Hmdb loader

Showing metabocard for Ganoderic acid H (HMDB0035987)

Jump To Section:
IdentificationTaxonomyOntologyPhysical propertiesSpectraBiological propertiesConcentrationsLinksReferencesXML
Record Information
Version5.0
StatusExpected but not Quantified
Creation Date2012-09-11 21:02:56 UTC
Update Date2022-03-07 02:54:43 UTC
HMDB IDHMDB0035987
Secondary Accession Numbers
  • HMDB35987
Metabolite Identification
Common NameGanoderic acid H
DescriptionGanoderic acid H, also known as ganoderate H, belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units. Ganoderic acid H is an extremely weak basic (essentially neutral) compound (based on its pKa).
Structure
Data?1563862803
MOL3D MOLSDF3D SDFPDB3D PDBSMILESInChI

MOL for HMDB0035987 (Ganoderic acid H)


  Mrv0541 02241211232D          

 41 44  0  0  0  0            999 V2000
    0.6581    1.3752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4077    0.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8973   -0.0743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4174   -0.7454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3678   -0.4978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0830   -0.9104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0830   -1.7384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7927   -2.1482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5010   -1.7384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2216   -2.1564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9285   -1.7480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9285   -0.9324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2216   -0.5239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5010   -0.9227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7927   -0.4978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7927    0.3204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0830    0.7288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3678    0.3287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2936    1.1511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4640    1.5527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9838    0.9118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7981    1.0411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3179    0.3988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1321    0.5281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4291    1.2983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1381    2.0175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0221   -0.3714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5010   -0.0977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2785   -1.3161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7428   -2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6824   -2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0830    1.5622    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6882    0.1416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5161    0.7288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6520   -0.1128    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6773   -1.5293    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6520   -2.1647    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3678   -2.1564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7982    1.9749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7982    2.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5133    1.5622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  1 20  1  0  0  0  0
  1 26  1  0  0  0  0
  2  3  1  0  0  0  0
  2 18  1  0  0  0  0
  3  4  1  0  0  0  0
  4  5  1  0  0  0  0
  4 36  2  0  0  0  0
  5  6  1  0  0  0  0
  5 18  1  0  0  0  0
  5 29  1  0  0  0  0
  6  7  1  0  0  0  0
  6 15  2  0  0  0  0
  7  8  1  0  0  0  0
  7 38  2  0  0  0  0
  8  9  1  0  0  0  0
  9 10  1  0  0  0  0
  9 14  1  0  0  0  0
 10 11  1  0  0  0  0
 10 30  1  0  0  0  0
 10 31  1  0  0  0  0
 11 12  1  0  0  0  0
 11 37  1  0  0  0  0
 12 13  1  0  0  0  0
 13 14  1  0  0  0  0
 14 15  1  0  0  0  0
 14 28  1  0  0  0  0
 15 16  1  0  0  0  0
 16 17  1  0  0  0  0
 16 34  2  0  0  0  0
 17 18  1  0  0  0  0
 17 32  1  0  0  0  0
 18 19  1  0  0  0  0
 20 21  1  0  0  0  0
 21 22  1  0  0  0  0
 21 33  2  0  0  0  0
 22 23  1  0  0  0  0
 23 24  1  0  0  0  0
 23 27  1  0  0  0  0
 24 25  2  0  0  0  0
 24 35  1  0  0  0  0
 32 39  1  0  0  0  0
 39 40  2  0  0  0  0
 39 41  1  0  0  0  0
M  END
Download

3D MOL for HMDB0035987 (Ganoderic acid H)

HMDB0035987
     RDKit          3D
Ganoderic acid H
 85 88  0  0  0  0  0  0  0  0999 V2000
    1.8660   -1.7897    3.7699 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0737   -1.8228    2.4947 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6479   -2.9581    2.1672 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8354   -0.6978    1.7477 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1120   -0.7398    0.5803 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1870   -0.0453    0.9596 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4705    0.3185    2.1028 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1164    0.1805   -0.1209 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7438   -0.2392   -1.3109 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7598   -0.6113   -2.3101 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4462   -1.1327   -3.4075 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1994   -0.3759   -2.0402 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4514   -0.0850   -0.5697 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4367    0.8421    0.0252 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4266    2.1280   -0.8151 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8168    1.1741    1.4173 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1544    1.8102    1.4972 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0710    1.5986    0.3516 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3901    1.5785    0.8593 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8727    0.3151   -0.3907 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6834   -0.7541    0.3573 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6012    0.4834   -1.7331 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3547   -0.3646   -1.6974 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1337    0.3759   -2.9742 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0715   -1.8211   -1.8005 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5982   -2.7343   -2.2234 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4642   -1.9660   -1.2941 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8375   -0.4570   -1.2736 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2284   -0.2204   -0.9541 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4889    1.2911   -1.0149 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7909   -0.6981    0.3266 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2582   -0.3376    0.3489 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8156    0.1985   -0.5841 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0868   -0.6409    1.5576 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4879   -0.1994    1.3157 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2793   -0.5305    2.5810 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1249   -0.8809    0.1749 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5616   -1.7585   -0.5187 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4272   -0.5272   -0.1477 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6574    0.0493   -0.5968 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5454    1.4804   -0.2605 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3214   -0.7979    3.9401 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1317   -1.9530    4.5868 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5915   -2.6243    3.8230 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2420   -1.7545    0.2637 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7456   -1.3457   -2.2397 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6480    0.3541   -2.7152 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3189   -1.0768   -0.0436 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0664    2.0295   -1.7156 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7094    3.0019   -0.1920 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3992    2.3345   -1.1828 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8035    0.2636    2.0476 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0764    1.9472    1.7848 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0755    2.9297    1.6360 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6460    1.4786    2.4596 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0734    2.4705   -0.3675 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4656    2.1911    1.6470 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2493   -0.9519    1.3493 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6709   -1.6985   -0.2230 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7168   -0.3473    0.4400 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3264    1.4158   -2.2356 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5553   -0.4127   -2.3482 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6854    0.6053   -1.4399 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0991    0.7595   -3.4236 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4954    1.2764   -2.9101 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2722   -0.3046   -3.7732 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5704   -2.4332   -0.3279 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1357   -2.4056   -2.0774 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7556   -0.2062   -2.3786 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8510   -0.6615   -1.7602 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.6617    1.8100   -1.5848 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7150    1.7331   -0.0432 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3815    1.5245   -1.6774 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4003   -0.1722    1.2236 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7725   -1.7904    0.3929 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.1129   -1.7615    1.6800 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6494   -0.2528    2.4860 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5775    0.8956    1.1665 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.3607   -0.4800    2.3940 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9205   -1.4787    2.9832 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.0152    0.2697    3.3280 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.7202    0.4342   -0.2907 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3844    2.1814   -1.1017 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3798    1.8817    0.3497 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3502    1.6858    0.4053 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  1  0
 20 21  1  0
 20 22  1  0
  9 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  2  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 29 31  1  0
 31 32  1  0
 32 33  2  0
 32 34  1  0
 34 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  2  0
 37 39  1  0
 28 40  1  0
 40 41  1  0
 40  5  1  0
 14  8  1  0
 40 23  1  0
 20 13  1  0
  1 42  1  0
  1 43  1  0
  1 44  1  0
  5 45  1  0
 12 46  1  0
 12 47  1  0
 13 48  1  0
 15 49  1  0
 15 50  1  0
 15 51  1  0
 16 52  1  0
 16 53  1  0
 17 54  1  0
 17 55  1  0
 18 56  1  0
 19 57  1  0
 21 58  1  0
 21 59  1  0
 21 60  1  0
 22 61  1  0
 22 62  1  0
 22 63  1  0
 24 64  1  0
 24 65  1  0
 24 66  1  0
 27 67  1  0
 27 68  1  0
 28 69  1  0
 29 70  1  0
 30 71  1  0
 30 72  1  0
 30 73  1  0
 31 74  1  0
 31 75  1  0
 34 76  1  0
 34 77  1  0
 35 78  1  0
 36 79  1  0
 36 80  1  0
 36 81  1  0
 39 82  1  0
 41 83  1  0
 41 84  1  0
 41 85  1  0
M  END
Download

3D SDF for HMDB0035987 (Ganoderic acid H)


  Mrv0541 02241211232D          

 41 44  0  0  0  0            999 V2000
    0.6581    1.3752    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4077    0.5900    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8973   -0.0743    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4174   -0.7454    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3678   -0.4978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0830   -0.9104    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0830   -1.7384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7927   -2.1482    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5010   -1.7384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2216   -2.1564    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9285   -1.7480    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9285   -0.9324    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2216   -0.5239    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5010   -0.9227    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7927   -0.4978    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7927    0.3204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0830    0.7288    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3678    0.3287    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2936    1.1511    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4640    1.5527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9838    0.9118    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7981    1.0411    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3179    0.3988    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1321    0.5281    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4291    1.2983    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1381    2.0175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0221   -0.3714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5010   -0.0977    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2785   -1.3161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7428   -2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6824   -2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0830    1.5622    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.6882    0.1416    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5161    0.7288    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6520   -0.1128    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6773   -1.5293    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6520   -2.1647    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3678   -2.1564    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7982    1.9749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7982    2.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5133    1.5622    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  1 20  1  0  0  0  0
  1 26  1  0  0  0  0
  2  3  1  0  0  0  0
  2 18  1  0  0  0  0
  3  4  1  0  0  0  0
  4  5  1  0  0  0  0
  4 36  2  0  0  0  0
  5  6  1  0  0  0  0
  5 18  1  0  0  0  0
  5 29  1  0  0  0  0
  6  7  1  0  0  0  0
  6 15  2  0  0  0  0
  7  8  1  0  0  0  0
  7 38  2  0  0  0  0
  8  9  1  0  0  0  0
  9 10  1  0  0  0  0
  9 14  1  0  0  0  0
 10 11  1  0  0  0  0
 10 30  1  0  0  0  0
 10 31  1  0  0  0  0
 11 12  1  0  0  0  0
 11 37  1  0  0  0  0
 12 13  1  0  0  0  0
 13 14  1  0  0  0  0
 14 15  1  0  0  0  0
 14 28  1  0  0  0  0
 15 16  1  0  0  0  0
 16 17  1  0  0  0  0
 16 34  2  0  0  0  0
 17 18  1  0  0  0  0
 17 32  1  0  0  0  0
 18 19  1  0  0  0  0
 20 21  1  0  0  0  0
 21 22  1  0  0  0  0
 21 33  2  0  0  0  0
 22 23  1  0  0  0  0
 23 24  1  0  0  0  0
 23 27  1  0  0  0  0
 24 25  2  0  0  0  0
 24 35  1  0  0  0  0
 32 39  1  0  0  0  0
 39 40  2  0  0  0  0
 39 41  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0035987

> <DATABASE_NAME>
hmdb

> <SMILES>
CC(CC(=O)CC(C)C(O)=O)C1CC(=O)C2(C)C3=C(C(=O)C(OC(C)=O)C12C)C1(C)CCC(O)C(C)(C)C1CC3=O

> <INCHI_IDENTIFIER>
InChI=1S/C32H44O9/c1-15(11-18(34)12-16(2)28(39)40)19-13-23(37)32(8)24-20(35)14-21-29(4,5)22(36)9-10-30(21,6)25(24)26(38)27(31(19,32)7)41-17(3)33/h15-16,19,21-22,27,36H,9-14H2,1-8H3,(H,39,40)

> <INCHI_KEY>
YCXUCEXEMJPDRZ-UHFFFAOYSA-N

> <FORMULA>
C32H44O9

> <MOLECULAR_WEIGHT>
572.6864

> <EXACT_MASS>
572.298533006

> <JCHEM_ACCEPTOR_COUNT>
8

> <JCHEM_AVERAGE_POLARIZABILITY>
61.08319481925747

> <JCHEM_BIOAVAILABILITY>
1

> <JCHEM_DONOR_COUNT>
2

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
6-[16-(acetyloxy)-5-hydroxy-2,6,6,11,15-pentamethyl-9,12,17-trioxotetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-1(10)-en-14-yl]-2-methyl-4-oxoheptanoic acid

> <ALOGPS_LOGP>
3.36

> <JCHEM_LOGP>
3.592876559666665

> <ALOGPS_LOGS>
-4.84

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
4

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-1

> <JCHEM_PKA>
16.85279731382841

> <JCHEM_PKA_STRONGEST_ACIDIC>
4.161468206245881

> <JCHEM_PKA_STRONGEST_BASIC>
-0.7785803887303967

> <JCHEM_POLAR_SURFACE_AREA>
152.11

> <JCHEM_REFRACTIVITY>
148.59670000000003

> <JCHEM_ROTATABLE_BOND_COUNT>
8

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
8.28e-03 g/l

> <JCHEM_TRADITIONAL_IUPAC>
6-[16-(acetyloxy)-5-hydroxy-2,6,6,11,15-pentamethyl-9,12,17-trioxotetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-1(10)-en-14-yl]-2-methyl-4-oxoheptanoic acid

> <JCHEM_VEBER_RULE>
0

$$$$
Download

3D-SDF for HMDB0035987 (Ganoderic acid H)

HMDB0035987
     RDKit          3D
Ganoderic acid H
 85 88  0  0  0  0  0  0  0  0999 V2000
    1.8660   -1.7897    3.7699 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0737   -1.8228    2.4947 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6479   -2.9581    2.1672 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8354   -0.6978    1.7477 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1120   -0.7398    0.5803 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1870   -0.0453    0.9596 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4705    0.3185    2.1028 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1164    0.1805   -0.1209 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7438   -0.2392   -1.3109 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7598   -0.6113   -2.3101 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4462   -1.1327   -3.4075 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1994   -0.3759   -2.0402 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4514   -0.0850   -0.5697 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4367    0.8421    0.0252 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4266    2.1280   -0.8151 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8168    1.1741    1.4173 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1544    1.8102    1.4972 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0710    1.5986    0.3516 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3901    1.5785    0.8593 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8727    0.3151   -0.3907 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6834   -0.7541    0.3573 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6012    0.4834   -1.7331 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3547   -0.3646   -1.6974 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1337    0.3759   -2.9742 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0715   -1.8211   -1.8005 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5982   -2.7343   -2.2234 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4642   -1.9660   -1.2941 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8375   -0.4570   -1.2736 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2284   -0.2204   -0.9541 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4889    1.2911   -1.0149 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7909   -0.6981    0.3266 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2582   -0.3376    0.3489 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8156    0.1985   -0.5841 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0868   -0.6409    1.5576 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4879   -0.1994    1.3157 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2793   -0.5305    2.5810 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1249   -0.8809    0.1749 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.5616   -1.7585   -0.5187 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4272   -0.5272   -0.1477 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6574    0.0493   -0.5968 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5454    1.4804   -0.2605 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3214   -0.7979    3.9401 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1317   -1.9530    4.5868 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5915   -2.6243    3.8230 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2420   -1.7545    0.2637 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7456   -1.3457   -2.2397 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6480    0.3541   -2.7152 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3189   -1.0768   -0.0436 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0664    2.0295   -1.7156 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7094    3.0019   -0.1920 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3992    2.3345   -1.1828 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8035    0.2636    2.0476 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0764    1.9472    1.7848 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0755    2.9297    1.6360 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6460    1.4786    2.4596 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0734    2.4705   -0.3675 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4656    2.1911    1.6470 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.2493   -0.9519    1.3493 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6709   -1.6985   -0.2230 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.7168   -0.3473    0.4400 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3264    1.4158   -2.2356 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5553   -0.4127   -2.3482 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6854    0.6053   -1.4399 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0991    0.7595   -3.4236 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4954    1.2764   -2.9101 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2722   -0.3046   -3.7732 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5704   -2.4332   -0.3279 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1357   -2.4056   -2.0774 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7556   -0.2062   -2.3786 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8510   -0.6615   -1.7602 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.6617    1.8100   -1.5848 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7150    1.7331   -0.0432 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3815    1.5245   -1.6774 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4003   -0.1722    1.2236 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7725   -1.7904    0.3929 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.1129   -1.7615    1.6800 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6494   -0.2528    2.4860 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.5775    0.8956    1.1665 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.3607   -0.4800    2.3940 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9205   -1.4787    2.9832 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.0152    0.2697    3.3280 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.7202    0.4342   -0.2907 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3844    2.1814   -1.1017 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3798    1.8817    0.3497 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3502    1.6858    0.4053 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  2  0
 10 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 14 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  1  0
 20 21  1  0
 20 22  1  0
  9 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  2  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 29 31  1  0
 31 32  1  0
 32 33  2  0
 32 34  1  0
 34 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  2  0
 37 39  1  0
 28 40  1  0
 40 41  1  0
 40  5  1  0
 14  8  1  0
 40 23  1  0
 20 13  1  0
  1 42  1  0
  1 43  1  0
  1 44  1  0
  5 45  1  0
 12 46  1  0
 12 47  1  0
 13 48  1  0
 15 49  1  0
 15 50  1  0
 15 51  1  0
 16 52  1  0
 16 53  1  0
 17 54  1  0
 17 55  1  0
 18 56  1  0
 19 57  1  0
 21 58  1  0
 21 59  1  0
 21 60  1  0
 22 61  1  0
 22 62  1  0
 22 63  1  0
 24 64  1  0
 24 65  1  0
 24 66  1  0
 27 67  1  0
 27 68  1  0
 28 69  1  0
 29 70  1  0
 30 71  1  0
 30 72  1  0
 30 73  1  0
 31 74  1  0
 31 75  1  0
 34 76  1  0
 34 77  1  0
 35 78  1  0
 36 79  1  0
 36 80  1  0
 36 81  1  0
 39 82  1  0
 41 83  1  0
 41 84  1  0
 41 85  1  0
M  END
Download

PDB for HMDB0035987 (Ganoderic acid H)

HEADER    PROTEIN                                 24-FEB-12   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   24-FEB-12         0                                  
HETATM    1  C   UNK     0       1.228   2.567   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0       0.761   1.101   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0       1.675  -0.139   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0       0.779  -1.391   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0      -0.687  -0.929   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0      -2.022  -1.699   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0      -2.022  -3.245   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      -3.346  -4.010   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0      -4.669  -3.245   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0      -6.014  -4.025   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0      -7.333  -3.263   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0      -7.333  -1.740   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0      -6.014  -0.978   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0      -4.669  -1.722   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0      -3.346  -0.929   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0      -3.346   0.598   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0      -2.022   1.360   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0      -0.687   0.614   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0      -0.548   2.149   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0       2.733   2.898   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0       3.703   1.702   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0       5.223   1.943   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0       6.193   0.744   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0       7.713   0.986   0.000  0.00  0.00           C+0
HETATM   25  O   UNK     0       8.268   2.423   0.000  0.00  0.00           O+0
HETATM   26  C   UNK     0       0.258   3.766   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0       5.641  -0.693   0.000  0.00  0.00           C+0
HETATM   28  C   UNK     0      -4.669  -0.182   0.000  0.00  0.00           C+0
HETATM   29  C   UNK     0      -0.520  -2.457   0.000  0.00  0.00           C+0
HETATM   30  C   UNK     0      -6.987  -5.227   0.000  0.00  0.00           C+0
HETATM   31  C   UNK     0      -5.007  -5.227   0.000  0.00  0.00           C+0
HETATM   32  O   UNK     0      -2.022   2.916   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0       3.151   0.264   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0      -4.697   1.360   0.000  0.00  0.00           O+0
HETATM   35  O   UNK     0       8.684  -0.211   0.000  0.00  0.00           O+0
HETATM   36  O   UNK     0       1.264  -2.855   0.000  0.00  0.00           O+0
HETATM   37  O   UNK     0      -8.684  -4.041   0.000  0.00  0.00           O+0
HETATM   38  O   UNK     0      -0.687  -4.025   0.000  0.00  0.00           O+0
HETATM   39  C   UNK     0      -3.357   3.686   0.000  0.00  0.00           C+0
HETATM   40  O   UNK     0      -3.357   5.227   0.000  0.00  0.00           O+0
HETATM   41  C   UNK     0      -4.691   2.916   0.000  0.00  0.00           C+0
CONECT    1    2   20   26                                                  
CONECT    2    1    3   18                                                  
CONECT    3    2    4                                                       
CONECT    4    3    5   36                                                  
CONECT    5    4    6   18   29                                             
CONECT    6    5    7   15                                                  
CONECT    7    6    8   38                                                  
CONECT    8    7    9                                                       
CONECT    9    8   10   14                                                  
CONECT   10    9   11   30   31                                             
CONECT   11   10   12   37                                                  
CONECT   12   11   13                                                       
CONECT   13   12   14                                                       
CONECT   14    9   13   15   28                                             
CONECT   15    6   14   16                                                  
CONECT   16   15   17   34                                                  
CONECT   17   16   18   32                                                  
CONECT   18    2    5   17   19                                             
CONECT   19   18                                                            
CONECT   20    1   21                                                       
CONECT   21   20   22   33                                                  
CONECT   22   21   23                                                       
CONECT   23   22   24   27                                                  
CONECT   24   23   25   35                                                  
CONECT   25   24                                                            
CONECT   26    1                                                            
CONECT   27   23                                                            
CONECT   28   14                                                            
CONECT   29    5                                                            
CONECT   30   10                                                            
CONECT   31   10                                                            
CONECT   32   17   39                                                       
CONECT   33   21                                                            
CONECT   34   16                                                            
CONECT   35   24                                                            
CONECT   36    4                                                            
CONECT   37   11                                                            
CONECT   38    7                                                            
CONECT   39   32   40   41                                                  
CONECT   40   39                                                            
CONECT   41   39                                                            
MASTER        0    0    0    0    0    0    0    0   41    0   88    0
END
Download

3D PDB for HMDB0035987 (Ganoderic acid H)

COMPND    HMDB0035987
HETATM    1  C1  UNL     1       1.866  -1.790   3.770  1.00  0.00           C  
HETATM    2  C2  UNL     1       1.074  -1.823   2.495  1.00  0.00           C  
HETATM    3  O1  UNL     1       0.648  -2.958   2.167  1.00  0.00           O  
HETATM    4  O2  UNL     1       0.835  -0.698   1.748  1.00  0.00           O  
HETATM    5  C3  UNL     1       0.112  -0.740   0.580  1.00  0.00           C  
HETATM    6  C4  UNL     1      -1.187  -0.045   0.960  1.00  0.00           C  
HETATM    7  O3  UNL     1      -1.470   0.318   2.103  1.00  0.00           O  
HETATM    8  C5  UNL     1      -2.116   0.180  -0.121  1.00  0.00           C  
HETATM    9  C6  UNL     1      -1.744  -0.239  -1.311  1.00  0.00           C  
HETATM   10  C7  UNL     1      -2.760  -0.611  -2.310  1.00  0.00           C  
HETATM   11  O4  UNL     1      -2.446  -1.133  -3.407  1.00  0.00           O  
HETATM   12  C8  UNL     1      -4.199  -0.376  -2.040  1.00  0.00           C  
HETATM   13  C9  UNL     1      -4.451  -0.085  -0.570  1.00  0.00           C  
HETATM   14  C10 UNL     1      -3.437   0.842   0.025  1.00  0.00           C  
HETATM   15  C11 UNL     1      -3.427   2.128  -0.815  1.00  0.00           C  
HETATM   16  C12 UNL     1      -3.817   1.174   1.417  1.00  0.00           C  
HETATM   17  C13 UNL     1      -5.154   1.810   1.497  1.00  0.00           C  
HETATM   18  C14 UNL     1      -6.071   1.599   0.352  1.00  0.00           C  
HETATM   19  O5  UNL     1      -7.390   1.578   0.859  1.00  0.00           O  
HETATM   20  C15 UNL     1      -5.873   0.315  -0.391  1.00  0.00           C  
HETATM   21  C16 UNL     1      -6.683  -0.754   0.357  1.00  0.00           C  
HETATM   22  C17 UNL     1      -6.601   0.483  -1.733  1.00  0.00           C  
HETATM   23  C18 UNL     1      -0.355  -0.365  -1.697  1.00  0.00           C  
HETATM   24  C19 UNL     1      -0.134   0.376  -2.974  1.00  0.00           C  
HETATM   25  C20 UNL     1       0.071  -1.821  -1.800  1.00  0.00           C  
HETATM   26  O6  UNL     1      -0.598  -2.734  -2.223  1.00  0.00           O  
HETATM   27  C21 UNL     1       1.464  -1.966  -1.294  1.00  0.00           C  
HETATM   28  C22 UNL     1       1.838  -0.457  -1.274  1.00  0.00           C  
HETATM   29  C23 UNL     1       3.228  -0.220  -0.954  1.00  0.00           C  
HETATM   30  C24 UNL     1       3.489   1.291  -1.015  1.00  0.00           C  
HETATM   31  C25 UNL     1       3.791  -0.698   0.327  1.00  0.00           C  
HETATM   32  C26 UNL     1       5.258  -0.338   0.349  1.00  0.00           C  
HETATM   33  O7  UNL     1       5.816   0.199  -0.584  1.00  0.00           O  
HETATM   34  C27 UNL     1       6.087  -0.641   1.558  1.00  0.00           C  
HETATM   35  C28 UNL     1       7.488  -0.199   1.316  1.00  0.00           C  
HETATM   36  C29 UNL     1       8.279  -0.531   2.581  1.00  0.00           C  
HETATM   37  C30 UNL     1       8.125  -0.881   0.175  1.00  0.00           C  
HETATM   38  O8  UNL     1       7.562  -1.758  -0.519  1.00  0.00           O  
HETATM   39  O9  UNL     1       9.427  -0.527  -0.148  1.00  0.00           O  
HETATM   40  C31 UNL     1       0.657   0.049  -0.597  1.00  0.00           C  
HETATM   41  C32 UNL     1       0.545   1.480  -0.260  1.00  0.00           C  
HETATM   42  H1  UNL     1       2.321  -0.798   3.940  1.00  0.00           H  
HETATM   43  H2  UNL     1       1.132  -1.953   4.587  1.00  0.00           H  
HETATM   44  H3  UNL     1       2.592  -2.624   3.823  1.00  0.00           H  
HETATM   45  H4  UNL     1      -0.242  -1.754   0.264  1.00  0.00           H  
HETATM   46  H5  UNL     1      -4.746  -1.346  -2.240  1.00  0.00           H  
HETATM   47  H6  UNL     1      -4.648   0.354  -2.715  1.00  0.00           H  
HETATM   48  H7  UNL     1      -4.319  -1.077  -0.044  1.00  0.00           H  
HETATM   49  H8  UNL     1      -4.066   2.030  -1.716  1.00  0.00           H  
HETATM   50  H9  UNL     1      -3.709   3.002  -0.192  1.00  0.00           H  
HETATM   51  H10 UNL     1      -2.399   2.335  -1.183  1.00  0.00           H  
HETATM   52  H11 UNL     1      -3.804   0.264   2.048  1.00  0.00           H  
HETATM   53  H12 UNL     1      -3.076   1.947   1.785  1.00  0.00           H  
HETATM   54  H13 UNL     1      -5.075   2.930   1.636  1.00  0.00           H  
HETATM   55  H14 UNL     1      -5.646   1.479   2.460  1.00  0.00           H  
HETATM   56  H15 UNL     1      -6.073   2.471  -0.368  1.00  0.00           H  
HETATM   57  H16 UNL     1      -7.466   2.191   1.647  1.00  0.00           H  
HETATM   58  H17 UNL     1      -6.249  -0.952   1.349  1.00  0.00           H  
HETATM   59  H18 UNL     1      -6.671  -1.699  -0.223  1.00  0.00           H  
HETATM   60  H19 UNL     1      -7.717  -0.347   0.440  1.00  0.00           H  
HETATM   61  H20 UNL     1      -6.326   1.416  -2.236  1.00  0.00           H  
HETATM   62  H21 UNL     1      -6.555  -0.413  -2.348  1.00  0.00           H  
HETATM   63  H22 UNL     1      -7.685   0.605  -1.440  1.00  0.00           H  
HETATM   64  H23 UNL     1      -1.099   0.759  -3.424  1.00  0.00           H  
HETATM   65  H24 UNL     1       0.495   1.276  -2.910  1.00  0.00           H  
HETATM   66  H25 UNL     1       0.272  -0.305  -3.773  1.00  0.00           H  
HETATM   67  H26 UNL     1       1.570  -2.433  -0.328  1.00  0.00           H  
HETATM   68  H27 UNL     1       2.136  -2.406  -2.077  1.00  0.00           H  
HETATM   69  H28 UNL     1       1.756  -0.206  -2.379  1.00  0.00           H  
HETATM   70  H29 UNL     1       3.851  -0.662  -1.760  1.00  0.00           H  
HETATM   71  H30 UNL     1       2.662   1.810  -1.585  1.00  0.00           H  
HETATM   72  H31 UNL     1       3.715   1.733  -0.043  1.00  0.00           H  
HETATM   73  H32 UNL     1       4.381   1.525  -1.677  1.00  0.00           H  
HETATM   74  H33 UNL     1       3.400  -0.172   1.224  1.00  0.00           H  
HETATM   75  H34 UNL     1       3.773  -1.790   0.393  1.00  0.00           H  
HETATM   76  H35 UNL     1       6.113  -1.762   1.680  1.00  0.00           H  
HETATM   77  H36 UNL     1       5.649  -0.253   2.486  1.00  0.00           H  
HETATM   78  H37 UNL     1       7.578   0.896   1.167  1.00  0.00           H  
HETATM   79  H38 UNL     1       9.361  -0.480   2.394  1.00  0.00           H  
HETATM   80  H39 UNL     1       7.920  -1.479   2.983  1.00  0.00           H  
HETATM   81  H40 UNL     1       8.015   0.270   3.328  1.00  0.00           H  
HETATM   82  H41 UNL     1       9.720   0.434  -0.291  1.00  0.00           H  
HETATM   83  H42 UNL     1       0.384   2.181  -1.102  1.00  0.00           H  
HETATM   84  H43 UNL     1       1.380   1.882   0.350  1.00  0.00           H  
HETATM   85  H44 UNL     1      -0.350   1.686   0.405  1.00  0.00           H  
CONECT    1    2   42   43   44
CONECT    2    3    3    4
CONECT    4    5
CONECT    5    6   40   45
CONECT    6    7    7    8
CONECT    8    9    9   14
CONECT    9   10   23
CONECT   10   11   11   12
CONECT   12   13   46   47
CONECT   13   14   20   48
CONECT   14   15   16
CONECT   15   49   50   51
CONECT   16   17   52   53
CONECT   17   18   54   55
CONECT   18   19   20   56
CONECT   19   57
CONECT   20   21   22
CONECT   21   58   59   60
CONECT   22   61   62   63
CONECT   23   24   25   40
CONECT   24   64   65   66
CONECT   25   26   26   27
CONECT   27   28   67   68
CONECT   28   29   40   69
CONECT   29   30   31   70
CONECT   30   71   72   73
CONECT   31   32   74   75
CONECT   32   33   33   34
CONECT   34   35   76   77
CONECT   35   36   37   78
CONECT   36   79   80   81
CONECT   37   38   38   39
CONECT   39   82
CONECT   40   41
CONECT   41   83   84   85
END
Download

SMILES for HMDB0035987 (Ganoderic acid H)

CC(CC(=O)CC(C)C(O)=O)C1CC(=O)C2(C)C3=C(C(=O)C(OC(C)=O)C12C)C1(C)CCC(O)C(C)(C)C1CC3=O
Download

INCHI for HMDB0035987 (Ganoderic acid H)

InChI=1S/C32H44O9/c1-15(11-18(34)12-16(2)28(39)40)19-13-23(37)32(8)24-20(35)14-21-29(4,5)22(36)9-10-30(21,6)25(24)26(38)27(31(19,32)7)41-17(3)33/h15-16,19,21-22,27,36H,9-14H2,1-8H3,(H,39,40)
Download
View in JSmolView Stereo Labels
Synonyms
ValueSource
Ganoderate HGenerator
12-Acetoxy-3-hydroxy-7,11,15,23-tetraoxolanost-8-en-26-Oic acidHMDB
3beta-Hydroxy-7,11,15,23-tetraoxo-12beta-acetoxy-5alpha-lanost-8-en-26-Oic acidHMDB
6-[16-(Acetyloxy)-5-hydroxy-2,6,6,11,15-pentamethyl-9,12,17-trioxotetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-1(10)-en-14-yl]-2-methyl-4-oxoheptanoateGenerator
Ganoderic acid HMeSH
Chemical FormulaC32H44O9
Average Molecular Weight572.6864
Monoisotopic Molecular Weight572.298533006
IUPAC Name6-[16-(acetyloxy)-5-hydroxy-2,6,6,11,15-pentamethyl-9,12,17-trioxotetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-1(10)-en-14-yl]-2-methyl-4-oxoheptanoic acid
Traditional Name6-[16-(acetyloxy)-5-hydroxy-2,6,6,11,15-pentamethyl-9,12,17-trioxotetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-1(10)-en-14-yl]-2-methyl-4-oxoheptanoic acid
CAS Registry Number98665-19-1
SMILES
CC(CC(=O)CC(C)C(O)=O)C1CC(=O)C2(C)C3=C(C(=O)C(OC(C)=O)C12C)C1(C)CCC(O)C(C)(C)C1CC3=O
InChI Identifier
InChI=1S/C32H44O9/c1-15(11-18(34)12-16(2)28(39)40)19-13-23(37)32(8)24-20(35)14-21-29(4,5)22(36)9-10-30(21,6)25(24)26(38)27(31(19,32)7)41-17(3)33/h15-16,19,21-22,27,36H,9-14H2,1-8H3,(H,39,40)
InChI KeyYCXUCEXEMJPDRZ-UHFFFAOYSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as triterpenoids. These are terpene molecules containing six isoprene units.
KingdomOrganic compounds
Super ClassLipids and lipid-like molecules
ClassPrenol lipids
Sub ClassTriterpenoids
Direct ParentTriterpenoids
Alternative ParentsNot Available
SubstituentsNot Available
Molecular FrameworkAliphatic homopolycyclic compounds
External DescriptorsNot Available
Ontology
Not AvailableNot Available
Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water SolubilityNot AvailableNot Available
LogPNot AvailableNot Available
Experimental Chromatographic PropertiesNot Available
Predicted Molecular Properties
PropertyValueSource
Water Solubility0.0083 g/LALOGPS
logP3.36ALOGPS
logP3.59ChemAxon
logS-4.8ALOGPS
pKa (Strongest Acidic)4.16ChemAxon
pKa (Strongest Basic)-0.78ChemAxon
Physiological Charge-1ChemAxon
Hydrogen Acceptor Count8ChemAxon
Hydrogen Donor Count2ChemAxon
Polar Surface Area152.11 ŲChemAxon
Rotatable Bond Count8ChemAxon
Refractivity148.6 m³·mol⁻¹ChemAxon
Polarizability61.08 ųChemAxon
Number of Rings4ChemAxon
BioavailabilityYesChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleYesChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DarkChem[M+H]+233.30231661259
DarkChem[M-H]-221.73431661259
DeepCCS[M-2H]-262.46130932474
DeepCCS[M+Na]+236.95730932474
AllCCS[M+H]+228.132859911
AllCCS[M+H-H2O]+226.932859911
AllCCS[M+NH4]+229.232859911
AllCCS[M+Na]+229.532859911
AllCCS[M-H]-231.932859911
AllCCS[M+Na-2H]-235.232859911
AllCCS[M+HCOO]-238.932859911

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
Ganoderic acid HCC(CC(=O)CC(C)C(O)=O)C1CC(=O)C2(C)C3=C(C(=O)C(OC(C)=O)C12C)C1(C)CCC(O)C(C)(C)C1CC3=O5561.1Standard polar33892256
Ganoderic acid HCC(CC(=O)CC(C)C(O)=O)C1CC(=O)C2(C)C3=C(C(=O)C(OC(C)=O)C12C)C1(C)CCC(O)C(C)(C)C1CC3=O3399.7Standard non polar33892256
Ganoderic acid HCC(CC(=O)CC(C)C(O)=O)C1CC(=O)C2(C)C3=C(C(=O)C(OC(C)=O)C12C)C1(C)CCC(O)C(C)(C)C1CC3=O4095.4Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
Ganoderic acid H,1TMS,isomer #1CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C)C12C4087.5Semi standard non polar33892256
Ganoderic acid H,1TMS,isomer #2CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O)C12C4039.0Semi standard non polar33892256
Ganoderic acid H,1TMS,isomer #3CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O)C12C3877.6Semi standard non polar33892256
Ganoderic acid H,1TMS,isomer #4CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C)C12C4053.1Semi standard non polar33892256
Ganoderic acid H,1TMS,isomer #5CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C)C12C4099.1Semi standard non polar33892256
Ganoderic acid H,1TMS,isomer #6CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O)C12C3953.5Semi standard non polar33892256
Ganoderic acid H,1TMS,isomer #7CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O)C12C3917.9Semi standard non polar33892256
Ganoderic acid H,2TMS,isomer #1CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C)C12C3984.2Semi standard non polar33892256
Ganoderic acid H,2TMS,isomer #10CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C)C12C3932.8Semi standard non polar33892256
Ganoderic acid H,2TMS,isomer #11CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C)C12C3966.8Semi standard non polar33892256
Ganoderic acid H,2TMS,isomer #12CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O)C12C3741.8Semi standard non polar33892256
Ganoderic acid H,2TMS,isomer #13CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O)C12C3730.0Semi standard non polar33892256
Ganoderic acid H,2TMS,isomer #14CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C)C12C3810.6Semi standard non polar33892256
Ganoderic acid H,2TMS,isomer #15CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C)C12C3825.3Semi standard non polar33892256
Ganoderic acid H,2TMS,isomer #16CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C)C12C3840.1Semi standard non polar33892256
Ganoderic acid H,2TMS,isomer #17CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C)C12C3840.4Semi standard non polar33892256
Ganoderic acid H,2TMS,isomer #18CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C)C12C3869.7Semi standard non polar33892256
Ganoderic acid H,2TMS,isomer #19CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C)C12C3874.4Semi standard non polar33892256
Ganoderic acid H,2TMS,isomer #2CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C)C12C3870.3Semi standard non polar33892256
Ganoderic acid H,2TMS,isomer #20CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O)C12C3798.6Semi standard non polar33892256
Ganoderic acid H,2TMS,isomer #3CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C)C12C3875.8Semi standard non polar33892256
Ganoderic acid H,2TMS,isomer #4CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C)C12C3893.3Semi standard non polar33892256
Ganoderic acid H,2TMS,isomer #5CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3958.1Semi standard non polar33892256
Ganoderic acid H,2TMS,isomer #6CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3998.9Semi standard non polar33892256
Ganoderic acid H,2TMS,isomer #7CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O)C12C3804.3Semi standard non polar33892256
Ganoderic acid H,2TMS,isomer #8CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O)C12C3840.5Semi standard non polar33892256
Ganoderic acid H,2TMS,isomer #9CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O)C12C3833.3Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #1CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C)C12C3791.0Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #1CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C)C12C4028.4Standard non polar33892256
Ganoderic acid H,3TMS,isomer #10CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C)C12C3742.2Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #10CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C)C12C3714.7Standard non polar33892256
Ganoderic acid H,3TMS,isomer #11CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3753.0Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #11CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3981.9Standard non polar33892256
Ganoderic acid H,3TMS,isomer #12CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3788.5Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #12CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3981.4Standard non polar33892256
Ganoderic acid H,3TMS,isomer #13CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3737.9Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #13CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3820.7Standard non polar33892256
Ganoderic acid H,3TMS,isomer #14CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)C=C(CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3789.3Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #14CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)C=C(CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3837.4Standard non polar33892256
Ganoderic acid H,3TMS,isomer #15CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O)C12C3704.3Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #15CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O)C12C3945.8Standard non polar33892256
Ganoderic acid H,3TMS,isomer #16CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O)C12C3660.4Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #16CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O)C12C3767.4Standard non polar33892256
Ganoderic acid H,3TMS,isomer #17CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C)C12C3727.9Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #17CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C)C12C4064.3Standard non polar33892256
Ganoderic acid H,3TMS,isomer #18CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C)C12C3741.7Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #18CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C)C12C4041.6Standard non polar33892256
Ganoderic acid H,3TMS,isomer #19CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O)C12C3719.6Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #19CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O)C12C3674.1Standard non polar33892256
Ganoderic acid H,3TMS,isomer #2CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C)C12C3802.9Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #2CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C)C12C3922.9Standard non polar33892256
Ganoderic acid H,3TMS,isomer #20CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C)C12C3758.9Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #20CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C)C12C3956.2Standard non polar33892256
Ganoderic acid H,3TMS,isomer #21CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C)C12C3778.0Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #21CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C)C12C3919.7Standard non polar33892256
Ganoderic acid H,3TMS,isomer #22CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C)C12C3736.6Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #22CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C)C12C3772.4Standard non polar33892256
Ganoderic acid H,3TMS,isomer #23CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C)C12C3762.4Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #23CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C)C12C3761.3Standard non polar33892256
Ganoderic acid H,3TMS,isomer #24CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O)C12C3684.9Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #24CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O)C12C3742.5Standard non polar33892256
Ganoderic acid H,3TMS,isomer #25CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C)C12C3718.3Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #25CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C)C12C4028.6Standard non polar33892256
Ganoderic acid H,3TMS,isomer #26CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C)C12C3726.8Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #26CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C)C12C3995.6Standard non polar33892256
Ganoderic acid H,3TMS,isomer #27CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C)C12C3683.7Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #27CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C)C12C3853.2Standard non polar33892256
Ganoderic acid H,3TMS,isomer #28CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C)C12C3694.0Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #28CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C)C12C3840.3Standard non polar33892256
Ganoderic acid H,3TMS,isomer #29CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C)C12C3740.8Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #29CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C)C12C3731.2Standard non polar33892256
Ganoderic acid H,3TMS,isomer #3CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C)C12C3781.6Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #3CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C)C12C3739.1Standard non polar33892256
Ganoderic acid H,3TMS,isomer #30CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C)C12C3762.9Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #30CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C)C12C3722.0Standard non polar33892256
Ganoderic acid H,3TMS,isomer #4CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3833.0Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #4CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C4004.2Standard non polar33892256
Ganoderic acid H,3TMS,isomer #5CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3866.3Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #5CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C4004.3Standard non polar33892256
Ganoderic acid H,3TMS,isomer #6CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C)C12C3737.4Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #6CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C)C12C3999.7Standard non polar33892256
Ganoderic acid H,3TMS,isomer #7CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C)C12C3710.0Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #7CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C)C12C3818.4Standard non polar33892256
Ganoderic acid H,3TMS,isomer #8CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3750.0Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #8CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C4096.4Standard non polar33892256
Ganoderic acid H,3TMS,isomer #9CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3781.9Semi standard non polar33892256
Ganoderic acid H,3TMS,isomer #9CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C4096.6Standard non polar33892256
Ganoderic acid H,4TMS,isomer #1CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C)C12C3685.2Semi standard non polar33892256
Ganoderic acid H,4TMS,isomer #1CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C)C12C3971.5Standard non polar33892256
Ganoderic acid H,4TMS,isomer #10CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C)C12C3665.9Semi standard non polar33892256
Ganoderic acid H,4TMS,isomer #10CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C)C12C3775.3Standard non polar33892256
Ganoderic acid H,4TMS,isomer #11CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3661.3Semi standard non polar33892256
Ganoderic acid H,4TMS,isomer #11CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C4035.9Standard non polar33892256
Ganoderic acid H,4TMS,isomer #12CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3681.5Semi standard non polar33892256
Ganoderic acid H,4TMS,isomer #12CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C4036.4Standard non polar33892256
Ganoderic acid H,4TMS,isomer #13CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3622.8Semi standard non polar33892256
Ganoderic acid H,4TMS,isomer #13CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3865.6Standard non polar33892256
Ganoderic acid H,4TMS,isomer #14CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)C=C(CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3651.9Semi standard non polar33892256
Ganoderic acid H,4TMS,isomer #14CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)C=C(CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3883.2Standard non polar33892256
Ganoderic acid H,4TMS,isomer #15CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3670.9Semi standard non polar33892256
Ganoderic acid H,4TMS,isomer #15CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3744.9Standard non polar33892256
Ganoderic acid H,4TMS,isomer #16CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)C=C(CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3703.7Semi standard non polar33892256
Ganoderic acid H,4TMS,isomer #16CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)C=C(CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3766.9Standard non polar33892256
Ganoderic acid H,4TMS,isomer #17CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O)C12C3646.4Semi standard non polar33892256
Ganoderic acid H,4TMS,isomer #17CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O)C12C3727.3Standard non polar33892256
Ganoderic acid H,4TMS,isomer #18CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C)C12C3663.9Semi standard non polar33892256
Ganoderic acid H,4TMS,isomer #18CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C)C12C3999.5Standard non polar33892256
Ganoderic acid H,4TMS,isomer #19CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C)C12C3674.9Semi standard non polar33892256
Ganoderic acid H,4TMS,isomer #19CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C)C12C3958.3Standard non polar33892256
Ganoderic acid H,4TMS,isomer #2CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C)C12C3651.6Semi standard non polar33892256
Ganoderic acid H,4TMS,isomer #2CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C)C12C3802.1Standard non polar33892256
Ganoderic acid H,4TMS,isomer #20CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C)C12C3619.8Semi standard non polar33892256
Ganoderic acid H,4TMS,isomer #20CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C)C12C3810.7Standard non polar33892256
Ganoderic acid H,4TMS,isomer #21CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C)C12C3629.4Semi standard non polar33892256
Ganoderic acid H,4TMS,isomer #21CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C)C12C3804.9Standard non polar33892256
Ganoderic acid H,4TMS,isomer #22CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C)C12C3681.1Semi standard non polar33892256
Ganoderic acid H,4TMS,isomer #22CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C)C12C3698.1Standard non polar33892256
Ganoderic acid H,4TMS,isomer #23CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C)C12C3697.0Semi standard non polar33892256
Ganoderic acid H,4TMS,isomer #23CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C)C12C3700.4Standard non polar33892256
Ganoderic acid H,4TMS,isomer #24CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C)C12C3665.9Semi standard non polar33892256
Ganoderic acid H,4TMS,isomer #24CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C)C12C3771.3Standard non polar33892256
Ganoderic acid H,4TMS,isomer #25CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C)C12C3668.9Semi standard non polar33892256
Ganoderic acid H,4TMS,isomer #25CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C)C12C3773.9Standard non polar33892256
Ganoderic acid H,4TMS,isomer #3CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3678.8Semi standard non polar33892256
Ganoderic acid H,4TMS,isomer #3CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C4070.4Standard non polar33892256
Ganoderic acid H,4TMS,isomer #4CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3712.0Semi standard non polar33892256
Ganoderic acid H,4TMS,isomer #4CC(=O)OC1=C(O[Si](C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C4074.5Standard non polar33892256
Ganoderic acid H,4TMS,isomer #5CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C)C12C3685.5Semi standard non polar33892256
Ganoderic acid H,4TMS,isomer #5CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C)C12C3705.4Standard non polar33892256
Ganoderic acid H,4TMS,isomer #6CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3697.2Semi standard non polar33892256
Ganoderic acid H,4TMS,isomer #6CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3964.0Standard non polar33892256
Ganoderic acid H,4TMS,isomer #7CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3716.8Semi standard non polar33892256
Ganoderic acid H,4TMS,isomer #7CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3962.3Standard non polar33892256
Ganoderic acid H,4TMS,isomer #8CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3657.7Semi standard non polar33892256
Ganoderic acid H,4TMS,isomer #8CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)CC(=CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3780.0Standard non polar33892256
Ganoderic acid H,4TMS,isomer #9CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)C=C(CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3693.6Semi standard non polar33892256
Ganoderic acid H,4TMS,isomer #9CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C)=CC(C(C)C=C(CC(C)C(=O)O[Si](C)(C)C)O[Si](C)(C)C)C12C3796.1Standard non polar33892256
Ganoderic acid H,1TBDMS,isomer #1CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C(C)(C)C)C12C4345.0Semi standard non polar33892256
Ganoderic acid H,1TBDMS,isomer #2CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C(C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O)C12C4267.6Semi standard non polar33892256
Ganoderic acid H,1TBDMS,isomer #3CC(=O)OC1=C(O[Si](C)(C)C(C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O)C12C4146.6Semi standard non polar33892256
Ganoderic acid H,1TBDMS,isomer #4CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C(C)(C)C)C12C4298.8Semi standard non polar33892256
Ganoderic acid H,1TBDMS,isomer #5CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C(C)(C)C)C12C4335.4Semi standard non polar33892256
Ganoderic acid H,1TBDMS,isomer #6CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C(C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O)C12C4190.4Semi standard non polar33892256
Ganoderic acid H,1TBDMS,isomer #7CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C(C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O)C12C4176.7Semi standard non polar33892256
Ganoderic acid H,2TBDMS,isomer #1CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C(C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C(C)(C)C)C12C4456.9Semi standard non polar33892256
Ganoderic acid H,2TBDMS,isomer #10CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C(C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C(C)(C)C)C12C4400.5Semi standard non polar33892256
Ganoderic acid H,2TBDMS,isomer #11CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C(C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C(C)(C)C)C12C4426.9Semi standard non polar33892256
Ganoderic acid H,2TBDMS,isomer #12CC(=O)OC1=C(O[Si](C)(C)C(C)(C)C)C2=C(C(O[Si](C)(C)C(C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O)C12C4209.2Semi standard non polar33892256
Ganoderic acid H,2TBDMS,isomer #13CC(=O)OC1=C(O[Si](C)(C)C(C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C(C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O)C12C4189.4Semi standard non polar33892256
Ganoderic acid H,2TBDMS,isomer #14CC(=O)OC1=C(O[Si](C)(C)C(C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C(C)(C)C)C12C4272.7Semi standard non polar33892256
Ganoderic acid H,2TBDMS,isomer #15CC(=O)OC1=C(O[Si](C)(C)C(C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C(C)(C)C)C12C4282.0Semi standard non polar33892256
Ganoderic acid H,2TBDMS,isomer #16CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C(C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C(C)(C)C)C12C4296.3Semi standard non polar33892256
Ganoderic acid H,2TBDMS,isomer #17CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C(C)(C)C)=CC(C(C)CC(=CC(C)C(=O)O)O[Si](C)(C)C(C)(C)C)C12C4293.3Semi standard non polar33892256
Ganoderic acid H,2TBDMS,isomer #18CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C(C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C(C)(C)C)C12C4318.1Semi standard non polar33892256
Ganoderic acid H,2TBDMS,isomer #19CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C(C)(C)C)=CC(C(C)C=C(CC(C)C(=O)O)O[Si](C)(C)C(C)(C)C)C12C4319.1Semi standard non polar33892256
Ganoderic acid H,2TBDMS,isomer #2CC(=O)OC1=C(O[Si](C)(C)C(C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C(C)(C)C)C12C4334.0Semi standard non polar33892256
Ganoderic acid H,2TBDMS,isomer #20CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C(C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C(C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O)C12C4243.7Semi standard non polar33892256
Ganoderic acid H,2TBDMS,isomer #3CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C(C)(C)C)=CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C(C)(C)C)C12C4335.3Semi standard non polar33892256
Ganoderic acid H,2TBDMS,isomer #4CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(O[Si](C)(C)C(C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O[Si](C)(C)C(C)(C)C)C12C4359.6Semi standard non polar33892256
Ganoderic acid H,2TBDMS,isomer #5CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)CC(=CC(C)C(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C12C4416.2Semi standard non polar33892256
Ganoderic acid H,2TBDMS,isomer #6CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O)C3(C)C)C2(C)C(=O)CC(C(C)C=C(CC(C)C(=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C12C4448.0Semi standard non polar33892256
Ganoderic acid H,2TBDMS,isomer #7CC(=O)OC1=C(O[Si](C)(C)C(C)(C)C)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C(C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O)C12C4263.9Semi standard non polar33892256
Ganoderic acid H,2TBDMS,isomer #8CC(=O)OC1C(=O)C2=C(C(O[Si](C)(C)C(C)(C)C)=CC3C2(C)CCC(O[Si](C)(C)C(C)(C)C)C3(C)C)C2(C)C(=O)CC(C(C)CC(=O)CC(C)C(=O)O)C12C4300.0Semi standard non polar33892256
Ganoderic acid H,2TBDMS,isomer #9CC(=O)OC1C(=O)C2=C(C(=O)CC3C2(C)CCC(O[Si](C)(C)C(C)(C)C)C3(C)C)C2(C)C(O[Si](C)(C)C(C)(C)C)=CC(C(C)CC(=O)CC(C)C(=O)O)C12C4301.7Semi standard non polar33892256
Spectra

GC-MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted GC-MSPredicted GC-MS Spectrum - Ganoderic acid H GC-MS (Non-derivatized) - 70eV, Positivesplash10-0006-7110690000-a76f8444dc5a9b2f05512017-09-01Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ganoderic acid H GC-MS (1 TMS) - 70eV, Positivesplash10-00bl-6120439000-1f043b0987c6260a26b32017-10-06Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ganoderic acid H GC-MS ("Ganoderic acid H,1TMS,#1" TMS) - 70eV, PositiveNot Available2021-10-14Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ganoderic acid H GC-MS (TMS_1_2) - 70eV, PositiveNot Available2021-10-15Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ganoderic acid H GC-MS (TMS_1_3) - 70eV, PositiveNot Available2021-10-15Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ganoderic acid H GC-MS (TMS_1_4) - 70eV, PositiveNot Available2021-10-15Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ganoderic acid H GC-MS (TMS_1_5) - 70eV, PositiveNot Available2021-10-15Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ganoderic acid H GC-MS (TMS_1_6) - 70eV, PositiveNot Available2021-10-15Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ganoderic acid H GC-MS (TMS_1_7) - 70eV, PositiveNot Available2021-10-15Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ganoderic acid H GC-MS (TMS_2_1) - 70eV, PositiveNot Available2021-10-15Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ganoderic acid H GC-MS (TMS_2_2) - 70eV, PositiveNot Available2021-10-15Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ganoderic acid H GC-MS (TMS_2_3) - 70eV, PositiveNot Available2021-10-15Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ganoderic acid H GC-MS (TMS_2_4) - 70eV, PositiveNot Available2021-10-15Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ganoderic acid H GC-MS (TMS_2_5) - 70eV, PositiveNot Available2021-10-15Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ganoderic acid H GC-MS (TMS_2_6) - 70eV, PositiveNot Available2021-10-15Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ganoderic acid H GC-MS (TMS_2_7) - 70eV, PositiveNot Available2021-10-15Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ganoderic acid H GC-MS (TMS_2_8) - 70eV, PositiveNot Available2021-10-15Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ganoderic acid H GC-MS (TMS_2_9) - 70eV, PositiveNot Available2021-10-15Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ganoderic acid H GC-MS (TMS_2_10) - 70eV, PositiveNot Available2021-10-15Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ganoderic acid H GC-MS (TMS_2_11) - 70eV, PositiveNot Available2021-10-15Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ganoderic acid H GC-MS (TMS_2_12) - 70eV, PositiveNot Available2021-10-15Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ganoderic acid H GC-MS (TMS_2_13) - 70eV, PositiveNot Available2021-10-15Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ganoderic acid H GC-MS (TMS_2_14) - 70eV, PositiveNot Available2021-10-15Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ganoderic acid H GC-MS (TMS_2_15) - 70eV, PositiveNot Available2021-10-15Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Ganoderic acid H GC-MS (TMS_2_16) - 70eV, PositiveNot Available2021-10-15Wishart LabView Spectrum

MS/MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ganoderic acid H 10V, Positive-QTOFsplash10-0a4r-0000190000-00294e2cd290c25542972016-08-02Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ganoderic acid H 20V, Positive-QTOFsplash10-052r-1000690000-4eb47bf615b959fd14c22016-08-02Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ganoderic acid H 40V, Positive-QTOFsplash10-00n3-9400660000-654b8cfb0d13445b6e6c2016-08-02Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ganoderic acid H 10V, Negative-QTOFsplash10-00fr-2000090000-6147b801d5d9145d50ab2016-08-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ganoderic acid H 20V, Negative-QTOFsplash10-05i0-7100290000-6c77faa5059cff938feb2016-08-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ganoderic acid H 40V, Negative-QTOFsplash10-0a4i-9000320000-3f325742b52244397c222016-08-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ganoderic acid H 10V, Negative-QTOFsplash10-00di-1000290000-bf125843f47cb87bab882021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ganoderic acid H 20V, Negative-QTOFsplash10-0a4i-9000000000-c8afd5b695c48f1273c72021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ganoderic acid H 40V, Negative-QTOFsplash10-0a4l-9000730000-41f6990c39e8537d9b2f2021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ganoderic acid H 10V, Positive-QTOFsplash10-009m-0004980000-17148a5cb2f7de8b8e2f2021-09-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ganoderic acid H 20V, Positive-QTOFsplash10-00ai-3305980000-da317a162054e7901fa52021-09-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Ganoderic acid H 40V, Positive-QTOFsplash10-001u-9405400000-20769318e255f6c85a572021-09-25Wishart LabView Spectrum
Biological Properties
Cellular Locations
  • Extracellular
Biospecimen LocationsNot Available
Tissue LocationsNot Available
Pathways
Normal Concentrations
Not Available
Abnormal Concentrations
Not Available
Associated Disorders and Diseases
Disease ReferencesNone
Associated OMIM IDsNone
DrugBank IDNot Available
Phenol Explorer Compound IDNot Available
FooDB IDFDB014793
KNApSAcK IDC00023827
Chemspider IDNot Available
KEGG Compound IDNot Available
BioCyc IDNot Available
BiGG IDNot Available
Wikipedia LinkNot Available
METLIN IDNot Available
PubChem Compound73657194
PDB IDNot Available
ChEBI IDNot Available
Food Biomarker OntologyNot Available
VMH IDNot Available
MarkerDB IDNot Available
Good Scents IDNot Available
References
Synthesis ReferenceNot Available
Material Safety Data Sheet (MSDS)Not Available
General References
  1. Simons K, Toomre D: Lipid rafts and signal transduction. Nat Rev Mol Cell Biol. 2000 Oct;1(1):31-9. [PubMed:11413487 ]
  2. Watson AD: Thematic review series: systems biology approaches to metabolic and cardiovascular disorders. Lipidomics: a global approach to lipid analysis in biological systems. J Lipid Res. 2006 Oct;47(10):2101-11. Epub 2006 Aug 10. [PubMed:16902246 ]
  3. Sethi JK, Vidal-Puig AJ: Thematic review series: adipocyte biology. Adipose tissue function and plasticity orchestrate nutritional adaptation. J Lipid Res. 2007 Jun;48(6):1253-62. Epub 2007 Mar 20. [PubMed:17374880 ]
  4. Lingwood D, Simons K: Lipid rafts as a membrane-organizing principle. Science. 2010 Jan 1;327(5961):46-50. doi: 10.1126/science.1174621. [PubMed:20044567 ]
  5. (). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .
  6. Gunstone, Frank D., John L. Harwood, and Albert J. Dijkstra (2007). The lipid handbook with CD-ROM. CRC Press.