Showing metabocard for 1,2-Di-(9Z,12Z-heptadecadienoyl)-3-(5Z,8Z,11Z,14Z-eicosatetraenoyl)-sn-glycerol (HMDB0258950)
Record Information | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Detected but not Quantified | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2021-09-11 20:49:15 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2021-09-26 23:16:12 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0258950 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | 1,2-Di-(9Z,12Z-heptadecadienoyl)-3-(5Z,8Z,11Z,14Z-eicosatetraenoyl)-sn-glycerol | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | 2,3-bis(heptadeca-9,12-dienoyloxy)propyl icosa-5,8,11,14-tetraenoate belongs to the class of organic compounds known as triacylglycerols. These are glycerides consisting of three fatty acid chains covalently bonded to a glycerol molecule through ester linkages. Based on a literature review very few articles have been published on 2,3-bis(heptadeca-9,12-dienoyloxy)propyl icosa-5,8,11,14-tetraenoate. This compound has been identified in human blood as reported by (PMID: 31557052 ). 1,2-di-(9z,12z-heptadecadienoyl)-3-(5z,8z,11z,14z-eicosatetraenoyl)-sn-glycerol is not a naturally occurring metabolite and is only found in those individuals exposed to this compound or its derivatives. Technically 1,2-Di-(9Z,12Z-heptadecadienoyl)-3-(5Z,8Z,11Z,14Z-eicosatetraenoyl)-sn-glycerol is part of the human exposome. The exposome can be defined as the collection of all the exposures of an individual in a lifetime and how those exposures relate to health. An individual's exposure begins before birth and includes insults from environmental and occupational sources. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0258950 (1,2-Di-(9Z,12Z-heptadecadienoyl)-3-(5Z,8Z,11Z,14Z-eicosatetraenoyl)-sn-glycerol)Mrv1652309112122492D 63 62 0 0 0 0 999 V2000 15.0609 -19.1646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.5183 -18.4780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.3416 -18.5308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.7990 -17.8442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.6223 -17.8970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.0797 -17.2104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.9030 -17.2632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.3604 -16.5766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.9945 -15.8372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.4519 -15.1506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.0860 -14.4112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.2627 -14.3584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.8968 -13.6190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.0735 -13.5662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.6161 -14.2528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.7928 -14.1999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.3354 -14.8865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.5121 -14.8337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.1461 -14.0943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3228 -14.0415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8654 -14.7281 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.9569 -13.3021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.1336 -13.2493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7677 -12.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9444 -12.4570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5785 -11.7176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7552 -11.6648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2978 -12.3514 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3893 -10.9254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5659 -10.8726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2000 -10.1332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3767 -10.0804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0108 -9.3409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1875 -9.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8216 -8.5487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9983 -8.4959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6324 -7.7565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8091 -7.7037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3517 -8.3903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5284 -8.3374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0710 -9.0240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4369 -9.7635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9795 -10.4501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1562 -10.3972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2251 -11.8233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.0484 -11.8761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.4143 -12.6155 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.5058 -11.1895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.3291 -11.2423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.7865 -10.5557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.6098 -10.6085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.0672 -9.9219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.8905 -9.9747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.3479 -9.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.1712 -9.3409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.6286 -8.6543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.4519 -8.7072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.9093 -8.0206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.5434 -7.2811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.0008 -6.5945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.6349 -5.8551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.8116 -5.8023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.4456 -5.0629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 6 5 1 4 0 0 0 6 7 2 0 0 0 0 7 8 1 0 0 0 0 9 8 1 4 0 0 0 9 10 2 0 0 0 0 10 11 1 0 0 0 0 12 11 1 4 0 0 0 12 13 2 0 0 0 0 13 14 1 0 0 0 0 15 14 1 4 0 0 0 15 16 2 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 20 21 2 0 0 0 0 20 22 1 0 0 0 0 22 23 1 0 0 0 0 23 24 1 0 0 0 0 24 25 1 0 0 0 0 25 26 1 0 0 0 0 26 27 1 0 0 0 0 27 28 2 0 0 0 0 27 29 1 0 0 0 0 29 30 1 0 0 0 0 30 31 1 0 0 0 0 31 32 1 0 0 0 0 32 33 1 0 0 0 0 33 34 1 0 0 0 0 34 35 1 0 0 0 0 36 35 1 4 0 0 0 36 37 2 0 0 0 0 37 38 1 0 0 0 0 39 38 1 4 0 0 0 39 40 2 0 0 0 0 40 41 1 0 0 0 0 41 42 1 0 0 0 0 42 43 1 0 0 0 0 43 44 1 0 0 0 0 24 45 1 0 0 0 0 45 46 1 0 0 0 0 46 47 2 0 0 0 0 46 48 1 0 0 0 0 48 49 1 0 0 0 0 49 50 1 0 0 0 0 50 51 1 0 0 0 0 51 52 1 0 0 0 0 52 53 1 0 0 0 0 53 54 1 0 0 0 0 55 54 1 4 0 0 0 55 56 2 0 0 0 0 56 57 1 0 0 0 0 58 57 1 4 0 0 0 58 59 2 0 0 0 0 59 60 1 0 0 0 0 60 61 1 0 0 0 0 61 62 1 0 0 0 0 62 63 1 0 0 0 0 M END 3D MOL for HMDB0258950 (1,2-Di-(9Z,12Z-heptadecadienoyl)-3-(5Z,8Z,11Z,14Z-eicosatetraenoyl)-sn-glycerol)HMDB0258950 RDKit 3D 1,2-Di-(9Z,12Z-heptadecadienoyl)-3-(5Z,8Z,11Z,14Z-eicosatetraenoyl)-sn-glycerol 157156 0 0 0 0 0 0 0 0999 V2000 6.4345 3.0066 2.5136 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0790 3.6981 3.8189 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6882 3.2662 4.2161 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3163 3.9501 5.5180 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9542 3.5662 5.9515 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0051 4.4773 6.1058 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6269 4.1428 6.5360 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4490 2.6885 6.7694 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4252 2.0042 6.0547 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6858 0.5418 6.2043 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3443 -0.1232 4.9150 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1515 0.4113 3.8018 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6475 0.2274 3.9113 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1966 0.8767 2.6472 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6578 0.7784 2.5143 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1383 1.4680 1.2756 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6343 1.0051 0.0006 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3608 1.2651 -1.0265 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4750 0.3187 -0.2823 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1523 -0.0567 -1.6174 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8464 -0.7737 -1.7050 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6438 -1.3975 -3.0302 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5264 -0.5107 -4.1251 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3122 -1.1014 -5.4003 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2477 -2.3517 -5.3738 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1783 -0.3365 -6.6425 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6322 -1.1078 -7.7913 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7793 -1.5376 -7.7115 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2117 -2.3752 -6.5938 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1648 -1.9349 -5.7539 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6647 -2.7025 -4.5907 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9879 -3.9898 -4.4046 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5483 -5.1861 -4.4003 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7310 -6.4271 -4.1948 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1746 -7.1442 -2.9844 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6067 -8.3940 -3.0420 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0358 -9.0527 -1.7971 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2089 -10.2398 -1.4596 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1940 -10.6030 -2.2305 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3859 -11.8115 -1.8455 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0596 -11.4178 -1.6167 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9171 -12.5903 -1.2220 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3337 -12.0585 -1.0185 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8590 -11.4297 -2.2869 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7796 0.0733 -1.2865 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0502 -0.2272 -0.1658 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4001 -1.2945 0.4537 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0742 0.5135 0.4075 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4772 1.7339 -0.3602 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3927 2.7433 -0.4325 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7956 3.9874 -1.2037 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9815 4.6380 -0.5698 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4773 5.8734 -1.2289 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5392 7.0224 -1.3047 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0902 7.5199 0.0034 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1865 7.5457 0.3222 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6475 8.0522 1.6584 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4036 7.0152 2.4177 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6583 7.2084 2.7976 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4097 6.1948 3.5430 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6584 5.7444 2.8092 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3915 4.7071 3.6010 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6425 4.2241 2.9329 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5017 2.8368 1.9610 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9541 2.0350 2.6906 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1009 3.7145 1.9470 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0347 4.7959 3.6598 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8037 3.4724 4.6277 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9693 3.6005 3.4429 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6621 2.1659 4.3892 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0416 3.6186 6.2748 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4165 5.0543 5.3916 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7399 2.5349 6.1416 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2248 5.5189 5.9143 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3883 4.7479 7.4282 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0618 4.5069 5.7392 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0541 2.2197 7.5343 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0025 2.5319 5.3058 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7709 0.4147 6.3880 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0598 0.0961 6.9989 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3540 -1.2316 4.9732 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7323 0.1348 4.6885 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9156 1.4695 3.5977 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8503 -0.1587 2.8746 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9813 0.8110 4.8026 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9539 -0.8059 4.0494 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6722 0.4128 1.8208 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9090 1.9440 2.6985 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9145 -0.3202 2.4012 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2308 1.1734 3.3825 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9093 2.5837 1.3152 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2707 1.4765 1.2285 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1308 0.8909 -2.2184 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9971 -0.6338 -2.0354 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9250 -1.6260 -0.9563 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7177 -2.0162 -2.9813 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5378 -2.0442 -3.2384 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4872 0.5315 -6.4066 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1519 0.1725 -6.9238 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3133 -2.0080 -7.9357 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8320 -0.5051 -8.7130 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4402 -0.6057 -7.7443 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0266 -2.0378 -8.7126 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8209 -3.3573 -6.4390 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5691 -0.9377 -5.9847 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4464 -2.0435 -3.6939 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7746 -2.8430 -4.6674 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9017 -3.9506 -4.2549 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6096 -5.2754 -4.5461 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8845 -7.0781 -5.0726 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6915 -6.1166 -4.0409 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1387 -6.6060 -2.0262 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6400 -8.9143 -3.9972 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1165 -9.3164 -1.8337 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9407 -8.3365 -0.9572 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4657 -10.7912 -0.5653 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9114 -10.0750 -3.1304 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4266 -12.5190 -2.6948 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7657 -12.2243 -0.8961 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4988 -10.9623 -2.5197 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0969 -10.6916 -0.7819 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5809 -12.9916 -0.2278 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8795 -13.4252 -1.9323 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2671 -11.2362 -0.2659 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0077 -12.8524 -0.6394 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5786 -12.0685 -3.1719 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4568 -10.4113 -2.4468 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9687 -11.3667 -2.2672 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7539 0.8679 1.4377 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9393 -0.1546 0.6323 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3282 2.1888 0.2363 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8120 1.5000 -1.3897 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0809 3.1066 0.5828 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5018 2.3535 -0.9277 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0102 3.6272 -2.2424 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0456 4.6966 -1.2865 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8642 4.7733 0.5231 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8272 3.8890 -0.6657 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3593 6.2219 -0.6180 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9179 5.6325 -2.2251 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1049 7.8729 -1.7884 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7148 6.8091 -1.9975 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8565 7.8646 0.6954 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9653 7.2099 -0.3480 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2478 8.3432 2.2554 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2866 8.9481 1.5826 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8754 6.0976 2.6438 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1302 8.1470 2.5437 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7163 6.5196 4.5524 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7996 5.2701 3.6942 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4779 5.4358 1.7748 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3293 6.6373 2.7564 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6529 5.0858 4.6110 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7315 3.8133 3.7626 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5317 4.6383 3.4886 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7520 4.5875 1.8901 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7394 3.1241 3.0282 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 2 3 6 7 1 0 7 8 1 0 8 9 2 3 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 2 0 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 2 0 24 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 2 3 30 31 1 0 31 32 1 0 32 33 2 3 33 34 1 0 34 35 1 0 35 36 2 3 36 37 1 0 37 38 1 0 38 39 2 3 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 21 45 1 0 45 46 1 0 46 47 2 0 46 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 2 3 56 57 1 0 57 58 1 0 58 59 2 3 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 1 64 1 0 1 65 1 0 1 66 1 0 2 67 1 0 2 68 1 0 3 69 1 0 3 70 1 0 4 71 1 0 4 72 1 0 5 73 1 0 6 74 1 0 7 75 1 0 7 76 1 0 8 77 1 0 9 78 1 0 10 79 1 0 10 80 1 0 11 81 1 0 11 82 1 0 12 83 1 0 12 84 1 0 13 85 1 0 13 86 1 0 14 87 1 0 14 88 1 0 15 89 1 0 15 90 1 0 16 91 1 0 16 92 1 0 20 93 1 0 20 94 1 0 21 95 1 0 22 96 1 0 22 97 1 0 26 98 1 0 26 99 1 0 27100 1 0 27101 1 0 28102 1 0 28103 1 0 29104 1 0 30105 1 0 31106 1 0 31107 1 0 32108 1 0 33109 1 0 34110 1 0 34111 1 0 35112 1 0 36113 1 0 37114 1 0 37115 1 0 38116 1 0 39117 1 0 40118 1 0 40119 1 0 41120 1 0 41121 1 0 42122 1 0 42123 1 0 43124 1 0 43125 1 0 44126 1 0 44127 1 0 44128 1 0 48129 1 0 48130 1 0 49131 1 0 49132 1 0 50133 1 0 50134 1 0 51135 1 0 51136 1 0 52137 1 0 52138 1 0 53139 1 0 53140 1 0 54141 1 0 54142 1 0 55143 1 0 56144 1 0 57145 1 0 57146 1 0 58147 1 0 59148 1 0 60149 1 0 60150 1 0 61151 1 0 61152 1 0 62153 1 0 62154 1 0 63155 1 0 63156 1 0 63157 1 0 M END 3D SDF for HMDB0258950 (1,2-Di-(9Z,12Z-heptadecadienoyl)-3-(5Z,8Z,11Z,14Z-eicosatetraenoyl)-sn-glycerol)Mrv1652309112122492D 63 62 0 0 0 0 999 V2000 15.0609 -19.1646 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.5183 -18.4780 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.3416 -18.5308 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.7990 -17.8442 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.6223 -17.8970 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.0797 -17.2104 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.9030 -17.2632 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.3604 -16.5766 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.9945 -15.8372 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.4519 -15.1506 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.0860 -14.4112 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.2627 -14.3584 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.8968 -13.6190 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.0735 -13.5662 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.6161 -14.2528 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.7928 -14.1999 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.3354 -14.8865 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.5121 -14.8337 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.1461 -14.0943 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3228 -14.0415 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8654 -14.7281 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.9569 -13.3021 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.1336 -13.2493 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7677 -12.5099 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9444 -12.4570 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5785 -11.7176 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7552 -11.6648 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2978 -12.3514 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.3893 -10.9254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5659 -10.8726 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2000 -10.1332 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3767 -10.0804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0108 -9.3409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1875 -9.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8216 -8.5487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9983 -8.4959 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6324 -7.7565 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8091 -7.7037 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3517 -8.3903 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5284 -8.3374 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0710 -9.0240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4369 -9.7635 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9795 -10.4501 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1562 -10.3972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2251 -11.8233 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.0484 -11.8761 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.4143 -12.6155 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.5058 -11.1895 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.3291 -11.2423 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.7865 -10.5557 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.6098 -10.6085 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.0672 -9.9219 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.8905 -9.9747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 17.3479 -9.2881 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.1712 -9.3409 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.6286 -8.6543 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.4519 -8.7072 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.9093 -8.0206 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.5434 -7.2811 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 20.0008 -6.5945 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.6349 -5.8551 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.8116 -5.8023 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.4456 -5.0629 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 4 5 1 0 0 0 0 6 5 1 4 0 0 0 6 7 2 0 0 0 0 7 8 1 0 0 0 0 9 8 1 4 0 0 0 9 10 2 0 0 0 0 10 11 1 0 0 0 0 12 11 1 4 0 0 0 12 13 2 0 0 0 0 13 14 1 0 0 0 0 15 14 1 4 0 0 0 15 16 2 0 0 0 0 16 17 1 0 0 0 0 17 18 1 0 0 0 0 18 19 1 0 0 0 0 19 20 1 0 0 0 0 20 21 2 0 0 0 0 20 22 1 0 0 0 0 22 23 1 0 0 0 0 23 24 1 0 0 0 0 24 25 1 0 0 0 0 25 26 1 0 0 0 0 26 27 1 0 0 0 0 27 28 2 0 0 0 0 27 29 1 0 0 0 0 29 30 1 0 0 0 0 30 31 1 0 0 0 0 31 32 1 0 0 0 0 32 33 1 0 0 0 0 33 34 1 0 0 0 0 34 35 1 0 0 0 0 36 35 1 4 0 0 0 36 37 2 0 0 0 0 37 38 1 0 0 0 0 39 38 1 4 0 0 0 39 40 2 0 0 0 0 40 41 1 0 0 0 0 41 42 1 0 0 0 0 42 43 1 0 0 0 0 43 44 1 0 0 0 0 24 45 1 0 0 0 0 45 46 1 0 0 0 0 46 47 2 0 0 0 0 46 48 1 0 0 0 0 48 49 1 0 0 0 0 49 50 1 0 0 0 0 50 51 1 0 0 0 0 51 52 1 0 0 0 0 52 53 1 0 0 0 0 53 54 1 0 0 0 0 55 54 1 4 0 0 0 55 56 2 0 0 0 0 56 57 1 0 0 0 0 58 57 1 4 0 0 0 58 59 2 0 0 0 0 59 60 1 0 0 0 0 60 61 1 0 0 0 0 61 62 1 0 0 0 0 62 63 1 0 0 0 0 M END > <DATABASE_ID> HMDB0258950 > <DATABASE_NAME> hmdb > <SMILES> CCCCCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCCCCCC=CCC=CCCCC)OC(=O)CCCCCCCC=CCC=CCCCC > <INCHI_IDENTIFIER> InChI=1S/C57H94O6/c1-4-7-10-13-16-19-22-25-28-29-30-33-35-38-41-44-47-50-56(59)62-53-54(63-57(60)51-48-45-42-39-36-32-27-24-21-18-15-12-9-6-3)52-61-55(58)49-46-43-40-37-34-31-26-23-20-17-14-11-8-5-2/h14-19,23-28,30,33,38,41,54H,4-13,20-22,29,31-32,34-37,39-40,42-53H2,1-3H3 > <INCHI_KEY> BMPVTDWOWBNPJU-UHFFFAOYSA-N > <FORMULA> C57H94O6 > <MOLECULAR_WEIGHT> 875.373 > <EXACT_MASS> 874.705040747 > <JCHEM_ACCEPTOR_COUNT> 3 > <JCHEM_ATOM_COUNT> 157 > <JCHEM_AVERAGE_POLARIZABILITY> 110.42350544059005 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 0 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 2,3-bis(heptadeca-9,12-dienoyloxy)propyl icosa-5,8,11,14-tetraenoate > <ALOGPS_LOGP> 10.26 > <JCHEM_LOGP> 18.696186421 > <ALOGPS_LOGS> -8.27 > <JCHEM_MDDR_LIKE_RULE> 0 > <JCHEM_NUMBER_OF_RINGS> 0 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA_STRONGEST_BASIC> -6.565907583667825 > <JCHEM_POLAR_SURFACE_AREA> 78.9 > <JCHEM_REFRACTIVITY> 277.8291 > <JCHEM_ROTATABLE_BOND_COUNT> 48 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 4.68e-06 g/l > <JCHEM_TRADITIONAL_IUPAC> 2,3-bis(heptadeca-9,12-dienoyloxy)propyl icosa-5,8,11,14-tetraenoate > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0258950 (1,2-Di-(9Z,12Z-heptadecadienoyl)-3-(5Z,8Z,11Z,14Z-eicosatetraenoyl)-sn-glycerol)HMDB0258950 RDKit 3D 1,2-Di-(9Z,12Z-heptadecadienoyl)-3-(5Z,8Z,11Z,14Z-eicosatetraenoyl)-sn-glycerol 157156 0 0 0 0 0 0 0 0999 V2000 6.4345 3.0066 2.5136 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0790 3.6981 3.8189 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6882 3.2662 4.2161 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3163 3.9501 5.5180 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9542 3.5662 5.9515 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0051 4.4773 6.1058 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6269 4.1428 6.5360 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4490 2.6885 6.7694 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4252 2.0042 6.0547 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6858 0.5418 6.2043 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3443 -0.1232 4.9150 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1515 0.4113 3.8018 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6475 0.2274 3.9113 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1966 0.8767 2.6472 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6578 0.7784 2.5143 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1383 1.4680 1.2756 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6343 1.0051 0.0006 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3608 1.2651 -1.0265 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4750 0.3187 -0.2823 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.1523 -0.0567 -1.6174 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8464 -0.7737 -1.7050 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6438 -1.3975 -3.0302 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5264 -0.5107 -4.1251 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3122 -1.1014 -5.4003 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2477 -2.3517 -5.3738 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1783 -0.3365 -6.6425 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6322 -1.1078 -7.7913 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7793 -1.5376 -7.7115 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2117 -2.3752 -6.5938 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1648 -1.9349 -5.7539 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6647 -2.7025 -4.5907 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9879 -3.9898 -4.4046 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5483 -5.1861 -4.4003 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7310 -6.4271 -4.1948 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1746 -7.1442 -2.9844 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6067 -8.3940 -3.0420 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0358 -9.0527 -1.7971 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2089 -10.2398 -1.4596 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1940 -10.6030 -2.2305 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3859 -11.8115 -1.8455 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0596 -11.4178 -1.6167 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9171 -12.5903 -1.2220 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3337 -12.0585 -1.0185 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8590 -11.4297 -2.2869 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7796 0.0733 -1.2865 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0502 -0.2272 -0.1658 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4001 -1.2945 0.4537 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0742 0.5135 0.4075 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4772 1.7339 -0.3602 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3927 2.7433 -0.4325 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7956 3.9874 -1.2037 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9815 4.6380 -0.5698 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4773 5.8734 -1.2289 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5392 7.0224 -1.3047 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0902 7.5199 0.0034 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1865 7.5457 0.3222 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6475 8.0522 1.6584 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4036 7.0152 2.4177 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6583 7.2084 2.7976 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4097 6.1948 3.5430 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6584 5.7444 2.8092 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.3915 4.7071 3.6010 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6425 4.2241 2.9329 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5017 2.8368 1.9610 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9541 2.0350 2.6906 H 0 0 0 0 0 0 0 0 0 0 0 0 7.1009 3.7145 1.9470 H 0 0 0 0 0 0 0 0 0 0 0 0 6.0347 4.7959 3.6598 H 0 0 0 0 0 0 0 0 0 0 0 0 6.8037 3.4724 4.6277 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9693 3.6005 3.4429 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6621 2.1659 4.3892 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0416 3.6186 6.2748 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4165 5.0543 5.3916 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7399 2.5349 6.1416 H 0 0 0 0 0 0 0 0 0 0 0 0 2.2248 5.5189 5.9143 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3883 4.7479 7.4282 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0618 4.5069 5.7392 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0541 2.2197 7.5343 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0025 2.5319 5.3058 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7709 0.4147 6.3880 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0598 0.0961 6.9989 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3540 -1.2316 4.9732 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7323 0.1348 4.6885 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9156 1.4695 3.5977 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8503 -0.1587 2.8746 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9813 0.8110 4.8026 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9539 -0.8059 4.0494 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6722 0.4128 1.8208 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.9090 1.9440 2.6985 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9145 -0.3202 2.4012 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2308 1.1734 3.3825 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9093 2.5837 1.3152 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2707 1.4765 1.2285 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1308 0.8909 -2.2184 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9971 -0.6338 -2.0354 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9250 -1.6260 -0.9563 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7177 -2.0162 -2.9813 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5378 -2.0442 -3.2384 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4872 0.5315 -6.4066 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1519 0.1725 -6.9238 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.3133 -2.0080 -7.9357 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8320 -0.5051 -8.7130 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4402 -0.6057 -7.7443 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0266 -2.0378 -8.7126 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8209 -3.3573 -6.4390 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5691 -0.9377 -5.9847 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4464 -2.0435 -3.6939 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7746 -2.8430 -4.6674 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9017 -3.9506 -4.2549 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6096 -5.2754 -4.5461 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8845 -7.0781 -5.0726 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6915 -6.1166 -4.0409 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1387 -6.6060 -2.0262 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6400 -8.9143 -3.9972 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1165 -9.3164 -1.8337 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9407 -8.3365 -0.9572 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4657 -10.7912 -0.5653 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9114 -10.0750 -3.1304 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4266 -12.5190 -2.6948 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7657 -12.2243 -0.8961 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4988 -10.9623 -2.5197 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0969 -10.6916 -0.7819 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.5809 -12.9916 -0.2278 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8795 -13.4252 -1.9323 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2671 -11.2362 -0.2659 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.0077 -12.8524 -0.6394 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5786 -12.0685 -3.1719 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4568 -10.4113 -2.4468 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9687 -11.3667 -2.2672 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7539 0.8679 1.4377 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9393 -0.1546 0.6323 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3282 2.1888 0.2363 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8120 1.5000 -1.3897 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0809 3.1066 0.5828 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5018 2.3535 -0.9277 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0102 3.6272 -2.2424 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0456 4.6966 -1.2865 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8642 4.7733 0.5231 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8272 3.8890 -0.6657 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3593 6.2219 -0.6180 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9179 5.6325 -2.2251 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1049 7.8729 -1.7884 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7148 6.8091 -1.9975 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8565 7.8646 0.6954 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9653 7.2099 -0.3480 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2478 8.3432 2.2554 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2866 8.9481 1.5826 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8754 6.0976 2.6438 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1302 8.1470 2.5437 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7163 6.5196 4.5524 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.7996 5.2701 3.6942 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4779 5.4358 1.7748 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3293 6.6373 2.7564 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6529 5.0858 4.6110 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7315 3.8133 3.7626 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.5317 4.6383 3.4886 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7520 4.5875 1.8901 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7394 3.1241 3.0282 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 4 5 1 0 5 6 2 3 6 7 1 0 7 8 1 0 8 9 2 3 9 10 1 0 10 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 2 0 17 19 1 0 19 20 1 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 2 0 24 26 1 0 26 27 1 0 27 28 1 0 28 29 1 0 29 30 2 3 30 31 1 0 31 32 1 0 32 33 2 3 33 34 1 0 34 35 1 0 35 36 2 3 36 37 1 0 37 38 1 0 38 39 2 3 39 40 1 0 40 41 1 0 41 42 1 0 42 43 1 0 43 44 1 0 21 45 1 0 45 46 1 0 46 47 2 0 46 48 1 0 48 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 55 56 2 3 56 57 1 0 57 58 1 0 58 59 2 3 59 60 1 0 60 61 1 0 61 62 1 0 62 63 1 0 1 64 1 0 1 65 1 0 1 66 1 0 2 67 1 0 2 68 1 0 3 69 1 0 3 70 1 0 4 71 1 0 4 72 1 0 5 73 1 0 6 74 1 0 7 75 1 0 7 76 1 0 8 77 1 0 9 78 1 0 10 79 1 0 10 80 1 0 11 81 1 0 11 82 1 0 12 83 1 0 12 84 1 0 13 85 1 0 13 86 1 0 14 87 1 0 14 88 1 0 15 89 1 0 15 90 1 0 16 91 1 0 16 92 1 0 20 93 1 0 20 94 1 0 21 95 1 0 22 96 1 0 22 97 1 0 26 98 1 0 26 99 1 0 27100 1 0 27101 1 0 28102 1 0 28103 1 0 29104 1 0 30105 1 0 31106 1 0 31107 1 0 32108 1 0 33109 1 0 34110 1 0 34111 1 0 35112 1 0 36113 1 0 37114 1 0 37115 1 0 38116 1 0 39117 1 0 40118 1 0 40119 1 0 41120 1 0 41121 1 0 42122 1 0 42123 1 0 43124 1 0 43125 1 0 44126 1 0 44127 1 0 44128 1 0 48129 1 0 48130 1 0 49131 1 0 49132 1 0 50133 1 0 50134 1 0 51135 1 0 51136 1 0 52137 1 0 52138 1 0 53139 1 0 53140 1 0 54141 1 0 54142 1 0 55143 1 0 56144 1 0 57145 1 0 57146 1 0 58147 1 0 59148 1 0 60149 1 0 60150 1 0 61151 1 0 61152 1 0 62153 1 0 62154 1 0 63155 1 0 63156 1 0 63157 1 0 M END PDB for HMDB0258950 (1,2-Di-(9Z,12Z-heptadecadienoyl)-3-(5Z,8Z,11Z,14Z-eicosatetraenoyl)-sn-glycerol)HEADER PROTEIN 11-SEP-21 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 11-SEP-21 0 HETATM 1 C UNK 0 28.114 -35.774 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 28.968 -34.492 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 30.504 -34.591 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 31.358 -33.309 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 32.895 -33.408 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 33.749 -32.126 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 35.286 -32.225 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 36.139 -30.943 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 35.456 -29.563 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 36.310 -28.281 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 35.627 -26.901 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 34.090 -26.802 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 33.407 -25.422 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 31.870 -25.323 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 31.017 -26.605 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 29.480 -26.507 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 28.626 -27.788 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 27.089 -27.690 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 26.406 -26.309 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 24.869 -26.211 0.000 0.00 0.00 C+0 HETATM 21 O UNK 0 24.015 -27.492 0.000 0.00 0.00 O+0 HETATM 22 O UNK 0 24.186 -24.831 0.000 0.00 0.00 O+0 HETATM 23 C UNK 0 22.649 -24.732 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 21.966 -23.352 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 20.430 -23.253 0.000 0.00 0.00 C+0 HETATM 26 O UNK 0 19.746 -21.873 0.000 0.00 0.00 O+0 HETATM 27 C UNK 0 18.210 -21.774 0.000 0.00 0.00 C+0 HETATM 28 O UNK 0 17.356 -23.056 0.000 0.00 0.00 O+0 HETATM 29 C UNK 0 17.527 -20.394 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 15.990 -20.295 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 15.307 -18.915 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 13.770 -18.817 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 13.087 -17.436 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 11.550 -17.338 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 10.867 -15.958 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 9.330 -15.859 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 8.647 -14.479 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 7.110 -14.380 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 6.256 -15.662 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 4.720 -15.563 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 3.866 -16.845 0.000 0.00 0.00 C+0 HETATM 42 C UNK 0 4.549 -18.225 0.000 0.00 0.00 C+0 HETATM 43 C UNK 0 3.695 -19.507 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 2.158 -19.408 0.000 0.00 0.00 C+0 HETATM 45 O UNK 0 22.820 -22.070 0.000 0.00 0.00 O+0 HETATM 46 C UNK 0 24.357 -22.169 0.000 0.00 0.00 C+0 HETATM 47 O UNK 0 25.040 -23.549 0.000 0.00 0.00 O+0 HETATM 48 C UNK 0 25.211 -20.887 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 26.748 -20.986 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 27.601 -19.704 0.000 0.00 0.00 C+0 HETATM 51 C UNK 0 29.138 -19.803 0.000 0.00 0.00 C+0 HETATM 52 C UNK 0 29.992 -18.521 0.000 0.00 0.00 C+0 HETATM 53 C UNK 0 31.529 -18.619 0.000 0.00 0.00 C+0 HETATM 54 C UNK 0 32.383 -17.338 0.000 0.00 0.00 C+0 HETATM 55 C UNK 0 33.920 -17.436 0.000 0.00 0.00 C+0 HETATM 56 C UNK 0 34.773 -16.155 0.000 0.00 0.00 C+0 HETATM 57 C UNK 0 36.310 -16.253 0.000 0.00 0.00 C+0 HETATM 58 C UNK 0 37.164 -14.972 0.000 0.00 0.00 C+0 HETATM 59 C UNK 0 36.481 -13.591 0.000 0.00 0.00 C+0 HETATM 60 C UNK 0 37.335 -12.310 0.000 0.00 0.00 C+0 HETATM 61 C UNK 0 36.652 -10.930 0.000 0.00 0.00 C+0 HETATM 62 C UNK 0 35.115 -10.831 0.000 0.00 0.00 C+0 HETATM 63 C UNK 0 34.432 -9.451 0.000 0.00 0.00 C+0 CONECT 1 2 CONECT 2 1 3 CONECT 3 2 4 CONECT 4 3 5 CONECT 5 4 6 CONECT 6 5 7 CONECT 7 6 8 CONECT 8 7 9 CONECT 9 8 10 CONECT 10 9 11 CONECT 11 10 12 CONECT 12 11 13 CONECT 13 12 14 CONECT 14 13 15 CONECT 15 14 16 CONECT 16 15 17 CONECT 17 16 18 CONECT 18 17 19 CONECT 19 18 20 CONECT 20 19 21 22 CONECT 21 20 CONECT 22 20 23 CONECT 23 22 24 CONECT 24 23 25 45 CONECT 25 24 26 CONECT 26 25 27 CONECT 27 26 28 29 CONECT 28 27 CONECT 29 27 30 CONECT 30 29 31 CONECT 31 30 32 CONECT 32 31 33 CONECT 33 32 34 CONECT 34 33 35 CONECT 35 34 36 CONECT 36 35 37 CONECT 37 36 38 CONECT 38 37 39 CONECT 39 38 40 CONECT 40 39 41 CONECT 41 40 42 CONECT 42 41 43 CONECT 43 42 44 CONECT 44 43 CONECT 45 24 46 CONECT 46 45 47 48 CONECT 47 46 CONECT 48 46 49 CONECT 49 48 50 CONECT 50 49 51 CONECT 51 50 52 CONECT 52 51 53 CONECT 53 52 54 CONECT 54 53 55 CONECT 55 54 56 CONECT 56 55 57 CONECT 57 56 58 CONECT 58 57 59 CONECT 59 58 60 CONECT 60 59 61 CONECT 61 60 62 CONECT 62 61 63 CONECT 63 62 MASTER 0 0 0 0 0 0 0 0 63 0 124 0 END 3D PDB for HMDB0258950 (1,2-Di-(9Z,12Z-heptadecadienoyl)-3-(5Z,8Z,11Z,14Z-eicosatetraenoyl)-sn-glycerol)COMPND HMDB0258950 HETATM 1 C1 UNL 1 6.434 3.007 2.514 1.00 0.00 C HETATM 2 C2 UNL 1 6.079 3.698 3.819 1.00 0.00 C HETATM 3 C3 UNL 1 4.688 3.266 4.216 1.00 0.00 C HETATM 4 C4 UNL 1 4.316 3.950 5.518 1.00 0.00 C HETATM 5 C5 UNL 1 2.954 3.566 5.952 1.00 0.00 C HETATM 6 C6 UNL 1 2.005 4.477 6.106 1.00 0.00 C HETATM 7 C7 UNL 1 0.627 4.143 6.536 1.00 0.00 C HETATM 8 C8 UNL 1 0.449 2.688 6.769 1.00 0.00 C HETATM 9 C9 UNL 1 -0.425 2.004 6.055 1.00 0.00 C HETATM 10 C10 UNL 1 -0.686 0.542 6.204 1.00 0.00 C HETATM 11 C11 UNL 1 -0.344 -0.123 4.915 1.00 0.00 C HETATM 12 C12 UNL 1 -1.151 0.411 3.802 1.00 0.00 C HETATM 13 C13 UNL 1 -2.647 0.227 3.911 1.00 0.00 C HETATM 14 C14 UNL 1 -3.197 0.877 2.647 1.00 0.00 C HETATM 15 C15 UNL 1 -4.658 0.778 2.514 1.00 0.00 C HETATM 16 C16 UNL 1 -5.138 1.468 1.276 1.00 0.00 C HETATM 17 C17 UNL 1 -4.634 1.005 0.001 1.00 0.00 C HETATM 18 O1 UNL 1 -5.361 1.265 -1.026 1.00 0.00 O HETATM 19 O2 UNL 1 -3.475 0.319 -0.282 1.00 0.00 O HETATM 20 C18 UNL 1 -3.152 -0.057 -1.617 1.00 0.00 C HETATM 21 C19 UNL 1 -1.846 -0.774 -1.705 1.00 0.00 C HETATM 22 C20 UNL 1 -1.644 -1.397 -3.030 1.00 0.00 C HETATM 23 O3 UNL 1 -1.526 -0.511 -4.125 1.00 0.00 O HETATM 24 C21 UNL 1 -1.312 -1.101 -5.400 1.00 0.00 C HETATM 25 O4 UNL 1 -1.248 -2.352 -5.374 1.00 0.00 O HETATM 26 C22 UNL 1 -1.178 -0.337 -6.643 1.00 0.00 C HETATM 27 C23 UNL 1 -0.632 -1.108 -7.791 1.00 0.00 C HETATM 28 C24 UNL 1 0.779 -1.538 -7.712 1.00 0.00 C HETATM 29 C25 UNL 1 1.212 -2.375 -6.594 1.00 0.00 C HETATM 30 C26 UNL 1 2.165 -1.935 -5.754 1.00 0.00 C HETATM 31 C27 UNL 1 2.665 -2.702 -4.591 1.00 0.00 C HETATM 32 C28 UNL 1 1.988 -3.990 -4.405 1.00 0.00 C HETATM 33 C29 UNL 1 2.548 -5.186 -4.400 1.00 0.00 C HETATM 34 C30 UNL 1 1.731 -6.427 -4.195 1.00 0.00 C HETATM 35 C31 UNL 1 2.175 -7.144 -2.984 1.00 0.00 C HETATM 36 C32 UNL 1 2.607 -8.394 -3.042 1.00 0.00 C HETATM 37 C33 UNL 1 3.036 -9.053 -1.797 1.00 0.00 C HETATM 38 C34 UNL 1 2.209 -10.240 -1.460 1.00 0.00 C HETATM 39 C35 UNL 1 1.194 -10.603 -2.230 1.00 0.00 C HETATM 40 C36 UNL 1 0.386 -11.812 -1.846 1.00 0.00 C HETATM 41 C37 UNL 1 -1.060 -11.418 -1.617 1.00 0.00 C HETATM 42 C38 UNL 1 -1.917 -12.590 -1.222 1.00 0.00 C HETATM 43 C39 UNL 1 -3.334 -12.058 -1.018 1.00 0.00 C HETATM 44 C40 UNL 1 -3.859 -11.430 -2.287 1.00 0.00 C HETATM 45 O5 UNL 1 -0.780 0.073 -1.287 1.00 0.00 O HETATM 46 C41 UNL 1 -0.050 -0.227 -0.166 1.00 0.00 C HETATM 47 O6 UNL 1 -0.400 -1.294 0.454 1.00 0.00 O HETATM 48 C42 UNL 1 1.074 0.514 0.407 1.00 0.00 C HETATM 49 C43 UNL 1 1.477 1.734 -0.360 1.00 0.00 C HETATM 50 C44 UNL 1 0.393 2.743 -0.432 1.00 0.00 C HETATM 51 C45 UNL 1 0.796 3.987 -1.204 1.00 0.00 C HETATM 52 C46 UNL 1 1.981 4.638 -0.570 1.00 0.00 C HETATM 53 C47 UNL 1 2.477 5.873 -1.229 1.00 0.00 C HETATM 54 C48 UNL 1 1.539 7.022 -1.305 1.00 0.00 C HETATM 55 C49 UNL 1 1.090 7.520 0.003 1.00 0.00 C HETATM 56 C50 UNL 1 -0.187 7.546 0.322 1.00 0.00 C HETATM 57 C51 UNL 1 -0.647 8.052 1.658 1.00 0.00 C HETATM 58 C52 UNL 1 -1.404 7.015 2.418 1.00 0.00 C HETATM 59 C53 UNL 1 -2.658 7.208 2.798 1.00 0.00 C HETATM 60 C54 UNL 1 -3.410 6.195 3.543 1.00 0.00 C HETATM 61 C55 UNL 1 -4.658 5.744 2.809 1.00 0.00 C HETATM 62 C56 UNL 1 -5.391 4.707 3.601 1.00 0.00 C HETATM 63 C57 UNL 1 -6.642 4.224 2.933 1.00 0.00 C HETATM 64 H1 UNL 1 5.502 2.837 1.961 1.00 0.00 H HETATM 65 H2 UNL 1 6.954 2.035 2.691 1.00 0.00 H HETATM 66 H3 UNL 1 7.101 3.715 1.947 1.00 0.00 H HETATM 67 H4 UNL 1 6.035 4.796 3.660 1.00 0.00 H HETATM 68 H5 UNL 1 6.804 3.472 4.628 1.00 0.00 H HETATM 69 H6 UNL 1 3.969 3.600 3.443 1.00 0.00 H HETATM 70 H7 UNL 1 4.662 2.166 4.389 1.00 0.00 H HETATM 71 H8 UNL 1 5.042 3.619 6.275 1.00 0.00 H HETATM 72 H9 UNL 1 4.416 5.054 5.392 1.00 0.00 H HETATM 73 H10 UNL 1 2.740 2.535 6.142 1.00 0.00 H HETATM 74 H11 UNL 1 2.225 5.519 5.914 1.00 0.00 H HETATM 75 H12 UNL 1 0.388 4.748 7.428 1.00 0.00 H HETATM 76 H13 UNL 1 -0.062 4.507 5.739 1.00 0.00 H HETATM 77 H14 UNL 1 1.054 2.220 7.534 1.00 0.00 H HETATM 78 H15 UNL 1 -1.002 2.532 5.306 1.00 0.00 H HETATM 79 H16 UNL 1 -1.771 0.415 6.388 1.00 0.00 H HETATM 80 H17 UNL 1 -0.060 0.096 6.999 1.00 0.00 H HETATM 81 H18 UNL 1 -0.354 -1.232 4.973 1.00 0.00 H HETATM 82 H19 UNL 1 0.732 0.135 4.689 1.00 0.00 H HETATM 83 H20 UNL 1 -0.916 1.470 3.598 1.00 0.00 H HETATM 84 H21 UNL 1 -0.850 -0.159 2.875 1.00 0.00 H HETATM 85 H22 UNL 1 -2.981 0.811 4.803 1.00 0.00 H HETATM 86 H23 UNL 1 -2.954 -0.806 4.049 1.00 0.00 H HETATM 87 H24 UNL 1 -2.672 0.413 1.821 1.00 0.00 H HETATM 88 H25 UNL 1 -2.909 1.944 2.699 1.00 0.00 H HETATM 89 H26 UNL 1 -4.915 -0.320 2.401 1.00 0.00 H HETATM 90 H27 UNL 1 -5.231 1.173 3.382 1.00 0.00 H HETATM 91 H28 UNL 1 -4.909 2.584 1.315 1.00 0.00 H HETATM 92 H29 UNL 1 -6.271 1.476 1.228 1.00 0.00 H HETATM 93 H30 UNL 1 -3.131 0.891 -2.218 1.00 0.00 H HETATM 94 H31 UNL 1 -3.997 -0.634 -2.035 1.00 0.00 H HETATM 95 H32 UNL 1 -1.925 -1.626 -0.956 1.00 0.00 H HETATM 96 H33 UNL 1 -0.718 -2.016 -2.981 1.00 0.00 H HETATM 97 H34 UNL 1 -2.538 -2.044 -3.238 1.00 0.00 H HETATM 98 H35 UNL 1 -0.487 0.531 -6.407 1.00 0.00 H HETATM 99 H36 UNL 1 -2.152 0.173 -6.924 1.00 0.00 H HETATM 100 H37 UNL 1 -1.313 -2.008 -7.936 1.00 0.00 H HETATM 101 H38 UNL 1 -0.832 -0.505 -8.713 1.00 0.00 H HETATM 102 H39 UNL 1 1.440 -0.606 -7.744 1.00 0.00 H HETATM 103 H40 UNL 1 1.027 -2.038 -8.713 1.00 0.00 H HETATM 104 H41 UNL 1 0.821 -3.357 -6.439 1.00 0.00 H HETATM 105 H42 UNL 1 2.569 -0.938 -5.985 1.00 0.00 H HETATM 106 H43 UNL 1 2.446 -2.043 -3.694 1.00 0.00 H HETATM 107 H44 UNL 1 3.775 -2.843 -4.667 1.00 0.00 H HETATM 108 H45 UNL 1 0.902 -3.951 -4.255 1.00 0.00 H HETATM 109 H46 UNL 1 3.610 -5.275 -4.546 1.00 0.00 H HETATM 110 H47 UNL 1 1.884 -7.078 -5.073 1.00 0.00 H HETATM 111 H48 UNL 1 0.692 -6.117 -4.041 1.00 0.00 H HETATM 112 H49 UNL 1 2.139 -6.606 -2.026 1.00 0.00 H HETATM 113 H50 UNL 1 2.640 -8.914 -3.997 1.00 0.00 H HETATM 114 H51 UNL 1 4.117 -9.316 -1.834 1.00 0.00 H HETATM 115 H52 UNL 1 2.941 -8.337 -0.957 1.00 0.00 H HETATM 116 H53 UNL 1 2.466 -10.791 -0.565 1.00 0.00 H HETATM 117 H54 UNL 1 0.911 -10.075 -3.130 1.00 0.00 H HETATM 118 H55 UNL 1 0.427 -12.519 -2.695 1.00 0.00 H HETATM 119 H56 UNL 1 0.766 -12.224 -0.896 1.00 0.00 H HETATM 120 H57 UNL 1 -1.499 -10.962 -2.520 1.00 0.00 H HETATM 121 H58 UNL 1 -1.097 -10.692 -0.782 1.00 0.00 H HETATM 122 H59 UNL 1 -1.581 -12.992 -0.228 1.00 0.00 H HETATM 123 H60 UNL 1 -1.879 -13.425 -1.932 1.00 0.00 H HETATM 124 H61 UNL 1 -3.267 -11.236 -0.266 1.00 0.00 H HETATM 125 H62 UNL 1 -4.008 -12.852 -0.639 1.00 0.00 H HETATM 126 H63 UNL 1 -3.579 -12.069 -3.172 1.00 0.00 H HETATM 127 H64 UNL 1 -3.457 -10.411 -2.447 1.00 0.00 H HETATM 128 H65 UNL 1 -4.969 -11.367 -2.267 1.00 0.00 H HETATM 129 H66 UNL 1 0.754 0.868 1.438 1.00 0.00 H HETATM 130 H67 UNL 1 1.939 -0.155 0.632 1.00 0.00 H HETATM 131 H68 UNL 1 2.328 2.189 0.236 1.00 0.00 H HETATM 132 H69 UNL 1 1.812 1.500 -1.390 1.00 0.00 H HETATM 133 H70 UNL 1 0.081 3.107 0.583 1.00 0.00 H HETATM 134 H71 UNL 1 -0.502 2.354 -0.928 1.00 0.00 H HETATM 135 H72 UNL 1 1.010 3.627 -2.242 1.00 0.00 H HETATM 136 H73 UNL 1 -0.046 4.697 -1.286 1.00 0.00 H HETATM 137 H74 UNL 1 1.864 4.773 0.523 1.00 0.00 H HETATM 138 H75 UNL 1 2.827 3.889 -0.666 1.00 0.00 H HETATM 139 H76 UNL 1 3.359 6.222 -0.618 1.00 0.00 H HETATM 140 H77 UNL 1 2.918 5.633 -2.225 1.00 0.00 H HETATM 141 H78 UNL 1 2.105 7.873 -1.788 1.00 0.00 H HETATM 142 H79 UNL 1 0.715 6.809 -1.997 1.00 0.00 H HETATM 143 H80 UNL 1 1.857 7.865 0.695 1.00 0.00 H HETATM 144 H81 UNL 1 -0.965 7.210 -0.348 1.00 0.00 H HETATM 145 H82 UNL 1 0.248 8.343 2.255 1.00 0.00 H HETATM 146 H83 UNL 1 -1.287 8.948 1.583 1.00 0.00 H HETATM 147 H84 UNL 1 -0.875 6.098 2.644 1.00 0.00 H HETATM 148 H85 UNL 1 -3.130 8.147 2.544 1.00 0.00 H HETATM 149 H86 UNL 1 -3.716 6.520 4.552 1.00 0.00 H HETATM 150 H87 UNL 1 -2.800 5.270 3.694 1.00 0.00 H HETATM 151 H88 UNL 1 -4.478 5.436 1.775 1.00 0.00 H HETATM 152 H89 UNL 1 -5.329 6.637 2.756 1.00 0.00 H HETATM 153 H90 UNL 1 -5.653 5.086 4.611 1.00 0.00 H HETATM 154 H91 UNL 1 -4.731 3.813 3.763 1.00 0.00 H HETATM 155 H92 UNL 1 -7.532 4.638 3.489 1.00 0.00 H HETATM 156 H93 UNL 1 -6.752 4.587 1.890 1.00 0.00 H HETATM 157 H94 UNL 1 -6.739 3.124 3.028 1.00 0.00 H CONECT 1 2 64 65 66 CONECT 2 3 67 68 CONECT 3 4 69 70 CONECT 4 5 71 72 CONECT 5 6 6 73 CONECT 6 7 74 CONECT 7 8 75 76 CONECT 8 9 9 77 CONECT 9 10 78 CONECT 10 11 79 80 CONECT 11 12 81 82 CONECT 12 13 83 84 CONECT 13 14 85 86 CONECT 14 15 87 88 CONECT 15 16 89 90 CONECT 16 17 91 92 CONECT 17 18 18 19 CONECT 19 20 CONECT 20 21 93 94 CONECT 21 22 45 95 CONECT 22 23 96 97 CONECT 23 24 CONECT 24 25 25 26 CONECT 26 27 98 99 CONECT 27 28 100 101 CONECT 28 29 102 103 CONECT 29 30 30 104 CONECT 30 31 105 CONECT 31 32 106 107 CONECT 32 33 33 108 CONECT 33 34 109 CONECT 34 35 110 111 CONECT 35 36 36 112 CONECT 36 37 113 CONECT 37 38 114 115 CONECT 38 39 39 116 CONECT 39 40 117 CONECT 40 41 118 119 CONECT 41 42 120 121 CONECT 42 43 122 123 CONECT 43 44 124 125 CONECT 44 126 127 128 CONECT 45 46 CONECT 46 47 47 48 CONECT 48 49 129 130 CONECT 49 50 131 132 CONECT 50 51 133 134 CONECT 51 52 135 136 CONECT 52 53 137 138 CONECT 53 54 139 140 CONECT 54 55 141 142 CONECT 55 56 56 143 CONECT 56 57 144 CONECT 57 58 145 146 CONECT 58 59 59 147 CONECT 59 60 148 CONECT 60 61 149 150 CONECT 61 62 151 152 CONECT 62 63 153 154 CONECT 63 155 156 157 END SMILES for HMDB0258950 (1,2-Di-(9Z,12Z-heptadecadienoyl)-3-(5Z,8Z,11Z,14Z-eicosatetraenoyl)-sn-glycerol)CCCCCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCCCCCC=CCC=CCCCC)OC(=O)CCCCCCCC=CCC=CCCCC INCHI for HMDB0258950 (1,2-Di-(9Z,12Z-heptadecadienoyl)-3-(5Z,8Z,11Z,14Z-eicosatetraenoyl)-sn-glycerol)InChI=1S/C57H94O6/c1-4-7-10-13-16-19-22-25-28-29-30-33-35-38-41-44-47-50-56(59)62-53-54(63-57(60)51-48-45-42-39-36-32-27-24-21-18-15-12-9-6-3)52-61-55(58)49-46-43-40-37-34-31-26-23-20-17-14-11-8-5-2/h14-19,23-28,30,33,38,41,54H,4-13,20-22,29,31-32,34-37,39-40,42-53H2,1-3H3 Structure for HMDB0258950 (1,2-Di-(9Z,12Z-heptadecadienoyl)-3-(5Z,8Z,11Z,14Z-eicosatetraenoyl)-sn-glycerol)3D Structure for HMDB0258950 (1,2-Di-(9Z,12Z-heptadecadienoyl)-3-(5Z,8Z,11Z,14Z-eicosatetraenoyl)-sn-glycerol) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C57H94O6 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 875.373 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 874.705040747 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 2,3-bis(heptadeca-9,12-dienoyloxy)propyl icosa-5,8,11,14-tetraenoate | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 2,3-bis(heptadeca-9,12-dienoyloxy)propyl icosa-5,8,11,14-tetraenoate | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CCCCCC=CCC=CCC=CCC=CCCCC(=O)OCC(COC(=O)CCCCCCCC=CCC=CCCCC)OC(=O)CCCCCCCC=CCC=CCCCC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C57H94O6/c1-4-7-10-13-16-19-22-25-28-29-30-33-35-38-41-44-47-50-56(59)62-53-54(63-57(60)51-48-45-42-39-36-32-27-24-21-18-15-12-9-6-3)52-61-55(58)49-46-43-40-37-34-31-26-23-20-17-14-11-8-5-2/h14-19,23-28,30,33,38,41,54H,4-13,20-22,29,31-32,34-37,39-40,42-53H2,1-3H3 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | BMPVTDWOWBNPJU-UHFFFAOYSA-N | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as triacylglycerols. These are glycerides consisting of three fatty acid chains covalently bonded to a glycerol molecule through ester linkages. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Lipids and lipid-like molecules | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Glycerolipids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Triradylcglycerols | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Triacylglycerols | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aliphatic acyclic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesUnderivatized
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | 21233097 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | |||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References |
|