Record Information |
---|
Version | 5.0 |
---|
Status | Detected but not Quantified |
---|
Creation Date | 2021-09-11 11:50:21 UTC |
---|
Update Date | 2021-09-26 23:06:35 UTC |
---|
HMDB ID | HMDB0253401 |
---|
Secondary Accession Numbers | None |
---|
Metabolite Identification |
---|
Common Name | Ilomastat |
---|
Description | Ilomastat belongs to the class of organic compounds known as n-acyl-alpha amino acids and derivatives. N-acyl-alpha amino acids and derivatives are compounds containing an alpha amino acid (or a derivative thereof) which bears an acyl group at its terminal nitrogen atom. Based on a literature review very few articles have been published on Ilomastat. This compound has been identified in human blood as reported by (PMID: 31557052 ). Ilomastat is not a naturally occurring metabolite and is only found in those individuals exposed to this compound or its derivatives. Technically Ilomastat is part of the human exposome. The exposome can be defined as the collection of all the exposures of an individual in a lifetime and how those exposures relate to health. An individual's exposure begins before birth and includes insults from environmental and occupational sources. |
---|
Structure | CNC(=O)C(CC1=CNC2=CC=CC=C12)NC(=O)C(CC(C)C)CC(=O)NO InChI=1S/C20H28N4O4/c1-12(2)8-13(10-18(25)24-28)19(26)23-17(20(27)21-3)9-14-11-22-16-7-5-4-6-15(14)16/h4-7,11-13,17,22,28H,8-10H2,1-3H3,(H,21,27)(H,23,26)(H,24,25) |
---|
Synonyms | Not Available |
---|
Chemical Formula | C20H28N4O4 |
---|
Average Molecular Weight | 388.468 |
---|
Monoisotopic Molecular Weight | 388.211055398 |
---|
IUPAC Name | N'-hydroxy-N-[2-(1H-indol-3-yl)-1-(methylcarbamoyl)ethyl]-2-(2-methylpropyl)butanediamide |
---|
Traditional Name | N'-hydroxy-N-[2-(1H-indol-3-yl)-1-(methylcarbamoyl)ethyl]-2-(2-methylpropyl)succinamide |
---|
CAS Registry Number | Not Available |
---|
SMILES | CNC(=O)C(CC1=CNC2=CC=CC=C12)NC(=O)C(CC(C)C)CC(=O)NO |
---|
InChI Identifier | InChI=1S/C20H28N4O4/c1-12(2)8-13(10-18(25)24-28)19(26)23-17(20(27)21-3)9-14-11-22-16-7-5-4-6-15(14)16/h4-7,11-13,17,22,28H,8-10H2,1-3H3,(H,21,27)(H,23,26)(H,24,25) |
---|
InChI Key | NITYDPDXAAFEIT-UHFFFAOYSA-N |
---|
Chemical Taxonomy |
---|
Description | Belongs to the class of organic compounds known as n-acyl-alpha amino acids and derivatives. N-acyl-alpha amino acids and derivatives are compounds containing an alpha amino acid (or a derivative thereof) which bears an acyl group at its terminal nitrogen atom. |
---|
Kingdom | Organic compounds |
---|
Super Class | Organic acids and derivatives |
---|
Class | Carboxylic acids and derivatives |
---|
Sub Class | Amino acids, peptides, and analogues |
---|
Direct Parent | N-acyl-alpha amino acids and derivatives |
---|
Alternative Parents | |
---|
Substituents | - N-acyl-alpha amino acid or derivatives
- Alpha-amino acid amide
- Triptan
- 3-alkylindole
- Indole
- Indole or derivatives
- Fatty amide
- N-acyl-amine
- Substituted pyrrole
- Benzenoid
- Fatty acyl
- Pyrrole
- Heteroaromatic compound
- Secondary carboxylic acid amide
- Hydroxamic acid
- Carboxamide group
- Organoheterocyclic compound
- Azacycle
- Hydrocarbon derivative
- Carbonyl group
- Organooxygen compound
- Organonitrogen compound
- Organic oxide
- Organopnictogen compound
- Organic oxygen compound
- Organic nitrogen compound
- Aromatic heteropolycyclic compound
|
---|
Molecular Framework | Aromatic heteropolycyclic compounds |
---|
External Descriptors | Not Available |
---|
Ontology |
---|
Physiological effect | Not Available |
---|
Disposition | |
---|
Process | Not Available |
---|
Role | Not Available |
---|
Physical Properties |
---|
State | Not Available |
---|
Experimental Molecular Properties | Property | Value | Reference |
---|
Melting Point | Not Available | Not Available | Boiling Point | Not Available | Not Available | Water Solubility | Not Available | Not Available | LogP | Not Available | Not Available |
|
---|
Experimental Chromatographic Properties | Not Available |
---|
Predicted Molecular Properties | |
---|
Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Kovats Retention IndicesUnderivatizedDerivatizedDerivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
---|
Ilomastat,1TMS,isomer #1 | CC(C)CC(CC(=O)NO)C(=O)NC(CC1=C[NH]C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C | 3498.2 | Semi standard non polar | 33892256 | Ilomastat,1TMS,isomer #1 | CC(C)CC(CC(=O)NO)C(=O)NC(CC1=C[NH]C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C | 3270.7 | Standard non polar | 33892256 | Ilomastat,1TMS,isomer #1 | CC(C)CC(CC(=O)NO)C(=O)NC(CC1=C[NH]C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C | 4632.6 | Standard polar | 33892256 | Ilomastat,1TMS,isomer #2 | CNC(=O)C(CC1=CN([Si](C)(C)C)C2=CC=CC=C12)NC(=O)C(CC(=O)NO)CC(C)C | 3386.0 | Semi standard non polar | 33892256 | Ilomastat,1TMS,isomer #2 | CNC(=O)C(CC1=CN([Si](C)(C)C)C2=CC=CC=C12)NC(=O)C(CC(=O)NO)CC(C)C | 3244.4 | Standard non polar | 33892256 | Ilomastat,1TMS,isomer #2 | CNC(=O)C(CC1=CN([Si](C)(C)C)C2=CC=CC=C12)NC(=O)C(CC(=O)NO)CC(C)C | 4708.7 | Standard polar | 33892256 | Ilomastat,1TMS,isomer #3 | CNC(=O)C(CC1=C[NH]C2=CC=CC=C12)N(C(=O)C(CC(=O)NO)CC(C)C)[Si](C)(C)C | 3367.0 | Semi standard non polar | 33892256 | Ilomastat,1TMS,isomer #3 | CNC(=O)C(CC1=C[NH]C2=CC=CC=C12)N(C(=O)C(CC(=O)NO)CC(C)C)[Si](C)(C)C | 3194.6 | Standard non polar | 33892256 | Ilomastat,1TMS,isomer #3 | CNC(=O)C(CC1=C[NH]C2=CC=CC=C12)N(C(=O)C(CC(=O)NO)CC(C)C)[Si](C)(C)C | 4700.0 | Standard polar | 33892256 | Ilomastat,1TMS,isomer #4 | CNC(=O)C(CC1=C[NH]C2=CC=CC=C12)NC(=O)C(CC(=O)N(O)[Si](C)(C)C)CC(C)C | 3334.3 | Semi standard non polar | 33892256 | Ilomastat,1TMS,isomer #4 | CNC(=O)C(CC1=C[NH]C2=CC=CC=C12)NC(=O)C(CC(=O)N(O)[Si](C)(C)C)CC(C)C | 3252.8 | Standard non polar | 33892256 | Ilomastat,1TMS,isomer #4 | CNC(=O)C(CC1=C[NH]C2=CC=CC=C12)NC(=O)C(CC(=O)N(O)[Si](C)(C)C)CC(C)C | 4862.9 | Standard polar | 33892256 | Ilomastat,2TMS,isomer #1 | CC(C)CC(CC(=O)N(O)[Si](C)(C)C)C(=O)NC(CC1=C[NH]C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C | 3407.7 | Semi standard non polar | 33892256 | Ilomastat,2TMS,isomer #1 | CC(C)CC(CC(=O)N(O)[Si](C)(C)C)C(=O)NC(CC1=C[NH]C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C | 3345.2 | Standard non polar | 33892256 | Ilomastat,2TMS,isomer #1 | CC(C)CC(CC(=O)N(O)[Si](C)(C)C)C(=O)NC(CC1=C[NH]C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C | 4416.1 | Standard polar | 33892256 | Ilomastat,2TMS,isomer #2 | CC(C)CC(CC(=O)NO)C(=O)N(C(CC1=C[NH]C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C)[Si](C)(C)C | 3415.3 | Semi standard non polar | 33892256 | Ilomastat,2TMS,isomer #2 | CC(C)CC(CC(=O)NO)C(=O)N(C(CC1=C[NH]C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C)[Si](C)(C)C | 3291.1 | Standard non polar | 33892256 | Ilomastat,2TMS,isomer #2 | CC(C)CC(CC(=O)NO)C(=O)N(C(CC1=C[NH]C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C)[Si](C)(C)C | 4258.9 | Standard polar | 33892256 | Ilomastat,2TMS,isomer #3 | CC(C)CC(CC(=O)NO)C(=O)NC(CC1=CN([Si](C)(C)C)C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C | 3434.8 | Semi standard non polar | 33892256 | Ilomastat,2TMS,isomer #3 | CC(C)CC(CC(=O)NO)C(=O)NC(CC1=CN([Si](C)(C)C)C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C | 3320.2 | Standard non polar | 33892256 | Ilomastat,2TMS,isomer #3 | CC(C)CC(CC(=O)NO)C(=O)NC(CC1=CN([Si](C)(C)C)C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C | 4256.8 | Standard polar | 33892256 | Ilomastat,2TMS,isomer #4 | CNC(=O)C(CC1=CN([Si](C)(C)C)C2=CC=CC=C12)N(C(=O)C(CC(=O)NO)CC(C)C)[Si](C)(C)C | 3323.3 | Semi standard non polar | 33892256 | Ilomastat,2TMS,isomer #4 | CNC(=O)C(CC1=CN([Si](C)(C)C)C2=CC=CC=C12)N(C(=O)C(CC(=O)NO)CC(C)C)[Si](C)(C)C | 3239.7 | Standard non polar | 33892256 | Ilomastat,2TMS,isomer #4 | CNC(=O)C(CC1=CN([Si](C)(C)C)C2=CC=CC=C12)N(C(=O)C(CC(=O)NO)CC(C)C)[Si](C)(C)C | 4297.0 | Standard polar | 33892256 | Ilomastat,2TMS,isomer #5 | CNC(=O)C(CC1=CN([Si](C)(C)C)C2=CC=CC=C12)NC(=O)C(CC(=O)N(O)[Si](C)(C)C)CC(C)C | 3293.9 | Semi standard non polar | 33892256 | Ilomastat,2TMS,isomer #5 | CNC(=O)C(CC1=CN([Si](C)(C)C)C2=CC=CC=C12)NC(=O)C(CC(=O)N(O)[Si](C)(C)C)CC(C)C | 3297.1 | Standard non polar | 33892256 | Ilomastat,2TMS,isomer #5 | CNC(=O)C(CC1=CN([Si](C)(C)C)C2=CC=CC=C12)NC(=O)C(CC(=O)N(O)[Si](C)(C)C)CC(C)C | 4470.0 | Standard polar | 33892256 | Ilomastat,2TMS,isomer #6 | CNC(=O)C(CC1=C[NH]C2=CC=CC=C12)N(C(=O)C(CC(=O)N(O)[Si](C)(C)C)CC(C)C)[Si](C)(C)C | 3310.5 | Semi standard non polar | 33892256 | Ilomastat,2TMS,isomer #6 | CNC(=O)C(CC1=C[NH]C2=CC=CC=C12)N(C(=O)C(CC(=O)N(O)[Si](C)(C)C)CC(C)C)[Si](C)(C)C | 3283.0 | Standard non polar | 33892256 | Ilomastat,2TMS,isomer #6 | CNC(=O)C(CC1=C[NH]C2=CC=CC=C12)N(C(=O)C(CC(=O)N(O)[Si](C)(C)C)CC(C)C)[Si](C)(C)C | 4456.7 | Standard polar | 33892256 | Ilomastat,3TMS,isomer #1 | CC(C)CC(CC(=O)N(O)[Si](C)(C)C)C(=O)N(C(CC1=C[NH]C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C)[Si](C)(C)C | 3384.0 | Semi standard non polar | 33892256 | Ilomastat,3TMS,isomer #1 | CC(C)CC(CC(=O)N(O)[Si](C)(C)C)C(=O)N(C(CC1=C[NH]C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C)[Si](C)(C)C | 3370.9 | Standard non polar | 33892256 | Ilomastat,3TMS,isomer #1 | CC(C)CC(CC(=O)N(O)[Si](C)(C)C)C(=O)N(C(CC1=C[NH]C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C)[Si](C)(C)C | 4151.5 | Standard polar | 33892256 | Ilomastat,3TMS,isomer #2 | CC(C)CC(CC(=O)N(O)[Si](C)(C)C)C(=O)NC(CC1=CN([Si](C)(C)C)C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C | 3355.4 | Semi standard non polar | 33892256 | Ilomastat,3TMS,isomer #2 | CC(C)CC(CC(=O)N(O)[Si](C)(C)C)C(=O)NC(CC1=CN([Si](C)(C)C)C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C | 3375.2 | Standard non polar | 33892256 | Ilomastat,3TMS,isomer #2 | CC(C)CC(CC(=O)N(O)[Si](C)(C)C)C(=O)NC(CC1=CN([Si](C)(C)C)C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C | 4159.5 | Standard polar | 33892256 | Ilomastat,3TMS,isomer #3 | CC(C)CC(CC(=O)NO)C(=O)N(C(CC1=CN([Si](C)(C)C)C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C)[Si](C)(C)C | 3385.2 | Semi standard non polar | 33892256 | Ilomastat,3TMS,isomer #3 | CC(C)CC(CC(=O)NO)C(=O)N(C(CC1=CN([Si](C)(C)C)C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C)[Si](C)(C)C | 3330.7 | Standard non polar | 33892256 | Ilomastat,3TMS,isomer #3 | CC(C)CC(CC(=O)NO)C(=O)N(C(CC1=CN([Si](C)(C)C)C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C)[Si](C)(C)C | 4002.0 | Standard polar | 33892256 | Ilomastat,3TMS,isomer #4 | CNC(=O)C(CC1=CN([Si](C)(C)C)C2=CC=CC=C12)N(C(=O)C(CC(=O)N(O)[Si](C)(C)C)CC(C)C)[Si](C)(C)C | 3287.2 | Semi standard non polar | 33892256 | Ilomastat,3TMS,isomer #4 | CNC(=O)C(CC1=CN([Si](C)(C)C)C2=CC=CC=C12)N(C(=O)C(CC(=O)N(O)[Si](C)(C)C)CC(C)C)[Si](C)(C)C | 3317.9 | Standard non polar | 33892256 | Ilomastat,3TMS,isomer #4 | CNC(=O)C(CC1=CN([Si](C)(C)C)C2=CC=CC=C12)N(C(=O)C(CC(=O)N(O)[Si](C)(C)C)CC(C)C)[Si](C)(C)C | 4185.6 | Standard polar | 33892256 | Ilomastat,4TMS,isomer #1 | CC(C)CC(CC(=O)N(O)[Si](C)(C)C)C(=O)N(C(CC1=CN([Si](C)(C)C)C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C)[Si](C)(C)C | 3376.1 | Semi standard non polar | 33892256 | Ilomastat,4TMS,isomer #1 | CC(C)CC(CC(=O)N(O)[Si](C)(C)C)C(=O)N(C(CC1=CN([Si](C)(C)C)C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C)[Si](C)(C)C | 3422.6 | Standard non polar | 33892256 | Ilomastat,4TMS,isomer #1 | CC(C)CC(CC(=O)N(O)[Si](C)(C)C)C(=O)N(C(CC1=CN([Si](C)(C)C)C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C)[Si](C)(C)C | 3976.0 | Standard polar | 33892256 | Ilomastat,1TBDMS,isomer #1 | CC(C)CC(CC(=O)NO)C(=O)NC(CC1=C[NH]C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C(C)(C)C | 3759.8 | Semi standard non polar | 33892256 | Ilomastat,1TBDMS,isomer #1 | CC(C)CC(CC(=O)NO)C(=O)NC(CC1=C[NH]C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C(C)(C)C | 3472.3 | Standard non polar | 33892256 | Ilomastat,1TBDMS,isomer #1 | CC(C)CC(CC(=O)NO)C(=O)NC(CC1=C[NH]C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C(C)(C)C | 4624.1 | Standard polar | 33892256 | Ilomastat,1TBDMS,isomer #2 | CNC(=O)C(CC1=CN([Si](C)(C)C(C)(C)C)C2=CC=CC=C12)NC(=O)C(CC(=O)NO)CC(C)C | 3603.5 | Semi standard non polar | 33892256 | Ilomastat,1TBDMS,isomer #2 | CNC(=O)C(CC1=CN([Si](C)(C)C(C)(C)C)C2=CC=CC=C12)NC(=O)C(CC(=O)NO)CC(C)C | 3423.6 | Standard non polar | 33892256 | Ilomastat,1TBDMS,isomer #2 | CNC(=O)C(CC1=CN([Si](C)(C)C(C)(C)C)C2=CC=CC=C12)NC(=O)C(CC(=O)NO)CC(C)C | 4664.6 | Standard polar | 33892256 | Ilomastat,1TBDMS,isomer #3 | CNC(=O)C(CC1=C[NH]C2=CC=CC=C12)N(C(=O)C(CC(=O)NO)CC(C)C)[Si](C)(C)C(C)(C)C | 3638.7 | Semi standard non polar | 33892256 | Ilomastat,1TBDMS,isomer #3 | CNC(=O)C(CC1=C[NH]C2=CC=CC=C12)N(C(=O)C(CC(=O)NO)CC(C)C)[Si](C)(C)C(C)(C)C | 3414.5 | Standard non polar | 33892256 | Ilomastat,1TBDMS,isomer #3 | CNC(=O)C(CC1=C[NH]C2=CC=CC=C12)N(C(=O)C(CC(=O)NO)CC(C)C)[Si](C)(C)C(C)(C)C | 4629.7 | Standard polar | 33892256 | Ilomastat,1TBDMS,isomer #4 | CNC(=O)C(CC1=C[NH]C2=CC=CC=C12)NC(=O)C(CC(=O)N(O)[Si](C)(C)C(C)(C)C)CC(C)C | 3611.0 | Semi standard non polar | 33892256 | Ilomastat,1TBDMS,isomer #4 | CNC(=O)C(CC1=C[NH]C2=CC=CC=C12)NC(=O)C(CC(=O)N(O)[Si](C)(C)C(C)(C)C)CC(C)C | 3457.7 | Standard non polar | 33892256 | Ilomastat,1TBDMS,isomer #4 | CNC(=O)C(CC1=C[NH]C2=CC=CC=C12)NC(=O)C(CC(=O)N(O)[Si](C)(C)C(C)(C)C)CC(C)C | 4763.2 | Standard polar | 33892256 | Ilomastat,2TBDMS,isomer #1 | CC(C)CC(CC(=O)N(O)[Si](C)(C)C(C)(C)C)C(=O)NC(CC1=C[NH]C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C(C)(C)C | 3928.4 | Semi standard non polar | 33892256 | Ilomastat,2TBDMS,isomer #1 | CC(C)CC(CC(=O)N(O)[Si](C)(C)C(C)(C)C)C(=O)NC(CC1=C[NH]C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C(C)(C)C | 3719.7 | Standard non polar | 33892256 | Ilomastat,2TBDMS,isomer #1 | CC(C)CC(CC(=O)N(O)[Si](C)(C)C(C)(C)C)C(=O)NC(CC1=C[NH]C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C(C)(C)C | 4447.1 | Standard polar | 33892256 | Ilomastat,2TBDMS,isomer #2 | CC(C)CC(CC(=O)NO)C(=O)N(C(CC1=C[NH]C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3974.7 | Semi standard non polar | 33892256 | Ilomastat,2TBDMS,isomer #2 | CC(C)CC(CC(=O)NO)C(=O)N(C(CC1=C[NH]C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3689.9 | Standard non polar | 33892256 | Ilomastat,2TBDMS,isomer #2 | CC(C)CC(CC(=O)NO)C(=O)N(C(CC1=C[NH]C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4323.9 | Standard polar | 33892256 | Ilomastat,2TBDMS,isomer #3 | CC(C)CC(CC(=O)NO)C(=O)NC(CC1=CN([Si](C)(C)C(C)(C)C)C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C(C)(C)C | 3916.7 | Semi standard non polar | 33892256 | Ilomastat,2TBDMS,isomer #3 | CC(C)CC(CC(=O)NO)C(=O)NC(CC1=CN([Si](C)(C)C(C)(C)C)C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C(C)(C)C | 3678.9 | Standard non polar | 33892256 | Ilomastat,2TBDMS,isomer #3 | CC(C)CC(CC(=O)NO)C(=O)NC(CC1=CN([Si](C)(C)C(C)(C)C)C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C(C)(C)C | 4315.6 | Standard polar | 33892256 | Ilomastat,2TBDMS,isomer #4 | CNC(=O)C(CC1=CN([Si](C)(C)C(C)(C)C)C2=CC=CC=C12)N(C(=O)C(CC(=O)NO)CC(C)C)[Si](C)(C)C(C)(C)C | 3784.2 | Semi standard non polar | 33892256 | Ilomastat,2TBDMS,isomer #4 | CNC(=O)C(CC1=CN([Si](C)(C)C(C)(C)C)C2=CC=CC=C12)N(C(=O)C(CC(=O)NO)CC(C)C)[Si](C)(C)C(C)(C)C | 3617.1 | Standard non polar | 33892256 | Ilomastat,2TBDMS,isomer #4 | CNC(=O)C(CC1=CN([Si](C)(C)C(C)(C)C)C2=CC=CC=C12)N(C(=O)C(CC(=O)NO)CC(C)C)[Si](C)(C)C(C)(C)C | 4312.6 | Standard polar | 33892256 | Ilomastat,2TBDMS,isomer #5 | CNC(=O)C(CC1=CN([Si](C)(C)C(C)(C)C)C2=CC=CC=C12)NC(=O)C(CC(=O)N(O)[Si](C)(C)C(C)(C)C)CC(C)C | 3762.8 | Semi standard non polar | 33892256 | Ilomastat,2TBDMS,isomer #5 | CNC(=O)C(CC1=CN([Si](C)(C)C(C)(C)C)C2=CC=CC=C12)NC(=O)C(CC(=O)N(O)[Si](C)(C)C(C)(C)C)CC(C)C | 3644.8 | Standard non polar | 33892256 | Ilomastat,2TBDMS,isomer #5 | CNC(=O)C(CC1=CN([Si](C)(C)C(C)(C)C)C2=CC=CC=C12)NC(=O)C(CC(=O)N(O)[Si](C)(C)C(C)(C)C)CC(C)C | 4460.5 | Standard polar | 33892256 | Ilomastat,2TBDMS,isomer #6 | CNC(=O)C(CC1=C[NH]C2=CC=CC=C12)N(C(=O)C(CC(=O)N(O)[Si](C)(C)C(C)(C)C)CC(C)C)[Si](C)(C)C(C)(C)C | 3819.3 | Semi standard non polar | 33892256 | Ilomastat,2TBDMS,isomer #6 | CNC(=O)C(CC1=C[NH]C2=CC=CC=C12)N(C(=O)C(CC(=O)N(O)[Si](C)(C)C(C)(C)C)CC(C)C)[Si](C)(C)C(C)(C)C | 3668.6 | Standard non polar | 33892256 | Ilomastat,2TBDMS,isomer #6 | CNC(=O)C(CC1=C[NH]C2=CC=CC=C12)N(C(=O)C(CC(=O)N(O)[Si](C)(C)C(C)(C)C)CC(C)C)[Si](C)(C)C(C)(C)C | 4441.8 | Standard polar | 33892256 | Ilomastat,3TBDMS,isomer #1 | CC(C)CC(CC(=O)N(O)[Si](C)(C)C(C)(C)C)C(=O)N(C(CC1=C[NH]C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4126.5 | Semi standard non polar | 33892256 | Ilomastat,3TBDMS,isomer #1 | CC(C)CC(CC(=O)N(O)[Si](C)(C)C(C)(C)C)C(=O)N(C(CC1=C[NH]C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3923.1 | Standard non polar | 33892256 | Ilomastat,3TBDMS,isomer #1 | CC(C)CC(CC(=O)N(O)[Si](C)(C)C(C)(C)C)C(=O)N(C(CC1=C[NH]C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4282.2 | Standard polar | 33892256 | Ilomastat,3TBDMS,isomer #2 | CC(C)CC(CC(=O)N(O)[Si](C)(C)C(C)(C)C)C(=O)NC(CC1=CN([Si](C)(C)C(C)(C)C)C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C(C)(C)C | 4061.0 | Semi standard non polar | 33892256 | Ilomastat,3TBDMS,isomer #2 | CC(C)CC(CC(=O)N(O)[Si](C)(C)C(C)(C)C)C(=O)NC(CC1=CN([Si](C)(C)C(C)(C)C)C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C(C)(C)C | 3889.0 | Standard non polar | 33892256 | Ilomastat,3TBDMS,isomer #2 | CC(C)CC(CC(=O)N(O)[Si](C)(C)C(C)(C)C)C(=O)NC(CC1=CN([Si](C)(C)C(C)(C)C)C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C(C)(C)C | 4279.2 | Standard polar | 33892256 | Ilomastat,3TBDMS,isomer #3 | CC(C)CC(CC(=O)NO)C(=O)N(C(CC1=CN([Si](C)(C)C(C)(C)C)C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4094.8 | Semi standard non polar | 33892256 | Ilomastat,3TBDMS,isomer #3 | CC(C)CC(CC(=O)NO)C(=O)N(C(CC1=CN([Si](C)(C)C(C)(C)C)C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 3873.3 | Standard non polar | 33892256 | Ilomastat,3TBDMS,isomer #3 | CC(C)CC(CC(=O)NO)C(=O)N(C(CC1=CN([Si](C)(C)C(C)(C)C)C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4146.0 | Standard polar | 33892256 | Ilomastat,3TBDMS,isomer #4 | CNC(=O)C(CC1=CN([Si](C)(C)C(C)(C)C)C2=CC=CC=C12)N(C(=O)C(CC(=O)N(O)[Si](C)(C)C(C)(C)C)CC(C)C)[Si](C)(C)C(C)(C)C | 3973.8 | Semi standard non polar | 33892256 | Ilomastat,3TBDMS,isomer #4 | CNC(=O)C(CC1=CN([Si](C)(C)C(C)(C)C)C2=CC=CC=C12)N(C(=O)C(CC(=O)N(O)[Si](C)(C)C(C)(C)C)CC(C)C)[Si](C)(C)C(C)(C)C | 3842.4 | Standard non polar | 33892256 | Ilomastat,3TBDMS,isomer #4 | CNC(=O)C(CC1=CN([Si](C)(C)C(C)(C)C)C2=CC=CC=C12)N(C(=O)C(CC(=O)N(O)[Si](C)(C)C(C)(C)C)CC(C)C)[Si](C)(C)C(C)(C)C | 4271.4 | Standard polar | 33892256 | Ilomastat,4TBDMS,isomer #1 | CC(C)CC(CC(=O)N(O)[Si](C)(C)C(C)(C)C)C(=O)N(C(CC1=CN([Si](C)(C)C(C)(C)C)C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4246.1 | Semi standard non polar | 33892256 | Ilomastat,4TBDMS,isomer #1 | CC(C)CC(CC(=O)N(O)[Si](C)(C)C(C)(C)C)C(=O)N(C(CC1=CN([Si](C)(C)C(C)(C)C)C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4084.0 | Standard non polar | 33892256 | Ilomastat,4TBDMS,isomer #1 | CC(C)CC(CC(=O)N(O)[Si](C)(C)C(C)(C)C)C(=O)N(C(CC1=CN([Si](C)(C)C(C)(C)C)C2=CC=CC=C12)C(=O)N(C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 4154.8 | Standard polar | 33892256 |
|
---|