Hmdb loader
Record Information
Version5.0
StatusExpected but not Quantified
Creation Date2012-09-12 02:36:58 UTC
Update Date2022-03-07 02:56:49 UTC
HMDB IDHMDB0040984
Secondary Accession Numbers
  • HMDB40984
Metabolite Identification
Common NameSophorotriose
DescriptionSophorotriose belongs to the class of organic compounds known as oligosaccharides. These are carbohydrates made up of 3 to 10 monosaccharide units linked to each other through glycosidic bonds. Sophorotriose has been detected, but not quantified in, a few different foods, such as alcoholic beverages, potatos (Solanum tuberosum), and pulses. This could make sophorotriose a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on Sophorotriose.
Structure
Data?1563863611
SynonymsNot Available
Chemical FormulaC18H32O16
Average Molecular Weight504.4371
Monoisotopic Molecular Weight504.169034976
IUPAC Name3-{[4,5-dihydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-6-(hydroxymethyl)oxane-2,4,5-triol
Traditional Name3-{[4,5-dihydroxy-6-(hydroxymethyl)-3-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-6-(hydroxymethyl)oxane-2,4,5-triol
CAS Registry Number32581-40-1
SMILES
OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O
InChI Identifier
InChI=1S/C18H32O16/c19-1-4-8(23)11(26)14(16(29)30-4)33-18-15(12(27)9(24)6(3-21)32-18)34-17-13(28)10(25)7(22)5(2-20)31-17/h4-29H,1-3H2
InChI KeyUQBIAGWOJDEOMN-UHFFFAOYSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as oligosaccharides. These are carbohydrates made up of 3 to 10 monosaccharide units linked to each other through glycosidic bonds.
KingdomOrganic compounds
Super ClassOrganic oxygen compounds
ClassOrganooxygen compounds
Sub ClassCarbohydrates and carbohydrate conjugates
Direct ParentOligosaccharides
Alternative Parents
Substituents
  • Oligosaccharide
  • O-glycosyl compound
  • Glycosyl compound
  • Oxane
  • Secondary alcohol
  • Hemiacetal
  • Oxacycle
  • Organoheterocyclic compound
  • Polyol
  • Acetal
  • Hydrocarbon derivative
  • Primary alcohol
  • Alcohol
  • Aliphatic heteromonocyclic compound
Molecular FrameworkAliphatic heteromonocyclic compounds
External DescriptorsNot Available
Ontology
Physiological effectNot Available
Disposition
ProcessNot Available
Role
Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting Point218 - 223 °CNot Available
Boiling PointNot AvailableNot Available
Water SolubilityNot AvailableNot Available
LogPNot AvailableNot Available
Experimental Chromatographic PropertiesNot Available
Predicted Molecular Properties
PropertyValueSource
Water Solubility612 g/LALOGPS
logP-2.7ALOGPS
logP-6.5ChemAxon
logS0.08ALOGPS
pKa (Strongest Acidic)11.25ChemAxon
pKa (Strongest Basic)-3.6ChemAxon
Physiological Charge0ChemAxon
Hydrogen Acceptor Count16ChemAxon
Hydrogen Donor Count11ChemAxon
Polar Surface Area268.68 ŲChemAxon
Rotatable Bond Count7ChemAxon
Refractivity100.75 m³·mol⁻¹ChemAxon
Polarizability46.81 ųChemAxon
Number of Rings3ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleYesChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DarkChem[M+H]+211.12331661259
DarkChem[M-H]-203.13531661259
DeepCCS[M+H]+207.62630932474
DeepCCS[M-H]-205.26830932474
DeepCCS[M-2H]-239.19830932474
DeepCCS[M+Na]+214.78430932474
AllCCS[M+H]+211.232859911
AllCCS[M+H-H2O]+209.632859911
AllCCS[M+NH4]+212.832859911
AllCCS[M+Na]+213.232859911
AllCCS[M-H]-206.132859911
AllCCS[M+Na-2H]-206.132859911
AllCCS[M+HCOO]-206.332859911

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
SophorotrioseOCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O3675.5Standard polar33892256
SophorotrioseOCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O4570.1Standard non polar33892256
SophorotrioseOCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O4209.6Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
Sophorotriose,1TMS,isomer #1C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O4272.3Semi standard non polar33892256
Sophorotriose,1TMS,isomer #10C[Si](C)(C)OC1C(O)C(CO)OC(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O4285.2Semi standard non polar33892256
Sophorotriose,1TMS,isomer #11C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C1O4277.3Semi standard non polar33892256
Sophorotriose,1TMS,isomer #2C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O4291.8Semi standard non polar33892256
Sophorotriose,1TMS,isomer #3C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O4264.1Semi standard non polar33892256
Sophorotriose,1TMS,isomer #4C[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)C1O4273.8Semi standard non polar33892256
Sophorotriose,1TMS,isomer #5C[Si](C)(C)OC1C(O)C(CO)OC(OC2C(O)OC(CO)C(O)C2O)C1OC1OC(CO)C(O)C(O)C1O4282.5Semi standard non polar33892256
Sophorotriose,1TMS,isomer #6C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O4260.6Semi standard non polar33892256
Sophorotriose,1TMS,isomer #7C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O)C1O4297.3Semi standard non polar33892256
Sophorotriose,1TMS,isomer #8C[Si](C)(C)OC1C(O)C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C1O4277.4Semi standard non polar33892256
Sophorotriose,1TMS,isomer #9C[Si](C)(C)OC1C(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)OC(CO)C(O)C1O4295.8Semi standard non polar33892256
Sophorotriose,2TMS,isomer #1C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O4233.9Semi standard non polar33892256
Sophorotriose,2TMS,isomer #10C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C4241.0Semi standard non polar33892256
Sophorotriose,2TMS,isomer #11C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O4247.4Semi standard non polar33892256
Sophorotriose,2TMS,isomer #12C[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O4250.9Semi standard non polar33892256
Sophorotriose,2TMS,isomer #13C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O4242.8Semi standard non polar33892256
Sophorotriose,2TMS,isomer #14C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O4246.5Semi standard non polar33892256
Sophorotriose,2TMS,isomer #15C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O4249.6Semi standard non polar33892256
Sophorotriose,2TMS,isomer #16C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O4239.4Semi standard non polar33892256
Sophorotriose,2TMS,isomer #17C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O4262.5Semi standard non polar33892256
Sophorotriose,2TMS,isomer #18C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O4239.3Semi standard non polar33892256
Sophorotriose,2TMS,isomer #19C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C4258.8Semi standard non polar33892256
Sophorotriose,2TMS,isomer #2C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O4232.5Semi standard non polar33892256
Sophorotriose,2TMS,isomer #20C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O4229.2Semi standard non polar33892256
Sophorotriose,2TMS,isomer #21C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O4231.9Semi standard non polar33892256
Sophorotriose,2TMS,isomer #22C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O4218.7Semi standard non polar33892256
Sophorotriose,2TMS,isomer #23C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4249.3Semi standard non polar33892256
Sophorotriose,2TMS,isomer #24C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4234.0Semi standard non polar33892256
Sophorotriose,2TMS,isomer #25C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4248.9Semi standard non polar33892256
Sophorotriose,2TMS,isomer #26C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O4231.8Semi standard non polar33892256
Sophorotriose,2TMS,isomer #27C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C4233.9Semi standard non polar33892256
Sophorotriose,2TMS,isomer #28C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O)C1O4233.1Semi standard non polar33892256
Sophorotriose,2TMS,isomer #29C[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C1O4231.3Semi standard non polar33892256
Sophorotriose,2TMS,isomer #3C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O4233.5Semi standard non polar33892256
Sophorotriose,2TMS,isomer #30C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O4221.2Semi standard non polar33892256
Sophorotriose,2TMS,isomer #31C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C1O4255.4Semi standard non polar33892256
Sophorotriose,2TMS,isomer #32C[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C1O4232.7Semi standard non polar33892256
Sophorotriose,2TMS,isomer #33C[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C1O4246.8Semi standard non polar33892256
Sophorotriose,2TMS,isomer #34C[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)C1O[Si](C)(C)C4254.0Semi standard non polar33892256
Sophorotriose,2TMS,isomer #35C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C1O4235.1Semi standard non polar33892256
Sophorotriose,2TMS,isomer #36C[Si](C)(C)OC1C(O)C(CO)OC(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O4234.0Semi standard non polar33892256
Sophorotriose,2TMS,isomer #37C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O4226.3Semi standard non polar33892256
Sophorotriose,2TMS,isomer #38C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C1O4254.4Semi standard non polar33892256
Sophorotriose,2TMS,isomer #39C[Si](C)(C)OC1C(O)C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C1O4233.0Semi standard non polar33892256
Sophorotriose,2TMS,isomer #4C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O4239.2Semi standard non polar33892256
Sophorotriose,2TMS,isomer #40C[Si](C)(C)OC1C(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)OC(CO)C(O)C1O4248.5Semi standard non polar33892256
Sophorotriose,2TMS,isomer #41C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O4225.1Semi standard non polar33892256
Sophorotriose,2TMS,isomer #42C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O)C1O4230.7Semi standard non polar33892256
Sophorotriose,2TMS,isomer #43C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O4248.9Semi standard non polar33892256
Sophorotriose,2TMS,isomer #44C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O4233.0Semi standard non polar33892256
Sophorotriose,2TMS,isomer #45C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C4247.2Semi standard non polar33892256
Sophorotriose,2TMS,isomer #46C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)C(O)C1O4257.2Semi standard non polar33892256
Sophorotriose,2TMS,isomer #47C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C1O4254.2Semi standard non polar33892256
Sophorotriose,2TMS,isomer #48C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C1O4246.1Semi standard non polar33892256
Sophorotriose,2TMS,isomer #49C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O)C1O[Si](C)(C)C4253.1Semi standard non polar33892256
Sophorotriose,2TMS,isomer #5C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O4232.4Semi standard non polar33892256
Sophorotriose,2TMS,isomer #50C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C1O4234.4Semi standard non polar33892256
Sophorotriose,2TMS,isomer #51C[Si](C)(C)OC1C(O)C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C1O4233.4Semi standard non polar33892256
Sophorotriose,2TMS,isomer #52C[Si](C)(C)OC1C(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)OC(CO)C(O)C1O[Si](C)(C)C4259.1Semi standard non polar33892256
Sophorotriose,2TMS,isomer #53C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C1O4253.5Semi standard non polar33892256
Sophorotriose,2TMS,isomer #54C[Si](C)(C)OC1C(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)OC(CO)C(O)C1O4256.3Semi standard non polar33892256
Sophorotriose,2TMS,isomer #55C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C1O[Si](C)(C)C4253.5Semi standard non polar33892256
Sophorotriose,2TMS,isomer #6C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4259.3Semi standard non polar33892256
Sophorotriose,2TMS,isomer #7C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4242.8Semi standard non polar33892256
Sophorotriose,2TMS,isomer #8C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4262.8Semi standard non polar33892256
Sophorotriose,2TMS,isomer #9C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O4231.4Semi standard non polar33892256
Sophorotriose,3TMS,isomer #1C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O4173.0Semi standard non polar33892256
Sophorotriose,3TMS,isomer #10C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O4196.5Semi standard non polar33892256
Sophorotriose,3TMS,isomer #100C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O4218.0Semi standard non polar33892256
Sophorotriose,3TMS,isomer #101C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O4210.9Semi standard non polar33892256
Sophorotriose,3TMS,isomer #102C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O4213.7Semi standard non polar33892256
Sophorotriose,3TMS,isomer #103C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C4226.4Semi standard non polar33892256
Sophorotriose,3TMS,isomer #104C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O4214.9Semi standard non polar33892256
Sophorotriose,3TMS,isomer #105C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O4187.0Semi standard non polar33892256
Sophorotriose,3TMS,isomer #106C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C4200.8Semi standard non polar33892256
Sophorotriose,3TMS,isomer #107C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O4199.7Semi standard non polar33892256
Sophorotriose,3TMS,isomer #108C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C4212.3Semi standard non polar33892256
Sophorotriose,3TMS,isomer #109C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C4198.2Semi standard non polar33892256
Sophorotriose,3TMS,isomer #11C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O4186.9Semi standard non polar33892256
Sophorotriose,3TMS,isomer #110C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C1O4225.6Semi standard non polar33892256
Sophorotriose,3TMS,isomer #111C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O4196.6Semi standard non polar33892256
Sophorotriose,3TMS,isomer #112C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C1O4236.3Semi standard non polar33892256
Sophorotriose,3TMS,isomer #113C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C1O4208.3Semi standard non polar33892256
Sophorotriose,3TMS,isomer #114C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C1O4228.7Semi standard non polar33892256
Sophorotriose,3TMS,isomer #115C[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C1O4230.2Semi standard non polar33892256
Sophorotriose,3TMS,isomer #116C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O4193.5Semi standard non polar33892256
Sophorotriose,3TMS,isomer #117C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C1O4233.3Semi standard non polar33892256
Sophorotriose,3TMS,isomer #118C[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C1O4205.3Semi standard non polar33892256
Sophorotriose,3TMS,isomer #119C[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C1O4226.1Semi standard non polar33892256
Sophorotriose,3TMS,isomer #12C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O)C3O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O4176.8Semi standard non polar33892256
Sophorotriose,3TMS,isomer #120C[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C1O[Si](C)(C)C4221.9Semi standard non polar33892256
Sophorotriose,3TMS,isomer #121C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O4196.9Semi standard non polar33892256
Sophorotriose,3TMS,isomer #122C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O4213.5Semi standard non polar33892256
Sophorotriose,3TMS,isomer #123C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O4203.4Semi standard non polar33892256
Sophorotriose,3TMS,isomer #124C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C4219.5Semi standard non polar33892256
Sophorotriose,3TMS,isomer #125C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O4245.6Semi standard non polar33892256
Sophorotriose,3TMS,isomer #126C[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1O4226.5Semi standard non polar33892256
Sophorotriose,3TMS,isomer #127C[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1O4236.9Semi standard non polar33892256
Sophorotriose,3TMS,isomer #128C[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O4236.7Semi standard non polar33892256
Sophorotriose,3TMS,isomer #129C[Si](C)(C)OC1C(O)C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O4219.5Semi standard non polar33892256
Sophorotriose,3TMS,isomer #13C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4218.9Semi standard non polar33892256
Sophorotriose,3TMS,isomer #130C[Si](C)(C)OC1C(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1O4229.4Semi standard non polar33892256
Sophorotriose,3TMS,isomer #131C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O4192.2Semi standard non polar33892256
Sophorotriose,3TMS,isomer #132C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C1O4233.5Semi standard non polar33892256
Sophorotriose,3TMS,isomer #133C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C1O4203.2Semi standard non polar33892256
Sophorotriose,3TMS,isomer #134C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C1O4223.4Semi standard non polar33892256
Sophorotriose,3TMS,isomer #135C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C1O[Si](C)(C)C4224.4Semi standard non polar33892256
Sophorotriose,3TMS,isomer #136C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O4188.0Semi standard non polar33892256
Sophorotriose,3TMS,isomer #137C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C1O4226.3Semi standard non polar33892256
Sophorotriose,3TMS,isomer #138C[Si](C)(C)OC1C(O)C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C1O4196.2Semi standard non polar33892256
Sophorotriose,3TMS,isomer #139C[Si](C)(C)OC1C(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)OC(CO)C(O)C1O4219.1Semi standard non polar33892256
Sophorotriose,3TMS,isomer #14C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4197.7Semi standard non polar33892256
Sophorotriose,3TMS,isomer #140C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O4205.0Semi standard non polar33892256
Sophorotriose,3TMS,isomer #141C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O4194.5Semi standard non polar33892256
Sophorotriose,3TMS,isomer #142C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C4211.3Semi standard non polar33892256
Sophorotriose,3TMS,isomer #143C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O4217.9Semi standard non polar33892256
Sophorotriose,3TMS,isomer #144C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C4228.9Semi standard non polar33892256
Sophorotriose,3TMS,isomer #145C[Si](C)(C)OC1C(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)OC(CO)C(O)C1O[Si](C)(C)C4227.6Semi standard non polar33892256
Sophorotriose,3TMS,isomer #146C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O)C1O4201.3Semi standard non polar33892256
Sophorotriose,3TMS,isomer #147C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O4214.6Semi standard non polar33892256
Sophorotriose,3TMS,isomer #148C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O4205.2Semi standard non polar33892256
Sophorotriose,3TMS,isomer #149C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C4219.2Semi standard non polar33892256
Sophorotriose,3TMS,isomer #15C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4209.7Semi standard non polar33892256
Sophorotriose,3TMS,isomer #150C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O4211.5Semi standard non polar33892256
Sophorotriose,3TMS,isomer #151C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O4199.0Semi standard non polar33892256
Sophorotriose,3TMS,isomer #152C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C4213.9Semi standard non polar33892256
Sophorotriose,3TMS,isomer #153C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O4210.2Semi standard non polar33892256
Sophorotriose,3TMS,isomer #154C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C4209.8Semi standard non polar33892256
Sophorotriose,3TMS,isomer #155C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C4212.5Semi standard non polar33892256
Sophorotriose,3TMS,isomer #156C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C1O4246.4Semi standard non polar33892256
Sophorotriose,3TMS,isomer #157C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1O4224.3Semi standard non polar33892256
Sophorotriose,3TMS,isomer #158C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1O4234.0Semi standard non polar33892256
Sophorotriose,3TMS,isomer #159C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C1O4219.2Semi standard non polar33892256
Sophorotriose,3TMS,isomer #16C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O4183.4Semi standard non polar33892256
Sophorotriose,3TMS,isomer #160C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C1O[Si](C)(C)C4229.8Semi standard non polar33892256
Sophorotriose,3TMS,isomer #161C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C4238.5Semi standard non polar33892256
Sophorotriose,3TMS,isomer #162C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O4235.1Semi standard non polar33892256
Sophorotriose,3TMS,isomer #163C[Si](C)(C)OC1C(O)C(CO)OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C1O4222.8Semi standard non polar33892256
Sophorotriose,3TMS,isomer #164C[Si](C)(C)OC1C(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)OC(CO)C(O)C1O[Si](C)(C)C4229.7Semi standard non polar33892256
Sophorotriose,3TMS,isomer #165C[Si](C)(C)OC1C(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O)OC(CO)C(O)C1O4237.7Semi standard non polar33892256
Sophorotriose,3TMS,isomer #17C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O4191.8Semi standard non polar33892256
Sophorotriose,3TMS,isomer #18C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O4211.3Semi standard non polar33892256
Sophorotriose,3TMS,isomer #19C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O4188.6Semi standard non polar33892256
Sophorotriose,3TMS,isomer #2C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O4194.4Semi standard non polar33892256
Sophorotriose,3TMS,isomer #20C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4236.1Semi standard non polar33892256
Sophorotriose,3TMS,isomer #21C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4207.8Semi standard non polar33892256
Sophorotriose,3TMS,isomer #22C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4222.5Semi standard non polar33892256
Sophorotriose,3TMS,isomer #23C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O4199.1Semi standard non polar33892256
Sophorotriose,3TMS,isomer #24C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C4210.7Semi standard non polar33892256
Sophorotriose,3TMS,isomer #25C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O4185.5Semi standard non polar33892256
Sophorotriose,3TMS,isomer #26C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4229.5Semi standard non polar33892256
Sophorotriose,3TMS,isomer #27C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4198.6Semi standard non polar33892256
Sophorotriose,3TMS,isomer #28C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4216.2Semi standard non polar33892256
Sophorotriose,3TMS,isomer #29C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O4192.7Semi standard non polar33892256
Sophorotriose,3TMS,isomer #3C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O4187.5Semi standard non polar33892256
Sophorotriose,3TMS,isomer #30C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C4203.6Semi standard non polar33892256
Sophorotriose,3TMS,isomer #31C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O4186.9Semi standard non polar33892256
Sophorotriose,3TMS,isomer #32C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O)C1O4178.7Semi standard non polar33892256
Sophorotriose,3TMS,isomer #33C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4209.7Semi standard non polar33892256
Sophorotriose,3TMS,isomer #34C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4200.5Semi standard non polar33892256
Sophorotriose,3TMS,isomer #35C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4213.9Semi standard non polar33892256
Sophorotriose,3TMS,isomer #36C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O4227.0Semi standard non polar33892256
Sophorotriose,3TMS,isomer #37C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O4219.5Semi standard non polar33892256
Sophorotriose,3TMS,isomer #38C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O4220.9Semi standard non polar33892256
Sophorotriose,3TMS,isomer #39C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C4232.4Semi standard non polar33892256
Sophorotriose,3TMS,isomer #4C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O4163.5Semi standard non polar33892256
Sophorotriose,3TMS,isomer #40C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O4223.9Semi standard non polar33892256
Sophorotriose,3TMS,isomer #41C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O4196.6Semi standard non polar33892256
Sophorotriose,3TMS,isomer #42C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C4208.6Semi standard non polar33892256
Sophorotriose,3TMS,isomer #43C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O4213.0Semi standard non polar33892256
Sophorotriose,3TMS,isomer #44C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C4221.2Semi standard non polar33892256
Sophorotriose,3TMS,isomer #45C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C4211.0Semi standard non polar33892256
Sophorotriose,3TMS,isomer #46C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O4219.6Semi standard non polar33892256
Sophorotriose,3TMS,isomer #47C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O4202.0Semi standard non polar33892256
Sophorotriose,3TMS,isomer #48C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O4225.9Semi standard non polar33892256
Sophorotriose,3TMS,isomer #49C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O4218.3Semi standard non polar33892256
Sophorotriose,3TMS,isomer #5C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4205.5Semi standard non polar33892256
Sophorotriose,3TMS,isomer #50C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O4190.4Semi standard non polar33892256
Sophorotriose,3TMS,isomer #51C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O4231.8Semi standard non polar33892256
Sophorotriose,3TMS,isomer #52C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O4200.9Semi standard non polar33892256
Sophorotriose,3TMS,isomer #53C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C4211.4Semi standard non polar33892256
Sophorotriose,3TMS,isomer #54C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O4191.6Semi standard non polar33892256
Sophorotriose,3TMS,isomer #55C[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O4216.7Semi standard non polar33892256
Sophorotriose,3TMS,isomer #56C[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O4208.0Semi standard non polar33892256
Sophorotriose,3TMS,isomer #57C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O)C1O4180.8Semi standard non polar33892256
Sophorotriose,3TMS,isomer #58C[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O4222.8Semi standard non polar33892256
Sophorotriose,3TMS,isomer #59C[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O4189.0Semi standard non polar33892256
Sophorotriose,3TMS,isomer #6C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4182.4Semi standard non polar33892256
Sophorotriose,3TMS,isomer #60C[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C4205.3Semi standard non polar33892256
Sophorotriose,3TMS,isomer #61C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O4169.3Semi standard non polar33892256
Sophorotriose,3TMS,isomer #62C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4212.4Semi standard non polar33892256
Sophorotriose,3TMS,isomer #63C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4189.2Semi standard non polar33892256
Sophorotriose,3TMS,isomer #64C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4194.9Semi standard non polar33892256
Sophorotriose,3TMS,isomer #65C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O4188.4Semi standard non polar33892256
Sophorotriose,3TMS,isomer #66C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C4197.6Semi standard non polar33892256
Sophorotriose,3TMS,isomer #67C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O4220.1Semi standard non polar33892256
Sophorotriose,3TMS,isomer #68C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O4188.8Semi standard non polar33892256
Sophorotriose,3TMS,isomer #69C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O4229.9Semi standard non polar33892256
Sophorotriose,3TMS,isomer #7C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4188.2Semi standard non polar33892256
Sophorotriose,3TMS,isomer #70C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O4197.9Semi standard non polar33892256
Sophorotriose,3TMS,isomer #71C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C4210.0Semi standard non polar33892256
Sophorotriose,3TMS,isomer #72C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O4183.2Semi standard non polar33892256
Sophorotriose,3TMS,isomer #73C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O4223.9Semi standard non polar33892256
Sophorotriose,3TMS,isomer #74C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O4191.1Semi standard non polar33892256
Sophorotriose,3TMS,isomer #75C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C4205.3Semi standard non polar33892256
Sophorotriose,3TMS,isomer #76C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O4194.3Semi standard non polar33892256
Sophorotriose,3TMS,isomer #77C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O4190.6Semi standard non polar33892256
Sophorotriose,3TMS,isomer #78C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C4201.0Semi standard non polar33892256
Sophorotriose,3TMS,isomer #79C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O4216.7Semi standard non polar33892256
Sophorotriose,3TMS,isomer #8C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O4181.8Semi standard non polar33892256
Sophorotriose,3TMS,isomer #80C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C4205.3Semi standard non polar33892256
Sophorotriose,3TMS,isomer #81C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C4214.6Semi standard non polar33892256
Sophorotriose,3TMS,isomer #82C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O4205.6Semi standard non polar33892256
Sophorotriose,3TMS,isomer #83C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O4178.2Semi standard non polar33892256
Sophorotriose,3TMS,isomer #84C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4225.9Semi standard non polar33892256
Sophorotriose,3TMS,isomer #85C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4202.1Semi standard non polar33892256
Sophorotriose,3TMS,isomer #86C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4214.9Semi standard non polar33892256
Sophorotriose,3TMS,isomer #87C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O4191.6Semi standard non polar33892256
Sophorotriose,3TMS,isomer #88C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C4202.5Semi standard non polar33892256
Sophorotriose,3TMS,isomer #89C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O4178.0Semi standard non polar33892256
Sophorotriose,3TMS,isomer #9C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C4194.1Semi standard non polar33892256
Sophorotriose,3TMS,isomer #90C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4220.0Semi standard non polar33892256
Sophorotriose,3TMS,isomer #91C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4195.9Semi standard non polar33892256
Sophorotriose,3TMS,isomer #92C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4211.4Semi standard non polar33892256
Sophorotriose,3TMS,isomer #93C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O4186.6Semi standard non polar33892256
Sophorotriose,3TMS,isomer #94C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C4197.4Semi standard non polar33892256
Sophorotriose,3TMS,isomer #95C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O4182.2Semi standard non polar33892256
Sophorotriose,3TMS,isomer #96C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O4172.6Semi standard non polar33892256
Sophorotriose,3TMS,isomer #97C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4197.5Semi standard non polar33892256
Sophorotriose,3TMS,isomer #98C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4191.4Semi standard non polar33892256
Sophorotriose,3TMS,isomer #99C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4201.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #1C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O4000.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #10C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O4010.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #100C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C4077.4Semi standard non polar33892256
Sophorotriose,4TMS,isomer #101C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O)C1O4039.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #102C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O4059.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #103C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O4038.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #104C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C4063.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #105C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O4052.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #106C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O4029.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #107C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O4050.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #108C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O4045.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #109C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O4043.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #11C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4115.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #110C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O4045.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #111C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O4106.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #112C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O4102.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #113C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C4116.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #114C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O4082.4Semi standard non polar33892256
Sophorotriose,4TMS,isomer #115C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C4093.4Semi standard non polar33892256
Sophorotriose,4TMS,isomer #116C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C4134.4Semi standard non polar33892256
Sophorotriose,4TMS,isomer #117C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O4083.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #118C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C4095.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #119C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C4078.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #12C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4054.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #120C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C4099.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #121C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O4057.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #122C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O4143.4Semi standard non polar33892256
Sophorotriose,4TMS,isomer #123C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O4127.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #124C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O)C1O4052.4Semi standard non polar33892256
Sophorotriose,4TMS,isomer #125C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O4170.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #126C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O4094.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #127C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C4126.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #128C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O4023.4Semi standard non polar33892256
Sophorotriose,4TMS,isomer #129C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4125.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #13C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4066.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #130C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4065.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #131C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4080.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #132C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O4047.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #133C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C4074.4Semi standard non polar33892256
Sophorotriose,4TMS,isomer #134C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O4136.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #135C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O4089.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #136C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O4173.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #137C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O4116.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #138C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C4142.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #139C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O4067.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #14C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O4041.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #140C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O4162.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #141C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O4089.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #142C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C4125.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #143C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O4083.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #144C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O4064.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #145C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C4090.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #146C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O4147.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #147C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C4119.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #148C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C4132.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #149C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O4011.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #15C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C4058.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #150C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4111.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #151C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4044.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #152C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4064.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #153C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O4033.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #154C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C4058.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #155C[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O4124.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #156C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O4076.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #157C[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O4167.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #158C[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O4094.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #159C[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C4131.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #16C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O3987.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #160C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O4054.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #161C[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O4153.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #162C[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O4065.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #163C[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C4109.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #164C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O4066.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #165C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O4044.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #166C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C4072.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #167C[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O4130.4Semi standard non polar33892256
Sophorotriose,4TMS,isomer #168C[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C4102.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #169C[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C4113.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #17C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4093.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #170C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O4004.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #171C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O3977.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #172C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4018.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #173C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4009.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #174C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4027.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #175C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O4084.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #176C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O4059.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #177C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O4076.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #178C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C4104.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #179C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O4058.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #18C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4026.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #180C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O4013.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #181C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C4040.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #182C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O4027.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #183C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C4056.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #184C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C4016.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #185C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O4045.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #186C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O4166.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #187C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O4089.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #188C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C4116.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #189C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O4082.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #19C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4042.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #190C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O4062.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #191C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C4090.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #192C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O4149.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #193C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C4118.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #194C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C4131.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #195C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O4058.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #196C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O4034.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #197C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C4065.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #198C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O4127.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #199C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C4094.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #2C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O3983.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #20C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O4020.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #200C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C4108.4Semi standard non polar33892256
Sophorotriose,4TMS,isomer #201C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O4032.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #202C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C4036.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #203C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C4036.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #204C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C4134.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #205C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O4044.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #206C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4147.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #207C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4093.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #208C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4112.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #209C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O4066.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #21C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C4034.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #210C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C4090.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #211C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O4038.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #212C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O4011.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #213C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4068.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #214C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4046.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #215C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4072.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #216C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O4127.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #217C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O4103.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #218C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O4104.4Semi standard non polar33892256
Sophorotriose,4TMS,isomer #219C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C4133.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #22C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O3990.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #220C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O4108.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #221C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O4043.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #222C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C4075.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #223C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O4071.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #224C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C4101.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #225C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C4048.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #226C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O4030.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #227C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O4009.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #228C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4062.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #229C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4037.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #23C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O)C1O3974.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #230C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4063.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #231C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O4118.4Semi standard non polar33892256
Sophorotriose,4TMS,isomer #232C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O4096.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #233C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O4094.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #234C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C4121.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #235C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O4097.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #236C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O4030.4Semi standard non polar33892256
Sophorotriose,4TMS,isomer #237C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C4061.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #238C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O4064.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #239C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C4091.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #24C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4004.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #240C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C4040.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #241C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O3997.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #242C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O4048.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #243C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O4026.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #244C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C4052.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #245C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O4021.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #246C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O4002.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #247C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O4027.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #248C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O4034.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #249C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O4033.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #25C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O3996.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #250C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O4034.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #251C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O4099.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #252C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O4079.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #253C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C4104.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #254C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O4049.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #255C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C4080.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #256C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C4080.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #257C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O4055.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #258C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C4086.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #259C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C4030.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #26C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4014.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #260C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C4041.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #261C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O4087.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #262C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O4188.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #263C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C1O4126.4Semi standard non polar33892256
Sophorotriose,4TMS,isomer #264C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C1O4156.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #265C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C1O[Si](C)(C)C4157.4Semi standard non polar33892256
Sophorotriose,4TMS,isomer #266C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O4111.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #267C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O4123.4Semi standard non polar33892256
Sophorotriose,4TMS,isomer #268C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O4095.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #269C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C4127.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #27C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O4072.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #270C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C1O4196.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #271C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1O4146.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #272C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1O4167.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #273C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O4159.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #274C[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C1O4145.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #275C[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C1O4174.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #276C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O4079.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #277C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O4115.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #278C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O4082.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #279C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C4116.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #28C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O4047.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #280C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O4182.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #281C[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1O4142.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #282C[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1O4162.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #283C[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O4155.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #284C[Si](C)(C)OC1C(O)C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O4112.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #285C[Si](C)(C)OC1C(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1O4150.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #286C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O4086.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #287C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O4068.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #288C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C4092.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #289C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O4083.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #29C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O4069.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #290C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C4079.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #291C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C4080.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #292C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O4130.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #293C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C4167.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #294C[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O4175.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #295C[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O[Si](C)(C)C4150.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #296C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O4091.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #297C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O4101.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #298C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O4067.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #299C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C4103.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #3C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C3O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O3955.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #30C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C4085.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #300C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C1O4187.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #301C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1O4127.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #302C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1O4154.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #303C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O4144.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #304C[Si](C)(C)OC1C(O)C(CO)OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C1O4120.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #305C[Si](C)(C)OC1C(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)OC(CO)C(O)C1O4162.4Semi standard non polar33892256
Sophorotriose,4TMS,isomer #306C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O4093.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #307C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O4052.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #308C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C4092.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #309C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O4120.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #31C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O4045.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #310C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C4145.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #311C[Si](C)(C)OC1C(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)OC(CO)C(O)C1O[Si](C)(C)C4134.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #312C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O4056.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #313C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C4051.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #314C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C4056.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #315C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C4158.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #316C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O4115.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #317C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O4093.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #318C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C4117.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #319C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O4082.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #32C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O4008.4Semi standard non polar33892256
Sophorotriose,4TMS,isomer #320C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C4080.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #321C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C4079.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #322C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O4073.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #323C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C4071.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #324C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C4071.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #325C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C4061.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #326C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C1O4155.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #327C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C1O[Si](C)(C)C4180.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #328C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O4170.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #329C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C4166.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #33C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C4026.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #330C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O[Si](C)(C)C4169.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #34C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O4024.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #35C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C4040.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #36C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C4003.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #37C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O4011.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #38C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O)C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O3997.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #39C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4090.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #4C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4046.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #40C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4037.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #41C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4057.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #42C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O4024.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #43C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C4035.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #44C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O)C3O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O3975.4Semi standard non polar33892256
Sophorotriose,4TMS,isomer #45C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4062.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #46C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4014.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #47C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4030.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #48C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O4005.4Semi standard non polar33892256
Sophorotriose,4TMS,isomer #49C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O4008.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #5C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O3996.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #50C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O3994.4Semi standard non polar33892256
Sophorotriose,4TMS,isomer #51C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O)C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O3988.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #52C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4027.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #53C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4005.4Semi standard non polar33892256
Sophorotriose,4TMS,isomer #54C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4032.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #55C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O4078.4Semi standard non polar33892256
Sophorotriose,4TMS,isomer #56C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O4063.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #57C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4073.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #58C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4087.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #59C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O4060.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #6C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4002.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #60C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4027.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #61C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4037.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #62C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4049.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #63C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4056.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #64C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O4041.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #65C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O4031.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #66C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4134.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #67C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4076.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #68C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4093.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #69C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O4066.4Semi standard non polar33892256
Sophorotriose,4TMS,isomer #7C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O3976.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #70C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C4078.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #71C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O4048.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #72C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O4038.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #73C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4078.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #74C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4055.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #75C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4083.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #76C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O4136.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #77C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O4112.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #78C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O4127.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #79C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C4143.0Semi standard non polar33892256
Sophorotriose,4TMS,isomer #8C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O4001.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #80C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O4118.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #81C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O4066.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #82C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C4083.8Semi standard non polar33892256
Sophorotriose,4TMS,isomer #83C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O4099.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #84C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C4112.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #85C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C4099.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #86C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O4023.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #87C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O4017.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #88C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O4053.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #89C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O4029.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #9C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O4039.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #90C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O4058.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #91C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O4113.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #92C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O4090.1Semi standard non polar33892256
Sophorotriose,4TMS,isomer #93C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O4103.6Semi standard non polar33892256
Sophorotriose,4TMS,isomer #94C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C4118.2Semi standard non polar33892256
Sophorotriose,4TMS,isomer #95C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O4091.7Semi standard non polar33892256
Sophorotriose,4TMS,isomer #96C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O4037.5Semi standard non polar33892256
Sophorotriose,4TMS,isomer #97C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C4054.3Semi standard non polar33892256
Sophorotriose,4TMS,isomer #98C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O4076.9Semi standard non polar33892256
Sophorotriose,4TMS,isomer #99C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C4087.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #1C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O3803.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #10C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O3777.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #100C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3854.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #101C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O3821.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #102C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C3829.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #103C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3848.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #104C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3854.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #105C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C3862.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #106C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O3809.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #107C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O)C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O3799.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #108C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O3823.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #109C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O3800.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #11C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O3795.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #110C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O3840.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #111C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O3843.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #112C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O3841.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #113C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O3855.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #114C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O3861.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #115C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3824.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #116C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O3795.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #117C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O3802.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #118C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3821.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #119C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3828.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #12C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O3787.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #120C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O3839.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #121C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O3829.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #122C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O3844.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #123C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O3825.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #124C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O3863.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #125C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O3835.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #126C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O3814.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #127C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O3853.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #128C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O3844.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #129C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3835.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #13C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O3811.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #130C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O3838.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #131C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3868.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #132C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O3858.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #133C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O3865.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #134C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O3857.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #135C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O3861.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #136C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O3892.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #137C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3841.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #138C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3847.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #139C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O3836.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #14C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O3785.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #140C[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O3851.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #141C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O3844.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #142C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O3836.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #143C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O3851.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #144C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O3830.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #145C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O3871.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #146C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O3895.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #147C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O3885.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #148C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O3904.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #149C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C3917.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #15C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C3O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O3761.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #150C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3878.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #151C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O3843.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #152C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C3857.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #153C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3866.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #154C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3876.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #155C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3895.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #156C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O3859.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #157C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O3864.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #158C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O3839.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #159C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C3882.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #16C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O3783.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #160C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O3856.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #161C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O3829.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #162C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O3872.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #163C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O3866.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #164C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3859.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #165C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O3863.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #166C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3913.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #167C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O3885.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #168C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C3897.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #169C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3882.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #17C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O3779.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #170C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3888.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #171C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3931.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #172C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3873.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #173C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3883.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #174C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3874.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #175C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C3891.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #176C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O3827.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #177C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O3835.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #178C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O3806.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #179C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C3853.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #18C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O3804.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #180C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O3825.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #181C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O3796.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #182C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O3842.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #183C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O3837.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #184C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3826.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #185C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O3833.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #186C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3880.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #187C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O3851.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #188C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C3865.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #189C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3851.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #19C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O3822.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #190C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3858.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #191C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3901.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #192C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3836.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #193C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3851.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #194C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3838.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #195C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C3860.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #196C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O3856.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #197C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O3837.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #198C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C3876.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #199C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3845.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #2C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O3787.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #20C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O3815.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #200C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3856.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #201C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C3847.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #202C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3841.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #203C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3851.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #204C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O3847.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #205C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3852.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #206C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3891.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #207C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3900.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #208C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3901.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #209C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C3890.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #21C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O3827.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #210C[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C3882.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #211C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O3822.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #212C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O3897.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #213C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O3840.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #214C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O3850.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #215C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O3843.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #216C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C3870.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #217C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O3909.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #218C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O3868.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #219C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O3945.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #22C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O3849.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #220C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O3875.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #221C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C3896.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #222C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O3836.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #223C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O3914.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #224C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O3836.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #225C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C3867.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #226C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O3852.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #227C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O3836.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #228C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C3875.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #229C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3905.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #23C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3801.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #230C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3892.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #231C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3883.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #232C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O3828.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #233C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O3806.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #234C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O3828.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #235C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O3815.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #236C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O3852.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #237C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O3875.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #238C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O3861.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #239C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O3869.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #24C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O3764.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #240C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C3896.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #241C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3854.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #242C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O3805.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #243C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C3834.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #244C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3824.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #245C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3852.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #246C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3850.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #247C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O3859.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #248C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O3940.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #249C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O3868.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #25C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O3791.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #250C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C3889.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #251C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O3865.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #252C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O3845.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #253C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C3890.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #254C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3909.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #255C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3899.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #256C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3894.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #257C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O3835.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #258C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O3809.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #259C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C3859.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #26C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O3780.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #260C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3873.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #261C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3868.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #262C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3854.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #263C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3847.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #264C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3851.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #265C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3854.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #266C[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C3912.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #267C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O3814.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #268C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O3788.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #269C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O3815.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #27C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O3807.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #270C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O3796.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #271C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O3837.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #272C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O3858.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #273C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O3848.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #274C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O3851.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #275C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C3881.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #276C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3837.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #277C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O3786.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #278C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C3815.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #279C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3806.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #28C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O3786.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #280C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3838.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #281C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3832.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #282C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O3842.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #283C[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O3924.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #284C[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O3845.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #285C[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C3874.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #286C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O3852.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #287C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O3827.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #288C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C3874.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #289C[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3891.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #29C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O3794.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #290C[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3884.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #291C[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3875.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #292C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O3816.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #293C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O3788.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #294C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C3837.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #295C[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3852.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #296C[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3849.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #297C[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3832.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #298C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3828.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #299C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3835.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #3C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O3850.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #30C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O3881.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #300C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3834.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #301C[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C3898.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #302C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O3786.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #303C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O3825.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #304C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O3808.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #305C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C3845.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #306C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O3797.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #307C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O3781.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #308C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O3822.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #309C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O3821.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #31C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O3820.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #310C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3812.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #311C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O3815.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #312C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3866.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #313C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O3835.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #314C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C3864.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #315C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3828.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #316C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3857.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #317C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3869.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #318C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3815.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #319C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3848.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #32C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O3829.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #320C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3807.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #321C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C3822.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #322C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O3844.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #323C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O3831.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #324C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C3871.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #325C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3899.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #326C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3885.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #327C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3879.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #328C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3854.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #329C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3857.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #33C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O3835.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #330C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3859.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #331C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C3914.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #332C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3816.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #333C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3822.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #334C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3825.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #335C[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C3881.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #336C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C3847.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #337C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O3854.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #338C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O3833.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #339C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O3860.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #34C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C3848.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #340C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O3844.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #341C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O3883.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #342C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O3907.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #343C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O3895.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #344C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O3901.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #345C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C3928.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #346C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3888.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #347C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O3839.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #348C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C3868.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #349C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3860.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #35C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O3817.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #350C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3887.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #351C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3884.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #352C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O3823.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #353C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O3855.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #354C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O3830.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #355C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C3874.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #356C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O3829.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #357C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O3806.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #358C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O3851.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #359C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O3855.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #36C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O3808.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #360C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3844.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #361C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O3849.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #362C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3901.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #363C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O3861.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #364C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C3889.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #365C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3851.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #366C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3880.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #367C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3895.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #368C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3847.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #369C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3876.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #37C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O3820.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #370C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3838.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #371C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C3857.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #372C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O3819.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #373C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O3849.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #374C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O3818.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #375C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C3863.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #376C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O3823.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #377C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O3794.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #378C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O3841.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #379C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O3849.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #38C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O3803.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #380C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3840.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #381C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O3844.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #382C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3890.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #383C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O3846.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #384C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C3873.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #385C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3845.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #386C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3871.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #387C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3889.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #388C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3833.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #389C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3861.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #39C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O3842.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #390C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3830.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #391C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C3852.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #392C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O3834.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #393C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O3817.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #394C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C3853.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #395C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3852.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #396C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3862.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #397C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C3854.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #398C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3823.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #399C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3836.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #4C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O3790.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #40C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O3864.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #400C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O3830.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #401C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3852.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #402C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3876.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #403C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3905.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #404C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3876.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #405C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C3869.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #406C[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C3861.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #407C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O3894.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #408C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O3881.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #409C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O3860.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #41C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O3855.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #410C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C3904.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #411C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3976.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #412C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1O3915.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #413C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1O3931.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #414C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O3917.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #415C[Si](C)(C)OC1C(O)C(CO)OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O3905.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #416C[Si](C)(C)OC1C(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)OC(CO)C(O)C1O3927.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #417C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O3899.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #418C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O3878.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #419C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C3921.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #42C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O3872.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #420C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3879.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #421C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3881.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #422C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3883.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #423C[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C1O3935.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #424C[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C1O3945.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #425C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O3948.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #426C[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O3931.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #427C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O3869.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #428C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O3842.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #429C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C3890.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #43C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C3885.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #430C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3868.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #431C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3870.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #432C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3874.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #433C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3905.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #434C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3909.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #435C[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O3932.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #436C[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O[Si](C)(C)C3897.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #437C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3875.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #438C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3876.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #439C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3881.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #44C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3847.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #440C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C3896.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #441C[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O[Si](C)(C)C3944.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #442C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O3870.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #443C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O3843.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #444C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O[Si](C)(C)C3892.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #445C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3849.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #446C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3850.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #447C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3853.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #448C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3907.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #449C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3908.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #45C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O3809.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #450C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O3916.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #451C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O[Si](C)(C)C3892.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #452C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3834.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #453C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3838.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #454C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3841.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #455C[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C3897.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #456C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C3863.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #457C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3883.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #458C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3886.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #459C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3892.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #46C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C3821.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #460C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C3883.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #461C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C3878.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #462C[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C1O[Si](C)(C)C3948.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #47C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3833.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #48C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3842.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #49C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3846.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #5C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O3805.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #50C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O3788.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #51C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C)C(O)C(O)C1O3775.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #52C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O3787.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #53C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O3768.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #54C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O3812.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #55C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O3830.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #56C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O3822.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #57C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O3838.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #58C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C3855.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #59C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3811.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #6C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O3802.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #60C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O3772.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #61C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C3785.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #62C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3794.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #63C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3810.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #64C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3812.2Semi standard non polar33892256
Sophorotriose,5TMS,isomer #65C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O)C1O3786.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #66C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O3809.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #67C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O3791.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #68C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C3830.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #69C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O[Si](C)(C)C)C(O)C1O3798.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #7C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C3821.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #70C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C3O[Si](C)(C)C)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C)C1O3777.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #71C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O3820.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #72C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O3806.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #73C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3798.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #74C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O3801.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #75C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O3854.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #76C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O3835.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #77C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O[Si](C)(C)C3848.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #78C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3829.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #79C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3840.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #8C[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O)C(O)C(O)C1O3773.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #80C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3858.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #81C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O3816.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #82C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C1O[Si](C)(C)C3830.8Semi standard non polar33892256
Sophorotriose,5TMS,isomer #83C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C3799.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #84C[Si](C)(C)OCC1OC(O[Si](C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C3814.0Semi standard non polar33892256
Sophorotriose,5TMS,isomer #85C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O)C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)C(O)C1O3805.3Semi standard non polar33892256
Sophorotriose,5TMS,isomer #86C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O3866.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #87C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O3811.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #88C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O3829.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #89C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C)C1O3831.5Semi standard non polar33892256
Sophorotriose,5TMS,isomer #9C[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O3840.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #90C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C3831.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #91C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C3O)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O3836.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #92C[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C)C(O)C3O[Si](C)(C)C)OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C(O)C1O3823.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #93C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(CO[Si](C)(C)C)C(O)C(O)C2O[Si](C)(C)C)C(O)C1O3846.9Semi standard non polar33892256
Sophorotriose,5TMS,isomer #94C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(CO[Si](C)(C)C)C(O)C(O[Si](C)(C)C)C2O)C(O)C1O3826.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #95C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O3863.1Semi standard non polar33892256
Sophorotriose,5TMS,isomer #96C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)C1O3868.6Semi standard non polar33892256
Sophorotriose,5TMS,isomer #97C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)C1O3867.7Semi standard non polar33892256
Sophorotriose,5TMS,isomer #98C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)C1O3879.4Semi standard non polar33892256
Sophorotriose,5TMS,isomer #99C[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C)C(O[Si](C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C3886.0Semi standard non polar33892256
Sophorotriose,1TBDMS,isomer #1CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O4481.2Semi standard non polar33892256
Sophorotriose,1TBDMS,isomer #10CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O4507.2Semi standard non polar33892256
Sophorotriose,1TBDMS,isomer #11CC(C)(C)[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C1O4503.5Semi standard non polar33892256
Sophorotriose,1TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O4505.1Semi standard non polar33892256
Sophorotriose,1TBDMS,isomer #3CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O4479.0Semi standard non polar33892256
Sophorotriose,1TBDMS,isomer #4CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)C1O4505.7Semi standard non polar33892256
Sophorotriose,1TBDMS,isomer #5CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2C(O)OC(CO)C(O)C2O)C1OC1OC(CO)C(O)C(O)C1O4511.1Semi standard non polar33892256
Sophorotriose,1TBDMS,isomer #6CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O4473.2Semi standard non polar33892256
Sophorotriose,1TBDMS,isomer #7CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O)C1O4521.6Semi standard non polar33892256
Sophorotriose,1TBDMS,isomer #8CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C1O4503.5Semi standard non polar33892256
Sophorotriose,1TBDMS,isomer #9CC(C)(C)[Si](C)(C)OC1C(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)OC(CO)C(O)C1O4504.3Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #1CC(C)(C)[Si](C)(C)OCC1OC(O[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O4598.0Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #10CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C4605.0Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #11CC(C)(C)[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O4635.4Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #12CC(C)(C)[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O4629.0Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #13CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O4603.1Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #14CC(C)(C)[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O4636.4Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #15CC(C)(C)[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O4632.1Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #16CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O4593.3Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #17CC(C)(C)[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O4645.5Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #18CC(C)(C)[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O4623.8Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #19CC(C)(C)[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C4621.2Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #2CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O4583.3Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #20CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O4606.3Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #21CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O4599.0Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #22CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O)C1O4575.2Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #23CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C1O4623.0Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #24CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O4598.3Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #25CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O4594.8Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #26CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O4607.5Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #27CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C4614.1Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #28CC(C)(C)[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O)C1O4629.3Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #29CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C1O4622.1Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #3CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O4611.0Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #30CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C1O4606.0Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #31CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O4646.3Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #32CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C1O4626.3Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #33CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C1O4623.7Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #34CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)C1O[Si](C)(C)C(C)(C)C4648.5Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #35CC(C)(C)[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C1O4626.4Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #36CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O4616.9Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #37CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O4599.0Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #38CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O4644.0Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #39CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C1O4621.6Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #4CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O4603.9Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #40CC(C)(C)[Si](C)(C)OC1C(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1O4617.2Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #41CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O4595.7Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #42CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C(O)C(O)C1O4589.3Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #43CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O4595.9Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #44CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O4603.0Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #45CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C4608.2Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #46CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C3O)OC(CO)C(O)C2O)C(O)C1O4640.0Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #47CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C(O)C1O4633.9Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #48CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O4621.6Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #49CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C4641.5Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #5CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O4570.9Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #50CC(C)(C)[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C1O4618.8Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #51CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C1O4612.4Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #52CC(C)(C)[Si](C)(C)OC1C(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C4631.6Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #53CC(C)(C)[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C1O4619.3Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #54CC(C)(C)[Si](C)(C)OC1C(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)OC(CO)C(O)C1O4612.1Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #55CC(C)(C)[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C1O[Si](C)(C)C(C)(C)C4638.2Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #6CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C1O4619.3Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #7CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O4597.1Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #8CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O4592.8Semi standard non polar33892256
Sophorotriose,2TBDMS,isomer #9CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O4595.9Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #1CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C(C)(C)C)OC(CO[Si](C)(C)C(C)(C)C)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O4627.7Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #10CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O4662.3Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #100CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O4716.5Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #101CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O4711.5Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #102CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O4729.5Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #103CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C4741.6Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #104CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(O)C1O4709.7Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #105CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O[Si](C)(C)C(C)(C)C)C1O4695.5Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #106CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O[Si](C)(C)C(C)(C)C4706.3Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #107CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O4692.6Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #108CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C4712.8Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #109CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C4734.7Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #11CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O4652.8Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #110CC(C)(C)[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C1O4749.2Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #111CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C1O4686.2Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #112CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C3O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O4744.4Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #113CC(C)(C)[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C1O4719.5Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #114CC(C)(C)[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C1O4715.8Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #115CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C1O4753.1Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #116CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C1O4689.2Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #117CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O4743.9Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #118CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C1O4721.3Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #119CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C1O4718.3Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #12CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C3O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O)C1O4580.7Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #120CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C1O[Si](C)(C)C(C)(C)C4748.5Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #121CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O4707.1Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #122CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O4710.4Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #123CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O4710.6Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #124CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C4725.8Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #125CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(O)C1O4769.8Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #126CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C1O4743.2Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #127CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C1O4752.5Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #128CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C1O4745.9Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #129CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C1O4741.7Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #13CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C1O4666.7Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #130CC(C)(C)[Si](C)(C)OC1C(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1O4741.3Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #131CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O4677.7Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #132CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O4738.8Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #133CC(C)(C)[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C1O4714.8Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #134CC(C)(C)[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C1O4709.6Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #135CC(C)(C)[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C1O[Si](C)(C)C(C)(C)C4750.1Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #136CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O4681.0Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #137CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O4737.3Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #138CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C1O4713.3Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #139CC(C)(C)[Si](C)(C)OC1C(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1O4711.8Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #14CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O4641.9Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #140CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C1O4693.8Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #141CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C1O4698.5Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #142CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O[Si](C)(C)C(C)(C)C4712.8Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #143CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O4734.2Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #144CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C4744.3Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #145CC(C)(C)[Si](C)(C)OC1C(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C4737.8Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #146CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C(O)C(O)C1O4695.9Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #147CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O4682.9Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #148CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C3O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O4687.0Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #149CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C4698.0Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #15CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O4639.6Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #150CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O4686.9Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #151CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O4690.5Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #152CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C4699.2Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #153CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O4708.9Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #154CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C4713.7Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #155CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C4718.9Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #156CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C(O)C1O4751.3Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #157CC(C)(C)[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C1O4719.6Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #158CC(C)(C)[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C1O4728.0Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #159CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O4720.3Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #16CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O4646.2Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #160CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C4729.4Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #161CC(C)(C)[Si](C)(C)OC1C(CO)OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C4756.6Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #162CC(C)(C)[Si](C)(C)OC1C(CO)OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C1O4724.7Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #163CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C1O4722.3Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #164CC(C)(C)[Si](C)(C)OC1C(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C4725.0Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #165CC(C)(C)[Si](C)(C)OC1C(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)OC(CO)C(O)C1O4727.1Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #17CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O4650.9Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #18CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O4715.6Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #19CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C3O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C1O4637.1Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #2CC(C)(C)[Si](C)(C)OCC1OC(O[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O4707.0Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #20CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C1O4724.6Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #21CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O4695.9Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #22CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O4698.2Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #23CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O4713.0Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #24CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C4717.4Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #25CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O4633.8Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #26CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C1O4713.9Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #27CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O4685.3Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #28CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O4682.1Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #29CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O4703.4Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #3CC(C)(C)[Si](C)(C)OCC1OC(O[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O4692.3Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #30CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C4706.9Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #31CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O4628.7Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #32CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C(O)C(O)C1O4623.9Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #33CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O4639.7Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #34CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O4642.5Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #35CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C1O4652.4Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #36CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O4705.7Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #37CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O4699.3Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #38CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O4712.4Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #39CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C4717.7Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #4CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C(C)(C)C)OC(CO[Si](C)(C)C(C)(C)C)C(O)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O4602.8Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #40CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(O)C1O4699.2Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #41CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O[Si](C)(C)C(C)(C)C)C1O4686.0Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #42CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O[Si](C)(C)C(C)(C)C4690.4Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #43CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O4687.5Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #44CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C4691.9Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #45CC(C)(C)[Si](C)(C)OCC1OC(O)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C4721.3Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #46CC(C)(C)[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O4750.1Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #47CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C(C)(C)C)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O4711.2Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #48CC(C)(C)[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O4751.9Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #49CC(C)(C)[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O4743.6Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #5CC(C)(C)[Si](C)(C)OCC1OC(O[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C1O4700.3Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #50CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C(C)(C)C)OC(CO)C(O[Si](C)(C)C(C)(C)C)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O4687.8Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #51CC(C)(C)[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O4744.0Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #52CC(C)(C)[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O4721.1Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #53CC(C)(C)[Si](C)(C)OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C4718.4Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #54CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O4705.4Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #55CC(C)(C)[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O4747.8Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #56CC(C)(C)[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O4738.5Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #57CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C(O)C(O)C1O4682.2Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #58CC(C)(C)[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O4739.0Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #59CC(C)(C)[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O4716.0Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #6CC(C)(C)[Si](C)(C)OCC1OC(O[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O4678.4Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #60CC(C)(C)[Si](C)(C)OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C4714.4Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #61CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C3O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O)C1O4612.4Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #62CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C1O4709.9Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #63CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O4687.3Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #64CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O4677.3Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #65CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O4696.0Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #66CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C4714.7Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #67CC(C)(C)[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O4750.7Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #68CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C1O4692.6Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #69CC(C)(C)[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O4747.4Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #7CC(C)(C)[Si](C)(C)OCC1OC(O[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O4667.9Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #70CC(C)(C)[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O4723.9Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #71CC(C)(C)[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C4721.3Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #72CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O4680.9Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #73CC(C)(C)[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O4739.4Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #74CC(C)(C)[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O4716.5Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #75CC(C)(C)[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1OC1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C4711.7Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #76CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O4677.2Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #77CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O4687.6Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #78CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O[Si](C)(C)C(C)(C)C)OC(CO)C(O)C3O)OC(CO)C(O)C2O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C4693.2Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #79CC(C)(C)[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1O4729.3Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #8CC(C)(C)[Si](C)(C)OCC1OC(O[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O4688.3Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #80CC(C)(C)[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O[Si](C)(C)C(C)(C)C4724.3Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #81CC(C)(C)[Si](C)(C)OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O)C1OC1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C4723.9Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #82CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O4716.8Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #83CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C3O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O)C1O4625.1Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #84CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C1O4712.6Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #85CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O4681.7Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #86CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O4682.6Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #87CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O4703.9Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #88CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O[Si](C)(C)C(C)(C)C)C2O)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C4712.8Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #89CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O[Si](C)(C)C(C)(C)C)OC(CO[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C(O)C1O4627.7Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #9CC(C)(C)[Si](C)(C)OCC1OC(O[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O)C(O)C2OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C4692.1Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #90CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C1O4714.2Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #91CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O4686.8Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #92CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O4686.2Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #93CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)C1O4704.5Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #94CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O[Si](C)(C)C(C)(C)C)C(OC2OC(CO)C(O)C(O)C2O)C(O)C1O[Si](C)(C)C(C)(C)C4715.1Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #95CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C(O)C1O4651.5Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #96CC(C)(C)[Si](C)(C)OCC1OC(OC2C(OC3C(O)OC(CO)C(O)C3O)OC(CO[Si](C)(C)C(C)(C)C)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C(O)C1O4642.0Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #97CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)C1O4648.1Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #98CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)C1O4650.6Semi standard non polar33892256
Sophorotriose,3TBDMS,isomer #99CC(C)(C)[Si](C)(C)OCC1OC(OC2C(O)OC(CO)C(O)C2O)C(OC2OC(CO[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)C1O4664.1Semi standard non polar33892256
Spectra

GC-MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted GC-MSPredicted GC-MS Spectrum - Sophorotriose GC-MS (Non-derivatized) - 70eV, Positivesplash10-01pc-2202900000-2c3f3e3db77eb8de29962017-09-01Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Sophorotriose GC-MS (2 TMS) - 70eV, Positivesplash10-001i-3401039000-6153cc1ae689d8dd2aae2017-10-06Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Sophorotriose GC-MS (TMS_3_120) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Sophorotriose GC-MS (TMS_3_121) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Sophorotriose GC-MS (TMS_3_125) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Sophorotriose GC-MS (TMS_3_129) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Sophorotriose GC-MS (TMS_3_130) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Sophorotriose GC-MS (TMS_3_165) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Sophorotriose GC-MS (TMS_4_65) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Sophorotriose GC-MS (TMS_4_121) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Sophorotriose GC-MS (TMS_4_134) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Sophorotriose GC-MS (TMS_4_155) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Sophorotriose GC-MS (TMS_4_185) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Sophorotriose GC-MS (TMS_4_206) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Sophorotriose GC-MS (TMS_4_207) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Sophorotriose GC-MS (TMS_4_241) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Sophorotriose GC-MS (TMS_4_261) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Sophorotriose GC-MS (TMS_4_262) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Sophorotriose GC-MS (TMS_4_274) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Sophorotriose GC-MS (TMS_4_276) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Sophorotriose GC-MS (TMS_4_280) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Sophorotriose GC-MS (TMS_4_284) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Sophorotriose GC-MS (TMS_4_285) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Sophorotriose GC-MS (TMS_4_286) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - Sophorotriose GC-MS (TMS_4_287) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum

MS/MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Sophorotriose 10V, Positive-QTOFsplash10-08j0-0903320000-61d989def6f857205fa62015-04-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Sophorotriose 20V, Positive-QTOFsplash10-03e9-0901000000-1d91796091560d86d9192015-04-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Sophorotriose 40V, Positive-QTOFsplash10-03di-3901000000-49fb8f4438efa4b2464d2015-04-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Sophorotriose 10V, Positive-QTOFsplash10-08j0-0903320000-61d989def6f857205fa62015-04-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Sophorotriose 20V, Positive-QTOFsplash10-03e9-0901000000-1d91796091560d86d9192015-04-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Sophorotriose 40V, Positive-QTOFsplash10-03di-3901000000-49fb8f4438efa4b2464d2015-04-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Sophorotriose 10V, Negative-QTOFsplash10-0wbi-3946650000-2de423a7f45e1d1a28a32015-04-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Sophorotriose 20V, Negative-QTOFsplash10-0200-2913200000-6c2d58cf804cd196c6f82015-04-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Sophorotriose 40V, Negative-QTOFsplash10-004i-3911000000-e64d3b02f0be6d3660dd2015-04-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Sophorotriose 10V, Negative-QTOFsplash10-0wbi-3946650000-2de423a7f45e1d1a28a32015-04-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Sophorotriose 20V, Negative-QTOFsplash10-0200-2913200000-6c2d58cf804cd196c6f82015-04-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Sophorotriose 40V, Negative-QTOFsplash10-004i-3911000000-e64d3b02f0be6d3660dd2015-04-25Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Sophorotriose 10V, Negative-QTOFsplash10-0udi-0002290000-d6943f1f6697f79e27562021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Sophorotriose 20V, Negative-QTOFsplash10-0pb9-8305930000-195701da0e3a256863a12021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Sophorotriose 40V, Negative-QTOFsplash10-0a6u-9314200000-ab5b58ff64df3ffb641d2021-09-22Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Sophorotriose 10V, Positive-QTOFsplash10-0670-0000930000-c373c836f2d8ef49481f2021-09-23Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Sophorotriose 20V, Positive-QTOFsplash10-0a4s-1704930000-6d6f95d88a82dea9b9802021-09-23Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - Sophorotriose 40V, Positive-QTOFsplash10-0544-9302400000-bec7fd193ca6524d61022021-09-23Wishart LabView Spectrum

NMR Spectra

Spectrum TypeDescriptionDeposition DateSourceView
Predicted 1D NMR13C NMR Spectrum (1D, 100 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 100 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 1000 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 1000 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 200 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 200 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 300 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 300 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 400 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 400 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 500 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 500 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 600 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 600 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 700 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 700 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 800 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 800 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 900 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 900 MHz, D2O, predicted)2021-09-24Wishart LabView Spectrum
Biological Properties
Cellular Locations
  • Cytoplasm
  • Extracellular
Biospecimen LocationsNot Available
Tissue LocationsNot Available
Pathways
Normal Concentrations
Not Available
Abnormal Concentrations
Not Available
Associated Disorders and Diseases
Disease ReferencesNone
Associated OMIM IDsNone
DrugBank IDNot Available
Phenol Explorer Compound IDNot Available
FooDB IDFDB020843
KNApSAcK IDNot Available
Chemspider IDNot Available
KEGG Compound IDNot Available
BioCyc IDNot Available
BiGG IDNot Available
Wikipedia LinkNot Available
METLIN IDNot Available
PubChem Compound13242851
PDB IDNot Available
ChEBI IDNot Available
Food Biomarker OntologyNot Available
VMH IDNot Available
MarkerDB IDNot Available
Good Scents IDNot Available
References
Synthesis ReferenceNot Available
Material Safety Data Sheet (MSDS)Not Available
General References
  1. (). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .