Showing metabocard for Methylcellulose (HMDB0254627)
Record Information | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Detected but not Quantified | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2021-09-11 14:00:31 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2021-09-26 23:08:44 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0254627 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Methylcellulose | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Methylcellulose belongs to the class of organic compounds known as oligosaccharides. These are carbohydrates made up of 3 to 10 monosaccharide units linked to each other through glycosidic bonds. Based on a literature review a significant number of articles have been published on Methylcellulose. This compound has been identified in human blood as reported by (PMID: 31557052 ). Methylcellulose is not a naturally occurring metabolite and is only found in those individuals exposed to this compound or its derivatives. Technically Methylcellulose is part of the human exposome. The exposome can be defined as the collection of all the exposures of an individual in a lifetime and how those exposures relate to health. An individual's exposure begins before birth and includes insults from environmental and occupational sources. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0254627 (Methylcellulose)Mrv1652309112116002D 45 47 0 0 0 0 999 V2000 2.8579 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 -2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 -2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 -3.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 -4.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 -4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 -5.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 -4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 -4.1250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -5.3625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -5.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 -4.9500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 -4.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -3.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -4.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -3.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -2.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 -3.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5737 -4.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2881 -3.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 -4.1250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 -4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2881 -5.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5737 -4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 -5.3625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 -6.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2881 -6.1875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 -6.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7171 -5.3625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.4315 -4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2881 -2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 -2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -6.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -6.6000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -7.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 -6.1875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 -6.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 -5.3625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 -6.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 -3.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 -4.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 7 8 1 0 0 0 0 8 9 1 0 0 0 0 4 9 1 0 0 0 0 8 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 11 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 15 19 1 0 0 0 0 19 20 1 0 0 0 0 14 21 1 0 0 0 0 21 22 1 0 0 0 0 22 23 1 0 0 0 0 23 24 1 0 0 0 0 24 25 1 0 0 0 0 25 26 1 0 0 0 0 26 27 1 0 0 0 0 22 27 1 0 0 0 0 27 28 1 0 0 0 0 28 29 1 0 0 0 0 26 30 1 0 0 0 0 30 31 1 0 0 0 0 25 32 1 0 0 0 0 32 33 1 0 0 0 0 23 34 1 0 0 0 0 34 35 1 0 0 0 0 35 36 1 0 0 0 0 12 37 1 0 0 0 0 37 38 1 0 0 0 0 38 39 1 0 0 0 0 7 40 1 0 0 0 0 40 41 1 0 0 0 0 6 42 1 0 0 0 0 42 43 1 0 0 0 0 5 44 1 0 0 0 0 44 45 1 0 0 0 0 M END 3D MOL for HMDB0254627 (Methylcellulose)HMDB0254627 RDKit 3D Methylcellulose 99101 0 0 0 0 0 0 0 0999 V2000 -5.5589 -1.5794 5.0086 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3349 -0.8555 3.8386 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4052 -1.4503 3.0175 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2074 -0.6346 1.7849 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7516 0.6492 2.0405 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2839 1.2085 0.8109 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4609 0.3127 0.1934 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1515 0.6753 0.0103 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1928 -0.1875 0.8153 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4500 0.6233 1.9100 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6010 1.1661 2.6769 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0068 1.9258 3.7016 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7744 -0.7664 0.0192 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6313 0.1304 -0.6127 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4391 -0.6589 -1.4534 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7649 -0.6781 -1.0872 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7480 -0.5404 -2.2038 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9608 0.8324 -2.7303 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5760 1.7090 -1.8674 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6995 2.9344 -2.5599 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9946 -1.0748 -1.8888 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2735 -1.1172 -0.5452 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2754 0.1063 0.0825 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5331 0.3970 0.5983 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2997 -2.0071 0.2394 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9496 -3.1911 0.5018 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1329 -3.4444 1.8520 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0260 -2.1060 -0.5241 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9582 -2.5254 0.2272 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2776 -3.6238 -0.3350 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7992 1.0957 -1.3964 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9214 2.4207 -1.0220 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3714 3.2512 -2.0271 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6785 0.6759 -1.4195 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3298 1.5639 -2.2288 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9045 0.9172 -3.3126 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5267 1.3854 -0.0290 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1930 1.9835 -1.2372 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7853 3.2134 -1.4267 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1885 0.0617 -0.3410 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3748 0.3303 -1.0491 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2531 -0.2868 -2.3143 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4645 -0.6416 0.9523 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8958 -1.9205 0.6542 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2064 -2.0528 1.1087 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6507 -1.7009 5.6275 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3319 -1.1027 5.6412 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9074 -2.6163 4.7866 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7830 -2.4647 2.7719 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4518 -1.6260 3.5783 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4171 -1.1370 1.1532 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8347 2.1530 1.1029 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0332 1.7063 0.4011 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7265 -1.0160 1.3296 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0514 -0.0855 2.5231 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0242 1.4791 1.5507 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6159 2.7402 3.2701 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7843 2.4093 4.3212 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6599 1.2630 4.2707 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2381 0.5927 0.1937 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9611 -0.0185 -0.2140 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3691 -1.1837 -3.0490 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4952 0.7587 -3.7145 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9668 1.2644 -3.0016 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6893 3.2885 -2.8420 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2154 3.6917 -1.9348 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3371 2.7793 -3.4785 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3134 -1.5371 -0.4642 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3257 0.4351 -0.1693 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8720 -0.3498 1.3601 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5348 1.4027 1.0783 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0727 -1.5446 1.2318 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2138 -3.5086 2.4362 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6401 -4.4300 1.9315 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8737 -2.7000 2.2572 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1072 -2.7394 -1.4305 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4369 -3.8803 0.3451 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0028 -3.4622 -1.3745 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9394 -4.5397 -0.3138 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1201 1.0302 -2.4552 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4654 4.2959 -1.7383 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4002 2.9065 -2.2908 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7831 3.1279 -2.9850 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7816 -0.3416 -1.8449 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6254 0.1746 -2.8878 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1488 0.3556 -3.9149 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4233 1.5938 -4.0024 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2152 2.0221 0.5756 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9065 3.0912 -1.4077 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4267 3.8838 -0.6190 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4476 3.6013 -2.4084 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4876 -0.5486 -0.9440 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3509 0.1748 -2.8080 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1557 -0.1683 -2.9199 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9740 -1.3414 -2.1152 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2562 -0.0566 1.4709 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5204 -3.0922 0.8524 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8860 -1.3172 0.6275 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2995 -1.9394 2.2066 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 9 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 17 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 22 25 1 0 25 26 1 0 26 27 1 0 25 28 1 0 28 29 1 0 29 30 1 0 14 31 1 0 31 32 1 0 32 33 1 0 31 34 1 0 34 35 1 0 35 36 1 0 6 37 1 0 37 38 1 0 38 39 1 0 37 40 1 0 40 41 1 0 41 42 1 0 40 43 1 0 43 44 1 0 44 45 1 0 43 4 1 0 34 8 1 0 28 16 1 0 1 46 1 0 1 47 1 0 1 48 1 0 3 49 1 0 3 50 1 0 4 51 1 0 6 52 1 0 8 53 1 0 9 54 1 0 10 55 1 0 10 56 1 0 12 57 1 0 12 58 1 0 12 59 1 0 14 60 1 0 16 61 1 0 17 62 1 0 18 63 1 0 18 64 1 0 20 65 1 0 20 66 1 0 20 67 1 0 22 68 1 0 24 69 1 0 24 70 1 0 24 71 1 0 25 72 1 0 27 73 1 0 27 74 1 0 27 75 1 0 28 76 1 0 30 77 1 0 30 78 1 0 30 79 1 0 31 80 1 0 33 81 1 0 33 82 1 0 33 83 1 0 34 84 1 0 36 85 1 0 36 86 1 0 36 87 1 0 37 88 1 0 39 89 1 0 39 90 1 0 39 91 1 0 40 92 1 0 42 93 1 0 42 94 1 0 42 95 1 0 43 96 1 0 45 97 1 0 45 98 1 0 45 99 1 0 M END 3D SDF for HMDB0254627 (Methylcellulose)Mrv1652309112116002D 45 47 0 0 0 0 999 V2000 2.8579 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 -2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 -2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 -3.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 -4.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.8579 -4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 -5.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 -4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 -4.1250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -5.3625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -5.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 -4.9500 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 -4.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -3.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -4.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -3.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.0013 -2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -2.8875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.1447 -2.4750 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 -3.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5737 -4.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2881 -3.7125 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 -4.1250 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 -4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2881 -5.3625 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5737 -4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 -5.3625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.8592 -6.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2881 -6.1875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 -6.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7171 -5.3625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.4315 -4.9500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2881 -2.8875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 -2.4750 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.0026 -1.6500 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4302 -6.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -6.6000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.7158 -7.4250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5724 -6.1875 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2868 -6.6000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 -5.3625 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 -6.1875 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1434 -3.7125 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4289 -4.1250 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 7 8 1 0 0 0 0 8 9 1 0 0 0 0 4 9 1 0 0 0 0 8 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 12 13 1 0 0 0 0 13 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 1 0 0 0 0 11 16 1 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 15 19 1 0 0 0 0 19 20 1 0 0 0 0 14 21 1 0 0 0 0 21 22 1 0 0 0 0 22 23 1 0 0 0 0 23 24 1 0 0 0 0 24 25 1 0 0 0 0 25 26 1 0 0 0 0 26 27 1 0 0 0 0 22 27 1 0 0 0 0 27 28 1 0 0 0 0 28 29 1 0 0 0 0 26 30 1 0 0 0 0 30 31 1 0 0 0 0 25 32 1 0 0 0 0 32 33 1 0 0 0 0 23 34 1 0 0 0 0 34 35 1 0 0 0 0 35 36 1 0 0 0 0 12 37 1 0 0 0 0 37 38 1 0 0 0 0 38 39 1 0 0 0 0 7 40 1 0 0 0 0 40 41 1 0 0 0 0 6 42 1 0 0 0 0 42 43 1 0 0 0 0 5 44 1 0 0 0 0 44 45 1 0 0 0 0 M END > <DATABASE_ID> HMDB0254627 > <DATABASE_NAME> hmdb > <SMILES> COCC1OC(OC2C(COC)OC(OC3C(COC)OC(OC)C(OC)C3OC)C(OC)C2OC)C(OC)C(OC)C1OC > <INCHI_IDENTIFIER> InChI=1S/C29H54O16/c1-30-12-15-18(33-4)21(34-5)25(38-9)28(42-15)45-20-17(14-32-3)43-29(26(39-10)23(20)36-7)44-19-16(13-31-2)41-27(40-11)24(37-8)22(19)35-6/h15-29H,12-14H2,1-11H3 > <INCHI_KEY> LNAZSHAWQACDHT-UHFFFAOYSA-N > <FORMULA> C29H54O16 > <MOLECULAR_WEIGHT> 658.735 > <EXACT_MASS> 658.341185659 > <JCHEM_ACCEPTOR_COUNT> 16 > <JCHEM_ATOM_COUNT> 99 > <JCHEM_AVERAGE_POLARIZABILITY> 68.86414985207303 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 0 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 2-{[4,5-dimethoxy-2-(methoxymethyl)-6-{[4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxy}oxan-3-yl]oxy}-3,4,5-trimethoxy-6-(methoxymethyl)oxane > <ALOGPS_LOGP> 0.44 > <JCHEM_LOGP> 0.6001810309999975 > <ALOGPS_LOGS> -2.74 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 3 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA_STRONGEST_BASIC> -3.2438624339193063 > <JCHEM_POLAR_SURFACE_AREA> 147.68 > <JCHEM_REFRACTIVITY> 153.01319999999996 > <JCHEM_ROTATABLE_BOND_COUNT> 18 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 1.20e+00 g/l > <JCHEM_TRADITIONAL_IUPAC> 2-{[4,5-dimethoxy-2-(methoxymethyl)-6-{[4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxy}oxan-3-yl]oxy}-3,4,5-trimethoxy-6-(methoxymethyl)oxane > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0254627 (Methylcellulose)HMDB0254627 RDKit 3D Methylcellulose 99101 0 0 0 0 0 0 0 0999 V2000 -5.5589 -1.5794 5.0086 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3349 -0.8555 3.8386 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.4052 -1.4503 3.0175 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2074 -0.6346 1.7849 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7516 0.6492 2.0405 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2839 1.2085 0.8109 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4609 0.3127 0.1934 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1515 0.6753 0.0103 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1928 -0.1875 0.8153 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4500 0.6233 1.9100 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6010 1.1661 2.6769 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0068 1.9258 3.7016 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7744 -0.7664 0.0192 O 0 0 0 0 0 0 0 0 0 0 0 0 1.6313 0.1304 -0.6127 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4391 -0.6589 -1.4534 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7649 -0.6781 -1.0872 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7480 -0.5404 -2.2038 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9608 0.8324 -2.7303 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5760 1.7090 -1.8674 O 0 0 0 0 0 0 0 0 0 0 0 0 5.6995 2.9344 -2.5599 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9946 -1.0748 -1.8888 O 0 0 0 0 0 0 0 0 0 0 0 0 6.2735 -1.1172 -0.5452 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2754 0.1063 0.0825 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5331 0.3970 0.5983 C 0 0 0 0 0 0 0 0 0 0 0 0 5.2997 -2.0071 0.2394 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9496 -3.1911 0.5018 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1329 -3.4444 1.8520 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0260 -2.1060 -0.5241 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9582 -2.5254 0.2272 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2776 -3.6238 -0.3350 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7992 1.0957 -1.3964 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9214 2.4207 -1.0220 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3714 3.2512 -2.0271 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6785 0.6759 -1.4195 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3298 1.5639 -2.2288 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.9045 0.9172 -3.3126 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5267 1.3854 -0.0290 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1930 1.9835 -1.2372 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.7853 3.2134 -1.4267 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1885 0.0617 -0.3410 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3748 0.3303 -1.0491 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.2531 -0.2868 -2.3143 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4645 -0.6416 0.9523 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8958 -1.9205 0.6542 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.2064 -2.0528 1.1087 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6507 -1.7009 5.6275 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3319 -1.1027 5.6412 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9074 -2.6163 4.7866 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7830 -2.4647 2.7719 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4518 -1.6260 3.5783 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4171 -1.1370 1.1532 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8347 2.1530 1.1029 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0332 1.7063 0.4011 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7265 -1.0160 1.3296 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0514 -0.0855 2.5231 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0242 1.4791 1.5507 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6159 2.7402 3.2701 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7843 2.4093 4.3212 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6599 1.2630 4.2707 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2381 0.5927 0.1937 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9611 -0.0185 -0.2140 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3691 -1.1837 -3.0490 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4952 0.7587 -3.7145 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9668 1.2644 -3.0016 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6893 3.2885 -2.8420 H 0 0 0 0 0 0 0 0 0 0 0 0 6.2154 3.6917 -1.9348 H 0 0 0 0 0 0 0 0 0 0 0 0 6.3371 2.7793 -3.4785 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3134 -1.5371 -0.4642 H 0 0 0 0 0 0 0 0 0 0 0 0 8.3257 0.4351 -0.1693 H 0 0 0 0 0 0 0 0 0 0 0 0 7.8720 -0.3498 1.3601 H 0 0 0 0 0 0 0 0 0 0 0 0 7.5348 1.4027 1.0783 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0727 -1.5446 1.2318 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2138 -3.5086 2.4362 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6401 -4.4300 1.9315 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8737 -2.7000 2.2572 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1072 -2.7394 -1.4305 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4369 -3.8803 0.3451 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0028 -3.4622 -1.3745 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9394 -4.5397 -0.3138 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1201 1.0302 -2.4552 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4654 4.2959 -1.7383 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4002 2.9065 -2.2908 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7831 3.1279 -2.9850 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7816 -0.3416 -1.8449 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6254 0.1746 -2.8878 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1488 0.3556 -3.9149 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4233 1.5938 -4.0024 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2152 2.0221 0.5756 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9065 3.0912 -1.4077 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4267 3.8838 -0.6190 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4476 3.6013 -2.4084 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4876 -0.5486 -0.9440 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3509 0.1748 -2.8080 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.1557 -0.1683 -2.9199 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.9740 -1.3414 -2.1152 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2562 -0.0566 1.4709 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5204 -3.0922 0.8524 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.8860 -1.3172 0.6275 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.2995 -1.9394 2.2066 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 9 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 1 0 18 19 1 0 19 20 1 0 17 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 22 25 1 0 25 26 1 0 26 27 1 0 25 28 1 0 28 29 1 0 29 30 1 0 14 31 1 0 31 32 1 0 32 33 1 0 31 34 1 0 34 35 1 0 35 36 1 0 6 37 1 0 37 38 1 0 38 39 1 0 37 40 1 0 40 41 1 0 41 42 1 0 40 43 1 0 43 44 1 0 44 45 1 0 43 4 1 0 34 8 1 0 28 16 1 0 1 46 1 0 1 47 1 0 1 48 1 0 3 49 1 0 3 50 1 0 4 51 1 0 6 52 1 0 8 53 1 0 9 54 1 0 10 55 1 0 10 56 1 0 12 57 1 0 12 58 1 0 12 59 1 0 14 60 1 0 16 61 1 0 17 62 1 0 18 63 1 0 18 64 1 0 20 65 1 0 20 66 1 0 20 67 1 0 22 68 1 0 24 69 1 0 24 70 1 0 24 71 1 0 25 72 1 0 27 73 1 0 27 74 1 0 27 75 1 0 28 76 1 0 30 77 1 0 30 78 1 0 30 79 1 0 31 80 1 0 33 81 1 0 33 82 1 0 33 83 1 0 34 84 1 0 36 85 1 0 36 86 1 0 36 87 1 0 37 88 1 0 39 89 1 0 39 90 1 0 39 91 1 0 40 92 1 0 42 93 1 0 42 94 1 0 42 95 1 0 43 96 1 0 45 97 1 0 45 98 1 0 45 99 1 0 M END PDB for HMDB0254627 (Methylcellulose)HEADER PROTEIN 11-SEP-21 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 11-SEP-21 0 HETATM 1 C UNK 0 5.335 -3.080 0.000 0.00 0.00 C+0 HETATM 2 O UNK 0 5.335 -4.620 0.000 0.00 0.00 O+0 HETATM 3 C UNK 0 6.668 -5.390 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 6.668 -6.930 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 5.335 -7.700 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 5.335 -9.240 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 6.668 -10.010 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 8.002 -9.240 0.000 0.00 0.00 C+0 HETATM 9 O UNK 0 8.002 -7.700 0.000 0.00 0.00 O+0 HETATM 10 O UNK 0 9.336 -10.010 0.000 0.00 0.00 O+0 HETATM 11 C UNK 0 10.669 -9.240 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 12.003 -10.010 0.000 0.00 0.00 C+0 HETATM 13 O UNK 0 13.337 -9.240 0.000 0.00 0.00 O+0 HETATM 14 C UNK 0 13.337 -7.700 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 12.003 -6.930 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 10.669 -7.700 0.000 0.00 0.00 C+0 HETATM 17 O UNK 0 9.336 -6.930 0.000 0.00 0.00 O+0 HETATM 18 C UNK 0 9.336 -5.390 0.000 0.00 0.00 C+0 HETATM 19 O UNK 0 12.003 -5.390 0.000 0.00 0.00 O+0 HETATM 20 C UNK 0 13.337 -4.620 0.000 0.00 0.00 C+0 HETATM 21 O UNK 0 14.670 -6.930 0.000 0.00 0.00 O+0 HETATM 22 C UNK 0 16.004 -7.700 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 17.338 -6.930 0.000 0.00 0.00 C+0 HETATM 24 O UNK 0 18.672 -7.700 0.000 0.00 0.00 O+0 HETATM 25 C UNK 0 18.672 -9.240 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 17.338 -10.010 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 16.004 -9.240 0.000 0.00 0.00 C+0 HETATM 28 O UNK 0 14.670 -10.010 0.000 0.00 0.00 O+0 HETATM 29 C UNK 0 14.670 -11.550 0.000 0.00 0.00 C+0 HETATM 30 O UNK 0 17.338 -11.550 0.000 0.00 0.00 O+0 HETATM 31 C UNK 0 18.672 -12.320 0.000 0.00 0.00 C+0 HETATM 32 O UNK 0 20.005 -10.010 0.000 0.00 0.00 O+0 HETATM 33 C UNK 0 21.339 -9.240 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 17.338 -5.390 0.000 0.00 0.00 C+0 HETATM 35 O UNK 0 18.672 -4.620 0.000 0.00 0.00 O+0 HETATM 36 C UNK 0 18.672 -3.080 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 12.003 -11.550 0.000 0.00 0.00 C+0 HETATM 38 O UNK 0 10.669 -12.320 0.000 0.00 0.00 O+0 HETATM 39 C UNK 0 10.669 -13.860 0.000 0.00 0.00 C+0 HETATM 40 O UNK 0 6.668 -11.550 0.000 0.00 0.00 O+0 HETATM 41 C UNK 0 8.002 -12.320 0.000 0.00 0.00 C+0 HETATM 42 O UNK 0 4.001 -10.010 0.000 0.00 0.00 O+0 HETATM 43 C UNK 0 4.001 -11.550 0.000 0.00 0.00 C+0 HETATM 44 O UNK 0 4.001 -6.930 0.000 0.00 0.00 O+0 HETATM 45 C UNK 0 2.667 -7.700 0.000 0.00 0.00 C+0 CONECT 1 2 CONECT 2 1 3 CONECT 3 2 4 CONECT 4 3 5 9 CONECT 5 4 6 44 CONECT 6 5 7 42 CONECT 7 6 8 40 CONECT 8 7 9 10 CONECT 9 8 4 CONECT 10 8 11 CONECT 11 10 12 16 CONECT 12 11 13 37 CONECT 13 12 14 CONECT 14 13 15 21 CONECT 15 14 16 19 CONECT 16 15 11 17 CONECT 17 16 18 CONECT 18 17 CONECT 19 15 20 CONECT 20 19 CONECT 21 14 22 CONECT 22 21 23 27 CONECT 23 22 24 34 CONECT 24 23 25 CONECT 25 24 26 32 CONECT 26 25 27 30 CONECT 27 26 22 28 CONECT 28 27 29 CONECT 29 28 CONECT 30 26 31 CONECT 31 30 CONECT 32 25 33 CONECT 33 32 CONECT 34 23 35 CONECT 35 34 36 CONECT 36 35 CONECT 37 12 38 CONECT 38 37 39 CONECT 39 38 CONECT 40 7 41 CONECT 41 40 CONECT 42 6 43 CONECT 43 42 CONECT 44 5 45 CONECT 45 44 MASTER 0 0 0 0 0 0 0 0 45 0 94 0 END 3D PDB for HMDB0254627 (Methylcellulose)COMPND HMDB0254627 HETATM 1 C1 UNL 1 -5.559 -1.579 5.009 1.00 0.00 C HETATM 2 O1 UNL 1 -5.335 -0.855 3.839 1.00 0.00 O HETATM 3 C2 UNL 1 -4.405 -1.450 3.018 1.00 0.00 C HETATM 4 C3 UNL 1 -4.207 -0.635 1.785 1.00 0.00 C HETATM 5 O2 UNL 1 -3.752 0.649 2.041 1.00 0.00 O HETATM 6 C4 UNL 1 -3.284 1.209 0.811 1.00 0.00 C HETATM 7 O3 UNL 1 -2.461 0.313 0.193 1.00 0.00 O HETATM 8 C5 UNL 1 -1.151 0.675 0.010 1.00 0.00 C HETATM 9 C6 UNL 1 -0.193 -0.188 0.815 1.00 0.00 C HETATM 10 C7 UNL 1 0.450 0.623 1.910 1.00 0.00 C HETATM 11 O4 UNL 1 -0.601 1.166 2.677 1.00 0.00 O HETATM 12 C8 UNL 1 -0.007 1.926 3.702 1.00 0.00 C HETATM 13 O5 UNL 1 0.774 -0.766 0.019 1.00 0.00 O HETATM 14 C9 UNL 1 1.631 0.130 -0.613 1.00 0.00 C HETATM 15 O6 UNL 1 2.439 -0.659 -1.453 1.00 0.00 O HETATM 16 C10 UNL 1 3.765 -0.678 -1.087 1.00 0.00 C HETATM 17 C11 UNL 1 4.748 -0.540 -2.204 1.00 0.00 C HETATM 18 C12 UNL 1 4.961 0.832 -2.730 1.00 0.00 C HETATM 19 O7 UNL 1 5.576 1.709 -1.867 1.00 0.00 O HETATM 20 C13 UNL 1 5.700 2.934 -2.560 1.00 0.00 C HETATM 21 O8 UNL 1 5.995 -1.075 -1.889 1.00 0.00 O HETATM 22 C14 UNL 1 6.274 -1.117 -0.545 1.00 0.00 C HETATM 23 O9 UNL 1 6.275 0.106 0.082 1.00 0.00 O HETATM 24 C15 UNL 1 7.533 0.397 0.598 1.00 0.00 C HETATM 25 C16 UNL 1 5.300 -2.007 0.239 1.00 0.00 C HETATM 26 O10 UNL 1 5.950 -3.191 0.502 1.00 0.00 O HETATM 27 C17 UNL 1 6.133 -3.444 1.852 1.00 0.00 C HETATM 28 C18 UNL 1 4.026 -2.106 -0.524 1.00 0.00 C HETATM 29 O11 UNL 1 2.958 -2.525 0.227 1.00 0.00 O HETATM 30 C19 UNL 1 2.278 -3.624 -0.335 1.00 0.00 C HETATM 31 C20 UNL 1 0.799 1.096 -1.396 1.00 0.00 C HETATM 32 O12 UNL 1 0.921 2.421 -1.022 1.00 0.00 O HETATM 33 C21 UNL 1 1.371 3.251 -2.027 1.00 0.00 C HETATM 34 C22 UNL 1 -0.678 0.676 -1.419 1.00 0.00 C HETATM 35 O13 UNL 1 -1.330 1.564 -2.229 1.00 0.00 O HETATM 36 C23 UNL 1 -1.905 0.917 -3.313 1.00 0.00 C HETATM 37 C24 UNL 1 -4.527 1.385 -0.029 1.00 0.00 C HETATM 38 O14 UNL 1 -4.193 1.984 -1.237 1.00 0.00 O HETATM 39 C25 UNL 1 -4.785 3.213 -1.427 1.00 0.00 C HETATM 40 C26 UNL 1 -5.188 0.062 -0.341 1.00 0.00 C HETATM 41 O15 UNL 1 -6.375 0.330 -1.049 1.00 0.00 O HETATM 42 C27 UNL 1 -6.253 -0.287 -2.314 1.00 0.00 C HETATM 43 C28 UNL 1 -5.464 -0.642 0.952 1.00 0.00 C HETATM 44 O16 UNL 1 -5.896 -1.921 0.654 1.00 0.00 O HETATM 45 C29 UNL 1 -7.206 -2.053 1.109 1.00 0.00 C HETATM 46 H1 UNL 1 -4.651 -1.701 5.628 1.00 0.00 H HETATM 47 H2 UNL 1 -6.332 -1.103 5.641 1.00 0.00 H HETATM 48 H3 UNL 1 -5.907 -2.616 4.787 1.00 0.00 H HETATM 49 H4 UNL 1 -4.783 -2.465 2.772 1.00 0.00 H HETATM 50 H5 UNL 1 -3.452 -1.626 3.578 1.00 0.00 H HETATM 51 H6 UNL 1 -3.417 -1.137 1.153 1.00 0.00 H HETATM 52 H7 UNL 1 -2.835 2.153 1.103 1.00 0.00 H HETATM 53 H8 UNL 1 -1.033 1.706 0.401 1.00 0.00 H HETATM 54 H9 UNL 1 -0.726 -1.016 1.330 1.00 0.00 H HETATM 55 H10 UNL 1 1.051 -0.085 2.523 1.00 0.00 H HETATM 56 H11 UNL 1 1.024 1.479 1.551 1.00 0.00 H HETATM 57 H12 UNL 1 0.616 2.740 3.270 1.00 0.00 H HETATM 58 H13 UNL 1 -0.784 2.409 4.321 1.00 0.00 H HETATM 59 H14 UNL 1 0.660 1.263 4.271 1.00 0.00 H HETATM 60 H15 UNL 1 2.238 0.593 0.194 1.00 0.00 H HETATM 61 H16 UNL 1 3.961 -0.018 -0.214 1.00 0.00 H HETATM 62 H17 UNL 1 4.369 -1.184 -3.049 1.00 0.00 H HETATM 63 H18 UNL 1 5.495 0.759 -3.715 1.00 0.00 H HETATM 64 H19 UNL 1 3.967 1.264 -3.002 1.00 0.00 H HETATM 65 H20 UNL 1 4.689 3.288 -2.842 1.00 0.00 H HETATM 66 H21 UNL 1 6.215 3.692 -1.935 1.00 0.00 H HETATM 67 H22 UNL 1 6.337 2.779 -3.479 1.00 0.00 H HETATM 68 H23 UNL 1 7.313 -1.537 -0.464 1.00 0.00 H HETATM 69 H24 UNL 1 8.326 0.435 -0.169 1.00 0.00 H HETATM 70 H25 UNL 1 7.872 -0.350 1.360 1.00 0.00 H HETATM 71 H26 UNL 1 7.535 1.403 1.078 1.00 0.00 H HETATM 72 H27 UNL 1 5.073 -1.545 1.232 1.00 0.00 H HETATM 73 H28 UNL 1 5.214 -3.509 2.436 1.00 0.00 H HETATM 74 H29 UNL 1 6.640 -4.430 1.932 1.00 0.00 H HETATM 75 H30 UNL 1 6.874 -2.700 2.257 1.00 0.00 H HETATM 76 H31 UNL 1 4.107 -2.739 -1.431 1.00 0.00 H HETATM 77 H32 UNL 1 1.437 -3.880 0.345 1.00 0.00 H HETATM 78 H33 UNL 1 2.003 -3.462 -1.374 1.00 0.00 H HETATM 79 H34 UNL 1 2.939 -4.540 -0.314 1.00 0.00 H HETATM 80 H35 UNL 1 1.120 1.030 -2.455 1.00 0.00 H HETATM 81 H36 UNL 1 1.465 4.296 -1.738 1.00 0.00 H HETATM 82 H37 UNL 1 2.400 2.906 -2.291 1.00 0.00 H HETATM 83 H38 UNL 1 0.783 3.128 -2.985 1.00 0.00 H HETATM 84 H39 UNL 1 -0.782 -0.342 -1.845 1.00 0.00 H HETATM 85 H40 UNL 1 -2.625 0.175 -2.888 1.00 0.00 H HETATM 86 H41 UNL 1 -1.149 0.356 -3.915 1.00 0.00 H HETATM 87 H42 UNL 1 -2.423 1.594 -4.002 1.00 0.00 H HETATM 88 H43 UNL 1 -5.215 2.022 0.576 1.00 0.00 H HETATM 89 H44 UNL 1 -5.906 3.091 -1.408 1.00 0.00 H HETATM 90 H45 UNL 1 -4.427 3.884 -0.619 1.00 0.00 H HETATM 91 H46 UNL 1 -4.448 3.601 -2.408 1.00 0.00 H HETATM 92 H47 UNL 1 -4.488 -0.549 -0.944 1.00 0.00 H HETATM 93 H48 UNL 1 -5.351 0.175 -2.808 1.00 0.00 H HETATM 94 H49 UNL 1 -7.156 -0.168 -2.920 1.00 0.00 H HETATM 95 H50 UNL 1 -5.974 -1.341 -2.115 1.00 0.00 H HETATM 96 H51 UNL 1 -6.256 -0.057 1.471 1.00 0.00 H HETATM 97 H52 UNL 1 -7.520 -3.092 0.852 1.00 0.00 H HETATM 98 H53 UNL 1 -7.886 -1.317 0.627 1.00 0.00 H HETATM 99 H54 UNL 1 -7.299 -1.939 2.207 1.00 0.00 H CONECT 1 2 46 47 48 CONECT 2 3 CONECT 3 4 49 50 CONECT 4 5 43 51 CONECT 5 6 CONECT 6 7 37 52 CONECT 7 8 CONECT 8 9 34 53 CONECT 9 10 13 54 CONECT 10 11 55 56 CONECT 11 12 CONECT 12 57 58 59 CONECT 13 14 CONECT 14 15 31 60 CONECT 15 16 CONECT 16 17 28 61 CONECT 17 18 21 62 CONECT 18 19 63 64 CONECT 19 20 CONECT 20 65 66 67 CONECT 21 22 CONECT 22 23 25 68 CONECT 23 24 CONECT 24 69 70 71 CONECT 25 26 28 72 CONECT 26 27 CONECT 27 73 74 75 CONECT 28 29 76 CONECT 29 30 CONECT 30 77 78 79 CONECT 31 32 34 80 CONECT 32 33 CONECT 33 81 82 83 CONECT 34 35 84 CONECT 35 36 CONECT 36 85 86 87 CONECT 37 38 40 88 CONECT 38 39 CONECT 39 89 90 91 CONECT 40 41 43 92 CONECT 41 42 CONECT 42 93 94 95 CONECT 43 44 96 CONECT 44 45 CONECT 45 97 98 99 END SMILES for HMDB0254627 (Methylcellulose)COCC1OC(OC2C(COC)OC(OC3C(COC)OC(OC)C(OC)C3OC)C(OC)C2OC)C(OC)C(OC)C1OC INCHI for HMDB0254627 (Methylcellulose)InChI=1S/C29H54O16/c1-30-12-15-18(33-4)21(34-5)25(38-9)28(42-15)45-20-17(14-32-3)43-29(26(39-10)23(20)36-7)44-19-16(13-31-2)41-27(40-11)24(37-8)22(19)35-6/h15-29H,12-14H2,1-11H3 3D Structure for HMDB0254627 (Methylcellulose) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C29H54O16 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 658.735 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 658.341185659 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 2-{[4,5-dimethoxy-2-(methoxymethyl)-6-{[4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxy}oxan-3-yl]oxy}-3,4,5-trimethoxy-6-(methoxymethyl)oxane | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 2-{[4,5-dimethoxy-2-(methoxymethyl)-6-{[4,5,6-trimethoxy-2-(methoxymethyl)oxan-3-yl]oxy}oxan-3-yl]oxy}-3,4,5-trimethoxy-6-(methoxymethyl)oxane | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | COCC1OC(OC2C(COC)OC(OC3C(COC)OC(OC)C(OC)C3OC)C(OC)C2OC)C(OC)C(OC)C1OC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C29H54O16/c1-30-12-15-18(33-4)21(34-5)25(38-9)28(42-15)45-20-17(14-32-3)43-29(26(39-10)23(20)36-7)44-19-16(13-31-2)41-27(40-11)24(37-8)22(19)35-6/h15-29H,12-14H2,1-11H3 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | LNAZSHAWQACDHT-UHFFFAOYSA-N | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as oligosaccharides. These are carbohydrates made up of 3 to 10 monosaccharide units linked to each other through glycosidic bonds. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Organic oxygen compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Organooxygen compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Carbohydrates and carbohydrate conjugates | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Oligosaccharides | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aliphatic heteromonocyclic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesUnderivatized
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | 18944972 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Methyl cellulose | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 22950330 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|