Showing metabocard for Peonidin 3-feruloyl-diglucoside 5-glucoside (HMDB0301897)
Record Information | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Expected but not Quantified | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2021-09-23 03:27:13 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2021-09-23 03:27:13 UTC | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0301897 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Peonidin 3-feruloyl-diglucoside 5-glucoside | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Peonidin 3-feruloyl-diglucoside 5-glucoside is a member of the class of compounds known as anthocyanidin 3-o-6-p-coumaroyl glycosides. Anthocyanidin 3-o-6-p-coumaroyl glycosides are anthocyanidin 3-O-glycosides where the carbohydrate moiety is esterified at the C6 position with a p-coumaric acid. P-coumaric acid is an organic derivative of cinnamic acid, that carries a hydroxyl group at the 4-position of the benzene ring. Peonidin 3-feruloyl-diglucoside 5-glucoside is practically insoluble (in water) and a very weakly acidic compound (based on its pKa). Peonidin 3-feruloyl-diglucoside 5-glucoside can be found in sweet potato, which makes peonidin 3-feruloyl-diglucoside 5-glucoside a potential biomarker for the consumption of this food product. | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0301897 (Peonidin 3-feruloyl-diglucoside 5-glucoside)Mrv0541 02241212262D 68 74 0 0 0 0 999 V2000 -2.8286 -0.7955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5430 -1.2080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5430 -2.0330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8286 -2.4456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1141 -2.0330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1141 -1.2080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3996 -0.7955 0.0000 O 0 3 0 0 0 0 0 0 0 0 0 0 -1.3996 -2.4456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6852 -2.0330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6852 -1.2080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0293 -0.7955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7438 0.4420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0293 0.0295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7438 -1.2080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4582 -0.7955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4582 0.0295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2575 -0.7955 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8286 -3.2706 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7438 1.2670 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4582 1.6795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1727 0.4420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0293 -3.8745 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4418 -4.5889 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.2668 -4.5889 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6793 -3.8745 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.2668 -3.1600 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.4418 -3.1600 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0293 -2.4455 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0293 -5.3034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6793 -5.3034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5043 -3.8745 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2575 -3.2706 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9720 -3.6831 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.9720 -4.5081 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.2575 -4.9206 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.5431 -4.5081 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.5431 -3.6831 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.8286 -4.9206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6865 -3.2706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6865 -4.9206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2575 -5.7456 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4009 -3.6831 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4418 -8.4929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2727 -8.9054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2727 -9.7304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4418 -10.1429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1563 -9.7304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1563 -8.9054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4418 -10.9679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9871 -10.1429 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4418 -7.6679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2727 -7.2554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2727 -6.4304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4418 -6.0179 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9872 -6.0179 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9168 -3.1600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7418 -3.1600 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 4.1543 -2.4455 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 3.7418 -1.7310 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.9168 -1.7310 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5043 -2.4455 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6793 -2.4455 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5043 -1.0166 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1543 -3.8744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9793 -2.4455 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1543 -1.0165 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9793 -3.8744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1563 -11.3804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 6 2 0 0 0 0 2 3 2 0 0 0 0 3 4 1 0 0 0 0 4 5 2 0 0 0 0 7 6 1 0 0 0 0 5 6 1 0 0 0 0 5 8 1 0 0 0 0 7 10 2 0 0 0 0 8 9 2 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 13 11 2 0 0 0 0 11 14 1 0 0 0 0 12 13 1 0 0 0 0 12 16 2 0 0 0 0 14 15 2 0 0 0 0 15 16 1 0 0 0 0 2 17 1 0 0 0 0 4 18 1 0 0 0 0 9 28 1 0 0 0 0 12 19 1 0 0 0 0 19 20 1 0 0 0 0 16 21 1 0 0 0 0 22 23 1 0 0 0 0 22 27 1 0 0 0 0 23 24 1 0 0 0 0 23 29 1 1 0 0 0 25 24 1 0 0 0 0 24 30 1 6 0 0 0 25 26 1 0 0 0 0 25 31 1 1 0 0 0 26 27 1 0 0 0 0 26 62 1 6 0 0 0 27 28 1 1 0 0 0 37 18 1 1 0 0 0 32 33 1 0 0 0 0 32 37 1 0 0 0 0 33 34 1 0 0 0 0 35 34 1 0 0 0 0 35 36 1 0 0 0 0 36 37 1 0 0 0 0 36 38 1 6 0 0 0 33 39 1 1 0 0 0 34 40 1 6 0 0 0 35 41 1 1 0 0 0 39 42 1 0 0 0 0 43 44 2 0 0 0 0 44 45 1 0 0 0 0 45 46 2 0 0 0 0 46 47 1 0 0 0 0 47 48 2 0 0 0 0 43 48 1 0 0 0 0 46 49 1 0 0 0 0 45 50 1 0 0 0 0 43 51 1 0 0 0 0 51 52 2 0 0 0 0 52 53 1 0 0 0 0 53 54 1 0 0 0 0 53 55 2 0 0 0 0 29 54 1 0 0 0 0 56 57 1 0 0 0 0 56 61 1 0 0 0 0 57 58 1 0 0 0 0 59 58 1 0 0 0 0 59 60 1 0 0 0 0 60 61 1 0 0 0 0 61 62 1 1 0 0 0 60 63 1 6 0 0 0 57 64 1 1 0 0 0 58 65 1 6 0 0 0 59 66 1 1 0 0 0 64 67 1 0 0 0 0 49 68 1 0 0 0 0 M CHG 1 7 1 M END 3D MOL for HMDB0301897 (Peonidin 3-feruloyl-diglucoside 5-glucoside)HMDB0301897 RDKit 3D Peonidin 3-feruloyl-diglucoside 5-glucoside 119125 0 0 0 0 0 0 0 0999 V2000 0.1051 9.5832 7.0936 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1642 9.5999 5.6798 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2752 8.5368 4.9028 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7986 7.3866 5.4317 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2306 6.3377 4.6455 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1588 6.3876 3.2537 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6097 5.2601 2.4630 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6090 5.1943 1.1403 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0969 3.9695 0.4649 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1025 3.9233 -0.7652 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5362 2.8946 1.1922 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0177 1.6736 0.7796 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0384 0.8690 -0.0884 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8408 0.7098 0.5394 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0571 -0.2968 0.0423 C 0 0 1 0 0 0 0 0 0 0 0 0 0.2212 -1.2891 0.9068 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6526 -2.4388 1.3266 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9264 -3.4734 0.4166 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3793 -4.6796 0.8566 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6396 -5.7073 -0.0637 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4624 -5.5846 -1.3352 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2348 -5.2757 -2.5835 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0263 -5.7760 -3.0604 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3464 -4.9438 -4.1526 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.8190 -5.1134 -4.5096 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6180 -4.8012 -3.4122 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5305 -5.3173 -5.3285 C 0 0 1 0 0 0 0 0 0 0 0 0 1.1110 -4.2688 -5.9781 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5868 -6.2919 -4.8471 C 0 0 2 0 0 0 0 0 0 0 0 0 0.9788 -7.5322 -4.6811 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2368 -5.7620 -3.6137 C 0 0 1 0 0 0 0 0 0 0 0 0 3.0623 -4.7009 -3.9434 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1069 -6.9091 0.5287 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2900 -7.0743 1.8561 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7559 -8.2614 2.4354 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0141 -6.0360 2.7079 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5530 -4.8259 2.2148 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2946 -3.8580 3.0349 O 0 0 0 0 0 3 0 0 0 0 0 0 0.8513 -2.6541 2.6995 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6077 -1.6776 3.7421 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4720 -2.1467 5.0452 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3186 -1.3186 6.1288 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2903 0.0488 5.9750 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1321 0.9146 7.0524 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4228 0.5519 4.6972 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3999 1.9288 4.5695 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5593 2.4765 3.2734 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5776 -0.3153 3.6093 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4415 -0.7089 -1.3866 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.1644 0.3708 -2.2667 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8389 0.0004 -3.1885 C 0 0 2 0 0 0 0 0 0 0 0 0 1.9023 0.8005 -2.9908 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0623 2.0047 -3.5434 C 0 0 2 0 0 0 0 0 0 0 0 0 1.3300 3.0620 -2.6992 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5022 4.3245 -3.2495 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4640 2.0923 -4.9240 C 0 0 1 0 0 0 0 0 0 0 0 0 2.2542 2.8788 -5.7373 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3745 0.6835 -5.4689 C 0 0 2 0 0 0 0 0 0 0 0 0 1.0358 0.6060 -6.7961 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3344 -0.0405 -4.6114 C 0 0 1 0 0 0 0 0 0 0 0 0 0.3280 -1.3471 -5.1251 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.8610 -1.1274 -1.4717 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.9813 -2.5108 -1.4418 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6669 -0.5003 -0.3447 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.0122 -0.4484 -0.6059 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6282 7.5569 2.7259 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1994 8.5979 3.5128 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3336 9.7747 2.9720 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1558 10.6002 7.5230 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8240 8.8871 7.5468 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9205 9.2030 7.3590 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8589 7.3359 6.5269 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6433 5.4402 5.1156 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9824 4.3777 2.9710 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2584 6.0311 0.5788 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9693 1.8065 0.2112 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2327 1.0655 1.6800 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0008 1.3791 -1.0614 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9800 0.1882 -0.2042 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7858 -3.3583 -0.6357 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0950 -4.1567 -2.7424 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1545 -3.8954 -3.8956 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0770 -4.3438 -5.2822 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0759 -6.1101 -4.8610 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3810 -4.2307 -3.6592 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1354 -5.8342 -6.0827 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1639 -4.3106 -6.9474 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3210 -6.4099 -5.6764 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1982 -7.5528 -5.3156 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8466 -6.5825 -3.1496 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5587 -4.3294 -3.1697 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3149 -7.7080 -0.1634 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1946 -9.0142 2.7456 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1421 -6.1213 3.7602 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4907 -3.2461 5.1832 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2173 -1.7152 7.1238 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1028 1.9064 6.8819 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3756 2.3019 2.7146 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8228 3.5721 3.3683 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3835 1.9641 2.6951 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6939 0.1193 2.6523 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2166 -1.5147 -1.6862 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1215 -1.0917 -2.9723 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1438 2.3466 -3.5694 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2435 2.7714 -2.6422 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7274 3.0447 -1.6817 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2096 4.9692 -2.5611 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4224 2.4800 -4.8173 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0588 3.1479 -5.2605 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3415 0.1681 -5.2770 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8042 0.9742 -7.3265 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6678 0.3507 -4.7104 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2001 -1.8052 -4.8708 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2997 -0.7730 -2.4240 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0502 -2.7865 -0.4950 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4932 -1.1053 0.5621 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3024 -1.1416 -1.2814 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5693 7.6103 1.6447 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3884 9.8316 1.9684 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 2 0 4 5 1 0 5 6 2 0 6 7 1 0 7 8 2 0 8 9 1 0 9 10 2 0 9 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 2 0 18 19 1 0 19 20 2 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 24 27 1 0 27 28 1 0 27 29 1 0 29 30 1 0 29 31 1 0 31 32 1 0 20 33 1 0 33 34 2 0 34 35 1 0 34 36 1 0 36 37 2 0 37 38 1 0 38 39 2 0 39 40 1 0 40 41 2 0 41 42 1 0 42 43 2 0 43 44 1 0 43 45 1 0 45 46 1 0 46 47 1 0 45 48 2 0 15 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 53 56 1 0 56 57 1 0 56 58 1 0 58 59 1 0 58 60 1 0 60 61 1 0 49 62 1 0 62 63 1 0 62 64 1 0 64 65 1 0 6 66 1 0 66 67 2 0 67 68 1 0 67 3 1 0 64 13 1 0 39 17 1 0 48 40 1 0 60 51 1 0 37 19 1 0 31 22 1 0 1 69 1 0 1 70 1 0 1 71 1 0 4 72 1 0 5 73 1 0 7 74 1 0 8 75 1 0 12 76 1 0 12 77 1 0 13 78 1 6 15 79 1 6 18 80 1 0 22 81 1 1 24 82 1 1 25 83 1 0 25 84 1 0 26 85 1 0 27 86 1 6 28 87 1 0 29 88 1 6 30 89 1 0 31 90 1 1 32 91 1 0 33 92 1 0 35 93 1 0 36 94 1 0 41 95 1 0 42 96 1 0 44 97 1 0 47 98 1 0 47 99 1 0 47100 1 0 48101 1 0 49102 1 6 51103 1 1 53104 1 6 54105 1 0 54106 1 0 55107 1 0 56108 1 1 57109 1 0 58110 1 6 59111 1 0 60112 1 1 61113 1 0 62114 1 6 63115 1 0 64116 1 1 65117 1 0 66118 1 0 68119 1 0 M CHG 1 38 1 M END 3D SDF for HMDB0301897 (Peonidin 3-feruloyl-diglucoside 5-glucoside)Mrv0541 02241212262D 68 74 0 0 0 0 999 V2000 -2.8286 -0.7955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5430 -1.2080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.5430 -2.0330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8286 -2.4456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1141 -2.0330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1141 -1.2080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3996 -0.7955 0.0000 O 0 3 0 0 0 0 0 0 0 0 0 0 -1.3996 -2.4456 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6852 -2.0330 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6852 -1.2080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0293 -0.7955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7438 0.4420 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0293 0.0295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7438 -1.2080 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4582 -0.7955 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4582 0.0295 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2575 -0.7955 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.8286 -3.2706 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.7438 1.2670 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4582 1.6795 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1727 0.4420 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0293 -3.8745 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4418 -4.5889 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.2668 -4.5889 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6793 -3.8745 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 1.2668 -3.1600 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.4418 -3.1600 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 0.0293 -2.4455 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0293 -5.3034 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6793 -5.3034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5043 -3.8745 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2575 -3.2706 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9720 -3.6831 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -4.9720 -4.5081 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.2575 -4.9206 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.5431 -4.5081 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -3.5431 -3.6831 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.8286 -4.9206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.6865 -3.2706 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.6865 -4.9206 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.2575 -5.7456 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -6.4009 -3.6831 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4418 -8.4929 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2727 -8.9054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2727 -9.7304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4418 -10.1429 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1563 -9.7304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1563 -8.9054 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4418 -10.9679 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9871 -10.1429 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4418 -7.6679 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2727 -7.2554 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.2727 -6.4304 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4418 -6.0179 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9872 -6.0179 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.9168 -3.1600 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.7418 -3.1600 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 4.1543 -2.4455 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 3.7418 -1.7310 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.9168 -1.7310 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 2.5043 -2.4455 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.6793 -2.4455 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.5043 -1.0166 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1543 -3.8744 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9793 -2.4455 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.1543 -1.0165 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.9793 -3.8744 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1563 -11.3804 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 1 6 2 0 0 0 0 2 3 2 0 0 0 0 3 4 1 0 0 0 0 4 5 2 0 0 0 0 7 6 1 0 0 0 0 5 6 1 0 0 0 0 5 8 1 0 0 0 0 7 10 2 0 0 0 0 8 9 2 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 13 11 2 0 0 0 0 11 14 1 0 0 0 0 12 13 1 0 0 0 0 12 16 2 0 0 0 0 14 15 2 0 0 0 0 15 16 1 0 0 0 0 2 17 1 0 0 0 0 4 18 1 0 0 0 0 9 28 1 0 0 0 0 12 19 1 0 0 0 0 19 20 1 0 0 0 0 16 21 1 0 0 0 0 22 23 1 0 0 0 0 22 27 1 0 0 0 0 23 24 1 0 0 0 0 23 29 1 1 0 0 0 25 24 1 0 0 0 0 24 30 1 6 0 0 0 25 26 1 0 0 0 0 25 31 1 1 0 0 0 26 27 1 0 0 0 0 26 62 1 6 0 0 0 27 28 1 1 0 0 0 37 18 1 1 0 0 0 32 33 1 0 0 0 0 32 37 1 0 0 0 0 33 34 1 0 0 0 0 35 34 1 0 0 0 0 35 36 1 0 0 0 0 36 37 1 0 0 0 0 36 38 1 6 0 0 0 33 39 1 1 0 0 0 34 40 1 6 0 0 0 35 41 1 1 0 0 0 39 42 1 0 0 0 0 43 44 2 0 0 0 0 44 45 1 0 0 0 0 45 46 2 0 0 0 0 46 47 1 0 0 0 0 47 48 2 0 0 0 0 43 48 1 0 0 0 0 46 49 1 0 0 0 0 45 50 1 0 0 0 0 43 51 1 0 0 0 0 51 52 2 0 0 0 0 52 53 1 0 0 0 0 53 54 1 0 0 0 0 53 55 2 0 0 0 0 29 54 1 0 0 0 0 56 57 1 0 0 0 0 56 61 1 0 0 0 0 57 58 1 0 0 0 0 59 58 1 0 0 0 0 59 60 1 0 0 0 0 60 61 1 0 0 0 0 61 62 1 1 0 0 0 60 63 1 6 0 0 0 57 64 1 1 0 0 0 58 65 1 6 0 0 0 59 66 1 1 0 0 0 64 67 1 0 0 0 0 49 68 1 0 0 0 0 M CHG 1 7 1 M END > <DATABASE_ID> HMDB0301897 > <DATABASE_NAME> hmdb > <SMILES> COC1=C(O)C=C(\C=C\C(=O)OC[C@H]2O[C@@H](OC3=CC4=C(O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)C=C(O)C=C4[O+]=C3C3=CC(OC)=C(O)C=C3)[C@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@@H]2O)C=C1 > <INCHI_IDENTIFIER> InChI=1S/C44H50O24/c1-59-23-7-3-17(9-22(23)49)4-8-31(50)61-16-30-34(53)37(56)41(68-43-39(58)36(55)33(52)29(15-46)66-43)44(67-30)64-27-13-20-24(62-40(27)18-5-6-21(48)26(10-18)60-2)11-19(47)12-25(20)63-42-38(57)35(54)32(51)28(14-45)65-42/h3-13,28-30,32-39,41-46,51-58H,14-16H2,1-2H3,(H2-,47,48,49)/p+1/b8-4+/t28-,29-,30-,32-,33-,34-,35+,36+,37+,38-,39-,41-,42-,43+,44-/m1/s1 > <INCHI_KEY> UQSLQWFUWYJIMM-AEGWHFIMSA-O > <FORMULA> C44H51O24 > <MOLECULAR_WEIGHT> 963.8613 > <EXACT_MASS> 963.27702756 > <JCHEM_ACCEPTOR_COUNT> 22 > <JCHEM_AVERAGE_POLARIZABILITY> 94.08972032145243 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 13 > <JCHEM_FORMAL_CHARGE> 1 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 3-{[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-({[(2E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]oxy}methyl)-3-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-7-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-5-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-1λ⁴-chromen-1-ylium > <ALOGPS_LOGP> 1.33 > <JCHEM_LOGP> -1.2003000000000044 > <ALOGPS_LOGS> -3.33 > <JCHEM_MDDR_LIKE_RULE> 1 > <JCHEM_NUMBER_OF_RINGS> 7 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA> 8.38302613929949 > <JCHEM_PKA_STRONGEST_ACIDIC> 6.661194078615713 > <JCHEM_PKA_STRONGEST_BASIC> -3.678622844118399 > <JCHEM_POLAR_SURFACE_AREA> 376.27000000000004 > <JCHEM_REFRACTIVITY> 233.30930000000006 > <JCHEM_ROTATABLE_BOND_COUNT> 16 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 4.67e-01 g/l > <JCHEM_TRADITIONAL_IUPAC> 3-{[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-({[(2E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]oxy}methyl)-3-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-7-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-5-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-1λ⁴-chromen-1-ylium > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0301897 (Peonidin 3-feruloyl-diglucoside 5-glucoside)HMDB0301897 RDKit 3D Peonidin 3-feruloyl-diglucoside 5-glucoside 119125 0 0 0 0 0 0 0 0999 V2000 0.1051 9.5832 7.0936 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1642 9.5999 5.6798 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2752 8.5368 4.9028 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7986 7.3866 5.4317 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.2306 6.3377 4.6455 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1588 6.3876 3.2537 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6097 5.2601 2.4630 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6090 5.1943 1.1403 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0969 3.9695 0.4649 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1025 3.9233 -0.7652 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.5362 2.8946 1.1922 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0177 1.6736 0.7796 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0384 0.8690 -0.0884 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.8408 0.7098 0.5394 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.0571 -0.2968 0.0423 C 0 0 1 0 0 0 0 0 0 0 0 0 0.2212 -1.2891 0.9068 O 0 0 0 0 0 0 0 0 0 0 0 0 0.6526 -2.4388 1.3266 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9264 -3.4734 0.4166 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3793 -4.6796 0.8566 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6396 -5.7073 -0.0637 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4624 -5.5846 -1.3352 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2348 -5.2757 -2.5835 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.0263 -5.7760 -3.0604 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3464 -4.9438 -4.1526 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.8190 -5.1134 -4.5096 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.6180 -4.8012 -3.4122 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5305 -5.3173 -5.3285 C 0 0 1 0 0 0 0 0 0 0 0 0 1.1110 -4.2688 -5.9781 O 0 0 0 0 0 0 0 0 0 0 0 0 1.5868 -6.2919 -4.8471 C 0 0 2 0 0 0 0 0 0 0 0 0 0.9788 -7.5322 -4.6811 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2368 -5.7620 -3.6137 C 0 0 1 0 0 0 0 0 0 0 0 0 3.0623 -4.7009 -3.9434 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1069 -6.9091 0.5287 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2900 -7.0743 1.8561 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7559 -8.2614 2.4354 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0141 -6.0360 2.7079 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5530 -4.8259 2.2148 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2946 -3.8580 3.0349 O 0 0 0 0 0 3 0 0 0 0 0 0 0.8513 -2.6541 2.6995 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6077 -1.6776 3.7421 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4720 -2.1467 5.0452 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3186 -1.3186 6.1288 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2903 0.0488 5.9750 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1321 0.9146 7.0524 O 0 0 0 0 0 0 0 0 0 0 0 0 0.4228 0.5519 4.6972 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3999 1.9288 4.5695 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5593 2.4765 3.2734 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5776 -0.3153 3.6093 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4415 -0.7089 -1.3866 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.1644 0.3708 -2.2667 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8389 0.0004 -3.1885 C 0 0 2 0 0 0 0 0 0 0 0 0 1.9023 0.8005 -2.9908 O 0 0 0 0 0 0 0 0 0 0 0 0 2.0623 2.0047 -3.5434 C 0 0 2 0 0 0 0 0 0 0 0 0 1.3300 3.0620 -2.6992 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5022 4.3245 -3.2495 O 0 0 0 0 0 0 0 0 0 0 0 0 1.4640 2.0923 -4.9240 C 0 0 1 0 0 0 0 0 0 0 0 0 2.2542 2.8788 -5.7373 O 0 0 0 0 0 0 0 0 0 0 0 0 1.3745 0.6835 -5.4689 C 0 0 2 0 0 0 0 0 0 0 0 0 1.0358 0.6060 -6.7961 O 0 0 0 0 0 0 0 0 0 0 0 0 0.3344 -0.0405 -4.6114 C 0 0 1 0 0 0 0 0 0 0 0 0 0.3280 -1.3471 -5.1251 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.8610 -1.1274 -1.4717 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.9813 -2.5108 -1.4418 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6669 -0.5003 -0.3447 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.0122 -0.4484 -0.6059 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.6282 7.5569 2.7259 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1994 8.5979 3.5128 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3336 9.7747 2.9720 O 0 0 0 0 0 0 0 0 0 0 0 0 0.1558 10.6002 7.5230 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8240 8.8871 7.5468 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9205 9.2030 7.3590 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8589 7.3359 6.5269 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6433 5.4402 5.1156 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9824 4.3777 2.9710 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2584 6.0311 0.5788 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9693 1.8065 0.2112 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2327 1.0655 1.6800 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0008 1.3791 -1.0614 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9800 0.1882 -0.2042 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7858 -3.3583 -0.6357 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0950 -4.1567 -2.7424 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1545 -3.8954 -3.8956 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0770 -4.3438 -5.2822 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0759 -6.1101 -4.8610 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.3810 -4.2307 -3.6592 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1354 -5.8342 -6.0827 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1639 -4.3106 -6.9474 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3210 -6.4099 -5.6764 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1982 -7.5528 -5.3156 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8466 -6.5825 -3.1496 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5587 -4.3294 -3.1697 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3149 -7.7080 -0.1634 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1946 -9.0142 2.7456 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1421 -6.1213 3.7602 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4907 -3.2461 5.1832 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2173 -1.7152 7.1238 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1028 1.9064 6.8819 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3756 2.3019 2.7146 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8228 3.5721 3.3683 H 0 0 0 0 0 0 0 0 0 0 0 0 1.3835 1.9641 2.6951 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6939 0.1193 2.6523 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2166 -1.5147 -1.6862 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1215 -1.0917 -2.9723 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1438 2.3466 -3.5694 H 0 0 0 0 0 0 0 0 0 0 0 0 0.2435 2.7714 -2.6422 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7274 3.0447 -1.6817 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2096 4.9692 -2.5611 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4224 2.4800 -4.8173 H 0 0 0 0 0 0 0 0 0 0 0 0 3.0588 3.1479 -5.2605 H 0 0 0 0 0 0 0 0 0 0 0 0 2.3415 0.1681 -5.2770 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8042 0.9742 -7.3265 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6678 0.3507 -4.7104 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2001 -1.8052 -4.8708 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2997 -0.7730 -2.4240 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.0502 -2.7865 -0.4950 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4932 -1.1053 0.5621 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.3024 -1.1416 -1.2814 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5693 7.6103 1.6447 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3884 9.8316 1.9684 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 2 0 4 5 1 0 5 6 2 0 6 7 1 0 7 8 2 0 8 9 1 0 9 10 2 0 9 11 1 0 11 12 1 0 12 13 1 0 13 14 1 0 14 15 1 0 15 16 1 0 16 17 1 0 17 18 2 0 18 19 1 0 19 20 2 0 20 21 1 0 21 22 1 0 22 23 1 0 23 24 1 0 24 25 1 0 25 26 1 0 24 27 1 0 27 28 1 0 27 29 1 0 29 30 1 0 29 31 1 0 31 32 1 0 20 33 1 0 33 34 2 0 34 35 1 0 34 36 1 0 36 37 2 0 37 38 1 0 38 39 2 0 39 40 1 0 40 41 2 0 41 42 1 0 42 43 2 0 43 44 1 0 43 45 1 0 45 46 1 0 46 47 1 0 45 48 2 0 15 49 1 0 49 50 1 0 50 51 1 0 51 52 1 0 52 53 1 0 53 54 1 0 54 55 1 0 53 56 1 0 56 57 1 0 56 58 1 0 58 59 1 0 58 60 1 0 60 61 1 0 49 62 1 0 62 63 1 0 62 64 1 0 64 65 1 0 6 66 1 0 66 67 2 0 67 68 1 0 67 3 1 0 64 13 1 0 39 17 1 0 48 40 1 0 60 51 1 0 37 19 1 0 31 22 1 0 1 69 1 0 1 70 1 0 1 71 1 0 4 72 1 0 5 73 1 0 7 74 1 0 8 75 1 0 12 76 1 0 12 77 1 0 13 78 1 6 15 79 1 6 18 80 1 0 22 81 1 1 24 82 1 1 25 83 1 0 25 84 1 0 26 85 1 0 27 86 1 6 28 87 1 0 29 88 1 6 30 89 1 0 31 90 1 1 32 91 1 0 33 92 1 0 35 93 1 0 36 94 1 0 41 95 1 0 42 96 1 0 44 97 1 0 47 98 1 0 47 99 1 0 47100 1 0 48101 1 0 49102 1 6 51103 1 1 53104 1 6 54105 1 0 54106 1 0 55107 1 0 56108 1 1 57109 1 0 58110 1 6 59111 1 0 60112 1 1 61113 1 0 62114 1 6 63115 1 0 64116 1 1 65117 1 0 66118 1 0 68119 1 0 M CHG 1 38 1 M END PDB for HMDB0301897 (Peonidin 3-feruloyl-diglucoside 5-glucoside)HEADER PROTEIN 24-FEB-12 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 24-FEB-12 0 HETATM 1 C UNK 0 -5.280 -1.485 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 -6.614 -2.255 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 -6.614 -3.795 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 -5.280 -4.565 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 -3.946 -3.795 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 -3.946 -2.255 0.000 0.00 0.00 C+0 HETATM 7 O UNK 0 -2.613 -1.485 0.000 0.00 0.00 O+1 HETATM 8 C UNK 0 -2.613 -4.565 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 -1.279 -3.795 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 -1.279 -2.255 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 0.055 -1.485 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 1.388 0.825 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 0.055 0.055 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 1.388 -2.255 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 2.722 -1.485 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 2.722 0.055 0.000 0.00 0.00 C+0 HETATM 17 O UNK 0 -7.947 -1.485 0.000 0.00 0.00 O+0 HETATM 18 O UNK 0 -5.280 -6.105 0.000 0.00 0.00 O+0 HETATM 19 O UNK 0 1.388 2.365 0.000 0.00 0.00 O+0 HETATM 20 C UNK 0 2.722 3.135 0.000 0.00 0.00 C+0 HETATM 21 O UNK 0 4.056 0.825 0.000 0.00 0.00 O+0 HETATM 22 O UNK 0 0.055 -7.232 0.000 0.00 0.00 O+0 HETATM 23 C UNK 0 0.825 -8.566 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 2.365 -8.566 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 3.135 -7.232 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 2.365 -5.899 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 0.825 -5.899 0.000 0.00 0.00 C+0 HETATM 28 O UNK 0 0.055 -4.565 0.000 0.00 0.00 O+0 HETATM 29 C UNK 0 0.055 -9.900 0.000 0.00 0.00 C+0 HETATM 30 O UNK 0 3.135 -9.900 0.000 0.00 0.00 O+0 HETATM 31 O UNK 0 4.675 -7.232 0.000 0.00 0.00 O+0 HETATM 32 O UNK 0 -7.947 -6.105 0.000 0.00 0.00 O+0 HETATM 33 C UNK 0 -9.281 -6.875 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 -9.281 -8.415 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 -7.947 -9.185 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 -6.614 -8.415 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 -6.614 -6.875 0.000 0.00 0.00 C+0 HETATM 38 O UNK 0 -5.280 -9.185 0.000 0.00 0.00 O+0 HETATM 39 C UNK 0 -10.615 -6.105 0.000 0.00 0.00 C+0 HETATM 40 O UNK 0 -10.615 -9.185 0.000 0.00 0.00 O+0 HETATM 41 O UNK 0 -7.947 -10.725 0.000 0.00 0.00 O+0 HETATM 42 O UNK 0 -11.948 -6.875 0.000 0.00 0.00 O+0 HETATM 43 C UNK 0 0.825 -15.853 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 -0.509 -16.623 0.000 0.00 0.00 C+0 HETATM 45 C UNK 0 -0.509 -18.163 0.000 0.00 0.00 C+0 HETATM 46 C UNK 0 0.825 -18.933 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 2.158 -18.163 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 2.158 -16.623 0.000 0.00 0.00 C+0 HETATM 49 O UNK 0 0.825 -20.473 0.000 0.00 0.00 O+0 HETATM 50 O UNK 0 -1.843 -18.933 0.000 0.00 0.00 O+0 HETATM 51 C UNK 0 0.825 -14.313 0.000 0.00 0.00 C+0 HETATM 52 C UNK 0 -0.509 -13.543 0.000 0.00 0.00 C+0 HETATM 53 C UNK 0 -0.509 -12.003 0.000 0.00 0.00 C+0 HETATM 54 O UNK 0 0.825 -11.233 0.000 0.00 0.00 O+0 HETATM 55 O UNK 0 -1.843 -11.233 0.000 0.00 0.00 O+0 HETATM 56 O UNK 0 5.445 -5.899 0.000 0.00 0.00 O+0 HETATM 57 C UNK 0 6.985 -5.899 0.000 0.00 0.00 C+0 HETATM 58 C UNK 0 7.755 -4.565 0.000 0.00 0.00 C+0 HETATM 59 C UNK 0 6.985 -3.231 0.000 0.00 0.00 C+0 HETATM 60 C UNK 0 5.445 -3.231 0.000 0.00 0.00 C+0 HETATM 61 C UNK 0 4.675 -4.565 0.000 0.00 0.00 C+0 HETATM 62 O UNK 0 3.135 -4.565 0.000 0.00 0.00 O+0 HETATM 63 O UNK 0 4.675 -1.898 0.000 0.00 0.00 O+0 HETATM 64 C UNK 0 7.755 -7.232 0.000 0.00 0.00 C+0 HETATM 65 O UNK 0 9.295 -4.565 0.000 0.00 0.00 O+0 HETATM 66 O UNK 0 7.755 -1.897 0.000 0.00 0.00 O+0 HETATM 67 O UNK 0 9.295 -7.232 0.000 0.00 0.00 O+0 HETATM 68 C UNK 0 2.158 -21.243 0.000 0.00 0.00 C+0 CONECT 1 2 6 CONECT 2 1 3 17 CONECT 3 2 4 CONECT 4 3 5 18 CONECT 5 4 6 8 CONECT 6 1 7 5 CONECT 7 6 10 CONECT 8 5 9 CONECT 9 8 10 28 CONECT 10 7 9 11 CONECT 11 10 13 14 CONECT 12 13 16 19 CONECT 13 11 12 CONECT 14 11 15 CONECT 15 14 16 CONECT 16 12 15 21 CONECT 17 2 CONECT 18 4 37 CONECT 19 12 20 CONECT 20 19 CONECT 21 16 CONECT 22 23 27 CONECT 23 22 24 29 CONECT 24 23 25 30 CONECT 25 24 26 31 CONECT 26 25 27 62 CONECT 27 22 26 28 CONECT 28 9 27 CONECT 29 23 54 CONECT 30 24 CONECT 31 25 CONECT 32 33 37 CONECT 33 32 34 39 CONECT 34 33 35 40 CONECT 35 34 36 41 CONECT 36 35 37 38 CONECT 37 18 32 36 CONECT 38 36 CONECT 39 33 42 CONECT 40 34 CONECT 41 35 CONECT 42 39 CONECT 43 44 48 51 CONECT 44 43 45 CONECT 45 44 46 50 CONECT 46 45 47 49 CONECT 47 46 48 CONECT 48 47 43 CONECT 49 46 68 CONECT 50 45 CONECT 51 43 52 CONECT 52 51 53 CONECT 53 52 54 55 CONECT 54 53 29 CONECT 55 53 CONECT 56 57 61 CONECT 57 56 58 64 CONECT 58 57 59 65 CONECT 59 58 60 66 CONECT 60 59 61 63 CONECT 61 56 60 62 CONECT 62 26 61 CONECT 63 60 CONECT 64 57 67 CONECT 65 58 CONECT 66 59 CONECT 67 64 CONECT 68 49 MASTER 0 0 0 0 0 0 0 0 68 0 148 0 END 3D PDB for HMDB0301897 (Peonidin 3-feruloyl-diglucoside 5-glucoside)COMPND HMDB0301897 HETATM 1 C1 UNL 1 0.105 9.583 7.094 1.00 0.00 C HETATM 2 O1 UNL 1 0.164 9.600 5.680 1.00 0.00 O HETATM 3 C2 UNL 1 -0.275 8.537 4.903 1.00 0.00 C HETATM 4 C3 UNL 1 -0.799 7.387 5.432 1.00 0.00 C HETATM 5 C4 UNL 1 -1.231 6.338 4.646 1.00 0.00 C HETATM 6 C5 UNL 1 -1.159 6.388 3.254 1.00 0.00 C HETATM 7 C6 UNL 1 -1.610 5.260 2.463 1.00 0.00 C HETATM 8 C7 UNL 1 -1.609 5.194 1.140 1.00 0.00 C HETATM 9 C8 UNL 1 -2.097 3.970 0.465 1.00 0.00 C HETATM 10 O2 UNL 1 -2.102 3.923 -0.765 1.00 0.00 O HETATM 11 O3 UNL 1 -2.536 2.895 1.192 1.00 0.00 O HETATM 12 C9 UNL 1 -3.018 1.674 0.780 1.00 0.00 C HETATM 13 C10 UNL 1 -2.038 0.869 -0.088 1.00 0.00 C HETATM 14 O4 UNL 1 -0.841 0.710 0.539 1.00 0.00 O HETATM 15 C11 UNL 1 -0.057 -0.297 0.042 1.00 0.00 C HETATM 16 O5 UNL 1 0.221 -1.289 0.907 1.00 0.00 O HETATM 17 C12 UNL 1 0.653 -2.439 1.327 1.00 0.00 C HETATM 18 C13 UNL 1 0.926 -3.473 0.417 1.00 0.00 C HETATM 19 C14 UNL 1 1.379 -4.680 0.857 1.00 0.00 C HETATM 20 C15 UNL 1 1.640 -5.707 -0.064 1.00 0.00 C HETATM 21 O6 UNL 1 1.462 -5.585 -1.335 1.00 0.00 O HETATM 22 C16 UNL 1 1.235 -5.276 -2.584 1.00 0.00 C HETATM 23 O7 UNL 1 -0.026 -5.776 -3.060 1.00 0.00 O HETATM 24 C17 UNL 1 -0.346 -4.944 -4.153 1.00 0.00 C HETATM 25 C18 UNL 1 -1.819 -5.113 -4.510 1.00 0.00 C HETATM 26 O8 UNL 1 -2.618 -4.801 -3.412 1.00 0.00 O HETATM 27 C19 UNL 1 0.530 -5.317 -5.328 1.00 0.00 C HETATM 28 O9 UNL 1 1.111 -4.269 -5.978 1.00 0.00 O HETATM 29 C20 UNL 1 1.587 -6.292 -4.847 1.00 0.00 C HETATM 30 O10 UNL 1 0.979 -7.532 -4.681 1.00 0.00 O HETATM 31 C21 UNL 1 2.237 -5.762 -3.614 1.00 0.00 C HETATM 32 O11 UNL 1 3.062 -4.701 -3.943 1.00 0.00 O HETATM 33 C22 UNL 1 2.107 -6.909 0.529 1.00 0.00 C HETATM 34 C23 UNL 1 2.290 -7.074 1.856 1.00 0.00 C HETATM 35 O12 UNL 1 2.756 -8.261 2.435 1.00 0.00 O HETATM 36 C24 UNL 1 2.014 -6.036 2.708 1.00 0.00 C HETATM 37 C25 UNL 1 1.553 -4.826 2.215 1.00 0.00 C HETATM 38 O13 UNL 1 1.295 -3.858 3.035 1.00 0.00 O1+ HETATM 39 C26 UNL 1 0.851 -2.654 2.700 1.00 0.00 C HETATM 40 C27 UNL 1 0.608 -1.678 3.742 1.00 0.00 C HETATM 41 C28 UNL 1 0.472 -2.147 5.045 1.00 0.00 C HETATM 42 C29 UNL 1 0.319 -1.319 6.129 1.00 0.00 C HETATM 43 C30 UNL 1 0.290 0.049 5.975 1.00 0.00 C HETATM 44 O14 UNL 1 0.132 0.915 7.052 1.00 0.00 O HETATM 45 C31 UNL 1 0.423 0.552 4.697 1.00 0.00 C HETATM 46 O15 UNL 1 0.400 1.929 4.570 1.00 0.00 O HETATM 47 C32 UNL 1 0.559 2.477 3.273 1.00 0.00 C HETATM 48 C33 UNL 1 0.578 -0.315 3.609 1.00 0.00 C HETATM 49 C34 UNL 1 -0.442 -0.709 -1.387 1.00 0.00 C HETATM 50 O16 UNL 1 -0.164 0.371 -2.267 1.00 0.00 O HETATM 51 C35 UNL 1 0.839 0.000 -3.188 1.00 0.00 C HETATM 52 O17 UNL 1 1.902 0.801 -2.991 1.00 0.00 O HETATM 53 C36 UNL 1 2.062 2.005 -3.543 1.00 0.00 C HETATM 54 C37 UNL 1 1.330 3.062 -2.699 1.00 0.00 C HETATM 55 O18 UNL 1 1.502 4.324 -3.250 1.00 0.00 O HETATM 56 C38 UNL 1 1.464 2.092 -4.924 1.00 0.00 C HETATM 57 O19 UNL 1 2.254 2.879 -5.737 1.00 0.00 O HETATM 58 C39 UNL 1 1.375 0.684 -5.469 1.00 0.00 C HETATM 59 O20 UNL 1 1.036 0.606 -6.796 1.00 0.00 O HETATM 60 C40 UNL 1 0.334 -0.040 -4.611 1.00 0.00 C HETATM 61 O21 UNL 1 0.328 -1.347 -5.125 1.00 0.00 O HETATM 62 C41 UNL 1 -1.861 -1.127 -1.472 1.00 0.00 C HETATM 63 O22 UNL 1 -1.981 -2.511 -1.442 1.00 0.00 O HETATM 64 C42 UNL 1 -2.667 -0.500 -0.345 1.00 0.00 C HETATM 65 O23 UNL 1 -4.012 -0.448 -0.606 1.00 0.00 O HETATM 66 C43 UNL 1 -0.628 7.557 2.726 1.00 0.00 C HETATM 67 C44 UNL 1 -0.199 8.598 3.513 1.00 0.00 C HETATM 68 O24 UNL 1 0.334 9.775 2.972 1.00 0.00 O HETATM 69 H1 UNL 1 0.156 10.600 7.523 1.00 0.00 H HETATM 70 H2 UNL 1 0.824 8.887 7.547 1.00 0.00 H HETATM 71 H3 UNL 1 -0.921 9.203 7.359 1.00 0.00 H HETATM 72 H4 UNL 1 -0.859 7.336 6.527 1.00 0.00 H HETATM 73 H5 UNL 1 -1.643 5.440 5.116 1.00 0.00 H HETATM 74 H6 UNL 1 -1.982 4.378 2.971 1.00 0.00 H HETATM 75 H7 UNL 1 -1.258 6.031 0.579 1.00 0.00 H HETATM 76 H8 UNL 1 -3.969 1.806 0.211 1.00 0.00 H HETATM 77 H9 UNL 1 -3.233 1.066 1.680 1.00 0.00 H HETATM 78 H10 UNL 1 -2.001 1.379 -1.061 1.00 0.00 H HETATM 79 H11 UNL 1 0.980 0.188 -0.204 1.00 0.00 H HETATM 80 H12 UNL 1 0.786 -3.358 -0.636 1.00 0.00 H HETATM 81 H13 UNL 1 1.095 -4.157 -2.742 1.00 0.00 H HETATM 82 H14 UNL 1 -0.155 -3.895 -3.896 1.00 0.00 H HETATM 83 H15 UNL 1 -2.077 -4.344 -5.282 1.00 0.00 H HETATM 84 H16 UNL 1 -2.076 -6.110 -4.861 1.00 0.00 H HETATM 85 H17 UNL 1 -3.381 -4.231 -3.659 1.00 0.00 H HETATM 86 H18 UNL 1 -0.135 -5.834 -6.083 1.00 0.00 H HETATM 87 H19 UNL 1 1.164 -4.311 -6.947 1.00 0.00 H HETATM 88 H20 UNL 1 2.321 -6.410 -5.676 1.00 0.00 H HETATM 89 H21 UNL 1 0.198 -7.553 -5.316 1.00 0.00 H HETATM 90 H22 UNL 1 2.847 -6.582 -3.150 1.00 0.00 H HETATM 91 H23 UNL 1 3.559 -4.329 -3.170 1.00 0.00 H HETATM 92 H24 UNL 1 2.315 -7.708 -0.163 1.00 0.00 H HETATM 93 H25 UNL 1 2.195 -9.014 2.746 1.00 0.00 H HETATM 94 H26 UNL 1 2.142 -6.121 3.760 1.00 0.00 H HETATM 95 H27 UNL 1 0.491 -3.246 5.183 1.00 0.00 H HETATM 96 H28 UNL 1 0.217 -1.715 7.124 1.00 0.00 H HETATM 97 H29 UNL 1 0.103 1.906 6.882 1.00 0.00 H HETATM 98 H30 UNL 1 -0.376 2.302 2.715 1.00 0.00 H HETATM 99 H31 UNL 1 0.823 3.572 3.368 1.00 0.00 H HETATM 100 H32 UNL 1 1.383 1.964 2.695 1.00 0.00 H HETATM 101 H33 UNL 1 0.694 0.119 2.652 1.00 0.00 H HETATM 102 H34 UNL 1 0.217 -1.515 -1.686 1.00 0.00 H HETATM 103 H35 UNL 1 1.122 -1.092 -2.972 1.00 0.00 H HETATM 104 H36 UNL 1 3.144 2.347 -3.569 1.00 0.00 H HETATM 105 H37 UNL 1 0.244 2.771 -2.642 1.00 0.00 H HETATM 106 H38 UNL 1 1.727 3.045 -1.682 1.00 0.00 H HETATM 107 H39 UNL 1 1.210 4.969 -2.561 1.00 0.00 H HETATM 108 H40 UNL 1 0.422 2.480 -4.817 1.00 0.00 H HETATM 109 H41 UNL 1 3.059 3.148 -5.260 1.00 0.00 H HETATM 110 H42 UNL 1 2.341 0.168 -5.277 1.00 0.00 H HETATM 111 H43 UNL 1 1.804 0.974 -7.327 1.00 0.00 H HETATM 112 H44 UNL 1 -0.668 0.351 -4.710 1.00 0.00 H HETATM 113 H45 UNL 1 1.200 -1.805 -4.871 1.00 0.00 H HETATM 114 H46 UNL 1 -2.300 -0.773 -2.424 1.00 0.00 H HETATM 115 H47 UNL 1 -2.050 -2.786 -0.495 1.00 0.00 H HETATM 116 H48 UNL 1 -2.493 -1.105 0.562 1.00 0.00 H HETATM 117 H49 UNL 1 -4.302 -1.142 -1.281 1.00 0.00 H HETATM 118 H50 UNL 1 -0.569 7.610 1.645 1.00 0.00 H HETATM 119 H51 UNL 1 0.388 9.832 1.968 1.00 0.00 H CONECT 1 2 69 70 71 CONECT 2 3 CONECT 3 4 4 67 CONECT 4 5 72 CONECT 5 6 6 73 CONECT 6 7 66 CONECT 7 8 8 74 CONECT 8 9 75 CONECT 9 10 10 11 CONECT 11 12 CONECT 12 13 76 77 CONECT 13 14 64 78 CONECT 14 15 CONECT 15 16 49 79 CONECT 16 17 CONECT 17 18 18 39 CONECT 18 19 80 CONECT 19 20 20 37 CONECT 20 21 33 CONECT 21 22 CONECT 22 23 31 81 CONECT 23 24 CONECT 24 25 27 82 CONECT 25 26 83 84 CONECT 26 85 CONECT 27 28 29 86 CONECT 28 87 CONECT 29 30 31 88 CONECT 30 89 CONECT 31 32 90 CONECT 32 91 CONECT 33 34 34 92 CONECT 34 35 36 CONECT 35 93 CONECT 36 37 37 94 CONECT 37 38 CONECT 38 39 39 CONECT 39 40 CONECT 40 41 41 48 CONECT 41 42 95 CONECT 42 43 43 96 CONECT 43 44 45 CONECT 44 97 CONECT 45 46 48 48 CONECT 46 47 CONECT 47 98 99 100 CONECT 48 101 CONECT 49 50 62 102 CONECT 50 51 CONECT 51 52 60 103 CONECT 52 53 CONECT 53 54 56 104 CONECT 54 55 105 106 CONECT 55 107 CONECT 56 57 58 108 CONECT 57 109 CONECT 58 59 60 110 CONECT 59 111 CONECT 60 61 112 CONECT 61 113 CONECT 62 63 64 114 CONECT 63 115 CONECT 64 65 116 CONECT 65 117 CONECT 66 67 67 118 CONECT 67 68 CONECT 68 119 END SMILES for HMDB0301897 (Peonidin 3-feruloyl-diglucoside 5-glucoside)COC1=C(O)C=C(\C=C\C(=O)OC[C@H]2O[C@@H](OC3=CC4=C(O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)C=C(O)C=C4[O+]=C3C3=CC(OC)=C(O)C=C3)[C@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@@H]2O)C=C1 INCHI for HMDB0301897 (Peonidin 3-feruloyl-diglucoside 5-glucoside)InChI=1S/C44H50O24/c1-59-23-7-3-17(9-22(23)49)4-8-31(50)61-16-30-34(53)37(56)41(68-43-39(58)36(55)33(52)29(15-46)66-43)44(67-30)64-27-13-20-24(62-40(27)18-5-6-21(48)26(10-18)60-2)11-19(47)12-25(20)63-42-38(57)35(54)32(51)28(14-45)65-42/h3-13,28-30,32-39,41-46,51-58H,14-16H2,1-2H3,(H2-,47,48,49)/p+1/b8-4+/t28-,29-,30-,32-,33-,34-,35+,36+,37+,38-,39-,41-,42-,43+,44-/m1/s1 3D Structure for HMDB0301897 (Peonidin 3-feruloyl-diglucoside 5-glucoside) | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C44H51O24 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 963.8613 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 963.27702756 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 3-{[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-({[(2E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]oxy}methyl)-3-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-7-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-5-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-1λ⁴-chromen-1-ylium | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 3-{[(2S,3R,4S,5S,6R)-4,5-dihydroxy-6-({[(2E)-3-(3-hydroxy-4-methoxyphenyl)prop-2-enoyl]oxy}methyl)-3-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]oxy}-7-hydroxy-2-(4-hydroxy-3-methoxyphenyl)-5-{[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-1λ⁴-chromen-1-ylium | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | COC1=C(O)C=C(\C=C\C(=O)OC[C@H]2O[C@@H](OC3=CC4=C(O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)C=C(O)C=C4[O+]=C3C3=CC(OC)=C(O)C=C3)[C@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@@H]2O)C=C1 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C44H50O24/c1-59-23-7-3-17(9-22(23)49)4-8-31(50)61-16-30-34(53)37(56)41(68-43-39(58)36(55)33(52)29(15-46)66-43)44(67-30)64-27-13-20-24(62-40(27)18-5-6-21(48)26(10-18)60-2)11-19(47)12-25(20)63-42-38(57)35(54)32(51)28(14-45)65-42/h3-13,28-30,32-39,41-46,51-58H,14-16H2,1-2H3,(H2-,47,48,49)/p+1/b8-4+/t28-,29-,30-,32-,33-,34-,35+,36+,37+,38-,39-,41-,42-,43+,44-/m1/s1 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | UQSLQWFUWYJIMM-AEGWHFIMSA-O | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as anthocyanidin 3-o-6-p-coumaroyl glycosides. These are anthocyanidin 3-O-glycosides where the carbohydrate moiety is esterified at the C6 position with a p-coumaric acid. P-coumaric acid is an organic derivative of cinnamic acid, that carries a hydroxyl group at the 4-position of the benzene ring. | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Phenylpropanoids and polyketides | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Flavonoids | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Flavonoid glycosides | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Anthocyanidin 3-O-6-p-coumaroyl glycosides | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aromatic heteropolycyclic compounds | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | FDB001587 | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References | Not Available |