Showing metabocard for HGluValLeuPnsAspAlaGluPheOH (HMDB0253807)
Record Information | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Detected but not Quantified | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2021-09-11 12:40:04 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2021-09-26 23:07:16 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0253807 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | HGluValLeuPnsAspAlaGluPheOH | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | 4-amino-4-[(1-{[1-({1-[(2-carboxy-1-{[1-({3-carboxy-1-[(1-carboxy-2-phenylethyl)-C-hydroxycarbonimidoyl]propyl}-C-hydroxycarbonimidoyl)ethyl]-C-hydroxycarbonimidoyl}ethyl)-C-hydroxycarbonimidoyl]-1-hydroxy-3-phenylpropan-2-yl}-C-hydroxycarbonimidoyl)-3-methylbutyl]-C-hydroxycarbonimidoyl}-2-methylpropyl)-C-hydroxycarbonimidoyl]butanoic acid belongs to the class of organic compounds known as peptides. Peptides are compounds containing an amide derived from two or more amino carboxylic acid molecules (the same or different) by formation of a covalent bond from the carbonyl carbon of one to the nitrogen atom of another. Based on a literature review very few articles have been published on 4-amino-4-[(1-{[1-({1-[(2-carboxy-1-{[1-({3-carboxy-1-[(1-carboxy-2-phenylethyl)-C-hydroxycarbonimidoyl]propyl}-C-hydroxycarbonimidoyl)ethyl]-C-hydroxycarbonimidoyl}ethyl)-C-hydroxycarbonimidoyl]-1-hydroxy-3-phenylpropan-2-yl}-C-hydroxycarbonimidoyl)-3-methylbutyl]-C-hydroxycarbonimidoyl}-2-methylpropyl)-C-hydroxycarbonimidoyl]butanoic acid. This compound has been identified in human blood as reported by (PMID: 31557052 ). Hgluvalleupnsaspalaglupheoh is not a naturally occurring metabolite and is only found in those individuals exposed to this compound or its derivatives. Technically HGluValLeuPnsAspAlaGluPheOH is part of the human exposome. The exposome can be defined as the collection of all the exposures of an individual in a lifetime and how those exposures relate to health. An individual's exposure begins before birth and includes insults from environmental and occupational sources. | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0253807 (HGluValLeuPnsAspAlaGluPheOH)Mrv1652309112114402D 71 72 0 0 0 0 999 V2000 10.7171 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7171 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4315 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4315 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7171 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2020 -1.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 -0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 9.2881 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2881 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7171 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4315 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4315 -3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7171 -3.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 -3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5737 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 -2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 -0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -3.3000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -1.2375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 -2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 -0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 -3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 -3.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 -3.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 -1.2375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1434 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1434 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 -2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5737 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.1460 -1.2375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 12.8605 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8605 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.5749 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.5749 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.2894 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8605 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.2894 -0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 15.0039 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.0039 -2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 15.7184 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.4328 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.1473 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.8618 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.5762 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 17.8618 -2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 15.7184 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 2 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 2 0 0 0 0 6 8 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 2 0 0 0 0 12 13 1 0 0 0 0 13 14 2 0 0 0 0 14 15 1 0 0 0 0 15 16 2 0 0 0 0 11 16 1 0 0 0 0 9 17 1 0 0 0 0 17 18 1 0 0 0 0 18 19 2 0 0 0 0 18 20 1 0 0 0 0 20 21 1 0 0 0 0 21 22 1 0 0 0 0 22 23 1 0 0 0 0 23 24 2 0 0 0 0 23 25 1 0 0 0 0 21 26 1 0 0 0 0 26 27 2 0 0 0 0 26 28 1 0 0 0 0 28 29 1 0 0 0 0 29 30 1 0 0 0 0 29 31 1 0 0 0 0 31 32 2 0 0 0 0 31 33 1 0 0 0 0 33 34 1 0 0 0 0 34 35 1 0 0 0 0 35 36 1 0 0 0 0 36 37 1 0 0 0 0 37 38 2 0 0 0 0 37 39 1 0 0 0 0 34 40 1 0 0 0 0 40 41 2 0 0 0 0 40 42 1 0 0 0 0 42 43 1 0 0 0 0 43 44 1 0 0 0 0 44 45 1 0 0 0 0 45 46 2 0 0 0 0 46 47 1 0 0 0 0 47 48 2 0 0 0 0 48 49 1 0 0 0 0 49 50 2 0 0 0 0 45 50 1 0 0 0 0 43 51 1 0 0 0 0 51 52 2 0 0 0 0 51 53 1 0 0 0 0 17 54 1 0 0 0 0 5 55 1 0 0 0 0 55 56 1 0 0 0 0 56 57 2 0 0 0 0 56 58 1 0 0 0 0 58 59 1 0 0 0 0 59 60 1 0 0 0 0 59 61 1 0 0 0 0 58 62 1 0 0 0 0 62 63 1 0 0 0 0 63 64 2 0 0 0 0 63 65 1 0 0 0 0 65 66 1 0 0 0 0 66 67 1 0 0 0 0 67 68 1 0 0 0 0 68 69 2 0 0 0 0 68 70 1 0 0 0 0 65 71 1 0 0 0 0 M END 3D MOL for HMDB0253807 (HGluValLeuPnsAspAlaGluPheOH)HMDB0253807 RDKit 3D HGluValLeuPnsAspAlaGluPheOH 137138 0 0 0 0 0 0 0 0999 V2000 -5.4699 1.1918 2.0726 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3735 1.2410 1.0551 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9567 2.7515 1.0709 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7684 0.9956 -0.3410 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4084 -0.2429 -0.7779 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7124 -0.5887 -0.2059 N 0 0 0 0 0 0 0 0 0 0 0 0 -7.8959 -0.1777 -0.8178 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7211 0.5421 -1.8888 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2570 -0.4782 -0.3746 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1056 0.6100 -0.8472 N 0 0 0 0 0 0 0 0 0 0 0 0 -11.2248 0.4776 -1.6863 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.5724 -0.6477 -2.0935 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.9991 1.6734 -2.0934 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.1540 1.2244 -2.8817 N 0 0 0 0 0 0 0 0 0 0 0 0 -12.4751 2.4599 -0.9104 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.2305 3.6998 -1.2810 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.4334 3.4326 -2.0826 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.4743 3.4585 -3.3455 O 0 0 0 0 0 0 0 0 0 0 0 0 -15.6217 3.1298 -1.3925 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3861 -0.7274 1.0710 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9867 0.4133 1.9732 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.7623 -1.2489 1.4592 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5440 -1.3992 -1.0167 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1098 -2.5104 -1.3373 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1402 -1.4182 -0.9320 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.3877 -2.6232 -1.2311 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0809 -3.3439 0.1009 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3147 -3.7406 0.8118 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7950 -5.0290 0.6011 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9551 -5.4269 1.2417 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6178 -4.5347 2.0759 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1438 -3.2458 2.2877 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9823 -2.8918 1.6334 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1189 -2.4006 -1.9733 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6408 -3.6918 -2.3510 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0036 -1.8432 -1.0515 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2304 -0.8640 -0.3280 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2390 -2.4877 -1.0772 N 0 0 0 0 0 0 0 0 0 0 0 0 2.4514 -2.2935 -0.3671 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1358 -3.6376 -0.2161 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2439 -4.5265 0.5568 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2718 -5.0786 0.0471 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5482 -4.7137 1.8926 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4325 -1.3474 -1.0948 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9379 -0.7972 -2.0905 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6696 -1.2241 -0.5850 N 0 0 0 0 0 0 0 0 0 0 0 0 5.9386 -1.0835 -0.0801 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2695 -2.0791 1.0551 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4707 0.2354 0.4063 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7748 1.2168 0.5983 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8730 0.1699 0.6035 N 0 0 0 0 0 0 0 0 0 0 0 0 8.9313 0.9545 1.0420 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4516 2.4507 0.7430 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6108 3.3319 1.1930 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2563 4.7423 0.9731 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1436 5.0463 0.5044 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1663 5.7330 1.2894 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1254 0.8827 0.1152 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8182 1.1487 -1.1049 O 0 0 0 0 0 0 0 0 0 0 0 0 11.4317 0.5602 0.4825 N 0 0 0 0 0 0 0 0 0 0 0 0 12.7054 0.2643 0.7581 C 0 0 0 0 0 0 0 0 0 0 0 0 13.7516 1.2419 1.1399 C 0 0 0 0 0 0 0 0 0 0 0 0 14.0235 2.3188 0.2024 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3819 3.5250 0.4134 C 0 0 0 0 0 0 0 0 0 0 0 0 13.5436 4.6249 -0.3982 C 0 0 0 0 0 0 0 0 0 0 0 0 14.4093 4.5070 -1.4945 C 0 0 0 0 0 0 0 0 0 0 0 0 15.0400 3.3065 -1.6898 C 0 0 0 0 0 0 0 0 0 0 0 0 14.8628 2.2184 -0.8660 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3261 -0.5956 -0.3647 C 0 0 0 0 0 0 0 0 0 0 0 0 12.6263 -0.8455 -1.3812 O 0 0 0 0 0 0 0 0 0 0 0 0 14.5987 -1.0920 -0.2816 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3928 1.5464 1.5373 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3419 1.9103 2.8958 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7024 0.1610 2.3864 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4420 0.7477 1.4094 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6769 3.0868 2.0590 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9270 3.2581 0.7859 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2746 2.9647 0.2384 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3746 1.8646 -0.7332 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8130 1.1019 -0.9639 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7459 0.0265 -1.8818 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7835 -1.1548 0.6804 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5730 -1.4294 -0.9145 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8283 1.5590 -0.5128 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4360 2.3364 -2.7670 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.4526 0.2527 -2.6205 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9407 1.2652 -3.9005 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5704 2.7741 -0.3219 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0764 1.8465 -0.2019 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.4956 4.2690 -0.3615 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5074 4.3447 -1.8651 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.3527 2.5731 -1.8333 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6696 -1.5752 1.3231 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0620 0.1764 2.5451 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7688 0.5565 2.7836 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8071 1.3463 1.4312 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0953 -0.7041 2.3502 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5115 -1.0516 0.6586 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7486 -2.3420 1.5772 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6229 -0.5665 -0.6540 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0420 -3.3239 -1.7707 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4633 -2.6718 0.7348 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4823 -4.2452 -0.0735 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3072 -5.7294 -0.0300 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3765 -6.4289 1.1063 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5235 -4.8212 2.5862 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6601 -2.5349 2.9469 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5805 -1.8942 1.7691 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1375 -1.7837 -2.8532 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1386 -3.6914 -3.1730 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2912 -3.3129 -1.8037 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2376 -1.8242 0.6095 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1536 -3.6100 0.1263 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2055 -4.0405 -1.2885 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0422 -5.4193 2.4062 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0065 -0.2666 -1.5376 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7363 -1.3266 -0.8910 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3842 -2.2077 1.6682 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0624 -1.6859 1.7219 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5747 -3.0156 0.5785 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2504 -0.8547 0.3257 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0891 1.0291 2.0904 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3448 2.5536 -0.3409 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5382 2.5680 1.2783 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8984 3.0825 2.2499 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5068 3.1194 0.5480 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9882 6.5296 1.8967 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8250 0.9911 -0.7755 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6964 -0.5986 1.5781 H 0 0 0 0 0 0 0 0 0 0 0 0 13.5203 1.5969 2.1974 H 0 0 0 0 0 0 0 0 0 0 0 0 14.7570 0.7240 1.3071 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7105 3.6443 1.2546 H 0 0 0 0 0 0 0 0 0 0 0 0 13.0280 5.5730 -0.2155 H 0 0 0 0 0 0 0 0 0 0 0 0 14.5323 5.3771 -2.1380 H 0 0 0 0 0 0 0 0 0 0 0 0 15.7196 3.1828 -2.5482 H 0 0 0 0 0 0 0 0 0 0 0 0 15.3901 1.3183 -1.0762 H 0 0 0 0 0 0 0 0 0 0 0 0 14.8089 -2.0505 -0.5938 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 2 0 7 9 1 0 9 10 1 0 10 11 1 0 11 12 2 0 11 13 1 0 13 14 1 0 13 15 1 0 15 16 1 0 16 17 1 0 17 18 2 0 17 19 1 0 9 20 1 0 20 21 1 0 20 22 1 0 5 23 1 0 23 24 2 0 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 2 0 29 30 1 0 30 31 2 0 31 32 1 0 32 33 2 0 26 34 1 0 34 35 1 0 34 36 1 0 36 37 2 0 36 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 2 0 41 43 1 0 39 44 1 0 44 45 2 0 44 46 1 0 46 47 1 0 47 48 1 0 47 49 1 0 49 50 2 0 49 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 2 0 55 57 1 0 52 58 1 0 58 59 2 0 58 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 2 0 64 65 1 0 65 66 2 0 66 67 1 0 67 68 2 0 61 69 1 0 69 70 2 0 69 71 1 0 33 28 1 0 68 63 1 0 1 72 1 0 1 73 1 0 1 74 1 0 2 75 1 0 3 76 1 0 3 77 1 0 3 78 1 0 4 79 1 0 4 80 1 0 5 81 1 0 6 82 1 0 9 83 1 0 10 84 1 0 13 85 1 0 14 86 1 0 14 87 1 0 15 88 1 0 15 89 1 0 16 90 1 0 16 91 1 0 19 92 1 0 20 93 1 0 21 94 1 0 21 95 1 0 21 96 1 0 22 97 1 0 22 98 1 0 22 99 1 0 25100 1 0 26101 1 0 27102 1 0 27103 1 0 29104 1 0 30105 1 0 31106 1 0 32107 1 0 33108 1 0 34109 1 0 35110 1 0 38111 1 0 39112 1 0 40113 1 0 40114 1 0 43115 1 0 46116 1 0 47117 1 0 48118 1 0 48119 1 0 48120 1 0 51121 1 0 52122 1 0 53123 1 0 53124 1 0 54125 1 0 54126 1 0 57127 1 0 60128 1 0 61129 1 0 62130 1 0 62131 1 0 64132 1 0 65133 1 0 66134 1 0 67135 1 0 68136 1 0 71137 1 0 M END 3D SDF for HMDB0253807 (HGluValLeuPnsAspAlaGluPheOH)Mrv1652309112114402D 71 72 0 0 0 0 999 V2000 10.7171 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7171 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4315 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4315 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7171 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2020 -1.9049 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 -0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 9.2881 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2881 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7171 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4315 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.4315 -3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7171 -3.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 -3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5737 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 -2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 -0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -3.3000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -1.2375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 -2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 -0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 -3.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 -3.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 -3.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7145 -1.2375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 -0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1434 0.4125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1434 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7145 -2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.4289 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5737 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.1460 -1.2375 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 12.8605 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8605 -0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.5749 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.5749 -2.0625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.2894 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8605 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.2894 -0.8250 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 15.0039 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.0039 -2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 15.7184 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.4328 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.1473 -0.8250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.8618 -1.2375 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.5762 -0.8250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 17.8618 -2.0625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 15.7184 -0.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 2 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 2 0 0 0 0 6 8 1 0 0 0 0 8 9 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 2 0 0 0 0 12 13 1 0 0 0 0 13 14 2 0 0 0 0 14 15 1 0 0 0 0 15 16 2 0 0 0 0 11 16 1 0 0 0 0 9 17 1 0 0 0 0 17 18 1 0 0 0 0 18 19 2 0 0 0 0 18 20 1 0 0 0 0 20 21 1 0 0 0 0 21 22 1 0 0 0 0 22 23 1 0 0 0 0 23 24 2 0 0 0 0 23 25 1 0 0 0 0 21 26 1 0 0 0 0 26 27 2 0 0 0 0 26 28 1 0 0 0 0 28 29 1 0 0 0 0 29 30 1 0 0 0 0 29 31 1 0 0 0 0 31 32 2 0 0 0 0 31 33 1 0 0 0 0 33 34 1 0 0 0 0 34 35 1 0 0 0 0 35 36 1 0 0 0 0 36 37 1 0 0 0 0 37 38 2 0 0 0 0 37 39 1 0 0 0 0 34 40 1 0 0 0 0 40 41 2 0 0 0 0 40 42 1 0 0 0 0 42 43 1 0 0 0 0 43 44 1 0 0 0 0 44 45 1 0 0 0 0 45 46 2 0 0 0 0 46 47 1 0 0 0 0 47 48 2 0 0 0 0 48 49 1 0 0 0 0 49 50 2 0 0 0 0 45 50 1 0 0 0 0 43 51 1 0 0 0 0 51 52 2 0 0 0 0 51 53 1 0 0 0 0 17 54 1 0 0 0 0 5 55 1 0 0 0 0 55 56 1 0 0 0 0 56 57 2 0 0 0 0 56 58 1 0 0 0 0 58 59 1 0 0 0 0 59 60 1 0 0 0 0 59 61 1 0 0 0 0 58 62 1 0 0 0 0 62 63 1 0 0 0 0 63 64 2 0 0 0 0 63 65 1 0 0 0 0 65 66 1 0 0 0 0 66 67 1 0 0 0 0 67 68 1 0 0 0 0 68 69 2 0 0 0 0 68 70 1 0 0 0 0 65 71 1 0 0 0 0 M END > <DATABASE_ID> HMDB0253807 > <DATABASE_NAME> hmdb > <SMILES> CC(C)CC(NC(=O)C(NC(=O)C(N)CCC(O)=O)C(C)C)C(=O)NC(CC1=CC=CC=C1)C(O)C(=O)NC(CC(O)=O)C(=O)NC(C)C(=O)NC(CCC(O)=O)C(=O)NC(CC1=CC=CC=C1)C(O)=O > <INCHI_IDENTIFIER> InChI=1S/C47H66N8O16/c1-24(2)20-32(52-45(68)38(25(3)4)55-41(64)29(48)16-18-35(56)57)44(67)51-31(21-27-12-8-6-9-13-27)39(62)46(69)53-33(23-37(60)61)43(66)49-26(5)40(63)50-30(17-19-36(58)59)42(65)54-34(47(70)71)22-28-14-10-7-11-15-28/h6-15,24-26,29-34,38-39,62H,16-23,48H2,1-5H3,(H,49,66)(H,50,63)(H,51,67)(H,52,68)(H,53,69)(H,54,65)(H,55,64)(H,56,57)(H,58,59)(H,60,61)(H,70,71) > <INCHI_KEY> XZLFSKMZGRMIHM-UHFFFAOYSA-N > <FORMULA> C47H66N8O16 > <MOLECULAR_WEIGHT> 999.085 > <EXACT_MASS> 998.459678077 > <JCHEM_ACCEPTOR_COUNT> 17 > <JCHEM_ATOM_COUNT> 137 > <JCHEM_AVERAGE_POLARIZABILITY> 100.72042818981629 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 13 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 4-amino-4-[(1-{[1-({1-[(2-carboxy-1-{[1-({3-carboxy-1-[(1-carboxy-2-phenylethyl)carbamoyl]propyl}carbamoyl)ethyl]carbamoyl}ethyl)carbamoyl]-1-hydroxy-3-phenylpropan-2-yl}carbamoyl)-3-methylbutyl]carbamoyl}-2-methylpropyl)carbamoyl]butanoic acid > <ALOGPS_LOGP> -0.63 > <JCHEM_LOGP> -3.4364275675466125 > <ALOGPS_LOGS> -4.74 > <JCHEM_MDDR_LIKE_RULE> 0 > <JCHEM_NUMBER_OF_RINGS> 2 > <JCHEM_PHYSIOLOGICAL_CHARGE> -3 > <JCHEM_PKA> 3.505440109886959 > <JCHEM_PKA_STRONGEST_ACIDIC> 3.042748757528368 > <JCHEM_PKA_STRONGEST_BASIC> 8.148914575786685 > <JCHEM_POLAR_SURFACE_AREA> 399.1499999999999 > <JCHEM_REFRACTIVITY> 247.06500000000017 > <JCHEM_ROTATABLE_BOND_COUNT> 31 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 1.81e-02 g/l > <JCHEM_TRADITIONAL_IUPAC> 4-amino-4-[(1-{[1-({1-[(2-carboxy-1-{[1-({3-carboxy-1-[(1-carboxy-2-phenylethyl)carbamoyl]propyl}carbamoyl)ethyl]carbamoyl}ethyl)carbamoyl]-1-hydroxy-3-phenylpropan-2-yl}carbamoyl)-3-methylbutyl]carbamoyl}-2-methylpropyl)carbamoyl]butanoic acid > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0253807 (HGluValLeuPnsAspAlaGluPheOH)HMDB0253807 RDKit 3D HGluValLeuPnsAspAlaGluPheOH 137138 0 0 0 0 0 0 0 0999 V2000 -5.4699 1.1918 2.0726 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3735 1.2410 1.0551 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9567 2.7515 1.0709 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.7684 0.9956 -0.3410 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4084 -0.2429 -0.7779 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.7124 -0.5887 -0.2059 N 0 0 0 0 0 0 0 0 0 0 0 0 -7.8959 -0.1777 -0.8178 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.7211 0.5421 -1.8888 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.2570 -0.4782 -0.3746 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.1056 0.6100 -0.8472 N 0 0 0 0 0 0 0 0 0 0 0 0 -11.2248 0.4776 -1.6863 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.5724 -0.6477 -2.0935 O 0 0 0 0 0 0 0 0 0 0 0 0 -11.9991 1.6734 -2.0934 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.1540 1.2244 -2.8817 N 0 0 0 0 0 0 0 0 0 0 0 0 -12.4751 2.4599 -0.9104 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.2305 3.6998 -1.2810 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.4334 3.4326 -2.0826 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.4743 3.4585 -3.3455 O 0 0 0 0 0 0 0 0 0 0 0 0 -15.6217 3.1298 -1.3925 O 0 0 0 0 0 0 0 0 0 0 0 0 -9.3861 -0.7274 1.0710 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.9867 0.4133 1.9732 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.7623 -1.2489 1.4592 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5440 -1.3992 -1.0167 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1098 -2.5104 -1.3373 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1402 -1.4182 -0.9320 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.3877 -2.6232 -1.2311 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0809 -3.3439 0.1009 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3147 -3.7406 0.8118 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7950 -5.0290 0.6011 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9551 -5.4269 1.2417 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6178 -4.5347 2.0759 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1438 -3.2458 2.2877 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9823 -2.8918 1.6334 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1189 -2.4006 -1.9733 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6408 -3.6918 -2.3510 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0036 -1.8432 -1.0515 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2304 -0.8640 -0.3280 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2390 -2.4877 -1.0772 N 0 0 0 0 0 0 0 0 0 0 0 0 2.4514 -2.2935 -0.3671 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1358 -3.6376 -0.2161 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2439 -4.5265 0.5568 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2718 -5.0786 0.0471 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5482 -4.7137 1.8926 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4325 -1.3474 -1.0948 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9379 -0.7972 -2.0905 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6696 -1.2241 -0.5850 N 0 0 0 0 0 0 0 0 0 0 0 0 5.9386 -1.0835 -0.0801 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2695 -2.0791 1.0551 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4707 0.2354 0.4063 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7748 1.2168 0.5983 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8730 0.1699 0.6035 N 0 0 0 0 0 0 0 0 0 0 0 0 8.9313 0.9545 1.0420 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4516 2.4507 0.7430 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6108 3.3319 1.1930 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2563 4.7423 0.9731 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1436 5.0463 0.5044 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1663 5.7330 1.2894 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1254 0.8827 0.1152 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8182 1.1487 -1.1049 O 0 0 0 0 0 0 0 0 0 0 0 0 11.4317 0.5602 0.4825 N 0 0 0 0 0 0 0 0 0 0 0 0 12.7054 0.2643 0.7581 C 0 0 0 0 0 0 0 0 0 0 0 0 13.7516 1.2419 1.1399 C 0 0 0 0 0 0 0 0 0 0 0 0 14.0235 2.3188 0.2024 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3819 3.5250 0.4134 C 0 0 0 0 0 0 0 0 0 0 0 0 13.5436 4.6249 -0.3982 C 0 0 0 0 0 0 0 0 0 0 0 0 14.4093 4.5070 -1.4945 C 0 0 0 0 0 0 0 0 0 0 0 0 15.0400 3.3065 -1.6898 C 0 0 0 0 0 0 0 0 0 0 0 0 14.8628 2.2184 -0.8660 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3261 -0.5956 -0.3647 C 0 0 0 0 0 0 0 0 0 0 0 0 12.6263 -0.8455 -1.3812 O 0 0 0 0 0 0 0 0 0 0 0 0 14.5987 -1.0920 -0.2816 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.3928 1.5464 1.5373 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3419 1.9103 2.8958 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7024 0.1610 2.3864 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4420 0.7477 1.4094 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6769 3.0868 2.0590 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9270 3.2581 0.7859 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2746 2.9647 0.2384 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3746 1.8646 -0.7332 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8130 1.1019 -0.9639 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7459 0.0265 -1.8818 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7835 -1.1548 0.6804 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.5730 -1.4294 -0.9145 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.8283 1.5590 -0.5128 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.4360 2.3364 -2.7670 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.4526 0.2527 -2.6205 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.9407 1.2652 -3.9005 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5704 2.7741 -0.3219 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.0764 1.8465 -0.2019 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.4956 4.2690 -0.3615 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.5074 4.3447 -1.8651 H 0 0 0 0 0 0 0 0 0 0 0 0 -16.3527 2.5731 -1.8333 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6696 -1.5752 1.3231 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0620 0.1764 2.5451 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.7688 0.5565 2.7836 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.8071 1.3463 1.4312 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.0953 -0.7041 2.3502 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.5115 -1.0516 0.6586 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.7486 -2.3420 1.5772 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6229 -0.5665 -0.6540 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0420 -3.3239 -1.7707 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4633 -2.6718 0.7348 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4823 -4.2452 -0.0735 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3072 -5.7294 -0.0300 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3765 -6.4289 1.1063 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5235 -4.8212 2.5862 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6601 -2.5349 2.9469 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5805 -1.8942 1.7691 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1375 -1.7837 -2.8532 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1386 -3.6914 -3.1730 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2912 -3.3129 -1.8037 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2376 -1.8242 0.6095 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1536 -3.6100 0.1263 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2055 -4.0405 -1.2885 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0422 -5.4193 2.4062 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0065 -0.2666 -1.5376 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7363 -1.3266 -0.8910 H 0 0 0 0 0 0 0 0 0 0 0 0 5.3842 -2.2077 1.6682 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0624 -1.6859 1.7219 H 0 0 0 0 0 0 0 0 0 0 0 0 6.5747 -3.0156 0.5785 H 0 0 0 0 0 0 0 0 0 0 0 0 8.2504 -0.8547 0.3257 H 0 0 0 0 0 0 0 0 0 0 0 0 9.0891 1.0291 2.0904 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3448 2.5536 -0.3409 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5382 2.5680 1.2783 H 0 0 0 0 0 0 0 0 0 0 0 0 9.8984 3.0825 2.2499 H 0 0 0 0 0 0 0 0 0 0 0 0 10.5068 3.1194 0.5480 H 0 0 0 0 0 0 0 0 0 0 0 0 9.9882 6.5296 1.8967 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8250 0.9911 -0.7755 H 0 0 0 0 0 0 0 0 0 0 0 0 12.6964 -0.5986 1.5781 H 0 0 0 0 0 0 0 0 0 0 0 0 13.5203 1.5969 2.1974 H 0 0 0 0 0 0 0 0 0 0 0 0 14.7570 0.7240 1.3071 H 0 0 0 0 0 0 0 0 0 0 0 0 12.7105 3.6443 1.2546 H 0 0 0 0 0 0 0 0 0 0 0 0 13.0280 5.5730 -0.2155 H 0 0 0 0 0 0 0 0 0 0 0 0 14.5323 5.3771 -2.1380 H 0 0 0 0 0 0 0 0 0 0 0 0 15.7196 3.1828 -2.5482 H 0 0 0 0 0 0 0 0 0 0 0 0 15.3901 1.3183 -1.0762 H 0 0 0 0 0 0 0 0 0 0 0 0 14.8089 -2.0505 -0.5938 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 2 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 2 0 7 9 1 0 9 10 1 0 10 11 1 0 11 12 2 0 11 13 1 0 13 14 1 0 13 15 1 0 15 16 1 0 16 17 1 0 17 18 2 0 17 19 1 0 9 20 1 0 20 21 1 0 20 22 1 0 5 23 1 0 23 24 2 0 23 25 1 0 25 26 1 0 26 27 1 0 27 28 1 0 28 29 2 0 29 30 1 0 30 31 2 0 31 32 1 0 32 33 2 0 26 34 1 0 34 35 1 0 34 36 1 0 36 37 2 0 36 38 1 0 38 39 1 0 39 40 1 0 40 41 1 0 41 42 2 0 41 43 1 0 39 44 1 0 44 45 2 0 44 46 1 0 46 47 1 0 47 48 1 0 47 49 1 0 49 50 2 0 49 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 2 0 55 57 1 0 52 58 1 0 58 59 2 0 58 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 63 64 2 0 64 65 1 0 65 66 2 0 66 67 1 0 67 68 2 0 61 69 1 0 69 70 2 0 69 71 1 0 33 28 1 0 68 63 1 0 1 72 1 0 1 73 1 0 1 74 1 0 2 75 1 0 3 76 1 0 3 77 1 0 3 78 1 0 4 79 1 0 4 80 1 0 5 81 1 0 6 82 1 0 9 83 1 0 10 84 1 0 13 85 1 0 14 86 1 0 14 87 1 0 15 88 1 0 15 89 1 0 16 90 1 0 16 91 1 0 19 92 1 0 20 93 1 0 21 94 1 0 21 95 1 0 21 96 1 0 22 97 1 0 22 98 1 0 22 99 1 0 25100 1 0 26101 1 0 27102 1 0 27103 1 0 29104 1 0 30105 1 0 31106 1 0 32107 1 0 33108 1 0 34109 1 0 35110 1 0 38111 1 0 39112 1 0 40113 1 0 40114 1 0 43115 1 0 46116 1 0 47117 1 0 48118 1 0 48119 1 0 48120 1 0 51121 1 0 52122 1 0 53123 1 0 53124 1 0 54125 1 0 54126 1 0 57127 1 0 60128 1 0 61129 1 0 62130 1 0 62131 1 0 64132 1 0 65133 1 0 66134 1 0 67135 1 0 68136 1 0 71137 1 0 M END PDB for HMDB0253807 (HGluValLeuPnsAspAlaGluPheOH)HEADER PROTEIN 11-SEP-21 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 11-SEP-21 0 HETATM 1 C UNK 0 20.005 2.310 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 20.005 0.770 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 18.672 0.000 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 21.339 0.000 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 21.339 -1.540 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 20.005 -2.310 0.000 0.00 0.00 C+0 HETATM 7 O UNK 0 20.910 -3.556 0.000 0.00 0.00 O+0 HETATM 8 N UNK 0 18.672 -1.540 0.000 0.00 0.00 N+0 HETATM 9 C UNK 0 17.338 -2.310 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 17.338 -3.850 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 18.672 -4.620 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 20.005 -3.850 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 21.339 -4.620 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 21.339 -6.160 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 20.005 -6.930 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 18.672 -6.160 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 16.004 -1.540 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 14.670 -2.310 0.000 0.00 0.00 C+0 HETATM 19 O UNK 0 14.670 -3.850 0.000 0.00 0.00 O+0 HETATM 20 N UNK 0 13.337 -1.540 0.000 0.00 0.00 N+0 HETATM 21 C UNK 0 12.003 -2.310 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 12.003 -3.850 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 10.669 -4.620 0.000 0.00 0.00 C+0 HETATM 24 O UNK 0 10.669 -6.160 0.000 0.00 0.00 O+0 HETATM 25 O UNK 0 9.336 -3.850 0.000 0.00 0.00 O+0 HETATM 26 C UNK 0 10.669 -1.540 0.000 0.00 0.00 C+0 HETATM 27 O UNK 0 10.669 0.000 0.000 0.00 0.00 O+0 HETATM 28 N UNK 0 9.336 -2.310 0.000 0.00 0.00 N+0 HETATM 29 C UNK 0 8.002 -1.540 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 8.002 -0.000 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 6.668 -2.310 0.000 0.00 0.00 C+0 HETATM 32 O UNK 0 6.668 -3.850 0.000 0.00 0.00 O+0 HETATM 33 N UNK 0 5.335 -1.540 0.000 0.00 0.00 N+0 HETATM 34 C UNK 0 4.001 -2.310 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 4.001 -3.850 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 2.667 -4.620 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 2.667 -6.160 0.000 0.00 0.00 C+0 HETATM 38 O UNK 0 4.001 -6.930 0.000 0.00 0.00 O+0 HETATM 39 O UNK 0 1.334 -6.930 0.000 0.00 0.00 O+0 HETATM 40 C UNK 0 2.667 -1.540 0.000 0.00 0.00 C+0 HETATM 41 O UNK 0 2.667 -0.000 0.000 0.00 0.00 O+0 HETATM 42 N UNK 0 1.334 -2.310 0.000 0.00 0.00 N+0 HETATM 43 C UNK 0 0.000 -1.540 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 0.000 -0.000 0.000 0.00 0.00 C+0 HETATM 45 C UNK 0 -1.334 0.770 0.000 0.00 0.00 C+0 HETATM 46 C UNK 0 -2.667 -0.000 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 -4.001 0.770 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 -4.001 2.310 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 -2.667 3.080 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 -1.334 2.310 0.000 0.00 0.00 C+0 HETATM 51 C UNK 0 -1.334 -2.310 0.000 0.00 0.00 C+0 HETATM 52 O UNK 0 -1.334 -3.850 0.000 0.00 0.00 O+0 HETATM 53 O UNK 0 -2.667 -1.540 0.000 0.00 0.00 O+0 HETATM 54 O UNK 0 16.004 0.000 0.000 0.00 0.00 O+0 HETATM 55 N UNK 0 22.673 -2.310 0.000 0.00 0.00 N+0 HETATM 56 C UNK 0 24.006 -1.540 0.000 0.00 0.00 C+0 HETATM 57 O UNK 0 24.006 -0.000 0.000 0.00 0.00 O+0 HETATM 58 C UNK 0 25.340 -2.310 0.000 0.00 0.00 C+0 HETATM 59 C UNK 0 25.340 -3.850 0.000 0.00 0.00 C+0 HETATM 60 C UNK 0 26.674 -4.620 0.000 0.00 0.00 C+0 HETATM 61 C UNK 0 24.006 -4.620 0.000 0.00 0.00 C+0 HETATM 62 N UNK 0 26.674 -1.540 0.000 0.00 0.00 N+0 HETATM 63 C UNK 0 28.007 -2.310 0.000 0.00 0.00 C+0 HETATM 64 O UNK 0 28.007 -3.850 0.000 0.00 0.00 O+0 HETATM 65 C UNK 0 29.341 -1.540 0.000 0.00 0.00 C+0 HETATM 66 C UNK 0 30.675 -2.310 0.000 0.00 0.00 C+0 HETATM 67 C UNK 0 32.008 -1.540 0.000 0.00 0.00 C+0 HETATM 68 C UNK 0 33.342 -2.310 0.000 0.00 0.00 C+0 HETATM 69 O UNK 0 34.676 -1.540 0.000 0.00 0.00 O+0 HETATM 70 O UNK 0 33.342 -3.850 0.000 0.00 0.00 O+0 HETATM 71 N UNK 0 29.341 -0.000 0.000 0.00 0.00 N+0 CONECT 1 2 CONECT 2 1 3 4 CONECT 3 2 CONECT 4 2 5 CONECT 5 4 6 55 CONECT 6 5 7 8 CONECT 7 6 CONECT 8 6 9 CONECT 9 8 10 17 CONECT 10 9 11 CONECT 11 10 12 16 CONECT 12 11 13 CONECT 13 12 14 CONECT 14 13 15 CONECT 15 14 16 CONECT 16 15 11 CONECT 17 9 18 54 CONECT 18 17 19 20 CONECT 19 18 CONECT 20 18 21 CONECT 21 20 22 26 CONECT 22 21 23 CONECT 23 22 24 25 CONECT 24 23 CONECT 25 23 CONECT 26 21 27 28 CONECT 27 26 CONECT 28 26 29 CONECT 29 28 30 31 CONECT 30 29 CONECT 31 29 32 33 CONECT 32 31 CONECT 33 31 34 CONECT 34 33 35 40 CONECT 35 34 36 CONECT 36 35 37 CONECT 37 36 38 39 CONECT 38 37 CONECT 39 37 CONECT 40 34 41 42 CONECT 41 40 CONECT 42 40 43 CONECT 43 42 44 51 CONECT 44 43 45 CONECT 45 44 46 50 CONECT 46 45 47 CONECT 47 46 48 CONECT 48 47 49 CONECT 49 48 50 CONECT 50 49 45 CONECT 51 43 52 53 CONECT 52 51 CONECT 53 51 CONECT 54 17 CONECT 55 5 56 CONECT 56 55 57 58 CONECT 57 56 CONECT 58 56 59 62 CONECT 59 58 60 61 CONECT 60 59 CONECT 61 59 CONECT 62 58 63 CONECT 63 62 64 65 CONECT 64 63 CONECT 65 63 66 71 CONECT 66 65 67 CONECT 67 66 68 CONECT 68 67 69 70 CONECT 69 68 CONECT 70 68 CONECT 71 65 MASTER 0 0 0 0 0 0 0 0 71 0 144 0 END 3D PDB for HMDB0253807 (HGluValLeuPnsAspAlaGluPheOH)COMPND HMDB0253807 HETATM 1 C1 UNL 1 -5.470 1.192 2.073 1.00 0.00 C HETATM 2 C2 UNL 1 -4.373 1.241 1.055 1.00 0.00 C HETATM 3 C3 UNL 1 -3.957 2.752 1.071 1.00 0.00 C HETATM 4 C4 UNL 1 -4.768 0.996 -0.341 1.00 0.00 C HETATM 5 C5 UNL 1 -5.408 -0.243 -0.778 1.00 0.00 C HETATM 6 N1 UNL 1 -6.712 -0.589 -0.206 1.00 0.00 N HETATM 7 C6 UNL 1 -7.896 -0.178 -0.818 1.00 0.00 C HETATM 8 O1 UNL 1 -7.721 0.542 -1.889 1.00 0.00 O HETATM 9 C7 UNL 1 -9.257 -0.478 -0.375 1.00 0.00 C HETATM 10 N2 UNL 1 -10.106 0.610 -0.847 1.00 0.00 N HETATM 11 C8 UNL 1 -11.225 0.478 -1.686 1.00 0.00 C HETATM 12 O2 UNL 1 -11.572 -0.648 -2.093 1.00 0.00 O HETATM 13 C9 UNL 1 -11.999 1.673 -2.093 1.00 0.00 C HETATM 14 N3 UNL 1 -13.154 1.224 -2.882 1.00 0.00 N HETATM 15 C10 UNL 1 -12.475 2.460 -0.910 1.00 0.00 C HETATM 16 C11 UNL 1 -13.231 3.700 -1.281 1.00 0.00 C HETATM 17 C12 UNL 1 -14.433 3.433 -2.083 1.00 0.00 C HETATM 18 O3 UNL 1 -14.474 3.459 -3.345 1.00 0.00 O HETATM 19 O4 UNL 1 -15.622 3.130 -1.393 1.00 0.00 O HETATM 20 C13 UNL 1 -9.386 -0.727 1.071 1.00 0.00 C HETATM 21 C14 UNL 1 -8.987 0.413 1.973 1.00 0.00 C HETATM 22 C15 UNL 1 -10.762 -1.249 1.459 1.00 0.00 C HETATM 23 C16 UNL 1 -4.544 -1.399 -1.017 1.00 0.00 C HETATM 24 O5 UNL 1 -5.110 -2.510 -1.337 1.00 0.00 O HETATM 25 N4 UNL 1 -3.140 -1.418 -0.932 1.00 0.00 N HETATM 26 C17 UNL 1 -2.388 -2.623 -1.231 1.00 0.00 C HETATM 27 C18 UNL 1 -2.081 -3.344 0.101 1.00 0.00 C HETATM 28 C19 UNL 1 -3.315 -3.741 0.812 1.00 0.00 C HETATM 29 C20 UNL 1 -3.795 -5.029 0.601 1.00 0.00 C HETATM 30 C21 UNL 1 -4.955 -5.427 1.242 1.00 0.00 C HETATM 31 C22 UNL 1 -5.618 -4.535 2.076 1.00 0.00 C HETATM 32 C23 UNL 1 -5.144 -3.246 2.288 1.00 0.00 C HETATM 33 C24 UNL 1 -3.982 -2.892 1.633 1.00 0.00 C HETATM 34 C25 UNL 1 -1.119 -2.401 -1.973 1.00 0.00 C HETATM 35 O6 UNL 1 -0.641 -3.692 -2.351 1.00 0.00 O HETATM 36 C26 UNL 1 -0.004 -1.843 -1.052 1.00 0.00 C HETATM 37 O7 UNL 1 -0.230 -0.864 -0.328 1.00 0.00 O HETATM 38 N5 UNL 1 1.239 -2.488 -1.077 1.00 0.00 N HETATM 39 C27 UNL 1 2.451 -2.293 -0.367 1.00 0.00 C HETATM 40 C28 UNL 1 3.136 -3.638 -0.216 1.00 0.00 C HETATM 41 C29 UNL 1 2.244 -4.527 0.557 1.00 0.00 C HETATM 42 O8 UNL 1 1.272 -5.079 0.047 1.00 0.00 O HETATM 43 O9 UNL 1 2.548 -4.714 1.893 1.00 0.00 O HETATM 44 C30 UNL 1 3.432 -1.347 -1.095 1.00 0.00 C HETATM 45 O10 UNL 1 2.938 -0.797 -2.091 1.00 0.00 O HETATM 46 N6 UNL 1 4.670 -1.224 -0.585 1.00 0.00 N HETATM 47 C31 UNL 1 5.939 -1.083 -0.080 1.00 0.00 C HETATM 48 C32 UNL 1 6.270 -2.079 1.055 1.00 0.00 C HETATM 49 C33 UNL 1 6.471 0.235 0.406 1.00 0.00 C HETATM 50 O11 UNL 1 5.775 1.217 0.598 1.00 0.00 O HETATM 51 N7 UNL 1 7.873 0.170 0.604 1.00 0.00 N HETATM 52 C34 UNL 1 8.931 0.954 1.042 1.00 0.00 C HETATM 53 C35 UNL 1 8.452 2.451 0.743 1.00 0.00 C HETATM 54 C36 UNL 1 9.611 3.332 1.193 1.00 0.00 C HETATM 55 C37 UNL 1 9.256 4.742 0.973 1.00 0.00 C HETATM 56 O12 UNL 1 8.144 5.046 0.504 1.00 0.00 O HETATM 57 O13 UNL 1 10.166 5.733 1.289 1.00 0.00 O HETATM 58 C38 UNL 1 10.125 0.883 0.115 1.00 0.00 C HETATM 59 O14 UNL 1 9.818 1.149 -1.105 1.00 0.00 O HETATM 60 N8 UNL 1 11.432 0.560 0.482 1.00 0.00 N HETATM 61 C39 UNL 1 12.705 0.264 0.758 1.00 0.00 C HETATM 62 C40 UNL 1 13.752 1.242 1.140 1.00 0.00 C HETATM 63 C41 UNL 1 14.024 2.319 0.202 1.00 0.00 C HETATM 64 C42 UNL 1 13.382 3.525 0.413 1.00 0.00 C HETATM 65 C43 UNL 1 13.544 4.625 -0.398 1.00 0.00 C HETATM 66 C44 UNL 1 14.409 4.507 -1.495 1.00 0.00 C HETATM 67 C45 UNL 1 15.040 3.306 -1.690 1.00 0.00 C HETATM 68 C46 UNL 1 14.863 2.218 -0.866 1.00 0.00 C HETATM 69 C47 UNL 1 13.326 -0.596 -0.365 1.00 0.00 C HETATM 70 O15 UNL 1 12.626 -0.845 -1.381 1.00 0.00 O HETATM 71 O16 UNL 1 14.599 -1.092 -0.282 1.00 0.00 O HETATM 72 H1 UNL 1 -6.393 1.546 1.537 1.00 0.00 H HETATM 73 H2 UNL 1 -5.342 1.910 2.896 1.00 0.00 H HETATM 74 H3 UNL 1 -5.702 0.161 2.386 1.00 0.00 H HETATM 75 H4 UNL 1 -3.442 0.748 1.409 1.00 0.00 H HETATM 76 H5 UNL 1 -3.677 3.087 2.059 1.00 0.00 H HETATM 77 H6 UNL 1 -4.927 3.258 0.786 1.00 0.00 H HETATM 78 H7 UNL 1 -3.275 2.965 0.238 1.00 0.00 H HETATM 79 H8 UNL 1 -5.375 1.865 -0.733 1.00 0.00 H HETATM 80 H9 UNL 1 -3.813 1.102 -0.964 1.00 0.00 H HETATM 81 H10 UNL 1 -5.746 0.027 -1.882 1.00 0.00 H HETATM 82 H11 UNL 1 -6.784 -1.155 0.680 1.00 0.00 H HETATM 83 H12 UNL 1 -9.573 -1.429 -0.914 1.00 0.00 H HETATM 84 H13 UNL 1 -9.828 1.559 -0.513 1.00 0.00 H HETATM 85 H14 UNL 1 -11.436 2.336 -2.767 1.00 0.00 H HETATM 86 H15 UNL 1 -13.453 0.253 -2.620 1.00 0.00 H HETATM 87 H16 UNL 1 -12.941 1.265 -3.900 1.00 0.00 H HETATM 88 H17 UNL 1 -11.570 2.774 -0.322 1.00 0.00 H HETATM 89 H18 UNL 1 -13.076 1.847 -0.202 1.00 0.00 H HETATM 90 H19 UNL 1 -13.496 4.269 -0.361 1.00 0.00 H HETATM 91 H20 UNL 1 -12.507 4.345 -1.865 1.00 0.00 H HETATM 92 H21 UNL 1 -16.353 2.573 -1.833 1.00 0.00 H HETATM 93 H22 UNL 1 -8.670 -1.575 1.323 1.00 0.00 H HETATM 94 H23 UNL 1 -8.062 0.176 2.545 1.00 0.00 H HETATM 95 H24 UNL 1 -9.769 0.557 2.784 1.00 0.00 H HETATM 96 H25 UNL 1 -8.807 1.346 1.431 1.00 0.00 H HETATM 97 H26 UNL 1 -11.095 -0.704 2.350 1.00 0.00 H HETATM 98 H27 UNL 1 -11.511 -1.052 0.659 1.00 0.00 H HETATM 99 H28 UNL 1 -10.749 -2.342 1.577 1.00 0.00 H HETATM 100 H29 UNL 1 -2.623 -0.566 -0.654 1.00 0.00 H HETATM 101 H30 UNL 1 -3.042 -3.324 -1.771 1.00 0.00 H HETATM 102 H31 UNL 1 -1.463 -2.672 0.735 1.00 0.00 H HETATM 103 H32 UNL 1 -1.482 -4.245 -0.074 1.00 0.00 H HETATM 104 H33 UNL 1 -3.307 -5.729 -0.030 1.00 0.00 H HETATM 105 H34 UNL 1 -5.376 -6.429 1.106 1.00 0.00 H HETATM 106 H35 UNL 1 -6.523 -4.821 2.586 1.00 0.00 H HETATM 107 H36 UNL 1 -5.660 -2.535 2.947 1.00 0.00 H HETATM 108 H37 UNL 1 -3.580 -1.894 1.769 1.00 0.00 H HETATM 109 H38 UNL 1 -1.137 -1.784 -2.853 1.00 0.00 H HETATM 110 H39 UNL 1 -0.139 -3.691 -3.173 1.00 0.00 H HETATM 111 H40 UNL 1 1.291 -3.313 -1.804 1.00 0.00 H HETATM 112 H41 UNL 1 2.238 -1.824 0.609 1.00 0.00 H HETATM 113 H42 UNL 1 4.154 -3.610 0.126 1.00 0.00 H HETATM 114 H43 UNL 1 3.206 -4.041 -1.288 1.00 0.00 H HETATM 115 H44 UNL 1 2.042 -5.419 2.406 1.00 0.00 H HETATM 116 H45 UNL 1 5.006 -0.267 -1.538 1.00 0.00 H HETATM 117 H46 UNL 1 6.736 -1.327 -0.891 1.00 0.00 H HETATM 118 H47 UNL 1 5.384 -2.208 1.668 1.00 0.00 H HETATM 119 H48 UNL 1 7.062 -1.686 1.722 1.00 0.00 H HETATM 120 H49 UNL 1 6.575 -3.016 0.579 1.00 0.00 H HETATM 121 H50 UNL 1 8.250 -0.855 0.326 1.00 0.00 H HETATM 122 H51 UNL 1 9.089 1.029 2.090 1.00 0.00 H HETATM 123 H52 UNL 1 8.345 2.554 -0.341 1.00 0.00 H HETATM 124 H53 UNL 1 7.538 2.568 1.278 1.00 0.00 H HETATM 125 H54 UNL 1 9.898 3.083 2.250 1.00 0.00 H HETATM 126 H55 UNL 1 10.507 3.119 0.548 1.00 0.00 H HETATM 127 H56 UNL 1 9.988 6.530 1.897 1.00 0.00 H HETATM 128 H57 UNL 1 11.825 0.991 -0.775 1.00 0.00 H HETATM 129 H58 UNL 1 12.696 -0.599 1.578 1.00 0.00 H HETATM 130 H59 UNL 1 13.520 1.597 2.197 1.00 0.00 H HETATM 131 H60 UNL 1 14.757 0.724 1.307 1.00 0.00 H HETATM 132 H61 UNL 1 12.710 3.644 1.255 1.00 0.00 H HETATM 133 H62 UNL 1 13.028 5.573 -0.216 1.00 0.00 H HETATM 134 H63 UNL 1 14.532 5.377 -2.138 1.00 0.00 H HETATM 135 H64 UNL 1 15.720 3.183 -2.548 1.00 0.00 H HETATM 136 H65 UNL 1 15.390 1.318 -1.076 1.00 0.00 H HETATM 137 H66 UNL 1 14.809 -2.050 -0.594 1.00 0.00 H CONECT 1 2 72 73 74 CONECT 2 3 4 75 CONECT 3 76 77 78 CONECT 4 5 79 80 CONECT 5 6 23 81 CONECT 6 7 82 CONECT 7 8 8 9 CONECT 9 10 20 83 CONECT 10 11 84 CONECT 11 12 12 13 CONECT 13 14 15 85 CONECT 14 86 87 CONECT 15 16 88 89 CONECT 16 17 90 91 CONECT 17 18 18 19 CONECT 19 92 CONECT 20 21 22 93 CONECT 21 94 95 96 CONECT 22 97 98 99 CONECT 23 24 24 25 CONECT 25 26 100 CONECT 26 27 34 101 CONECT 27 28 102 103 CONECT 28 29 29 33 CONECT 29 30 104 CONECT 30 31 31 105 CONECT 31 32 106 CONECT 32 33 33 107 CONECT 33 108 CONECT 34 35 36 109 CONECT 35 110 CONECT 36 37 37 38 CONECT 38 39 111 CONECT 39 40 44 112 CONECT 40 41 113 114 CONECT 41 42 42 43 CONECT 43 115 CONECT 44 45 45 46 CONECT 46 47 116 CONECT 47 48 49 117 CONECT 48 118 119 120 CONECT 49 50 50 51 CONECT 51 52 121 CONECT 52 53 58 122 CONECT 53 54 123 124 CONECT 54 55 125 126 CONECT 55 56 56 57 CONECT 57 127 CONECT 58 59 59 60 CONECT 60 61 128 CONECT 61 62 69 129 CONECT 62 63 130 131 CONECT 63 64 64 68 CONECT 64 65 132 CONECT 65 66 66 133 CONECT 66 67 134 CONECT 67 68 68 135 CONECT 68 136 CONECT 69 70 70 71 CONECT 71 137 END SMILES for HMDB0253807 (HGluValLeuPnsAspAlaGluPheOH)CC(C)CC(NC(=O)C(NC(=O)C(N)CCC(O)=O)C(C)C)C(=O)NC(CC1=CC=CC=C1)C(O)C(=O)NC(CC(O)=O)C(=O)NC(C)C(=O)NC(CCC(O)=O)C(=O)NC(CC1=CC=CC=C1)C(O)=O INCHI for HMDB0253807 (HGluValLeuPnsAspAlaGluPheOH)InChI=1S/C47H66N8O16/c1-24(2)20-32(52-45(68)38(25(3)4)55-41(64)29(48)16-18-35(56)57)44(67)51-31(21-27-12-8-6-9-13-27)39(62)46(69)53-33(23-37(60)61)43(66)49-26(5)40(63)50-30(17-19-36(58)59)42(65)54-34(47(70)71)22-28-14-10-7-11-15-28/h6-15,24-26,29-34,38-39,62H,16-23,48H2,1-5H3,(H,49,66)(H,50,63)(H,51,67)(H,52,68)(H,53,69)(H,54,65)(H,55,64)(H,56,57)(H,58,59)(H,60,61)(H,70,71) 3D Structure for HMDB0253807 (HGluValLeuPnsAspAlaGluPheOH) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C47H66N8O16 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 999.085 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 998.459678077 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 4-amino-4-[(1-{[1-({1-[(2-carboxy-1-{[1-({3-carboxy-1-[(1-carboxy-2-phenylethyl)carbamoyl]propyl}carbamoyl)ethyl]carbamoyl}ethyl)carbamoyl]-1-hydroxy-3-phenylpropan-2-yl}carbamoyl)-3-methylbutyl]carbamoyl}-2-methylpropyl)carbamoyl]butanoic acid | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 4-amino-4-[(1-{[1-({1-[(2-carboxy-1-{[1-({3-carboxy-1-[(1-carboxy-2-phenylethyl)carbamoyl]propyl}carbamoyl)ethyl]carbamoyl}ethyl)carbamoyl]-1-hydroxy-3-phenylpropan-2-yl}carbamoyl)-3-methylbutyl]carbamoyl}-2-methylpropyl)carbamoyl]butanoic acid | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CC(C)CC(NC(=O)C(NC(=O)C(N)CCC(O)=O)C(C)C)C(=O)NC(CC1=CC=CC=C1)C(O)C(=O)NC(CC(O)=O)C(=O)NC(C)C(=O)NC(CCC(O)=O)C(=O)NC(CC1=CC=CC=C1)C(O)=O | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C47H66N8O16/c1-24(2)20-32(52-45(68)38(25(3)4)55-41(64)29(48)16-18-35(56)57)44(67)51-31(21-27-12-8-6-9-13-27)39(62)46(69)53-33(23-37(60)61)43(66)49-26(5)40(63)50-30(17-19-36(58)59)42(65)54-34(47(70)71)22-28-14-10-7-11-15-28/h6-15,24-26,29-34,38-39,62H,16-23,48H2,1-5H3,(H,49,66)(H,50,63)(H,51,67)(H,52,68)(H,53,69)(H,54,65)(H,55,64)(H,56,57)(H,58,59)(H,60,61)(H,70,71) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | XZLFSKMZGRMIHM-UHFFFAOYSA-N | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as peptides. Peptides are compounds containing an amide derived from two or more amino carboxylic acid molecules (the same or different) by formation of a covalent bond from the carbonyl carbon of one to the nitrogen atom of another. | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Organic acids and derivatives | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Carboxylic acids and derivatives | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Amino acids, peptides, and analogues | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Peptides | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aromatic homomonocyclic compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|