Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2019-10-08 19:50:27 UTC

Update Date

2022-03-07 03:18:18 UTC

HMDB ID

HMDB0240511

Secondary Accession Numbers

None

Metabolite Identification

Common Name

Epicatechin 5-O-glucuronide

Description

Epicatechin 5-O-glucuronide, also known as E5G, belongs to the class of organic compounds known as flavonoid o-glucuronides. These are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to glucuronic acid. Based on a literature review very few articles have been published on Epicatechin 5-O-glucuronide.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv1652311131923082D          

 33 36  0  0  0  0            999 V2000
   -1.7857   -1.2272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4993   -0.8149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4993    0.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7857    0.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0708    0.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0708   -0.8149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3573   -1.2272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3574   -0.8149    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    1.0723   -1.2272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3573    0.4224    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3574    0.0100    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    1.0723    0.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7861    0.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5011    0.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5011    1.2474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2146    1.6597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0723    1.2474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7861    1.6597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7861    2.4847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7857   -2.0523    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2146   -2.0523    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9291   -2.4649    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   -3.9291   -3.2899    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   -3.2146   -3.7023    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   -2.5002   -3.2899    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   -2.5002   -2.4649    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   -1.7857   -3.7023    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2146   -4.5273    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6436   -3.7023    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6436   -2.0523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3579   -2.4649    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6436   -1.2273    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2143    0.4224    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0  0  0  0
  1  6  1  0  0  0  0
  2  3  1  0  0  0  0
  3  4  2  0  0  0  0
  4  5  1  0  0  0  0
  5  6  2  0  0  0  0
  5 10  1  0  0  0  0
  6  7  1  0  0  0  0
  7  8  1  0  0  0  0
  8  9  1  6  0  0  0
  8 11  1  0  0  0  0
 10 11  1  0  0  0  0
 11 12  1  6  0  0  0
 12 13  2  0  0  0  0
 12 17  1  0  0  0  0
 13 14  1  0  0  0  0
 14 15  2  0  0  0  0
 15 16  1  0  0  0  0
 15 18  1  0  0  0  0
 17 18  2  0  0  0  0
 18 19  1  0  0  0  0
 26 20  1  1  0  0  0
 21 22  1  0  0  0  0
 22 23  1  0  0  0  0
 23 24  1  0  0  0  0
 24 25  1  0  0  0  0
 25 26  1  0  0  0  0
 21 26  1  0  0  0  0
 25 27  1  6  0  0  0
 24 28  1  1  0  0  0
 23 29  1  6  0  0  0
 22 30  1  1  0  0  0
 30 31  1  0  0  0  0
 30 32  2  0  0  0  0
  3 33  1  0  0  0  0
 20  1  1  0  0  0  0
M  END

HMDB0240511
     RDKit          3D
Epicatechin 5-O-glucuronide
 55 58  0  0  0  0  0  0  0  0999 V2000
   -5.1750   -2.0970    3.0810 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2158   -2.0010    2.2730 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2872   -3.0212    2.2362 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1629   -0.7919    1.4226 C   0  0  1  0  0  0  0  0  0  0  0  0
   -3.0663   -0.7967    0.5757 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7513    0.4980    0.1282 C   0  0  1  0  0  0  0  0  0  0  0  0
   -2.1431    0.4005   -1.0527 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9934    0.3771   -1.7135 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0109    0.3444   -3.1307 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1298    0.3215   -3.8589 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0709    0.2892   -5.2600 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3786    0.3290   -3.2664 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4376    0.3597   -1.8924 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2801    0.3815   -1.1408 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3935    0.3636    0.3479 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7652   -0.0015    0.8254 C   0  0  1  0  0  0  0  0  0  0  0  0
    1.9010   -1.3859    0.7035 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8036    0.7420    0.0583 C   0  0  1  0  0  0  0  0  0  0  0  0
    4.1774    0.4704    0.4998 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8837    1.3830    1.2580 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1892    1.1107    1.6704 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7912   -0.0766    1.3244 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1047   -0.3492    1.7400 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1154   -0.9933    0.5769 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7205   -2.1869    0.2290 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8244   -0.7033    0.1796 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7220    0.3695   -1.3225 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9839    1.3617    0.0002 C   0  0  2  0  0  0  0  0  0  0  0  0
   -4.0173    2.2206    1.0942 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2793    0.6751   -0.1252 C   0  0  1  0  0  0  0  0  0  0  0  0
   -5.6824    0.5967   -1.4813 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3725   -0.6897    0.5139 C   0  0  2  0  0  0  0  0  0  0  0  0
   -6.5566   -0.8506    1.2072 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9422   -3.4491    3.0980 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0817    0.1085    2.0657 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1001    0.9020    0.9308 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9883    0.3385   -3.6048 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7892    0.2817   -5.7688 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2877    0.3118   -3.8358 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3434   -0.4330    0.6786 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1638    1.3649    0.7303 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8402    0.2910    1.8928 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1129   -1.8180    1.1157 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5795    1.8206    0.1204 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3908    2.3055    1.5163 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7025    1.8633    2.2666 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.5992    0.3424    2.2975 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.6472   -2.3901    0.5167 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3128   -1.4468   -0.4113 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8607    2.0351   -0.8996 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2068    2.7852    1.1616 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1032    1.2911    0.3471 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0179    0.0247   -1.9780 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2666   -1.4344   -0.3174 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9279   -1.7442    0.9877 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 10 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 24 26  2  0
 18 27  1  0
  6 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
 30 32  1  0
 32 33  1  0
 32  4  1  0
 14  8  1  0
 26 19  1  0
 27 13  1  0
  3 34  1  0
  4 35  1  1
  6 36  1  1
  9 37  1  0
 11 38  1  0
 12 39  1  0
 15 40  1  0
 15 41  1  0
 16 42  1  1
 17 43  1  0
 18 44  1  6
 20 45  1  0
 21 46  1  0
 23 47  1  0
 25 48  1  0
 26 49  1  0
 28 50  1  6
 29 51  1  0
 30 52  1  1
 31 53  1  0
 32 54  1  6
 33 55  1  0
M  END


  Mrv1652311131923082D          

 33 36  0  0  0  0            999 V2000
   -1.7857   -1.2272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4993   -0.8149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4993    0.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7857    0.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0708    0.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0708   -0.8149    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3573   -1.2272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3574   -0.8149    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    1.0723   -1.2272    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3573    0.4224    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3574    0.0100    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    1.0723    0.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7861    0.0100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5011    0.4224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5011    1.2474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2146    1.6597    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0723    1.2474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7861    1.6597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7861    2.4847    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7857   -2.0523    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2146   -2.0523    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9291   -2.4649    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   -3.9291   -3.2899    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   -3.2146   -3.7023    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   -2.5002   -3.2899    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   -2.5002   -2.4649    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   -1.7857   -3.7023    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2146   -4.5273    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6436   -3.7023    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6436   -2.0523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3579   -2.4649    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6436   -1.2273    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2143    0.4224    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0  0  0  0
  1  6  1  0  0  0  0
  2  3  1  0  0  0  0
  3  4  2  0  0  0  0
  4  5  1  0  0  0  0
  5  6  2  0  0  0  0
  5 10  1  0  0  0  0
  6  7  1  0  0  0  0
  7  8  1  0  0  0  0
  8  9  1  6  0  0  0
  8 11  1  0  0  0  0
 10 11  1  0  0  0  0
 11 12  1  6  0  0  0
 12 13  2  0  0  0  0
 12 17  1  0  0  0  0
 13 14  1  0  0  0  0
 14 15  2  0  0  0  0
 15 16  1  0  0  0  0
 15 18  1  0  0  0  0
 17 18  2  0  0  0  0
 18 19  1  0  0  0  0
 26 20  1  1  0  0  0
 21 22  1  0  0  0  0
 22 23  1  0  0  0  0
 23 24  1  0  0  0  0
 24 25  1  0  0  0  0
 25 26  1  0  0  0  0
 21 26  1  0  0  0  0
 25 27  1  6  0  0  0
 24 28  1  1  0  0  0
 23 29  1  6  0  0  0
 22 30  1  1  0  0  0
 30 31  1  0  0  0  0
 30 32  2  0  0  0  0
  3 33  1  0  0  0  0
 20  1  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0240511

> <DATABASE_NAME>
hmdb

> <SMILES>
O[C@@H]1CC2=C(O[C@@H]1C1=CC=C(O)C(O)=C1)C=C(O)C=C2O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)C(O)=O

> <INCHI_IDENTIFIER>
InChI=1S/C21H22O12/c22-8-4-13-9(6-12(25)18(31-13)7-1-2-10(23)11(24)3-7)14(5-8)32-21-17(28)15(26)16(27)19(33-21)20(29)30/h1-5,12,15-19,21-28H,6H2,(H,29,30)/t12-,15+,16+,17-,18-,19+,21-/m1/s1

> <INCHI_KEY>
KGLMKAPOVXBIJB-CVPXIJHMSA-N

> <FORMULA>
C21H22O12

> <MOLECULAR_WEIGHT>
466.395

> <EXACT_MASS>
466.111126148

> <JCHEM_ACCEPTOR_COUNT>
12

> <JCHEM_ATOM_COUNT>
55

> <JCHEM_AVERAGE_POLARIZABILITY>
43.62479333882312

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
8

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
1

> <JCHEM_IUPAC>
(2S,3S,4S,5R,6S)-6-{[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-3,4-dihydro-2H-1-benzopyran-5-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid

> <ALOGPS_LOGP>
0.01

> <JCHEM_LOGP>
-0.15268653999999993

> <ALOGPS_LOGS>
-2.20

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
4

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-1

> <JCHEM_PKA>
9.084807873427858

> <JCHEM_PKA_STRONGEST_ACIDIC>
2.9302345525762297

> <JCHEM_PKA_STRONGEST_BASIC>
-3.686826905653203

> <JCHEM_POLAR_SURFACE_AREA>
206.59999999999997

> <JCHEM_REFRACTIVITY>
106.01149999999996

> <JCHEM_ROTATABLE_BOND_COUNT>
4

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
2.92e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
(2S,3S,4S,5R,6S)-6-{[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-3,4-dihydro-2H-1-benzopyran-5-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0240511
     RDKit          3D
Epicatechin 5-O-glucuronide
 55 58  0  0  0  0  0  0  0  0999 V2000
   -5.1750   -2.0970    3.0810 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2158   -2.0010    2.2730 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2872   -3.0212    2.2362 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1629   -0.7919    1.4226 C   0  0  1  0  0  0  0  0  0  0  0  0
   -3.0663   -0.7967    0.5757 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7513    0.4980    0.1282 C   0  0  1  0  0  0  0  0  0  0  0  0
   -2.1431    0.4005   -1.0527 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9934    0.3771   -1.7135 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0109    0.3444   -3.1307 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1298    0.3215   -3.8589 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0709    0.2892   -5.2600 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3786    0.3290   -3.2664 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4376    0.3597   -1.8924 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2801    0.3815   -1.1408 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3935    0.3636    0.3479 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7652   -0.0015    0.8254 C   0  0  1  0  0  0  0  0  0  0  0  0
    1.9010   -1.3859    0.7035 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8036    0.7420    0.0583 C   0  0  1  0  0  0  0  0  0  0  0  0
    4.1774    0.4704    0.4998 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8837    1.3830    1.2580 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1892    1.1107    1.6704 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7912   -0.0766    1.3244 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1047   -0.3492    1.7400 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1154   -0.9933    0.5769 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7205   -2.1869    0.2290 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8244   -0.7033    0.1796 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7220    0.3695   -1.3225 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9839    1.3617    0.0002 C   0  0  2  0  0  0  0  0  0  0  0  0
   -4.0173    2.2206    1.0942 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2793    0.6751   -0.1252 C   0  0  1  0  0  0  0  0  0  0  0  0
   -5.6824    0.5967   -1.4813 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3725   -0.6897    0.5139 C   0  0  2  0  0  0  0  0  0  0  0  0
   -6.5566   -0.8506    1.2072 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9422   -3.4491    3.0980 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0817    0.1085    2.0657 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1001    0.9020    0.9308 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9883    0.3385   -3.6048 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7892    0.2817   -5.7688 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2877    0.3118   -3.8358 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3434   -0.4330    0.6786 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1638    1.3649    0.7303 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8402    0.2910    1.8928 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1129   -1.8180    1.1157 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5795    1.8206    0.1204 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3908    2.3055    1.5163 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7025    1.8633    2.2666 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.5992    0.3424    2.2975 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.6472   -2.3901    0.5167 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3128   -1.4468   -0.4113 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8607    2.0351   -0.8996 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2068    2.7852    1.1616 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1032    1.2911    0.3471 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0179    0.0247   -1.9780 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2666   -1.4344   -0.3174 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9279   -1.7442    0.9877 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 10 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 24 26  2  0
 18 27  1  0
  6 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
 30 32  1  0
 32 33  1  0
 32  4  1  0
 14  8  1  0
 26 19  1  0
 27 13  1  0
  3 34  1  0
  4 35  1  1
  6 36  1  1
  9 37  1  0
 11 38  1  0
 12 39  1  0
 15 40  1  0
 15 41  1  0
 16 42  1  1
 17 43  1  0
 18 44  1  6
 20 45  1  0
 21 46  1  0
 23 47  1  0
 25 48  1  0
 26 49  1  0
 28 50  1  6
 29 51  1  0
 30 52  1  1
 31 53  1  0
 32 54  1  6
 33 55  1  0
M  END

HEADER    PROTEIN                                 13-NOV-19   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   13-NOV-19         0                                  
HETATM    1  C   UNK     0      -3.333  -2.291   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      -4.665  -1.521   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0      -4.665   0.019   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0      -3.333   0.788   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0      -1.999   0.019   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0      -1.999  -1.521   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0      -0.667  -2.291   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0       0.667  -1.521   0.000  0.00  0.00           C+0
HETATM    9  O   UNK     0       2.002  -2.291   0.000  0.00  0.00           O+0
HETATM   10  O   UNK     0      -0.667   0.788   0.000  0.00  0.00           O+0
HETATM   11  C   UNK     0       0.667   0.019   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       2.002   0.788   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       3.334   0.019   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0       4.669   0.788   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       4.669   2.328   0.000  0.00  0.00           C+0
HETATM   16  O   UNK     0       6.001   3.098   0.000  0.00  0.00           O+0
HETATM   17  C   UNK     0       2.002   2.328   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0       3.334   3.098   0.000  0.00  0.00           C+0
HETATM   19  O   UNK     0       3.334   4.638   0.000  0.00  0.00           O+0
HETATM   20  O   UNK     0      -3.333  -3.831   0.000  0.00  0.00           O+0
HETATM   21  O   UNK     0      -6.001  -3.831   0.000  0.00  0.00           O+0
HETATM   22  C   UNK     0      -7.334  -4.601   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0      -7.334  -6.141   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0      -6.001  -6.911   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0      -4.667  -6.141   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0      -4.667  -4.601   0.000  0.00  0.00           C+0
HETATM   27  O   UNK     0      -3.333  -6.911   0.000  0.00  0.00           O+0
HETATM   28  O   UNK     0      -6.001  -8.451   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0      -8.668  -6.911   0.000  0.00  0.00           O+0
HETATM   30  C   UNK     0      -8.668  -3.831   0.000  0.00  0.00           C+0
HETATM   31  O   UNK     0     -10.002  -4.601   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0      -8.668  -2.291   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0      -6.000   0.788   0.000  0.00  0.00           O+0
CONECT    1    2    6   20                                                  
CONECT    2    1    3                                                       
CONECT    3    2    4   33                                                  
CONECT    4    3    5                                                       
CONECT    5    4    6   10                                                  
CONECT    6    1    5    7                                                  
CONECT    7    6    8                                                       
CONECT    8    7    9   11                                                  
CONECT    9    8                                                            
CONECT   10    5   11                                                       
CONECT   11    8   10   12                                                  
CONECT   12   11   13   17                                                  
CONECT   13   12   14                                                       
CONECT   14   13   15                                                       
CONECT   15   14   16   18                                                  
CONECT   16   15                                                            
CONECT   17   12   18                                                       
CONECT   18   15   17   19                                                  
CONECT   19   18                                                            
CONECT   20   26    1                                                       
CONECT   21   22   26                                                       
CONECT   22   21   23   30                                                  
CONECT   23   22   24   29                                                  
CONECT   24   23   25   28                                                  
CONECT   25   24   26   27                                                  
CONECT   26   20   25   21                                                  
CONECT   27   25                                                            
CONECT   28   24                                                            
CONECT   29   23                                                            
CONECT   30   22   31   32                                                  
CONECT   31   30                                                            
CONECT   32   30                                                            
CONECT   33    3                                                            
MASTER        0    0    0    0    0    0    0    0   33    0   72    0
END

COMPND    HMDB0240511
HETATM    1  O1  UNL     1      -5.175  -2.097   3.081  1.00  0.00           O  
HETATM    2  C1  UNL     1      -4.216  -2.001   2.273  1.00  0.00           C  
HETATM    3  O2  UNL     1      -3.287  -3.021   2.236  1.00  0.00           O  
HETATM    4  C2  UNL     1      -4.163  -0.792   1.423  1.00  0.00           C  
HETATM    5  O3  UNL     1      -3.066  -0.797   0.576  1.00  0.00           O  
HETATM    6  C3  UNL     1      -2.751   0.498   0.128  1.00  0.00           C  
HETATM    7  O4  UNL     1      -2.143   0.401  -1.053  1.00  0.00           O  
HETATM    8  C4  UNL     1      -0.993   0.377  -1.713  1.00  0.00           C  
HETATM    9  C5  UNL     1      -1.011   0.344  -3.131  1.00  0.00           C  
HETATM   10  C6  UNL     1       0.130   0.322  -3.859  1.00  0.00           C  
HETATM   11  O5  UNL     1       0.071   0.289  -5.260  1.00  0.00           O  
HETATM   12  C7  UNL     1       1.379   0.329  -3.266  1.00  0.00           C  
HETATM   13  C8  UNL     1       1.438   0.360  -1.892  1.00  0.00           C  
HETATM   14  C9  UNL     1       0.280   0.381  -1.141  1.00  0.00           C  
HETATM   15  C10 UNL     1       0.393   0.364   0.348  1.00  0.00           C  
HETATM   16  C11 UNL     1       1.765  -0.001   0.825  1.00  0.00           C  
HETATM   17  O6  UNL     1       1.901  -1.386   0.704  1.00  0.00           O  
HETATM   18  C12 UNL     1       2.804   0.742   0.058  1.00  0.00           C  
HETATM   19  C13 UNL     1       4.177   0.470   0.500  1.00  0.00           C  
HETATM   20  C14 UNL     1       4.884   1.383   1.258  1.00  0.00           C  
HETATM   21  C15 UNL     1       6.189   1.111   1.670  1.00  0.00           C  
HETATM   22  C16 UNL     1       6.791  -0.077   1.324  1.00  0.00           C  
HETATM   23  O7  UNL     1       8.105  -0.349   1.740  1.00  0.00           O  
HETATM   24  C17 UNL     1       6.115  -0.993   0.577  1.00  0.00           C  
HETATM   25  O8  UNL     1       6.720  -2.187   0.229  1.00  0.00           O  
HETATM   26  C18 UNL     1       4.824  -0.703   0.180  1.00  0.00           C  
HETATM   27  O9  UNL     1       2.722   0.369  -1.323  1.00  0.00           O  
HETATM   28  C19 UNL     1      -3.984   1.362   0.000  1.00  0.00           C  
HETATM   29  O10 UNL     1      -4.017   2.221   1.094  1.00  0.00           O  
HETATM   30  C20 UNL     1      -5.279   0.675  -0.125  1.00  0.00           C  
HETATM   31  O11 UNL     1      -5.682   0.597  -1.481  1.00  0.00           O  
HETATM   32  C21 UNL     1      -5.372  -0.690   0.514  1.00  0.00           C  
HETATM   33  O12 UNL     1      -6.557  -0.851   1.207  1.00  0.00           O  
HETATM   34  H1  UNL     1      -2.942  -3.449   3.098  1.00  0.00           H  
HETATM   35  H2  UNL     1      -4.082   0.108   2.066  1.00  0.00           H  
HETATM   36  H3  UNL     1      -2.100   0.902   0.931  1.00  0.00           H  
HETATM   37  H4  UNL     1      -1.988   0.339  -3.605  1.00  0.00           H  
HETATM   38  H5  UNL     1      -0.789   0.282  -5.769  1.00  0.00           H  
HETATM   39  H6  UNL     1       2.288   0.312  -3.836  1.00  0.00           H  
HETATM   40  H7  UNL     1      -0.343  -0.433   0.679  1.00  0.00           H  
HETATM   41  H8  UNL     1       0.164   1.365   0.730  1.00  0.00           H  
HETATM   42  H9  UNL     1       1.840   0.291   1.893  1.00  0.00           H  
HETATM   43  H10 UNL     1       1.113  -1.818   1.116  1.00  0.00           H  
HETATM   44  H11 UNL     1       2.580   1.821   0.120  1.00  0.00           H  
HETATM   45  H12 UNL     1       4.391   2.305   1.516  1.00  0.00           H  
HETATM   46  H13 UNL     1       6.702   1.863   2.267  1.00  0.00           H  
HETATM   47  H14 UNL     1       8.599   0.342   2.297  1.00  0.00           H  
HETATM   48  H15 UNL     1       7.647  -2.390   0.517  1.00  0.00           H  
HETATM   49  H16 UNL     1       4.313  -1.447  -0.411  1.00  0.00           H  
HETATM   50  H17 UNL     1      -3.861   2.035  -0.900  1.00  0.00           H  
HETATM   51  H18 UNL     1      -3.207   2.785   1.162  1.00  0.00           H  
HETATM   52  H19 UNL     1      -6.103   1.291   0.347  1.00  0.00           H  
HETATM   53  H20 UNL     1      -5.018   0.025  -1.978  1.00  0.00           H  
HETATM   54  H21 UNL     1      -5.267  -1.434  -0.317  1.00  0.00           H  
HETATM   55  H22 UNL     1      -6.928  -1.744   0.988  1.00  0.00           H  
CONECT    1    2    2
CONECT    2    3    4
CONECT    3   34
CONECT    4    5   32   35
CONECT    5    6
CONECT    6    7   28   36
CONECT    7    8
CONECT    8    9    9   14
CONECT    9   10   37
CONECT   10   11   12   12
CONECT   11   38
CONECT   12   13   39
CONECT   13   14   14   27
CONECT   14   15
CONECT   15   16   40   41
CONECT   16   17   18   42
CONECT   17   43
CONECT   18   19   27   44
CONECT   19   20   20   26
CONECT   20   21   45
CONECT   21   22   22   46
CONECT   22   23   24
CONECT   23   47
CONECT   24   25   26   26
CONECT   25   48
CONECT   26   49
CONECT   28   29   30   50
CONECT   29   51
CONECT   30   31   32   52
CONECT   31   53
CONECT   32   33   54
CONECT   33   55
END

HMDB0240511
     RDKit          3D
Epicatechin 5-O-glucuronide
 55 58  0  0  0  0  0  0  0  0999 V2000
   -5.1750   -2.0970    3.0810 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2158   -2.0010    2.2730 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2872   -3.0212    2.2362 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1629   -0.7919    1.4226 C   0  0  1  0  0  0  0  0  0  0  0  0
   -3.0663   -0.7967    0.5757 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7513    0.4980    0.1282 C   0  0  1  0  0  0  0  0  0  0  0  0
   -2.1431    0.4005   -1.0527 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9934    0.3771   -1.7135 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0109    0.3444   -3.1307 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1298    0.3215   -3.8589 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0709    0.2892   -5.2600 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3786    0.3290   -3.2664 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4376    0.3597   -1.8924 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2801    0.3815   -1.1408 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3935    0.3636    0.3479 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7652   -0.0015    0.8254 C   0  0  1  0  0  0  0  0  0  0  0  0
    1.9010   -1.3859    0.7035 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8036    0.7420    0.0583 C   0  0  1  0  0  0  0  0  0  0  0  0
    4.1774    0.4704    0.4998 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8837    1.3830    1.2580 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1892    1.1107    1.6704 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7912   -0.0766    1.3244 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1047   -0.3492    1.7400 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1154   -0.9933    0.5769 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7205   -2.1869    0.2290 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8244   -0.7033    0.1796 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7220    0.3695   -1.3225 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9839    1.3617    0.0002 C   0  0  2  0  0  0  0  0  0  0  0  0
   -4.0173    2.2206    1.0942 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2793    0.6751   -0.1252 C   0  0  1  0  0  0  0  0  0  0  0  0
   -5.6824    0.5967   -1.4813 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3725   -0.6897    0.5139 C   0  0  2  0  0  0  0  0  0  0  0  0
   -6.5566   -0.8506    1.2072 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9422   -3.4491    3.0980 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0817    0.1085    2.0657 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1001    0.9020    0.9308 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9883    0.3385   -3.6048 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7892    0.2817   -5.7688 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2877    0.3118   -3.8358 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3434   -0.4330    0.6786 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1638    1.3649    0.7303 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8402    0.2910    1.8928 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1129   -1.8180    1.1157 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5795    1.8206    0.1204 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3908    2.3055    1.5163 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7025    1.8633    2.2666 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.5992    0.3424    2.2975 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.6472   -2.3901    0.5167 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3128   -1.4468   -0.4113 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8607    2.0351   -0.8996 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2068    2.7852    1.1616 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.1032    1.2911    0.3471 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0179    0.0247   -1.9780 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.2666   -1.4344   -0.3174 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.9279   -1.7442    0.9877 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  2  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  2  0
  9 10  1  0
 10 11  1  0
 10 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 16 18  1  0
 18 19  1  0
 19 20  2  0
 20 21  1  0
 21 22  2  0
 22 23  1  0
 22 24  1  0
 24 25  1  0
 24 26  2  0
 18 27  1  0
  6 28  1  0
 28 29  1  0
 28 30  1  0
 30 31  1  0
 30 32  1  0
 32 33  1  0
 32  4  1  0
 14  8  1  0
 26 19  1  0
 27 13  1  0
  3 34  1  0
  4 35  1  1
  6 36  1  1
  9 37  1  0
 11 38  1  0
 12 39  1  0
 15 40  1  0
 15 41  1  0
 16 42  1  1
 17 43  1  0
 18 44  1  6
 20 45  1  0
 21 46  1  0
 23 47  1  0
 25 48  1  0
 26 49  1  0
 28 50  1  6
 29 51  1  0
 30 52  1  1
 31 53  1  0
 32 54  1  6
 33 55  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
(2S,3S,4S,5R,6S)-6-{[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-3,4-dihydro-2H-1-benzopyran-5-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylate	HMDB
(−)-epicatechin-5-beta-D-glucuronide	HMDB
(−)-epicatechin-5-β-D-glucuronide	HMDB
E5G	HMDB
Epicatechin 5-O-beta-D-glucuronide	HMDB
Epicatechin 5-O-β-D-glucuronide	HMDB
Epicatechin 5-glucuronide	HMDB
Epicatechin 5-O-glucuronide	HMDB

Chemical Formula

C₂₁H₂₂O₁₂

Average Molecular Weight

466.395

Monoisotopic Molecular Weight

466.111126148

IUPAC Name

(2S,3S,4S,5R,6S)-6-{[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-3,4-dihydro-2H-1-benzopyran-5-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid

Traditional Name

(2S,3S,4S,5R,6S)-6-{[(2R,3R)-2-(3,4-dihydroxyphenyl)-3,7-dihydroxy-3,4-dihydro-2H-1-benzopyran-5-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid

CAS Registry Number

223614-70-8

SMILES

O[C@@H]1CC2=C(O[C@@H]1C1=CC=C(O)C(O)=C1)C=C(O)C=C2O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)C(O)=O

InChI Identifier

InChI=1S/C21H22O12/c22-8-4-13-9(6-12(25)18(31-13)7-1-2-10(23)11(24)3-7)14(5-8)32-21-17(28)15(26)16(27)19(33-21)20(29)30/h1-5,12,15-19,21-28H,6H2,(H,29,30)/t12-,15+,16+,17-,18-,19+,21-/m1/s1

InChI Key

KGLMKAPOVXBIJB-CVPXIJHMSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as flavonoid o-glucuronides. These are phenolic compounds containing a flavonoid moiety which is O-glycosidically linked to glucuronic acid.

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Flavonoids

Sub Class

Flavonoid glycosides

Direct Parent

Flavonoid O-glucuronides

Alternative Parents

Substituents

Flavonoid-5-o-glucuronide
Catechin
3'-hydroxyflavonoid
3-hydroxyflavonoid
4'-hydroxyflavonoid
7-hydroxyflavonoid
Hydroxyflavonoid
Flavan-3-ol
Flavan
Phenolic glycoside
1-o-glucuronide
O-glucuronide
Glucuronic acid or derivatives
Hexose monosaccharide
O-glycosyl compound
Glycosyl compound
Chromane
1-benzopyran
Benzopyran
Catechol
1-hydroxy-4-unsubstituted benzenoid
1-hydroxy-2-unsubstituted benzenoid
Alkyl aryl ether
Beta-hydroxy acid
Phenol
Pyran
Benzenoid
Monosaccharide
Hydroxy acid
Monocyclic benzene moiety
Oxane
Secondary alcohol
Acetal
Polyol
Ether
Organoheterocyclic compound
Carboxylic acid
Carboxylic acid derivative
Monocarboxylic acid or derivatives
Oxacycle
Carbonyl group
Organic oxygen compound
Alcohol
Organooxygen compound
Hydrocarbon derivative
Organic oxide
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Not Available

Not Available

Not Available

Not Available

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
logP	0.01	ALOGPS
logP	-0.15	ChemAxon
logS	-2.2	ALOGPS
pKa (Strongest Acidic)	2.93	ChemAxon
pKa (Strongest Basic)	-3.7	ChemAxon
Physiological Charge	-1	ChemAxon
Hydrogen Acceptor Count	12	ChemAxon
Hydrogen Donor Count	8	ChemAxon
Polar Surface Area	206.6 Å²	ChemAxon
Rotatable Bond Count	4	ChemAxon
Refractivity	106.01 m³·mol⁻¹	ChemAxon
Polarizability	43.62 Å³	ChemAxon
Number of Rings	4	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	Yes	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M+H]+	196.893	30932474
DeepCCS	[M-H]-	195.005	30932474
DeepCCS	[M-2H]-	228.244	30932474
DeepCCS	[M+Na]+	202.499	30932474

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Epicatechin 5-O-glucuronide	O[C@@H]1CC2=C(O[C@@H]1C1=CC=C(O)C(O)=C1)C=C(O)C=C2O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)C(O)=O	5448.7	Standard polar	33892256
Epicatechin 5-O-glucuronide	O[C@@H]1CC2=C(O[C@@H]1C1=CC=C(O)C(O)=C1)C=C(O)C=C2O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)C(O)=O	4054.9	Standard non polar	33892256
Epicatechin 5-O-glucuronide	O[C@@H]1CC2=C(O[C@@H]1C1=CC=C(O)C(O)=C1)C=C(O)C=C2O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)C(O)=O	4437.9	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Epicatechin 5-O-glucuronide,1TMS,isomer #1	C[Si](C)(C)O[C@@H]1CC2=C(O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O)C=C(O)C=C2O[C@@H]1C1=CC=C(O)C(O)=C1	4189.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,1TMS,isomer #2	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O)=C3C[C@H]2O)C=C1O	4167.6	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,1TMS,isomer #3	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O)=C3C[C@H]2O)=CC=C1O	4136.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,1TMS,isomer #4	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	4155.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,1TMS,isomer #5	C[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@H]1O	4183.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,1TMS,isomer #6	C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)O[C@H](C(=O)O)[C@H]1O	4170.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,1TMS,isomer #7	C[Si](C)(C)O[C@H]1[C@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)O[C@H](C(=O)O)[C@@H](O)[C@@H]1O	4179.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,1TMS,isomer #8	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	4134.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #1	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	4064.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #10	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]4O)=C3C[C@H]2O)C=C1O	4047.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #11	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]4O)=C3C[C@H]2O)C=C1O	4018.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #12	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O[Si](C)(C)C)=C3C[C@H]2O)C=C1O	4046.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #13	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O)=C3C[C@H]2O)C=C1O[Si](C)(C)C	4035.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #14	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	4019.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #15	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	4003.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #16	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]4O)=C3C[C@H]2O)=CC=C1O	4029.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #17	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]4O)=C3C[C@H]2O)=CC=C1O	3995.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #18	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O[Si](C)(C)C)=C3C[C@H]2O)=CC=C1O	4026.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #19	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	4037.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #2	C[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@H]1O	4130.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #20	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	4080.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #21	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	4052.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #22	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	4067.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #23	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4096.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #24	C[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@H]1O	4125.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #25	C[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@H]1O[Si](C)(C)C	4116.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #26	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](C(=O)O)O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@@H]1O[Si](C)(C)C	4102.6	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #27	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	4071.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #28	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4088.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #3	C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)O[C@H](C(=O)O)[C@H]1O	4108.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #4	C[Si](C)(C)O[C@H]1[C@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)O[C@H](C(=O)O)[C@@H](O)[C@@H]1O	4117.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #5	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	4084.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #6	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O)=C3C[C@H]2O[Si](C)(C)C)C=C1O	4045.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #7	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O)=C3C[C@H]2O[Si](C)(C)C)=CC=C1O	4037.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #8	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	4030.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TMS,isomer #9	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	4027.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #1	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	3976.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #10	C[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@H]1O	4050.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #11	C[Si](C)(C)O[C@@H]1CC2=C(O[C@@H]3O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]3O)C=C(O)C=C2O[C@@H]1C1=CC=C(O)C(O)=C1	4035.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #12	C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](C(=O)O)O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@@H]1O[Si](C)(C)C	4019.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #13	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	3982.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #14	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]4O)=C3C[C@H]2O[Si](C)(C)C)C=C1O	3904.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #15	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]4O)=C3C[C@H]2O[Si](C)(C)C)=CC=C1O	3908.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #16	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	4008.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #17	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O[Si](C)(C)C)=C3C[C@H]2O[Si](C)(C)C)C=C1O	3937.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #18	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O[Si](C)(C)C)=C3C[C@H]2O[Si](C)(C)C)=CC=C1O	3944.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #19	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	3932.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #2	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	3913.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #20	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	3934.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #21	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O)=C3C[C@H]2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3959.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #22	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	3953.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #23	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	3961.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #24	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	3932.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #25	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	3952.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #26	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	3961.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #27	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	3929.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #28	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	3943.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #29	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	3909.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #3	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	3913.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #30	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	3950.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #31	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]4O)=C3C[C@H]2O)C=C1O	3929.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #32	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]4O[Si](C)(C)C)=C3C[C@H]2O)C=C1O	3950.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #33	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]4O)=C3C[C@H]2O)C=C1O[Si](C)(C)C	3962.6	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #34	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]4O[Si](C)(C)C)=C3C[C@H]2O)C=C1O	3925.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #35	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]4O)=C3C[C@H]2O)C=C1O[Si](C)(C)C	3927.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #36	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O[Si](C)(C)C)=C3C[C@H]2O)C=C1O[Si](C)(C)C	3955.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #37	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	3945.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #38	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	3958.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #39	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	3926.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #4	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	4029.6	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #40	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	3952.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #41	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	3932.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #42	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	3895.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #43	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	3938.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #44	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]4O)=C3C[C@H]2O)=CC=C1O	3929.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #45	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]4O[Si](C)(C)C)=C3C[C@H]2O)=CC=C1O	3947.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #46	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]4O[Si](C)(C)C)=C3C[C@H]2O)=CC=C1O	3923.6	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #47	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	3998.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #48	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	3960.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #49	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4008.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #5	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	3995.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #50	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	3995.6	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #51	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	4012.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #52	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	3991.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #53	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	4050.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #54	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4024.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #55	C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)O[C@H](C(=O)O)[C@H]1O[Si](C)(C)C	4035.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #56	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	4017.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #6	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	4031.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #7	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	4017.6	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #8	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]4O)=C3C[C@H]2O[Si](C)(C)C)C=C1O	3941.6	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TMS,isomer #9	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]4O)=C3C[C@H]2O[Si](C)(C)C)=CC=C1O	3952.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #1	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	3885.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #10	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	3863.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #11	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	3830.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #12	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	3861.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #13	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	3978.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #14	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	4016.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #15	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	3985.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #16	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	3940.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #17	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	3950.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #18	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	3902.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #19	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	3908.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #2	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	3888.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #20	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]4O)=C3C[C@H]2O[Si](C)(C)C)C=C1O	3870.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #21	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]4O[Si](C)(C)C)=C3C[C@H]2O[Si](C)(C)C)C=C1O	3877.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #22	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]4O)=C3C[C@H]2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3917.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #23	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]4O)=C3C[C@H]2O[Si](C)(C)C)=CC=C1O	3881.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #24	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]4O[Si](C)(C)C)=C3C[C@H]2O[Si](C)(C)C)=CC=C1O	3886.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #25	C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)[C@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)O[C@H](C(=O)O)[C@H]1O[Si](C)(C)C	3997.6	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #26	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	3927.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #27	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]4O[Si](C)(C)C)=C3C[C@H]2O[Si](C)(C)C)C=C1O	3855.6	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #28	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]4O[Si](C)(C)C)=C3C[C@H]2O[Si](C)(C)C)=CC=C1O	3864.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #29	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	3887.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #3	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	3940.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #30	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	3883.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #31	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]4O)=C3C[C@H]2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3887.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #32	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	3894.6	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #33	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	3900.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #34	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O[Si](C)(C)C)=C3C[C@H]2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3911.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #35	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	3928.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #36	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	3918.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #37	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	3916.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #38	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	3891.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #39	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	3918.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #4	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	3895.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #40	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	3911.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #41	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	3917.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #42	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	3942.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #43	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	3904.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #44	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	3909.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #45	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	3932.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #46	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	3890.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #47	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	3855.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #48	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	3889.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #49	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	3874.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #5	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	3939.6	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #50	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	3903.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #51	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	3877.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #52	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]4O[Si](C)(C)C)=C3C[C@H]2O)C=C1O	3894.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #53	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]4O)=C3C[C@H]2O)C=C1O[Si](C)(C)C	3907.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #54	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]4O[Si](C)(C)C)=C3C[C@H]2O)C=C1O[Si](C)(C)C	3913.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #55	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]4O[Si](C)(C)C)=C3C[C@H]2O)C=C1O[Si](C)(C)C	3898.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #56	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	3911.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #57	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	3881.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #58	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	3913.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #59	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	3909.6	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #6	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	3882.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #60	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	3914.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #61	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	3903.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #62	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	3868.6	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #63	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	3894.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #64	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	3868.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #65	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]4O[Si](C)(C)C)=C3C[C@H]2O)=CC=C1O	3900.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #66	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	3922.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #67	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	3956.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #68	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	3931.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #69	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	3961.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #7	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	3862.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #70	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	4023.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #8	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	3836.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,4TMS,isomer #9	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	3861.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #1	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	3890.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #10	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	3872.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #11	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	3889.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #12	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	3857.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #13	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	3888.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #14	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	3853.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #15	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	3873.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #16	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	3853.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #17	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	3856.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #18	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	3877.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #19	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	3854.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #2	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	3874.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #20	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	3996.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #21	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	3914.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #22	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	3876.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #23	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	3878.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #24	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	3885.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #25	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	3887.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #26	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	3910.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #27	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]4O[Si](C)(C)C)=C3C[C@H]2O[Si](C)(C)C)C=C1O	3868.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #28	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]4O)=C3C[C@H]2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3890.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #29	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]4O[Si](C)(C)C)=C3C[C@H]2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3895.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #3	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	3858.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #30	C[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]4O[Si](C)(C)C)=C3C[C@H]2O[Si](C)(C)C)=CC=C1O	3878.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #31	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	3868.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #32	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	3869.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #33	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]4O[Si](C)(C)C)=C3C[C@H]2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3875.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #34	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	3886.6	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #35	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	3896.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #36	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	3902.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #37	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	3884.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #38	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	3902.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #39	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	3880.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #4	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	3876.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #40	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	3901.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #41	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	3881.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #42	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	3906.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #43	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	3913.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #44	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	3917.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #45	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	3897.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #46	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	3882.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #47	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	3903.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #48	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	3878.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #49	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	3904.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #5	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	3875.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #50	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]4O[Si](C)(C)C)=C3C[C@H]2O)C=C1O[Si](C)(C)C	3902.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #51	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	3875.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #52	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	3897.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #53	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	3875.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #54	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	3901.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #55	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	3901.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #56	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	3931.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #6	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	3858.6	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #7	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	3875.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #8	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	3871.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,5TMS,isomer #9	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	3903.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #1	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O	3886.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #10	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	3884.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #11	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	3880.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #12	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	3899.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #13	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	3876.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #14	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	3887.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #15	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	3891.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #16	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC2=C1	3880.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #17	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC2=C1	3885.6	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #18	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	3900.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #19	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	3902.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #2	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O	3865.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #20	C[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]4O[Si](C)(C)C)=C3C[C@H]2O[Si](C)(C)C)C=C1O[Si](C)(C)C	3903.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #21	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O[Si](C)(C)C)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	3889.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #22	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	3882.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #23	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	3894.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #24	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	3876.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #25	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	3881.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #26	C[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)=C2C[C@@H](O)[C@@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC2=C1	3914.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #27	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	3913.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #28	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	3879.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #3	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C	3886.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #4	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	3851.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #5	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	3867.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #6	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C)C(O)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	3851.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #7	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O	3856.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #8	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C	3872.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,6TMS,isomer #9	C[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C	3855.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)O[C@@H]1CC2=C(O[C@@H]3O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]3O)C=C(O)C=C2O[C@@H]1C1=CC=C(O)C(O)=C1	4424.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O)=C3C[C@H]2O)C=C1O	4413.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O)=C3C[C@H]2O)=CC=C1O	4384.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	4402.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@H]1O	4427.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)O[C@H](C(=O)O)[C@H]1O	4417.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)O[C@H]1[C@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)O[C@H](C(=O)O)[C@@H](O)[C@@H]1O	4432.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,1TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	4438.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	4528.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]4O)=C3C[C@H]2O)C=C1O	4484.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]4O)=C3C[C@H]2O)C=C1O	4465.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O[Si](C)(C)C(C)(C)C)=C3C[C@H]2O)C=C1O	4498.6	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O)=C3C[C@H]2O)C=C1O[Si](C)(C)C(C)(C)C	4481.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1	4492.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	4487.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]4O)=C3C[C@H]2O)=CC=C1O	4459.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]4O)=C3C[C@H]2O)=CC=C1O	4442.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O[Si](C)(C)C(C)(C)C)=C3C[C@H]2O)=CC=C1O	4474.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C(C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	4515.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@H]1O	4526.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	4503.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	4487.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	4509.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C	4557.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #24	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O	4539.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #25	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C	4524.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #26	CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](C(=O)O)O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@@H]1O[Si](C)(C)C(C)(C)C	4524.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O	4527.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O	4551.6	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)O[C@H](C(=O)O)[C@H]1O	4511.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)O[C@H]1[C@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)O[C@H](C(=O)O)[C@@H](O)[C@@H]1O	4531.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)=C2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	4487.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O)=C3C[C@H]2O[Si](C)(C)C(C)(C)C)C=C1O	4463.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O)=C3C[C@H]2O[Si](C)(C)C(C)(C)C)=CC=C1O	4448.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC2=C1	4524.6	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	4514.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C(C)(C)C)=CC3=C2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	4594.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #10	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](C(=O)O)O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O	4612.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #11	CC(C)(C)[Si](C)(C)O[C@@H]1CC2=C(O[C@@H]3O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3O)C=C(O)C=C2O[C@@H]1C1=CC=C(O)C(O)=C1	4590.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #12	CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](C(=O)O)O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@@H]1O[Si](C)(C)C(C)(C)C	4591.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)=C2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	4550.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]4O)=C3C[C@H]2O[Si](C)(C)C(C)(C)C)C=C1O	4536.6	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]4O)=C3C[C@H]2O[Si](C)(C)C(C)(C)C)=CC=C1O	4525.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)=C2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	4570.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O[Si](C)(C)C(C)(C)C)=C3C[C@H]2O[Si](C)(C)C(C)(C)C)C=C1O	4561.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O[Si](C)(C)C(C)(C)C)=C3C[C@H]2O[Si](C)(C)C(C)(C)C)=CC=C1O	4552.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)=C2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC2=C1	4624.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	4577.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)=C2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C3=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1	4607.6	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O)=C3C[C@H]2O[Si](C)(C)C(C)(C)C)C=C1O[Si](C)(C)C(C)(C)C	4577.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C(C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	4679.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC2=C1	4658.6	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC2=C1	4655.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)=C2C[C@@H](O)[C@@H](C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC2=C1	4668.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1	4652.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	4611.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)O3)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O	4620.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O	4592.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	4565.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C	4613.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]4O)=C3C[C@H]2O)C=C1O	4570.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]4O[Si](C)(C)C(C)(C)C)=C3C[C@H]2O)C=C1O	4584.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]4O)=C3C[C@H]2O)C=C1O[Si](C)(C)C(C)(C)C	4580.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]4O[Si](C)(C)C(C)(C)C)=C3C[C@H]2O)C=C1O	4569.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]4O)=C3C[C@H]2O)C=C1O[Si](C)(C)C(C)(C)C	4564.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]4O[Si](C)(C)C(C)(C)C)=C3C[C@H]2O)C=C1O[Si](C)(C)C(C)(C)C	4594.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C(C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O	4650.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #38	CC(C)(C)[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1	4633.6	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #39	CC(C)(C)[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1	4629.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O	4629.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #40	CC(C)(C)[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC2=C1	4641.3	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #41	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)O3)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O	4595.0	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #42	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O	4565.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #43	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C	4586.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #44	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]4O)=C3C[C@H]2O)=CC=C1O	4555.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #45	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]4O[Si](C)(C)C(C)(C)C)=C3C[C@H]2O)=CC=C1O	4562.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #46	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]4O[Si](C)(C)C(C)(C)C)=C3C[C@H]2O)=CC=C1O	4553.6	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #47	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C(C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O	4620.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #48	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C(C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O	4588.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #49	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O[Si](C)(C)C(C)(C)C)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C	4619.1	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O	4584.5	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #50	CC(C)(C)[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	4581.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #51	CC(C)(C)[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	4592.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #52	CC(C)(C)[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)=C2C[C@@H](O)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	4581.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #53	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C	4658.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #54	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C	4611.2	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #55	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)O[C@H](C(=O)O)[C@H]1O[Si](C)(C)C(C)(C)C	4605.8	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #56	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O	4606.9	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC(=O)[C@H]1O[C@@H](OC2=CC(O)=CC3=C2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C2=CC=C(O)C(O)=C2)O3)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C	4627.7	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1=CC(O[C@@H]2O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)=C2C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C3=CC=C(O)C(O)=C3)OC2=C1	4569.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]4O)=C3C[C@H]2O[Si](C)(C)C(C)(C)C)C=C1O	4554.4	Semi standard non polar	33892256
Epicatechin 5-O-glucuronide,3TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=CC(O)=CC(O[C@@H]4O[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]4O)=C3C[C@H]2O[Si](C)(C)C(C)(C)C)=CC=C1O	4544.5	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Epicatechin 5-O-glucuronide GC-MS (Non-derivatized) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Epicatechin 5-O-glucuronide 10V, Negative-QTOF	splash10-014i-0000900000-f1c8e2c594347dfab282	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Epicatechin 5-O-glucuronide 20V, Negative-QTOF	splash10-00xr-3948500000-2f10d54b82530a8d8f83	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Epicatechin 5-O-glucuronide 40V, Negative-QTOF	splash10-08mr-3579300000-43aa78acdd503ed704b8	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Epicatechin 5-O-glucuronide 10V, Positive-QTOF	splash10-014i-0011900000-5f36c9aba35fa6d664b3	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Epicatechin 5-O-glucuronide 20V, Positive-QTOF	splash10-014j-0719500000-4c8e2509573a76e591d6	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Epicatechin 5-O-glucuronide 40V, Positive-QTOF	splash10-00di-1930000000-1bd6c1bce3a4e3f4437d	2021-09-24	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Not Available

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

Not Available

KNApSAcK ID

Not Available

Chemspider ID

8271600

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

10096065

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

Not Available

Showing metabocard for Epicatechin 5-O-glucuronide (HMDB0240511)

MOL for HMDB0240511 (Epicatechin 5-O-glucuronide)

3D MOL for HMDB0240511 (Epicatechin 5-O-glucuronide)

3D SDF for HMDB0240511 (Epicatechin 5-O-glucuronide)

3D-SDF for HMDB0240511 (Epicatechin 5-O-glucuronide)

PDB for HMDB0240511 (Epicatechin 5-O-glucuronide)

3D PDB for HMDB0240511 (Epicatechin 5-O-glucuronide)

SMILES for HMDB0240511 (Epicatechin 5-O-glucuronide)

INCHI for HMDB0240511 (Epicatechin 5-O-glucuronide)

Structure for HMDB0240511 (Epicatechin 5-O-glucuronide)

3D Structure for HMDB0240511 (Epicatechin 5-O-glucuronide)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra