Hmdb loader
You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Human Metabolome Database.
Record Information
Version5.0
StatusExpected but not Quantified
Creation Date2012-09-11 23:16:27 UTC
Update Date2022-03-07 02:55:35 UTC
HMDB IDHMDB0037998
Secondary Accession Numbers
  • HMDB37998
Metabolite Identification
Common NameDelphinidin 3-arabinoside
DescriptionDelphinidin 3-arabinoside belongs to the class of organic compounds known as anthocyanidin-3-o-glycosides. These are phenolic compounds containing one anthocyanidin moiety which is O-glycosidically linked to a carbohydrate moiety at the C3-position. Delphinidin 3-arabinoside is an extremely weak basic (essentially neutral) compound (based on its pKa). Outside of the human body, delphinidin 3-arabinoside is found, on average, in the highest concentration in a few different foods, such as bilberries, highbush blueberries, and lowbush blueberries and in a lower concentration in . delphinidin 3-arabinoside has also been detected, but not quantified in, several different foods, such as strawberries, black chokeberries, sweet cherries, red raspberries, and common grapes. This could make delphinidin 3-arabinoside a potential biomarker for the consumption of these foods.
Structure
Data?1563863123
SynonymsNot Available
Chemical FormulaC20H19O11
Average Molecular Weight435.3583
Monoisotopic Molecular Weight435.09273645
IUPAC Name3-{[(2S,3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy}-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-1λ⁴-chromen-1-ylium
Traditional Name3-{[(2S,3S,4S,5S)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy}-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-1λ⁴-chromen-1-ylium
CAS Registry Number28500-01-8
SMILES
OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O)[C@@H]1O
InChI Identifier
InChI=1S/C20H18O11/c21-6-15-17(27)18(28)20(31-15)30-14-5-9-10(23)3-8(22)4-13(9)29-19(14)7-1-11(24)16(26)12(25)2-7/h1-5,15,17-18,20-21,27-28H,6H2,(H4-,22,23,24,25,26)/p+1/t15-,17+,18-,20+/m0/s1
InChI KeyWIEYMFHXYNRELM-ZNWBIBPKSA-O
Chemical Taxonomy
Description Belongs to the class of organic compounds known as anthocyanidin-3-o-glycosides. These are phenolic compounds containing one anthocyanidin moiety which is O-glycosidically linked to a carbohydrate moiety at the C3-position.
KingdomOrganic compounds
Super ClassPhenylpropanoids and polyketides
ClassFlavonoids
Sub ClassFlavonoid glycosides
Direct ParentAnthocyanidin-3-O-glycosides
Alternative ParentsNot Available
SubstituentsNot Available
Molecular FrameworkAromatic heteropolycyclic compounds
External DescriptorsNot Available
Ontology
Physiological effectNot Available
Disposition
Biological locationRoute of exposureSource
ProcessNot Available
Role
Physical Properties
StateNot Available
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water SolubilityNot AvailableNot Available
LogPNot AvailableNot Available
Experimental Chromatographic PropertiesNot Available
Predicted Molecular Properties
PropertyValueSource
Water Solubility0.47 g/LALOGPS
logP1.35ALOGPS
logP0.78ChemAxon
logS-3ALOGPS
pKa (Strongest Acidic)6.37ChemAxon
pKa (Strongest Basic)-3ChemAxon
Physiological Charge0ChemAxon
Hydrogen Acceptor Count10ChemAxon
Hydrogen Donor Count8ChemAxon
Polar Surface Area193.44 ŲChemAxon
Rotatable Bond Count4ChemAxon
Refractivity112.28 m³·mol⁻¹ChemAxon
Polarizability41.39 ųChemAxon
Number of Rings4ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterYesChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleNoChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DarkChem[M+H]+199.25631661259
DarkChem[M-H]-194.95131661259
DeepCCS[M+H]+191.47630932474
DeepCCS[M-H]-189.0830932474
DeepCCS[M-2H]-222.26630932474
DeepCCS[M+Na]+197.38830932474
AllCCS[M+H]+199.332859911
AllCCS[M+H-H2O]+196.732859911
AllCCS[M+NH4]+201.632859911
AllCCS[M+Na]+202.332859911
AllCCS[M-H]-197.532859911
AllCCS[M+Na-2H]-197.632859911
AllCCS[M+HCOO]-197.932859911

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
Delphinidin 3-arabinosideOC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O)[C@@H]1O6639.1Standard polar33892256
Delphinidin 3-arabinosideOC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O)[C@@H]1O4335.8Standard non polar33892256
Delphinidin 3-arabinosideOC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O)[C@@H]1O4317.7Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
Delphinidin 3-arabinoside,1TMS,isomer #1C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O)[C@@H]1O4194.2Semi standard non polar33892256
Delphinidin 3-arabinoside,1TMS,isomer #2C[Si](C)(C)OC1=CC(O)=CC2=[O+]C(C3=CC(O)=C(O)C(O)=C3)=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O)C=C124184.3Semi standard non polar33892256
Delphinidin 3-arabinoside,1TMS,isomer #3C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O)C(C3=CC(O)=C(O)C(O)=C3)=[O+]C2=C14235.9Semi standard non polar33892256
Delphinidin 3-arabinoside,1TMS,isomer #4C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O)=CC(O)=C1O4161.7Semi standard non polar33892256
Delphinidin 3-arabinoside,1TMS,isomer #5C[Si](C)(C)OC1=C(O)C=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O)C=C1O4103.8Semi standard non polar33892256
Delphinidin 3-arabinoside,1TMS,isomer #6C[Si](C)(C)O[C@@H]1[C@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)O[C@@H](CO)[C@H]1O4254.0Semi standard non polar33892256
Delphinidin 3-arabinoside,1TMS,isomer #7C[Si](C)(C)O[C@@H]1[C@H](CO)O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@H]1O4254.4Semi standard non polar33892256
Delphinidin 3-arabinoside,2TMS,isomer #1C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O)[C@@H]1O4089.5Semi standard non polar33892256
Delphinidin 3-arabinoside,2TMS,isomer #10C[Si](C)(C)OC1=CC(O)=CC2=[O+]C(C3=CC(O)=C(O)C(O)=C3)=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)C=C124103.7Semi standard non polar33892256
Delphinidin 3-arabinoside,2TMS,isomer #11C[Si](C)(C)OC1=CC(O)=CC2=[O+]C(C3=CC(O)=C(O)C(O)=C3)=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)C=C124115.3Semi standard non polar33892256
Delphinidin 3-arabinoside,2TMS,isomer #12C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)C(C3=CC(O)=C(O)C(O)=C3)=[O+]C2=C14106.1Semi standard non polar33892256
Delphinidin 3-arabinoside,2TMS,isomer #13C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)C(C3=CC(O)=C(O)C(O)=C3)=[O+]C2=C14122.6Semi standard non polar33892256
Delphinidin 3-arabinoside,2TMS,isomer #14C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O)C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C14026.8Semi standard non polar33892256
Delphinidin 3-arabinoside,2TMS,isomer #15C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O)C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)=[O+]C2=C13993.8Semi standard non polar33892256
Delphinidin 3-arabinoside,2TMS,isomer #16C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O)=CC(O)=C1O4087.6Semi standard non polar33892256
Delphinidin 3-arabinoside,2TMS,isomer #17C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)=CC(O)=C1O4098.6Semi standard non polar33892256
Delphinidin 3-arabinoside,2TMS,isomer #18C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O)=CC(O[Si](C)(C)C)=C1O4054.9Semi standard non polar33892256
Delphinidin 3-arabinoside,2TMS,isomer #19C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O)=CC(O)=C1O[Si](C)(C)C3999.8Semi standard non polar33892256
Delphinidin 3-arabinoside,2TMS,isomer #2C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O)[C@@H]1O4089.2Semi standard non polar33892256
Delphinidin 3-arabinoside,2TMS,isomer #20C[Si](C)(C)OC1=C(O)C=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O)C=C1O4029.3Semi standard non polar33892256
Delphinidin 3-arabinoside,2TMS,isomer #21C[Si](C)(C)OC1=C(O)C=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)C=C1O4053.6Semi standard non polar33892256
Delphinidin 3-arabinoside,2TMS,isomer #22C[Si](C)(C)O[C@@H]1[C@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)O[C@@H](CO)[C@H]1O[Si](C)(C)C4193.5Semi standard non polar33892256
Delphinidin 3-arabinoside,2TMS,isomer #3C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O4070.0Semi standard non polar33892256
Delphinidin 3-arabinoside,2TMS,isomer #4C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)[C@@H](O)[C@@H]1O4034.5Semi standard non polar33892256
Delphinidin 3-arabinoside,2TMS,isomer #5C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O4168.9Semi standard non polar33892256
Delphinidin 3-arabinoside,2TMS,isomer #6C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C4173.8Semi standard non polar33892256
Delphinidin 3-arabinoside,2TMS,isomer #7C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O)C(C3=CC(O)=C(O)C(O)=C3)=[O+]C2=C14035.2Semi standard non polar33892256
Delphinidin 3-arabinoside,2TMS,isomer #8C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O)=CC(O)=C1O4046.1Semi standard non polar33892256
Delphinidin 3-arabinoside,2TMS,isomer #9C[Si](C)(C)OC1=C(O)C=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O)C=C1O4005.5Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #1C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O)[C@@H]1O3940.7Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #10C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O3961.5Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #11C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O3921.4Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #12C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O4006.3Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #13C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C4014.5Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #14C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O3958.7Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #15C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C3959.5Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #16C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C4074.0Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #17C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)C(C3=CC(O)=C(O)C(O)=C3)=[O+]C2=C13947.8Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #18C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)C(C3=CC(O)=C(O)C(O)=C3)=[O+]C2=C13953.7Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #19C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O)C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13853.3Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #2C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O3936.9Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #20C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O)C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)=[O+]C2=C13885.2Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #21C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O)=CC(O)=C1O3927.9Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #22C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)=CC(O)=C1O3938.3Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #23C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O)=CC(O[Si](C)(C)C)=C1O3894.8Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #24C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O)=CC(O)=C1O[Si](C)(C)C3861.3Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #25C[Si](C)(C)OC1=C(O)C=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O)C=C1O3865.1Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #26C[Si](C)(C)OC1=C(O)C=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)C=C1O3888.4Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #27C[Si](C)(C)OC1=CC(O)=CC2=[O+]C(C3=CC(O)=C(O)C(O)=C3)=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C=C124027.7Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #28C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C(C3=CC(O)=C(O)C(O)=C3)=[O+]C2=C14033.3Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #29C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13910.4Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #3C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)[C@@H](O)[C@@H]1O3878.4Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #30C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)=[O+]C2=C13850.3Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #31C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13920.4Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #32C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)=[O+]C2=C13871.8Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #33C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O)C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13878.0Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #34C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O)C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13849.2Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #35C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)=CC(O)=C1O4019.4Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #36C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O)=CC(O[Si](C)(C)C)=C1O3960.7Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #37C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O)=CC(O)=C1O[Si](C)(C)C3914.4Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #38C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O3968.7Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #39C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)=CC(O)=C1O[Si](C)(C)C3924.0Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #4C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O4024.3Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #40C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C3935.4Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #41C[Si](C)(C)OC1=C(O)C=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)C=C1O3956.0Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #5C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C4028.1Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #6C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O3911.8Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #7C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)[C@@H](O)[C@@H]1O3860.4Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #8C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O4014.6Semi standard non polar33892256
Delphinidin 3-arabinoside,3TMS,isomer #9C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C4021.6Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #1C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O3793.0Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #10C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C3792.4Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #11C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3958.7Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #12C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O3809.5Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #13C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O3807.7Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #14C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O3850.2Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #15C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C3850.6Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #16C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O3804.0Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #17C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C3799.9Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #18C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3968.0Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #19C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O3888.2Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #2C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)[C@@H](O)[C@@H]1O3825.7Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #20C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O3892.7Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #21C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C3892.7Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #22C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O3871.6Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #23C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C3870.2Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #24C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3946.3Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #25C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3885.3Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #26C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C(C3=CC(O)=C(O)C(O)=C3)=[O+]C2=C13915.6Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #27C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13798.7Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #28C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)=[O+]C2=C13845.6Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #29C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13793.8Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #3C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O3907.7Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #30C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)=[O+]C2=C13844.9Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #31C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O)C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13834.5Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #32C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O)C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13829.2Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #33C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)=CC(O)=C1O3865.3Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #34C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O)=CC(O[Si](C)(C)C)=C1O3806.1Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #35C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O)=CC(O)=C1O[Si](C)(C)C3794.2Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #36C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O3809.5Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #37C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)=CC(O)=C1O[Si](C)(C)C3795.4Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #38C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C3817.9Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #39C[Si](C)(C)OC1=C(O)C=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)C=C1O3805.7Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #4C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C3909.6Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #40C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13864.0Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #41C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)=[O+]C2=C13813.9Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #42C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13813.4Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #43C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13802.5Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #44C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13810.9Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #45C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13804.0Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #46C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O)C(C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13830.9Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #47C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O3908.5Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #48C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)=CC(O)=C1O[Si](C)(C)C3884.8Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #49C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C3883.7Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #5C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O3807.7Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #50C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C3888.9Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #6C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O3800.1Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #7C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O3853.1Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #8C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C3851.1Semi standard non polar33892256
Delphinidin 3-arabinoside,4TMS,isomer #9C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O3800.0Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #1C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O3817.3Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #10C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C3775.1Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #11C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O3767.0Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #12C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C3769.1Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #13C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3800.2Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #14C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3756.7Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #15C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O3831.3Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #16C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O3787.8Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #17C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C3791.8Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #18C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O3783.2Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #19C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C3787.1Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #2C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O3806.6Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #20C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3810.1Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #21C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3771.4Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #22C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O3859.5Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #23C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C3858.8Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #24C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3838.0Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #25C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3826.6Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #26C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C(C3=CC(O)=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13786.6Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #27C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C(C3=CC(O)=C(O[Si](C)(C)C)C(O)=C3)=[O+]C2=C13833.5Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #28C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13831.9Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #29C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13820.2Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #3C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O3774.9Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #30C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13828.3Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #31C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13816.6Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #32C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O)C(C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13822.6Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #33C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O3799.3Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #34C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)=CC(O)=C1O[Si](C)(C)C3787.4Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #35C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C3811.1Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #36C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C3814.6Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #37C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13811.0Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #38C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13801.8Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #39C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)C(C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13828.9Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #4C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C3780.1Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #40C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)C(C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13831.5Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #41C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C3876.0Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #5C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O3808.3Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #6C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C3816.3Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #7C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3853.2Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #8C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O3815.7Semi standard non polar33892256
Delphinidin 3-arabinoside,5TMS,isomer #9C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O3772.4Semi standard non polar33892256
Delphinidin 3-arabinoside,6TMS,isomer #1C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O3819.5Semi standard non polar33892256
Delphinidin 3-arabinoside,6TMS,isomer #10C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3769.6Semi standard non polar33892256
Delphinidin 3-arabinoside,6TMS,isomer #11C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3760.2Semi standard non polar33892256
Delphinidin 3-arabinoside,6TMS,isomer #12C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O3823.2Semi standard non polar33892256
Delphinidin 3-arabinoside,6TMS,isomer #13C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C3816.3Semi standard non polar33892256
Delphinidin 3-arabinoside,6TMS,isomer #14C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3783.3Semi standard non polar33892256
Delphinidin 3-arabinoside,6TMS,isomer #15C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3779.5Semi standard non polar33892256
Delphinidin 3-arabinoside,6TMS,isomer #16C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3838.6Semi standard non polar33892256
Delphinidin 3-arabinoside,6TMS,isomer #17C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C(C3=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C3)=[O+]C2=C13834.3Semi standard non polar33892256
Delphinidin 3-arabinoside,6TMS,isomer #18C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C(C3=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13817.5Semi standard non polar33892256
Delphinidin 3-arabinoside,6TMS,isomer #19C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O)C(C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13822.0Semi standard non polar33892256
Delphinidin 3-arabinoside,6TMS,isomer #2C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O3809.1Semi standard non polar33892256
Delphinidin 3-arabinoside,6TMS,isomer #20C[Si](C)(C)OC1=CC(O[Si](C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C)C(C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13824.9Semi standard non polar33892256
Delphinidin 3-arabinoside,6TMS,isomer #21C[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)=CC(O[Si](C)(C)C)=C1O[Si](C)(C)C3815.2Semi standard non polar33892256
Delphinidin 3-arabinoside,6TMS,isomer #22C[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C)[C@@H]3O[Si](C)(C)C)C(C3=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)=[O+]C2=C13828.9Semi standard non polar33892256
Delphinidin 3-arabinoside,6TMS,isomer #3C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C3812.9Semi standard non polar33892256
Delphinidin 3-arabinoside,6TMS,isomer #4C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O3797.5Semi standard non polar33892256
Delphinidin 3-arabinoside,6TMS,isomer #5C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C3799.1Semi standard non polar33892256
Delphinidin 3-arabinoside,6TMS,isomer #6C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3764.7Semi standard non polar33892256
Delphinidin 3-arabinoside,6TMS,isomer #7C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O[Si](C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C)C(O)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3789.7Semi standard non polar33892256
Delphinidin 3-arabinoside,6TMS,isomer #8C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@@H](O[Si](C)(C)C)[C@@H]1O3802.6Semi standard non polar33892256
Delphinidin 3-arabinoside,6TMS,isomer #9C[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C3797.4Semi standard non polar33892256
Delphinidin 3-arabinoside,1TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O)[C@@H]1O4476.8Semi standard non polar33892256
Delphinidin 3-arabinoside,1TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=[O+]C(C3=CC(O)=C(O)C(O)=C3)=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O)C=C124478.9Semi standard non polar33892256
Delphinidin 3-arabinoside,1TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O)C(C3=CC(O)=C(O)C(O)=C3)=[O+]C2=C14492.1Semi standard non polar33892256
Delphinidin 3-arabinoside,1TBDMS,isomer #4CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O)=CC(O)=C1O4479.9Semi standard non polar33892256
Delphinidin 3-arabinoside,1TBDMS,isomer #5CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O)C=C1O4442.8Semi standard non polar33892256
Delphinidin 3-arabinoside,1TBDMS,isomer #6CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)O[C@@H](CO)[C@H]1O4530.8Semi standard non polar33892256
Delphinidin 3-arabinoside,1TBDMS,isomer #7CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](CO)O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@H]1O4533.2Semi standard non polar33892256
Delphinidin 3-arabinoside,2TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O)[C@@H]1O4591.6Semi standard non polar33892256
Delphinidin 3-arabinoside,2TBDMS,isomer #10CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=[O+]C(C3=CC(O)=C(O)C(O)=C3)=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)C=C124640.8Semi standard non polar33892256
Delphinidin 3-arabinoside,2TBDMS,isomer #11CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=[O+]C(C3=CC(O)=C(O)C(O)=C3)=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)C=C124644.6Semi standard non polar33892256
Delphinidin 3-arabinoside,2TBDMS,isomer #12CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)C(C3=CC(O)=C(O)C(O)=C3)=[O+]C2=C14651.1Semi standard non polar33892256
Delphinidin 3-arabinoside,2TBDMS,isomer #13CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)C(C3=CC(O)=C(O)C(O)=C3)=[O+]C2=C14653.9Semi standard non polar33892256
Delphinidin 3-arabinoside,2TBDMS,isomer #14CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O)C(C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)=[O+]C2=C14545.1Semi standard non polar33892256
Delphinidin 3-arabinoside,2TBDMS,isomer #15CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O)C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)=[O+]C2=C14538.5Semi standard non polar33892256
Delphinidin 3-arabinoside,2TBDMS,isomer #16CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)=CC(O)=C1O4632.1Semi standard non polar33892256
Delphinidin 3-arabinoside,2TBDMS,isomer #17CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O4643.2Semi standard non polar33892256
Delphinidin 3-arabinoside,2TBDMS,isomer #18CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O4570.1Semi standard non polar33892256
Delphinidin 3-arabinoside,2TBDMS,isomer #19CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O)=CC(O)=C1O[Si](C)(C)C(C)(C)C4531.9Semi standard non polar33892256
Delphinidin 3-arabinoside,2TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O)[C@@H]1O4600.4Semi standard non polar33892256
Delphinidin 3-arabinoside,2TBDMS,isomer #20CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)C=C1O4590.6Semi standard non polar33892256
Delphinidin 3-arabinoside,2TBDMS,isomer #21CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)C=C1O4606.1Semi standard non polar33892256
Delphinidin 3-arabinoside,2TBDMS,isomer #22CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)O[C@@H](CO)[C@H]1O[Si](C)(C)C(C)(C)C4713.2Semi standard non polar33892256
Delphinidin 3-arabinoside,2TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)[C@@H](O)[C@@H]1O4602.2Semi standard non polar33892256
Delphinidin 3-arabinoside,2TBDMS,isomer #4CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)[C@@H](O)[C@@H]1O4566.8Semi standard non polar33892256
Delphinidin 3-arabinoside,2TBDMS,isomer #5CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4670.0Semi standard non polar33892256
Delphinidin 3-arabinoside,2TBDMS,isomer #6CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4668.1Semi standard non polar33892256
Delphinidin 3-arabinoside,2TBDMS,isomer #7CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O)C(C3=CC(O)=C(O)C(O)=C3)=[O+]C2=C14551.6Semi standard non polar33892256
Delphinidin 3-arabinoside,2TBDMS,isomer #8CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O)=CC(O)=C1O4540.7Semi standard non polar33892256
Delphinidin 3-arabinoside,2TBDMS,isomer #9CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O)C=C1O4530.6Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C(C)(C)C)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O)[C@@H]1O4644.3Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #10CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)[C@@H](O)[C@@H]1O4663.9Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #11CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)[C@@H](O)[C@@H]1O4636.8Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #12CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4711.9Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #13CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4715.3Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #14CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4664.7Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #15CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4661.6Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #16CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4777.7Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #17CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)C(C3=CC(O)=C(O)C(O)=C3)=[O+]C2=C14683.3Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #18CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)C(C3=CC(O)=C(O)C(O)=C3)=[O+]C2=C14686.2Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #19CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O)C(C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)=[O+]C2=C14622.2Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)[C@@H](O)[C@@H]1O4630.9Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #20CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O)C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)=[O+]C2=C14680.8Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #21CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)=CC(O)=C1O4660.7Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #22CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O4668.4Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #23CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O4630.3Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #24CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O)=CC(O)=C1O[Si](C)(C)C(C)(C)C4611.3Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #25CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)C=C1O4656.0Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #26CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)C=C1O4667.5Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #27CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=[O+]C(C3=CC(O)=C(O)C(O)=C3)=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O[Si](C)(C)C(C)(C)C)C=C124755.1Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #28CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O[Si](C)(C)C(C)(C)C)C(C3=CC(O)=C(O)C(O)=C3)=[O+]C2=C14763.2Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #29CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)C(C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)=[O+]C2=C14669.2Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)[C@@H](O)[C@@H]1O4624.3Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #30CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)=[O+]C2=C14670.2Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #31CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)C(C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)=[O+]C2=C14673.1Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #32CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)=[O+]C2=C14678.7Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #33CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O)C(C3=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)=[O+]C2=C14642.0Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #34CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O)C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3)=[O+]C2=C14625.4Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #35CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O4750.6Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #36CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O4690.1Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #37CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)=CC(O)=C1O[Si](C)(C)C(C)(C)C4660.6Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #38CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C1O4693.0Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #39CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O[Si](C)(C)C(C)(C)C4668.2Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #4CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4716.8Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #40CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C4650.4Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #41CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)C=C1O4701.0Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #5CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4719.3Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #6CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)[C@@H](O)[C@@H]1O4636.0Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #7CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)[C@@H](O)[C@@H]1O4636.1Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #8CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4726.5Semi standard non polar33892256
Delphinidin 3-arabinoside,3TBDMS,isomer #9CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4730.4Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C(C)(C)C)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)[C@@H](O)[C@@H]1O4734.6Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #10CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4736.6Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #11CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4804.1Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #12CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)[C@@H](O)[C@@H]1O4755.5Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #13CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)[C@@H](O)[C@@H]1O4740.7Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #14CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4747.9Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #15CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4743.6Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #16CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4765.6Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #17CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4754.1Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #18CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4822.4Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #19CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)[C@@H](O)[C@@H]1O4747.5Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C(C)(C)C)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)[C@@H](O)[C@@H]1O4793.8Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #20CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4761.9Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #21CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4752.2Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #22CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4736.8Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #23CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4726.1Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #24CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4781.9Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #25CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4739.2Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #26CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O[Si](C)(C)C(C)(C)C)C(C3=CC(O)=C(O)C(O)=C3)=[O+]C2=C14770.3Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #27CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)C(C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)=[O+]C2=C14757.6Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #28CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)=[O+]C2=C14834.9Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #29CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)C(C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)=[O+]C2=C14752.8Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C(C)(C)C)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4762.4Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #30CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)=[O+]C2=C14833.3Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #31CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O)C(C3=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)=[O+]C2=C14796.3Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #32CC(C)(C)[Si](C)(C)OC1=CC(O[Si](C)(C)C(C)(C)C)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O)C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3)=[O+]C2=C14780.2Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #33CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O4751.0Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #34CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O4748.8Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #35CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)=CC(O)=C1O[Si](C)(C)C(C)(C)C4729.5Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #36CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C1O4754.7Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #37CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O[Si](C)(C)C(C)(C)C4735.6Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #38CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C4719.5Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #39CC(C)(C)[Si](C)(C)OC1=C(O)C=C(C2=[O+]C3=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)C=C1O4756.9Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #4CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C(C)(C)C)C=C(O[Si](C)(C)C(C)(C)C)C=C3[O+]=C2C2=CC(O)=C(O)C(O)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4757.6Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #40CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O[Si](C)(C)C(C)(C)C)C(C3=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)=[O+]C2=C14761.4Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #41CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O[Si](C)(C)C(C)(C)C)C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)=[O+]C2=C14774.4Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #42CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)C(C3=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)=[O+]C2=C14770.9Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #43CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]3O)C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3)=[O+]C2=C14752.7Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #44CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)C(C3=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)=[O+]C2=C14770.3Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #45CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O[Si](C)(C)C(C)(C)C)C(C3=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3)=[O+]C2=C14753.7Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #46CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C=C(O[C@@H]3O[C@@H](CO)[C@@H](O)[C@@H]3O)C(C3=CC(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3)=[O+]C2=C14746.3Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #47CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C1O4772.2Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #48CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)=CC(O)=C1O[Si](C)(C)C(C)(C)C4746.6Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #49CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C4750.6Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #5CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O[Si](C)(C)C(C)(C)C)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)[C@@H](O)[C@@H]1O4738.6Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #50CC(C)(C)[Si](C)(C)OC1=CC(C2=[O+]C3=CC(O)=CC(O)=C3C=C2O[C@@H]2O[C@@H](CO)[C@@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)=CC(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C4760.2Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #6CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)[C@@H](O)[C@@H]1O4721.7Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #7CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4733.2Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #8CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4725.9Semi standard non polar33892256
Delphinidin 3-arabinoside,4TBDMS,isomer #9CC(C)(C)[Si](C)(C)OC[C@@H]1O[C@@H](OC2=CC3=C(O[Si](C)(C)C(C)(C)C)C=C(O)C=C3[O+]=C2C2=CC(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4749.7Semi standard non polar33892256
Spectra

GC-MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted GC-MSPredicted GC-MS Spectrum - Delphinidin 3-arabinoside GC-MS (Non-derivatized) - 70eV, Positivesplash10-0ab9-9103200000-528bff0460288422ec1f2017-09-01Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Delphinidin 3-arabinoside GC-MS (3 TMS) - 70eV, Positivesplash10-002r-6910128000-05cc5d5c9a55b6deb6422017-10-06Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Delphinidin 3-arabinoside GC-MS (Non-derivatized) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Delphinidin 3-arabinoside GC-MS (Non-derivatized) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum

MS/MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Delphinidin 3-arabinoside 10V, Positive-QTOFsplash10-000i-0100900000-cfbce2d34297134d9e202016-08-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Delphinidin 3-arabinoside 20V, Positive-QTOFsplash10-00lr-1300900000-960e93c80bfdaf41cf532016-08-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Delphinidin 3-arabinoside 40V, Positive-QTOFsplash10-015a-9602000000-5a79501d8679d383ee172016-08-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Delphinidin 3-arabinoside 10V, Negative-QTOFsplash10-001i-1100900000-f45c828e6fb218872ad02016-08-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Delphinidin 3-arabinoside 20V, Negative-QTOFsplash10-001i-2700900000-5bac816d979b7210fb652016-08-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Delphinidin 3-arabinoside 40V, Negative-QTOFsplash10-0f7o-8910000000-c6cccf5a8fe21b55d4732016-08-03Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Delphinidin 3-arabinoside 10V, Positive-QTOFsplash10-0670-0008900000-13564c825935f5bf261d2021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Delphinidin 3-arabinoside 20V, Positive-QTOFsplash10-0a4r-0109700000-c31c644689c8c20e9b272021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Delphinidin 3-arabinoside 40V, Positive-QTOFsplash10-0a4i-3297000000-41967221fa5bb7b938f12021-09-22Wishart LabView Spectrum
Biological Properties
Cellular Locations
  • Cytoplasm
  • Extracellular
Biospecimen Locations
  • Urine
Tissue LocationsNot Available
Pathways
Normal Concentrations
BiospecimenStatusValueAgeSexConditionReferenceDetails
UrineExpected but not QuantifiedNot QuantifiedNot AvailableNot AvailableConsuming polyphenols described by Phenol-Explorer entry 29 details
UrineExpected but not QuantifiedNot QuantifiedNot AvailableNot AvailableConsuming polyphenols described by Phenol-Explorer entry 29 details
UrineExpected but not QuantifiedNot QuantifiedNot AvailableNot AvailableConsuming polyphenols described by Phenol-Explorer entry 29 details
Abnormal Concentrations
Not Available
Associated Disorders and Diseases
Disease ReferencesNone
Associated OMIM IDsNone
DrugBank IDNot Available
Phenol Explorer Compound IDNot Available
FooDB IDFDB017192
KNApSAcK IDC00006696
Chemspider IDNot Available
KEGG Compound IDNot Available
BioCyc IDNot Available
BiGG IDNot Available
Wikipedia LinkNot Available
METLIN IDNot Available
PubChem Compound131752268
PDB IDNot Available
ChEBI IDNot Available
Food Biomarker OntologyNot Available
VMH IDNot Available
MarkerDB IDNot Available
Good Scents IDNot Available
References
Synthesis ReferenceNot Available
Material Safety Data Sheet (MSDS)Not Available
General References
  1. (). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .