Showing metabocard for CL(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) (HMDB0059328)
Record Information | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Expected but not Quantified | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2012-10-09 08:21:21 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2022-11-30 19:11:44 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0059328 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | CL(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | CL(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) is a cardiolipin (CL). Cardiolipins are sometimes called 'double' phospholipids because they have four fatty acid tails, instead of the usual two. They are glycerophospholipids in which the O1 and O3 oxygen atoms of the central glycerol moiety are each linked to one 1,3-diacylglyerol chain. Their general formula is OC(COP(O)(=O)OC[C@@H](CO[R1])O[R2])COP(O)(=O)OC[C@@H](CO[R3])O[R4], where R1-R4 are four fatty acyl chains. CL(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) contains one chain of (4Z,7Z,10Z,13Z,16Z-docosapentaenoyl) at the C1 position, one chain of (5Z,8Z,11Z,14Z-eicosatetraenoyl) at the C2 position, two chains of (7Z,10Z,13Z,16Z,19Z-docosapentaenoyl) at the C3 and C4 positions fatty acids. Cardiolipins are known to be present in all mammalian cells, especially cells with a high number of mitochondria. De novo synthesis of Cardiolipins begins with condensing phosphatidic acid (PA) with cytidine-5’-triphosphate (CTP) to form cytidine-diphosphate-1,2-diacyl-sn-glycerol (CDP-DG). Glycerol-3-phosphate is subsequently added to this newly formed CDP-DG molecule to form phosphatidylglycerol phosphate (PGP), which is immediately dephosphorylated to form PG. The final step is the process of condensing the PG molecule with another CDP-DG molecule to form a new cardiolipin, which is catalyzed by cardiolipin synthase. All new cardiolipins immediately undergo a series remodeling resulting in the common cardiolipin compositions. (PMID: 16442164 ). Cardiolipin synthase shows no selectivity for fatty acyl chains used in the de novo synthesis of cardiolipin (PMID: 16442164 ). Cardiolipins (bisphosphatidyl glycerol) are an important component of the inner mitochondrial membrane, where they constitute about 20% of the total lipid. While most lipids are made in the endoplasmic reticulum, cardiolipin is synthesized on the matrix side of the inner mitochondrial membrane and are important for mitochondrial respiratory capacity. They are highly abundant in metabolically active cells (heart, muscle) and play an important role in the blood clotting process. Tafazzin is an important enzyme in the remodeling of cardiolipins, and in contrast to cardiolipin synthase, it shows strong acyl specificity. This suggests that the specificity in cardiolipin composition is achieved through the remodeling steps. Mutation in the tafazzin gene disrupts the remodeling of cardiolipins and is the cause of Barth syndrome (BTHS), an X-linked human disease (PMID: 16973164 ). BTHS patients seem to lack acyl specificity. As a result, there are many potential cardiolipin species that can exist (PMID: 16226238 ). | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0059328 (CL(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)))CL(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) Mrv1652308071921212D 117116 0 0 1 0 999 V2000 28.9801 -8.8497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 28.3984 -7.9046 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 28.9258 -6.9281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 28.4528 -9.8262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 28.3440 -5.9830 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 29.2253 -7.6197 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 27.5639 -7.5431 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 26.6598 -4.7192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 25.6987 -5.2740 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 24.7374 -4.7192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 27.6210 -5.2740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 23.7762 -5.2740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 24.8926 -6.0903 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 26.4795 -6.1326 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 28.8473 -4.8685 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 29.9759 -5.1901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 28.8473 -3.5722 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 24.9410 -9.2713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 23.9798 -9.8262 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 23.0186 -9.2713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 25.9022 -9.8262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 22.0574 -9.8262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 23.1458 -10.6705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 24.7327 -10.7128 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 27.1285 -9.3528 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 27.1285 -8.5278 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 26.7090 -10.4093 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 23.0617 -4.8616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 23.0617 -4.0901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 22.3476 -5.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.6335 -4.8616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.9194 -5.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.0944 -5.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.3803 -4.8616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.6662 -5.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.8412 -5.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.1270 -4.8616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.4129 -5.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.5879 -5.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.8738 -4.8616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.1597 -5.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3347 -5.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.6206 -4.8616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9065 -5.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0815 -5.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3674 -4.8616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6532 -5.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9391 -4.8616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2250 -5.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5109 -4.8616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 24.1782 -6.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 24.1782 -7.2742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 23.4641 -6.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.7500 -6.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.0358 -6.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.3217 -6.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.4967 -6.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.7826 -6.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.0685 -6.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.2435 -6.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.5294 -6.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.8153 -6.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.9903 -6.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.2762 -6.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.5621 -6.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.7371 -6.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.0229 -6.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3088 -6.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.5947 -6.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8806 -6.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1665 -6.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.3430 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.3430 -8.6423 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 20.6288 -9.8268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.9147 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.2006 -9.8268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.4865 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.7723 -9.8268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.0582 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.2332 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.5191 -9.8268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.8050 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.9800 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.2659 -9.8268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.5518 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7268 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0127 -9.8268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2985 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4735 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7594 -9.8268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0453 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2204 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5063 -9.8268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7921 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.4314 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.4314 -11.8544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 21.7173 -10.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.0032 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.2890 -10.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.5749 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.8608 -10.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.1467 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.3218 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.6076 -10.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.8935 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.0685 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.3544 -10.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.6403 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8153 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1012 -10.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3871 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5621 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8480 -10.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1339 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3089 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5947 -10.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8806 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 0 0 0 0 2 6 1 0 0 0 0 2 7 1 1 0 0 0 3 2 1 0 0 0 0 4 1 1 0 0 0 0 5 3 1 0 0 0 0 9 8 1 0 0 0 0 9 13 1 0 0 0 0 9 14 1 1 0 0 0 10 9 1 0 0 0 0 11 8 1 0 0 0 0 12 10 1 0 0 0 0 12 28 1 0 0 0 0 13 51 1 0 0 0 0 15 16 1 0 0 0 0 15 17 2 0 0 0 0 15 5 1 0 0 0 0 15 11 1 0 0 0 0 19 18 1 0 0 0 0 19 23 1 0 0 0 0 19 24 1 1 0 0 0 20 19 1 0 0 0 0 21 18 1 0 0 0 0 22 20 1 0 0 0 0 22 72 1 0 0 0 0 23 95 1 0 0 0 0 25 4 1 0 0 0 0 25 26 2 0 0 0 0 25 27 1 0 0 0 0 25 21 1 0 0 0 0 28 29 2 0 0 0 0 28 30 1 0 0 0 0 30 31 1 0 0 0 0 31 32 1 0 0 0 0 32 33 2 0 0 0 0 33 34 1 0 0 0 0 34 35 1 0 0 0 0 35 36 2 0 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 38 39 2 0 0 0 0 39 40 1 0 0 0 0 40 41 1 0 0 0 0 41 42 2 0 0 0 0 42 43 1 0 0 0 0 43 44 1 0 0 0 0 44 45 2 0 0 0 0 45 46 1 0 0 0 0 46 47 1 0 0 0 0 47 48 1 0 0 0 0 48 49 1 0 0 0 0 49 50 1 0 0 0 0 51 52 2 0 0 0 0 51 53 1 0 0 0 0 53 54 1 0 0 0 0 54 55 1 0 0 0 0 55 56 1 0 0 0 0 56 57 2 0 0 0 0 57 58 1 0 0 0 0 58 59 1 0 0 0 0 59 60 2 0 0 0 0 60 61 1 0 0 0 0 61 62 1 0 0 0 0 62 63 2 0 0 0 0 63 64 1 0 0 0 0 64 65 1 0 0 0 0 65 66 2 0 0 0 0 66 67 1 0 0 0 0 67 68 1 0 0 0 0 68 69 1 0 0 0 0 69 70 1 0 0 0 0 70 71 1 0 0 0 0 72 73 2 0 0 0 0 72 74 1 0 0 0 0 74 75 1 0 0 0 0 75 76 1 0 0 0 0 76 77 1 0 0 0 0 77 78 1 0 0 0 0 78 79 1 0 0 0 0 79 80 2 0 0 0 0 80 81 1 0 0 0 0 81 82 1 0 0 0 0 82 83 2 0 0 0 0 83 84 1 0 0 0 0 84 85 1 0 0 0 0 85 86 2 0 0 0 0 86 87 1 0 0 0 0 87 88 1 0 0 0 0 88 89 2 0 0 0 0 89 90 1 0 0 0 0 90 91 1 0 0 0 0 91 92 2 0 0 0 0 92 93 1 0 0 0 0 93 94 1 0 0 0 0 95 96 2 0 0 0 0 95 97 1 0 0 0 0 97 98 1 0 0 0 0 98 99 1 0 0 0 0 99100 1 0 0 0 0 100101 1 0 0 0 0 101102 1 0 0 0 0 102103 2 0 0 0 0 103104 1 0 0 0 0 104105 1 0 0 0 0 105106 2 0 0 0 0 106107 1 0 0 0 0 107108 1 0 0 0 0 108109 2 0 0 0 0 109110 1 0 0 0 0 110111 1 0 0 0 0 111112 2 0 0 0 0 112113 1 0 0 0 0 113114 1 0 0 0 0 114115 2 0 0 0 0 115116 1 0 0 0 0 116117 1 0 0 0 0 M END 3D MOL for HMDB0059328 (CL(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)))HMDB0059328 RDKit 3D CL(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(... 262261 0 0 0 0 0 0 0 0999 V2000 2.4044 7.4102 4.7129 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4690 8.6299 3.7800 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4718 9.8156 4.6655 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3746 10.7180 4.7124 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6426 10.7884 3.8771 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4935 12.0597 3.1322 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5889 12.2257 1.8895 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9061 11.1161 0.8926 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1756 11.7171 0.2864 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3213 12.0803 -0.9313 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2775 11.9439 -1.9485 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8308 11.5538 -3.2574 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7427 10.5797 -4.0415 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9548 9.3262 -3.8636 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7994 9.3846 -4.8185 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6185 8.9893 -4.3703 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2917 8.4656 -3.0647 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4484 9.1842 -2.0892 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1102 8.2213 -0.9669 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2874 7.5545 -0.3044 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7113 6.5874 0.7151 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7169 5.7319 1.3883 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6367 6.1544 2.0923 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6099 4.3880 1.2241 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2955 3.3092 1.7250 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7741 2.0496 0.9257 C 0 0 2 0 0 0 0 0 0 0 0 0 2.7732 0.9011 1.8002 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9964 -0.1946 1.4693 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0372 -1.3996 2.6526 P 0 0 0 0 0 5 0 0 0 0 0 0 3.4382 -1.9554 2.7166 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7003 -0.7902 4.2075 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8923 -2.5686 2.2135 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4422 -3.6698 1.6669 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3491 -4.7040 1.3489 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6044 -4.1490 0.5455 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0880 -5.7055 0.4205 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2873 -6.6518 -0.1456 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3449 -7.6846 -1.1227 P 0 0 0 0 0 5 0 0 0 0 0 0 0.8490 -9.1123 -1.0013 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9629 -7.2095 -2.7203 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8528 -7.4079 -0.7787 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9713 -8.0330 -0.6693 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9955 -7.0169 -0.1215 C 0 0 1 0 0 0 0 0 0 0 0 0 6.1836 -7.6194 0.5232 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8967 -8.7788 1.2758 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9613 -8.9098 2.2746 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2478 -7.9262 2.5739 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7617 -10.1613 3.0098 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3753 -10.5232 3.4552 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4272 -10.7273 2.3765 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2694 -10.1528 2.2771 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7725 -9.2057 3.2757 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4206 -9.8624 3.9675 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6136 -9.4210 4.0158 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2104 -8.1864 3.4449 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3318 -8.6565 2.5733 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5835 -8.3436 1.3381 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6677 -7.3588 0.6336 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6460 -6.2730 0.2395 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7753 -5.8852 -0.9831 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0131 -6.4185 -2.1111 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9251 -7.0225 -3.1173 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0617 -6.5626 -4.3573 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3242 -5.3942 -4.8438 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4267 -5.7968 -6.0111 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4280 -6.8211 -5.5962 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5214 -7.1186 -6.7869 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2089 -5.8728 -7.2097 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1162 -5.8838 -0.9128 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7175 -4.6058 -0.4093 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3868 -4.7469 0.8328 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6305 -3.3280 -1.0126 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7666 -2.4070 -1.2140 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1007 -1.0930 -1.7128 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4118 -1.2771 -2.9468 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1161 -1.1581 -3.0927 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2935 -0.8182 -1.8723 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3744 -2.0105 -1.8118 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0856 -2.0070 -1.7692 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8036 -0.8036 -1.7495 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6649 -0.9618 -0.5597 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7338 -0.1345 0.4258 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9826 1.1032 0.5685 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9292 2.2528 0.5423 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0782 3.0189 1.5735 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4061 2.8865 2.8384 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5476 2.7641 3.8826 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0789 2.6121 5.2823 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2698 1.3689 5.5629 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1025 0.1235 5.2357 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2175 2.1302 -0.3528 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5620 2.6515 -1.4087 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4097 3.0954 -1.2126 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0956 2.7662 -2.7963 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0337 3.2554 -3.7835 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9639 2.2336 -3.8941 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2003 2.6240 -4.8211 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1323 1.4054 -4.7681 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3771 1.4493 -5.4642 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5454 1.2897 -4.8001 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6016 1.0767 -3.3162 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5665 2.0918 -2.7710 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5191 1.7261 -1.9519 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6474 0.2862 -1.5421 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3250 0.3036 -0.0913 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0142 -0.1683 0.8297 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3089 -0.8647 0.7093 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0169 -2.2315 1.3310 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5642 -2.5575 2.4549 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4721 -1.6731 3.2034 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7455 -1.3713 4.4946 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1846 -1.6671 5.6886 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4498 -2.3340 5.9622 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2827 -1.3397 6.7897 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0854 7.7108 5.7332 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4007 6.9516 4.8004 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6883 6.6508 4.3638 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3196 8.5623 3.1146 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4584 8.6575 3.2667 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5923 9.8893 5.3354 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2219 11.5465 5.4465 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5318 10.8567 4.5589 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7765 9.9008 3.2690 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2779 12.9343 3.7915 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4438 13.2166 1.3818 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2005 10.2025 1.3751 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0936 11.0138 0.2159 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9948 11.8203 0.9948 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2960 12.5197 -1.2315 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5584 11.1355 -1.6189 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7121 12.9040 -2.0966 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5412 12.3953 -3.6876 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3241 10.5944 -5.0500 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6242 9.3351 -2.8217 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6015 8.5037 -4.1658 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9629 9.7388 -5.8116 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7915 9.1017 -5.1079 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2252 8.0536 -2.5479 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7237 7.4517 -3.2260 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8685 10.1289 -1.7041 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4719 9.4621 -2.5657 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4922 8.7866 -0.2267 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3970 7.4585 -1.3815 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8436 8.3207 0.2489 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9621 7.0435 -0.9916 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9061 5.9754 0.2405 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1417 7.2333 1.4373 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0069 3.1184 2.7743 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3747 3.2956 1.6518 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6559 2.3917 0.8750 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8391 0.4760 1.8421 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5523 1.2230 2.8507 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7368 -0.6705 4.2462 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0827 -3.5090 0.8017 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0398 -4.1770 2.4945 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0684 -5.1720 2.2323 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1548 -4.8249 0.0641 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9636 -6.1283 0.9555 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4679 -5.0447 -0.4030 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9077 -8.0009 -3.3184 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9857 -8.8836 0.0551 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4093 -8.4965 -1.6067 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4049 -6.6505 0.8106 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8332 -8.0141 -0.3434 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8260 -6.9189 1.0472 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3645 -10.1162 3.9728 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2213 -11.0315 2.4902 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4508 -11.4603 4.0845 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0976 -9.7369 4.1968 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7419 -11.4515 1.5865 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5990 -10.3517 1.4178 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4136 -8.8660 4.0603 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2952 -8.3596 2.7051 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1255 -10.8211 4.4701 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3382 -10.1055 4.5965 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5073 -7.6125 2.8550 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6546 -7.5316 4.2275 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0722 -9.3785 3.0222 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4276 -8.7632 0.7702 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9800 -6.8514 1.3097 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2378 -7.9133 -0.1762 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2446 -5.8068 1.0501 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5135 -5.0746 -1.2607 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4862 -5.5270 -2.5489 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2219 -7.1697 -1.8511 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5428 -7.8982 -2.8616 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7694 -7.1012 -5.0258 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7709 -4.7929 -4.1353 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1455 -4.7205 -5.3011 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9958 -4.8686 -6.4035 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1171 -6.1805 -6.8091 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9796 -7.7382 -5.2740 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8334 -6.4316 -4.7586 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2082 -7.9089 -6.4754 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1556 -7.4499 -7.6310 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0728 -5.0347 -6.4856 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0738 -5.5848 -8.2179 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2994 -6.1245 -7.2312 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1695 -3.4649 -2.0544 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8079 -2.7334 -0.4953 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2670 -2.1577 -0.2862 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4377 -2.7702 -2.0141 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0302 -0.4143 -1.8385 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6209 -0.7026 -0.8212 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9916 -1.5430 -3.8523 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5560 -1.2738 -4.0211 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8061 -0.7148 -0.9665 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6555 0.0132 -2.1975 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8503 -3.0264 -1.7994 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4075 -3.0068 -1.7906 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4768 -0.8419 -2.6650 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2407 0.0803 -1.8343 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3046 -1.8938 -0.4982 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4520 -0.3740 1.2699 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3036 1.1398 1.4239 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3100 1.2820 -0.3140 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5226 2.4300 -0.3969 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7991 3.8886 1.5049 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8327 3.8112 3.1336 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7635 2.0522 3.0543 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1775 1.8948 3.5893 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1307 3.7212 3.8359 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4805 3.5140 5.6074 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9541 2.5990 5.9561 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2995 1.3630 5.0734 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1308 1.3214 6.6808 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0549 0.1629 5.8148 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5507 -0.7726 5.5944 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3540 0.1004 4.1679 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8469 3.5965 -2.7406 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5933 1.8742 -3.1424 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4682 3.5665 -4.7496 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6091 4.1830 -3.3222 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4067 1.2594 -4.2696 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5451 1.9947 -2.9211 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2346 2.7283 -5.8142 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7481 3.4684 -4.4430 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2210 1.1936 -3.7105 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5218 0.5709 -5.2794 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4539 1.6102 -6.5365 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4678 1.3099 -5.3224 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6438 1.2469 -2.7940 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9117 0.0327 -3.2043 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4612 3.1332 -3.0655 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2187 2.4662 -1.5579 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7658 0.0939 -1.6751 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0648 -0.4507 -2.0176 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3349 0.8265 0.0892 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6631 -0.0820 1.8812 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5463 -1.1596 -0.3578 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1381 -0.3866 1.1695 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3546 -2.9277 0.7965 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3275 -3.5514 2.8914 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7024 -0.7132 2.7801 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4240 -2.1653 3.4571 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7750 -0.8377 4.4651 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5788 -1.3950 6.5935 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2985 -3.2057 6.6815 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0789 -2.6584 5.1582 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9434 -0.7904 6.0741 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6135 -0.5591 7.2281 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8090 -1.9014 7.5573 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 2 0 4 5 1 0 5 6 1 0 6 7 2 0 7 8 1 0 8 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 12 13 2 0 13 14 1 0 14 15 1 0 15 16 2 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 2 0 22 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 2 0 29 31 1 0 29 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 34 36 1 0 36 37 1 0 37 38 1 0 38 39 2 0 38 40 1 0 38 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 2 0 46 48 1 0 48 49 1 0 49 50 1 0 50 51 2 0 51 52 1 0 52 53 1 0 53 54 2 0 54 55 1 0 55 56 1 0 56 57 2 0 57 58 1 0 58 59 1 0 59 60 2 0 60 61 1 0 61 62 1 0 62 63 2 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 43 69 1 0 69 70 1 0 70 71 2 0 70 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 75 76 2 0 76 77 1 0 77 78 1 0 78 79 2 0 79 80 1 0 80 81 1 0 81 82 2 0 82 83 1 0 83 84 1 0 84 85 2 0 85 86 1 0 86 87 1 0 87 88 1 0 88 89 1 0 89 90 1 0 26 91 1 0 91 92 1 0 92 93 2 0 92 94 1 0 94 95 1 0 95 96 1 0 96 97 1 0 97 98 1 0 98 99 1 0 99100 2 0 100101 1 0 101102 1 0 102103 2 0 103104 1 0 104105 1 0 105106 2 0 106107 1 0 107108 1 0 108109 2 0 109110 1 0 110111 1 0 111112 2 0 112113 1 0 113114 1 0 1115 1 0 1116 1 0 1117 1 0 2118 1 0 2119 1 0 3120 1 0 4121 1 0 5122 1 0 5123 1 0 6124 1 0 7125 1 0 8126 1 0 8127 1 0 9128 1 0 10129 1 0 11130 1 0 11131 1 0 12132 1 0 13133 1 0 14134 1 0 14135 1 0 15136 1 0 16137 1 0 17138 1 0 17139 1 0 18140 1 0 18141 1 0 19142 1 0 19143 1 0 20144 1 0 20145 1 0 21146 1 0 21147 1 0 25148 1 0 25149 1 0 26150 1 6 27151 1 0 27152 1 0 31153 1 0 33154 1 0 33155 1 0 34156 1 1 35157 1 0 36158 1 0 36159 1 0 40160 1 0 42161 1 0 42162 1 0 43163 1 1 44164 1 0 44165 1 0 48166 1 0 48167 1 0 49168 1 0 49169 1 0 50170 1 0 51171 1 0 52172 1 0 52173 1 0 53174 1 0 54175 1 0 55176 1 0 55177 1 0 56178 1 0 57179 1 0 58180 1 0 58181 1 0 59182 1 0 60183 1 0 61184 1 0 61185 1 0 62186 1 0 63187 1 0 64188 1 0 64189 1 0 65190 1 0 65191 1 0 66192 1 0 66193 1 0 67194 1 0 67195 1 0 68196 1 0 68197 1 0 68198 1 0 72199 1 0 72200 1 0 73201 1 0 73202 1 0 74203 1 0 74204 1 0 75205 1 0 76206 1 0 77207 1 0 77208 1 0 78209 1 0 79210 1 0 80211 1 0 80212 1 0 81213 1 0 82214 1 0 83215 1 0 83216 1 0 84217 1 0 85218 1 0 86219 1 0 86220 1 0 87221 1 0 87222 1 0 88223 1 0 88224 1 0 89225 1 0 89226 1 0 90227 1 0 90228 1 0 90229 1 0 94230 1 0 94231 1 0 95232 1 0 95233 1 0 96234 1 0 96235 1 0 97236 1 0 97237 1 0 98238 1 0 98239 1 0 99240 1 0 100241 1 0 101242 1 0 101243 1 0 102244 1 0 103245 1 0 104246 1 0 104247 1 0 105248 1 0 106249 1 0 107250 1 0 107251 1 0 108252 1 0 109253 1 0 110254 1 0 110255 1 0 111256 1 0 112257 1 0 113258 1 0 113259 1 0 114260 1 0 114261 1 0 114262 1 0 M END 3D SDF for HMDB0059328 (CL(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)))CL(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)) Mrv1652308071921212D 117116 0 0 1 0 999 V2000 28.9801 -8.8497 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 28.3984 -7.9046 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 28.9258 -6.9281 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 28.4528 -9.8262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 28.3440 -5.9830 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 29.2253 -7.6197 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 27.5639 -7.5431 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 26.6598 -4.7192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 25.6987 -5.2740 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 24.7374 -4.7192 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 27.6210 -5.2740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 23.7762 -5.2740 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 24.8926 -6.0903 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 26.4795 -6.1326 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 28.8473 -4.8685 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 29.9759 -5.1901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 28.8473 -3.5722 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 24.9410 -9.2713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 23.9798 -9.8262 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 23.0186 -9.2713 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 25.9022 -9.8262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 22.0574 -9.8262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 23.1458 -10.6705 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 24.7327 -10.7128 0.0000 H 0 0 0 0 0 0 0 0 0 0 0 0 27.1285 -9.3528 0.0000 P 0 0 0 0 0 0 0 0 0 0 0 0 27.1285 -8.5278 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 26.7090 -10.4093 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 23.0617 -4.8616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 23.0617 -4.0901 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 22.3476 -5.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.6335 -4.8616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.9194 -5.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.0944 -5.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.3803 -4.8616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.6662 -5.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.8412 -5.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.1270 -4.8616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.4129 -5.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.5879 -5.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.8738 -4.8616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.1597 -5.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3347 -5.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.6206 -4.8616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9065 -5.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0815 -5.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.3674 -4.8616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6532 -5.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9391 -4.8616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2250 -5.2747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5109 -4.8616 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 24.1782 -6.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 24.1782 -7.2742 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 23.4641 -6.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.7500 -6.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.0358 -6.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.3217 -6.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.4967 -6.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.7826 -6.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.0685 -6.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.2435 -6.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.5294 -6.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.8153 -6.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.9903 -6.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.2762 -6.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.5621 -6.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.7371 -6.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.0229 -6.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3088 -6.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.5947 -6.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8806 -6.5028 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1665 -6.0896 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.3430 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.3430 -8.6423 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 20.6288 -9.8268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.9147 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.2006 -9.8268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.4865 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.7723 -9.8268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.0582 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.2332 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.5191 -9.8268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.8050 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.9800 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.2659 -9.8268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.5518 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7268 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0127 -9.8268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2985 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4735 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7594 -9.8268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0453 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2204 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5063 -9.8268 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7921 -9.4137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.4314 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 22.4314 -11.8544 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 21.7173 -10.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 21.0032 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.2890 -10.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.5749 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.8608 -10.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.1467 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.3218 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.6076 -10.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.8935 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.0685 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.3544 -10.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.6403 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8153 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1012 -10.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3871 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5621 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8480 -10.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1339 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3089 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5947 -10.6698 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8806 -11.0829 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 0 0 0 0 2 6 1 0 0 0 0 2 7 1 1 0 0 0 3 2 1 0 0 0 0 4 1 1 0 0 0 0 5 3 1 0 0 0 0 9 8 1 0 0 0 0 9 13 1 0 0 0 0 9 14 1 1 0 0 0 10 9 1 0 0 0 0 11 8 1 0 0 0 0 12 10 1 0 0 0 0 12 28 1 0 0 0 0 13 51 1 0 0 0 0 15 16 1 0 0 0 0 15 17 2 0 0 0 0 15 5 1 0 0 0 0 15 11 1 0 0 0 0 19 18 1 0 0 0 0 19 23 1 0 0 0 0 19 24 1 1 0 0 0 20 19 1 0 0 0 0 21 18 1 0 0 0 0 22 20 1 0 0 0 0 22 72 1 0 0 0 0 23 95 1 0 0 0 0 25 4 1 0 0 0 0 25 26 2 0 0 0 0 25 27 1 0 0 0 0 25 21 1 0 0 0 0 28 29 2 0 0 0 0 28 30 1 0 0 0 0 30 31 1 0 0 0 0 31 32 1 0 0 0 0 32 33 2 0 0 0 0 33 34 1 0 0 0 0 34 35 1 0 0 0 0 35 36 2 0 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 38 39 2 0 0 0 0 39 40 1 0 0 0 0 40 41 1 0 0 0 0 41 42 2 0 0 0 0 42 43 1 0 0 0 0 43 44 1 0 0 0 0 44 45 2 0 0 0 0 45 46 1 0 0 0 0 46 47 1 0 0 0 0 47 48 1 0 0 0 0 48 49 1 0 0 0 0 49 50 1 0 0 0 0 51 52 2 0 0 0 0 51 53 1 0 0 0 0 53 54 1 0 0 0 0 54 55 1 0 0 0 0 55 56 1 0 0 0 0 56 57 2 0 0 0 0 57 58 1 0 0 0 0 58 59 1 0 0 0 0 59 60 2 0 0 0 0 60 61 1 0 0 0 0 61 62 1 0 0 0 0 62 63 2 0 0 0 0 63 64 1 0 0 0 0 64 65 1 0 0 0 0 65 66 2 0 0 0 0 66 67 1 0 0 0 0 67 68 1 0 0 0 0 68 69 1 0 0 0 0 69 70 1 0 0 0 0 70 71 1 0 0 0 0 72 73 2 0 0 0 0 72 74 1 0 0 0 0 74 75 1 0 0 0 0 75 76 1 0 0 0 0 76 77 1 0 0 0 0 77 78 1 0 0 0 0 78 79 1 0 0 0 0 79 80 2 0 0 0 0 80 81 1 0 0 0 0 81 82 1 0 0 0 0 82 83 2 0 0 0 0 83 84 1 0 0 0 0 84 85 1 0 0 0 0 85 86 2 0 0 0 0 86 87 1 0 0 0 0 87 88 1 0 0 0 0 88 89 2 0 0 0 0 89 90 1 0 0 0 0 90 91 1 0 0 0 0 91 92 2 0 0 0 0 92 93 1 0 0 0 0 93 94 1 0 0 0 0 95 96 2 0 0 0 0 95 97 1 0 0 0 0 97 98 1 0 0 0 0 98 99 1 0 0 0 0 99100 1 0 0 0 0 100101 1 0 0 0 0 101102 1 0 0 0 0 102103 2 0 0 0 0 103104 1 0 0 0 0 104105 1 0 0 0 0 105106 2 0 0 0 0 106107 1 0 0 0 0 107108 1 0 0 0 0 108109 2 0 0 0 0 109110 1 0 0 0 0 110111 1 0 0 0 0 111112 2 0 0 0 0 112113 1 0 0 0 0 113114 1 0 0 0 0 114115 2 0 0 0 0 115116 1 0 0 0 0 116117 1 0 0 0 0 M END > <DATABASE_ID> HMDB0059328 > <DATABASE_NAME> hmdb > <SMILES> [H][C@@](O)(COP(O)(=O)OC[C@@]([H])(COC(=O)CCCCC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CC)OC(=O)CCCCC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CC)COP(O)(=O)OC[C@@]([H])(COC(=O)CC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CCCCC)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC > <INCHI_IDENTIFIER> InChI=1S/C95H148O17P2/c1-5-9-13-17-21-25-29-33-37-41-44-48-51-55-59-63-67-71-75-79-92(97)105-85-90(111-94(99)81-77-73-69-65-61-57-53-47-40-36-32-28-24-20-16-12-8-4)87-109-113(101,102)107-83-89(96)84-108-114(103,104)110-88-91(112-95(100)82-78-74-70-66-62-58-54-50-46-43-39-35-31-27-23-19-15-11-7-3)86-106-93(98)80-76-72-68-64-60-56-52-49-45-42-38-34-30-26-22-18-14-10-6-2/h10-11,14-15,21-28,33-40,44-46,48-50,53,55-60,62,65,67,69,71,89-91,96H,5-9,12-13,16-20,29-32,41-43,47,51-52,54,61,63-64,66,68,70,72-88H2,1-4H3,(H,101,102)(H,103,104)/b14-10-,15-11-,25-21-,26-22-,27-23-,28-24-,37-33-,38-34-,39-35-,40-36-,48-44-,49-45-,50-46-,57-53-,59-55-,60-56-,62-58-,69-65-,71-67-/t89-,90+,91+/m0/s1 > <INCHI_KEY> YBZALENRXMWXJQ-YLXDJXDMSA-N > <FORMULA> C95H148O17P2 > <MOLECULAR_WEIGHT> 1624.16 > <EXACT_MASS> 1623.019177302 > <JCHEM_ACCEPTOR_COUNT> 9 > <JCHEM_ATOM_COUNT> 262 > <JCHEM_AVERAGE_POLARIZABILITY> 186.18500405974558 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 3 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> [(2R)-3-({[(2R)-2,3-bis[(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyloxy]propoxy](hydroxy)phosphoryl}oxy)-2-hydroxypropoxy][(2R)-3-[(4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoyloxy]-2-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyloxy]propoxy]phosphinic acid > <ALOGPS_LOGP> 8.77 > <JCHEM_LOGP> 26.617116214666666 > <ALOGPS_LOGS> -7.12 > <JCHEM_MDDR_LIKE_RULE> 0 > <JCHEM_NUMBER_OF_RINGS> 0 > <JCHEM_PHYSIOLOGICAL_CHARGE> -2 > <JCHEM_PKA> 2.1918043582150952 > <JCHEM_PKA_STRONGEST_ACIDIC> 1.5897376143161037 > <JCHEM_PKA_STRONGEST_BASIC> -3.4105029523385797 > <JCHEM_POLAR_SURFACE_AREA> 236.94999999999996 > <JCHEM_REFRACTIVITY> 492.5390999999995 > <JCHEM_ROTATABLE_BOND_COUNT> 81 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 1.24e-04 g/l > <JCHEM_TRADITIONAL_IUPAC> (2R)-3-{[(2R)-2,3-bis[(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyloxy]propoxy(hydroxy)phosphoryl]oxy}-2-hydroxypropoxy((2R)-3-[(4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoyloxy]-2-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyloxy]propoxy)phosphinic acid > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0059328 (CL(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)))HMDB0059328 RDKit 3D CL(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(... 262261 0 0 0 0 0 0 0 0999 V2000 2.4044 7.4102 4.7129 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4690 8.6299 3.7800 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4718 9.8156 4.6655 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3746 10.7180 4.7124 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6426 10.7884 3.8771 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4935 12.0597 3.1322 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5889 12.2257 1.8895 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9061 11.1161 0.8926 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1756 11.7171 0.2864 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3213 12.0803 -0.9313 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2775 11.9439 -1.9485 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8308 11.5538 -3.2574 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7427 10.5797 -4.0415 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9548 9.3262 -3.8636 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7994 9.3846 -4.8185 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6185 8.9893 -4.3703 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2917 8.4656 -3.0647 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4484 9.1842 -2.0892 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1102 8.2213 -0.9669 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2874 7.5545 -0.3044 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7113 6.5874 0.7151 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7169 5.7319 1.3883 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6367 6.1544 2.0923 O 0 0 0 0 0 0 0 0 0 0 0 0 2.6099 4.3880 1.2241 O 0 0 0 0 0 0 0 0 0 0 0 0 3.2955 3.3092 1.7250 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7741 2.0496 0.9257 C 0 0 2 0 0 0 0 0 0 0 0 0 2.7732 0.9011 1.8002 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9964 -0.1946 1.4693 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0372 -1.3996 2.6526 P 0 0 0 0 0 5 0 0 0 0 0 0 3.4382 -1.9554 2.7166 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7003 -0.7902 4.2075 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8923 -2.5686 2.2135 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4422 -3.6698 1.6669 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3491 -4.7040 1.3489 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.6044 -4.1490 0.5455 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0880 -5.7055 0.4205 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2873 -6.6518 -0.1456 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3449 -7.6846 -1.1227 P 0 0 0 0 0 5 0 0 0 0 0 0 0.8490 -9.1123 -1.0013 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9629 -7.2095 -2.7203 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8528 -7.4079 -0.7787 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9713 -8.0330 -0.6693 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9955 -7.0169 -0.1215 C 0 0 1 0 0 0 0 0 0 0 0 0 6.1836 -7.6194 0.5232 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8967 -8.7788 1.2758 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9613 -8.9098 2.2746 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2478 -7.9262 2.5739 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7617 -10.1613 3.0098 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3753 -10.5232 3.4552 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4272 -10.7273 2.3765 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2694 -10.1528 2.2771 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7725 -9.2057 3.2757 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4206 -9.8624 3.9675 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6136 -9.4210 4.0158 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2104 -8.1864 3.4449 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3318 -8.6565 2.5733 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5835 -8.3436 1.3381 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6677 -7.3588 0.6336 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6460 -6.2730 0.2395 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7753 -5.8852 -0.9831 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0131 -6.4185 -2.1111 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9251 -7.0225 -3.1173 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0617 -6.5626 -4.3573 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3242 -5.3942 -4.8438 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4267 -5.7968 -6.0111 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4280 -6.8211 -5.5962 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5214 -7.1186 -6.7869 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2089 -5.8728 -7.2097 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1162 -5.8838 -0.9128 O 0 0 0 0 0 0 0 0 0 0 0 0 4.7175 -4.6058 -0.4093 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3868 -4.7469 0.8328 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6305 -3.3280 -1.0126 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7666 -2.4070 -1.2140 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1007 -1.0930 -1.7128 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4118 -1.2771 -2.9468 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1161 -1.1581 -3.0927 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2935 -0.8182 -1.8723 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3744 -2.0105 -1.8118 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0856 -2.0070 -1.7692 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8036 -0.8036 -1.7495 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6649 -0.9618 -0.5597 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7338 -0.1345 0.4258 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9826 1.1032 0.5685 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9292 2.2528 0.5423 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0782 3.0189 1.5735 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4061 2.8865 2.8384 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5476 2.7641 3.8826 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0789 2.6121 5.2823 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2698 1.3689 5.5629 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1025 0.1235 5.2357 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2175 2.1302 -0.3528 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5620 2.6515 -1.4087 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4097 3.0954 -1.2126 O 0 0 0 0 0 0 0 0 0 0 0 0 3.0956 2.7662 -2.7963 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0337 3.2554 -3.7835 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9639 2.2336 -3.8941 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2003 2.6240 -4.8211 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1323 1.4054 -4.7681 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.3771 1.4493 -5.4642 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5454 1.2897 -4.8001 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6016 1.0767 -3.3162 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5665 2.0918 -2.7710 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5191 1.7261 -1.9519 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6474 0.2862 -1.5421 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3250 0.3036 -0.0913 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0142 -0.1683 0.8297 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3089 -0.8647 0.7093 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.0169 -2.2315 1.3310 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.5642 -2.5575 2.4549 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.4721 -1.6731 3.2034 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7455 -1.3713 4.4946 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.1846 -1.6671 5.6886 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.4498 -2.3340 5.9622 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.2827 -1.3397 6.7897 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0854 7.7108 5.7332 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4007 6.9516 4.8004 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6883 6.6508 4.3638 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3196 8.5623 3.1146 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4584 8.6575 3.2667 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5923 9.8893 5.3354 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2219 11.5465 5.4465 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5318 10.8567 4.5589 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7765 9.9008 3.2690 H 0 0 0 0 0 0 0 0 0 0 0 0 4.2779 12.9343 3.7915 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4438 13.2166 1.3818 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2005 10.2025 1.3751 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0936 11.0138 0.2159 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9948 11.8203 0.9948 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2960 12.5197 -1.2315 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5584 11.1355 -1.6189 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7121 12.9040 -2.0966 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5412 12.3953 -3.6876 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3241 10.5944 -5.0500 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6242 9.3351 -2.8217 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6015 8.5037 -4.1658 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9629 9.7388 -5.8116 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7915 9.1017 -5.1079 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2252 8.0536 -2.5479 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7237 7.4517 -3.2260 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8685 10.1289 -1.7041 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4719 9.4621 -2.5657 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4922 8.7866 -0.2267 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3970 7.4585 -1.3815 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8436 8.3207 0.2489 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9621 7.0435 -0.9916 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9061 5.9754 0.2405 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1417 7.2333 1.4373 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0069 3.1184 2.7743 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3747 3.2956 1.6518 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6559 2.3917 0.8750 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8391 0.4760 1.8421 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5523 1.2230 2.8507 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7368 -0.6705 4.2462 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0827 -3.5090 0.8017 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0398 -4.1770 2.4945 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0684 -5.1720 2.2323 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1548 -4.8249 0.0641 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9636 -6.1283 0.9555 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4679 -5.0447 -0.4030 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9077 -8.0009 -3.3184 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9857 -8.8836 0.0551 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4093 -8.4965 -1.6067 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4049 -6.6505 0.8106 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8332 -8.0141 -0.3434 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8260 -6.9189 1.0472 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3645 -10.1162 3.9728 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2213 -11.0315 2.4902 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4508 -11.4603 4.0845 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0976 -9.7369 4.1968 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7419 -11.4515 1.5865 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5990 -10.3517 1.4178 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4136 -8.8660 4.0603 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2952 -8.3596 2.7051 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1255 -10.8211 4.4701 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3382 -10.1055 4.5965 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5073 -7.6125 2.8550 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6546 -7.5316 4.2275 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0722 -9.3785 3.0222 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4276 -8.7632 0.7702 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9800 -6.8514 1.3097 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2378 -7.9133 -0.1762 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2446 -5.8068 1.0501 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5135 -5.0746 -1.2607 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4862 -5.5270 -2.5489 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2219 -7.1697 -1.8511 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5428 -7.8982 -2.8616 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7694 -7.1012 -5.0258 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7709 -4.7929 -4.1353 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1455 -4.7205 -5.3011 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9958 -4.8686 -6.4035 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1171 -6.1805 -6.8091 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9796 -7.7382 -5.2740 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8334 -6.4316 -4.7586 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2082 -7.9089 -6.4754 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1556 -7.4499 -7.6310 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0728 -5.0347 -6.4856 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0738 -5.5848 -8.2179 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2994 -6.1245 -7.2312 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1695 -3.4649 -2.0544 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8079 -2.7334 -0.4953 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2670 -2.1577 -0.2862 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4377 -2.7702 -2.0141 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0302 -0.4143 -1.8385 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6209 -0.7026 -0.8212 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9916 -1.5430 -3.8523 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5560 -1.2738 -4.0211 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8061 -0.7148 -0.9665 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6555 0.0132 -2.1975 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8503 -3.0264 -1.7994 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4075 -3.0068 -1.7906 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4768 -0.8419 -2.6650 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2407 0.0803 -1.8343 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3046 -1.8938 -0.4982 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4520 -0.3740 1.2699 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3036 1.1398 1.4239 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3100 1.2820 -0.3140 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5226 2.4300 -0.3969 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7991 3.8886 1.5049 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8327 3.8112 3.1336 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7635 2.0522 3.0543 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1775 1.8948 3.5893 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1307 3.7212 3.8359 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4805 3.5140 5.6074 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9541 2.5990 5.9561 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2995 1.3630 5.0734 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1308 1.3214 6.6808 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0549 0.1629 5.8148 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5507 -0.7726 5.5944 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3540 0.1004 4.1679 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8469 3.5965 -2.7406 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5933 1.8742 -3.1424 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4682 3.5665 -4.7496 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6091 4.1830 -3.3222 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4067 1.2594 -4.2696 H 0 0 0 0 0 0 0 0 0 0 0 0 0.5451 1.9947 -2.9211 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2346 2.7283 -5.8142 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7481 3.4684 -4.4430 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2210 1.1936 -3.7105 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5218 0.5709 -5.2794 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4539 1.6102 -6.5365 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4678 1.3099 -5.3224 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6438 1.2469 -2.7940 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9117 0.0327 -3.2043 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4612 3.1332 -3.0655 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2187 2.4662 -1.5579 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7658 0.0939 -1.6751 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0648 -0.4507 -2.0176 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3349 0.8265 0.0892 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6631 -0.0820 1.8812 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5463 -1.1596 -0.3578 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1381 -0.3866 1.1695 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3546 -2.9277 0.7965 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.3275 -3.5514 2.8914 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7024 -0.7132 2.7801 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4240 -2.1653 3.4571 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7750 -0.8377 4.4651 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5788 -1.3950 6.5935 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2985 -3.2057 6.6815 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.0789 -2.6584 5.1582 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.9434 -0.7904 6.0741 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.6135 -0.5591 7.2281 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.8090 -1.9014 7.5573 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 2 0 4 5 1 0 5 6 1 0 6 7 2 0 7 8 1 0 8 9 1 0 9 10 2 0 10 11 1 0 11 12 1 0 12 13 2 0 13 14 1 0 14 15 1 0 15 16 2 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 2 0 22 24 1 0 24 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 2 0 29 31 1 0 29 32 1 0 32 33 1 0 33 34 1 0 34 35 1 0 34 36 1 0 36 37 1 0 37 38 1 0 38 39 2 0 38 40 1 0 38 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 44 45 1 0 45 46 1 0 46 47 2 0 46 48 1 0 48 49 1 0 49 50 1 0 50 51 2 0 51 52 1 0 52 53 1 0 53 54 2 0 54 55 1 0 55 56 1 0 56 57 2 0 57 58 1 0 58 59 1 0 59 60 2 0 60 61 1 0 61 62 1 0 62 63 2 0 63 64 1 0 64 65 1 0 65 66 1 0 66 67 1 0 67 68 1 0 43 69 1 0 69 70 1 0 70 71 2 0 70 72 1 0 72 73 1 0 73 74 1 0 74 75 1 0 75 76 2 0 76 77 1 0 77 78 1 0 78 79 2 0 79 80 1 0 80 81 1 0 81 82 2 0 82 83 1 0 83 84 1 0 84 85 2 0 85 86 1 0 86 87 1 0 87 88 1 0 88 89 1 0 89 90 1 0 26 91 1 0 91 92 1 0 92 93 2 0 92 94 1 0 94 95 1 0 95 96 1 0 96 97 1 0 97 98 1 0 98 99 1 0 99100 2 0 100101 1 0 101102 1 0 102103 2 0 103104 1 0 104105 1 0 105106 2 0 106107 1 0 107108 1 0 108109 2 0 109110 1 0 110111 1 0 111112 2 0 112113 1 0 113114 1 0 1115 1 0 1116 1 0 1117 1 0 2118 1 0 2119 1 0 3120 1 0 4121 1 0 5122 1 0 5123 1 0 6124 1 0 7125 1 0 8126 1 0 8127 1 0 9128 1 0 10129 1 0 11130 1 0 11131 1 0 12132 1 0 13133 1 0 14134 1 0 14135 1 0 15136 1 0 16137 1 0 17138 1 0 17139 1 0 18140 1 0 18141 1 0 19142 1 0 19143 1 0 20144 1 0 20145 1 0 21146 1 0 21147 1 0 25148 1 0 25149 1 0 26150 1 6 27151 1 0 27152 1 0 31153 1 0 33154 1 0 33155 1 0 34156 1 1 35157 1 0 36158 1 0 36159 1 0 40160 1 0 42161 1 0 42162 1 0 43163 1 1 44164 1 0 44165 1 0 48166 1 0 48167 1 0 49168 1 0 49169 1 0 50170 1 0 51171 1 0 52172 1 0 52173 1 0 53174 1 0 54175 1 0 55176 1 0 55177 1 0 56178 1 0 57179 1 0 58180 1 0 58181 1 0 59182 1 0 60183 1 0 61184 1 0 61185 1 0 62186 1 0 63187 1 0 64188 1 0 64189 1 0 65190 1 0 65191 1 0 66192 1 0 66193 1 0 67194 1 0 67195 1 0 68196 1 0 68197 1 0 68198 1 0 72199 1 0 72200 1 0 73201 1 0 73202 1 0 74203 1 0 74204 1 0 75205 1 0 76206 1 0 77207 1 0 77208 1 0 78209 1 0 79210 1 0 80211 1 0 80212 1 0 81213 1 0 82214 1 0 83215 1 0 83216 1 0 84217 1 0 85218 1 0 86219 1 0 86220 1 0 87221 1 0 87222 1 0 88223 1 0 88224 1 0 89225 1 0 89226 1 0 90227 1 0 90228 1 0 90229 1 0 94230 1 0 94231 1 0 95232 1 0 95233 1 0 96234 1 0 96235 1 0 97236 1 0 97237 1 0 98238 1 0 98239 1 0 99240 1 0 100241 1 0 101242 1 0 101243 1 0 102244 1 0 103245 1 0 104246 1 0 104247 1 0 105248 1 0 106249 1 0 107250 1 0 107251 1 0 108252 1 0 109253 1 0 110254 1 0 110255 1 0 111256 1 0 112257 1 0 113258 1 0 113259 1 0 114260 1 0 114261 1 0 114262 1 0 M END PDB for HMDB0059328 (CL(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)))HEADER PROTEIN 07-AUG-19 NONE TITLE NULL COMPND MOLECULE: CL(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)/22: SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 07-AUG-19 0 HETATM 1 C UNK 0 54.096 -16.519 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 53.010 -14.755 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 53.995 -12.932 0.000 0.00 0.00 C+0 HETATM 4 O UNK 0 53.112 -18.342 0.000 0.00 0.00 O+0 HETATM 5 O UNK 0 52.909 -11.168 0.000 0.00 0.00 O+0 HETATM 6 O UNK 0 54.554 -14.223 0.000 0.00 0.00 O+0 HETATM 7 H UNK 0 51.453 -14.080 0.000 0.00 0.00 H+0 HETATM 8 C UNK 0 49.765 -8.809 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 47.971 -9.845 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 46.176 -8.809 0.000 0.00 0.00 C+0 HETATM 11 O UNK 0 51.559 -9.845 0.000 0.00 0.00 O+0 HETATM 12 O UNK 0 44.382 -9.845 0.000 0.00 0.00 O+0 HETATM 13 O UNK 0 46.466 -11.369 0.000 0.00 0.00 O+0 HETATM 14 H UNK 0 49.428 -11.448 0.000 0.00 0.00 H+0 HETATM 15 P UNK 0 53.848 -9.088 0.000 0.00 0.00 P+0 HETATM 16 O UNK 0 55.955 -9.688 0.000 0.00 0.00 O+0 HETATM 17 O UNK 0 53.848 -6.668 0.000 0.00 0.00 O+0 HETATM 18 C UNK 0 46.557 -17.306 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 44.762 -18.342 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 42.968 -17.306 0.000 0.00 0.00 C+0 HETATM 21 O UNK 0 48.351 -18.342 0.000 0.00 0.00 O+0 HETATM 22 O UNK 0 41.174 -18.342 0.000 0.00 0.00 O+0 HETATM 23 O UNK 0 43.205 -19.918 0.000 0.00 0.00 O+0 HETATM 24 H UNK 0 46.168 -19.997 0.000 0.00 0.00 H+0 HETATM 25 P UNK 0 50.640 -17.459 0.000 0.00 0.00 P+0 HETATM 26 O UNK 0 50.640 -15.919 0.000 0.00 0.00 O+0 HETATM 27 O UNK 0 49.857 -19.431 0.000 0.00 0.00 O+0 HETATM 28 C UNK 0 43.049 -9.075 0.000 0.00 0.00 C+0 HETATM 29 O UNK 0 43.049 -7.635 0.000 0.00 0.00 O+0 HETATM 30 C UNK 0 41.716 -9.846 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 40.383 -9.075 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 39.050 -9.846 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 37.510 -9.846 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 36.177 -9.075 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 34.844 -9.846 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 33.304 -9.846 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 31.970 -9.075 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 30.637 -9.846 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 29.097 -9.846 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 27.764 -9.075 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 26.431 -9.846 0.000 0.00 0.00 C+0 HETATM 42 C UNK 0 24.891 -9.846 0.000 0.00 0.00 C+0 HETATM 43 C UNK 0 23.558 -9.075 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 22.225 -9.846 0.000 0.00 0.00 C+0 HETATM 45 C UNK 0 20.685 -9.846 0.000 0.00 0.00 C+0 HETATM 46 C UNK 0 19.352 -9.075 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 18.019 -9.846 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 16.686 -9.075 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 15.353 -9.846 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 14.020 -9.075 0.000 0.00 0.00 C+0 HETATM 51 C UNK 0 45.133 -12.139 0.000 0.00 0.00 C+0 HETATM 52 O UNK 0 45.133 -13.579 0.000 0.00 0.00 O+0 HETATM 53 C UNK 0 43.800 -11.367 0.000 0.00 0.00 C+0 HETATM 54 C UNK 0 42.467 -12.139 0.000 0.00 0.00 C+0 HETATM 55 C UNK 0 41.133 -11.367 0.000 0.00 0.00 C+0 HETATM 56 C UNK 0 39.801 -12.139 0.000 0.00 0.00 C+0 HETATM 57 C UNK 0 38.261 -12.139 0.000 0.00 0.00 C+0 HETATM 58 C UNK 0 36.928 -11.367 0.000 0.00 0.00 C+0 HETATM 59 C UNK 0 35.595 -12.139 0.000 0.00 0.00 C+0 HETATM 60 C UNK 0 34.055 -12.139 0.000 0.00 0.00 C+0 HETATM 61 C UNK 0 32.722 -11.367 0.000 0.00 0.00 C+0 HETATM 62 C UNK 0 31.389 -12.139 0.000 0.00 0.00 C+0 HETATM 63 C UNK 0 29.849 -12.139 0.000 0.00 0.00 C+0 HETATM 64 C UNK 0 28.516 -11.367 0.000 0.00 0.00 C+0 HETATM 65 C UNK 0 27.183 -12.139 0.000 0.00 0.00 C+0 HETATM 66 C UNK 0 25.643 -12.139 0.000 0.00 0.00 C+0 HETATM 67 C UNK 0 24.309 -11.367 0.000 0.00 0.00 C+0 HETATM 68 C UNK 0 22.976 -12.139 0.000 0.00 0.00 C+0 HETATM 69 C UNK 0 21.643 -11.367 0.000 0.00 0.00 C+0 HETATM 70 C UNK 0 20.310 -12.139 0.000 0.00 0.00 C+0 HETATM 71 C UNK 0 18.977 -11.367 0.000 0.00 0.00 C+0 HETATM 72 C UNK 0 39.840 -17.572 0.000 0.00 0.00 C+0 HETATM 73 O UNK 0 39.840 -16.132 0.000 0.00 0.00 O+0 HETATM 74 C UNK 0 38.507 -18.343 0.000 0.00 0.00 C+0 HETATM 75 C UNK 0 37.174 -17.572 0.000 0.00 0.00 C+0 HETATM 76 C UNK 0 35.841 -18.343 0.000 0.00 0.00 C+0 HETATM 77 C UNK 0 34.508 -17.572 0.000 0.00 0.00 C+0 HETATM 78 C UNK 0 33.175 -18.343 0.000 0.00 0.00 C+0 HETATM 79 C UNK 0 31.842 -17.572 0.000 0.00 0.00 C+0 HETATM 80 C UNK 0 30.302 -17.572 0.000 0.00 0.00 C+0 HETATM 81 C UNK 0 28.969 -18.343 0.000 0.00 0.00 C+0 HETATM 82 C UNK 0 27.636 -17.572 0.000 0.00 0.00 C+0 HETATM 83 C UNK 0 26.096 -17.572 0.000 0.00 0.00 C+0 HETATM 84 C UNK 0 24.763 -18.343 0.000 0.00 0.00 C+0 HETATM 85 C UNK 0 23.430 -17.572 0.000 0.00 0.00 C+0 HETATM 86 C UNK 0 21.890 -17.572 0.000 0.00 0.00 C+0 HETATM 87 C UNK 0 20.557 -18.343 0.000 0.00 0.00 C+0 HETATM 88 C UNK 0 19.224 -17.572 0.000 0.00 0.00 C+0 HETATM 89 C UNK 0 17.684 -17.572 0.000 0.00 0.00 C+0 HETATM 90 C UNK 0 16.351 -18.343 0.000 0.00 0.00 C+0 HETATM 91 C UNK 0 15.018 -17.572 0.000 0.00 0.00 C+0 HETATM 92 C UNK 0 13.478 -17.572 0.000 0.00 0.00 C+0 HETATM 93 C UNK 0 12.145 -18.343 0.000 0.00 0.00 C+0 HETATM 94 C UNK 0 10.812 -17.572 0.000 0.00 0.00 C+0 HETATM 95 C UNK 0 41.872 -20.688 0.000 0.00 0.00 C+0 HETATM 96 O UNK 0 41.872 -22.128 0.000 0.00 0.00 O+0 HETATM 97 C UNK 0 40.539 -19.917 0.000 0.00 0.00 C+0 HETATM 98 C UNK 0 39.206 -20.688 0.000 0.00 0.00 C+0 HETATM 99 C UNK 0 37.873 -19.917 0.000 0.00 0.00 C+0 HETATM 100 C UNK 0 36.540 -20.688 0.000 0.00 0.00 C+0 HETATM 101 C UNK 0 35.207 -19.917 0.000 0.00 0.00 C+0 HETATM 102 C UNK 0 33.874 -20.688 0.000 0.00 0.00 C+0 HETATM 103 C UNK 0 32.334 -20.688 0.000 0.00 0.00 C+0 HETATM 104 C UNK 0 31.001 -19.917 0.000 0.00 0.00 C+0 HETATM 105 C UNK 0 29.668 -20.688 0.000 0.00 0.00 C+0 HETATM 106 C UNK 0 28.128 -20.688 0.000 0.00 0.00 C+0 HETATM 107 C UNK 0 26.795 -19.917 0.000 0.00 0.00 C+0 HETATM 108 C UNK 0 25.462 -20.688 0.000 0.00 0.00 C+0 HETATM 109 C UNK 0 23.922 -20.688 0.000 0.00 0.00 C+0 HETATM 110 C UNK 0 22.589 -19.917 0.000 0.00 0.00 C+0 HETATM 111 C UNK 0 21.256 -20.688 0.000 0.00 0.00 C+0 HETATM 112 C UNK 0 19.716 -20.688 0.000 0.00 0.00 C+0 HETATM 113 C UNK 0 18.383 -19.917 0.000 0.00 0.00 C+0 HETATM 114 C UNK 0 17.050 -20.688 0.000 0.00 0.00 C+0 HETATM 115 C UNK 0 15.510 -20.688 0.000 0.00 0.00 C+0 HETATM 116 C UNK 0 14.177 -19.917 0.000 0.00 0.00 C+0 HETATM 117 C UNK 0 12.844 -20.688 0.000 0.00 0.00 C+0 CONECT 1 2 4 CONECT 2 1 6 7 3 CONECT 3 2 5 CONECT 4 1 25 CONECT 5 3 15 CONECT 6 2 CONECT 7 2 CONECT 8 9 11 CONECT 9 8 13 14 10 CONECT 10 9 12 CONECT 11 8 15 CONECT 12 10 28 CONECT 13 9 51 CONECT 14 9 CONECT 15 16 17 5 11 CONECT 16 15 CONECT 17 15 CONECT 18 19 21 CONECT 19 18 23 24 20 CONECT 20 19 22 CONECT 21 18 25 CONECT 22 20 72 CONECT 23 19 95 CONECT 24 19 CONECT 25 4 26 27 21 CONECT 26 25 CONECT 27 25 CONECT 28 12 29 30 CONECT 29 28 CONECT 30 28 31 CONECT 31 30 32 CONECT 32 31 33 CONECT 33 32 34 CONECT 34 33 35 CONECT 35 34 36 CONECT 36 35 37 CONECT 37 36 38 CONECT 38 37 39 CONECT 39 38 40 CONECT 40 39 41 CONECT 41 40 42 CONECT 42 41 43 CONECT 43 42 44 CONECT 44 43 45 CONECT 45 44 46 CONECT 46 45 47 CONECT 47 46 48 CONECT 48 47 49 CONECT 49 48 50 CONECT 50 49 CONECT 51 13 52 53 CONECT 52 51 CONECT 53 51 54 CONECT 54 53 55 CONECT 55 54 56 CONECT 56 55 57 CONECT 57 56 58 CONECT 58 57 59 CONECT 59 58 60 CONECT 60 59 61 CONECT 61 60 62 CONECT 62 61 63 CONECT 63 62 64 CONECT 64 63 65 CONECT 65 64 66 CONECT 66 65 67 CONECT 67 66 68 CONECT 68 67 69 CONECT 69 68 70 CONECT 70 69 71 CONECT 71 70 CONECT 72 22 73 74 CONECT 73 72 CONECT 74 72 75 CONECT 75 74 76 CONECT 76 75 77 CONECT 77 76 78 CONECT 78 77 79 CONECT 79 78 80 CONECT 80 79 81 CONECT 81 80 82 CONECT 82 81 83 CONECT 83 82 84 CONECT 84 83 85 CONECT 85 84 86 CONECT 86 85 87 CONECT 87 86 88 CONECT 88 87 89 CONECT 89 88 90 CONECT 90 89 91 CONECT 91 90 92 CONECT 92 91 93 CONECT 93 92 94 CONECT 94 93 CONECT 95 23 96 97 CONECT 96 95 CONECT 97 95 98 CONECT 98 97 99 CONECT 99 98 100 CONECT 100 99 101 CONECT 101 100 102 CONECT 102 101 103 CONECT 103 102 104 CONECT 104 103 105 CONECT 105 104 106 CONECT 106 105 107 CONECT 107 106 108 CONECT 108 107 109 CONECT 109 108 110 CONECT 110 109 111 CONECT 111 110 112 CONECT 112 111 113 CONECT 113 112 114 CONECT 114 113 115 CONECT 115 114 116 CONECT 116 115 117 CONECT 117 116 MASTER 0 0 0 0 0 0 0 0 117 0 232 0 END 3D PDB for HMDB0059328 (CL(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)))COMPND HMDB0059328 HETATM 1 C1 UNL 1 2.404 7.410 4.713 1.00 0.00 C HETATM 2 C2 UNL 1 2.469 8.630 3.780 1.00 0.00 C HETATM 3 C3 UNL 1 2.472 9.816 4.666 1.00 0.00 C HETATM 4 C4 UNL 1 3.375 10.718 4.712 1.00 0.00 C HETATM 5 C5 UNL 1 4.643 10.788 3.877 1.00 0.00 C HETATM 6 C6 UNL 1 4.494 12.060 3.132 1.00 0.00 C HETATM 7 C7 UNL 1 4.589 12.226 1.889 1.00 0.00 C HETATM 8 C8 UNL 1 4.906 11.116 0.893 1.00 0.00 C HETATM 9 C9 UNL 1 6.176 11.717 0.286 1.00 0.00 C HETATM 10 C10 UNL 1 6.321 12.080 -0.931 1.00 0.00 C HETATM 11 C11 UNL 1 5.278 11.944 -1.948 1.00 0.00 C HETATM 12 C12 UNL 1 5.831 11.554 -3.257 1.00 0.00 C HETATM 13 C13 UNL 1 5.743 10.580 -4.042 1.00 0.00 C HETATM 14 C14 UNL 1 4.955 9.326 -3.864 1.00 0.00 C HETATM 15 C15 UNL 1 3.799 9.385 -4.818 1.00 0.00 C HETATM 16 C16 UNL 1 2.618 8.989 -4.370 1.00 0.00 C HETATM 17 C17 UNL 1 2.292 8.466 -3.065 1.00 0.00 C HETATM 18 C18 UNL 1 1.448 9.184 -2.089 1.00 0.00 C HETATM 19 C19 UNL 1 1.110 8.221 -0.967 1.00 0.00 C HETATM 20 C20 UNL 1 2.287 7.555 -0.304 1.00 0.00 C HETATM 21 C21 UNL 1 1.711 6.587 0.715 1.00 0.00 C HETATM 22 C22 UNL 1 2.717 5.732 1.388 1.00 0.00 C HETATM 23 O1 UNL 1 3.637 6.154 2.092 1.00 0.00 O HETATM 24 O2 UNL 1 2.610 4.388 1.224 1.00 0.00 O HETATM 25 C23 UNL 1 3.296 3.309 1.725 1.00 0.00 C HETATM 26 C24 UNL 1 2.774 2.050 0.926 1.00 0.00 C HETATM 27 C25 UNL 1 2.773 0.901 1.800 1.00 0.00 C HETATM 28 O3 UNL 1 1.996 -0.195 1.469 1.00 0.00 O HETATM 29 P1 UNL 1 2.037 -1.400 2.653 1.00 0.00 P HETATM 30 O4 UNL 1 3.438 -1.955 2.717 1.00 0.00 O HETATM 31 O5 UNL 1 1.700 -0.790 4.207 1.00 0.00 O HETATM 32 O6 UNL 1 0.892 -2.569 2.214 1.00 0.00 O HETATM 33 C26 UNL 1 1.442 -3.670 1.667 1.00 0.00 C HETATM 34 C27 UNL 1 0.349 -4.704 1.349 1.00 0.00 C HETATM 35 O7 UNL 1 -0.604 -4.149 0.545 1.00 0.00 O HETATM 36 C28 UNL 1 1.088 -5.705 0.420 1.00 0.00 C HETATM 37 O8 UNL 1 0.287 -6.652 -0.146 1.00 0.00 O HETATM 38 P2 UNL 1 1.345 -7.685 -1.123 1.00 0.00 P HETATM 39 O9 UNL 1 0.849 -9.112 -1.001 1.00 0.00 O HETATM 40 O10 UNL 1 0.963 -7.209 -2.720 1.00 0.00 O HETATM 41 O11 UNL 1 2.853 -7.408 -0.779 1.00 0.00 O HETATM 42 C29 UNL 1 3.971 -8.033 -0.669 1.00 0.00 C HETATM 43 C30 UNL 1 4.996 -7.017 -0.121 1.00 0.00 C HETATM 44 C31 UNL 1 6.184 -7.619 0.523 1.00 0.00 C HETATM 45 O12 UNL 1 5.897 -8.779 1.276 1.00 0.00 O HETATM 46 C32 UNL 1 4.961 -8.910 2.275 1.00 0.00 C HETATM 47 O13 UNL 1 4.248 -7.926 2.574 1.00 0.00 O HETATM 48 C33 UNL 1 4.762 -10.161 3.010 1.00 0.00 C HETATM 49 C34 UNL 1 3.375 -10.523 3.455 1.00 0.00 C HETATM 50 C35 UNL 1 2.427 -10.727 2.376 1.00 0.00 C HETATM 51 C36 UNL 1 1.269 -10.153 2.277 1.00 0.00 C HETATM 52 C37 UNL 1 0.773 -9.206 3.276 1.00 0.00 C HETATM 53 C38 UNL 1 -0.421 -9.862 3.967 1.00 0.00 C HETATM 54 C39 UNL 1 -1.614 -9.421 4.016 1.00 0.00 C HETATM 55 C40 UNL 1 -2.210 -8.186 3.445 1.00 0.00 C HETATM 56 C41 UNL 1 -3.332 -8.656 2.573 1.00 0.00 C HETATM 57 C42 UNL 1 -3.584 -8.344 1.338 1.00 0.00 C HETATM 58 C43 UNL 1 -2.668 -7.359 0.634 1.00 0.00 C HETATM 59 C44 UNL 1 -3.646 -6.273 0.240 1.00 0.00 C HETATM 60 C45 UNL 1 -3.775 -5.885 -0.983 1.00 0.00 C HETATM 61 C46 UNL 1 -3.013 -6.419 -2.111 1.00 0.00 C HETATM 62 C47 UNL 1 -3.925 -7.023 -3.117 1.00 0.00 C HETATM 63 C48 UNL 1 -4.062 -6.563 -4.357 1.00 0.00 C HETATM 64 C49 UNL 1 -3.324 -5.394 -4.844 1.00 0.00 C HETATM 65 C50 UNL 1 -2.427 -5.797 -6.011 1.00 0.00 C HETATM 66 C51 UNL 1 -1.428 -6.821 -5.596 1.00 0.00 C HETATM 67 C52 UNL 1 -0.521 -7.119 -6.787 1.00 0.00 C HETATM 68 C53 UNL 1 0.209 -5.873 -7.210 1.00 0.00 C HETATM 69 O14 UNL 1 5.116 -5.884 -0.913 1.00 0.00 O HETATM 70 C54 UNL 1 4.718 -4.606 -0.409 1.00 0.00 C HETATM 71 O15 UNL 1 4.387 -4.747 0.833 1.00 0.00 O HETATM 72 C55 UNL 1 4.631 -3.328 -1.013 1.00 0.00 C HETATM 73 C56 UNL 1 5.767 -2.407 -1.214 1.00 0.00 C HETATM 74 C57 UNL 1 5.101 -1.093 -1.713 1.00 0.00 C HETATM 75 C58 UNL 1 4.412 -1.277 -2.947 1.00 0.00 C HETATM 76 C59 UNL 1 3.116 -1.158 -3.093 1.00 0.00 C HETATM 77 C60 UNL 1 2.294 -0.818 -1.872 1.00 0.00 C HETATM 78 C61 UNL 1 1.374 -2.010 -1.812 1.00 0.00 C HETATM 79 C62 UNL 1 0.086 -2.007 -1.769 1.00 0.00 C HETATM 80 C63 UNL 1 -0.804 -0.804 -1.750 1.00 0.00 C HETATM 81 C64 UNL 1 -1.665 -0.962 -0.560 1.00 0.00 C HETATM 82 C65 UNL 1 -1.734 -0.134 0.426 1.00 0.00 C HETATM 83 C66 UNL 1 -0.983 1.103 0.568 1.00 0.00 C HETATM 84 C67 UNL 1 -1.929 2.253 0.542 1.00 0.00 C HETATM 85 C68 UNL 1 -2.078 3.019 1.573 1.00 0.00 C HETATM 86 C69 UNL 1 -1.406 2.886 2.838 1.00 0.00 C HETATM 87 C70 UNL 1 -2.548 2.764 3.883 1.00 0.00 C HETATM 88 C71 UNL 1 -2.079 2.612 5.282 1.00 0.00 C HETATM 89 C72 UNL 1 -1.270 1.369 5.563 1.00 0.00 C HETATM 90 C73 UNL 1 -2.102 0.123 5.236 1.00 0.00 C HETATM 91 O16 UNL 1 3.218 2.130 -0.353 1.00 0.00 O HETATM 92 C74 UNL 1 2.562 2.651 -1.409 1.00 0.00 C HETATM 93 O17 UNL 1 1.410 3.095 -1.213 1.00 0.00 O HETATM 94 C75 UNL 1 3.096 2.766 -2.796 1.00 0.00 C HETATM 95 C76 UNL 1 2.034 3.255 -3.783 1.00 0.00 C HETATM 96 C77 UNL 1 0.964 2.234 -3.894 1.00 0.00 C HETATM 97 C78 UNL 1 -0.200 2.624 -4.821 1.00 0.00 C HETATM 98 C79 UNL 1 -1.132 1.405 -4.768 1.00 0.00 C HETATM 99 C80 UNL 1 -2.377 1.449 -5.464 1.00 0.00 C HETATM 100 C81 UNL 1 -3.545 1.290 -4.800 1.00 0.00 C HETATM 101 C82 UNL 1 -3.602 1.077 -3.316 1.00 0.00 C HETATM 102 C83 UNL 1 -4.566 2.092 -2.771 1.00 0.00 C HETATM 103 C84 UNL 1 -5.519 1.726 -1.952 1.00 0.00 C HETATM 104 C85 UNL 1 -5.647 0.286 -1.542 1.00 0.00 C HETATM 105 C86 UNL 1 -5.325 0.304 -0.091 1.00 0.00 C HETATM 106 C87 UNL 1 -6.014 -0.168 0.830 1.00 0.00 C HETATM 107 C88 UNL 1 -7.309 -0.865 0.709 1.00 0.00 C HETATM 108 C89 UNL 1 -7.017 -2.232 1.331 1.00 0.00 C HETATM 109 C90 UNL 1 -7.564 -2.558 2.455 1.00 0.00 C HETATM 110 C91 UNL 1 -8.472 -1.673 3.203 1.00 0.00 C HETATM 111 C92 UNL 1 -7.746 -1.371 4.495 1.00 0.00 C HETATM 112 C93 UNL 1 -8.185 -1.667 5.689 1.00 0.00 C HETATM 113 C94 UNL 1 -9.450 -2.334 5.962 1.00 0.00 C HETATM 114 C95 UNL 1 -10.283 -1.340 6.790 1.00 0.00 C HETATM 115 H1 UNL 1 2.085 7.711 5.733 1.00 0.00 H HETATM 116 H2 UNL 1 3.401 6.952 4.800 1.00 0.00 H HETATM 117 H3 UNL 1 1.688 6.651 4.364 1.00 0.00 H HETATM 118 H4 UNL 1 3.320 8.562 3.115 1.00 0.00 H HETATM 119 H5 UNL 1 1.458 8.657 3.267 1.00 0.00 H HETATM 120 H6 UNL 1 1.592 9.889 5.335 1.00 0.00 H HETATM 121 H7 UNL 1 3.222 11.547 5.447 1.00 0.00 H HETATM 122 H8 UNL 1 5.532 10.857 4.559 1.00 0.00 H HETATM 123 H9 UNL 1 4.776 9.901 3.269 1.00 0.00 H HETATM 124 H10 UNL 1 4.278 12.934 3.792 1.00 0.00 H HETATM 125 H11 UNL 1 4.444 13.217 1.382 1.00 0.00 H HETATM 126 H12 UNL 1 5.201 10.203 1.375 1.00 0.00 H HETATM 127 H13 UNL 1 4.094 11.014 0.216 1.00 0.00 H HETATM 128 H14 UNL 1 6.995 11.820 0.995 1.00 0.00 H HETATM 129 H15 UNL 1 7.296 12.520 -1.231 1.00 0.00 H HETATM 130 H16 UNL 1 4.558 11.136 -1.619 1.00 0.00 H HETATM 131 H17 UNL 1 4.712 12.904 -2.097 1.00 0.00 H HETATM 132 H18 UNL 1 6.541 12.395 -3.688 1.00 0.00 H HETATM 133 H19 UNL 1 6.324 10.594 -5.050 1.00 0.00 H HETATM 134 H20 UNL 1 4.624 9.335 -2.822 1.00 0.00 H HETATM 135 H21 UNL 1 5.602 8.504 -4.166 1.00 0.00 H HETATM 136 H22 UNL 1 3.963 9.739 -5.812 1.00 0.00 H HETATM 137 H23 UNL 1 1.792 9.102 -5.108 1.00 0.00 H HETATM 138 H24 UNL 1 3.225 8.054 -2.548 1.00 0.00 H HETATM 139 H25 UNL 1 1.724 7.452 -3.226 1.00 0.00 H HETATM 140 H26 UNL 1 1.868 10.129 -1.704 1.00 0.00 H HETATM 141 H27 UNL 1 0.472 9.462 -2.566 1.00 0.00 H HETATM 142 H28 UNL 1 0.492 8.787 -0.227 1.00 0.00 H HETATM 143 H29 UNL 1 0.397 7.458 -1.382 1.00 0.00 H HETATM 144 H30 UNL 1 2.844 8.321 0.249 1.00 0.00 H HETATM 145 H31 UNL 1 2.962 7.043 -0.992 1.00 0.00 H HETATM 146 H32 UNL 1 0.906 5.975 0.241 1.00 0.00 H HETATM 147 H33 UNL 1 1.142 7.233 1.437 1.00 0.00 H HETATM 148 H34 UNL 1 3.007 3.118 2.774 1.00 0.00 H HETATM 149 H35 UNL 1 4.375 3.296 1.652 1.00 0.00 H HETATM 150 H36 UNL 1 1.656 2.392 0.875 1.00 0.00 H HETATM 151 H37 UNL 1 3.839 0.476 1.842 1.00 0.00 H HETATM 152 H38 UNL 1 2.552 1.223 2.851 1.00 0.00 H HETATM 153 H39 UNL 1 0.737 -0.670 4.246 1.00 0.00 H HETATM 154 H40 UNL 1 2.083 -3.509 0.802 1.00 0.00 H HETATM 155 H41 UNL 1 2.040 -4.177 2.494 1.00 0.00 H HETATM 156 H42 UNL 1 -0.068 -5.172 2.232 1.00 0.00 H HETATM 157 H43 UNL 1 -1.155 -4.825 0.064 1.00 0.00 H HETATM 158 H44 UNL 1 1.964 -6.128 0.956 1.00 0.00 H HETATM 159 H45 UNL 1 1.468 -5.045 -0.403 1.00 0.00 H HETATM 160 H46 UNL 1 0.908 -8.001 -3.318 1.00 0.00 H HETATM 161 H47 UNL 1 3.986 -8.884 0.055 1.00 0.00 H HETATM 162 H48 UNL 1 4.409 -8.496 -1.607 1.00 0.00 H HETATM 163 H49 UNL 1 4.405 -6.651 0.811 1.00 0.00 H HETATM 164 H50 UNL 1 6.833 -8.014 -0.343 1.00 0.00 H HETATM 165 H51 UNL 1 6.826 -6.919 1.047 1.00 0.00 H HETATM 166 H52 UNL 1 5.364 -10.116 3.973 1.00 0.00 H HETATM 167 H53 UNL 1 5.221 -11.032 2.490 1.00 0.00 H HETATM 168 H54 UNL 1 3.451 -11.460 4.085 1.00 0.00 H HETATM 169 H55 UNL 1 3.098 -9.737 4.197 1.00 0.00 H HETATM 170 H56 UNL 1 2.742 -11.452 1.587 1.00 0.00 H HETATM 171 H57 UNL 1 0.599 -10.352 1.418 1.00 0.00 H HETATM 172 H58 UNL 1 1.414 -8.866 4.060 1.00 0.00 H HETATM 173 H59 UNL 1 0.295 -8.360 2.705 1.00 0.00 H HETATM 174 H60 UNL 1 -0.126 -10.821 4.470 1.00 0.00 H HETATM 175 H61 UNL 1 -2.338 -10.105 4.596 1.00 0.00 H HETATM 176 H62 UNL 1 -1.507 -7.613 2.855 1.00 0.00 H HETATM 177 H63 UNL 1 -2.655 -7.532 4.228 1.00 0.00 H HETATM 178 H64 UNL 1 -4.072 -9.378 3.022 1.00 0.00 H HETATM 179 H65 UNL 1 -4.428 -8.763 0.770 1.00 0.00 H HETATM 180 H66 UNL 1 -1.980 -6.851 1.310 1.00 0.00 H HETATM 181 H67 UNL 1 -2.238 -7.913 -0.176 1.00 0.00 H HETATM 182 H68 UNL 1 -4.245 -5.807 1.050 1.00 0.00 H HETATM 183 H69 UNL 1 -4.514 -5.075 -1.261 1.00 0.00 H HETATM 184 H70 UNL 1 -2.486 -5.527 -2.549 1.00 0.00 H HETATM 185 H71 UNL 1 -2.222 -7.170 -1.851 1.00 0.00 H HETATM 186 H72 UNL 1 -4.543 -7.898 -2.862 1.00 0.00 H HETATM 187 H73 UNL 1 -4.769 -7.101 -5.026 1.00 0.00 H HETATM 188 H74 UNL 1 -2.771 -4.793 -4.135 1.00 0.00 H HETATM 189 H75 UNL 1 -4.145 -4.720 -5.301 1.00 0.00 H HETATM 190 H76 UNL 1 -1.996 -4.869 -6.404 1.00 0.00 H HETATM 191 H77 UNL 1 -3.117 -6.180 -6.809 1.00 0.00 H HETATM 192 H78 UNL 1 -1.980 -7.738 -5.274 1.00 0.00 H HETATM 193 H79 UNL 1 -0.833 -6.432 -4.759 1.00 0.00 H HETATM 194 H80 UNL 1 0.208 -7.909 -6.475 1.00 0.00 H HETATM 195 H81 UNL 1 -1.156 -7.450 -7.631 1.00 0.00 H HETATM 196 H82 UNL 1 0.073 -5.035 -6.486 1.00 0.00 H HETATM 197 H83 UNL 1 -0.074 -5.585 -8.218 1.00 0.00 H HETATM 198 H84 UNL 1 1.299 -6.124 -7.231 1.00 0.00 H HETATM 199 H85 UNL 1 4.169 -3.465 -2.054 1.00 0.00 H HETATM 200 H86 UNL 1 3.808 -2.733 -0.495 1.00 0.00 H HETATM 201 H87 UNL 1 6.267 -2.158 -0.286 1.00 0.00 H HETATM 202 H88 UNL 1 6.438 -2.770 -2.014 1.00 0.00 H HETATM 203 H89 UNL 1 6.030 -0.414 -1.839 1.00 0.00 H HETATM 204 H90 UNL 1 4.621 -0.703 -0.821 1.00 0.00 H HETATM 205 H91 UNL 1 4.992 -1.543 -3.852 1.00 0.00 H HETATM 206 H92 UNL 1 2.556 -1.274 -4.021 1.00 0.00 H HETATM 207 H93 UNL 1 2.806 -0.715 -0.966 1.00 0.00 H HETATM 208 H94 UNL 1 1.655 0.013 -2.197 1.00 0.00 H HETATM 209 H95 UNL 1 1.850 -3.026 -1.799 1.00 0.00 H HETATM 210 H96 UNL 1 -0.408 -3.007 -1.791 1.00 0.00 H HETATM 211 H97 UNL 1 -1.477 -0.842 -2.665 1.00 0.00 H HETATM 212 H98 UNL 1 -0.241 0.080 -1.834 1.00 0.00 H HETATM 213 H99 UNL 1 -2.305 -1.894 -0.498 1.00 0.00 H HETATM 214 HA0 UNL 1 -2.452 -0.374 1.270 1.00 0.00 H HETATM 215 HA1 UNL 1 -0.304 1.140 1.424 1.00 0.00 H HETATM 216 HA2 UNL 1 -0.310 1.282 -0.314 1.00 0.00 H HETATM 217 HA3 UNL 1 -2.523 2.430 -0.397 1.00 0.00 H HETATM 218 HA4 UNL 1 -2.799 3.889 1.505 1.00 0.00 H HETATM 219 HA5 UNL 1 -0.833 3.811 3.134 1.00 0.00 H HETATM 220 HA6 UNL 1 -0.763 2.052 3.054 1.00 0.00 H HETATM 221 HA7 UNL 1 -3.177 1.895 3.589 1.00 0.00 H HETATM 222 HA8 UNL 1 -3.131 3.721 3.836 1.00 0.00 H HETATM 223 HA9 UNL 1 -1.480 3.514 5.607 1.00 0.00 H HETATM 224 HB0 UNL 1 -2.954 2.599 5.956 1.00 0.00 H HETATM 225 HB1 UNL 1 -0.300 1.363 5.073 1.00 0.00 H HETATM 226 HB2 UNL 1 -1.131 1.321 6.681 1.00 0.00 H HETATM 227 HB3 UNL 1 -3.055 0.163 5.815 1.00 0.00 H HETATM 228 HB4 UNL 1 -1.551 -0.773 5.594 1.00 0.00 H HETATM 229 HB5 UNL 1 -2.354 0.100 4.168 1.00 0.00 H HETATM 230 HB6 UNL 1 3.847 3.597 -2.741 1.00 0.00 H HETATM 231 HB7 UNL 1 3.593 1.874 -3.142 1.00 0.00 H HETATM 232 HB8 UNL 1 2.468 3.566 -4.750 1.00 0.00 H HETATM 233 HB9 UNL 1 1.609 4.183 -3.322 1.00 0.00 H HETATM 234 HC0 UNL 1 1.407 1.259 -4.270 1.00 0.00 H HETATM 235 HC1 UNL 1 0.545 1.995 -2.921 1.00 0.00 H HETATM 236 HC2 UNL 1 0.235 2.728 -5.814 1.00 0.00 H HETATM 237 HC3 UNL 1 -0.748 3.468 -4.443 1.00 0.00 H HETATM 238 HC4 UNL 1 -1.221 1.194 -3.711 1.00 0.00 H HETATM 239 HC5 UNL 1 -0.522 0.571 -5.279 1.00 0.00 H HETATM 240 HC6 UNL 1 -2.454 1.610 -6.537 1.00 0.00 H HETATM 241 HC7 UNL 1 -4.468 1.310 -5.322 1.00 0.00 H HETATM 242 HC8 UNL 1 -2.644 1.247 -2.794 1.00 0.00 H HETATM 243 HC9 UNL 1 -3.912 0.033 -3.204 1.00 0.00 H HETATM 244 HD0 UNL 1 -4.461 3.133 -3.066 1.00 0.00 H HETATM 245 HD1 UNL 1 -6.219 2.466 -1.558 1.00 0.00 H HETATM 246 HD2 UNL 1 -6.766 0.094 -1.675 1.00 0.00 H HETATM 247 HD3 UNL 1 -5.065 -0.451 -2.018 1.00 0.00 H HETATM 248 HD4 UNL 1 -4.335 0.827 0.089 1.00 0.00 H HETATM 249 HD5 UNL 1 -5.663 -0.082 1.881 1.00 0.00 H HETATM 250 HD6 UNL 1 -7.546 -1.160 -0.358 1.00 0.00 H HETATM 251 HD7 UNL 1 -8.138 -0.387 1.170 1.00 0.00 H HETATM 252 HD8 UNL 1 -6.355 -2.928 0.797 1.00 0.00 H HETATM 253 HD9 UNL 1 -7.328 -3.551 2.891 1.00 0.00 H HETATM 254 HE0 UNL 1 -8.702 -0.713 2.780 1.00 0.00 H HETATM 255 HE1 UNL 1 -9.424 -2.165 3.457 1.00 0.00 H HETATM 256 HE2 UNL 1 -6.775 -0.838 4.465 1.00 0.00 H HETATM 257 HE3 UNL 1 -7.579 -1.395 6.593 1.00 0.00 H HETATM 258 HE4 UNL 1 -9.298 -3.206 6.681 1.00 0.00 H HETATM 259 HE5 UNL 1 -10.079 -2.658 5.158 1.00 0.00 H HETATM 260 HE6 UNL 1 -10.943 -0.790 6.074 1.00 0.00 H HETATM 261 HE7 UNL 1 -9.613 -0.559 7.228 1.00 0.00 H HETATM 262 HE8 UNL 1 -10.809 -1.901 7.557 1.00 0.00 H CONECT 1 2 115 116 117 CONECT 2 3 118 119 CONECT 3 4 4 120 CONECT 4 5 121 CONECT 5 6 122 123 CONECT 6 7 7 124 CONECT 7 8 125 CONECT 8 9 126 127 CONECT 9 10 10 128 CONECT 10 11 129 CONECT 11 12 130 131 CONECT 12 13 13 132 CONECT 13 14 133 CONECT 14 15 134 135 CONECT 15 16 16 136 CONECT 16 17 137 CONECT 17 18 138 139 CONECT 18 19 140 141 CONECT 19 20 142 143 CONECT 20 21 144 145 CONECT 21 22 146 147 CONECT 22 23 23 24 CONECT 24 25 CONECT 25 26 148 149 CONECT 26 27 91 150 CONECT 27 28 151 152 CONECT 28 29 CONECT 29 30 30 31 32 CONECT 31 153 CONECT 32 33 CONECT 33 34 154 155 CONECT 34 35 36 156 CONECT 35 157 CONECT 36 37 158 159 CONECT 37 38 CONECT 38 39 39 40 41 CONECT 40 160 CONECT 41 42 CONECT 42 43 161 162 CONECT 43 44 69 163 CONECT 44 45 164 165 CONECT 45 46 CONECT 46 47 47 48 CONECT 48 49 166 167 CONECT 49 50 168 169 CONECT 50 51 51 170 CONECT 51 52 171 CONECT 52 53 172 173 CONECT 53 54 54 174 CONECT 54 55 175 CONECT 55 56 176 177 CONECT 56 57 57 178 CONECT 57 58 179 CONECT 58 59 180 181 CONECT 59 60 60 182 CONECT 60 61 183 CONECT 61 62 184 185 CONECT 62 63 63 186 CONECT 63 64 187 CONECT 64 65 188 189 CONECT 65 66 190 191 CONECT 66 67 192 193 CONECT 67 68 194 195 CONECT 68 196 197 198 CONECT 69 70 CONECT 70 71 71 72 CONECT 72 73 199 200 CONECT 73 74 201 202 CONECT 74 75 203 204 CONECT 75 76 76 205 CONECT 76 77 206 CONECT 77 78 207 208 CONECT 78 79 79 209 CONECT 79 80 210 CONECT 80 81 211 212 CONECT 81 82 82 213 CONECT 82 83 214 CONECT 83 84 215 216 CONECT 84 85 85 217 CONECT 85 86 218 CONECT 86 87 219 220 CONECT 87 88 221 222 CONECT 88 89 223 224 CONECT 89 90 225 226 CONECT 90 227 228 229 CONECT 91 92 CONECT 92 93 93 94 CONECT 94 95 230 231 CONECT 95 96 232 233 CONECT 96 97 234 235 CONECT 97 98 236 237 CONECT 98 99 238 239 CONECT 99 100 100 240 CONECT 100 101 241 CONECT 101 102 242 243 CONECT 102 103 103 244 CONECT 103 104 245 CONECT 104 105 246 247 CONECT 105 106 106 248 CONECT 106 107 249 CONECT 107 108 250 251 CONECT 108 109 109 252 CONECT 109 110 253 CONECT 110 111 254 255 CONECT 111 112 112 256 CONECT 112 113 257 CONECT 113 114 258 259 CONECT 114 260 261 262 END SMILES for HMDB0059328 (CL(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)))[H][C@@](O)(COP(O)(=O)OC[C@@]([H])(COC(=O)CCCCC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CC)OC(=O)CCCCC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CC)COP(O)(=O)OC[C@@]([H])(COC(=O)CC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CCCCC)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC INCHI for HMDB0059328 (CL(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)))InChI=1S/C95H148O17P2/c1-5-9-13-17-21-25-29-33-37-41-44-48-51-55-59-63-67-71-75-79-92(97)105-85-90(111-94(99)81-77-73-69-65-61-57-53-47-40-36-32-28-24-20-16-12-8-4)87-109-113(101,102)107-83-89(96)84-108-114(103,104)110-88-91(112-95(100)82-78-74-70-66-62-58-54-50-46-43-39-35-31-27-23-19-15-11-7-3)86-106-93(98)80-76-72-68-64-60-56-52-49-45-42-38-34-30-26-22-18-14-10-6-2/h10-11,14-15,21-28,33-40,44-46,48-50,53,55-60,62,65,67,69,71,89-91,96H,5-9,12-13,16-20,29-32,41-43,47,51-52,54,61,63-64,66,68,70,72-88H2,1-4H3,(H,101,102)(H,103,104)/b14-10-,15-11-,25-21-,26-22-,27-23-,28-24-,37-33-,38-34-,39-35-,40-36-,48-44-,49-45-,50-46-,57-53-,59-55-,60-56-,62-58-,69-65-,71-67-/t89-,90+,91+/m0/s1 Structure for HMDB0059328 (CL(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z)))3D Structure for HMDB0059328 (CL(22:5(4Z,7Z,10Z,13Z,16Z)/20:4(5Z,8Z,11Z,14Z)/22:5(7Z,10Z,13Z,16Z,19Z)/22:5(7Z,10Z,13Z,16Z,19Z))) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C95H148O17P2 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 1624.16 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 1623.019177302 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | [(2R)-3-({[(2R)-2,3-bis[(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyloxy]propoxy](hydroxy)phosphoryl}oxy)-2-hydroxypropoxy][(2R)-3-[(4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoyloxy]-2-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyloxy]propoxy]phosphinic acid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | (2R)-3-{[(2R)-2,3-bis[(7Z,10Z,13Z,16Z,19Z)-docosa-7,10,13,16,19-pentaenoyloxy]propoxy(hydroxy)phosphoryl]oxy}-2-hydroxypropoxy((2R)-3-[(4Z,7Z,10Z,13Z,16Z)-docosa-4,7,10,13,16-pentaenoyloxy]-2-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyloxy]propoxy)phosphinic acid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | [H][C@@](O)(COP(O)(=O)OC[C@@]([H])(COC(=O)CCCCC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CC)OC(=O)CCCCC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CC)COP(O)(=O)OC[C@@]([H])(COC(=O)CC\C=C/C\C=C/C\C=C/C\C=C/C\C=C/CCCCC)OC(=O)CCC\C=C/C\C=C/C\C=C/C\C=C/CCCCC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C95H148O17P2/c1-5-9-13-17-21-25-29-33-37-41-44-48-51-55-59-63-67-71-75-79-92(97)105-85-90(111-94(99)81-77-73-69-65-61-57-53-47-40-36-32-28-24-20-16-12-8-4)87-109-113(101,102)107-83-89(96)84-108-114(103,104)110-88-91(112-95(100)82-78-74-70-66-62-58-54-50-46-43-39-35-31-27-23-19-15-11-7-3)86-106-93(98)80-76-72-68-64-60-56-52-49-45-42-38-34-30-26-22-18-14-10-6-2/h10-11,14-15,21-28,33-40,44-46,48-50,53,55-60,62,65,67,69,71,89-91,96H,5-9,12-13,16-20,29-32,41-43,47,51-52,54,61,63-64,66,68,70,72-88H2,1-4H3,(H,101,102)(H,103,104)/b14-10-,15-11-,25-21-,26-22-,27-23-,28-24-,37-33-,38-34-,39-35-,40-36-,48-44-,49-45-,50-46-,57-53-,59-55-,60-56-,62-58-,69-65-,71-67-/t89-,90+,91+/m0/s1 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | YBZALENRXMWXJQ-YLXDJXDMSA-N | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as cardiolipins. These are glycerophospholipids in which the O1 and O3 oxygen atoms of the central glycerol moiety are each linked to one 1,2-diacylglycerol chain. Their general formula is OC(COP(O)(=O)OC[C@@H](CO[R1])O[R2])COP(O)(=O)OC[C@@H](CO[R3])O[R4], where R1-R4 are four fatty acyl chains. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Lipids and lipid-like molecules | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Glycerophospholipids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Glycerophosphoglycerophosphoglycerols | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Cardiolipins | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aliphatic acyclic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Health effect
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | Biological location
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | Naturally occurring process
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | Biological role
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Solid | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
GC-MS Spectra
MS/MS Spectra
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | FDB034330 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 131769534 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|