| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2013-07-04 18:54:41 UTC |
|---|
| Update Date | 2021-09-14 15:00:06 UTC |
|---|
| HMDB ID | HMDB0060716 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | 2-Hydroxy-desipramine glucuronide |
|---|
| Description | 2-Hydroxy-desipramine glucuronide is a metabolite of desipramine. Desipramine (also known as desmethylimipramine) is a tricyclic antidepressant (TCA). It inhibits the reuptake of norepinephrine and to a lesser extent serotonin. It is used to treat depression, but not considered a first line treatment since the introduction of SSRI antidepressants. Desipramine is an active metabolite of imipramine. It is sold under the brand names Norpramin and Pertofane. Along with other tricyclics, desipramine has found use in treating neuropathic pain. (Wikipedia) |
|---|
| Structure | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@@H]([C@@H](O)[C@H](O)[C@H]3O)C(O)=O)=CC=C12 InChI=1S/C24H30N2O7/c1-25-11-4-12-26-17-6-3-2-5-14(17)7-8-15-13-16(9-10-18(15)26)32-24-21(29)19(27)20(28)22(33-24)23(30)31/h2-3,5-6,9-10,13,19-22,24-25,27-29H,4,7-8,11-12H2,1H3,(H,30,31)/t19-,20-,21+,22-,24+/m0/s1 |
|---|
| Synonyms | Not Available |
|---|
| Chemical Formula | C24H30N2O7 |
|---|
| Average Molecular Weight | 458.5042 |
|---|
| Monoisotopic Molecular Weight | 458.205301324 |
|---|
| IUPAC Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-({2-[3-(methylamino)propyl]-2-azatricyclo[9.4.0.0³,⁸]pentadeca-1(15),3,5,7,11,13-hexaen-6-yl}oxy)oxane-2-carboxylic acid |
|---|
| Traditional Name | (2S,3S,4S,5R,6S)-3,4,5-trihydroxy-6-({2-[3-(methylamino)propyl]-2-azatricyclo[9.4.0.0³,⁸]pentadeca-1(15),3,5,7,11,13-hexaen-6-yl}oxy)oxane-2-carboxylic acid |
|---|
| CAS Registry Number | Not Available |
|---|
| SMILES | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@@H]([C@@H](O)[C@H](O)[C@H]3O)C(O)=O)=CC=C12 |
|---|
| InChI Identifier | InChI=1S/C24H30N2O7/c1-25-11-4-12-26-17-6-3-2-5-14(17)7-8-15-13-16(9-10-18(15)26)32-24-21(29)19(27)20(28)22(33-24)23(30)31/h2-3,5-6,9-10,13,19-22,24-25,27-29H,4,7-8,11-12H2,1H3,(H,30,31)/t19-,20-,21+,22-,24+/m0/s1 |
|---|
| InChI Key | XJHAOJJEVSPMBA-QMDPOKHVSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as dibenzazepines. Dibenzazepines are compounds with two benzene rings connected by an azepine ring. Azepine is an unsaturated seven-member heterocycle with one nitrogen atom replacing a carbon atom. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Organoheterocyclic compounds |
|---|
| Class | Benzazepines |
|---|
| Sub Class | Dibenzazepines |
|---|
| Direct Parent | Dibenzazepines |
|---|
| Alternative Parents | |
|---|
| Substituents | - Dibenzazepine
- Phenolic glycoside
- O-glucuronide
- 1-o-glucuronide
- Glucuronic acid or derivatives
- Alkyldiarylamine
- O-glycosyl compound
- Glycosyl compound
- Tertiary aliphatic/aromatic amine
- Azepine
- Beta-hydroxy acid
- Hydroxy acid
- Benzenoid
- Oxane
- Monosaccharide
- Pyran
- Secondary alcohol
- Tertiary amine
- Amino acid
- Amino acid or derivatives
- Acetal
- Carboxylic acid derivative
- Carboxylic acid
- Secondary aliphatic amine
- Oxacycle
- Azacycle
- Monocarboxylic acid or derivatives
- Secondary amine
- Polyol
- Organic nitrogen compound
- Amine
- Organic oxide
- Hydrocarbon derivative
- Organic oxygen compound
- Organopnictogen compound
- Carbonyl group
- Alcohol
- Organooxygen compound
- Organonitrogen compound
- Aromatic heteropolycyclic compound
|
|---|
| Molecular Framework | Aromatic heteropolycyclic compounds |
|---|
| External Descriptors | Not Available |
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | |
|---|
| Role | Not Available |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | Not Available | Not Available | | LogP | Not Available | Not Available |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 3.85 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 11.1695 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 4.72 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 1034.9 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 202.3 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 136.6 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 186.9 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 80.2 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 316.1 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 350.9 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 770.4 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 801.7 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 420.7 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1042.5 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 245.4 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 283.4 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 429.8 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 375.9 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 83.7 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| 2-Hydroxy-desipramine glucuronide,1TMS,isomer #1 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)=CC=C21 | 3762.3 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,1TMS,isomer #2 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)=CC=C21 | 3756.4 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,1TMS,isomer #3 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)=CC=C21 | 3750.1 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,1TMS,isomer #4 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)=CC=C21 | 3700.4 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,1TMS,isomer #5 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O)=CC=C21)[Si](C)(C)C | 3958.1 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,2TMS,isomer #1 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)=CC=C21 | 3719.9 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,2TMS,isomer #10 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)=CC=C21)[Si](C)(C)C | 3859.8 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,2TMS,isomer #2 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)=CC=C21 | 3750.2 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,2TMS,isomer #3 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)=CC=C21 | 3746.0 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,2TMS,isomer #4 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)=CC=C21)[Si](C)(C)C | 3898.4 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,2TMS,isomer #5 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)=CC=C21 | 3696.7 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,2TMS,isomer #6 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)=CC=C21 | 3748.2 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,2TMS,isomer #7 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)=CC=C21)[Si](C)(C)C | 3894.2 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,2TMS,isomer #8 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)=CC=C21 | 3696.3 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,2TMS,isomer #9 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)=CC=C21)[Si](C)(C)C | 3901.7 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,3TMS,isomer #1 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)=CC=C21 | 3740.5 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,3TMS,isomer #10 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C)=CC=C21)[Si](C)(C)C | 3860.9 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,3TMS,isomer #2 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)=CC=C21 | 3737.0 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,3TMS,isomer #3 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O)=CC=C21)[Si](C)(C)C | 3870.5 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,3TMS,isomer #4 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)=CC=C21 | 3781.2 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,3TMS,isomer #5 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)=CC=C21)[Si](C)(C)C | 3892.1 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,3TMS,isomer #6 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)=CC=C21)[Si](C)(C)C | 3892.8 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,3TMS,isomer #7 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)=CC=C21 | 3722.5 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,3TMS,isomer #8 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O)=CC=C21)[Si](C)(C)C | 3846.5 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,3TMS,isomer #9 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)=CC=C21)[Si](C)(C)C | 3896.3 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,4TMS,isomer #1 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)=CC=C21 | 3788.8 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,4TMS,isomer #2 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)=CC=C21)[Si](C)(C)C | 3872.2 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,4TMS,isomer #3 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)=CC=C21)[Si](C)(C)C | 3874.2 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,4TMS,isomer #4 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)=CC=C21)[Si](C)(C)C | 3904.4 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,4TMS,isomer #5 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)=CC=C21)[Si](C)(C)C | 3867.4 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,5TMS,isomer #1 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)=CC=C21)[Si](C)(C)C | 3897.4 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,5TMS,isomer #1 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)=CC=C21)[Si](C)(C)C | 3904.2 | Standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,5TMS,isomer #1 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O[Si](C)(C)C)=CC=C21)[Si](C)(C)C | 4229.0 | Standard polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,1TBDMS,isomer #1 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)=CC=C21 | 3986.1 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,1TBDMS,isomer #2 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)=CC=C21 | 3985.5 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,1TBDMS,isomer #3 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)=CC=C21 | 3986.0 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,1TBDMS,isomer #4 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)=CC=C21 | 3961.9 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,1TBDMS,isomer #5 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O)=CC=C21)[Si](C)(C)C(C)(C)C | 4174.2 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,2TBDMS,isomer #1 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)=CC=C21 | 4128.1 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,2TBDMS,isomer #10 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]3O)=CC=C21)[Si](C)(C)C(C)(C)C | 4305.3 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,2TBDMS,isomer #2 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)=CC=C21 | 4133.4 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,2TBDMS,isomer #3 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)=CC=C21 | 4133.9 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,2TBDMS,isomer #4 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)=CC=C21)[Si](C)(C)C(C)(C)C | 4319.1 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,2TBDMS,isomer #5 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)=CC=C21 | 4099.2 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,2TBDMS,isomer #6 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O[Si](C)(C)C(C)(C)C)=CC=C21 | 4132.0 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,2TBDMS,isomer #7 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)=CC=C21)[Si](C)(C)C(C)(C)C | 4313.9 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,2TBDMS,isomer #8 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)=CC=C21 | 4115.3 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,2TBDMS,isomer #9 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)=CC=C21)[Si](C)(C)C(C)(C)C | 4327.6 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,3TBDMS,isomer #1 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)=CC=C21 | 4257.5 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,3TBDMS,isomer #10 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)=CC=C21)[Si](C)(C)C(C)(C)C | 4480.8 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,3TBDMS,isomer #2 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)=CC=C21 | 4283.6 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,3TBDMS,isomer #3 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)=CC=C21)[Si](C)(C)C(C)(C)C | 4483.7 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,3TBDMS,isomer #4 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O[Si](C)(C)C(C)(C)C)=CC=C21 | 4298.9 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,3TBDMS,isomer #5 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)=CC=C21)[Si](C)(C)C(C)(C)C | 4495.1 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,3TBDMS,isomer #6 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)=CC=C21)[Si](C)(C)C(C)(C)C | 4494.3 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,3TBDMS,isomer #7 | CNCCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O[Si](C)(C)C(C)(C)C)=CC=C21 | 4254.8 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,3TBDMS,isomer #8 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)=CC=C21)[Si](C)(C)C(C)(C)C | 4451.4 | Semi standard non polar | 33892256 | | 2-Hydroxy-desipramine glucuronide,3TBDMS,isomer #9 | CN(CCCN1C2=CC=CC=C2CCC2=CC(O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O[Si](C)(C)C(C)(C)C)=CC=C21)[Si](C)(C)C(C)(C)C | 4492.2 | Semi standard non polar | 33892256 |
|
|---|