Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-12 01:17:22 UTC

Update Date

2022-03-07 02:56:20 UTC

HMDB ID

HMDB0039750

Secondary Accession Numbers

HMDB39750

Metabolite Identification

Common Name

Lacto-N-triose I

Description

Lacto-N-triose I belongs to the class of organic compounds known as oligosaccharides. These are carbohydrates made up of 3 to 10 monosaccharide units linked to each other through glycosidic bonds. Lacto-N-triose I has been detected, but not quantified in, milk and milk products. This could make lacto-N-triose I a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on Lacto-N-triose I.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv0541 02241210302D          

 37 39  0  0  0  0            999 V2000
   -3.5290    2.5029    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8721    2.0921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8721    1.2719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1337    0.7794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1337   -0.0409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8721   -0.4509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8721   -1.2719    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3491    1.1894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6106    0.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6106   -0.0409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3491   -0.4509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3945   -0.4509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7385    0.0416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7385    0.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2311    1.4361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0008   -1.2719    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0008   -0.4509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7385   -0.0409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6561    0.7794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0008    1.2719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0817    2.0921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5742    2.5847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4769   -0.3692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2155    0.0416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2155    0.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6411    1.4361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8721   -1.2719    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8721   -0.3692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6106   -0.0409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3491   -0.4509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6924    2.5029    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9539    2.0921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9539    1.2719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6924    0.7794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4918   -2.5847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6561   -1.7644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4769   -1.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  3  4  1  0  0  0  0
  3  9  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  1  0  0  0  0
  5 12  1  0  0  0  0
  6  7  1  0  0  0  0
  6 10  1  0  0  0  0
  8  9  1  0  0  0  0
  9 10  1  0  0  0  0
 10 11  1  0  0  0  0
 12 13  1  0  0  0  0
 13 14  1  0  0  0  0
 13 17  1  0  0  0  0
 14 15  1  0  0  0  0
 14 20  1  0  0  0  0
 16 17  1  0  0  0  0
 16 36  1  0  0  0  0
 17 18  1  0  0  0  0
 18 19  1  0  0  0  0
 18 23  1  0  0  0  0
 19 20  1  0  0  0  0
 20 21  1  0  0  0  0
 21 22  1  0  0  0  0
 23 24  1  0  0  0  0
 24 25  1  0  0  0  0
 24 28  1  0  0  0  0
 25 26  1  0  0  0  0
 25 33  1  0  0  0  0
 27 28  1  0  0  0  0
 28 29  1  0  0  0  0
 29 30  1  0  0  0  0
 29 34  1  0  0  0  0
 31 32  1  0  0  0  0
 32 33  1  0  0  0  0
 33 34  1  0  0  0  0
 35 36  2  0  0  0  0
 36 37  1  0  0  0  0
M  END

HMDB0039750
     RDKit          3D
Lacto-N-triose I
 72 74  0  0  0  0  0  0  0  0999 V2000
   -2.7560    2.6389   -3.6346 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0050    2.2404   -2.4267 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2988    2.8332   -1.3444 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0150    1.2472   -2.5000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2386    0.8065   -1.3523 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3566   -0.6809   -1.1254 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6608   -1.0863   -0.9078 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8643   -1.7624    0.2629 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5355   -3.1140    0.0521 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7460   -2.8958   -0.5915 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8015   -3.7412    1.3800 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0843   -4.3145    1.4535 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6061   -2.9180    2.4586 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1802   -1.6768    2.3612 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6811   -1.6839    2.5465 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0451   -2.1750    3.7890 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8212   -0.9392    1.1033 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3593    0.3407    1.3446 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0725   -1.2996   -2.2998 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4212   -1.1337   -2.5412 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7024   -1.7276   -3.9148 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9088   -1.0130   -4.8414 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8360    0.3154   -2.6002 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2093    0.3604   -2.6169 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2327    1.1456   -1.5024 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8275    0.9793   -0.2830 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3257    2.1328    0.2941 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5563    2.4100    1.4061 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0190    1.9210    2.5881 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8991    0.4160    2.6089 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5274    0.1149    2.4515 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3904    2.4091    2.9684 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3580    3.3410    3.9821 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1280    2.9418    1.7597 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4958    2.9167    2.0312 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7926    2.1285    0.5143 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4245    2.7679   -0.5509 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0383    1.7142   -4.1819 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1498    3.2493   -4.3375 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6747    3.1888   -3.3844 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8109    0.7942   -3.3988 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6014    1.4047   -0.4832 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3409   -0.9550   -0.3314 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9370   -1.8877    0.8771 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9303   -3.7654   -0.6096 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9858   -3.6266   -1.2189 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0944   -4.6096    1.4975 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1467   -4.9695    2.1740 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7728   -1.0627    3.2143 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1916   -2.2768    1.7530 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0416   -0.6484    2.4650 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8421   -1.6968    4.0960 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7556   -0.8395    0.4768 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1529    0.8716    1.6505 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.9972   -1.7012   -1.7874 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3163   -2.7665   -3.9011 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7660   -1.6578   -4.1543 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5369   -0.5368   -5.4589 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4811    0.7069   -3.5840 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6062    0.7679   -3.4031 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2377    2.2112   -1.8613 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0952    2.9617   -0.4387 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3229    2.2932    3.3900 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1705    0.0334    3.6312 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4726   -0.0801    1.8229 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3245   -0.7754    2.8277 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9568    1.5305    3.3406 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2034    3.8588    3.9684 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8418    4.0061    1.6489 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.9994    3.5972    1.5158 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2195    1.1202    0.7025 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1650    2.1778   -0.8402 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  1  0
 11 12  1  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 14 17  1  0
 17 18  1  0
  6 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 20 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 29 32  1  0
 32 33  1  0
 32 34  1  0
 34 35  1  0
 34 36  1  0
 36 37  1  0
 25  5  1  0
 36 27  1  0
 17  8  1  0
  1 38  1  0
  1 39  1  0
  1 40  1  0
  4 41  1  0
  5 42  1  0
  6 43  1  0
  8 44  1  0
  9 45  1  0
 10 46  1  0
 11 47  1  0
 12 48  1  0
 14 49  1  0
 15 50  1  0
 15 51  1  0
 16 52  1  0
 17 53  1  0
 18 54  1  0
 20 55  1  0
 21 56  1  0
 21 57  1  0
 22 58  1  0
 23 59  1  0
 24 60  1  0
 25 61  1  0
 27 62  1  0
 29 63  1  0
 30 64  1  0
 30 65  1  0
 31 66  1  0
 32 67  1  0
 33 68  1  0
 34 69  1  0
 35 70  1  0
 36 71  1  0
 37 72  1  0
M  END


  Mrv0541 02241210302D          

 37 39  0  0  0  0            999 V2000
   -3.5290    2.5029    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8721    2.0921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8721    1.2719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1337    0.7794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1337   -0.0409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8721   -0.4509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8721   -1.2719    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3491    1.1894    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6106    0.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6106   -0.0409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3491   -0.4509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3945   -0.4509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7385    0.0416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7385    0.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2311    1.4361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0008   -1.2719    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0008   -0.4509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7385   -0.0409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6561    0.7794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0008    1.2719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0817    2.0921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5742    2.5847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4769   -0.3692    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2155    0.0416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2155    0.8611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6411    1.4361    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8721   -1.2719    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8721   -0.3692    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6106   -0.0409    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3491   -0.4509    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6924    2.5029    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9539    2.0921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9539    1.2719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6924    0.7794    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.4918   -2.5847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6561   -1.7644    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4769   -1.6819    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  3  4  1  0  0  0  0
  3  9  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  1  0  0  0  0
  5 12  1  0  0  0  0
  6  7  1  0  0  0  0
  6 10  1  0  0  0  0
  8  9  1  0  0  0  0
  9 10  1  0  0  0  0
 10 11  1  0  0  0  0
 12 13  1  0  0  0  0
 13 14  1  0  0  0  0
 13 17  1  0  0  0  0
 14 15  1  0  0  0  0
 14 20  1  0  0  0  0
 16 17  1  0  0  0  0
 16 36  1  0  0  0  0
 17 18  1  0  0  0  0
 18 19  1  0  0  0  0
 18 23  1  0  0  0  0
 19 20  1  0  0  0  0
 20 21  1  0  0  0  0
 21 22  1  0  0  0  0
 23 24  1  0  0  0  0
 24 25  1  0  0  0  0
 24 28  1  0  0  0  0
 25 26  1  0  0  0  0
 25 33  1  0  0  0  0
 27 28  1  0  0  0  0
 28 29  1  0  0  0  0
 29 30  1  0  0  0  0
 29 34  1  0  0  0  0
 31 32  1  0  0  0  0
 32 33  1  0  0  0  0
 33 34  1  0  0  0  0
 35 36  2  0  0  0  0
 36 37  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0039750

> <DATABASE_NAME>
hmdb

> <SMILES>
CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O

> <INCHI_IDENTIFIER>
InChI=1S/C20H35NO16/c1-5(25)21-9-16(36-20-14(30)13(29)10(26)6(2-22)35-20)11(27)8(4-24)34-19(9)37-17-12(28)7(3-23)33-18(32)15(17)31/h6-20,22-24,26-32H,2-4H2,1H3,(H,21,25)

> <INCHI_KEY>
CJOPBLPCFAQCNO-UHFFFAOYSA-N

> <FORMULA>
C20H35NO16

> <MOLECULAR_WEIGHT>
545.489

> <EXACT_MASS>
545.195584077

> <JCHEM_ACCEPTOR_COUNT>
16

> <JCHEM_AVERAGE_POLARIZABILITY>
51.5773062179788

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
11

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
N-[5-hydroxy-6-(hydroxymethyl)-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-2-{[2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy}oxan-3-yl]acetamide

> <ALOGPS_LOGP>
-2.62

> <JCHEM_LOGP>
-6.762245703000001

> <ALOGPS_LOGS>
-0.26

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
3

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
11.902191454390216

> <JCHEM_PKA_STRONGEST_ACIDIC>
11.196174289502064

> <JCHEM_PKA_STRONGEST_BASIC>
-3.6409005825912857

> <JCHEM_POLAR_SURFACE_AREA>
277.54999999999995

> <JCHEM_REFRACTIVITY>
111.8513

> <JCHEM_ROTATABLE_BOND_COUNT>
8

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
3.03e+02 g/l

> <JCHEM_TRADITIONAL_IUPAC>
N-[5-hydroxy-6-(hydroxymethyl)-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-2-{[2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy}oxan-3-yl]acetamide

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0039750
     RDKit          3D
Lacto-N-triose I
 72 74  0  0  0  0  0  0  0  0999 V2000
   -2.7560    2.6389   -3.6346 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0050    2.2404   -2.4267 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2988    2.8332   -1.3444 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0150    1.2472   -2.5000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2386    0.8065   -1.3523 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3566   -0.6809   -1.1254 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6608   -1.0863   -0.9078 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8643   -1.7624    0.2629 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5355   -3.1140    0.0521 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7460   -2.8958   -0.5915 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8015   -3.7412    1.3800 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0843   -4.3145    1.4535 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6061   -2.9180    2.4586 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1802   -1.6768    2.3612 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6811   -1.6839    2.5465 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0451   -2.1750    3.7890 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8212   -0.9392    1.1033 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3593    0.3407    1.3446 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0725   -1.2996   -2.2998 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4212   -1.1337   -2.5412 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7024   -1.7276   -3.9148 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9088   -1.0130   -4.8414 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8360    0.3154   -2.6002 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2093    0.3604   -2.6169 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2327    1.1456   -1.5024 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8275    0.9793   -0.2830 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3257    2.1328    0.2941 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5563    2.4100    1.4061 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0190    1.9210    2.5881 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8991    0.4160    2.6089 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5274    0.1149    2.4515 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3904    2.4091    2.9684 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3580    3.3410    3.9821 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1280    2.9418    1.7597 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4958    2.9167    2.0312 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7926    2.1285    0.5143 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4245    2.7679   -0.5509 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0383    1.7142   -4.1819 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1498    3.2493   -4.3375 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6747    3.1888   -3.3844 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8109    0.7942   -3.3988 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6014    1.4047   -0.4832 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3409   -0.9550   -0.3314 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9370   -1.8877    0.8771 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9303   -3.7654   -0.6096 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9858   -3.6266   -1.2189 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0944   -4.6096    1.4975 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1467   -4.9695    2.1740 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7728   -1.0627    3.2143 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1916   -2.2768    1.7530 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0416   -0.6484    2.4650 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8421   -1.6968    4.0960 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7556   -0.8395    0.4768 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1529    0.8716    1.6505 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.9972   -1.7012   -1.7874 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3163   -2.7665   -3.9011 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7660   -1.6578   -4.1543 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5369   -0.5368   -5.4589 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4811    0.7069   -3.5840 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6062    0.7679   -3.4031 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2377    2.2112   -1.8613 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0952    2.9617   -0.4387 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3229    2.2932    3.3900 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1705    0.0334    3.6312 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4726   -0.0801    1.8229 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3245   -0.7754    2.8277 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9568    1.5305    3.3406 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2034    3.8588    3.9684 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8418    4.0061    1.6489 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.9994    3.5972    1.5158 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2195    1.1202    0.7025 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1650    2.1778   -0.8402 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  1  0
 11 12  1  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 14 17  1  0
 17 18  1  0
  6 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 20 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 29 32  1  0
 32 33  1  0
 32 34  1  0
 34 35  1  0
 34 36  1  0
 36 37  1  0
 25  5  1  0
 36 27  1  0
 17  8  1  0
  1 38  1  0
  1 39  1  0
  1 40  1  0
  4 41  1  0
  5 42  1  0
  6 43  1  0
  8 44  1  0
  9 45  1  0
 10 46  1  0
 11 47  1  0
 12 48  1  0
 14 49  1  0
 15 50  1  0
 15 51  1  0
 16 52  1  0
 17 53  1  0
 18 54  1  0
 20 55  1  0
 21 56  1  0
 21 57  1  0
 22 58  1  0
 23 59  1  0
 24 60  1  0
 25 61  1  0
 27 62  1  0
 29 63  1  0
 30 64  1  0
 30 65  1  0
 31 66  1  0
 32 67  1  0
 33 68  1  0
 34 69  1  0
 35 70  1  0
 36 71  1  0
 37 72  1  0
M  END

HEADER    PROTEIN                                 24-FEB-12   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   24-FEB-12         0                                  
HETATM    1  O   UNK     0      -6.587   4.672   0.000  0.00  0.00           O+0
HETATM    2  C   UNK     0      -5.361   3.905   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0      -5.361   2.374   0.000  0.00  0.00           C+0
HETATM    4  O   UNK     0      -3.983   1.455   0.000  0.00  0.00           O+0
HETATM    5  C   UNK     0      -3.983  -0.076   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0      -5.361  -0.842   0.000  0.00  0.00           C+0
HETATM    7  O   UNK     0      -5.361  -2.374   0.000  0.00  0.00           O+0
HETATM    8  O   UNK     0      -8.118   2.220   0.000  0.00  0.00           O+0
HETATM    9  C   UNK     0      -6.740   1.607   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0      -6.740  -0.076   0.000  0.00  0.00           C+0
HETATM   11  O   UNK     0      -8.118  -0.842   0.000  0.00  0.00           O+0
HETATM   12  O   UNK     0      -2.603  -0.842   0.000  0.00  0.00           O+0
HETATM   13  C   UNK     0      -1.378   0.078   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0      -1.378   1.607   0.000  0.00  0.00           C+0
HETATM   15  O   UNK     0      -2.298   2.681   0.000  0.00  0.00           O+0
HETATM   16  N   UNK     0      -0.001  -2.374   0.000  0.00  0.00           N+0
HETATM   17  C   UNK     0      -0.001  -0.842   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0       1.378  -0.076   0.000  0.00  0.00           C+0
HETATM   19  O   UNK     0       1.225   1.455   0.000  0.00  0.00           O+0
HETATM   20  C   UNK     0      -0.001   2.374   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0       0.153   3.905   0.000  0.00  0.00           C+0
HETATM   22  O   UNK     0      -1.072   4.825   0.000  0.00  0.00           O+0
HETATM   23  O   UNK     0       2.757  -0.689   0.000  0.00  0.00           O+0
HETATM   24  C   UNK     0       4.136   0.078   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0       4.136   1.607   0.000  0.00  0.00           C+0
HETATM   26  O   UNK     0       3.063   2.681   0.000  0.00  0.00           O+0
HETATM   27  O   UNK     0       5.361  -2.374   0.000  0.00  0.00           O+0
HETATM   28  C   UNK     0       5.361  -0.689   0.000  0.00  0.00           C+0
HETATM   29  C   UNK     0       6.740  -0.076   0.000  0.00  0.00           C+0
HETATM   30  O   UNK     0       8.118  -0.842   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0       6.892   4.672   0.000  0.00  0.00           O+0
HETATM   32  C   UNK     0       5.514   3.905   0.000  0.00  0.00           C+0
HETATM   33  C   UNK     0       5.514   2.374   0.000  0.00  0.00           C+0
HETATM   34  O   UNK     0       6.892   1.455   0.000  0.00  0.00           O+0
HETATM   35  O   UNK     0       0.918  -4.825   0.000  0.00  0.00           O+0
HETATM   36  C   UNK     0       1.225  -3.294   0.000  0.00  0.00           C+0
HETATM   37  C   UNK     0       2.757  -3.140   0.000  0.00  0.00           C+0
CONECT    1    2                                                            
CONECT    2    1    3                                                       
CONECT    3    2    4    9                                                  
CONECT    4    3    5                                                       
CONECT    5    4    6   12                                                  
CONECT    6    5    7   10                                                  
CONECT    7    6                                                            
CONECT    8    9                                                            
CONECT    9    3    8   10                                                  
CONECT   10    6    9   11                                                  
CONECT   11   10                                                            
CONECT   12    5   13                                                       
CONECT   13   12   14   17                                                  
CONECT   14   13   15   20                                                  
CONECT   15   14                                                            
CONECT   16   17   36                                                       
CONECT   17   13   16   18                                                  
CONECT   18   17   19   23                                                  
CONECT   19   18   20                                                       
CONECT   20   14   19   21                                                  
CONECT   21   20   22                                                       
CONECT   22   21                                                            
CONECT   23   18   24                                                       
CONECT   24   23   25   28                                                  
CONECT   25   24   26   33                                                  
CONECT   26   25                                                            
CONECT   27   28                                                            
CONECT   28   24   27   29                                                  
CONECT   29   28   30   34                                                  
CONECT   30   29                                                            
CONECT   31   32                                                            
CONECT   32   31   33                                                       
CONECT   33   25   32   34                                                  
CONECT   34   29   33                                                       
CONECT   35   36                                                            
CONECT   36   16   35   37                                                  
CONECT   37   36                                                            
MASTER        0    0    0    0    0    0    0    0   37    0   78    0
END

COMPND    HMDB0039750
HETATM    1  C1  UNL     1      -2.756   2.639  -3.635  1.00  0.00           C  
HETATM    2  C2  UNL     1      -2.005   2.240  -2.427  1.00  0.00           C  
HETATM    3  O1  UNL     1      -2.299   2.833  -1.344  1.00  0.00           O  
HETATM    4  N1  UNL     1      -1.015   1.247  -2.500  1.00  0.00           N  
HETATM    5  C3  UNL     1      -0.239   0.807  -1.352  1.00  0.00           C  
HETATM    6  C4  UNL     1      -0.357  -0.681  -1.125  1.00  0.00           C  
HETATM    7  O2  UNL     1      -1.661  -1.086  -0.908  1.00  0.00           O  
HETATM    8  C5  UNL     1      -1.864  -1.762   0.263  1.00  0.00           C  
HETATM    9  C6  UNL     1      -2.535  -3.114   0.052  1.00  0.00           C  
HETATM   10  O3  UNL     1      -3.746  -2.896  -0.592  1.00  0.00           O  
HETATM   11  C7  UNL     1      -2.802  -3.741   1.380  1.00  0.00           C  
HETATM   12  O4  UNL     1      -4.084  -4.315   1.453  1.00  0.00           O  
HETATM   13  O5  UNL     1      -2.606  -2.918   2.459  1.00  0.00           O  
HETATM   14  C8  UNL     1      -3.180  -1.677   2.361  1.00  0.00           C  
HETATM   15  C9  UNL     1      -4.681  -1.684   2.547  1.00  0.00           C  
HETATM   16  O6  UNL     1      -5.045  -2.175   3.789  1.00  0.00           O  
HETATM   17  C10 UNL     1      -2.821  -0.939   1.103  1.00  0.00           C  
HETATM   18  O7  UNL     1      -2.359   0.341   1.345  1.00  0.00           O  
HETATM   19  O8  UNL     1       0.073  -1.300  -2.300  1.00  0.00           O  
HETATM   20  C11 UNL     1       1.421  -1.134  -2.541  1.00  0.00           C  
HETATM   21  C12 UNL     1       1.702  -1.728  -3.915  1.00  0.00           C  
HETATM   22  O9  UNL     1       0.909  -1.013  -4.841  1.00  0.00           O  
HETATM   23  C13 UNL     1       1.836   0.315  -2.600  1.00  0.00           C  
HETATM   24  O10 UNL     1       3.209   0.360  -2.617  1.00  0.00           O  
HETATM   25  C14 UNL     1       1.233   1.146  -1.502  1.00  0.00           C  
HETATM   26  O11 UNL     1       1.827   0.979  -0.283  1.00  0.00           O  
HETATM   27  C15 UNL     1       2.326   2.133   0.294  1.00  0.00           C  
HETATM   28  O12 UNL     1       1.556   2.410   1.406  1.00  0.00           O  
HETATM   29  C16 UNL     1       2.019   1.921   2.588  1.00  0.00           C  
HETATM   30  C17 UNL     1       1.899   0.416   2.609  1.00  0.00           C  
HETATM   31  O13 UNL     1       0.527   0.115   2.452  1.00  0.00           O  
HETATM   32  C18 UNL     1       3.390   2.409   2.968  1.00  0.00           C  
HETATM   33  O14 UNL     1       3.358   3.341   3.982  1.00  0.00           O  
HETATM   34  C19 UNL     1       4.128   2.942   1.760  1.00  0.00           C  
HETATM   35  O15 UNL     1       5.496   2.917   2.031  1.00  0.00           O  
HETATM   36  C20 UNL     1       3.793   2.129   0.514  1.00  0.00           C  
HETATM   37  O16 UNL     1       4.425   2.768  -0.551  1.00  0.00           O  
HETATM   38  H1  UNL     1      -3.038   1.714  -4.182  1.00  0.00           H  
HETATM   39  H2  UNL     1      -2.150   3.249  -4.337  1.00  0.00           H  
HETATM   40  H3  UNL     1      -3.675   3.189  -3.384  1.00  0.00           H  
HETATM   41  H4  UNL     1      -0.811   0.794  -3.399  1.00  0.00           H  
HETATM   42  H5  UNL     1      -0.601   1.405  -0.483  1.00  0.00           H  
HETATM   43  H6  UNL     1       0.341  -0.955  -0.331  1.00  0.00           H  
HETATM   44  H7  UNL     1      -0.937  -1.888   0.877  1.00  0.00           H  
HETATM   45  H8  UNL     1      -1.930  -3.765  -0.610  1.00  0.00           H  
HETATM   46  H9  UNL     1      -3.986  -3.627  -1.219  1.00  0.00           H  
HETATM   47  H10 UNL     1      -2.094  -4.610   1.497  1.00  0.00           H  
HETATM   48  H11 UNL     1      -4.147  -4.970   2.174  1.00  0.00           H  
HETATM   49  H12 UNL     1      -2.773  -1.063   3.214  1.00  0.00           H  
HETATM   50  H13 UNL     1      -5.192  -2.277   1.753  1.00  0.00           H  
HETATM   51  H14 UNL     1      -5.042  -0.648   2.465  1.00  0.00           H  
HETATM   52  H15 UNL     1      -5.842  -1.697   4.096  1.00  0.00           H  
HETATM   53  H16 UNL     1      -3.756  -0.840   0.477  1.00  0.00           H  
HETATM   54  H17 UNL     1      -3.153   0.872   1.650  1.00  0.00           H  
HETATM   55  H18 UNL     1       1.997  -1.701  -1.787  1.00  0.00           H  
HETATM   56  H19 UNL     1       1.316  -2.766  -3.901  1.00  0.00           H  
HETATM   57  H20 UNL     1       2.766  -1.658  -4.154  1.00  0.00           H  
HETATM   58  H21 UNL     1       1.537  -0.537  -5.459  1.00  0.00           H  
HETATM   59  H22 UNL     1       1.481   0.707  -3.584  1.00  0.00           H  
HETATM   60  H23 UNL     1       3.606   0.768  -3.403  1.00  0.00           H  
HETATM   61  H24 UNL     1       1.238   2.211  -1.861  1.00  0.00           H  
HETATM   62  H25 UNL     1       2.095   2.962  -0.439  1.00  0.00           H  
HETATM   63  H26 UNL     1       1.323   2.293   3.390  1.00  0.00           H  
HETATM   64  H27 UNL     1       2.171   0.033   3.631  1.00  0.00           H  
HETATM   65  H28 UNL     1       2.473  -0.080   1.823  1.00  0.00           H  
HETATM   66  H29 UNL     1       0.324  -0.775   2.828  1.00  0.00           H  
HETATM   67  H30 UNL     1       3.957   1.530   3.341  1.00  0.00           H  
HETATM   68  H31 UNL     1       4.203   3.859   3.968  1.00  0.00           H  
HETATM   69  H32 UNL     1       3.842   4.006   1.649  1.00  0.00           H  
HETATM   70  H33 UNL     1       5.999   3.597   1.516  1.00  0.00           H  
HETATM   71  H34 UNL     1       4.220   1.120   0.703  1.00  0.00           H  
HETATM   72  H35 UNL     1       5.165   2.178  -0.840  1.00  0.00           H  
CONECT    1    2   38   39   40
CONECT    2    3    3    4
CONECT    4    5   41
CONECT    5    6   25   42
CONECT    6    7   19   43
CONECT    7    8
CONECT    8    9   17   44
CONECT    9   10   11   45
CONECT   10   46
CONECT   11   12   13   47
CONECT   12   48
CONECT   13   14
CONECT   14   15   17   49
CONECT   15   16   50   51
CONECT   16   52
CONECT   17   18   53
CONECT   18   54
CONECT   19   20
CONECT   20   21   23   55
CONECT   21   22   56   57
CONECT   22   58
CONECT   23   24   25   59
CONECT   24   60
CONECT   25   26   61
CONECT   26   27
CONECT   27   28   36   62
CONECT   28   29
CONECT   29   30   32   63
CONECT   30   31   64   65
CONECT   31   66
CONECT   32   33   34   67
CONECT   33   68
CONECT   34   35   36   69
CONECT   35   70
CONECT   36   37   71
CONECT   37   72
END

HMDB0039750
     RDKit          3D
Lacto-N-triose I
 72 74  0  0  0  0  0  0  0  0999 V2000
   -2.7560    2.6389   -3.6346 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0050    2.2404   -2.4267 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2988    2.8332   -1.3444 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0150    1.2472   -2.5000 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2386    0.8065   -1.3523 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3566   -0.6809   -1.1254 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6608   -1.0863   -0.9078 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8643   -1.7624    0.2629 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5355   -3.1140    0.0521 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7460   -2.8958   -0.5915 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8015   -3.7412    1.3800 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0843   -4.3145    1.4535 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6061   -2.9180    2.4586 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1802   -1.6768    2.3612 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6811   -1.6839    2.5465 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0451   -2.1750    3.7890 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8212   -0.9392    1.1033 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3593    0.3407    1.3446 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0725   -1.2996   -2.2998 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4212   -1.1337   -2.5412 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7024   -1.7276   -3.9148 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9088   -1.0130   -4.8414 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8360    0.3154   -2.6002 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2093    0.3604   -2.6169 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2327    1.1456   -1.5024 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8275    0.9793   -0.2830 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3257    2.1328    0.2941 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5563    2.4100    1.4061 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0190    1.9210    2.5881 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8991    0.4160    2.6089 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5274    0.1149    2.4515 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3904    2.4091    2.9684 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3580    3.3410    3.9821 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1280    2.9418    1.7597 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4958    2.9167    2.0312 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.7926    2.1285    0.5143 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4245    2.7679   -0.5509 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0383    1.7142   -4.1819 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1498    3.2493   -4.3375 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6747    3.1888   -3.3844 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8109    0.7942   -3.3988 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6014    1.4047   -0.4832 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3409   -0.9550   -0.3314 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9370   -1.8877    0.8771 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9303   -3.7654   -0.6096 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9858   -3.6266   -1.2189 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0944   -4.6096    1.4975 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1467   -4.9695    2.1740 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7728   -1.0627    3.2143 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1916   -2.2768    1.7530 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0416   -0.6484    2.4650 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8421   -1.6968    4.0960 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7556   -0.8395    0.4768 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1529    0.8716    1.6505 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.9972   -1.7012   -1.7874 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3163   -2.7665   -3.9011 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7660   -1.6578   -4.1543 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5369   -0.5368   -5.4589 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4811    0.7069   -3.5840 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6062    0.7679   -3.4031 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2377    2.2112   -1.8613 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0952    2.9617   -0.4387 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3229    2.2932    3.3900 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1705    0.0334    3.6312 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4726   -0.0801    1.8229 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3245   -0.7754    2.8277 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9568    1.5305    3.3406 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2034    3.8588    3.9684 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8418    4.0061    1.6489 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.9994    3.5972    1.5158 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2195    1.1202    0.7025 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1650    2.1778   -0.8402 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
  9 11  1  0
 11 12  1  0
 11 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 14 17  1  0
 17 18  1  0
  6 19  1  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 20 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 29 32  1  0
 32 33  1  0
 32 34  1  0
 34 35  1  0
 34 36  1  0
 36 37  1  0
 25  5  1  0
 36 27  1  0
 17  8  1  0
  1 38  1  0
  1 39  1  0
  1 40  1  0
  4 41  1  0
  5 42  1  0
  6 43  1  0
  8 44  1  0
  9 45  1  0
 10 46  1  0
 11 47  1  0
 12 48  1  0
 14 49  1  0
 15 50  1  0
 15 51  1  0
 16 52  1  0
 17 53  1  0
 18 54  1  0
 20 55  1  0
 21 56  1  0
 21 57  1  0
 22 58  1  0
 23 59  1  0
 24 60  1  0
 25 61  1  0
 27 62  1  0
 29 63  1  0
 30 64  1  0
 30 65  1  0
 31 66  1  0
 32 67  1  0
 33 68  1  0
 34 69  1  0
 35 70  1  0
 36 71  1  0
 37 72  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
b-D-Glucopyranosyl-(1->3)-2-acetamido-2-deoxy-b-D-glucopyranosyl-(1->3)-D-galactose	HMDB
N-[5-Hydroxy-6-(hydroxymethyl)-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-2-{[2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy}oxan-3-yl]ethanimidate	Generator
Lacto-N-triose I	MeSH

Chemical Formula

C₂₀H₃₅NO₁₆

Average Molecular Weight

545.489

Monoisotopic Molecular Weight

545.195584077

IUPAC Name

N-[5-hydroxy-6-(hydroxymethyl)-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-2-{[2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy}oxan-3-yl]acetamide

Traditional Name

N-[5-hydroxy-6-(hydroxymethyl)-4-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-2-{[2,3,5-trihydroxy-6-(hydroxymethyl)oxan-4-yl]oxy}oxan-3-yl]acetamide

CAS Registry Number

Not Available

SMILES

CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O

InChI Identifier

InChI=1S/C20H35NO16/c1-5(25)21-9-16(36-20-14(30)13(29)10(26)6(2-22)35-20)11(27)8(4-24)34-19(9)37-17-12(28)7(3-23)33-18(32)15(17)31/h6-20,22-24,26-32H,2-4H2,1H3,(H,21,25)

InChI Key

CJOPBLPCFAQCNO-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as oligosaccharides. These are carbohydrates made up of 3 to 10 monosaccharide units linked to each other through glycosidic bonds.

Kingdom

Organic compounds

Super Class

Organic oxygen compounds

Class

Organooxygen compounds

Sub Class

Carbohydrates and carbohydrate conjugates

Direct Parent

Oligosaccharides

Alternative Parents

Substituents

Oligosaccharide
N-acyl-alpha-hexosamine
Glycosyl compound
O-glycosyl compound
Oxane
Acetamide
Carboxamide group
Secondary carboxylic acid amide
Secondary alcohol
Hemiacetal
Oxacycle
Organoheterocyclic compound
Carboxylic acid derivative
Acetal
Polyol
Organopnictogen compound
Primary alcohol
Organic nitrogen compound
Organic oxide
Hydrocarbon derivative
Organonitrogen compound
Carbonyl group
Alcohol
Aliphatic heteromonocyclic compound

Molecular Framework

Aliphatic heteromonocyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0039750)
Cytoplasm (HMDB: HMDB0039750)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0039750)

Source

Exogenous

Food

Food (HMDB: HMDB0039750)

Milk and milk product

Milk and milk products (FooDB: FOOD00863)

Endogenous

Animal

Animal (HMDB: HMDB0039750)

Not Available

Nutrient (HMDB: HMDB0039750)

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	202 °C	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	303 g/L	ALOGPS
logP	-2.6	ALOGPS
logP	-6.8	ChemAxon
logS	-0.26	ALOGPS
pKa (Strongest Acidic)	11.2	ChemAxon
pKa (Strongest Basic)	-3.6	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	16	ChemAxon
Hydrogen Donor Count	11	ChemAxon
Polar Surface Area	277.55 Å²	ChemAxon
Rotatable Bond Count	8	ChemAxon
Refractivity	111.85 m³·mol⁻¹	ChemAxon
Polarizability	51.58 Å³	ChemAxon
Number of Rings	3	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DarkChem	[M+H]+	222.066	31661259
DarkChem	[M-H]-	213.06	31661259
DeepCCS	[M+H]+	218.445	30932474
DeepCCS	[M-H]-	216.087	30932474
DeepCCS	[M-2H]-	249.529	30932474
DeepCCS	[M+Na]+	224.756	30932474
AllCCS	[M+H]+	219.0	32859911
AllCCS	[M+H-H2O]+	217.6	32859911
AllCCS	[M+NH4]+	220.2	32859911
AllCCS	[M+Na]+	220.6	32859911
AllCCS	[M-H]-	216.0	32859911
AllCCS	[M+Na-2H]-	216.4	32859911
AllCCS	[M+HCOO]-	217.1	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Lacto-N-triose I	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4102.9	Standard polar	33892256
Lacto-N-triose I	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4187.3	Standard non polar	33892256
Lacto-N-triose I	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4612.7	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Lacto-N-triose I,1TMS,isomer #1	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4527.0	Semi standard non polar	33892256
Lacto-N-triose I,1TMS,isomer #10	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4532.3	Semi standard non polar	33892256
Lacto-N-triose I,1TMS,isomer #11	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4481.2	Semi standard non polar	33892256
Lacto-N-triose I,1TMS,isomer #2	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4532.1	Semi standard non polar	33892256
Lacto-N-triose I,1TMS,isomer #3	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4516.7	Semi standard non polar	33892256
Lacto-N-triose I,1TMS,isomer #4	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4525.1	Semi standard non polar	33892256
Lacto-N-triose I,1TMS,isomer #5	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	4525.3	Semi standard non polar	33892256
Lacto-N-triose I,1TMS,isomer #6	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4534.5	Semi standard non polar	33892256
Lacto-N-triose I,1TMS,isomer #7	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4520.1	Semi standard non polar	33892256
Lacto-N-triose I,1TMS,isomer #8	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4528.9	Semi standard non polar	33892256
Lacto-N-triose I,1TMS,isomer #9	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4505.4	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #1	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4467.6	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #10	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4421.2	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #11	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4480.0	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #12	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4453.6	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #13	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	4460.5	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #14	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4481.5	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #15	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4449.1	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #16	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4480.0	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #17	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4440.9	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #18	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4466.5	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #19	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4413.6	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #2	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4459.3	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #20	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4471.8	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #21	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	4446.5	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #22	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4461.4	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #23	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4441.1	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #24	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4473.7	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #25	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4446.8	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #26	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4464.8	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #27	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4404.7	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #28	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	4464.2	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #29	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4488.3	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #3	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4490.8	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #30	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4454.2	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #31	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4491.4	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #32	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4465.3	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #33	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4484.1	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #34	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4431.3	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #35	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4460.8	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #36	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4443.3	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #37	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4476.7	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #38	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4451.9	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #39	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4468.8	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #4	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	4457.4	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #40	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4402.4	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #41	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4456.1	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #42	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4496.4	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #43	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4469.5	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #44	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4483.8	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #45	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4428.0	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #46	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4470.1	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #47	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4449.8	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #48	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4464.7	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #49	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)[Si](C)(C)C	4405.6	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #5	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4481.9	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #50	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4487.1	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #51	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4472.9	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #52	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4440.8	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #53	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4485.1	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #54	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4417.5	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #55	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4429.3	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #6	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4451.0	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #7	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4489.7	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #8	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4459.9	Semi standard non polar	33892256
Lacto-N-triose I,2TMS,isomer #9	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4482.1	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #1	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4413.9	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #10	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4346.4	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #100	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4333.8	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #101	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4299.2	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #102	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4330.6	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #103	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)[Si](C)(C)C	4343.3	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #104	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4383.6	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #105	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4378.2	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #106	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4383.3	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #107	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4368.4	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #108	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4353.6	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #109	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4374.1	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #11	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	4316.4	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #110	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4366.2	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #111	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4324.5	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #112	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4414.7	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #113	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4365.9	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #114	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4391.1	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #115	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4373.3	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #116	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4390.6	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #117	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4459.8	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #118	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4420.2	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #119	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4446.5	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #12	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4381.9	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #120	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4403.8	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #121	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4395.6	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #122	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4366.1	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #123	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4393.5	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #124	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)[Si](C)(C)C	4376.0	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #125	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4435.6	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #126	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4429.2	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #127	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4408.9	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #128	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4432.6	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #129	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4383.9	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #13	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4313.1	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #130	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4400.5	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #131	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4290.0	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #132	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4375.6	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #133	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4325.3	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #134	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4346.8	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #135	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4343.3	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #136	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4319.6	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #137	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4284.8	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #138	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4316.4	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #139	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)[Si](C)(C)C	4337.0	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #14	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4395.4	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #140	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4373.9	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #141	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4367.2	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #142	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4383.5	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #143	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4357.0	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #144	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4353.4	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #145	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4371.9	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #146	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4383.7	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #147	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4353.2	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #148	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4377.8	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #149	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)[Si](C)(C)C	4367.6	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #15	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4343.9	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #150	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4428.3	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #151	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4421.1	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #152	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4406.5	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #153	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4421.0	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #154	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4379.5	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #155	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4394.7	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #156	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4350.7	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #157	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4339.7	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #158	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4377.8	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #159	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4341.7	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #16	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4375.5	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #160	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4356.6	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #161	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4374.3	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #162	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4422.1	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #163	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4393.2	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #164	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4381.0	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #165	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C	4387.3	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #17	CC(=O)N(C1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4350.9	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #18	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	4360.1	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #19	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4433.7	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #2	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4352.0	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #20	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4360.0	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #21	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4439.8	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #22	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4388.4	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #23	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4412.3	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #24	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4384.5	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #25	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4346.9	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #26	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4301.7	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #27	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4389.1	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #28	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4335.6	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #29	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4366.5	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #3	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	4361.7	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #30	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4344.0	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #31	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4372.3	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #32	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4444.5	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #33	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4393.9	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #34	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4424.8	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #35	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4380.9	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #36	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4367.8	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #37	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4333.9	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #38	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4368.0	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #39	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)[Si](C)(C)C	4348.7	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #4	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4423.3	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #40	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4411.7	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #41	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4396.8	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #42	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4393.7	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #43	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4404.4	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #44	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4360.1	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #45	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4381.9	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #46	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4326.2	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #47	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	4370.0	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #48	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4429.6	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #49	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4367.7	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #5	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4360.3	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #50	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4430.2	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #51	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4380.6	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #52	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4412.8	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #53	CC(=O)N(C1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4377.3	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #54	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	4293.1	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #55	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4360.8	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #56	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4291.7	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #57	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4374.0	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #58	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4311.1	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #59	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4341.5	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #6	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4438.9	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #60	CC(=O)N(C1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4344.6	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #61	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4333.9	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #62	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4296.8	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #63	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4378.1	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #64	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4316.9	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #65	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4345.9	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #66	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4349.3	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #67	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4360.7	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #68	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4427.4	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #69	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4375.1	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #7	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4387.7	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #70	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4404.8	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #71	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4377.2	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #72	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4354.0	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #73	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4315.3	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #74	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4348.7	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #75	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)[Si](C)(C)C	4348.6	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #76	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4393.8	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #77	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4378.5	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #78	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4379.7	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #79	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4385.1	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #8	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4416.9	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #80	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4343.3	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #81	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4360.6	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #82	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	4320.7	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #83	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4384.5	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #84	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4320.9	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #85	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4407.2	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #86	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4355.2	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #87	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4380.2	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #88	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4374.7	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #89	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4304.9	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #9	CC(=O)N(C1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4381.5	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #90	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4260.4	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #91	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4351.4	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #92	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4300.4	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #93	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4328.6	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #94	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4338.2	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #95	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4330.3	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #96	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4412.0	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #97	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4362.7	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #98	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4387.3	Semi standard non polar	33892256
Lacto-N-triose I,3TMS,isomer #99	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4371.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #1	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4120.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #10	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4205.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #100	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4205.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #101	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4209.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #102	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4176.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #103	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4198.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #104	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)[Si](C)(C)C	4211.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #105	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4245.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #106	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4241.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #107	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4259.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #108	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4233.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #109	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4219.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #11	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4136.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #110	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4236.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #111	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4173.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #112	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4168.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #113	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4213.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #114	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4166.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #115	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4183.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #116	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4202.6	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #117	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4219.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #118	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4226.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #119	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4219.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #12	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4200.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #120	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C	4214.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #121	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	4098.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #122	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4159.6	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #123	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4095.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #124	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4154.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #125	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4094.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #126	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4120.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #127	CC(=O)N(C1C(OC2C(O)C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4177.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #128	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4162.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #129	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4114.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #13	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4150.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #130	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4181.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #131	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4119.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #132	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4144.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #133	CC(=O)N(C1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4198.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #134	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4176.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #134	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4133.3	Standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #135	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4249.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #136	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4182.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #136	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4101.6	Standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #137	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4204.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #138	CC(=O)N(C1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4232.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #139	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4163.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #14	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4179.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #140	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4121.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #141	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4146.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #142	CC(=O)N(C1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)[Si](C)(C)C	4192.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #143	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4185.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #144	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4186.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #145	CC(=O)N(C1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4238.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #146	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4168.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #147	CC(=O)N(C1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4187.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #148	CC(=O)N(C1C(OC2C(O)C(O[Si](C)(C)C)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4201.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #149	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4108.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #15	CC(=O)N(C1C(OC2C(O[Si](C)(C)C)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4208.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #150	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4057.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #151	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4115.6	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #152	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4055.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #153	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4091.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #154	CC(=O)N(C1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4164.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #155	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4120.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #156	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4186.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #157	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4120.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #158	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4147.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #159	CC(=O)N(C1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4195.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #16	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4181.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #160	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4110.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #161	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4064.6	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #162	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4097.6	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #163	CC(=O)N(C1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)[Si](C)(C)C	4153.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #164	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4117.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #165	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4127.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #166	CC(=O)N(C1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4194.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #167	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4104.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #168	CC(=O)N(C1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4144.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #169	CC(=O)N(C1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4162.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #17	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4128.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #170	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4102.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #171	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4162.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #172	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4105.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #173	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4124.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #174	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4179.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #175	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4110.6	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #176	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4067.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #177	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4098.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #178	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)[Si](C)(C)C	4158.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #179	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4124.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #18	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4201.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #180	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4132.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #181	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4197.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #182	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4111.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #183	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4150.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #184	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4166.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #185	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4171.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #186	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4128.6	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #187	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4153.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #188	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)[Si](C)(C)C	4190.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #189	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4193.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #19	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4151.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #190	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4192.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #191	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4238.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #192	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4176.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #193	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4184.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #194	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4202.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #195	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4115.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #196	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4117.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #197	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4185.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #198	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4109.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #199	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4151.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #2	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	4148.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #20	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4175.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #200	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4168.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #201	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4163.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #202	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4196.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #203	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4181.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #204	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C	4174.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #205	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4146.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #206	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4094.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #207	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4162.6	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #208	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4111.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #209	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4140.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #21	CC(=O)N(C1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4211.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #210	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4199.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #211	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4161.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #212	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4232.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #213	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4178.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #214	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4203.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #215	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4229.6	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #216	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4155.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #217	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4118.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #218	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4145.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #219	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)[Si](C)(C)C	4194.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #22	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4196.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #220	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4182.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #221	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4185.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #222	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4238.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #223	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4168.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #224	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4199.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #225	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4216.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #226	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4104.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #227	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4162.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #228	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4115.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #229	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4140.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #23	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4274.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #230	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4187.6	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #231	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4113.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #232	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4074.6	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #233	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4102.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #234	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)[Si](C)(C)C	4165.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #235	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4129.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #236	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4137.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #237	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4205.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #238	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4114.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #239	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4165.6	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #24	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4221.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #240	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4192.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #241	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4172.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #242	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4135.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #243	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4157.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #244	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)[Si](C)(C)C	4193.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #245	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4197.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #246	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4198.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #247	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4243.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #248	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4184.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #249	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4202.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #25	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4247.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #250	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4217.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #251	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4129.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #252	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4130.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #253	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4199.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #254	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4119.6	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #255	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4165.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #256	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4188.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #257	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4167.6	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #258	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4207.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #259	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4203.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #26	CC(=O)N(C1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4247.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #260	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C	4197.6	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #261	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4138.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #262	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4210.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #263	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4164.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #264	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4183.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #265	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4214.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #266	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4154.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #267	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4120.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #268	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4140.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #269	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)[Si](C)(C)C	4197.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #27	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4187.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #270	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4185.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #271	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4186.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #272	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4244.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #273	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4172.6	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #274	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4206.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #275	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4221.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #276	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4221.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #277	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4182.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #278	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4207.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #279	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)[Si](C)(C)C	4229.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #28	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4154.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #280	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4258.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #281	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4252.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #282	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4286.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #283	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4244.6	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #284	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4245.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #285	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4257.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #286	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4178.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #287	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4169.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #288	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4236.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #289	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4169.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #29	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4178.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #290	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4207.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #291	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4222.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #292	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4230.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #293	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4254.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #294	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4241.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #295	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C	4239.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #296	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4134.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #297	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4104.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #298	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4123.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #299	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)[Si](C)(C)C	4173.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #3	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4224.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #30	CC(=O)N(C1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)[Si](C)(C)C	4209.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #300	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4163.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #301	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4162.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #302	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4219.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #303	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4148.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #304	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4180.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #305	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4195.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #306	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4107.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #307	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4108.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #308	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4196.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #309	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4099.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #31	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4228.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #310	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4163.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #311	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4187.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #312	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4150.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #313	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4203.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #314	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4201.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #315	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C	4195.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #316	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4176.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #317	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4165.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #318	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4227.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #319	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4168.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #32	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4224.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #320	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4198.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #321	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4212.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #322	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4228.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #323	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4246.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #324	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4236.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #325	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C	4233.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #326	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4137.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #327	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4192.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #328	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4191.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #329	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C	4188.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #33	CC(=O)N(C1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4255.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #330	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C)[Si](C)(C)C	4233.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #34	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4215.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #35	CC(=O)N(C1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4216.6	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #36	CC(=O)N(C1C(OC2C(O[Si](C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4233.6	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #37	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	4103.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #38	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4171.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #39	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4101.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #4	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4143.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #40	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4170.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #41	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4109.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #42	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4131.6	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #43	CC(=O)N(C1C(OC2C(O)C(CO[Si](C)(C)C)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4189.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #44	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4160.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #45	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4109.6	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #46	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4170.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #47	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4116.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #48	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4152.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #49	CC(=O)N(C1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4191.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #5	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4224.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #50	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4170.2	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #51	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4232.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #52	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4180.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #53	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4208.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #54	CC(=O)N(C1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4219.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #55	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4166.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #56	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4125.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #57	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4156.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #58	CC(=O)N(C1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)[Si](C)(C)C	4186.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #59	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4184.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #6	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4161.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #60	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4193.6	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #61	CC(=O)N(C1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4222.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #62	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4175.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #63	CC(=O)N(C1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4183.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #64	CC(=O)N(C1C(OC2C(O)C(CO[Si](C)(C)C)OC(O)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4205.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #65	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4155.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #66	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4105.6	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #67	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4179.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #68	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4118.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #69	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4140.6	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #7	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4180.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #70	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4198.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #71	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4174.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #72	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4251.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #73	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4183.6	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #74	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4206.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #75	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4229.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #76	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4162.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #77	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4121.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #78	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4145.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #79	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)[Si](C)(C)C	4192.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #8	CC(=O)N(C1C(OC2C(O[Si](C)(C)C)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4225.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #80	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4188.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #81	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4187.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #82	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4238.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #83	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4169.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #84	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4187.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #85	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C)[Si](C)(C)C	4202.9	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #86	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O	4140.4	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #87	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O	4202.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #88	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O	4154.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #89	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C	4177.7	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #9	CC(=O)NC1C(OC2C(O[Si](C)(C)C)C(O)OC(CO[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	4138.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #90	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C	4202.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #91	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O	4152.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #92	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O	4116.0	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #93	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C	4141.8	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #94	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C)C(O)C(O)C1O)[Si](C)(C)C	4184.5	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #95	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	4177.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #96	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	4181.6	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #97	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O)[Si](C)(C)C	4221.1	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #98	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	4165.3	Semi standard non polar	33892256
Lacto-N-triose I,4TMS,isomer #99	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O)[Si](C)(C)C	4184.1	Semi standard non polar	33892256
Lacto-N-triose I,1TBDMS,isomer #1	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4737.5	Semi standard non polar	33892256
Lacto-N-triose I,1TBDMS,isomer #10	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4731.8	Semi standard non polar	33892256
Lacto-N-triose I,1TBDMS,isomer #11	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4739.8	Semi standard non polar	33892256
Lacto-N-triose I,1TBDMS,isomer #2	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4742.5	Semi standard non polar	33892256
Lacto-N-triose I,1TBDMS,isomer #3	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4705.0	Semi standard non polar	33892256
Lacto-N-triose I,1TBDMS,isomer #4	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4739.3	Semi standard non polar	33892256
Lacto-N-triose I,1TBDMS,isomer #5	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	4714.2	Semi standard non polar	33892256
Lacto-N-triose I,1TBDMS,isomer #6	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4754.1	Semi standard non polar	33892256
Lacto-N-triose I,1TBDMS,isomer #7	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4702.6	Semi standard non polar	33892256
Lacto-N-triose I,1TBDMS,isomer #8	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4742.8	Semi standard non polar	33892256
Lacto-N-triose I,1TBDMS,isomer #9	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4727.6	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #1	CC(=O)NC1C(OC2C(O[Si](C)(C)C(C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4830.9	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #10	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4830.7	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #11	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C(C)(C)C)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4844.3	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #12	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C(C)(C)C)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4789.5	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #13	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	4796.4	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #14	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4851.1	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #15	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4779.4	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #16	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4841.6	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #17	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4808.9	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #18	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4813.8	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #19	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4845.0	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #2	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C(C)(C)C)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4802.6	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #20	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4802.9	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #21	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	4742.0	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #22	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4812.0	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #23	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4722.4	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #24	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4805.6	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #25	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4768.3	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #26	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4777.4	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #27	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4808.4	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #28	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	4804.1	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #29	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4852.5	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #3	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4852.0	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #30	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4787.2	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #31	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4844.8	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #32	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4811.4	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #33	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4820.7	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #34	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4831.4	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #35	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4813.2	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #36	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4729.5	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #37	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4810.4	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #38	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4774.6	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #39	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4783.6	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #4	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	4801.7	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #40	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4812.2	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #41	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4799.3	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #42	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4854.1	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #43	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4821.8	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #44	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4825.9	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #45	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4834.2	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #46	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4789.1	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #47	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4775.4	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #48	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4781.6	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #49	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4801.2	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #5	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4849.1	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #50	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4826.9	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #51	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4813.9	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #52	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)[Si](C)(C)C(C)(C)C	4834.2	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #53	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4820.2	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #54	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)[Si](C)(C)C(C)(C)C	4820.9	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #55	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C	4814.6	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #6	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4783.4	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #7	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4841.4	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #8	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4807.5	Semi standard non polar	33892256
Lacto-N-triose I,2TBDMS,isomer #9	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4816.0	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #1	CC(=O)NC1C(OC2C(O[Si](C)(C)C(C)(C)C)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4908.5	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #10	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C(C)(C)C)OC(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4829.6	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #100	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4781.7	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #101	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4773.2	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #102	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4779.1	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #103	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4843.1	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #104	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4826.1	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #105	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4827.5	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #106	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)[Si](C)(C)C(C)(C)C	4906.6	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #107	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4822.4	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #108	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)[Si](C)(C)C(C)(C)C	4889.2	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #109	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C	4887.3	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #11	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C(C)(C)C)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	4797.1	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #110	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4850.2	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #111	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4766.5	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #112	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4843.4	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #113	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4820.7	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #114	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4819.0	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #115	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4920.7	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #116	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4828.5	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #117	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4934.2	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #118	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4907.2	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #119	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4904.6	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #12	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C(C)(C)C)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4860.0	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #120	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4948.0	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #121	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4824.6	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #122	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4820.8	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #123	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4820.5	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #124	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4901.5	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #125	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4905.4	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #126	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4902.1	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #127	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)[Si](C)(C)C(C)(C)C	4939.4	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #128	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4902.1	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #129	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)[Si](C)(C)C(C)(C)C	4920.5	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #13	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C(C)(C)C)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4775.0	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #130	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C	4920.1	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #131	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4775.6	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #132	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4851.5	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #133	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4829.8	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #134	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4821.8	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #135	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4915.0	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #136	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4774.1	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #137	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4772.4	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #138	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4773.6	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #139	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4848.6	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #14	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C(C)(C)C)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4851.4	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #140	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4826.8	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #141	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4827.4	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #142	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)[Si](C)(C)C(C)(C)C	4913.2	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #143	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4821.8	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #144	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)[Si](C)(C)C(C)(C)C	4893.8	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #145	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C	4892.7	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #146	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4833.6	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #147	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4832.0	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #148	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4826.3	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #149	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4897.8	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #15	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C(C)(C)C)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4822.8	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #150	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4910.7	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #151	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4906.3	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #152	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)[Si](C)(C)C(C)(C)C	4940.1	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #153	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4904.6	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #154	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)[Si](C)(C)C(C)(C)C	4919.8	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #155	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C	4916.3	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #156	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4831.7	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #157	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4818.1	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #158	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)[Si](C)(C)C(C)(C)C	4895.7	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #159	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4822.6	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #16	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C(C)(C)C)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4828.3	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #160	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)[Si](C)(C)C(C)(C)C	4892.7	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #161	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C	4889.4	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #162	CC(=O)NC1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4900.5	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #163	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O)[Si](C)(C)C(C)(C)C	4922.9	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #164	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C	4908.2	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #165	CC(=O)N(C1C(OC2C(O)C(O)OC(CO)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C	4915.9	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #17	CC(=O)N(C1C(OC2C(O)C(CO[Si](C)(C)C(C)(C)C)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4905.4	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #18	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	4835.9	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #19	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4929.0	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #2	CC(=O)NC1C(OC2C(O[Si](C)(C)C(C)(C)C)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4830.7	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #20	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4814.4	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #21	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4922.7	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #22	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4900.2	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #23	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4897.1	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #24	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4945.1	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #25	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4859.6	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #26	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4773.2	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #27	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4850.7	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #28	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4827.4	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #29	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4828.0	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #3	CC(=O)NC1C(OC2C(O[Si](C)(C)C(C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	4831.7	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #30	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4912.8	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #31	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4837.6	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #32	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4936.9	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #33	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4910.4	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #34	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4910.5	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #35	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4940.1	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #36	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4833.8	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #37	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4827.7	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #38	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4828.0	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #39	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4892.8	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #4	CC(=O)NC1C(OC2C(O[Si](C)(C)C(C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4927.9	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #40	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4908.8	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #41	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4902.1	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #42	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)[Si](C)(C)C(C)(C)C	4933.6	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #43	CC(=O)NC1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4905.8	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #44	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)[Si](C)(C)C(C)(C)C	4916.0	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #45	CC(=O)N(C1C(OC2C(O)C(CO)OC(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C	4914.9	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #46	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C(C)(C)C)OC(CO[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O	4823.9	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #47	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C(C)(C)C)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	4830.4	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #48	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C(C)(C)C)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4923.6	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #49	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C(C)(C)C)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4807.6	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #5	CC(=O)NC1C(OC2C(O[Si](C)(C)C(C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4809.1	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #50	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C(C)(C)C)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4917.3	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #51	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C(C)(C)C)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4893.6	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #52	CC(=O)NC1C(OC2C(O)C(O[Si](C)(C)C(C)(C)C)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4891.5	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #53	CC(=O)N(C1C(OC2C(O)C(O[Si](C)(C)C(C)(C)C)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4930.0	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #54	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C(C)(C)C)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	4779.0	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #55	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C(C)(C)C)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4836.5	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #56	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C(C)(C)C)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4758.5	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #57	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C(C)(C)C)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4827.4	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #58	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C(C)(C)C)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4800.3	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #59	CC(=O)NC1C(OC2C(O)C(CO[Si](C)(C)C(C)(C)C)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4804.2	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #6	CC(=O)NC1C(OC2C(O[Si](C)(C)C(C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4916.4	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #60	CC(=O)N(C1C(OC2C(O)C(CO[Si](C)(C)C(C)(C)C)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4895.5	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #61	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4839.3	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #62	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4763.4	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #63	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4836.1	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #64	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4811.8	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #65	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4811.7	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #66	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4903.1	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #67	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4821.1	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #68	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4921.7	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #69	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4898.6	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #7	CC(=O)NC1C(OC2C(O[Si](C)(C)C(C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4886.0	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #70	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4894.0	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #71	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4933.8	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #72	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4819.9	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #73	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4811.4	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #74	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4814.2	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #75	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4888.3	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #76	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O	4902.7	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #77	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C	4898.6	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #78	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O)[Si](C)(C)C(C)(C)C	4933.7	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #79	CC(=O)NC1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C	4900.0	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #8	CC(=O)NC1C(OC2C(O[Si](C)(C)C(C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4891.0	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #80	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O)[Si](C)(C)C(C)(C)C	4921.0	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #81	CC(=O)N(C1C(OC2C(O)C(CO)OC(O[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C	4915.0	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #82	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O	4791.9	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #83	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4849.3	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #84	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4769.6	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #85	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4841.4	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #86	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4816.8	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #87	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4818.3	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #88	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4910.9	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #89	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O	4804.2	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #9	CC(=O)N(C1C(OC2C(O[Si](C)(C)C(C)(C)C)C(O)OC(CO)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4933.6	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #90	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4740.5	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #91	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4796.6	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #92	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4774.7	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #93	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4776.9	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #94	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4862.5	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #95	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C1O	4780.8	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #96	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	4853.6	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #97	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	4831.3	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #98	CC(=O)NC1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	4827.5	Semi standard non polar	33892256
Lacto-N-triose I,3TBDMS,isomer #99	CC(=O)N(C1C(OC2C(O)C(O)OC(CO[Si](C)(C)C(C)(C)C)C2O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O)[Si](C)(C)C(C)(C)C	4909.7	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Lacto-N-triose I GC-MS (Non-derivatized) - 70eV, Positive	splash10-03fr-3522970000-601463b9c59f417262d2	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Lacto-N-triose I GC-MS (2 TMS) - 70eV, Positive	splash10-00di-3412029000-9e4bf626be6d18544d0a	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Lacto-N-triose I GC-MS ("Lacto-N-triose I,1TMS,#1" TMS) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Lacto-N-triose I GC-MS (TMS_1_1) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Lacto-N-triose I GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Lacto-N-triose I GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Lacto-N-triose I GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Lacto-N-triose I GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Lacto-N-triose I GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Lacto-N-triose I GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Lacto-N-triose I GC-MS (TMS_1_8) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Lacto-N-triose I GC-MS (TMS_1_9) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Lacto-N-triose I GC-MS (TMS_1_10) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Lacto-N-triose I GC-MS (TMS_1_11) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Lacto-N-triose I GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Lacto-N-triose I GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Lacto-N-triose I GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Lacto-N-triose I GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Lacto-N-triose I GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Lacto-N-triose I GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Lacto-N-triose I GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Lacto-N-triose I GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Lacto-N-triose I GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Lacto-N-triose I GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Lacto-N-triose I GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Lacto-N-triose I 10V, Negative-QTOF	splash10-002f-1224590000-1b5e2c045f4112c08170	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Lacto-N-triose I 20V, Negative-QTOF	splash10-03fr-2589560000-afaf05e06f83d0117fe8	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Lacto-N-triose I 40V, Negative-QTOF	splash10-0bvr-7960000000-037e344170106d010144	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Lacto-N-triose I 10V, Negative-QTOF	splash10-0006-0010290000-22e56e97a6a21bca2fc9	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Lacto-N-triose I 20V, Negative-QTOF	splash10-0pi3-9301750000-012a08bc4937cb90a601	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Lacto-N-triose I 40V, Negative-QTOF	splash10-0596-9113100000-cb6f4946cbe93923343b	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Lacto-N-triose I 10V, Positive-QTOF	splash10-017j-0209180000-cf09fafe87838150fb6b	2016-08-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Lacto-N-triose I 20V, Positive-QTOF	splash10-0159-0409010000-3882c80b6ad8fdff7b1f	2016-08-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Lacto-N-triose I 40V, Positive-QTOF	splash10-02u0-2429000000-4485547a8f7d019e6e5b	2016-08-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Lacto-N-triose I 10V, Positive-QTOF	splash10-01r2-0002090000-406dc79afd60783a3e10	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Lacto-N-triose I 20V, Positive-QTOF	splash10-0002-1556390000-28fa4efa762264a838f3	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Lacto-N-triose I 40V, Positive-QTOF	splash10-0095-9734700000-f731d863da2fcbb606e7	2021-09-23	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-24	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB019398

KNApSAcK ID

Not Available

Chemspider ID

11498334

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

22609086

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for Lacto-N-triose I (HMDB0039750)

MOL for HMDB0039750 (Lacto-N-triose I)

3D MOL for HMDB0039750 (Lacto-N-triose I)

3D SDF for HMDB0039750 (Lacto-N-triose I)

3D-SDF for HMDB0039750 (Lacto-N-triose I)

PDB for HMDB0039750 (Lacto-N-triose I)

3D PDB for HMDB0039750 (Lacto-N-triose I)

SMILES for HMDB0039750 (Lacto-N-triose I)

INCHI for HMDB0039750 (Lacto-N-triose I)

Structure for HMDB0039750 (Lacto-N-triose I)

3D Structure for HMDB0039750 (Lacto-N-triose I)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra