Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2006-05-22 14:17:41 UTC

Update Date

2022-03-07 02:49:13 UTC

HMDB ID

HMDB0002208

Secondary Accession Numbers

HMDB02208

Metabolite Identification

Common Name

Cholestane-3,7,12,24,25-pentol

Description

Cholestane-3,7,12,24,25-pentol is the major bile alcohol identified in urine from healthy humans, both in children and adults. Bile alcohols have been found to be present as minor components in the bile and urine in healthy subjects. Bile alcohols are end products for cholesterol elimination as well as major biliary constituents; in mammals, cholesterol is metabolized by additional enzymes that ultimately transform it to bile acids. Bile alcohols are preferentially excreted as glucuronides into the urine, which constitute about 10% of total bile acids. The excretion of glucuronidated bile alcohols in urine is suggested to reflect an alternative metabolism of intermediates in the normal biosynthesis of bile acids. Patients with the rare inherited sterol storage disease, cerebrotendinous xanthomatosis, accumulation bile alcohols in bile and feces.(PMID: 6726087 , 6548247 , 11718684 ).

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI

  Mrv0541 02231219252D          

 37 40  0  0  1  0            999 V2000
   19.4240   -8.7807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4240   -9.6057    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   20.1385  -10.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8530   -9.6057    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   20.8530   -8.7807    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   20.1385   -8.3681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5674  -10.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2819   -9.6057    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   22.2819   -8.7807    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   21.5674   -8.3681    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   22.9964   -8.3681    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   22.9964   -7.5431    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   22.2819   -7.1306    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   21.5674   -7.5431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7811   -8.6230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2660   -7.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7811   -7.2882    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   18.7095  -10.0182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.0827   -6.7226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0360   -6.5035    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   21.5674   -9.1932    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   20.8530   -7.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2819   -7.9556    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   23.0827   -9.1886    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   24.8430   -6.3320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0979   -5.5474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9049   -5.3759    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   26.1599   -4.5913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5438   -7.1087    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   23.4840   -5.8904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9963  -10.0182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.8587  -10.5050    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   26.4570   -5.9890    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.2819   -6.3056    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.9669   -4.4198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6079   -3.9782    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.3529   -4.7628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  3  4  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  1  0  0  0  0
  6  1  1  0  0  0  0
  4  7  1  0  0  0  0
  7  8  1  0  0  0  0
  8  9  1  0  0  0  0
  9 10  1  0  0  0  0
 10  5  1  0  0  0  0
  9 11  1  0  0  0  0
 11 12  1  0  0  0  0
 12 13  1  0  0  0  0
 13 14  1  0  0  0  0
 14 10  1  0  0  0  0
 11 15  1  0  0  0  0
 15 16  1  0  0  0  0
 16 17  1  0  0  0  0
 17 12  1  0  0  0  0
  2 18  1  6  0  0  0
 12 19  1  1  0  0  0
 17 20  1  0  0  0  0
 10 21  1  6  0  0  0
  5 22  1  1  0  0  0
  9 23  1  1  0  0  0
 11 24  1  6  0  0  0
 25 20  1  0  0  0  0
 26 25  1  0  0  0  0
 27 26  1  0  0  0  0
 28 27  1  0  0  0  0
 17 29  1  6  0  0  0
 20 30  1  6  0  0  0
  8 31  1  6  0  0  0
  4 32  1  1  0  0  0
 27 33  1  1  0  0  0
 13 34  1  6  0  0  0
 35 28  1  0  0  0  0
 36 28  1  0  0  0  0
 37 28  1  0  0  0  0
M  END

HMDB0002208
     RDKit          3D
Cholestane-3,7,12,24,25-pentol
 80 83  0  0  0  0  0  0  0  0999 V2000
    3.1979   -1.5223    1.3977 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6698   -1.5687    0.0437 C   0  0  2  0  0  0  0  0  0  0  0  0
    3.3450   -0.7091   -0.9572 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7402   -0.8722   -1.3423 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9014   -0.6794   -0.4862 C   0  0  2  0  0  0  0  0  0  0  0  0
    6.0873   -1.4078    0.6389 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2886    0.7726   -0.2513 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8126    0.8048   -0.0304 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6864    1.3713    0.9773 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0898    1.5427   -1.3945 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2072   -1.6040   -0.1620 C   0  0  1  0  0  0  0  0  0  0  0  0
    0.6471   -2.8617    0.5335 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8391   -2.6940    0.5793 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0295   -1.3525   -0.0615 C   0  0  1  0  0  0  0  0  0  0  0  0
   -2.2199   -0.6147    0.4056 C   0  0  1  0  0  0  0  0  0  0  0  0
   -2.3366    0.6820   -0.3474 C   0  0  2  0  0  0  0  0  0  0  0  0
   -1.0725    1.4507   -0.4245 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1365    0.6022   -0.7293 C   0  0  2  0  0  0  0  0  0  0  0  0
   -0.0388    0.0830   -2.0135 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2684   -0.5770    0.2173 C   0  0  2  0  0  0  0  0  0  0  0  0
    0.1776   -0.1800    1.6444 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5165    1.4237    0.2119 C   0  0  1  0  0  0  0  0  0  0  0  0
   -2.9742    2.4982    1.1671 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2389    2.2104   -0.8677 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4752    1.5377   -1.3676 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4804    1.3617   -0.2569 C   0  0  1  0  0  0  0  0  0  0  0  0
   -7.3982    0.3445   -0.5454 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8452    1.2040    1.0864 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4567    0.5786    1.0189 C   0  0  1  0  0  0  0  0  0  0  0  0
   -4.6373   -0.8179    0.5520 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4375   -1.4436   -0.0646 C   0  0  1  0  0  0  0  0  0  0  0  0
   -3.4793   -1.4163   -1.4505 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4001   -1.4938    2.2054 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9111   -2.3499    1.6500 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7430   -0.5864    1.5842 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9802   -2.6462   -0.3100 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1197    0.3936   -0.7093 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7418   -0.7985   -1.9359 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9529   -0.3363   -2.3481 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8251   -1.9693   -1.7256 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7948   -1.0568   -1.1661 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3072   -2.3619    0.5015 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.2092    1.7930   -0.3761 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.2799    0.0234   -0.6345 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9890    0.6385    1.0501 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6328    1.6988    0.8368 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2298    2.2965    1.3094 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7462    0.6925    1.8488 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4234    2.2469   -1.2016 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0404   -1.8339   -1.2607 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8815   -3.7408   -0.0996 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0878   -2.9478    1.5472 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2216   -2.6693    1.6341 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4051   -3.4455    0.0170 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1308   -1.4475   -1.1841 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3729   -0.5131    1.4765 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6383    0.4012   -1.4018 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8191    2.0738    0.4467 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1642    2.1699   -1.2853 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9854    1.2760   -0.7553 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1082    0.8313   -2.6730 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6974    0.5264    1.7522 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0548   -1.0533    2.3100 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0252    0.4105    2.0272 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4260    3.2885    0.6387 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8906    3.0251    1.5753 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4922    2.0621    2.0400 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5166    2.2729   -1.7324 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4798    3.2410   -0.5685 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2690    0.6072   -1.9335 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9183    2.2409   -2.1331 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0899    2.3110   -0.2117 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2221    0.5564   -0.0359 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4578    0.5523    1.7427 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7378    2.1738    1.5883 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1049    0.5461    2.0915 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9094   -1.4468    1.4507 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5011   -0.9624   -0.1399 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2261   -2.4845    0.3091 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5585   -2.3526   -1.8115 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  1  0
  7  8  1  0
  7  9  1  0
  7 10  1  0
  2 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  1  0
 20 21  1  1
 16 22  1  0
 22 23  1  1
 22 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 20 11  1  0
 29 22  1  0
 20 14  1  0
 31 15  1  0
  1 33  1  0
  1 34  1  0
  1 35  1  0
  2 36  1  6
  3 37  1  0
  3 38  1  0
  4 39  1  0
  4 40  1  0
  5 41  1  6
  6 42  1  0
  8 43  1  0
  8 44  1  0
  8 45  1  0
  9 46  1  0
  9 47  1  0
  9 48  1  0
 10 49  1  0
 11 50  1  6
 12 51  1  0
 12 52  1  0
 13 53  1  0
 13 54  1  0
 14 55  1  6
 15 56  1  1
 16 57  1  6
 17 58  1  0
 17 59  1  0
 18 60  1  6
 19 61  1  0
 21 62  1  0
 21 63  1  0
 21 64  1  0
 23 65  1  0
 23 66  1  0
 23 67  1  0
 24 68  1  0
 24 69  1  0
 25 70  1  0
 25 71  1  0
 26 72  1  1
 27 73  1  0
 28 74  1  0
 28 75  1  0
 29 76  1  1
 30 77  1  0
 30 78  1  0
 31 79  1  6
 32 80  1  0
M  END

  Mrv0541 02231219252D          

 37 40  0  0  1  0            999 V2000
   19.4240   -8.7807    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4240   -9.6057    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   20.1385  -10.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.8530   -9.6057    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   20.8530   -8.7807    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   20.1385   -8.3681    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   21.5674  -10.0182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2819   -9.6057    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   22.2819   -8.7807    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   21.5674   -8.3681    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   22.9964   -8.3681    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   22.9964   -7.5431    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   22.2819   -7.1306    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   21.5674   -7.5431    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7811   -8.6230    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.2660   -7.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   23.7811   -7.2882    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   18.7095  -10.0182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.0827   -6.7226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.0360   -6.5035    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   21.5674   -9.1932    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   20.8530   -7.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.2819   -7.9556    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   23.0827   -9.1886    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   24.8430   -6.3320    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.0979   -5.5474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.9049   -5.3759    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   26.1599   -4.5913    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5438   -7.1087    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   23.4840   -5.8904    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.9963  -10.0182    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.8587  -10.5050    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   26.4570   -5.9890    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.2819   -6.3056    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   26.9669   -4.4198    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.6079   -3.9782    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   25.3529   -4.7628    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  3  4  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  1  0  0  0  0
  6  1  1  0  0  0  0
  4  7  1  0  0  0  0
  7  8  1  0  0  0  0
  8  9  1  0  0  0  0
  9 10  1  0  0  0  0
 10  5  1  0  0  0  0
  9 11  1  0  0  0  0
 11 12  1  0  0  0  0
 12 13  1  0  0  0  0
 13 14  1  0  0  0  0
 14 10  1  0  0  0  0
 11 15  1  0  0  0  0
 15 16  1  0  0  0  0
 16 17  1  0  0  0  0
 17 12  1  0  0  0  0
  2 18  1  6  0  0  0
 12 19  1  1  0  0  0
 17 20  1  0  0  0  0
 10 21  1  6  0  0  0
  5 22  1  1  0  0  0
  9 23  1  1  0  0  0
 11 24  1  6  0  0  0
 25 20  1  0  0  0  0
 26 25  1  0  0  0  0
 27 26  1  0  0  0  0
 28 27  1  0  0  0  0
 17 29  1  6  0  0  0
 20 30  1  6  0  0  0
  8 31  1  6  0  0  0
  4 32  1  1  0  0  0
 27 33  1  1  0  0  0
 13 34  1  6  0  0  0
 35 28  1  0  0  0  0
 36 28  1  0  0  0  0
 37 28  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0002208

> <DATABASE_NAME>
hmdb

> <SMILES>
[H][C@@]1(CC[C@@]2([H])[C@]3([H])[C@H](O)C[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])C[C@H](O)[C@]12C)[C@H](C)CC[C@H](O)C(C)(C)O

> <INCHI_IDENTIFIER>
InChI=1S/C27H48O5/c1-15(6-9-22(30)25(2,3)32)18-7-8-19-24-20(14-23(31)27(18,19)5)26(4)11-10-17(28)12-16(26)13-21(24)29/h15-24,28-32H,6-14H2,1-5H3/t15-,16+,17-,18-,19+,20+,21-,22+,23+,24+,26+,27-/m1/s1

> <INCHI_KEY>
NHPWQASMMFUHIZ-YBMOUMCLSA-N

> <FORMULA>
C27H48O5

> <MOLECULAR_WEIGHT>
452.667

> <EXACT_MASS>
452.350174646

> <JCHEM_ACCEPTOR_COUNT>
5

> <JCHEM_AVERAGE_POLARIZABILITY>
53.74782155153972

> <JCHEM_BIOAVAILABILITY>
1

> <JCHEM_DONOR_COUNT>
5

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
(1S,2S,5R,7S,9R,10R,11S,14R,15R,16S)-14-[(2R,5S)-5,6-dihydroxy-6-methylheptan-2-yl]-2,15-dimethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecane-5,9,16-triol

> <ALOGPS_LOGP>
2.54

> <JCHEM_LOGP>
2.4328743559999992

> <ALOGPS_LOGS>
-4.02

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
4

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
15.325111730088558

> <JCHEM_PKA_STRONGEST_ACIDIC>
13.849642772256644

> <JCHEM_PKA_STRONGEST_BASIC>
-0.15943471521408192

> <JCHEM_POLAR_SURFACE_AREA>
101.15

> <JCHEM_REFRACTIVITY>
126.07209999999998

> <JCHEM_ROTATABLE_BOND_COUNT>
5

> <JCHEM_RULE_OF_FIVE>
1

> <ALOGPS_SOLUBILITY>
4.37e-02 g/l

> <JCHEM_TRADITIONAL_IUPAC>
(1S,2S,5R,7S,9R,10R,11S,14R,15R,16S)-14-[(2R,5S)-5,6-dihydroxy-6-methylheptan-2-yl]-2,15-dimethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecane-5,9,16-triol

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0002208
     RDKit          3D
Cholestane-3,7,12,24,25-pentol
 80 83  0  0  0  0  0  0  0  0999 V2000
    3.1979   -1.5223    1.3977 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6698   -1.5687    0.0437 C   0  0  2  0  0  0  0  0  0  0  0  0
    3.3450   -0.7091   -0.9572 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7402   -0.8722   -1.3423 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9014   -0.6794   -0.4862 C   0  0  2  0  0  0  0  0  0  0  0  0
    6.0873   -1.4078    0.6389 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2886    0.7726   -0.2513 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8126    0.8048   -0.0304 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6864    1.3713    0.9773 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0898    1.5427   -1.3945 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2072   -1.6040   -0.1620 C   0  0  1  0  0  0  0  0  0  0  0  0
    0.6471   -2.8617    0.5335 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8391   -2.6940    0.5793 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0295   -1.3525   -0.0615 C   0  0  1  0  0  0  0  0  0  0  0  0
   -2.2199   -0.6147    0.4056 C   0  0  1  0  0  0  0  0  0  0  0  0
   -2.3366    0.6820   -0.3474 C   0  0  2  0  0  0  0  0  0  0  0  0
   -1.0725    1.4507   -0.4245 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1365    0.6022   -0.7293 C   0  0  2  0  0  0  0  0  0  0  0  0
   -0.0388    0.0830   -2.0135 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2684   -0.5770    0.2173 C   0  0  2  0  0  0  0  0  0  0  0  0
    0.1776   -0.1800    1.6444 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5165    1.4237    0.2119 C   0  0  1  0  0  0  0  0  0  0  0  0
   -2.9742    2.4982    1.1671 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2389    2.2104   -0.8677 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4752    1.5377   -1.3676 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4804    1.3617   -0.2569 C   0  0  1  0  0  0  0  0  0  0  0  0
   -7.3982    0.3445   -0.5454 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8452    1.2040    1.0864 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4567    0.5786    1.0189 C   0  0  1  0  0  0  0  0  0  0  0  0
   -4.6373   -0.8179    0.5520 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4375   -1.4436   -0.0646 C   0  0  1  0  0  0  0  0  0  0  0  0
   -3.4793   -1.4163   -1.4505 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4001   -1.4938    2.2054 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9111   -2.3499    1.6500 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7430   -0.5864    1.5842 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9802   -2.6462   -0.3100 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1197    0.3936   -0.7093 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7418   -0.7985   -1.9359 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9529   -0.3363   -2.3481 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8251   -1.9693   -1.7256 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7948   -1.0568   -1.1661 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3072   -2.3619    0.5015 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.2092    1.7930   -0.3761 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.2799    0.0234   -0.6345 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9890    0.6385    1.0501 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6328    1.6988    0.8368 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2298    2.2965    1.3094 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7462    0.6925    1.8488 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4234    2.2469   -1.2016 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0404   -1.8339   -1.2607 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8815   -3.7408   -0.0996 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0878   -2.9478    1.5472 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2216   -2.6693    1.6341 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4051   -3.4455    0.0170 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1308   -1.4475   -1.1841 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3729   -0.5131    1.4765 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6383    0.4012   -1.4018 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8191    2.0738    0.4467 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1642    2.1699   -1.2853 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9854    1.2760   -0.7553 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1082    0.8313   -2.6730 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6974    0.5264    1.7522 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0548   -1.0533    2.3100 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0252    0.4105    2.0272 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4260    3.2885    0.6387 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8906    3.0251    1.5753 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4922    2.0621    2.0400 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5166    2.2729   -1.7324 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4798    3.2410   -0.5685 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2690    0.6072   -1.9335 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9183    2.2409   -2.1331 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0899    2.3110   -0.2117 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2221    0.5564   -0.0359 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4578    0.5523    1.7427 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7378    2.1738    1.5883 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1049    0.5461    2.0915 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9094   -1.4468    1.4507 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5011   -0.9624   -0.1399 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2261   -2.4845    0.3091 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5585   -2.3526   -1.8115 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  1  0
  7  8  1  0
  7  9  1  0
  7 10  1  0
  2 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  1  0
 20 21  1  1
 16 22  1  0
 22 23  1  1
 22 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 20 11  1  0
 29 22  1  0
 20 14  1  0
 31 15  1  0
  1 33  1  0
  1 34  1  0
  1 35  1  0
  2 36  1  6
  3 37  1  0
  3 38  1  0
  4 39  1  0
  4 40  1  0
  5 41  1  6
  6 42  1  0
  8 43  1  0
  8 44  1  0
  8 45  1  0
  9 46  1  0
  9 47  1  0
  9 48  1  0
 10 49  1  0
 11 50  1  6
 12 51  1  0
 12 52  1  0
 13 53  1  0
 13 54  1  0
 14 55  1  6
 15 56  1  1
 16 57  1  6
 17 58  1  0
 17 59  1  0
 18 60  1  6
 19 61  1  0
 21 62  1  0
 21 63  1  0
 21 64  1  0
 23 65  1  0
 23 66  1  0
 23 67  1  0
 24 68  1  0
 24 69  1  0
 25 70  1  0
 25 71  1  0
 26 72  1  1
 27 73  1  0
 28 74  1  0
 28 75  1  0
 29 76  1  1
 30 77  1  0
 30 78  1  0
 31 79  1  6
 32 80  1  0
M  END

HEADER    PROTEIN                                 23-FEB-12   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   23-FEB-12         0                                  
HETATM    1  C   UNK     0      36.258 -16.391   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      36.258 -17.931   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0      37.592 -18.701   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0      38.926 -17.931   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0      38.926 -16.391   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0      37.592 -15.620   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0      40.259 -18.701   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      41.593 -17.931   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0      41.593 -16.391   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0      40.259 -15.620   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0      42.927 -15.620   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0      42.927 -14.080   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0      41.593 -13.310   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0      40.259 -14.080   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0      44.391 -16.096   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0      45.297 -14.850   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0      44.391 -13.605   0.000  0.00  0.00           C+0
HETATM   18  O   UNK     0      34.924 -18.701   0.000  0.00  0.00           O+0
HETATM   19  C   UNK     0      43.088 -12.549   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0      44.867 -12.140   0.000  0.00  0.00           C+0
HETATM   21  H   UNK     0      40.259 -17.161   0.000  0.00  0.00           H+0
HETATM   22  C   UNK     0      38.926 -14.850   0.000  0.00  0.00           C+0
HETATM   23  H   UNK     0      41.593 -14.850   0.000  0.00  0.00           H+0
HETATM   24  H   UNK     0      43.088 -17.152   0.000  0.00  0.00           H+0
HETATM   25  C   UNK     0      46.374 -11.820   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0      46.849 -10.355   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0      48.356 -10.035   0.000  0.00  0.00           C+0
HETATM   28  C   UNK     0      48.832  -8.570   0.000  0.00  0.00           C+0
HETATM   29  H   UNK     0      45.815 -13.270   0.000  0.00  0.00           H+0
HETATM   30  C   UNK     0      43.837 -10.995   0.000  0.00  0.00           C+0
HETATM   31  O   UNK     0      42.926 -18.701   0.000  0.00  0.00           O+0
HETATM   32  H   UNK     0      38.936 -19.609   0.000  0.00  0.00           H+0
HETATM   33  O   UNK     0      49.386 -11.179   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0      41.593 -11.770   0.000  0.00  0.00           O+0
HETATM   35  C   UNK     0      50.338  -8.250   0.000  0.00  0.00           C+0
HETATM   36  O   UNK     0      47.801  -7.426   0.000  0.00  0.00           O+0
HETATM   37  C   UNK     0      47.325  -8.891   0.000  0.00  0.00           C+0
CONECT    1    2    6                                                       
CONECT    2    1    3   18                                                  
CONECT    3    2    4                                                       
CONECT    4    3    5    7   32                                             
CONECT    5    4    6   10   22                                             
CONECT    6    5    1                                                       
CONECT    7    4    8                                                       
CONECT    8    7    9   31                                                  
CONECT    9    8   10   11   23                                             
CONECT   10    9    5   14   21                                             
CONECT   11    9   12   15   24                                             
CONECT   12   11   13   17   19                                             
CONECT   13   12   14   34                                                  
CONECT   14   13   10                                                       
CONECT   15   11   16                                                       
CONECT   16   15   17                                                       
CONECT   17   16   12   20   29                                             
CONECT   18    2                                                            
CONECT   19   12                                                            
CONECT   20   17   25   30                                                  
CONECT   21   10                                                            
CONECT   22    5                                                            
CONECT   23    9                                                            
CONECT   24   11                                                            
CONECT   25   20   26                                                       
CONECT   26   25   27                                                       
CONECT   27   26   28   33                                                  
CONECT   28   27   35   36   37                                             
CONECT   29   17                                                            
CONECT   30   20                                                            
CONECT   31    8                                                            
CONECT   32    4                                                            
CONECT   33   27                                                            
CONECT   34   13                                                            
CONECT   35   28                                                            
CONECT   36   28                                                            
CONECT   37   28                                                            
MASTER        0    0    0    0    0    0    0    0   37    0   80    0
END

COMPND    HMDB0002208
HETATM    1  C1  UNL     1       3.198  -1.522   1.398  1.00  0.00           C  
HETATM    2  C2  UNL     1       2.670  -1.569   0.044  1.00  0.00           C  
HETATM    3  C3  UNL     1       3.345  -0.709  -0.957  1.00  0.00           C  
HETATM    4  C4  UNL     1       4.740  -0.872  -1.342  1.00  0.00           C  
HETATM    5  C5  UNL     1       5.901  -0.679  -0.486  1.00  0.00           C  
HETATM    6  O1  UNL     1       6.087  -1.408   0.639  1.00  0.00           O  
HETATM    7  C6  UNL     1       6.289   0.773  -0.251  1.00  0.00           C  
HETATM    8  C7  UNL     1       7.813   0.805  -0.030  1.00  0.00           C  
HETATM    9  C8  UNL     1       5.686   1.371   0.977  1.00  0.00           C  
HETATM   10  O2  UNL     1       6.090   1.543  -1.395  1.00  0.00           O  
HETATM   11  C9  UNL     1       1.207  -1.604  -0.162  1.00  0.00           C  
HETATM   12  C10 UNL     1       0.647  -2.862   0.533  1.00  0.00           C  
HETATM   13  C11 UNL     1      -0.839  -2.694   0.579  1.00  0.00           C  
HETATM   14  C12 UNL     1      -1.029  -1.352  -0.061  1.00  0.00           C  
HETATM   15  C13 UNL     1      -2.220  -0.615   0.406  1.00  0.00           C  
HETATM   16  C14 UNL     1      -2.337   0.682  -0.347  1.00  0.00           C  
HETATM   17  C15 UNL     1      -1.072   1.451  -0.425  1.00  0.00           C  
HETATM   18  C16 UNL     1       0.136   0.602  -0.729  1.00  0.00           C  
HETATM   19  O3  UNL     1      -0.039   0.083  -2.014  1.00  0.00           O  
HETATM   20  C17 UNL     1       0.268  -0.577   0.217  1.00  0.00           C  
HETATM   21  C18 UNL     1       0.178  -0.180   1.644  1.00  0.00           C  
HETATM   22  C19 UNL     1      -3.517   1.424   0.212  1.00  0.00           C  
HETATM   23  C20 UNL     1      -2.974   2.498   1.167  1.00  0.00           C  
HETATM   24  C21 UNL     1      -4.239   2.210  -0.868  1.00  0.00           C  
HETATM   25  C22 UNL     1      -5.475   1.538  -1.368  1.00  0.00           C  
HETATM   26  C23 UNL     1      -6.480   1.362  -0.257  1.00  0.00           C  
HETATM   27  O4  UNL     1      -7.398   0.344  -0.545  1.00  0.00           O  
HETATM   28  C24 UNL     1      -5.845   1.204   1.086  1.00  0.00           C  
HETATM   29  C25 UNL     1      -4.457   0.579   1.019  1.00  0.00           C  
HETATM   30  C26 UNL     1      -4.637  -0.818   0.552  1.00  0.00           C  
HETATM   31  C27 UNL     1      -3.437  -1.444  -0.065  1.00  0.00           C  
HETATM   32  O5  UNL     1      -3.479  -1.416  -1.450  1.00  0.00           O  
HETATM   33  H1  UNL     1       2.400  -1.494   2.205  1.00  0.00           H  
HETATM   34  H2  UNL     1       3.911  -2.350   1.650  1.00  0.00           H  
HETATM   35  H3  UNL     1       3.743  -0.586   1.584  1.00  0.00           H  
HETATM   36  H4  UNL     1       2.980  -2.646  -0.310  1.00  0.00           H  
HETATM   37  H5  UNL     1       3.120   0.394  -0.709  1.00  0.00           H  
HETATM   38  H6  UNL     1       2.742  -0.799  -1.936  1.00  0.00           H  
HETATM   39  H7  UNL     1       4.953  -0.336  -2.348  1.00  0.00           H  
HETATM   40  H8  UNL     1       4.825  -1.969  -1.726  1.00  0.00           H  
HETATM   41  H9  UNL     1       6.795  -1.057  -1.166  1.00  0.00           H  
HETATM   42  H10 UNL     1       6.307  -2.362   0.501  1.00  0.00           H  
HETATM   43  H11 UNL     1       8.209   1.793  -0.376  1.00  0.00           H  
HETATM   44  H12 UNL     1       8.280   0.023  -0.634  1.00  0.00           H  
HETATM   45  H13 UNL     1       7.989   0.638   1.050  1.00  0.00           H  
HETATM   46  H14 UNL     1       4.633   1.699   0.837  1.00  0.00           H  
HETATM   47  H15 UNL     1       6.230   2.296   1.309  1.00  0.00           H  
HETATM   48  H16 UNL     1       5.746   0.693   1.849  1.00  0.00           H  
HETATM   49  H17 UNL     1       5.423   2.247  -1.202  1.00  0.00           H  
HETATM   50  H18 UNL     1       1.040  -1.834  -1.261  1.00  0.00           H  
HETATM   51  H19 UNL     1       0.882  -3.741  -0.100  1.00  0.00           H  
HETATM   52  H20 UNL     1       1.088  -2.948   1.547  1.00  0.00           H  
HETATM   53  H21 UNL     1      -1.222  -2.669   1.634  1.00  0.00           H  
HETATM   54  H22 UNL     1      -1.405  -3.446   0.017  1.00  0.00           H  
HETATM   55  H23 UNL     1      -1.131  -1.447  -1.184  1.00  0.00           H  
HETATM   56  H24 UNL     1      -2.373  -0.513   1.477  1.00  0.00           H  
HETATM   57  H25 UNL     1      -2.638   0.401  -1.402  1.00  0.00           H  
HETATM   58  H26 UNL     1      -0.819   2.074   0.447  1.00  0.00           H  
HETATM   59  H27 UNL     1      -1.164   2.170  -1.285  1.00  0.00           H  
HETATM   60  H28 UNL     1       0.985   1.276  -0.755  1.00  0.00           H  
HETATM   61  H29 UNL     1       0.108   0.831  -2.673  1.00  0.00           H  
HETATM   62  H30 UNL     1      -0.697   0.526   1.752  1.00  0.00           H  
HETATM   63  H31 UNL     1       0.055  -1.053   2.310  1.00  0.00           H  
HETATM   64  H32 UNL     1       1.025   0.410   2.027  1.00  0.00           H  
HETATM   65  H33 UNL     1      -2.426   3.288   0.639  1.00  0.00           H  
HETATM   66  H34 UNL     1      -3.891   3.025   1.575  1.00  0.00           H  
HETATM   67  H35 UNL     1      -2.492   2.062   2.040  1.00  0.00           H  
HETATM   68  H36 UNL     1      -3.517   2.273  -1.732  1.00  0.00           H  
HETATM   69  H37 UNL     1      -4.480   3.241  -0.569  1.00  0.00           H  
HETATM   70  H38 UNL     1      -5.269   0.607  -1.934  1.00  0.00           H  
HETATM   71  H39 UNL     1      -5.918   2.241  -2.133  1.00  0.00           H  
HETATM   72  H40 UNL     1      -7.090   2.311  -0.212  1.00  0.00           H  
HETATM   73  H41 UNL     1      -8.222   0.556  -0.036  1.00  0.00           H  
HETATM   74  H42 UNL     1      -6.458   0.552   1.743  1.00  0.00           H  
HETATM   75  H43 UNL     1      -5.738   2.174   1.588  1.00  0.00           H  
HETATM   76  H44 UNL     1      -4.105   0.546   2.091  1.00  0.00           H  
HETATM   77  H45 UNL     1      -4.909  -1.447   1.451  1.00  0.00           H  
HETATM   78  H46 UNL     1      -5.501  -0.962  -0.140  1.00  0.00           H  
HETATM   79  H47 UNL     1      -3.226  -2.484   0.309  1.00  0.00           H  
HETATM   80  H48 UNL     1      -3.559  -2.353  -1.812  1.00  0.00           H  
CONECT    1    2   33   34   35
CONECT    2    3   11   36
CONECT    3    4   37   38
CONECT    4    5   39   40
CONECT    5    6    7   41
CONECT    6   42
CONECT    7    8    9   10
CONECT    8   43   44   45
CONECT    9   46   47   48
CONECT   10   49
CONECT   11   12   20   50
CONECT   12   13   51   52
CONECT   13   14   53   54
CONECT   14   15   20   55
CONECT   15   16   31   56
CONECT   16   17   22   57
CONECT   17   18   58   59
CONECT   18   19   20   60
CONECT   19   61
CONECT   20   21
CONECT   21   62   63   64
CONECT   22   23   24   29
CONECT   23   65   66   67
CONECT   24   25   68   69
CONECT   25   26   70   71
CONECT   26   27   28   72
CONECT   27   73
CONECT   28   29   74   75
CONECT   29   30   76
CONECT   30   31   77   78
CONECT   31   32   79
CONECT   32   80
END

HMDB0002208
     RDKit          3D
Cholestane-3,7,12,24,25-pentol
 80 83  0  0  0  0  0  0  0  0999 V2000
    3.1979   -1.5223    1.3977 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6698   -1.5687    0.0437 C   0  0  2  0  0  0  0  0  0  0  0  0
    3.3450   -0.7091   -0.9572 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7402   -0.8722   -1.3423 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9014   -0.6794   -0.4862 C   0  0  2  0  0  0  0  0  0  0  0  0
    6.0873   -1.4078    0.6389 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2886    0.7726   -0.2513 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8126    0.8048   -0.0304 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6864    1.3713    0.9773 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0898    1.5427   -1.3945 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2072   -1.6040   -0.1620 C   0  0  1  0  0  0  0  0  0  0  0  0
    0.6471   -2.8617    0.5335 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8391   -2.6940    0.5793 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0295   -1.3525   -0.0615 C   0  0  1  0  0  0  0  0  0  0  0  0
   -2.2199   -0.6147    0.4056 C   0  0  1  0  0  0  0  0  0  0  0  0
   -2.3366    0.6820   -0.3474 C   0  0  2  0  0  0  0  0  0  0  0  0
   -1.0725    1.4507   -0.4245 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1365    0.6022   -0.7293 C   0  0  2  0  0  0  0  0  0  0  0  0
   -0.0388    0.0830   -2.0135 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2684   -0.5770    0.2173 C   0  0  2  0  0  0  0  0  0  0  0  0
    0.1776   -0.1800    1.6444 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5165    1.4237    0.2119 C   0  0  1  0  0  0  0  0  0  0  0  0
   -2.9742    2.4982    1.1671 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2389    2.2104   -0.8677 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4752    1.5377   -1.3676 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4804    1.3617   -0.2569 C   0  0  1  0  0  0  0  0  0  0  0  0
   -7.3982    0.3445   -0.5454 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8452    1.2040    1.0864 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4567    0.5786    1.0189 C   0  0  1  0  0  0  0  0  0  0  0  0
   -4.6373   -0.8179    0.5520 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4375   -1.4436   -0.0646 C   0  0  1  0  0  0  0  0  0  0  0  0
   -3.4793   -1.4163   -1.4505 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4001   -1.4938    2.2054 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9111   -2.3499    1.6500 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7430   -0.5864    1.5842 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9802   -2.6462   -0.3100 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1197    0.3936   -0.7093 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7418   -0.7985   -1.9359 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9529   -0.3363   -2.3481 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8251   -1.9693   -1.7256 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7948   -1.0568   -1.1661 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3072   -2.3619    0.5015 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.2092    1.7930   -0.3761 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.2799    0.0234   -0.6345 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9890    0.6385    1.0501 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6328    1.6988    0.8368 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2298    2.2965    1.3094 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7462    0.6925    1.8488 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4234    2.2469   -1.2016 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0404   -1.8339   -1.2607 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8815   -3.7408   -0.0996 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0878   -2.9478    1.5472 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2216   -2.6693    1.6341 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4051   -3.4455    0.0170 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1308   -1.4475   -1.1841 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3729   -0.5131    1.4765 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6383    0.4012   -1.4018 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8191    2.0738    0.4467 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1642    2.1699   -1.2853 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9854    1.2760   -0.7553 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1082    0.8313   -2.6730 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6974    0.5264    1.7522 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0548   -1.0533    2.3100 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0252    0.4105    2.0272 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4260    3.2885    0.6387 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8906    3.0251    1.5753 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4922    2.0621    2.0400 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5166    2.2729   -1.7324 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4798    3.2410   -0.5685 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2690    0.6072   -1.9335 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9183    2.2409   -2.1331 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0899    2.3110   -0.2117 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2221    0.5564   -0.0359 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.4578    0.5523    1.7427 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7378    2.1738    1.5883 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1049    0.5461    2.0915 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9094   -1.4468    1.4507 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5011   -0.9624   -0.1399 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2261   -2.4845    0.3091 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5585   -2.3526   -1.8115 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  5  7  1  0
  7  8  1  0
  7  9  1  0
  7 10  1  0
  2 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 18 20  1  0
 20 21  1  1
 16 22  1  0
 22 23  1  1
 22 24  1  0
 24 25  1  0
 25 26  1  0
 26 27  1  0
 26 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 20 11  1  0
 29 22  1  0
 20 14  1  0
 31 15  1  0
  1 33  1  0
  1 34  1  0
  1 35  1  0
  2 36  1  6
  3 37  1  0
  3 38  1  0
  4 39  1  0
  4 40  1  0
  5 41  1  6
  6 42  1  0
  8 43  1  0
  8 44  1  0
  8 45  1  0
  9 46  1  0
  9 47  1  0
  9 48  1  0
 10 49  1  0
 11 50  1  6
 12 51  1  0
 12 52  1  0
 13 53  1  0
 13 54  1  0
 14 55  1  6
 15 56  1  1
 16 57  1  6
 17 58  1  0
 17 59  1  0
 18 60  1  6
 19 61  1  0
 21 62  1  0
 21 63  1  0
 21 64  1  0
 23 65  1  0
 23 66  1  0
 23 67  1  0
 24 68  1  0
 24 69  1  0
 25 70  1  0
 25 71  1  0
 26 72  1  1
 27 73  1  0
 28 74  1  0
 28 75  1  0
 29 76  1  1
 30 77  1  0
 30 78  1  0
 31 79  1  6
 32 80  1  0
M  END

View in JSmol View Stereo Labels

Synonyms

Value	Source
5-beta-Cholestane-3 alpha,7 alpha,12 alpha,24 beta,25-pentol	MeSH
3alpha,7alpha,12alpha,24S,25-Pentahydroxy-5beta-cholestane	HMDB
5-beta-Cholestane-3alpha,7alpha,12alpha,24beta,25-pentol	HMDB
5beta-Cholestane-3alpha,7alpha,12alpha,24S,25-pentol	HMDB
Cholestane-3,7,12,24,25-pentol	MeSH

Chemical Formula

C₂₇H₄₈O₅

Average Molecular Weight

452.667

Monoisotopic Molecular Weight

452.350174646

IUPAC Name

(1S,2S,5R,7S,9R,10R,11S,14R,15R,16S)-14-[(2R,5S)-5,6-dihydroxy-6-methylheptan-2-yl]-2,15-dimethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecane-5,9,16-triol

Traditional Name

(1S,2S,5R,7S,9R,10R,11S,14R,15R,16S)-14-[(2R,5S)-5,6-dihydroxy-6-methylheptan-2-yl]-2,15-dimethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadecane-5,9,16-triol

CAS Registry Number

58580-61-3

SMILES

[H][C@@]1(CC[C@@]2([H])[C@]3([H])[C@H](O)C[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])C[C@H](O)[C@]12C)[C@H](C)CC[C@H](O)C(C)(C)O

InChI Identifier

InChI=1S/C27H48O5/c1-15(6-9-22(30)25(2,3)32)18-7-8-19-24-20(14-23(31)27(18,19)5)26(4)11-10-17(28)12-16(26)13-21(24)29/h15-24,28-32H,6-14H2,1-5H3/t15-,16+,17-,18-,19+,20+,21-,22+,23+,24+,26+,27-/m1/s1

InChI Key

NHPWQASMMFUHIZ-YBMOUMCLSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as pentahydroxy bile acids, alcohols and derivatives. These are bile acids, alcohols or derivatives bearing five hydroxyl groups.

Kingdom

Organic compounds

Super Class

Lipids and lipid-like molecules

Class

Steroids and steroid derivatives

Sub Class

Bile acids, alcohols and derivatives

Direct Parent

Pentahydroxy bile acids, alcohols and derivatives

Alternative Parents

Substituents

Pentahydroxy bile acid, alcohol, or derivatives
25-hydroxysteroid
24-hydroxysteroid
3-hydroxysteroid
12-hydroxysteroid
7-hydroxysteroid
3-alpha-hydroxysteroid
Hydroxysteroid
Cyclic alcohol
Tertiary alcohol
Secondary alcohol
Polyol
Alcohol
Hydrocarbon derivative
Organic oxygen compound
Organooxygen compound
Aliphatic homopolycyclic compound

Molecular Framework

Aliphatic homopolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Excreta

Biofluid or Excreta

Urine (HMDB: HMDB0002208)

Tissue

Nervous tissue

Hepatic tissue (HMDB: HMDB0002208)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0002208)

Source

Endogenous

Endogenous (HMDB: HMDB0002208)

Animal

Animal (HMDB: HMDB0002208)

Exogenous

Food

Food (HMDB: HMDB0002208)

Animal origin

Poultry

Pheasant (FooDB: FOOD00430)
Squab (FooDB: FOOD00481)
Turkey (FooDB: FOOD00494)
Quail (FooDB: FOOD00541)
Anatidae (FooDB: FOOD00576)
Rock ptarmigan (FooDB: FOOD00597)
Columbidae (Dove, Pigeon) (FooDB: FOOD00610)
Chicken (FooDB: FOOD00329)
Mallard duck (FooDB: FOOD00353)
Emu (FooDB: FOOD00360)
Greylag goose (FooDB: FOOD00368)
Guinea hen (FooDB: FOOD00373)
Ostrich (FooDB: FOOD00422)
Velvet duck (FooDB: FOOD00427)

Lagomorph

Ovis

Sheep (Mutton, Lamb) (FooDB: FOOD00473)

Bovine

Venison

Deer (FooDB: FOOD00524)
Mule deer (FooDB: FOOD00348)
Elk (FooDB: FOOD00359)

Caprae

Domestic goat (FooDB: FOOD00529)

Swine

Domestic pig (FooDB: FOOD00536)
Wild boar (FooDB: FOOD00307)

Equine

Horse (FooDB: FOOD00378)

Exogenous (HMDB: HMDB0002208)

Process

Naturally occurring process

Biological process

Chemical reaction

Lipid Peroxidation (HMDB: HMDB0002208)

Biochemical pathway

Metabolic pathway

Fatty Acid Metabolism (HMDB: HMDB0002208)

Lipid metabolism pathway (HMDB: HMDB0002208)

Cellular process

Cell signaling (HMDB: HMDB0002208)

Biochemical process

Lipid transport (HMDB: HMDB0002208)

Role

Biological role

Membrane stabilizer (HMDB: HMDB0002208)

Molecular messenger

Hormone (HMDB: HMDB0002208)

Industrial application

Manufacturing industry

Material processing agent

Fluid processing agent

Surfactant

Surfactant (HMDB: HMDB0002208)

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	0.044 g/L	ALOGPS
logP	2.54	ALOGPS
logP	2.43	ChemAxon
logS	-4	ALOGPS
pKa (Strongest Acidic)	13.85	ChemAxon
pKa (Strongest Basic)	-0.16	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	5	ChemAxon
Hydrogen Donor Count	5	ChemAxon
Polar Surface Area	101.15 Å²	ChemAxon
Rotatable Bond Count	5	ChemAxon
Refractivity	126.07 m³·mol⁻¹	ChemAxon
Polarizability	53.75 Å³	ChemAxon
Number of Rings	4	ChemAxon
Bioavailability	Yes	ChemAxon
Rule of Five	Yes	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M-2H]-	242.176	30932474
DeepCCS	[M+Na]+	216.343	30932474
AllCCS	[M+H]+	213.5	32859911
AllCCS	[M+H-H2O]+	211.8	32859911
AllCCS	[M+NH4]+	215.0	32859911
AllCCS	[M+Na]+	215.5	32859911
AllCCS	[M-H]-	209.4	32859911
AllCCS	[M+Na-2H]-	211.8	32859911
AllCCS	[M+HCOO]-	214.5	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Cholestane-3,7,12,24,25-pentol	[H][C@@]1(CC[C@@]2([H])[C@]3([H])[C@H](O)C[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])C[C@H](O)[C@]12C)[C@H](C)CC[C@H](O)C(C)(C)O	3211.7	Standard polar	33892256
Cholestane-3,7,12,24,25-pentol	[H][C@@]1(CC[C@@]2([H])[C@]3([H])[C@H](O)C[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])C[C@H](O)[C@]12C)[C@H](C)CC[C@H](O)C(C)(C)O	3622.3	Standard non polar	33892256
Cholestane-3,7,12,24,25-pentol	[H][C@@]1(CC[C@@]2([H])[C@]3([H])[C@H](O)C[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])C[C@H](O)[C@]12C)[C@H](C)CC[C@H](O)C(C)(C)O	3882.2	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Cholestane-3,7,12,24,25-pentol,1TMS,isomer #1	C[C@H](CC[C@H](O)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O[Si](C)(C)C	3546.0	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,1TMS,isomer #2	C[C@H](CC[C@H](O)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C)C[C@H]1C[C@H]3O	3669.6	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,1TMS,isomer #3	C[C@H](CC[C@H](O)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O	3618.4	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,1TMS,isomer #4	C[C@H](CC[C@H](O[Si](C)(C)C)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O	3663.1	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,1TMS,isomer #5	C[C@H](CC[C@H](O)C(C)(C)O[Si](C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O	3723.2	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,2TMS,isomer #1	C[C@H](CC[C@H](O[Si](C)(C)C)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O[Si](C)(C)C	3531.3	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,2TMS,isomer #10	C[C@H](CC[C@H](O[Si](C)(C)C)C(C)(C)O[Si](C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O	3724.0	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,2TMS,isomer #2	C[C@H](CC[C@H](O)C(C)(C)O[Si](C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O[Si](C)(C)C	3610.9	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,2TMS,isomer #3	C[C@H](CC[C@H](O)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O[Si](C)(C)C	3485.9	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,2TMS,isomer #4	C[C@H](CC[C@H](O)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C)C[C@H]1C[C@H]3O[Si](C)(C)C	3497.7	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,2TMS,isomer #5	C[C@H](CC[C@H](O[Si](C)(C)C)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C)C[C@H]1C[C@H]3O	3632.5	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,2TMS,isomer #6	C[C@H](CC[C@H](O)C(C)(C)O[Si](C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C)C[C@H]1C[C@H]3O	3707.6	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,2TMS,isomer #7	C[C@H](CC[C@H](O)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C)C[C@H]1C[C@H]3O	3530.5	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,2TMS,isomer #8	C[C@H](CC[C@H](O[Si](C)(C)C)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O	3607.5	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,2TMS,isomer #9	C[C@H](CC[C@H](O)C(C)(C)O[Si](C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O	3682.4	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,3TMS,isomer #1	C[C@H](CC[C@H](O[Si](C)(C)C)C(C)(C)O[Si](C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O[Si](C)(C)C	3607.6	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,3TMS,isomer #10	C[C@H](CC[C@H](O[Si](C)(C)C)C(C)(C)O[Si](C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O	3685.3	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,3TMS,isomer #2	C[C@H](CC[C@H](O[Si](C)(C)C)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O[Si](C)(C)C	3518.9	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,3TMS,isomer #3	C[C@H](CC[C@H](O[Si](C)(C)C)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C)C[C@H]1C[C@H]3O[Si](C)(C)C	3506.2	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,3TMS,isomer #4	C[C@H](CC[C@H](O)C(C)(C)O[Si](C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O[Si](C)(C)C	3596.2	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,3TMS,isomer #5	C[C@H](CC[C@H](O)C(C)(C)O[Si](C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C)C[C@H]1C[C@H]3O[Si](C)(C)C	3584.6	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,3TMS,isomer #6	C[C@H](CC[C@H](O)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C)C[C@H]1C[C@H]3O[Si](C)(C)C	3457.6	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,3TMS,isomer #7	C[C@H](CC[C@H](O[Si](C)(C)C)C(C)(C)O[Si](C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C)C[C@H]1C[C@H]3O	3688.0	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,3TMS,isomer #8	C[C@H](CC[C@H](O[Si](C)(C)C)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C)C[C@H]1C[C@H]3O	3536.6	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,3TMS,isomer #9	C[C@H](CC[C@H](O)C(C)(C)O[Si](C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C)C[C@H]1C[C@H]3O	3625.4	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,4TMS,isomer #1	C[C@H](CC[C@H](O[Si](C)(C)C)C(C)(C)O[Si](C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O[Si](C)(C)C	3618.0	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,4TMS,isomer #2	C[C@H](CC[C@H](O[Si](C)(C)C)C(C)(C)O[Si](C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C)C[C@H]1C[C@H]3O[Si](C)(C)C	3598.5	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,4TMS,isomer #3	C[C@H](CC[C@H](O[Si](C)(C)C)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C)C[C@H]1C[C@H]3O[Si](C)(C)C	3506.8	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,4TMS,isomer #4	C[C@H](CC[C@H](O)C(C)(C)O[Si](C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C)C[C@H]1C[C@H]3O[Si](C)(C)C	3590.2	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,4TMS,isomer #5	C[C@H](CC[C@H](O[Si](C)(C)C)C(C)(C)O[Si](C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C)C[C@H]1C[C@H]3O	3633.9	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,5TMS,isomer #1	C[C@H](CC[C@H](O[Si](C)(C)C)C(C)(C)O[Si](C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C)C[C@H]1C[C@H]3O[Si](C)(C)C	3607.8	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,1TBDMS,isomer #1	C[C@H](CC[C@H](O)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O[Si](C)(C)C(C)(C)C	3756.1	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,1TBDMS,isomer #2	C[C@H](CC[C@H](O)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C[C@H]3O	3876.3	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,1TBDMS,isomer #3	C[C@H](CC[C@H](O)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O	3831.7	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,1TBDMS,isomer #4	C[C@H](CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O	3897.6	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,1TBDMS,isomer #5	C[C@H](CC[C@H](O)C(C)(C)O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O	3951.2	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,2TBDMS,isomer #1	C[C@H](CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O[Si](C)(C)C(C)(C)C	3981.3	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,2TBDMS,isomer #10	C[C@H](CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O	4188.1	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,2TBDMS,isomer #2	C[C@H](CC[C@H](O)C(C)(C)O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O[Si](C)(C)C(C)(C)C	4045.0	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,2TBDMS,isomer #3	C[C@H](CC[C@H](O)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O[Si](C)(C)C(C)(C)C	3915.0	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,2TBDMS,isomer #4	C[C@H](CC[C@H](O)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C[C@H]3O[Si](C)(C)C(C)(C)C	3919.2	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,2TBDMS,isomer #5	C[C@H](CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C[C@H]3O	4093.8	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,2TBDMS,isomer #6	C[C@H](CC[C@H](O)C(C)(C)O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C[C@H]3O	4159.4	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,2TBDMS,isomer #7	C[C@H](CC[C@H](O)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C[C@H]3O	3960.8	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,2TBDMS,isomer #8	C[C@H](CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O	4069.3	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,2TBDMS,isomer #9	C[C@H](CC[C@H](O)C(C)(C)O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O	4130.7	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,3TBDMS,isomer #1	C[C@H](CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O[Si](C)(C)C(C)(C)C	4248.8	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,3TBDMS,isomer #10	C[C@H](CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O	4344.7	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,3TBDMS,isomer #2	C[C@H](CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O[Si](C)(C)C(C)(C)C	4166.1	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,3TBDMS,isomer #3	C[C@H](CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C[C@H]3O[Si](C)(C)C(C)(C)C	4150.5	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,3TBDMS,isomer #4	C[C@H](CC[C@H](O)C(C)(C)O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O)C[C@H]1C[C@H]3O[Si](C)(C)C(C)(C)C	4222.5	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,3TBDMS,isomer #5	C[C@H](CC[C@H](O)C(C)(C)O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C[C@H]3O[Si](C)(C)C(C)(C)C	4215.2	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,3TBDMS,isomer #6	C[C@H](CC[C@H](O)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C[C@H]3O[Si](C)(C)C(C)(C)C	4093.1	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,3TBDMS,isomer #7	C[C@H](CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C[C@H]3O	4350.2	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,3TBDMS,isomer #8	C[C@H](CC[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)O)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C[C@H]3O	4213.3	Semi standard non polar	33892256
Cholestane-3,7,12,24,25-pentol,3TBDMS,isomer #9	C[C@H](CC[C@H](O)C(C)(C)O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@H]3[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@@]21C)[C@@]1(C)CC[C@@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C[C@H]3O	4279.0	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Cholestane-3,7,12,24,25-pentol GC-MS (Non-derivatized) - 70eV, Positive	splash10-0a4i-5225900000-7bfe77e73e7fc24ad195	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Cholestane-3,7,12,24,25-pentol GC-MS (3 TMS) - 70eV, Positive	splash10-0ue9-1322129000-1ee58111be3f38bfe31a	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Cholestane-3,7,12,24,25-pentol GC-MS (Non-derivatized) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Cholestane-3,7,12,24,25-pentol 10V, Positive-QTOF	splash10-014r-0001900000-cdb2ed65e69d8df890ff	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Cholestane-3,7,12,24,25-pentol 20V, Positive-QTOF	splash10-014i-1004900000-4f5b915308d8cc197d26	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Cholestane-3,7,12,24,25-pentol 40V, Positive-QTOF	splash10-05mk-3109700000-c919e36c46d0c17d51ee	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Cholestane-3,7,12,24,25-pentol 10V, Negative-QTOF	splash10-0ue9-0000900000-32cdd9e3f773b9c66cdf	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Cholestane-3,7,12,24,25-pentol 20V, Negative-QTOF	splash10-0f89-0004900000-8e0b2f488aa99497b265	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Cholestane-3,7,12,24,25-pentol 40V, Negative-QTOF	splash10-00ri-9002500000-971f342cc22704f557d9	2017-09-01	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Cholestane-3,7,12,24,25-pentol 10V, Positive-QTOF	splash10-0gb9-0001900000-824b9d3ad57ad4f16486	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Cholestane-3,7,12,24,25-pentol 20V, Positive-QTOF	splash10-0ftv-4477900000-e8837317e3485190852f	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Cholestane-3,7,12,24,25-pentol 40V, Positive-QTOF	splash10-004m-6951000000-00ad768b7d9da74502f8	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Cholestane-3,7,12,24,25-pentol 10V, Negative-QTOF	splash10-0udi-0000900000-6df22a99e7d0a9fae0b1	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Cholestane-3,7,12,24,25-pentol 20V, Negative-QTOF	splash10-0udl-0006900000-63a49e7ab4159da2ebfc	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Cholestane-3,7,12,24,25-pentol 40V, Negative-QTOF	splash10-0002-0003900000-ee43a4f1e19159b4dd91	2021-09-24	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB022908

KNApSAcK ID

Not Available

Chemspider ID

4956022

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

6453659

PDB ID

Not Available

ChEBI ID

172123

Food Biomarker Ontology

Not Available

VMH ID

CE1273

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

Nakagawa M, Une M, Takenaka S, Tazawa Y, Nozaki S, Imanaka T, Kuramoto T: Urinary bile alcohol profiles in healthy and cholestatic children. Clin Chim Acta. 2001 Dec;314(1-2):101-6. [PubMed:11718684 ]
Karlaganis G, Karlaganis V, Sjovall J: Identification of 27-nor-5 beta-cholestane-3 alpha,7 alpha,12 alpha,24 xi, 25 xi,26-hexol and partial characterization of the bile alcohol profile in urine. J Lipid Res. 1984 Jul;25(7):693-702. [PubMed:6548247 ]
Kuwabara M, Ushiroguchi T, Kihira K, Kuramoto T, Hoshita T: Identification of bile alcohols in urine from healthy humans. J Lipid Res. 1984 Apr;25(4):361-8. [PubMed:6726087 ]

Showing metabocard for Cholestane-3,7,12,24,25-pentol (HMDB0002208)

MOL for HMDB0002208 (Cholestane-3,7,12,24,25-pentol)

3D MOL for HMDB0002208 (Cholestane-3,7,12,24,25-pentol)

3D SDF for HMDB0002208 (Cholestane-3,7,12,24,25-pentol)

3D-SDF for HMDB0002208 (Cholestane-3,7,12,24,25-pentol)

PDB for HMDB0002208 (Cholestane-3,7,12,24,25-pentol)

3D PDB for HMDB0002208 (Cholestane-3,7,12,24,25-pentol)

SMILES for HMDB0002208 (Cholestane-3,7,12,24,25-pentol)

INCHI for HMDB0002208 (Cholestane-3,7,12,24,25-pentol)

Structure for HMDB0002208 (Cholestane-3,7,12,24,25-pentol)

3D Structure for HMDB0002208 (Cholestane-3,7,12,24,25-pentol)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra