Showing metabocard for (6-Phe)BN (6-13) methyl ester (HMDB0243626)
Record Information | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Detected but not Quantified | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2021-09-10 20:52:30 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2021-09-26 22:50:47 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0243626 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | (6-Phe)BN (6-13) methyl ester | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | (6-Phe)BN (6-13) methyl ester belongs to the class of organic compounds known as peptides. Peptides are compounds containing an amide derived from two or more amino carboxylic acid molecules (the same or different) by formation of a covalent bond from the carbonyl carbon of one to the nitrogen atom of another. Based on a literature review very few articles have been published on (6-Phe)BN (6-13) methyl ester. This compound has been identified in human blood as reported by (PMID: 31557052 ). (6-phe)bn (6-13) methyl ester is not a naturally occurring metabolite and is only found in those individuals exposed to this compound or its derivatives. Technically (6-Phe)BN (6-13) methyl ester is part of the human exposome. The exposome can be defined as the collection of all the exposures of an individual in a lifetime and how those exposures relate to health. An individual's exposure begins before birth and includes insults from environmental and occupational sources. | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0243626 ((6-Phe)BN (6-13) methyl ester)Mrv1652309102122522D 70 73 0 0 0 0 999 V2000 3.8894 -14.6838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2553 -13.9444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7979 -13.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0786 -13.8916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4445 -13.1522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9872 -12.4656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3531 -11.7262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1638 -12.5184 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7065 -11.8318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2679 -13.0994 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 6.6338 -12.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1764 -11.6733 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.4571 -12.3071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9145 -12.9937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5486 -13.7331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9317 -14.4638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3552 -15.0539 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 6.6158 -14.6880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7353 -13.8717 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.8230 -11.5677 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 8.6463 -11.5149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1037 -12.2015 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0122 -10.7755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8355 -10.7227 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 10.2014 -9.9833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7440 -9.2967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0247 -9.9304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4821 -10.6170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3054 -10.5642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1162 -11.3564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3907 -9.1910 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 12.2140 -9.1382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.6714 -9.8248 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.5799 -8.3988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1225 -7.7122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.4032 -8.3460 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 13.7691 -7.6066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3117 -6.9200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 14.5924 -7.5538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.9583 -6.8143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.5009 -6.1277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.6766 -6.0942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.4538 -5.2999 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 14.1404 -4.8425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.2599 -4.0262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.0266 -3.7215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.6738 -4.2332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.5542 -5.0495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.7876 -5.3541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.0498 -8.2404 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 14.6839 -8.9798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.8606 -9.0326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 15.1413 -9.6664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.9646 -9.6135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.4220 -10.3001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.2453 -10.2473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.7027 -10.9339 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 17.6112 -9.5079 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 14.7754 -10.4058 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 15.2328 -11.0924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.0561 -11.0396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 14.8668 -11.8318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.3242 -12.5184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.1475 -12.4656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.5135 -11.7262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.3368 -11.6733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.7942 -12.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.4282 -13.0994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.6049 -13.1522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.0435 -11.8846 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 2 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 2 0 0 0 0 6 8 1 0 0 0 0 8 9 1 0 0 0 0 5 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 2 0 0 0 0 11 13 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 16 17 2 0 0 0 0 17 18 1 0 0 0 0 18 19 2 0 0 0 0 15 19 1 0 0 0 0 13 20 1 0 0 0 0 20 21 1 0 0 0 0 21 22 2 0 0 0 0 21 23 1 0 0 0 0 23 24 1 0 0 0 0 24 25 1 0 0 0 0 25 26 2 0 0 0 0 25 27 1 0 0 0 0 27 28 1 0 0 0 0 28 29 1 0 0 0 0 28 30 1 0 0 0 0 27 31 1 0 0 0 0 31 32 1 0 0 0 0 32 33 2 0 0 0 0 32 34 1 0 0 0 0 34 35 1 0 0 0 0 34 36 1 0 0 0 0 36 37 1 0 0 0 0 37 38 2 0 0 0 0 37 39 1 0 0 0 0 39 40 1 0 0 0 0 40 41 1 0 0 0 0 41 42 2 0 0 0 0 42 43 1 0 0 0 0 43 44 1 0 0 0 0 44 45 2 0 0 0 0 45 46 1 0 0 0 0 46 47 2 0 0 0 0 47 48 1 0 0 0 0 48 49 2 0 0 0 0 44 49 1 0 0 0 0 41 49 1 0 0 0 0 39 50 1 0 0 0 0 50 51 1 0 0 0 0 51 52 2 0 0 0 0 51 53 1 0 0 0 0 53 54 1 0 0 0 0 54 55 1 0 0 0 0 55 56 1 0 0 0 0 56 57 2 0 0 0 0 56 58 1 0 0 0 0 53 59 1 0 0 0 0 59 60 1 0 0 0 0 60 61 2 0 0 0 0 60 62 1 0 0 0 0 62 63 1 0 0 0 0 63 64 1 0 0 0 0 64 65 2 0 0 0 0 65 66 1 0 0 0 0 66 67 2 0 0 0 0 67 68 1 0 0 0 0 68 69 2 0 0 0 0 64 69 1 0 0 0 0 62 70 1 0 0 0 0 M END 3D MOL for HMDB0243626 ((6-Phe)BN (6-13) methyl ester)HMDB0243626 RDKit 3D (6-Phe)BN (6-13) methyl ester 136139 0 0 0 0 0 0 0 0999 V2000 -7.4038 4.9711 0.4614 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3665 3.9577 0.1707 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2865 2.7500 0.8304 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4044 2.5278 1.6777 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2753 1.6184 0.5526 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6015 2.1916 0.8350 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.8112 1.3606 0.6564 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.8867 0.1214 1.4975 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.1110 1.0637 -0.7962 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9563 0.4688 1.3289 N 0 0 0 0 0 0 0 0 0 0 0 0 -7.9949 -0.5035 0.8525 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4524 -0.2645 -0.2427 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6736 -1.7164 1.6375 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5080 -2.8918 1.1511 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2999 -4.1673 1.8954 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6536 -4.1434 3.3182 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5166 -5.0881 3.4980 N 0 0 0 0 0 0 0 0 0 0 0 0 -9.8008 -5.7782 2.2935 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1065 -5.2548 1.3633 N 0 0 0 0 0 0 0 0 0 0 0 0 -6.2738 -2.0689 1.2498 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.3557 -2.6261 2.1110 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7824 -2.8628 3.3398 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9692 -3.0307 1.9577 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3637 -2.6880 0.7222 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.1276 -1.3866 0.2610 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5261 -0.4429 1.0357 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4634 -0.9793 -1.0023 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6322 0.2010 -0.6494 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.2799 0.0776 -0.3493 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2030 -1.1224 -0.4136 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6826 1.1214 0.0391 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1670 1.9015 1.2713 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9846 0.5427 0.3511 N 0 0 0 0 0 0 0 0 0 0 0 0 3.2252 1.0963 -0.0383 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2126 2.1581 -0.6871 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4800 0.4361 0.3071 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5678 -0.0923 1.7140 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4140 0.9265 2.7639 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2532 1.1684 3.5039 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4787 2.1682 4.3434 N 0 0 0 0 0 0 0 0 0 0 0 0 4.7638 2.6292 4.2057 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4218 3.6412 4.8597 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7243 3.9079 4.5274 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3056 3.1388 3.5481 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6555 2.1229 2.8906 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3282 1.8441 3.2211 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6729 1.0997 -0.1569 N 0 0 0 0 0 0 0 0 0 0 0 0 6.6826 0.3951 -0.8763 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4270 -0.8647 -1.0456 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9277 0.9316 -1.4189 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6505 1.1193 -2.9408 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5138 2.0601 -3.1809 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7648 3.4172 -2.6762 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6626 4.3330 -2.5940 N 0 0 0 0 0 0 0 0 0 0 0 0 7.8641 3.8254 -2.3186 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0257 -0.0140 -1.2527 N 0 0 0 0 0 0 0 0 0 0 0 0 10.3172 0.1645 -1.7290 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6144 1.2198 -2.3905 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3943 -0.8009 -1.5187 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4723 -0.5615 -2.4865 N 0 0 0 0 0 0 0 0 0 0 0 0 10.9613 -2.2095 -1.4394 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2788 -2.7863 -2.5933 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9169 -2.9324 -2.7302 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3471 -3.4966 -3.8628 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1737 -3.9148 -4.8623 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5416 -3.7732 -4.7420 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1038 -3.2236 -3.6397 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3256 -0.7097 -2.1665 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1505 -1.8734 -2.6206 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2243 0.5111 -1.9527 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7654 5.7063 1.1916 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4486 4.5202 0.7444 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2194 5.5468 -0.4973 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0960 1.4415 -0.5430 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7250 3.0968 0.1491 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5798 2.5877 1.8970 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6922 2.0020 0.9899 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9559 -0.2575 1.5151 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6979 0.3694 2.5878 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2366 -0.6971 1.1399 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2902 0.4772 -1.2665 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2292 2.0428 -1.3482 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0585 0.5132 -0.9362 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3807 0.3072 2.2464 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7099 -1.6578 2.7095 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3267 -3.1012 0.0740 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5981 -2.6421 1.2339 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2355 -4.5400 1.7547 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2913 -3.4953 4.0705 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4682 -6.6162 2.1076 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9664 -1.8804 0.2572 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4009 -2.4200 2.7494 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8472 -4.1163 2.2114 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0741 -3.5200 0.1130 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7319 -1.7829 -1.2162 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0947 1.1271 -0.6372 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8557 1.9099 -0.7106 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7139 2.8538 1.3832 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8956 2.1308 1.1456 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3938 1.3070 2.1946 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0268 -0.3562 0.9089 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4680 -0.5542 -0.3136 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5764 -0.5780 1.8747 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7929 -0.9044 1.8405 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3480 0.5718 3.3431 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7947 2.5738 5.0348 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9191 4.2171 5.6209 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2789 4.6971 5.0067 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3407 3.3661 3.3025 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1320 1.5302 2.1314 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8197 2.1116 0.0245 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2663 1.9170 -1.0967 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6028 1.4862 -3.3925 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4254 0.1493 -3.4185 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3691 2.1013 -4.2883 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5771 1.6401 -2.7384 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5629 4.8363 -1.6827 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0088 4.4914 -3.3819 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8380 -0.9083 -0.6928 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8762 -0.5906 -0.4816 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1175 -0.7490 -3.4658 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6700 0.4744 -2.4894 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2974 -2.3196 -0.5169 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8431 -2.8744 -1.1768 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2594 -2.6284 -1.9508 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2644 -3.6059 -3.9565 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7386 -4.3709 -5.7586 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1661 -4.1203 -5.5574 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1965 -3.1300 -3.5542 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6959 -0.4056 -3.0401 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8816 -2.7869 -2.0174 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9472 -2.1050 -3.6707 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2289 -1.7409 -2.4726 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7360 1.4555 -2.2129 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4690 0.5220 -0.8805 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1624 0.4531 -2.5141 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 2 0 3 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 7 9 1 0 5 10 1 0 10 11 1 0 11 12 2 0 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 17 18 1 0 18 19 2 0 13 20 1 0 20 21 1 0 21 22 2 0 21 23 1 0 23 24 1 0 24 25 1 0 25 26 2 0 25 27 1 0 27 28 1 0 28 29 1 0 29 30 2 0 29 31 1 0 31 32 1 0 31 33 1 0 33 34 1 0 34 35 2 0 34 36 1 0 36 37 1 0 37 38 1 0 38 39 2 0 39 40 1 0 40 41 1 0 41 42 2 0 42 43 1 0 43 44 2 0 44 45 1 0 45 46 2 0 36 47 1 0 47 48 1 0 48 49 2 0 48 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 53 55 2 0 50 56 1 0 56 57 1 0 57 58 2 0 57 59 1 0 59 60 1 0 59 61 1 0 61 62 1 0 62 63 2 0 63 64 1 0 64 65 2 0 65 66 1 0 66 67 2 0 27 68 1 0 68 69 1 0 68 70 1 0 19 15 1 0 46 38 1 0 67 62 1 0 46 41 1 0 1 71 1 0 1 72 1 0 1 73 1 0 5 74 1 0 6 75 1 0 6 76 1 0 7 77 1 0 8 78 1 0 8 79 1 0 8 80 1 0 9 81 1 0 9 82 1 0 9 83 1 0 10 84 1 0 13 85 1 0 14 86 1 0 14 87 1 0 15 88 1 0 16 89 1 0 18 90 1 0 20 91 1 0 23 92 1 0 23 93 1 0 24 94 1 0 27 95 1 0 28 96 1 0 31 97 1 0 32 98 1 0 32 99 1 0 32100 1 0 33101 1 0 36102 1 0 37103 1 0 37104 1 0 39105 1 0 40106 1 0 42107 1 0 43108 1 0 44109 1 0 45110 1 0 47111 1 0 50112 1 0 51113 1 0 51114 1 0 52115 1 0 52116 1 0 54117 1 0 54118 1 0 56119 1 0 59120 1 0 60121 1 0 60122 1 0 61123 1 0 61124 1 0 63125 1 0 64126 1 0 65127 1 0 66128 1 0 67129 1 0 68130 1 0 69131 1 0 69132 1 0 69133 1 0 70134 1 0 70135 1 0 70136 1 0 M END 3D SDF for HMDB0243626 ((6-Phe)BN (6-13) methyl ester)Mrv1652309102122522D 70 73 0 0 0 0 999 V2000 3.8894 -14.6838 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2553 -13.9444 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7979 -13.2578 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0786 -13.8916 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4445 -13.1522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9872 -12.4656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3531 -11.7262 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1638 -12.5184 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7065 -11.8318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2679 -13.0994 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 6.6338 -12.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1764 -11.6733 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.4571 -12.3071 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9145 -12.9937 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.5486 -13.7331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.9317 -14.4638 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3552 -15.0539 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 6.6158 -14.6880 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7353 -13.8717 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 7.8230 -11.5677 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 8.6463 -11.5149 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1037 -12.2015 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0122 -10.7755 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8355 -10.7227 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 10.2014 -9.9833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7440 -9.2967 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.0247 -9.9304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4821 -10.6170 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.3054 -10.5642 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1162 -11.3564 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.3907 -9.1910 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 12.2140 -9.1382 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.6714 -9.8248 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.5799 -8.3988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1225 -7.7122 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.4032 -8.3460 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 13.7691 -7.6066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3117 -6.9200 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 14.5924 -7.5538 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.9583 -6.8143 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.5009 -6.1277 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.6766 -6.0942 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.4538 -5.2999 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 14.1404 -4.8425 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.2599 -4.0262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.0266 -3.7215 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.6738 -4.2332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.5542 -5.0495 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.7876 -5.3541 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.0498 -8.2404 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 14.6839 -8.9798 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.8606 -9.0326 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 15.1413 -9.6664 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.9646 -9.6135 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.4220 -10.3001 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.2453 -10.2473 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.7027 -10.9339 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 17.6112 -9.5079 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 14.7754 -10.4058 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 15.2328 -11.0924 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.0561 -11.0396 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 14.8668 -11.8318 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.3242 -12.5184 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.1475 -12.4656 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.5135 -11.7262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.3368 -11.6733 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.7942 -12.3599 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.4282 -13.0994 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.6049 -13.1522 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.0435 -11.8846 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 2 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 2 0 0 0 0 6 8 1 0 0 0 0 8 9 1 0 0 0 0 5 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 2 0 0 0 0 11 13 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 16 17 2 0 0 0 0 17 18 1 0 0 0 0 18 19 2 0 0 0 0 15 19 1 0 0 0 0 13 20 1 0 0 0 0 20 21 1 0 0 0 0 21 22 2 0 0 0 0 21 23 1 0 0 0 0 23 24 1 0 0 0 0 24 25 1 0 0 0 0 25 26 2 0 0 0 0 25 27 1 0 0 0 0 27 28 1 0 0 0 0 28 29 1 0 0 0 0 28 30 1 0 0 0 0 27 31 1 0 0 0 0 31 32 1 0 0 0 0 32 33 2 0 0 0 0 32 34 1 0 0 0 0 34 35 1 0 0 0 0 34 36 1 0 0 0 0 36 37 1 0 0 0 0 37 38 2 0 0 0 0 37 39 1 0 0 0 0 39 40 1 0 0 0 0 40 41 1 0 0 0 0 41 42 2 0 0 0 0 42 43 1 0 0 0 0 43 44 1 0 0 0 0 44 45 2 0 0 0 0 45 46 1 0 0 0 0 46 47 2 0 0 0 0 47 48 1 0 0 0 0 48 49 2 0 0 0 0 44 49 1 0 0 0 0 41 49 1 0 0 0 0 39 50 1 0 0 0 0 50 51 1 0 0 0 0 51 52 2 0 0 0 0 51 53 1 0 0 0 0 53 54 1 0 0 0 0 54 55 1 0 0 0 0 55 56 1 0 0 0 0 56 57 2 0 0 0 0 56 58 1 0 0 0 0 53 59 1 0 0 0 0 59 60 1 0 0 0 0 60 61 2 0 0 0 0 60 62 1 0 0 0 0 62 63 1 0 0 0 0 63 64 1 0 0 0 0 64 65 2 0 0 0 0 65 66 1 0 0 0 0 66 67 2 0 0 0 0 67 68 1 0 0 0 0 68 69 2 0 0 0 0 64 69 1 0 0 0 0 62 70 1 0 0 0 0 M END > <DATABASE_ID> HMDB0243626 > <DATABASE_NAME> hmdb > <SMILES> COC(=O)C(CC(C)C)NC(=O)C(CC1C=NC=N1)NC(=O)CNC(=O)C(NC(=O)C(C)NC(=O)C(CC1=CNC2=CC=CC=C12)NC(=O)C(CCC(N)=O)NC(=O)C(N)CC1=CC=CC=C1)C(C)C > <INCHI_IDENTIFIER> InChI=1S/C48H66N12O10/c1-26(2)18-38(48(69)70-6)59-46(67)37(21-31-23-51-25-54-31)56-40(62)24-53-47(68)41(27(3)4)60-42(63)28(5)55-45(66)36(20-30-22-52-34-15-11-10-14-32(30)34)58-44(65)35(16-17-39(50)61)57-43(64)33(49)19-29-12-8-7-9-13-29/h7-15,22-23,25-28,31,33,35-38,41,52H,16-21,24,49H2,1-6H3,(H2,50,61)(H,53,68)(H,55,66)(H,56,62)(H,57,64)(H,58,65)(H,59,67)(H,60,63) > <INCHI_KEY> ORCBJPDHGBTVHS-UHFFFAOYSA-N > <FORMULA> C48H66N12O10 > <MOLECULAR_WEIGHT> 971.13 > <EXACT_MASS> 970.502486373 > <JCHEM_ACCEPTOR_COUNT> 12 > <JCHEM_ATOM_COUNT> 136 > <JCHEM_AVERAGE_POLARIZABILITY> 101.15683931728354 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 10 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> methyl 2-(2-{2-[2-(2-{2-[2-(2-amino-3-phenylpropanamido)-4-carbamoylbutanamido]-3-(1H-indol-3-yl)propanamido}propanamido)-3-methylbutanamido]acetamido}-3-(4H-imidazol-4-yl)propanamido)-4-methylpentanoate > <ALOGPS_LOGP> 1.54 > <JCHEM_LOGP> -1.4982321430000018 > <ALOGPS_LOGS> -5.31 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 4 > <JCHEM_PHYSIOLOGICAL_CHARGE> 1 > <JCHEM_PKA> 11.94445697888798 > <JCHEM_PKA_STRONGEST_ACIDIC> 11.52822096631181 > <JCHEM_PKA_STRONGEST_BASIC> 7.7087252401855455 > <JCHEM_POLAR_SURFACE_AREA> 339.6199999999999 > <JCHEM_REFRACTIVITY> 254.5992 > <JCHEM_ROTATABLE_BOND_COUNT> 28 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 4.81e-03 g/l > <JCHEM_TRADITIONAL_IUPAC> methyl 2-(2-{2-[2-(2-{2-[2-(2-amino-3-phenylpropanamido)-4-carbamoylbutanamido]-3-(1H-indol-3-yl)propanamido}propanamido)-3-methylbutanamido]acetamido}-3-(4H-imidazol-4-yl)propanamido)-4-methylpentanoate > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0243626 ((6-Phe)BN (6-13) methyl ester)HMDB0243626 RDKit 3D (6-Phe)BN (6-13) methyl ester 136139 0 0 0 0 0 0 0 0999 V2000 -7.4038 4.9711 0.4614 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.3665 3.9577 0.1707 O 0 0 0 0 0 0 0 0 0 0 0 0 -8.2865 2.7500 0.8304 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4044 2.5278 1.6777 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2753 1.6184 0.5526 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.6015 2.1916 0.8350 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.8112 1.3606 0.6564 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.8867 0.1214 1.4975 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.1110 1.0637 -0.7962 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9563 0.4688 1.3289 N 0 0 0 0 0 0 0 0 0 0 0 0 -7.9949 -0.5035 0.8525 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.4524 -0.2645 -0.2427 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6736 -1.7164 1.6375 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5080 -2.8918 1.1511 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2999 -4.1673 1.8954 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.6536 -4.1434 3.3182 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.5166 -5.0881 3.4980 N 0 0 0 0 0 0 0 0 0 0 0 0 -9.8008 -5.7782 2.2935 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.1065 -5.2548 1.3633 N 0 0 0 0 0 0 0 0 0 0 0 0 -6.2738 -2.0689 1.2498 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.3557 -2.6261 2.1110 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7824 -2.8628 3.3398 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.9692 -3.0307 1.9577 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3637 -2.6880 0.7222 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.1276 -1.3866 0.2610 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5261 -0.4429 1.0357 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.4634 -0.9793 -1.0023 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6322 0.2010 -0.6494 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.2799 0.0776 -0.3493 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2030 -1.1224 -0.4136 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6826 1.1214 0.0391 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1670 1.9015 1.2713 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9846 0.5427 0.3511 N 0 0 0 0 0 0 0 0 0 0 0 0 3.2252 1.0963 -0.0383 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2126 2.1581 -0.6871 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4800 0.4361 0.3071 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5678 -0.0923 1.7140 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4140 0.9265 2.7639 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2532 1.1684 3.5039 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4787 2.1682 4.3434 N 0 0 0 0 0 0 0 0 0 0 0 0 4.7638 2.6292 4.2057 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4218 3.6412 4.8597 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7243 3.9079 4.5274 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3056 3.1388 3.5481 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6555 2.1229 2.8906 C 0 0 0 0 0 0 0 0 0 0 0 0 5.3282 1.8441 3.2211 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6729 1.0997 -0.1569 N 0 0 0 0 0 0 0 0 0 0 0 0 6.6826 0.3951 -0.8763 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4270 -0.8647 -1.0456 O 0 0 0 0 0 0 0 0 0 0 0 0 7.9277 0.9316 -1.4189 C 0 0 0 0 0 0 0 0 0 0 0 0 7.6505 1.1193 -2.9408 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5138 2.0601 -3.1809 C 0 0 0 0 0 0 0 0 0 0 0 0 6.7648 3.4172 -2.6762 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6626 4.3330 -2.5940 N 0 0 0 0 0 0 0 0 0 0 0 0 7.8641 3.8254 -2.3186 O 0 0 0 0 0 0 0 0 0 0 0 0 9.0257 -0.0140 -1.2527 N 0 0 0 0 0 0 0 0 0 0 0 0 10.3172 0.1645 -1.7290 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6144 1.2198 -2.3905 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3943 -0.8009 -1.5187 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4723 -0.5615 -2.4865 N 0 0 0 0 0 0 0 0 0 0 0 0 10.9613 -2.2095 -1.4394 C 0 0 0 0 0 0 0 0 0 0 0 0 10.2788 -2.7863 -2.5933 C 0 0 0 0 0 0 0 0 0 0 0 0 8.9169 -2.9324 -2.7302 C 0 0 0 0 0 0 0 0 0 0 0 0 8.3471 -3.4966 -3.8628 C 0 0 0 0 0 0 0 0 0 0 0 0 9.1737 -3.9148 -4.8623 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5416 -3.7732 -4.7420 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1038 -3.2236 -3.6397 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3256 -0.7097 -2.1665 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1505 -1.8734 -2.6206 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2243 0.5111 -1.9527 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7654 5.7063 1.1916 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4486 4.5202 0.7444 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2194 5.5468 -0.4973 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.0960 1.4415 -0.5430 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7250 3.0968 0.1491 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5798 2.5877 1.8970 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.6922 2.0020 0.9899 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9559 -0.2575 1.5151 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6979 0.3694 2.5878 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2366 -0.6971 1.1399 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.2902 0.4772 -1.2665 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.2292 2.0428 -1.3482 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0585 0.5132 -0.9362 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.3807 0.3072 2.2464 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7099 -1.6578 2.7095 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3267 -3.1012 0.0740 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5981 -2.6421 1.2339 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2355 -4.5400 1.7547 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.2913 -3.4953 4.0705 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.4682 -6.6162 2.1076 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9664 -1.8804 0.2572 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4009 -2.4200 2.7494 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8472 -4.1163 2.2114 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0741 -3.5200 0.1130 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7319 -1.7829 -1.2162 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0947 1.1271 -0.6372 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8557 1.9099 -0.7106 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7139 2.8538 1.3832 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8956 2.1308 1.1456 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3938 1.3070 2.1946 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0268 -0.3562 0.9089 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4680 -0.5542 -0.3136 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5764 -0.5780 1.8747 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7929 -0.9044 1.8405 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3480 0.5718 3.3431 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7947 2.5738 5.0348 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9191 4.2171 5.6209 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2789 4.6971 5.0067 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3407 3.3661 3.3025 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1320 1.5302 2.1314 H 0 0 0 0 0 0 0 0 0 0 0 0 5.8197 2.1116 0.0245 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2663 1.9170 -1.0967 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6028 1.4862 -3.3925 H 0 0 0 0 0 0 0 0 0 0 0 0 7.4254 0.1493 -3.4185 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3691 2.1013 -4.2883 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5771 1.6401 -2.7384 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5629 4.8363 -1.6827 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0088 4.4914 -3.3819 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8380 -0.9083 -0.6928 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8762 -0.5906 -0.4816 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1175 -0.7490 -3.4658 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6700 0.4744 -2.4894 H 0 0 0 0 0 0 0 0 0 0 0 0 10.2974 -2.3196 -0.5169 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8431 -2.8744 -1.1768 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2594 -2.6284 -1.9508 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2644 -3.6059 -3.9565 H 0 0 0 0 0 0 0 0 0 0 0 0 8.7386 -4.3709 -5.7586 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1661 -4.1203 -5.5574 H 0 0 0 0 0 0 0 0 0 0 0 0 12.1965 -3.1300 -3.5542 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6959 -0.4056 -3.0401 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8816 -2.7869 -2.0174 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9472 -2.1050 -3.6707 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2289 -1.7409 -2.4726 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7360 1.4555 -2.2129 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4690 0.5220 -0.8805 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1624 0.4531 -2.5141 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 2 0 3 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 7 9 1 0 5 10 1 0 10 11 1 0 11 12 2 0 11 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 2 0 17 18 1 0 18 19 2 0 13 20 1 0 20 21 1 0 21 22 2 0 21 23 1 0 23 24 1 0 24 25 1 0 25 26 2 0 25 27 1 0 27 28 1 0 28 29 1 0 29 30 2 0 29 31 1 0 31 32 1 0 31 33 1 0 33 34 1 0 34 35 2 0 34 36 1 0 36 37 1 0 37 38 1 0 38 39 2 0 39 40 1 0 40 41 1 0 41 42 2 0 42 43 1 0 43 44 2 0 44 45 1 0 45 46 2 0 36 47 1 0 47 48 1 0 48 49 2 0 48 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 53 55 2 0 50 56 1 0 56 57 1 0 57 58 2 0 57 59 1 0 59 60 1 0 59 61 1 0 61 62 1 0 62 63 2 0 63 64 1 0 64 65 2 0 65 66 1 0 66 67 2 0 27 68 1 0 68 69 1 0 68 70 1 0 19 15 1 0 46 38 1 0 67 62 1 0 46 41 1 0 1 71 1 0 1 72 1 0 1 73 1 0 5 74 1 0 6 75 1 0 6 76 1 0 7 77 1 0 8 78 1 0 8 79 1 0 8 80 1 0 9 81 1 0 9 82 1 0 9 83 1 0 10 84 1 0 13 85 1 0 14 86 1 0 14 87 1 0 15 88 1 0 16 89 1 0 18 90 1 0 20 91 1 0 23 92 1 0 23 93 1 0 24 94 1 0 27 95 1 0 28 96 1 0 31 97 1 0 32 98 1 0 32 99 1 0 32100 1 0 33101 1 0 36102 1 0 37103 1 0 37104 1 0 39105 1 0 40106 1 0 42107 1 0 43108 1 0 44109 1 0 45110 1 0 47111 1 0 50112 1 0 51113 1 0 51114 1 0 52115 1 0 52116 1 0 54117 1 0 54118 1 0 56119 1 0 59120 1 0 60121 1 0 60122 1 0 61123 1 0 61124 1 0 63125 1 0 64126 1 0 65127 1 0 66128 1 0 67129 1 0 68130 1 0 69131 1 0 69132 1 0 69133 1 0 70134 1 0 70135 1 0 70136 1 0 M END PDB for HMDB0243626 ((6-Phe)BN (6-13) methyl ester)HEADER PROTEIN 10-SEP-21 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 10-SEP-21 0 HETATM 1 C UNK 0 7.260 -27.410 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 7.943 -26.030 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 7.089 -24.748 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 9.480 -25.931 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 10.163 -24.551 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 9.309 -23.269 0.000 0.00 0.00 C+0 HETATM 7 O UNK 0 9.992 -21.889 0.000 0.00 0.00 O+0 HETATM 8 O UNK 0 7.773 -23.368 0.000 0.00 0.00 O+0 HETATM 9 C UNK 0 6.919 -22.086 0.000 0.00 0.00 C+0 HETATM 10 N UNK 0 11.700 -24.452 0.000 0.00 0.00 N+0 HETATM 11 C UNK 0 12.383 -23.072 0.000 0.00 0.00 C+0 HETATM 12 O UNK 0 11.529 -21.790 0.000 0.00 0.00 O+0 HETATM 13 C UNK 0 13.920 -22.973 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 14.774 -24.255 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 14.091 -25.635 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 14.806 -26.999 0.000 0.00 0.00 C+0 HETATM 17 N UNK 0 13.730 -28.101 0.000 0.00 0.00 N+0 HETATM 18 C UNK 0 12.349 -27.418 0.000 0.00 0.00 C+0 HETATM 19 N UNK 0 12.573 -25.894 0.000 0.00 0.00 N+0 HETATM 20 N UNK 0 14.603 -21.593 0.000 0.00 0.00 N+0 HETATM 21 C UNK 0 16.140 -21.494 0.000 0.00 0.00 C+0 HETATM 22 O UNK 0 16.994 -22.776 0.000 0.00 0.00 O+0 HETATM 23 C UNK 0 16.823 -20.114 0.000 0.00 0.00 C+0 HETATM 24 N UNK 0 18.360 -20.016 0.000 0.00 0.00 N+0 HETATM 25 C UNK 0 19.043 -18.635 0.000 0.00 0.00 C+0 HETATM 26 O UNK 0 18.189 -17.354 0.000 0.00 0.00 O+0 HETATM 27 C UNK 0 20.580 -18.537 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 21.433 -19.818 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 22.970 -19.720 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 20.750 -21.199 0.000 0.00 0.00 C+0 HETATM 31 N UNK 0 21.263 -17.157 0.000 0.00 0.00 N+0 HETATM 32 C UNK 0 22.799 -17.058 0.000 0.00 0.00 C+0 HETATM 33 O UNK 0 23.653 -18.340 0.000 0.00 0.00 O+0 HETATM 34 C UNK 0 23.482 -15.678 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 22.629 -14.396 0.000 0.00 0.00 C+0 HETATM 36 N UNK 0 25.019 -15.579 0.000 0.00 0.00 N+0 HETATM 37 C UNK 0 25.702 -14.199 0.000 0.00 0.00 C+0 HETATM 38 O UNK 0 24.849 -12.917 0.000 0.00 0.00 O+0 HETATM 39 C UNK 0 27.239 -14.100 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 27.922 -12.720 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 27.068 -11.438 0.000 0.00 0.00 C+0 HETATM 42 C UNK 0 25.530 -11.376 0.000 0.00 0.00 C+0 HETATM 43 N UNK 0 25.114 -9.893 0.000 0.00 0.00 N+0 HETATM 44 C UNK 0 26.395 -9.039 0.000 0.00 0.00 C+0 HETATM 45 C UNK 0 26.618 -7.516 0.000 0.00 0.00 C+0 HETATM 46 C UNK 0 28.050 -6.947 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 29.258 -7.902 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 29.035 -9.426 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 27.603 -9.994 0.000 0.00 0.00 C+0 HETATM 50 N UNK 0 28.093 -15.382 0.000 0.00 0.00 N+0 HETATM 51 C UNK 0 27.410 -16.762 0.000 0.00 0.00 C+0 HETATM 52 O UNK 0 25.873 -16.861 0.000 0.00 0.00 O+0 HETATM 53 C UNK 0 28.264 -18.044 0.000 0.00 0.00 C+0 HETATM 54 C UNK 0 29.801 -17.945 0.000 0.00 0.00 C+0 HETATM 55 C UNK 0 30.654 -19.227 0.000 0.00 0.00 C+0 HETATM 56 C UNK 0 32.191 -19.128 0.000 0.00 0.00 C+0 HETATM 57 O UNK 0 33.045 -20.410 0.000 0.00 0.00 O+0 HETATM 58 N UNK 0 32.874 -17.748 0.000 0.00 0.00 N+0 HETATM 59 N UNK 0 27.581 -19.424 0.000 0.00 0.00 N+0 HETATM 60 C UNK 0 28.434 -20.706 0.000 0.00 0.00 C+0 HETATM 61 O UNK 0 29.971 -20.607 0.000 0.00 0.00 O+0 HETATM 62 C UNK 0 27.751 -22.086 0.000 0.00 0.00 C+0 HETATM 63 C UNK 0 28.605 -23.368 0.000 0.00 0.00 C+0 HETATM 64 C UNK 0 30.142 -23.269 0.000 0.00 0.00 C+0 HETATM 65 C UNK 0 30.825 -21.889 0.000 0.00 0.00 C+0 HETATM 66 C UNK 0 32.362 -21.790 0.000 0.00 0.00 C+0 HETATM 67 C UNK 0 33.216 -23.072 0.000 0.00 0.00 C+0 HETATM 68 C UNK 0 32.533 -24.452 0.000 0.00 0.00 C+0 HETATM 69 C UNK 0 30.996 -24.551 0.000 0.00 0.00 C+0 HETATM 70 N UNK 0 26.215 -22.185 0.000 0.00 0.00 N+0 CONECT 1 2 CONECT 2 1 3 4 CONECT 3 2 CONECT 4 2 5 CONECT 5 4 6 10 CONECT 6 5 7 8 CONECT 7 6 CONECT 8 6 9 CONECT 9 8 CONECT 10 5 11 CONECT 11 10 12 13 CONECT 12 11 CONECT 13 11 14 20 CONECT 14 13 15 CONECT 15 14 16 19 CONECT 16 15 17 CONECT 17 16 18 CONECT 18 17 19 CONECT 19 18 15 CONECT 20 13 21 CONECT 21 20 22 23 CONECT 22 21 CONECT 23 21 24 CONECT 24 23 25 CONECT 25 24 26 27 CONECT 26 25 CONECT 27 25 28 31 CONECT 28 27 29 30 CONECT 29 28 CONECT 30 28 CONECT 31 27 32 CONECT 32 31 33 34 CONECT 33 32 CONECT 34 32 35 36 CONECT 35 34 CONECT 36 34 37 CONECT 37 36 38 39 CONECT 38 37 CONECT 39 37 40 50 CONECT 40 39 41 CONECT 41 40 42 49 CONECT 42 41 43 CONECT 43 42 44 CONECT 44 43 45 49 CONECT 45 44 46 CONECT 46 45 47 CONECT 47 46 48 CONECT 48 47 49 CONECT 49 48 44 41 CONECT 50 39 51 CONECT 51 50 52 53 CONECT 52 51 CONECT 53 51 54 59 CONECT 54 53 55 CONECT 55 54 56 CONECT 56 55 57 58 CONECT 57 56 CONECT 58 56 CONECT 59 53 60 CONECT 60 59 61 62 CONECT 61 60 CONECT 62 60 63 70 CONECT 63 62 64 CONECT 64 63 65 69 CONECT 65 64 66 CONECT 66 65 67 CONECT 67 66 68 CONECT 68 67 69 CONECT 69 68 64 CONECT 70 62 MASTER 0 0 0 0 0 0 0 0 70 0 146 0 END 3D PDB for HMDB0243626 ((6-Phe)BN (6-13) methyl ester)COMPND HMDB0243626 HETATM 1 C1 UNL 1 -7.404 4.971 0.461 1.00 0.00 C HETATM 2 O1 UNL 1 -8.367 3.958 0.171 1.00 0.00 O HETATM 3 C2 UNL 1 -8.286 2.750 0.830 1.00 0.00 C HETATM 4 O2 UNL 1 -7.404 2.528 1.678 1.00 0.00 O HETATM 5 C3 UNL 1 -9.275 1.618 0.553 1.00 0.00 C HETATM 6 C4 UNL 1 -10.602 2.192 0.835 1.00 0.00 C HETATM 7 C5 UNL 1 -11.811 1.361 0.656 1.00 0.00 C HETATM 8 C6 UNL 1 -11.887 0.121 1.498 1.00 0.00 C HETATM 9 C7 UNL 1 -12.111 1.064 -0.796 1.00 0.00 C HETATM 10 N1 UNL 1 -8.956 0.469 1.329 1.00 0.00 N HETATM 11 C8 UNL 1 -7.995 -0.503 0.852 1.00 0.00 C HETATM 12 O3 UNL 1 -7.452 -0.265 -0.243 1.00 0.00 O HETATM 13 C9 UNL 1 -7.674 -1.716 1.637 1.00 0.00 C HETATM 14 C10 UNL 1 -8.508 -2.892 1.151 1.00 0.00 C HETATM 15 C11 UNL 1 -8.300 -4.167 1.895 1.00 0.00 C HETATM 16 C12 UNL 1 -8.654 -4.143 3.318 1.00 0.00 C HETATM 17 N2 UNL 1 -9.517 -5.088 3.498 1.00 0.00 N HETATM 18 C13 UNL 1 -9.801 -5.778 2.293 1.00 0.00 C HETATM 19 N3 UNL 1 -9.106 -5.255 1.363 1.00 0.00 N HETATM 20 N4 UNL 1 -6.274 -2.069 1.250 1.00 0.00 N HETATM 21 C14 UNL 1 -5.356 -2.626 2.111 1.00 0.00 C HETATM 22 O4 UNL 1 -5.782 -2.863 3.340 1.00 0.00 O HETATM 23 C15 UNL 1 -3.969 -3.031 1.958 1.00 0.00 C HETATM 24 N5 UNL 1 -3.364 -2.688 0.722 1.00 0.00 N HETATM 25 C16 UNL 1 -3.128 -1.387 0.261 1.00 0.00 C HETATM 26 O5 UNL 1 -3.526 -0.443 1.036 1.00 0.00 O HETATM 27 C17 UNL 1 -2.463 -0.979 -1.002 1.00 0.00 C HETATM 28 N6 UNL 1 -1.632 0.201 -0.649 1.00 0.00 N HETATM 29 C18 UNL 1 -0.280 0.078 -0.349 1.00 0.00 C HETATM 30 O6 UNL 1 0.203 -1.122 -0.414 1.00 0.00 O HETATM 31 C19 UNL 1 0.683 1.121 0.039 1.00 0.00 C HETATM 32 C20 UNL 1 0.167 1.902 1.271 1.00 0.00 C HETATM 33 N7 UNL 1 1.985 0.543 0.351 1.00 0.00 N HETATM 34 C21 UNL 1 3.225 1.096 -0.038 1.00 0.00 C HETATM 35 O7 UNL 1 3.213 2.158 -0.687 1.00 0.00 O HETATM 36 C22 UNL 1 4.480 0.436 0.307 1.00 0.00 C HETATM 37 C23 UNL 1 4.568 -0.092 1.714 1.00 0.00 C HETATM 38 C24 UNL 1 4.414 0.927 2.764 1.00 0.00 C HETATM 39 C25 UNL 1 3.253 1.168 3.504 1.00 0.00 C HETATM 40 N8 UNL 1 3.479 2.168 4.343 1.00 0.00 N HETATM 41 C26 UNL 1 4.764 2.629 4.206 1.00 0.00 C HETATM 42 C27 UNL 1 5.422 3.641 4.860 1.00 0.00 C HETATM 43 C28 UNL 1 6.724 3.908 4.527 1.00 0.00 C HETATM 44 C29 UNL 1 7.306 3.139 3.548 1.00 0.00 C HETATM 45 C30 UNL 1 6.655 2.123 2.891 1.00 0.00 C HETATM 46 C31 UNL 1 5.328 1.844 3.221 1.00 0.00 C HETATM 47 N9 UNL 1 5.673 1.100 -0.157 1.00 0.00 N HETATM 48 C32 UNL 1 6.683 0.395 -0.876 1.00 0.00 C HETATM 49 O8 UNL 1 6.427 -0.865 -1.046 1.00 0.00 O HETATM 50 C33 UNL 1 7.928 0.932 -1.419 1.00 0.00 C HETATM 51 C34 UNL 1 7.651 1.119 -2.941 1.00 0.00 C HETATM 52 C35 UNL 1 6.514 2.060 -3.181 1.00 0.00 C HETATM 53 C36 UNL 1 6.765 3.417 -2.676 1.00 0.00 C HETATM 54 N10 UNL 1 5.663 4.333 -2.594 1.00 0.00 N HETATM 55 O9 UNL 1 7.864 3.825 -2.319 1.00 0.00 O HETATM 56 N11 UNL 1 9.026 -0.014 -1.253 1.00 0.00 N HETATM 57 C37 UNL 1 10.317 0.164 -1.729 1.00 0.00 C HETATM 58 O10 UNL 1 10.614 1.220 -2.390 1.00 0.00 O HETATM 59 C38 UNL 1 11.394 -0.801 -1.519 1.00 0.00 C HETATM 60 N12 UNL 1 12.472 -0.562 -2.486 1.00 0.00 N HETATM 61 C39 UNL 1 10.961 -2.209 -1.439 1.00 0.00 C HETATM 62 C40 UNL 1 10.279 -2.786 -2.593 1.00 0.00 C HETATM 63 C41 UNL 1 8.917 -2.932 -2.730 1.00 0.00 C HETATM 64 C42 UNL 1 8.347 -3.497 -3.863 1.00 0.00 C HETATM 65 C43 UNL 1 9.174 -3.915 -4.862 1.00 0.00 C HETATM 66 C44 UNL 1 10.542 -3.773 -4.742 1.00 0.00 C HETATM 67 C45 UNL 1 11.104 -3.224 -3.640 1.00 0.00 C HETATM 68 C46 UNL 1 -3.326 -0.710 -2.166 1.00 0.00 C HETATM 69 C47 UNL 1 -4.151 -1.873 -2.621 1.00 0.00 C HETATM 70 C48 UNL 1 -4.224 0.511 -1.953 1.00 0.00 C HETATM 71 H1 UNL 1 -7.765 5.706 1.192 1.00 0.00 H HETATM 72 H2 UNL 1 -6.449 4.520 0.744 1.00 0.00 H HETATM 73 H3 UNL 1 -7.219 5.547 -0.497 1.00 0.00 H HETATM 74 H4 UNL 1 -9.096 1.442 -0.543 1.00 0.00 H HETATM 75 H5 UNL 1 -10.725 3.097 0.149 1.00 0.00 H HETATM 76 H6 UNL 1 -10.580 2.588 1.897 1.00 0.00 H HETATM 77 H7 UNL 1 -12.692 2.002 0.990 1.00 0.00 H HETATM 78 H8 UNL 1 -12.956 -0.257 1.515 1.00 0.00 H HETATM 79 H9 UNL 1 -11.698 0.369 2.588 1.00 0.00 H HETATM 80 H10 UNL 1 -11.237 -0.697 1.140 1.00 0.00 H HETATM 81 H11 UNL 1 -11.290 0.477 -1.266 1.00 0.00 H HETATM 82 H12 UNL 1 -12.229 2.043 -1.348 1.00 0.00 H HETATM 83 H13 UNL 1 -13.058 0.513 -0.936 1.00 0.00 H HETATM 84 H14 UNL 1 -9.381 0.307 2.246 1.00 0.00 H HETATM 85 H15 UNL 1 -7.710 -1.658 2.710 1.00 0.00 H HETATM 86 H16 UNL 1 -8.327 -3.101 0.074 1.00 0.00 H HETATM 87 H17 UNL 1 -9.598 -2.642 1.234 1.00 0.00 H HETATM 88 H18 UNL 1 -7.236 -4.540 1.755 1.00 0.00 H HETATM 89 H19 UNL 1 -8.291 -3.495 4.071 1.00 0.00 H HETATM 90 H20 UNL 1 -10.468 -6.616 2.108 1.00 0.00 H HETATM 91 H21 UNL 1 -5.966 -1.880 0.257 1.00 0.00 H HETATM 92 H22 UNL 1 -3.401 -2.420 2.749 1.00 0.00 H HETATM 93 H23 UNL 1 -3.847 -4.116 2.211 1.00 0.00 H HETATM 94 H24 UNL 1 -3.074 -3.520 0.113 1.00 0.00 H HETATM 95 H25 UNL 1 -1.732 -1.783 -1.216 1.00 0.00 H HETATM 96 H26 UNL 1 -2.095 1.127 -0.637 1.00 0.00 H HETATM 97 H27 UNL 1 0.856 1.910 -0.711 1.00 0.00 H HETATM 98 H28 UNL 1 0.714 2.854 1.383 1.00 0.00 H HETATM 99 H29 UNL 1 -0.896 2.131 1.146 1.00 0.00 H HETATM 100 H30 UNL 1 0.394 1.307 2.195 1.00 0.00 H HETATM 101 H31 UNL 1 2.027 -0.356 0.909 1.00 0.00 H HETATM 102 H32 UNL 1 4.468 -0.554 -0.314 1.00 0.00 H HETATM 103 H33 UNL 1 5.576 -0.578 1.875 1.00 0.00 H HETATM 104 H34 UNL 1 3.793 -0.904 1.841 1.00 0.00 H HETATM 105 H35 UNL 1 2.348 0.572 3.343 1.00 0.00 H HETATM 106 H36 UNL 1 2.795 2.574 5.035 1.00 0.00 H HETATM 107 H37 UNL 1 4.919 4.217 5.621 1.00 0.00 H HETATM 108 H38 UNL 1 7.279 4.697 5.007 1.00 0.00 H HETATM 109 H39 UNL 1 8.341 3.366 3.303 1.00 0.00 H HETATM 110 H40 UNL 1 7.132 1.530 2.131 1.00 0.00 H HETATM 111 H41 UNL 1 5.820 2.112 0.024 1.00 0.00 H HETATM 112 H42 UNL 1 8.266 1.917 -1.097 1.00 0.00 H HETATM 113 H43 UNL 1 8.603 1.486 -3.393 1.00 0.00 H HETATM 114 H44 UNL 1 7.425 0.149 -3.419 1.00 0.00 H HETATM 115 H45 UNL 1 6.369 2.101 -4.288 1.00 0.00 H HETATM 116 H46 UNL 1 5.577 1.640 -2.738 1.00 0.00 H HETATM 117 H47 UNL 1 5.563 4.836 -1.683 1.00 0.00 H HETATM 118 H48 UNL 1 5.009 4.491 -3.382 1.00 0.00 H HETATM 119 H49 UNL 1 8.838 -0.908 -0.693 1.00 0.00 H HETATM 120 H50 UNL 1 11.876 -0.591 -0.482 1.00 0.00 H HETATM 121 H51 UNL 1 12.117 -0.749 -3.466 1.00 0.00 H HETATM 122 H52 UNL 1 12.670 0.474 -2.489 1.00 0.00 H HETATM 123 H53 UNL 1 10.297 -2.320 -0.517 1.00 0.00 H HETATM 124 H54 UNL 1 11.843 -2.874 -1.177 1.00 0.00 H HETATM 125 H55 UNL 1 8.259 -2.628 -1.951 1.00 0.00 H HETATM 126 H56 UNL 1 7.264 -3.606 -3.957 1.00 0.00 H HETATM 127 H57 UNL 1 8.739 -4.371 -5.759 1.00 0.00 H HETATM 128 H58 UNL 1 11.166 -4.120 -5.557 1.00 0.00 H HETATM 129 H59 UNL 1 12.197 -3.130 -3.554 1.00 0.00 H HETATM 130 H60 UNL 1 -2.696 -0.406 -3.040 1.00 0.00 H HETATM 131 H61 UNL 1 -3.882 -2.787 -2.017 1.00 0.00 H HETATM 132 H62 UNL 1 -3.947 -2.105 -3.671 1.00 0.00 H HETATM 133 H63 UNL 1 -5.229 -1.741 -2.473 1.00 0.00 H HETATM 134 H64 UNL 1 -3.736 1.456 -2.213 1.00 0.00 H HETATM 135 H65 UNL 1 -4.469 0.522 -0.881 1.00 0.00 H HETATM 136 H66 UNL 1 -5.162 0.453 -2.514 1.00 0.00 H CONECT 1 2 71 72 73 CONECT 2 3 CONECT 3 4 4 5 CONECT 5 6 10 74 CONECT 6 7 75 76 CONECT 7 8 9 77 CONECT 8 78 79 80 CONECT 9 81 82 83 CONECT 10 11 84 CONECT 11 12 12 13 CONECT 13 14 20 85 CONECT 14 15 86 87 CONECT 15 16 19 88 CONECT 16 17 17 89 CONECT 17 18 CONECT 18 19 19 90 CONECT 20 21 91 CONECT 21 22 22 23 CONECT 23 24 92 93 CONECT 24 25 94 CONECT 25 26 26 27 CONECT 27 28 68 95 CONECT 28 29 96 CONECT 29 30 30 31 CONECT 31 32 33 97 CONECT 32 98 99 100 CONECT 33 34 101 CONECT 34 35 35 36 CONECT 36 37 47 102 CONECT 37 38 103 104 CONECT 38 39 39 46 CONECT 39 40 105 CONECT 40 41 106 CONECT 41 42 42 46 CONECT 42 43 107 CONECT 43 44 44 108 CONECT 44 45 109 CONECT 45 46 46 110 CONECT 47 48 111 CONECT 48 49 49 50 CONECT 50 51 56 112 CONECT 51 52 113 114 CONECT 52 53 115 116 CONECT 53 54 55 55 CONECT 54 117 118 CONECT 56 57 119 CONECT 57 58 58 59 CONECT 59 60 61 120 CONECT 60 121 122 CONECT 61 62 123 124 CONECT 62 63 63 67 CONECT 63 64 125 CONECT 64 65 65 126 CONECT 65 66 127 CONECT 66 67 67 128 CONECT 67 129 CONECT 68 69 70 130 CONECT 69 131 132 133 CONECT 70 134 135 136 END SMILES for HMDB0243626 ((6-Phe)BN (6-13) methyl ester)COC(=O)C(CC(C)C)NC(=O)C(CC1C=NC=N1)NC(=O)CNC(=O)C(NC(=O)C(C)NC(=O)C(CC1=CNC2=CC=CC=C12)NC(=O)C(CCC(N)=O)NC(=O)C(N)CC1=CC=CC=C1)C(C)C INCHI for HMDB0243626 ((6-Phe)BN (6-13) methyl ester)InChI=1S/C48H66N12O10/c1-26(2)18-38(48(69)70-6)59-46(67)37(21-31-23-51-25-54-31)56-40(62)24-53-47(68)41(27(3)4)60-42(63)28(5)55-45(66)36(20-30-22-52-34-15-11-10-14-32(30)34)58-44(65)35(16-17-39(50)61)57-43(64)33(49)19-29-12-8-7-9-13-29/h7-15,22-23,25-28,31,33,35-38,41,52H,16-21,24,49H2,1-6H3,(H2,50,61)(H,53,68)(H,55,66)(H,56,62)(H,57,64)(H,58,65)(H,59,67)(H,60,63) 3D Structure for HMDB0243626 ((6-Phe)BN (6-13) methyl ester) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C48H66N12O10 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 971.13 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 970.502486373 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | methyl 2-(2-{2-[2-(2-{2-[2-(2-amino-3-phenylpropanamido)-4-carbamoylbutanamido]-3-(1H-indol-3-yl)propanamido}propanamido)-3-methylbutanamido]acetamido}-3-(4H-imidazol-4-yl)propanamido)-4-methylpentanoate | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | methyl 2-(2-{2-[2-(2-{2-[2-(2-amino-3-phenylpropanamido)-4-carbamoylbutanamido]-3-(1H-indol-3-yl)propanamido}propanamido)-3-methylbutanamido]acetamido}-3-(4H-imidazol-4-yl)propanamido)-4-methylpentanoate | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | COC(=O)C(CC(C)C)NC(=O)C(CC1C=NC=N1)NC(=O)CNC(=O)C(NC(=O)C(C)NC(=O)C(CC1=CNC2=CC=CC=C12)NC(=O)C(CCC(N)=O)NC(=O)C(N)CC1=CC=CC=C1)C(C)C | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C48H66N12O10/c1-26(2)18-38(48(69)70-6)59-46(67)37(21-31-23-51-25-54-31)56-40(62)24-53-47(68)41(27(3)4)60-42(63)28(5)55-45(66)36(20-30-22-52-34-15-11-10-14-32(30)34)58-44(65)35(16-17-39(50)61)57-43(64)33(49)19-29-12-8-7-9-13-29/h7-15,22-23,25-28,31,33,35-38,41,52H,16-21,24,49H2,1-6H3,(H2,50,61)(H,53,68)(H,55,66)(H,56,62)(H,57,64)(H,58,65)(H,59,67)(H,60,63) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | ORCBJPDHGBTVHS-UHFFFAOYSA-N | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as peptides. Peptides are compounds containing an amide derived from two or more amino carboxylic acid molecules (the same or different) by formation of a covalent bond from the carbonyl carbon of one to the nitrogen atom of another. | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Organic acids and derivatives | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Carboxylic acids and derivatives | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Amino acids, peptides, and analogues | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Peptides | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aromatic heteropolycyclic compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
NMR Spectra
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | 74786417 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 78401020 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|