Hmdb loader
You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Human Metabolome Database.
Record Information
Version5.0
StatusExpected but not Quantified
Creation Date2017-03-23 02:42:53 UTC
Update Date2021-09-14 15:44:42 UTC
HMDB IDHMDB0062502
Secondary Accession Numbers
  • HMDB62502
Metabolite Identification
Common NameNeuNGc
DescriptionNeu5Gc, also known as NGNA or gcneu, belongs to the class of organic compounds known as n-acylneuraminic acids. These are neuraminic acids carrying an N-acyl substituent. Neu5Gc is an extremely weak basic (essentially neutral) compound (based on its pKa). Neu5Gc exists in all living organisms, ranging from bacteria to humans. From here, Neu5Gc are available for activation and addition to glycoconjugates. Neu5Gc is rapidly absorbed in the intestinal tract, some of which is converted to acylmannosamines by intestinal cells and bacteria, and reconverted back to Neu5Gc in the body. Neu5Gc is closely related to the commonly known N-acetylneuraminic acid (Neu5Ac).
Structure
Data?1563866320
Synonyms
ValueSource
N-GlycolylneuraminateKegg
N-Glycolylneuraminic acidGenerator
NGNAMeSH
N-Glycoloylneuraminic acidMeSH
N-Glycolylneuraminic acid, (alpha-D-gal)-isomerMeSH
GcNeuMeSH
Neu5GCKEGG
N-Glycoloyl-neuraminic acidGenerator, HMDB
Chemical FormulaC11H19NO10
Average Molecular Weight325.27
Monoisotopic Molecular Weight325.100895816
IUPAC Name(4S,5R,6R)-2,4-dihydroxy-5-(2-hydroxyacetamido)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid
Traditional Name(4S,5R,6R)-2,4-dihydroxy-5-(2-hydroxyacetamido)-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid
CAS Registry NumberNot Available
SMILES
OC[C@@H](O)[C@@H](O)[C@@H]1OC(O)(C[C@H](O)[C@H]1NC(=O)CO)C(O)=O
InChI Identifier
InChI=1S/C11H19NO10/c13-2-5(16)8(18)9-7(12-6(17)3-14)4(15)1-11(21,22-9)10(19)20/h4-5,7-9,13-16,18,21H,1-3H2,(H,12,17)(H,19,20)/t4-,5+,7+,8+,9+,11?/m0/s1
InChI KeyFDJKUWYYUZCUJX-PGIATKPXSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as n-acylneuraminic acids. These are neuraminic acids carrying an N-acyl substituent.
KingdomOrganic compounds
Super ClassOrganic oxygen compounds
ClassOrganooxygen compounds
Sub ClassCarbohydrates and carbohydrate conjugates
Direct ParentN-acylneuraminic acids
Alternative Parents
Substituents
  • N-acylneuraminic acid
  • Neuraminic acid
  • C-glucuronide
  • C-glycosyl compound
  • Glycosyl compound
  • Alpha-hydroxy acid
  • Pyran
  • Hydroxy acid
  • Oxane
  • Carboxamide group
  • Hemiacetal
  • Secondary carboxylic acid amide
  • Secondary alcohol
  • Carboxylic acid derivative
  • Carboxylic acid
  • Oxacycle
  • Organoheterocyclic compound
  • Monocarboxylic acid or derivatives
  • Polyol
  • Alcohol
  • Hydrocarbon derivative
  • Organic nitrogen compound
  • Organopnictogen compound
  • Primary alcohol
  • Organic oxide
  • Carbonyl group
  • Organonitrogen compound
  • Aliphatic heteromonocyclic compound
Molecular FrameworkAliphatic heteromonocyclic compounds
External DescriptorsNot Available
Ontology
Disposition

Source

Route of exposure

Physical Properties
StateNot Available
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water Solubility254 g/lALOGPS
LogP-2.98ALOGPS
Experimental Chromatographic PropertiesNot Available
Predicted Molecular Properties
PropertyValueSource
logP10(-3) g/LALOGPS
logP10(-4.4) g/LChemAxon
logS10(-0.11) g/LALOGPS
pKa (Strongest Acidic)2.92ChemAxon
pKa (Strongest Basic)-3ChemAxon
Physiological Charge-1ChemAxon
Hydrogen Acceptor Count10ChemAxon
Hydrogen Donor Count8ChemAxon
Polar Surface Area197.01 ŲChemAxon
Rotatable Bond Count6ChemAxon
Refractivity65.48 m³·mol⁻¹ChemAxon
Polarizability29.25 ųChemAxon
Number of Rings1ChemAxon
BioavailabilityYesChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleNoChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DarkChem[M+H]+175.35431661259
DarkChem[M-H]-164.19731661259
DeepCCS[M+H]+170.88430932474
DeepCCS[M-H]-168.48830932474

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
NeuNGcOC[C@@H](O)[C@@H](O)[C@@H]1OC(O)(C[C@H](O)[C@H]1NC(=O)CO)C(O)=O3839.6Standard polar33892256
NeuNGcOC[C@@H](O)[C@@H](O)[C@@H]1OC(O)(C[C@H](O)[C@H]1NC(=O)CO)C(O)=O2596.5Standard non polar33892256
NeuNGcOC[C@@H](O)[C@@H](O)[C@@H]1OC(O)(C[C@H](O)[C@H]1NC(=O)CO)C(O)=O3011.3Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
NeuNGc,1TMS,isomer #1C[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO2699.9Semi standard non polar33892256
NeuNGc,1TMS,isomer #2C[Si](C)(C)O[C@H](CO)[C@@H](O)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO2711.2Semi standard non polar33892256
NeuNGc,1TMS,isomer #3C[Si](C)(C)O[C@H]([C@H](O)CO)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO2679.0Semi standard non polar33892256
NeuNGc,1TMS,isomer #4C[Si](C)(C)OC1(C(=O)O)C[C@H](O)[C@@H](NC(=O)CO)[C@H]([C@H](O)[C@H](O)CO)O12693.2Semi standard non polar33892256
NeuNGc,1TMS,isomer #5C[Si](C)(C)O[C@H]1CC(O)(C(=O)O)O[C@@H]([C@H](O)[C@H](O)CO)[C@@H]1NC(=O)CO2687.3Semi standard non polar33892256
NeuNGc,1TMS,isomer #6C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO2751.4Semi standard non polar33892256
NeuNGc,1TMS,isomer #7C[Si](C)(C)OC(=O)C1(O)C[C@H](O)[C@@H](NC(=O)CO)[C@H]([C@H](O)[C@H](O)CO)O12641.0Semi standard non polar33892256
NeuNGc,1TMS,isomer #8C[Si](C)(C)N(C(=O)CO)[C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO2653.5Semi standard non polar33892256
NeuNGc,2TMS,isomer #1C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO2680.6Semi standard non polar33892256
NeuNGc,2TMS,isomer #10C[Si](C)(C)OC(=O)C1(O)C[C@H](O)[C@@H](NC(=O)CO)[C@H]([C@H](O)[C@@H](CO)O[Si](C)(C)C)O12634.2Semi standard non polar33892256
NeuNGc,2TMS,isomer #11C[Si](C)(C)O[C@H]1CC(O)(C(=O)O)O[C@@H]([C@H](O)[C@@H](CO)O[Si](C)(C)C)[C@@H]1NC(=O)CO2666.5Semi standard non polar33892256
NeuNGc,2TMS,isomer #12C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C2690.1Semi standard non polar33892256
NeuNGc,2TMS,isomer #13C[Si](C)(C)O[C@H](CO)[C@@H](O)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C2637.1Semi standard non polar33892256
NeuNGc,2TMS,isomer #14C[Si](C)(C)O[C@H]([C@H](O)CO)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO2672.2Semi standard non polar33892256
NeuNGc,2TMS,isomer #15C[Si](C)(C)OC(=O)C1(O)C[C@H](O)[C@@H](NC(=O)CO)[C@H]([C@H](O[Si](C)(C)C)[C@H](O)CO)O12621.0Semi standard non polar33892256
NeuNGc,2TMS,isomer #16C[Si](C)(C)O[C@H]1CC(O)(C(=O)O)O[C@@H]([C@H](O[Si](C)(C)C)[C@H](O)CO)[C@@H]1NC(=O)CO2655.2Semi standard non polar33892256
NeuNGc,2TMS,isomer #17C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO2668.2Semi standard non polar33892256
NeuNGc,2TMS,isomer #18C[Si](C)(C)O[C@H]([C@H](O)CO)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C2638.4Semi standard non polar33892256
NeuNGc,2TMS,isomer #19C[Si](C)(C)OC(=O)C1(O[Si](C)(C)C)C[C@H](O)[C@@H](NC(=O)CO)[C@H]([C@H](O)[C@H](O)CO)O12635.4Semi standard non polar33892256
NeuNGc,2TMS,isomer #2C[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO2668.0Semi standard non polar33892256
NeuNGc,2TMS,isomer #20C[Si](C)(C)O[C@H]1CC(O[Si](C)(C)C)(C(=O)O)O[C@@H]([C@H](O)[C@H](O)CO)[C@@H]1NC(=O)CO2672.6Semi standard non polar33892256
NeuNGc,2TMS,isomer #21C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO2720.2Semi standard non polar33892256
NeuNGc,2TMS,isomer #22C[Si](C)(C)OC1(C(=O)O)C[C@H](O)[C@@H](N(C(=O)CO)[Si](C)(C)C)[C@H]([C@H](O)[C@H](O)CO)O12659.3Semi standard non polar33892256
NeuNGc,2TMS,isomer #23C[Si](C)(C)OC(=O)C1(O)C[C@H](O[Si](C)(C)C)[C@@H](NC(=O)CO)[C@H]([C@H](O)[C@H](O)CO)O12597.9Semi standard non polar33892256
NeuNGc,2TMS,isomer #24C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO2677.8Semi standard non polar33892256
NeuNGc,2TMS,isomer #25C[Si](C)(C)O[C@H]1CC(O)(C(=O)O)O[C@@H]([C@H](O)[C@H](O)CO)[C@@H]1N(C(=O)CO)[Si](C)(C)C2638.9Semi standard non polar33892256
NeuNGc,2TMS,isomer #26C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO2643.9Semi standard non polar33892256
NeuNGc,2TMS,isomer #27C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO)[Si](C)(C)C2655.6Semi standard non polar33892256
NeuNGc,2TMS,isomer #28C[Si](C)(C)OC(=O)C1(O)C[C@H](O)[C@@H](N(C(=O)CO)[Si](C)(C)C)[C@H]([C@H](O)[C@H](O)CO)O12592.2Semi standard non polar33892256
NeuNGc,2TMS,isomer #3C[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO2695.4Semi standard non polar33892256
NeuNGc,2TMS,isomer #4C[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C)C[C@H](O)[C@H]1NC(=O)CO2633.2Semi standard non polar33892256
NeuNGc,2TMS,isomer #5C[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O)(C(=O)O)C[C@H](O[Si](C)(C)C)[C@H]1NC(=O)CO2681.3Semi standard non polar33892256
NeuNGc,2TMS,isomer #6C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C2684.8Semi standard non polar33892256
NeuNGc,2TMS,isomer #7C[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C2647.4Semi standard non polar33892256
NeuNGc,2TMS,isomer #8C[Si](C)(C)O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO2683.8Semi standard non polar33892256
NeuNGc,2TMS,isomer #9C[Si](C)(C)O[C@H](CO)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO2696.1Semi standard non polar33892256
NeuNGc,3TMS,isomer #1C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO2631.0Semi standard non polar33892256
NeuNGc,3TMS,isomer #10C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C2650.2Semi standard non polar33892256
NeuNGc,3TMS,isomer #11C[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C2634.2Semi standard non polar33892256
NeuNGc,3TMS,isomer #12C[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)C[C@H](O)[C@H]1NC(=O)CO2576.8Semi standard non polar33892256
NeuNGc,3TMS,isomer #13C[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O)C[C@H](O[Si](C)(C)C)[C@H]1NC(=O)CO2609.4Semi standard non polar33892256
NeuNGc,3TMS,isomer #14C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C2659.2Semi standard non polar33892256
NeuNGc,3TMS,isomer #15C[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C2640.6Semi standard non polar33892256
NeuNGc,3TMS,isomer #16C[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C)C[C@H](O[Si](C)(C)C)[C@H]1NC(=O)CO2566.4Semi standard non polar33892256
NeuNGc,3TMS,isomer #17C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C2611.4Semi standard non polar33892256
NeuNGc,3TMS,isomer #18C[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C2597.6Semi standard non polar33892256
NeuNGc,3TMS,isomer #19C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C2611.3Semi standard non polar33892256
NeuNGc,3TMS,isomer #2C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO2645.4Semi standard non polar33892256
NeuNGc,3TMS,isomer #20C[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O)(C(=O)O)C[C@H](O[Si](C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C2615.1Semi standard non polar33892256
NeuNGc,3TMS,isomer #21C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C)[Si](C)(C)C2623.3Semi standard non polar33892256
NeuNGc,3TMS,isomer #22C[Si](C)(C)O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO2661.5Semi standard non polar33892256
NeuNGc,3TMS,isomer #23C[Si](C)(C)OC(=O)C1(O)C[C@H](O)[C@@H](NC(=O)CO)[C@H]([C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C)O12639.7Semi standard non polar33892256
NeuNGc,3TMS,isomer #24C[Si](C)(C)O[C@H]1CC(O)(C(=O)O)O[C@@H]([C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C)[C@@H]1NC(=O)CO2616.3Semi standard non polar33892256
NeuNGc,3TMS,isomer #25C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C2658.2Semi standard non polar33892256
NeuNGc,3TMS,isomer #26C[Si](C)(C)O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C2634.1Semi standard non polar33892256
NeuNGc,3TMS,isomer #27C[Si](C)(C)OC(=O)C1(O[Si](C)(C)C)C[C@H](O)[C@@H](NC(=O)CO)[C@H]([C@H](O)[C@@H](CO)O[Si](C)(C)C)O12607.0Semi standard non polar33892256
NeuNGc,3TMS,isomer #28C[Si](C)(C)O[C@H]1CC(O[Si](C)(C)C)(C(=O)O)O[C@@H]([C@H](O)[C@@H](CO)O[Si](C)(C)C)[C@@H]1NC(=O)CO2636.7Semi standard non polar33892256
NeuNGc,3TMS,isomer #29C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C2691.3Semi standard non polar33892256
NeuNGc,3TMS,isomer #3C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C)C[C@H](O)[C@H]1NC(=O)CO2593.7Semi standard non polar33892256
NeuNGc,3TMS,isomer #30C[Si](C)(C)O[C@H](CO)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C2648.2Semi standard non polar33892256
NeuNGc,3TMS,isomer #31C[Si](C)(C)OC(=O)C1(O)C[C@H](O[Si](C)(C)C)[C@@H](NC(=O)CO)[C@H]([C@H](O)[C@@H](CO)O[Si](C)(C)C)O12591.9Semi standard non polar33892256
NeuNGc,3TMS,isomer #32C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C2648.4Semi standard non polar33892256
NeuNGc,3TMS,isomer #33C[Si](C)(C)OC(=O)C1(O)C[C@H](O)[C@@H](N(C(=O)CO)[Si](C)(C)C)[C@H]([C@H](O)[C@@H](CO)O[Si](C)(C)C)O12597.7Semi standard non polar33892256
NeuNGc,3TMS,isomer #34C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C2646.1Semi standard non polar33892256
NeuNGc,3TMS,isomer #35C[Si](C)(C)O[C@H]1CC(O)(C(=O)O)O[C@@H]([C@H](O)[C@@H](CO)O[Si](C)(C)C)[C@@H]1N(C(=O)CO)[Si](C)(C)C2628.7Semi standard non polar33892256
NeuNGc,3TMS,isomer #36C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C)[Si](C)(C)C2628.6Semi standard non polar33892256
NeuNGc,3TMS,isomer #37C[Si](C)(C)OC(=O)C1(O[Si](C)(C)C)C[C@H](O)[C@@H](NC(=O)CO)[C@H]([C@H](O[Si](C)(C)C)[C@H](O)CO)O12566.8Semi standard non polar33892256
NeuNGc,3TMS,isomer #38C[Si](C)(C)O[C@H]1CC(O[Si](C)(C)C)(C(=O)O)O[C@@H]([C@H](O[Si](C)(C)C)[C@H](O)CO)[C@@H]1NC(=O)CO2599.2Semi standard non polar33892256
NeuNGc,3TMS,isomer #39C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO2644.1Semi standard non polar33892256
NeuNGc,3TMS,isomer #4C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC(O)(C(=O)O)C[C@H](O[Si](C)(C)C)[C@H]1NC(=O)CO2592.8Semi standard non polar33892256
NeuNGc,3TMS,isomer #40C[Si](C)(C)O[C@H]([C@H](O)CO)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C2627.0Semi standard non polar33892256
NeuNGc,3TMS,isomer #41C[Si](C)(C)OC(=O)C1(O)C[C@H](O[Si](C)(C)C)[C@@H](NC(=O)CO)[C@H]([C@H](O[Si](C)(C)C)[C@H](O)CO)O12577.0Semi standard non polar33892256
NeuNGc,3TMS,isomer #42C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO2626.6Semi standard non polar33892256
NeuNGc,3TMS,isomer #43C[Si](C)(C)OC(=O)C1(O)C[C@H](O)[C@@H](N(C(=O)CO)[Si](C)(C)C)[C@H]([C@H](O[Si](C)(C)C)[C@H](O)CO)O12601.7Semi standard non polar33892256
NeuNGc,3TMS,isomer #44C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO2616.4Semi standard non polar33892256
NeuNGc,3TMS,isomer #45C[Si](C)(C)O[C@H]1CC(O)(C(=O)O)O[C@@H]([C@H](O[Si](C)(C)C)[C@H](O)CO)[C@@H]1N(C(=O)CO)[Si](C)(C)C2620.4Semi standard non polar33892256
NeuNGc,3TMS,isomer #46C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO)[Si](C)(C)C2623.0Semi standard non polar33892256
NeuNGc,3TMS,isomer #47C[Si](C)(C)OC(=O)C1(O[Si](C)(C)C)C[C@H](O[Si](C)(C)C)[C@@H](NC(=O)CO)[C@H]([C@H](O)[C@H](O)CO)O12546.1Semi standard non polar33892256
NeuNGc,3TMS,isomer #48C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO2596.3Semi standard non polar33892256
NeuNGc,3TMS,isomer #49C[Si](C)(C)OC(=O)C1(O[Si](C)(C)C)C[C@H](O)[C@@H](N(C(=O)CO)[Si](C)(C)C)[C@H]([C@H](O)[C@H](O)CO)O12594.3Semi standard non polar33892256
NeuNGc,3TMS,isomer #5C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C2615.6Semi standard non polar33892256
NeuNGc,3TMS,isomer #50C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO2637.7Semi standard non polar33892256
NeuNGc,3TMS,isomer #51C[Si](C)(C)O[C@H]1CC(O[Si](C)(C)C)(C(=O)O)O[C@@H]([C@H](O)[C@H](O)CO)[C@@H]1N(C(=O)CO)[Si](C)(C)C2625.0Semi standard non polar33892256
NeuNGc,3TMS,isomer #52C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO)[Si](C)(C)C2625.1Semi standard non polar33892256
NeuNGc,3TMS,isomer #53C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO2602.6Semi standard non polar33892256
NeuNGc,3TMS,isomer #54C[Si](C)(C)OC(=O)C1(O)C[C@H](O[Si](C)(C)C)[C@@H](N(C(=O)CO)[Si](C)(C)C)[C@H]([C@H](O)[C@H](O)CO)O12585.2Semi standard non polar33892256
NeuNGc,3TMS,isomer #55C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO)[Si](C)(C)C2605.6Semi standard non polar33892256
NeuNGc,3TMS,isomer #56C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO)[Si](C)(C)C2597.8Semi standard non polar33892256
NeuNGc,3TMS,isomer #6C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C2599.7Semi standard non polar33892256
NeuNGc,3TMS,isomer #7C[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO2653.0Semi standard non polar33892256
NeuNGc,3TMS,isomer #8C[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C)C[C@H](O)[C@H]1NC(=O)CO2634.6Semi standard non polar33892256
NeuNGc,3TMS,isomer #9C[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O)(C(=O)O)C[C@H](O[Si](C)(C)C)[C@H]1NC(=O)CO2617.3Semi standard non polar33892256
NeuNGc,4TMS,isomer #1C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO2653.6Semi standard non polar33892256
NeuNGc,4TMS,isomer #10C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C)C[C@H](O[Si](C)(C)C)[C@H]1NC(=O)CO2596.8Semi standard non polar33892256
NeuNGc,4TMS,isomer #11C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C2633.9Semi standard non polar33892256
NeuNGc,4TMS,isomer #12C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C2616.5Semi standard non polar33892256
NeuNGc,4TMS,isomer #13C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C2604.1Semi standard non polar33892256
NeuNGc,4TMS,isomer #14C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC(O)(C(=O)O)C[C@H](O[Si](C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C2619.5Semi standard non polar33892256
NeuNGc,4TMS,isomer #15C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C2632.0Semi standard non polar33892256
NeuNGc,4TMS,isomer #16C[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)C[C@H](O)[C@H]1NC(=O)CO2623.3Semi standard non polar33892256
NeuNGc,4TMS,isomer #17C[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O)C[C@H](O[Si](C)(C)C)[C@H]1NC(=O)CO2643.3Semi standard non polar33892256
NeuNGc,4TMS,isomer #18C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C2695.3Semi standard non polar33892256
NeuNGc,4TMS,isomer #19C[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C2666.6Semi standard non polar33892256
NeuNGc,4TMS,isomer #2C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C)C[C@H](O)[C@H]1NC(=O)CO2638.4Semi standard non polar33892256
NeuNGc,4TMS,isomer #20C[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C)C[C@H](O[Si](C)(C)C)[C@H]1NC(=O)CO2625.0Semi standard non polar33892256
NeuNGc,4TMS,isomer #21C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C2670.1Semi standard non polar33892256
NeuNGc,4TMS,isomer #22C[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C2641.1Semi standard non polar33892256
NeuNGc,4TMS,isomer #23C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C2632.8Semi standard non polar33892256
NeuNGc,4TMS,isomer #24C[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O)(C(=O)O)C[C@H](O[Si](C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C2644.4Semi standard non polar33892256
NeuNGc,4TMS,isomer #25C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C)[Si](C)(C)C2665.3Semi standard non polar33892256
NeuNGc,4TMS,isomer #26C[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)C[C@H](O[Si](C)(C)C)[C@H]1NC(=O)CO2569.4Semi standard non polar33892256
NeuNGc,4TMS,isomer #27C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C2624.2Semi standard non polar33892256
NeuNGc,4TMS,isomer #28C[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C2624.6Semi standard non polar33892256
NeuNGc,4TMS,isomer #29C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C2626.6Semi standard non polar33892256
NeuNGc,4TMS,isomer #3C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O)(C(=O)O)C[C@H](O[Si](C)(C)C)[C@H]1NC(=O)CO2590.1Semi standard non polar33892256
NeuNGc,4TMS,isomer #30C[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O)C[C@H](O[Si](C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C2637.5Semi standard non polar33892256
NeuNGc,4TMS,isomer #31C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C)[Si](C)(C)C2666.6Semi standard non polar33892256
NeuNGc,4TMS,isomer #32C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C2614.5Semi standard non polar33892256
NeuNGc,4TMS,isomer #33C[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C)C[C@H](O[Si](C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C2610.3Semi standard non polar33892256
NeuNGc,4TMS,isomer #34C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C)[Si](C)(C)C2642.6Semi standard non polar33892256
NeuNGc,4TMS,isomer #35C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C)[Si](C)(C)C2631.2Semi standard non polar33892256
NeuNGc,4TMS,isomer #36C[Si](C)(C)OC(=O)C1(O[Si](C)(C)C)C[C@H](O)[C@@H](NC(=O)CO)[C@H]([C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C)O12626.1Semi standard non polar33892256
NeuNGc,4TMS,isomer #37C[Si](C)(C)O[C@H]1CC(O[Si](C)(C)C)(C(=O)O)O[C@@H]([C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C)[C@@H]1NC(=O)CO2650.1Semi standard non polar33892256
NeuNGc,4TMS,isomer #38C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C2699.5Semi standard non polar33892256
NeuNGc,4TMS,isomer #39C[Si](C)(C)O[C@H]([C@@H](CO)O[Si](C)(C)C)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C2670.1Semi standard non polar33892256
NeuNGc,4TMS,isomer #4C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C2618.2Semi standard non polar33892256
NeuNGc,4TMS,isomer #40C[Si](C)(C)OC(=O)C1(O)C[C@H](O[Si](C)(C)C)[C@@H](NC(=O)CO)[C@H]([C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C)O12626.6Semi standard non polar33892256
NeuNGc,4TMS,isomer #41C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C2674.6Semi standard non polar33892256
NeuNGc,4TMS,isomer #42C[Si](C)(C)OC(=O)C1(O)C[C@H](O)[C@@H](N(C(=O)CO)[Si](C)(C)C)[C@H]([C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C)O12639.5Semi standard non polar33892256
NeuNGc,4TMS,isomer #43C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C2637.3Semi standard non polar33892256
NeuNGc,4TMS,isomer #44C[Si](C)(C)O[C@H]1CC(O)(C(=O)O)O[C@@H]([C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C)[C@@H]1N(C(=O)CO)[Si](C)(C)C2648.4Semi standard non polar33892256
NeuNGc,4TMS,isomer #45C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C)[Si](C)(C)C2662.5Semi standard non polar33892256
NeuNGc,4TMS,isomer #46C[Si](C)(C)OC(=O)C1(O[Si](C)(C)C)C[C@H](O[Si](C)(C)C)[C@@H](NC(=O)CO)[C@H]([C@H](O)[C@@H](CO)O[Si](C)(C)C)O12601.1Semi standard non polar33892256
NeuNGc,4TMS,isomer #47C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C2661.9Semi standard non polar33892256
NeuNGc,4TMS,isomer #48C[Si](C)(C)OC(=O)C1(O[Si](C)(C)C)C[C@H](O)[C@@H](N(C(=O)CO)[Si](C)(C)C)[C@H]([C@H](O)[C@@H](CO)O[Si](C)(C)C)O12627.2Semi standard non polar33892256
NeuNGc,4TMS,isomer #49C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C2665.1Semi standard non polar33892256
NeuNGc,4TMS,isomer #5C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C2635.1Semi standard non polar33892256
NeuNGc,4TMS,isomer #50C[Si](C)(C)O[C@H]1CC(O[Si](C)(C)C)(C(=O)O)O[C@@H]([C@H](O)[C@@H](CO)O[Si](C)(C)C)[C@@H]1N(C(=O)CO)[Si](C)(C)C2660.1Semi standard non polar33892256
NeuNGc,4TMS,isomer #51C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C)[Si](C)(C)C2680.8Semi standard non polar33892256
NeuNGc,4TMS,isomer #52C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C2645.6Semi standard non polar33892256
NeuNGc,4TMS,isomer #53C[Si](C)(C)OC(=O)C1(O)C[C@H](O[Si](C)(C)C)[C@@H](N(C(=O)CO)[Si](C)(C)C)[C@H]([C@H](O)[C@@H](CO)O[Si](C)(C)C)O12610.0Semi standard non polar33892256
NeuNGc,4TMS,isomer #54C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C)[Si](C)(C)C2643.9Semi standard non polar33892256
NeuNGc,4TMS,isomer #55C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C)[Si](C)(C)C2655.6Semi standard non polar33892256
NeuNGc,4TMS,isomer #56C[Si](C)(C)OC(=O)C1(O[Si](C)(C)C)C[C@H](O[Si](C)(C)C)[C@@H](NC(=O)CO)[C@H]([C@H](O[Si](C)(C)C)[C@H](O)CO)O12585.6Semi standard non polar33892256
NeuNGc,4TMS,isomer #57C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO2634.9Semi standard non polar33892256
NeuNGc,4TMS,isomer #58C[Si](C)(C)OC(=O)C1(O[Si](C)(C)C)C[C@H](O)[C@@H](N(C(=O)CO)[Si](C)(C)C)[C@H]([C@H](O[Si](C)(C)C)[C@H](O)CO)O12610.1Semi standard non polar33892256
NeuNGc,4TMS,isomer #59C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO2649.0Semi standard non polar33892256
NeuNGc,4TMS,isomer #6C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)C[C@H](O)[C@H]1NC(=O)CO2604.6Semi standard non polar33892256
NeuNGc,4TMS,isomer #60C[Si](C)(C)O[C@H]1CC(O[Si](C)(C)C)(C(=O)O)O[C@@H]([C@H](O[Si](C)(C)C)[C@H](O)CO)[C@@H]1N(C(=O)CO)[Si](C)(C)C2634.9Semi standard non polar33892256
NeuNGc,4TMS,isomer #61C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO)[Si](C)(C)C2658.5Semi standard non polar33892256
NeuNGc,4TMS,isomer #62C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO2640.1Semi standard non polar33892256
NeuNGc,4TMS,isomer #63C[Si](C)(C)OC(=O)C1(O)C[C@H](O[Si](C)(C)C)[C@@H](N(C(=O)CO)[Si](C)(C)C)[C@H]([C@H](O[Si](C)(C)C)[C@H](O)CO)O12612.4Semi standard non polar33892256
NeuNGc,4TMS,isomer #64C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO)[Si](C)(C)C2639.0Semi standard non polar33892256
NeuNGc,4TMS,isomer #65C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO)[Si](C)(C)C2638.2Semi standard non polar33892256
NeuNGc,4TMS,isomer #66C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO2585.0Semi standard non polar33892256
NeuNGc,4TMS,isomer #67C[Si](C)(C)OC(=O)C1(O[Si](C)(C)C)C[C@H](O[Si](C)(C)C)[C@@H](N(C(=O)CO)[Si](C)(C)C)[C@H]([C@H](O)[C@H](O)CO)O12614.0Semi standard non polar33892256
NeuNGc,4TMS,isomer #68C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO)[Si](C)(C)C2622.0Semi standard non polar33892256
NeuNGc,4TMS,isomer #69C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO)[Si](C)(C)C2627.5Semi standard non polar33892256
NeuNGc,4TMS,isomer #7C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O)C[C@H](O[Si](C)(C)C)[C@H]1NC(=O)CO2618.8Semi standard non polar33892256
NeuNGc,4TMS,isomer #70C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO)[Si](C)(C)C2611.5Semi standard non polar33892256
NeuNGc,4TMS,isomer #8C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C2672.5Semi standard non polar33892256
NeuNGc,4TMS,isomer #9C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C2641.7Semi standard non polar33892256
NeuNGc,5TMS,isomer #1C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)C[C@H](O)[C@H]1NC(=O)CO2643.5Semi standard non polar33892256
NeuNGc,5TMS,isomer #10C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C2658.9Semi standard non polar33892256
NeuNGc,5TMS,isomer #11C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)C[C@H](O[Si](C)(C)C)[C@H]1NC(=O)CO2620.4Semi standard non polar33892256
NeuNGc,5TMS,isomer #12C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C2661.8Semi standard non polar33892256
NeuNGc,5TMS,isomer #13C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C2637.6Semi standard non polar33892256
NeuNGc,5TMS,isomer #14C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C2655.0Semi standard non polar33892256
NeuNGc,5TMS,isomer #15C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O)C[C@H](O[Si](C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C2657.2Semi standard non polar33892256
NeuNGc,5TMS,isomer #16C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C2697.0Semi standard non polar33892256
NeuNGc,5TMS,isomer #17C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C2621.3Semi standard non polar33892256
NeuNGc,5TMS,isomer #18C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C)C[C@H](O[Si](C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C2623.2Semi standard non polar33892256
NeuNGc,5TMS,isomer #19C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C2656.4Semi standard non polar33892256
NeuNGc,5TMS,isomer #2C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O)C[C@H](O[Si](C)(C)C)[C@H]1NC(=O)CO2646.4Semi standard non polar33892256
NeuNGc,5TMS,isomer #20C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C2651.3Semi standard non polar33892256
NeuNGc,5TMS,isomer #21C[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)C[C@H](O[Si](C)(C)C)[C@H]1NC(=O)CO2634.7Semi standard non polar33892256
NeuNGc,5TMS,isomer #22C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C2673.4Semi standard non polar33892256
NeuNGc,5TMS,isomer #23C[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C2641.9Semi standard non polar33892256
NeuNGc,5TMS,isomer #24C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C2677.7Semi standard non polar33892256
NeuNGc,5TMS,isomer #25C[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O)C[C@H](O[Si](C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C2672.2Semi standard non polar33892256
NeuNGc,5TMS,isomer #26C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C)[Si](C)(C)C2711.6Semi standard non polar33892256
NeuNGc,5TMS,isomer #27C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C2649.0Semi standard non polar33892256
NeuNGc,5TMS,isomer #28C[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C)C[C@H](O[Si](C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C2635.8Semi standard non polar33892256
NeuNGc,5TMS,isomer #29C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C)[Si](C)(C)C2671.4Semi standard non polar33892256
NeuNGc,5TMS,isomer #3C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C2681.9Semi standard non polar33892256
NeuNGc,5TMS,isomer #30C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C)[Si](C)(C)C2664.9Semi standard non polar33892256
NeuNGc,5TMS,isomer #31C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C2612.0Semi standard non polar33892256
NeuNGc,5TMS,isomer #32C[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)C[C@H](O[Si](C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C2643.6Semi standard non polar33892256
NeuNGc,5TMS,isomer #33C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C)[Si](C)(C)C2670.6Semi standard non polar33892256
NeuNGc,5TMS,isomer #34C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C)[Si](C)(C)C2674.0Semi standard non polar33892256
NeuNGc,5TMS,isomer #35C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C)[Si](C)(C)C2652.6Semi standard non polar33892256
NeuNGc,5TMS,isomer #36C[Si](C)(C)OC(=O)C1(O[Si](C)(C)C)C[C@H](O[Si](C)(C)C)[C@@H](NC(=O)CO)[C@H]([C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C)O12643.4Semi standard non polar33892256
NeuNGc,5TMS,isomer #37C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C2674.5Semi standard non polar33892256
NeuNGc,5TMS,isomer #38C[Si](C)(C)OC(=O)C1(O[Si](C)(C)C)C[C@H](O)[C@@H](N(C(=O)CO)[Si](C)(C)C)[C@H]([C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C)O12648.1Semi standard non polar33892256
NeuNGc,5TMS,isomer #39C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C2678.2Semi standard non polar33892256
NeuNGc,5TMS,isomer #4C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C2679.2Semi standard non polar33892256
NeuNGc,5TMS,isomer #40C[Si](C)(C)O[C@H]1CC(O[Si](C)(C)C)(C(=O)O)O[C@@H]([C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C)[C@@H]1N(C(=O)CO)[Si](C)(C)C2680.5Semi standard non polar33892256
NeuNGc,5TMS,isomer #41C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C)[Si](C)(C)C2715.1Semi standard non polar33892256
NeuNGc,5TMS,isomer #42C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C2649.5Semi standard non polar33892256
NeuNGc,5TMS,isomer #43C[Si](C)(C)OC(=O)C1(O)C[C@H](O[Si](C)(C)C)[C@@H](N(C(=O)CO)[Si](C)(C)C)[C@H]([C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C)O12645.7Semi standard non polar33892256
NeuNGc,5TMS,isomer #44C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C)[Si](C)(C)C2673.9Semi standard non polar33892256
NeuNGc,5TMS,isomer #45C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C)[Si](C)(C)C2674.5Semi standard non polar33892256
NeuNGc,5TMS,isomer #46C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C2648.3Semi standard non polar33892256
NeuNGc,5TMS,isomer #47C[Si](C)(C)OC(=O)C1(O[Si](C)(C)C)C[C@H](O[Si](C)(C)C)[C@@H](N(C(=O)CO)[Si](C)(C)C)[C@H]([C@H](O)[C@@H](CO)O[Si](C)(C)C)O12641.8Semi standard non polar33892256
NeuNGc,5TMS,isomer #48C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C)[Si](C)(C)C2674.0Semi standard non polar33892256
NeuNGc,5TMS,isomer #49C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C)[Si](C)(C)C2697.2Semi standard non polar33892256
NeuNGc,5TMS,isomer #5C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C)C[C@H](O[Si](C)(C)C)[C@H]1NC(=O)CO2630.3Semi standard non polar33892256
NeuNGc,5TMS,isomer #50C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C)[Si](C)(C)C2656.0Semi standard non polar33892256
NeuNGc,5TMS,isomer #51C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO2642.9Semi standard non polar33892256
NeuNGc,5TMS,isomer #52C[Si](C)(C)OC(=O)C1(O[Si](C)(C)C)C[C@H](O[Si](C)(C)C)[C@@H](N(C(=O)CO)[Si](C)(C)C)[C@H]([C@H](O[Si](C)(C)C)[C@H](O)CO)O12642.2Semi standard non polar33892256
NeuNGc,5TMS,isomer #53C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO)[Si](C)(C)C2660.0Semi standard non polar33892256
NeuNGc,5TMS,isomer #54C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO)[Si](C)(C)C2688.2Semi standard non polar33892256
NeuNGc,5TMS,isomer #55C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO)[Si](C)(C)C2662.8Semi standard non polar33892256
NeuNGc,5TMS,isomer #56C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO)[Si](C)(C)C2660.4Semi standard non polar33892256
NeuNGc,5TMS,isomer #6C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C2664.2Semi standard non polar33892256
NeuNGc,5TMS,isomer #7C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C2646.6Semi standard non polar33892256
NeuNGc,5TMS,isomer #8C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C2606.8Semi standard non polar33892256
NeuNGc,5TMS,isomer #9C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O)(C(=O)O)C[C@H](O[Si](C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C2648.2Semi standard non polar33892256
NeuNGc,6TMS,isomer #1C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)C[C@H](O[Si](C)(C)C)[C@H]1NC(=O)CO2654.8Semi standard non polar33892256
NeuNGc,6TMS,isomer #10C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C2686.3Semi standard non polar33892256
NeuNGc,6TMS,isomer #11C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C2632.8Semi standard non polar33892256
NeuNGc,6TMS,isomer #12C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)C[C@H](O[Si](C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C2661.6Semi standard non polar33892256
NeuNGc,6TMS,isomer #13C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C2677.0Semi standard non polar33892256
NeuNGc,6TMS,isomer #14C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C2706.9Semi standard non polar33892256
NeuNGc,6TMS,isomer #15C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C2663.4Semi standard non polar33892256
NeuNGc,6TMS,isomer #16C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C2640.8Semi standard non polar33892256
NeuNGc,6TMS,isomer #17C[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)C[C@H](O[Si](C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C2659.7Semi standard non polar33892256
NeuNGc,6TMS,isomer #18C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C)[Si](C)(C)C2675.4Semi standard non polar33892256
NeuNGc,6TMS,isomer #19C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C)[Si](C)(C)C2710.8Semi standard non polar33892256
NeuNGc,6TMS,isomer #2C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C2656.2Semi standard non polar33892256
NeuNGc,6TMS,isomer #20C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C)[Si](C)(C)C2671.8Semi standard non polar33892256
NeuNGc,6TMS,isomer #21C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C)[Si](C)(C)C2678.5Semi standard non polar33892256
NeuNGc,6TMS,isomer #22C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C2652.2Semi standard non polar33892256
NeuNGc,6TMS,isomer #23C[Si](C)(C)OC(=O)C1(O[Si](C)(C)C)C[C@H](O[Si](C)(C)C)[C@@H](N(C(=O)CO)[Si](C)(C)C)[C@H]([C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C)O12675.4Semi standard non polar33892256
NeuNGc,6TMS,isomer #24C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C)[Si](C)(C)C2687.8Semi standard non polar33892256
NeuNGc,6TMS,isomer #25C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C)[Si](C)(C)C2729.5Semi standard non polar33892256
NeuNGc,6TMS,isomer #26C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C)[Si](C)(C)C2689.9Semi standard non polar33892256
NeuNGc,6TMS,isomer #27C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C)[Si](C)(C)C2692.6Semi standard non polar33892256
NeuNGc,6TMS,isomer #28C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO)[Si](C)(C)C2682.5Semi standard non polar33892256
NeuNGc,6TMS,isomer #3C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C2666.2Semi standard non polar33892256
NeuNGc,6TMS,isomer #4C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C2656.2Semi standard non polar33892256
NeuNGc,6TMS,isomer #5C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O)C[C@H](O[Si](C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C2699.6Semi standard non polar33892256
NeuNGc,6TMS,isomer #6C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C2716.3Semi standard non polar33892256
NeuNGc,6TMS,isomer #7C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C2630.3Semi standard non polar33892256
NeuNGc,6TMS,isomer #8C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C)C[C@H](O[Si](C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C2661.5Semi standard non polar33892256
NeuNGc,6TMS,isomer #9C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C2676.2Semi standard non polar33892256
NeuNGc,7TMS,isomer #1C[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C2663.7Semi standard non polar33892256
NeuNGc,7TMS,isomer #2C[Si](C)(C)OC[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1OC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)C[C@H](O[Si](C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C2702.9Semi standard non polar33892256
NeuNGc,7TMS,isomer #3C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C2715.8Semi standard non polar33892256
NeuNGc,7TMS,isomer #4C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C2753.8Semi standard non polar33892256
NeuNGc,7TMS,isomer #5C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C2714.6Semi standard non polar33892256
NeuNGc,7TMS,isomer #6C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C)O[Si](C)(C)C)[Si](C)(C)C2712.0Semi standard non polar33892256
NeuNGc,7TMS,isomer #7C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@H](O)CO[Si](C)(C)C)[Si](C)(C)C2712.0Semi standard non polar33892256
NeuNGc,7TMS,isomer #8C[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C)CC(O[Si](C)(C)C)(C(=O)O[Si](C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[Si](C)(C)C)[Si](C)(C)C2728.8Semi standard non polar33892256
NeuNGc,1TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO2951.3Semi standard non polar33892256
NeuNGc,1TBDMS,isomer #2CC(C)(C)[Si](C)(C)O[C@H](CO)[C@@H](O)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO2952.3Semi standard non polar33892256
NeuNGc,1TBDMS,isomer #3CC(C)(C)[Si](C)(C)O[C@H]([C@H](O)CO)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO2928.2Semi standard non polar33892256
NeuNGc,1TBDMS,isomer #4CC(C)(C)[Si](C)(C)OC1(C(=O)O)C[C@H](O)[C@@H](NC(=O)CO)[C@H]([C@H](O)[C@H](O)CO)O12946.8Semi standard non polar33892256
NeuNGc,1TBDMS,isomer #5CC(C)(C)[Si](C)(C)O[C@H]1CC(O)(C(=O)O)O[C@@H]([C@H](O)[C@H](O)CO)[C@@H]1NC(=O)CO2918.5Semi standard non polar33892256
NeuNGc,1TBDMS,isomer #6CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO2971.9Semi standard non polar33892256
NeuNGc,1TBDMS,isomer #7CC(C)(C)[Si](C)(C)OC(=O)C1(O)C[C@H](O)[C@@H](NC(=O)CO)[C@H]([C@H](O)[C@H](O)CO)O12919.5Semi standard non polar33892256
NeuNGc,1TBDMS,isomer #8CC(C)(C)[Si](C)(C)N(C(=O)CO)[C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO2917.6Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO3109.8Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #10CC(C)(C)[Si](C)(C)OC(=O)C1(O)C[C@H](O)[C@@H](NC(=O)CO)[C@H]([C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C)O13123.0Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #11CC(C)(C)[Si](C)(C)O[C@H]1CC(O)(C(=O)O)O[C@@H]([C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@@H]1NC(=O)CO3110.7Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #12CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C3144.1Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #13CC(C)(C)[Si](C)(C)O[C@H](CO)[C@@H](O)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3114.1Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #14CC(C)(C)[Si](C)(C)O[C@H]([C@H](O)CO)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO3097.5Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #15CC(C)(C)[Si](C)(C)OC(=O)C1(O)C[C@H](O)[C@@H](NC(=O)CO)[C@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO)O13106.2Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #16CC(C)(C)[Si](C)(C)O[C@H]1CC(O)(C(=O)O)O[C@@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO)[C@@H]1NC(=O)CO3076.9Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #17CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO3117.3Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #18CC(C)(C)[Si](C)(C)O[C@H]([C@H](O)CO)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3106.6Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #19CC(C)(C)[Si](C)(C)OC(=O)C1(O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@@H](NC(=O)CO)[C@H]([C@H](O)[C@H](O)CO)O13106.9Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO3106.5Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #20CC(C)(C)[Si](C)(C)O[C@H]1CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@@H]([C@H](O)[C@H](O)CO)[C@@H]1NC(=O)CO3092.2Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #21CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO3141.1Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #22CC(C)(C)[Si](C)(C)OC1(C(=O)O)C[C@H](O)[C@@H](N(C(=O)CO)[Si](C)(C)C(C)(C)C)[C@H]([C@H](O)[C@H](O)CO)O13110.7Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #23CC(C)(C)[Si](C)(C)OC(=O)C1(O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](NC(=O)CO)[C@H]([C@H](O)[C@H](O)CO)O13086.1Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #24CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO3104.8Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #25CC(C)(C)[Si](C)(C)O[C@H]1CC(O)(C(=O)O)O[C@@H]([C@H](O)[C@H](O)CO)[C@@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3082.6Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #26CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO3145.1Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #27CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO)[Si](C)(C)C(C)(C)C3121.5Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #28CC(C)(C)[Si](C)(C)OC(=O)C1(O)C[C@H](O)[C@@H](N(C(=O)CO)[Si](C)(C)C(C)(C)C)[C@H]([C@H](O)[C@H](O)CO)O13097.9Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO3132.9Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #4CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@H]1NC(=O)CO3111.5Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #5CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O)(C(=O)O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1NC(=O)CO3096.5Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #6CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C3117.8Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #7CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3108.3Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #8CC(C)(C)[Si](C)(C)O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO3110.3Semi standard non polar33892256
NeuNGc,2TBDMS,isomer #9CC(C)(C)[Si](C)(C)O[C@H](CO)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO3139.8Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO3269.3Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #10CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO[Si](C)(C)C(C)(C)C3300.8Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #11CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3299.2Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #12CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@H]1NC(=O)CO3302.4Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #13CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1NC(=O)CO3302.9Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #14CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C3339.7Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #15CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3312.8Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #16CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1NC(=O)CO3279.7Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #17CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C3315.1Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #18CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3299.7Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #19CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C3306.8Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO3307.2Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #20CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O)(C(=O)O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3288.6Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #21CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3307.9Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #22CC(C)(C)[Si](C)(C)O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO3307.3Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #23CC(C)(C)[Si](C)(C)OC(=O)C1(O)C[C@H](O)[C@@H](NC(=O)CO)[C@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C)O13292.2Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #24CC(C)(C)[Si](C)(C)O[C@H]1CC(O)(C(=O)O)O[C@@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@@H]1NC(=O)CO3289.4Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #25CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C3302.8Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #26CC(C)(C)[Si](C)(C)O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3299.5Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #27CC(C)(C)[Si](C)(C)OC(=O)C1(O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@@H](NC(=O)CO)[C@H]([C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C)O13311.7Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #28CC(C)(C)[Si](C)(C)O[C@H]1CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@@H]([C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@@H]1NC(=O)CO3317.8Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #29CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C3357.7Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@H]1NC(=O)CO3274.6Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #30CC(C)(C)[Si](C)(C)O[C@H](CO)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3324.2Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #31CC(C)(C)[Si](C)(C)OC(=O)C1(O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](NC(=O)CO)[C@H]([C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C)O13298.4Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #32CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C3347.7Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #33CC(C)(C)[Si](C)(C)OC(=O)C1(O)C[C@H](O)[C@@H](N(C(=O)CO)[Si](C)(C)C(C)(C)C)[C@H]([C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C)O13311.1Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #34CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C3335.1Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #35CC(C)(C)[Si](C)(C)O[C@H]1CC(O)(C(=O)O)O[C@@H]([C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3301.8Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #36CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3320.2Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #37CC(C)(C)[Si](C)(C)OC(=O)C1(O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@@H](NC(=O)CO)[C@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO)O13279.9Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #38CC(C)(C)[Si](C)(C)O[C@H]1CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO)[C@@H]1NC(=O)CO3284.2Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #39CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO3304.7Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #4CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC(O)(C(=O)O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1NC(=O)CO3271.3Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #40CC(C)(C)[Si](C)(C)O[C@H]([C@H](O)CO)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3303.9Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #41CC(C)(C)[Si](C)(C)OC(=O)C1(O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](NC(=O)CO)[C@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO)O13275.0Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #42CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO3308.5Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #43CC(C)(C)[Si](C)(C)OC(=O)C1(O)C[C@H](O)[C@@H](N(C(=O)CO)[Si](C)(C)C(C)(C)C)[C@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO)O13294.3Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #44CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO3285.9Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #45CC(C)(C)[Si](C)(C)O[C@H]1CC(O)(C(=O)O)O[C@@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO)[C@@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3292.4Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #46CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO)[Si](C)(C)C(C)(C)C3316.0Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #47CC(C)(C)[Si](C)(C)OC(=O)C1(O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](NC(=O)CO)[C@H]([C@H](O)[C@H](O)CO)O13300.1Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #48CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO3329.1Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #49CC(C)(C)[Si](C)(C)OC(=O)C1(O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@@H](N(C(=O)CO)[Si](C)(C)C(C)(C)C)[C@H]([C@H](O)[C@H](O)CO)O13300.7Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #5CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3286.9Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #50CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO3316.0Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #51CC(C)(C)[Si](C)(C)O[C@H]1CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@@H]([C@H](O)[C@H](O)CO)[C@@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3305.6Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #52CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO)[Si](C)(C)C(C)(C)C3341.7Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #53CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO3315.1Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #54CC(C)(C)[Si](C)(C)OC(=O)C1(O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N(C(=O)CO)[Si](C)(C)C(C)(C)C)[C@H]([C@H](O)[C@H](O)CO)O13291.6Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #55CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO)[Si](C)(C)C(C)(C)C3309.9Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #56CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO)[Si](C)(C)C(C)(C)C3323.5Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #6CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3285.0Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #7CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO3303.3Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #8CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@H]1NC(=O)CO3291.0Semi standard non polar33892256
NeuNGc,3TBDMS,isomer #9CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O)(C(=O)O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1NC(=O)CO3283.1Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O)C[C@H](O)[C@H]1NC(=O)CO3498.4Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #10CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1NC(=O)CO3481.7Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #11CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3517.6Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #12CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3488.9Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #13CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3496.2Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #14CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC(O)(C(=O)O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3476.4Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #15CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3500.1Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #16CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@H]1NC(=O)CO3496.6Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #17CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1NC(=O)CO3494.4Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #18CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO[Si](C)(C)C(C)(C)C3529.7Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #19CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3514.6Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@H]1NC(=O)CO3495.2Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #20CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1NC(=O)CO3506.6Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #21CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO[Si](C)(C)C(C)(C)C3539.2Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #22CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3505.4Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #23CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO[Si](C)(C)C(C)(C)C3513.0Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #24CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O)(C(=O)O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3502.7Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #25CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3524.3Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #26CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1NC(=O)CO3481.1Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #27CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C3514.2Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #28CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3495.7Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #29CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C3509.8Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O)(C(=O)O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1NC(=O)CO3474.1Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #30CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3502.4Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #31CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3531.4Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #32CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C3508.9Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #33CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3483.3Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #34CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3510.3Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #35CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3494.8Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #36CC(C)(C)[Si](C)(C)OC(=O)C1(O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@@H](NC(=O)CO)[C@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C)O13493.5Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #37CC(C)(C)[Si](C)(C)O[C@H]1CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@@H]1NC(=O)CO3503.7Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #38CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C3529.9Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #39CC(C)(C)[Si](C)(C)O[C@H]([C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3508.2Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #4CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3506.5Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #40CC(C)(C)[Si](C)(C)OC(=O)C1(O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](NC(=O)CO)[C@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C)O13502.2Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #41CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C3528.5Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #42CC(C)(C)[Si](C)(C)OC(=O)C1(O)C[C@H](O)[C@@H](N(C(=O)CO)[Si](C)(C)C(C)(C)C)[C@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C)O13494.9Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #43CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C3511.5Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #44CC(C)(C)[Si](C)(C)O[C@H]1CC(O)(C(=O)O)O[C@@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3496.5Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #45CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3521.4Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #46CC(C)(C)[Si](C)(C)OC(=O)C1(O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](NC(=O)CO)[C@H]([C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C)O13502.2Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #47CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C3538.9Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #48CC(C)(C)[Si](C)(C)OC(=O)C1(O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@@H](N(C(=O)CO)[Si](C)(C)C(C)(C)C)[C@H]([C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C)O13507.6Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #49CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C3542.8Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #5CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3490.6Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #50CC(C)(C)[Si](C)(C)O[C@H]1CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@@H]([C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3519.3Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #51CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3547.1Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #52CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C3538.6Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #53CC(C)(C)[Si](C)(C)OC(=O)C1(O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N(C(=O)CO)[Si](C)(C)C(C)(C)C)[C@H]([C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C)O13496.6Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #54CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3529.4Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #55CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3520.1Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #56CC(C)(C)[Si](C)(C)OC(=O)C1(O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](NC(=O)CO)[C@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO)O13472.3Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #57CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO3491.3Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #58CC(C)(C)[Si](C)(C)OC(=O)C1(O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@@H](N(C(=O)CO)[Si](C)(C)C(C)(C)C)[C@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO)O13478.8Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #59CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO3501.2Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #6CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@H]1NC(=O)CO3490.3Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #60CC(C)(C)[Si](C)(C)O[C@H]1CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO)[C@@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3499.2Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #61CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO)[Si](C)(C)C(C)(C)C3518.6Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #62CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO3507.8Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #63CC(C)(C)[Si](C)(C)OC(=O)C1(O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N(C(=O)CO)[Si](C)(C)C(C)(C)C)[C@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO)O13488.8Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #64CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO)[Si](C)(C)C(C)(C)C3500.9Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #65CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO)[Si](C)(C)C(C)(C)C3506.3Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #66CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO3501.3Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #67CC(C)(C)[Si](C)(C)OC(=O)C1(O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N(C(=O)CO)[Si](C)(C)C(C)(C)C)[C@H]([C@H](O)[C@H](O)CO)O13502.6Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #68CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO)[Si](C)(C)C(C)(C)C3511.0Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #69CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO)[Si](C)(C)C(C)(C)C3519.6Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #7CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1NC(=O)CO3490.1Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #70CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO)[Si](C)(C)C(C)(C)C3499.1Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #8CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3531.5Semi standard non polar33892256
NeuNGc,4TBDMS,isomer #9CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3501.2Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@H]1NC(=O)CO3673.3Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #10CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3718.1Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #11CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1NC(=O)CO3667.2Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #12CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3710.3Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #13CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3685.5Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #14CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3714.3Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #15CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3699.7Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #16CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3733.9Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #17CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3711.7Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #18CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3670.7Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #19CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3705.0Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1NC(=O)CO3678.6Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #20CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3694.4Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #21CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1NC(=O)CO3673.9Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #22CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO[Si](C)(C)C(C)(C)C3710.8Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #23CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3692.8Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #24CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO[Si](C)(C)C(C)(C)C3714.3Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #25CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3708.8Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #26CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3741.9Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #27CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO[Si](C)(C)C(C)(C)C3723.7Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #28CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3693.6Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #29CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3722.8Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #3CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3723.4Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #30CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3718.9Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #31CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C3685.8Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #32CC(C)(C)[Si](C)(C)OC[C@@H](O)[C@@H](O)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3676.5Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #33CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3698.0Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #34CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3711.8Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #35CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3688.3Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #36CC(C)(C)[Si](C)(C)OC(=O)C1(O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](NC(=O)CO)[C@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C)O13676.1Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #37CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C3708.2Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #38CC(C)(C)[Si](C)(C)OC(=O)C1(O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@@H](N(C(=O)CO)[Si](C)(C)C(C)(C)C)[C@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C)O13686.0Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #39CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C3718.9Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #4CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O[Si](C)(C)C(C)(C)C)(C(=O)O)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3708.7Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #40CC(C)(C)[Si](C)(C)O[C@H]1CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[C@@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3709.7Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #41CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3738.1Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #42CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C3720.1Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #43CC(C)(C)[Si](C)(C)OC(=O)C1(O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N(C(=O)CO)[Si](C)(C)C(C)(C)C)[C@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C)O13685.5Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #44CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3715.0Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #45CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3715.3Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #46CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C3710.6Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #47CC(C)(C)[Si](C)(C)OC(=O)C1(O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N(C(=O)CO)[Si](C)(C)C(C)(C)C)[C@H]([C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C)O13695.1Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #48CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3718.4Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #49CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3744.7Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #5CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1NC(=O)CO3685.7Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #50CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O)[C@@H](CO)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C3709.6Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #51CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO3687.1Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #52CC(C)(C)[Si](C)(C)OC(=O)C1(O[Si](C)(C)C(C)(C)C)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](N(C(=O)CO)[Si](C)(C)C(C)(C)C)[C@H]([C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO)O13679.4Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #53CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO)[Si](C)(C)C(C)(C)C3688.3Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #54CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO)[Si](C)(C)C(C)(C)C3715.7Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #55CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)CO)[Si](C)(C)C(C)(C)C3702.0Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #56CC(C)(C)[Si](C)(C)OCC(=O)N([C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O[Si](C)(C)C(C)(C)C)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O)[C@H](O)CO)[Si](C)(C)C(C)(C)C3686.9Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #6CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O)CC(O)(C(=O)O[Si](C)(C)C(C)(C)C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3714.5Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #7CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O)(C(=O)O[Si](C)(C)C(C)(C)C)C[C@H](O)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3691.8Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #8CC(C)(C)[Si](C)(C)OCC(=O)N[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CC(O)(C(=O)O)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C3701.5Semi standard non polar33892256
NeuNGc,5TBDMS,isomer #9CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(O)(C(=O)O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1N(C(=O)CO)[Si](C)(C)C(C)(C)C3688.6Semi standard non polar33892256
Spectra

GC-MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted GC-MSPredicted GC-MS Spectrum - NeuNGc GC-MS (Non-derivatized) - 70eV, Positivesplash10-06r6-9273000000-5c6d51bda33a259f5d8f2017-09-20Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - NeuNGc GC-MS (5 TMS) - 70eV, Positivesplash10-00di-3312039000-3f2d2ae3b97aea62318d2017-10-06Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - NeuNGc GC-MS (Non-derivatized) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum

MS/MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - NeuNGc 10V, Positive-QTOFsplash10-0a6r-0059000000-377e90bfda4ffa8facb42017-10-06Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - NeuNGc 20V, Positive-QTOFsplash10-03dl-7093000000-15010234d25f713c5b712017-10-06Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - NeuNGc 40V, Positive-QTOFsplash10-114i-9360000000-5a4ced086491066da4192017-10-06Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - NeuNGc 10V, Negative-QTOFsplash10-06xx-4963000000-310a6dbf7e7376a9ec4a2017-10-06Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - NeuNGc 20V, Negative-QTOFsplash10-000i-9210000000-f1b47230cbc1325c439d2017-10-06Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - NeuNGc 40V, Negative-QTOFsplash10-0abi-9300000000-390de2a5f39f68f89b602017-10-06Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - NeuNGc 10V, Negative-QTOFsplash10-00di-0019000000-f054376685deeb8718e92021-09-23Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - NeuNGc 20V, Negative-QTOFsplash10-0pi0-9182000000-2ac0fb29e70889e8c9112021-09-23Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - NeuNGc 40V, Negative-QTOFsplash10-0006-9000000000-4318c8fac7ddac1f7f9f2021-09-23Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - NeuNGc 10V, Positive-QTOFsplash10-004i-0009000000-3ee984b0be99d490e78c2021-09-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - NeuNGc 20V, Positive-QTOFsplash10-0059-1296000000-07dc35c9a1e407f8d5302021-09-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - NeuNGc 40V, Positive-QTOFsplash10-0006-6910000000-dd1ffb002d3101aaae3f2021-09-24Wishart LabView Spectrum

NMR Spectra

Spectrum TypeDescriptionDeposition DateSourceView
Predicted 1D NMR13C NMR Spectrum (1D, 100 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 100 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 1000 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 1000 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 200 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 200 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 300 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 300 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 400 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 400 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 500 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 500 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 600 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 600 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 700 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 700 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 800 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 800 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 900 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 900 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Biological Properties
Cellular LocationsNot Available
Biospecimen LocationsNot Available
Tissue LocationsNot Available
Pathways
Normal Concentrations
Not Available
Abnormal Concentrations
Not Available
Associated Disorders and Diseases
Disease ReferencesNone
Associated OMIM IDsNone
DrugBank IDNot Available
Phenol Explorer Compound IDNot Available
FooDB IDNot Available
KNApSAcK IDNot Available
Chemspider IDNot Available
KEGG Compound IDC03410
BioCyc IDNot Available
BiGG IDNot Available
Wikipedia LinkN-Glycolylneuraminic acid
METLIN IDNot Available
PubChem Compound440001
PDB IDNot Available
ChEBI IDNot Available
Food Biomarker OntologyNot Available
VMH IDNot Available
MarkerDB IDNot Available
Good Scents IDNot Available
References
Synthesis ReferenceNot Available
Material Safety Data Sheet (MSDS)Not Available
General ReferencesNot Available