si](C)(C)C4845.7Semi standard non polar33892256
Paromomycin,3TMS,isomer #99C[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[Si](C)(C)C)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C)[C@@H]1O4776.8Semi standard non polar33892256
Paromomycin,1TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N5249.5Semi standard non polar33892256
Paromomycin,1TBDMS,isomer #10CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O5332.5Semi standard non polar33892256
Paromomycin,1TBDMS,isomer #11CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N5313.3Semi standard non polar33892256
Paromomycin,1TBDMS,isomer #12CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O5322.4Semi standard non polar33892256
Paromomycin,1TBDMS,isomer #13CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O5317.7Semi standard non polar33892256
Paromomycin,1TBDMS,isomer #2CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](N)C[C@H]1N5240.9Semi standard non polar33892256
Paromomycin,1TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O5258.1Semi standard non polar33892256
Paromomycin,1TBDMS,isomer #4CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@H]1O5239.2Semi standard non polar33892256
Paromomycin,1TBDMS,isomer #5CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](N)[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@H]1O5241.5Semi standard non polar33892256
Paromomycin,1TBDMS,isomer #6CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)O[C@H](CO)[C@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N5249.7Semi standard non polar33892256
Paromomycin,1TBDMS,isomer #7CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@H](CN)O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@@H]1N5228.9Semi standard non polar33892256
Paromomycin,1TBDMS,isomer #8CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](CN)O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@H]1O5233.1Semi standard non polar33892256
Paromomycin,1TBDMS,isomer #9CC(C)(C)[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O5346.1Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N5287.8Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #10CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O5336.4Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #11CC(C)(C)[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O5369.6Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #12CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O5329.0Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #13CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](N)C[C@H]1N5239.9Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #14CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3N)[C@H]2O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](N)C[C@H]1N5243.6Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #15CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@@H](N)C[C@H]1N5270.5Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #16CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O5295.1Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #17CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@@H](N)C[C@H]1N5248.7Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #18CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@@H](N)C[C@H]1N5250.4Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #19CC(C)(C)[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O5343.0Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N5331.6Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #20CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O5304.1Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #21CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O5311.7Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #22CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N5323.2Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #23CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O[Si](C)(C)C(C)(C)C5334.2Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #24CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O5279.6Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #25CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O5275.5Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #26CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O5309.7Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #27CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O5286.5Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #28CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C5288.5Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #29CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1N5350.4Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N5280.5Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #30CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O5367.7Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #31CC(C)(C)[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O5383.4Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #32CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O5343.9Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #33CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O5336.1Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #34CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@H]1O5226.7Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #35CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3N)[C@H]2O)[C@H](N)[C@H]1O5227.6Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #36CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]1O5260.6Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #37CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H](N)[C@H]1O[Si](C)(C)C(C)(C)C5250.2Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #38CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N5301.3Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #39CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O5322.5Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #4CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N5278.5Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #40CC(C)(C)[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O5338.4Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #41CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O5294.8Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #42CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O5309.3Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #43CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](CN)O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3N)[C@@H]2O)[C@H](N)[C@H]1O5229.8Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #44CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@H](CN)O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3N)[C@@H]2O)[C@@H]1N5229.6Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #45CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)O[C@H](CO)[C@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N5264.0Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #46CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C5308.0Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #47CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N5304.1Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #48CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O5324.5Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #49CC(C)(C)[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O5333.1Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #5CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N5294.5Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #50CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O5296.2Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #51CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](CN)O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@H]1O5250.6Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #52CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)O[C@H](CO)[C@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N5253.9Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #53CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H]1O5341.3Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #54CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N5319.4Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #55CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H](O)[C@@H]1O5314.4Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #56CC(C)(C)[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@H](N)[C@@H](O)[C@@H]1O5348.3Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #57CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O[Si](C)(C)C(C)(C)C)O[C@@H](CN)[C@@H](O)[C@@H]1O5303.1Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #58CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](CN)O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@H]1O[Si](C)(C)C(C)(C)C5238.7Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #59CC(C)(C)[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O5333.2Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #6CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1N5269.0Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #60CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3N)[C@H]2O)[C@H]1O5311.9Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #61CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N5290.8Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #62CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O5291.1Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #63CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C5295.1Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #64CC(C)(C)[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C5342.8Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #65CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O5316.3Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #66CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N5294.5Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #67CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O5295.4Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #68CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O5297.3Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #69CC(C)(C)[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N[Si](C)(C)C(C)(C)C)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O5424.0Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #7CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](O)[C@H](N)C[C@H](N)[C@H]2O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O)[C@@H]1O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N5268.6Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #70CC(C)(C)[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N[Si](C)(C)C(C)(C)C)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O5400.9Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #71CC(C)(C)[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O5398.3Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #72CC(C)(C)[Si](C)(C)NC[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O5385.5Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #73CC(C)(C)[Si](C)(C)N(C[C@@H]1O[C@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)[C@H](N)[C@@H](O)[C@@H]1O)[Si](C)(C)C(C)(C)C5544.6Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #74CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N5391.9Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #75CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N[Si](C)(C)C(C)(C)C)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O5397.5Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #76CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H]1O5393.8Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #77CC(C)(C)[Si](C)(C)N([C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O)[Si](C)(C)C(C)(C)C5473.6Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #78CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N5368.7Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #79CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N[Si](C)(C)C(C)(C)C5371.4Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #8CC(C)(C)[Si](C)(C)N[C@@H]1C[C@H](N)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2N)[C@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@H]1O5352.5Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #80CC(C)(C)[Si](C)(C)N([C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N)[Si](C)(C)C(C)(C)C5447.9Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #81CC(C)(C)[Si](C)(C)N[C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O5363.4Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #82CC(C)(C)[Si](C)(C)N([C@H]1[C@@H](O[C@@H]2[C@@H](N)C[C@@H](N)[C@H](O)[C@H]2O[C@@H]2O[C@H](CO)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)O[C@H](CO)[C@@H](O)[C@@H]1O)[Si](C)(C)C(C)(C)C5498.6Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #83CC(C)(C)[Si](C)(C)N([C@H]1[C@@H](O[C@@H]2[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](O)[C@H](N)C[C@H](N)[C@H]3O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3N)[C@@H]2O)O[C@@H](CN)[C@@H](O)[C@@H]1O)[Si](C)(C)C(C)(C)C5482.3Semi standard non polar33892256
Paromomycin,2TBDMS,isomer #9CC(C)(C)[Si](C)(C)N[C@H]1C[C@@H](N)[C@H](O)[C@@H](O[C@@H]2O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]3O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]3N)[C@H]2O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1N5334.3Semi standard non polar33892256
Spectra

GC-MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted GC-MSPredicted GC-MS Spectrum - Paromomycin GC-MS (Non-derivatized) - 70eV, Positivesplash10-001i-9342160000-31e82797142b42a046022017-09-01Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Paromomycin GC-MS (1 TMS) - 70eV, Positivesplash10-05ai-9224006000-5f0d0b615d31a61755032017-10-06Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Paromomycin GC-MS (TMS_1_2) - 70eV, PositiveNot Available2021-10-16Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Paromomycin GC-MS (TMS_1_3) - 70eV, PositiveNot Available2021-10-16Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Paromomycin GC-MS (TMS_1_4) - 70eV, PositiveNot Available2021-10-16Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Paromomycin GC-MS (TMS_1_5) - 70eV, PositiveNot Available2021-10-16Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Paromomycin GC-MS (TMS_1_6) - 70eV, PositiveNot Available2021-10-16Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Paromomycin GC-MS (TMS_1_7) - 70eV, PositiveNot Available2021-10-16Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Paromomycin GC-MS (TMS_1_8) - 70eV, PositiveNot Available2021-10-16Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Paromomycin GC-MS (TMS_1_9) - 70eV, PositiveNot Available2021-10-16Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Paromomycin GC-MS (TMS_1_10) - 70eV, PositiveNot Available2021-10-16Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Paromomycin GC-MS (TMS_1_11) - 70eV, PositiveNot Available2021-10-16Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Paromomycin GC-MS (TMS_1_12) - 70eV, PositiveNot Available2021-10-16Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Paromomycin GC-MS (TMS_1_13) - 70eV, PositiveNot Available2021-10-16Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Paromomycin GC-MS (TMS_2_1) - 70eV, PositiveNot Available2021-10-16Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Paromomycin GC-MS (TMS_2_2) - 70eV, PositiveNot Available2021-10-16Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Paromomycin GC-MS (TMS_2_3) - 70eV, PositiveNot Available2021-10-16Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Paromomycin GC-MS (TMS_2_4) - 70eV, PositiveNot Available2021-10-16Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Paromomycin GC-MS (TMS_2_5) - 70eV, PositiveNot Available2021-10-16Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Paromomycin GC-MS (TMS_2_6) - 70eV, PositiveNot Available2021-10-16Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Paromomycin GC-MS (TMS_2_7) - 70eV, PositiveNot Available2021-10-16Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Paromomycin GC-MS (TMS_2_8) - 70eV, PositiveNot Available2021-10-16Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Paromomycin GC-MS (TMS_2_9) - 70eV, PositiveNot Available2021-10-16Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Paromomycin GC-MS (TMS_2_10) - 70eV, PositiveNot Available2021-10-16Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Paromomycin GC-MS (TMS_2_11) - 70eV, PositiveNot Available2021-10-16Wishart LabView Spectrum

MS/MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Paromomycin 10V, Positive-QTOFsplash10-059t-0219482000-de54ecf4533aaf593cb72017-07-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Paromomycin 20V, Positive-QTOFsplash10-08mr-0928620000-164caf74a05e11da1b902017-07-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Paromomycin 40V, Positive-QTOFsplash10-074j-4916000000-9889a128fd12e51aa8102017-07-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Paromomycin 10V, Negative-QTOFsplash10-01p9-9014352000-7b4651a85addb05e31c82017-07-26Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Paromomycin 20V, Negative-QTOFsplash10-0ff1-7928450000-0a6e638198c9d0cc1aa62017-07-26Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Paromomycin 40V, Negative-QTOFsplash10-0fmi-5948010000-45dae05f691e7d1970ae2017-07-26Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Paromomycin 10V, Positive-QTOFsplash10-014l-0900448000-7d8ab098df904222341e2021-10-11Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Paromomycin 20V, Positive-QTOFsplash10-01ox-0900211000-56e8bf3a166490deef7f2021-10-11Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Paromomycin 40V, Positive-QTOFsplash10-0007-9812840000-4d2d1f05533b960d578a2021-10-11Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Paromomycin 10V, Negative-QTOFsplash10-03di-0101119000-a82209ef657383b76b042021-10-11Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Paromomycin 20V, Negative-QTOFsplash10-03dl-4435198000-344c98991aa4d34449892021-10-11Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Paromomycin 40V, Negative-QTOFsplash10-0fkc-5696400000-b9ad849333b79fa332352021-10-11Wishart LabView Spectrum

NMR Spectra

Spectrum TypeDescriptionDeposition DateSourceView
Predicted 1D NMR13C NMR Spectrum (1D, 100 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 100 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 1000 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 1000 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 200 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 200 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 300 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 300 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 400 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 400 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 500 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 500 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 600 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 600 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 700 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 700 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 800 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 800 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 900 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 900 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Biological Properties
Cellular Locations
  • Cytoplasm
Biospecimen Locations
  • Blood
  • Urine
Tissue LocationsNot Available
Pathways
Normal Concentrations
BiospecimenStatusValueAgeSexConditionReferenceDetails
BloodExpected but not QuantifiedNot QuantifiedNot AvailableNot AvailableTaking drug identified by DrugBank entry DB01421 details
UrineExpected but not QuantifiedNot QuantifiedNot AvailableNot AvailableTaking drug identified by DrugBank entry DB01421 details
Abnormal Concentrations
Not Available
Associated Disorders and Diseases
Disease ReferencesNone
Associated OMIM IDsNone
DrugBank IDDB01421
Phenol Explorer Compound IDNot Available
FooDB IDNot Available
KNApSAcK IDC00018808
Chemspider ID145115
KEGG Compound IDC00832
BioCyc IDNot Available
BiGG IDNot Available
Wikipedia LinkParomomycin
METLIN IDNot Available
PubChem Compound165580
PDB IDPAR
ChEBI ID7934
Food Biomarker OntologyNot Available
VMH IDNot Available
MarkerDB IDNot Available
Good Scents IDNot Available
References
Synthesis ReferenceNot Available
Material Safety Data Sheet (MSDS)Not Available
General References
  1. Vicens Q, Westhof E: Crystal structure of paromomycin docked into the eubacterial ribosomal decoding A site. Structure. 2001 Aug;9(8):647-58. [PubMed:11587639 ]