| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter). Predicted by Afia on May 17, 2022. Predicted by Afia on May 17, 2022. | 2.07 minutes | 32390414 |
| Predicted by Siyang on May 30, 2022 | 8.4233 minutes | 33406817 |
| Predicted by Siyang using ReTip algorithm on June 8, 2022 | 5.95 minutes | 32390414 |
| Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 431.4 seconds | 40023050 |
| Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 278.3 seconds | 40023050 |
| Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 61.4 seconds | 40023050 |
| Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 176.4 seconds | 40023050 |
| RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 51.8 seconds | 40023050 |
| Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 272.4 seconds | 40023050 |
| BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 243.5 seconds | 40023050 |
| HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 989.4 seconds | 40023050 |
| UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 541.8 seconds | 40023050 |
| BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 33.6 seconds | 40023050 |
| UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 598.3 seconds | 40023050 |
| SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 185.5 seconds | 40023050 |
| RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 200.7 seconds | 40023050 |
| MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 838.9 seconds | 40023050 |
| KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 664.1 seconds | 40023050 |
| Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 279.9 seconds | 40023050 |
| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| 2-((3-Aminopropyl)amino)ethanethiol,1TMS,isomer #1 | C[Si](C)(C)SCCNCCCN | 1496.8 | Semi standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,1TMS,isomer #1 | C[Si](C)(C)SCCNCCCN | 1507.2 | Standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,1TMS,isomer #1 | C[Si](C)(C)SCCNCCCN | 2333.9 | Standard polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,1TMS,isomer #2 | C[Si](C)(C)NCCCNCCS | 1522.9 | Semi standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,1TMS,isomer #2 | C[Si](C)(C)NCCCNCCS | 1357.2 | Standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,1TMS,isomer #2 | C[Si](C)(C)NCCCNCCS | 1927.3 | Standard polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,1TMS,isomer #3 | C[Si](C)(C)N(CCS)CCCN | 1464.7 | Semi standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,1TMS,isomer #3 | C[Si](C)(C)N(CCS)CCCN | 1369.1 | Standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,1TMS,isomer #3 | C[Si](C)(C)N(CCS)CCCN | 2123.3 | Standard polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,2TMS,isomer #1 | C[Si](C)(C)NCCCNCCS[Si](C)(C)C | 1668.9 | Semi standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,2TMS,isomer #1 | C[Si](C)(C)NCCCNCCS[Si](C)(C)C | 1719.3 | Standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,2TMS,isomer #1 | C[Si](C)(C)NCCCNCCS[Si](C)(C)C | 1904.8 | Standard polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,2TMS,isomer #2 | C[Si](C)(C)SCCN(CCCN)[Si](C)(C)C | 1621.6 | Semi standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,2TMS,isomer #2 | C[Si](C)(C)SCCN(CCCN)[Si](C)(C)C | 1702.4 | Standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,2TMS,isomer #2 | C[Si](C)(C)SCCN(CCCN)[Si](C)(C)C | 2182.0 | Standard polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,2TMS,isomer #3 | C[Si](C)(C)N(CCCNCCS)[Si](C)(C)C | 1687.2 | Semi standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,2TMS,isomer #3 | C[Si](C)(C)N(CCCNCCS)[Si](C)(C)C | 1656.8 | Standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,2TMS,isomer #3 | C[Si](C)(C)N(CCCNCCS)[Si](C)(C)C | 1932.0 | Standard polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,2TMS,isomer #4 | C[Si](C)(C)NCCCN(CCS)[Si](C)(C)C | 1622.8 | Semi standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,2TMS,isomer #4 | C[Si](C)(C)NCCCN(CCS)[Si](C)(C)C | 1618.6 | Standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,2TMS,isomer #4 | C[Si](C)(C)NCCCN(CCS)[Si](C)(C)C | 1825.4 | Standard polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,3TMS,isomer #1 | C[Si](C)(C)SCCNCCCN([Si](C)(C)C)[Si](C)(C)C | 1864.1 | Semi standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,3TMS,isomer #1 | C[Si](C)(C)SCCNCCCN([Si](C)(C)C)[Si](C)(C)C | 1902.8 | Standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,3TMS,isomer #1 | C[Si](C)(C)SCCNCCCN([Si](C)(C)C)[Si](C)(C)C | 1841.4 | Standard polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,3TMS,isomer #2 | C[Si](C)(C)NCCCN(CCS[Si](C)(C)C)[Si](C)(C)C | 1776.1 | Semi standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,3TMS,isomer #2 | C[Si](C)(C)NCCCN(CCS[Si](C)(C)C)[Si](C)(C)C | 1902.5 | Standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,3TMS,isomer #2 | C[Si](C)(C)NCCCN(CCS[Si](C)(C)C)[Si](C)(C)C | 1828.1 | Standard polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,3TMS,isomer #3 | C[Si](C)(C)N(CCS)CCCN([Si](C)(C)C)[Si](C)(C)C | 1880.4 | Semi standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,3TMS,isomer #3 | C[Si](C)(C)N(CCS)CCCN([Si](C)(C)C)[Si](C)(C)C | 1878.4 | Standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,3TMS,isomer #3 | C[Si](C)(C)N(CCS)CCCN([Si](C)(C)C)[Si](C)(C)C | 1845.7 | Standard polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,4TMS,isomer #1 | C[Si](C)(C)SCCN(CCCN([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 2006.4 | Semi standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,4TMS,isomer #1 | C[Si](C)(C)SCCN(CCCN([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 2085.7 | Standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,4TMS,isomer #1 | C[Si](C)(C)SCCN(CCCN([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C | 1810.5 | Standard polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)SCCNCCCN | 1729.8 | Semi standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)SCCNCCCN | 1726.8 | Standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,1TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)SCCNCCCN | 2412.0 | Standard polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCCCNCCS | 1731.7 | Semi standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCCCNCCS | 1597.7 | Standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,1TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCCCNCCS | 2066.5 | Standard polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(CCS)CCCN | 1695.0 | Semi standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(CCS)CCCN | 1599.5 | Standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,1TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(CCS)CCCN | 2247.0 | Standard polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NCCCNCCS[Si](C)(C)C(C)(C)C | 2162.9 | Semi standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NCCCNCCS[Si](C)(C)C(C)(C)C | 2131.6 | Standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,2TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)NCCCNCCS[Si](C)(C)C(C)(C)C | 2046.2 | Standard polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)SCCN(CCCN)[Si](C)(C)C(C)(C)C | 2104.7 | Semi standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)SCCN(CCCN)[Si](C)(C)C(C)(C)C | 2127.6 | Standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,2TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)SCCN(CCCN)[Si](C)(C)C(C)(C)C | 2233.2 | Standard polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(CCCNCCS)[Si](C)(C)C(C)(C)C | 2104.7 | Semi standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(CCCNCCS)[Si](C)(C)C(C)(C)C | 2046.9 | Standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,2TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(CCCNCCS)[Si](C)(C)C(C)(C)C | 2080.0 | Standard polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NCCCN(CCS)[Si](C)(C)C(C)(C)C | 2093.7 | Semi standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NCCCN(CCS)[Si](C)(C)C(C)(C)C | 2073.5 | Standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,2TBDMS,isomer #4 | CC(C)(C)[Si](C)(C)NCCCN(CCS)[Si](C)(C)C(C)(C)C | 2040.0 | Standard polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)SCCNCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2535.7 | Semi standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)SCCNCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2500.4 | Standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,3TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)SCCNCCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2138.0 | Standard polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCCCN(CCS[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2499.6 | Semi standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCCCN(CCS[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2493.6 | Standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,3TBDMS,isomer #2 | CC(C)(C)[Si](C)(C)NCCCN(CCS[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2169.4 | Standard polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(CCS)CCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2499.8 | Semi standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(CCS)CCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2476.8 | Standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,3TBDMS,isomer #3 | CC(C)(C)[Si](C)(C)N(CCS)CCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2131.0 | Standard polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)SCCN(CCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2875.2 | Semi standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)SCCN(CCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2815.6 | Standard non polar | 33892256 |
| 2-((3-Aminopropyl)amino)ethanethiol,4TBDMS,isomer #1 | CC(C)(C)[Si](C)(C)SCCN(CCCN([Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C)[Si](C)(C)C(C)(C)C | 2241.8 | Standard polar | 33892256 |