Showing metabocard for Citrusin I (HMDB0303680)
Record Information | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Expected but not Quantified | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2021-09-24 03:47:37 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2021-09-24 03:47:37 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0303680 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Citrusin I | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | 15-benzyl-9-(butan-2-yl)-3,18-bis(1-hydroxyethyl)-6-methyl-12-(2-methylpropyl)-1,4,7,10,13,16,19-heptaazacyclohenicosa-1,4,7,10,13,16,19-heptaene-2,5,8,11,14,17,20-heptol belongs to the class of organic compounds known as oligopeptides. These are organic compounds containing a sequence of between three and ten alpha-amino acids joined by peptide bonds. Based on a literature review very few articles have been published on 15-benzyl-9-(butan-2-yl)-3,18-bis(1-hydroxyethyl)-6-methyl-12-(2-methylpropyl)-1,4,7,10,13,16,19-heptaazacyclohenicosa-1,4,7,10,13,16,19-heptaene-2,5,8,11,14,17,20-heptol. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0303680 (Citrusin I)Mrv1533004261502102D 50 51 0 0 0 0 999 V2000 -6.8327 -1.3383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2715 -0.7336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4672 -0.9171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2240 -1.7055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9060 -0.3124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1017 -0.4959 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.9788 -1.3117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6238 -1.8261 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2108 -1.6131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0878 -2.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7329 -2.9433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6099 -3.7591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5008 -2.6419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5658 -1.0988 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.8513 -1.5113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8513 -2.3363 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1369 -1.0988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4224 -1.5113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4224 -2.3363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2921 -2.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2921 -3.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4224 -3.9863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1369 -3.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1369 -2.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1369 -0.2738 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.3689 0.0276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2761 -0.4867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2459 0.8434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8909 1.3578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.6478 2.1462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1566 2.3297 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2089 2.7509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0132 2.5673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.4780 3.2490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1200 3.9923 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3006 3.1873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6586 2.4440 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.4813 2.5057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8392 3.2490 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9460 1.8240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7687 1.8857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5881 1.0807 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.1492 0.4760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9535 0.6596 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7654 3.8690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5881 3.8073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4074 4.6123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5221 1.1448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6450 1.9606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1671 0.6305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 3 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 7 8 2 0 0 0 0 7 9 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 11 13 1 0 0 0 0 9 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 2 0 0 0 0 15 17 1 0 0 0 0 17 18 1 0 0 0 0 18 19 1 0 0 0 0 19 20 2 0 0 0 0 20 21 1 0 0 0 0 21 22 2 0 0 0 0 22 23 1 0 0 0 0 23 24 2 0 0 0 0 19 24 1 0 0 0 0 17 25 1 0 0 0 0 25 26 1 0 0 0 0 26 27 2 0 0 0 0 26 28 1 0 0 0 0 28 29 1 0 0 0 0 29 30 1 0 0 0 0 30 31 2 0 0 0 0 30 32 1 0 0 0 0 32 33 1 0 0 0 0 33 34 1 0 0 0 0 34 35 2 0 0 0 0 34 36 1 0 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 38 39 2 0 0 0 0 38 40 1 0 0 0 0 40 41 1 0 0 0 0 40 42 1 0 0 0 0 42 43 1 0 0 0 0 5 43 1 0 0 0 0 43 44 2 0 0 0 0 36 45 1 0 0 0 0 45 46 1 0 0 0 0 45 47 1 0 0 0 0 28 48 1 0 0 0 0 48 49 1 0 0 0 0 48 50 1 0 0 0 0 M END 3D MOL for HMDB0303680 (Citrusin I)HMDB0303680 RDKit 3D Citrusin I 103104 0 0 0 0 0 0 0 0999 V2000 -2.0393 -2.9319 3.0533 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7436 -3.7370 1.9947 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3283 -2.8547 0.8888 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9896 -3.7858 -0.0766 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1384 -2.2326 0.1450 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3399 -3.3111 -0.3977 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0218 -3.5940 -0.1672 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3531 -4.7534 0.2521 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1857 -2.6693 -0.3586 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4219 -3.5285 -0.6903 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1602 -4.3177 -1.9534 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3347 -5.1793 -2.3273 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9806 -3.3107 -3.0993 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3905 -1.8425 0.7998 N 0 0 0 0 0 0 0 0 0 0 0 0 2.3531 -0.8955 1.0977 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0188 -1.0750 2.1911 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7659 0.3191 0.3704 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0911 0.1196 -0.2653 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1475 -0.1678 0.7276 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4896 -1.4354 1.1116 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4955 -1.6210 2.0557 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1634 -0.5610 2.6202 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8236 0.7203 2.2371 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8309 0.9119 1.3053 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7389 0.8747 -0.4951 N 0 0 0 0 0 0 0 0 0 0 0 0 1.6963 2.1970 -0.9926 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5858 2.3024 -2.2500 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7640 3.4444 -0.2247 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1349 3.9660 0.0541 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9396 4.1745 -1.2127 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9751 5.2534 0.6154 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0093 3.3760 1.0230 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.3499 3.7648 1.1217 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0877 3.0803 1.8693 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9060 4.9024 0.4036 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7835 4.5985 -0.6949 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.5097 3.4681 -1.0013 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2067 2.8602 -2.1032 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6152 2.7953 -0.2759 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4878 3.7461 0.5244 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2859 4.6523 -0.3914 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8432 4.4286 1.5148 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5545 2.1973 -1.2443 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.3537 1.0548 -0.9964 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5793 1.0999 -1.2995 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8747 -0.2211 -0.4008 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0952 -1.1192 -0.2734 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8676 -0.8504 -1.2105 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.5781 -1.2712 -0.8998 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5727 -0.8064 -1.5688 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2947 -3.3526 4.0694 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3308 -1.8631 3.0213 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9543 -3.0991 2.9377 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1075 -4.5325 1.5793 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6186 -4.2357 2.4704 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9456 -2.1278 1.3852 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0799 -3.8152 0.1593 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9296 -3.4252 -1.1350 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5917 -4.8186 -0.0235 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6121 -1.6321 0.9101 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8419 -3.9728 -1.0423 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0836 -2.0506 -1.2601 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5434 -4.2532 0.1358 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2726 -2.8695 -0.8358 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2076 -4.8782 -1.9087 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1263 -5.1809 -1.5334 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8558 -4.8278 -3.2468 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9962 -6.2300 -2.5598 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9549 -2.9467 -3.1219 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7619 -2.5421 -3.0717 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1453 -3.8857 -4.0567 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6534 -1.9992 1.5758 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9346 1.1751 1.1224 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1068 -0.6486 -1.0626 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4237 1.0600 -0.8022 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9712 -2.2676 0.6727 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7107 -2.6473 2.3102 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9462 -0.7646 3.3583 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3515 1.5571 2.6838 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5678 1.8972 1.0072 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9712 0.2011 -0.7494 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2549 4.2667 -0.8117 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7281 3.3984 0.7530 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0204 4.2956 -0.9489 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6246 5.1368 -1.6566 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8640 3.3231 -1.9181 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4519 5.3386 1.4760 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5629 3.0071 1.8550 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4616 5.6169 1.0829 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0409 5.5598 0.0532 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8642 5.4144 -1.3947 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1767 2.0403 0.3848 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2484 3.0847 1.0350 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2610 4.1705 -0.6599 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5518 5.6117 0.0891 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7730 4.8795 -1.3256 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6758 3.8997 2.3301 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5914 2.6978 -2.1585 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5185 0.0519 0.6130 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0378 -0.5440 -0.3986 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0020 -1.9376 -1.0085 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1543 -1.5582 0.7400 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1686 -1.0128 -2.2257 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 3 5 1 0 5 6 1 0 6 7 1 0 7 8 2 0 7 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 11 13 1 0 9 14 1 0 14 15 1 0 15 16 2 0 15 17 1 0 17 18 1 0 18 19 1 0 19 20 2 0 20 21 1 0 21 22 2 0 22 23 1 0 23 24 2 0 17 25 1 0 25 26 1 0 26 27 2 0 26 28 1 0 28 29 1 0 29 30 1 0 29 31 1 0 28 32 1 0 32 33 1 0 33 34 2 0 33 35 1 0 35 36 1 0 36 37 1 0 37 38 2 0 37 39 1 0 39 40 1 0 40 41 1 0 40 42 1 0 39 43 1 0 43 44 1 0 44 45 2 0 44 46 1 0 46 47 1 0 46 48 1 0 48 49 1 0 49 50 2 0 49 5 1 0 24 19 1 0 1 51 1 0 1 52 1 0 1 53 1 0 2 54 1 0 2 55 1 0 3 56 1 0 4 57 1 0 4 58 1 0 4 59 1 0 5 60 1 0 6 61 1 0 9 62 1 0 10 63 1 0 10 64 1 0 11 65 1 0 12 66 1 0 12 67 1 0 12 68 1 0 13 69 1 0 13 70 1 0 13 71 1 0 14 72 1 0 17 73 1 0 18 74 1 0 18 75 1 0 20 76 1 0 21 77 1 0 22 78 1 0 23 79 1 0 24 80 1 0 25 81 1 0 28 82 1 0 29 83 1 0 30 84 1 0 30 85 1 0 30 86 1 0 31 87 1 0 32 88 1 0 35 89 1 0 35 90 1 0 36 91 1 0 39 92 1 0 40 93 1 0 41 94 1 0 41 95 1 0 41 96 1 0 42 97 1 0 43 98 1 0 46 99 1 0 47100 1 0 47101 1 0 47102 1 0 48103 1 0 M END 3D SDF for HMDB0303680 (Citrusin I)Mrv1533004261502102D 50 51 0 0 0 0 999 V2000 -6.8327 -1.3383 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.2715 -0.7336 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4672 -0.9171 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2240 -1.7055 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9060 -0.3124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1017 -0.4959 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.9788 -1.3117 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.6238 -1.8261 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.2108 -1.6131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0878 -2.4289 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7329 -2.9433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6099 -3.7591 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5008 -2.6419 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.5658 -1.0988 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -1.8513 -1.5113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8513 -2.3363 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.1369 -1.0988 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4224 -1.5113 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4224 -2.3363 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2921 -2.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2921 -3.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4224 -3.9863 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1369 -3.5738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1369 -2.7488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1369 -0.2738 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.3689 0.0276 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2761 -0.4867 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2459 0.8434 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8909 1.3578 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.6478 2.1462 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.1566 2.3297 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.2089 2.7509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0132 2.5673 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.4780 3.2490 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1200 3.9923 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.3006 3.1873 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6586 2.4440 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -4.4813 2.5057 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.8392 3.2490 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.9460 1.8240 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.7687 1.8857 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5881 1.0807 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.1492 0.4760 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.9535 0.6596 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.7654 3.8690 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.5881 3.8073 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4074 4.6123 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.5221 1.1448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6450 1.9606 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1671 0.6305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 0 0 0 2 3 1 0 0 0 0 3 4 1 0 0 0 0 3 5 1 0 0 0 0 5 6 1 0 0 0 0 6 7 1 0 0 0 0 7 8 2 0 0 0 0 7 9 1 0 0 0 0 9 10 1 0 0 0 0 10 11 1 0 0 0 0 11 12 1 0 0 0 0 11 13 1 0 0 0 0 9 14 1 0 0 0 0 14 15 1 0 0 0 0 15 16 2 0 0 0 0 15 17 1 0 0 0 0 17 18 1 0 0 0 0 18 19 1 0 0 0 0 19 20 2 0 0 0 0 20 21 1 0 0 0 0 21 22 2 0 0 0 0 22 23 1 0 0 0 0 23 24 2 0 0 0 0 19 24 1 0 0 0 0 17 25 1 0 0 0 0 25 26 1 0 0 0 0 26 27 2 0 0 0 0 26 28 1 0 0 0 0 28 29 1 0 0 0 0 29 30 1 0 0 0 0 30 31 2 0 0 0 0 30 32 1 0 0 0 0 32 33 1 0 0 0 0 33 34 1 0 0 0 0 34 35 2 0 0 0 0 34 36 1 0 0 0 0 36 37 1 0 0 0 0 37 38 1 0 0 0 0 38 39 2 0 0 0 0 38 40 1 0 0 0 0 40 41 1 0 0 0 0 40 42 1 0 0 0 0 42 43 1 0 0 0 0 5 43 1 0 0 0 0 43 44 2 0 0 0 0 36 45 1 0 0 0 0 45 46 1 0 0 0 0 45 47 1 0 0 0 0 28 48 1 0 0 0 0 48 49 1 0 0 0 0 48 50 1 0 0 0 0 M END > <DATABASE_ID> HMDB0303680 > <DATABASE_NAME> hmdb > <SMILES> CCC(C)C1NC(=O)C(CC(C)C)NC(=O)C(CC2=CC=CC=C2)NC(=O)C(NC(=O)CNC(=O)C(NC(=O)C(C)NC1=O)C(C)O)C(C)O > <INCHI_IDENTIFIER> InChI=1S/C34H53N7O9/c1-8-18(4)26-33(49)36-19(5)29(45)41-27(20(6)42)32(48)35-16-25(44)39-28(21(7)43)34(50)38-24(15-22-12-10-9-11-13-22)30(46)37-23(14-17(2)3)31(47)40-26/h9-13,17-21,23-24,26-28,42-43H,8,14-16H2,1-7H3,(H,35,48)(H,36,49)(H,37,46)(H,38,50)(H,39,44)(H,40,47)(H,41,45) > <INCHI_KEY> LZVXYGLCVNPQDY-UHFFFAOYSA-N > <FORMULA> C34H53N7O9 > <MOLECULAR_WEIGHT> 703.838 > <EXACT_MASS> 703.390476315 > <JCHEM_ACCEPTOR_COUNT> 9 > <JCHEM_ATOM_COUNT> 103 > <JCHEM_AVERAGE_POLARIZABILITY> 71.9714744966053 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 9 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> 15-benzyl-9-(butan-2-yl)-3,18-bis(1-hydroxyethyl)-6-methyl-12-(2-methylpropyl)-1,4,7,10,13,16,19-heptaazacyclohenicosane-2,5,8,11,14,17,20-heptone > <ALOGPS_LOGP> 0.40 > <JCHEM_LOGP> -1.3425666973333328 > <ALOGPS_LOGS> -3.63 > <JCHEM_MDDR_LIKE_RULE> 0 > <JCHEM_NUMBER_OF_RINGS> 2 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA> 11.751659854826741 > <JCHEM_PKA_STRONGEST_ACIDIC> 11.354484192405595 > <JCHEM_PKA_STRONGEST_BASIC> -2.937114196742349 > <JCHEM_POLAR_SURFACE_AREA> 244.15999999999997 > <JCHEM_REFRACTIVITY> 180.40210000000008 > <JCHEM_ROTATABLE_BOND_COUNT> 8 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 1.66e-01 g/l > <JCHEM_TRADITIONAL_IUPAC> 15-benzyl-3,18-bis(1-hydroxyethyl)-6-methyl-12-(2-methylpropyl)-9-(sec-butyl)-1,4,7,10,13,16,19-heptaazacyclohenicosane-2,5,8,11,14,17,20-heptone > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0303680 (Citrusin I)HMDB0303680 RDKit 3D Citrusin I 103104 0 0 0 0 0 0 0 0999 V2000 -2.0393 -2.9319 3.0533 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7436 -3.7370 1.9947 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3283 -2.8547 0.8888 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.9896 -3.7858 -0.0766 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.1384 -2.2326 0.1450 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3399 -3.3111 -0.3977 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0218 -3.5940 -0.1672 C 0 0 0 0 0 0 0 0 0 0 0 0 0.3531 -4.7534 0.2521 O 0 0 0 0 0 0 0 0 0 0 0 0 1.1857 -2.6693 -0.3586 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4219 -3.5285 -0.6903 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1602 -4.3177 -1.9534 C 0 0 0 0 0 0 0 0 0 0 0 0 3.3347 -5.1793 -2.3273 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9806 -3.3107 -3.0993 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3905 -1.8425 0.7998 N 0 0 0 0 0 0 0 0 0 0 0 0 2.3531 -0.8955 1.0977 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0188 -1.0750 2.1911 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7659 0.3191 0.3704 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0911 0.1196 -0.2653 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1475 -0.1678 0.7276 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4896 -1.4354 1.1116 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4955 -1.6210 2.0557 C 0 0 0 0 0 0 0 0 0 0 0 0 7.1634 -0.5610 2.6202 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8236 0.7203 2.2371 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8309 0.9119 1.3053 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7389 0.8747 -0.4951 N 0 0 0 0 0 0 0 0 0 0 0 0 1.6963 2.1970 -0.9926 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5858 2.3024 -2.2500 O 0 0 0 0 0 0 0 0 0 0 0 0 1.7640 3.4444 -0.2247 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1349 3.9660 0.0541 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9396 4.1745 -1.2127 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9751 5.2534 0.6154 O 0 0 0 0 0 0 0 0 0 0 0 0 1.0093 3.3760 1.0230 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.3499 3.7648 1.1217 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.0877 3.0803 1.8693 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9060 4.9024 0.4036 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7835 4.5985 -0.6949 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.5097 3.4681 -1.0013 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.2067 2.8602 -2.1032 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.6152 2.7953 -0.2759 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4878 3.7461 0.5244 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.2859 4.6523 -0.3914 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8432 4.4286 1.5148 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.5545 2.1973 -1.2443 N 0 0 0 0 0 0 0 0 0 0 0 0 -5.3537 1.0548 -0.9964 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.5793 1.0999 -1.2995 O 0 0 0 0 0 0 0 0 0 0 0 0 -4.8747 -0.2211 -0.4008 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0952 -1.1192 -0.2734 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8676 -0.8504 -1.2105 N 0 0 0 0 0 0 0 0 0 0 0 0 -2.5781 -1.2712 -0.8998 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5727 -0.8064 -1.5688 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2947 -3.3526 4.0694 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3308 -1.8631 3.0213 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.9543 -3.0991 2.9377 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1075 -4.5325 1.5793 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6186 -4.2357 2.4704 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9456 -2.1278 1.3852 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0799 -3.8152 0.1593 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9296 -3.4252 -1.1350 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.5917 -4.8186 -0.0235 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6121 -1.6321 0.9101 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8419 -3.9728 -1.0423 H 0 0 0 0 0 0 0 0 0 0 0 0 1.0836 -2.0506 -1.2601 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5434 -4.2532 0.1358 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2726 -2.8695 -0.8358 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2076 -4.8782 -1.9087 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1263 -5.1809 -1.5334 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8558 -4.8278 -3.2468 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9962 -6.2300 -2.5598 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9549 -2.9467 -3.1219 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7619 -2.5421 -3.0717 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1453 -3.8857 -4.0567 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6534 -1.9992 1.5758 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9346 1.1751 1.1224 H 0 0 0 0 0 0 0 0 0 0 0 0 4.1068 -0.6486 -1.0626 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4237 1.0600 -0.8022 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9712 -2.2676 0.6727 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7107 -2.6473 2.3102 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9462 -0.7646 3.3583 H 0 0 0 0 0 0 0 0 0 0 0 0 7.3515 1.5571 2.6838 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5678 1.8972 1.0072 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9712 0.2011 -0.7494 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2549 4.2667 -0.8117 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7281 3.3984 0.7530 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0204 4.2956 -0.9489 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6246 5.1368 -1.6566 H 0 0 0 0 0 0 0 0 0 0 0 0 3.8640 3.3231 -1.9181 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4519 5.3386 1.4760 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5629 3.0071 1.8550 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4616 5.6169 1.0829 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0409 5.5598 0.0532 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8642 5.4144 -1.3947 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1767 2.0403 0.3848 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.2484 3.0847 1.0350 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.2610 4.1705 -0.6599 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.5518 5.6117 0.0891 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.7730 4.8795 -1.3256 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.6758 3.8997 2.3301 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5914 2.6978 -2.1585 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.5185 0.0519 0.6130 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0378 -0.5440 -0.3986 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0020 -1.9376 -1.0085 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1543 -1.5582 0.7400 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1686 -1.0128 -2.2257 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 1 0 3 4 1 0 3 5 1 0 5 6 1 0 6 7 1 0 7 8 2 0 7 9 1 0 9 10 1 0 10 11 1 0 11 12 1 0 11 13 1 0 9 14 1 0 14 15 1 0 15 16 2 0 15 17 1 0 17 18 1 0 18 19 1 0 19 20 2 0 20 21 1 0 21 22 2 0 22 23 1 0 23 24 2 0 17 25 1 0 25 26 1 0 26 27 2 0 26 28 1 0 28 29 1 0 29 30 1 0 29 31 1 0 28 32 1 0 32 33 1 0 33 34 2 0 33 35 1 0 35 36 1 0 36 37 1 0 37 38 2 0 37 39 1 0 39 40 1 0 40 41 1 0 40 42 1 0 39 43 1 0 43 44 1 0 44 45 2 0 44 46 1 0 46 47 1 0 46 48 1 0 48 49 1 0 49 50 2 0 49 5 1 0 24 19 1 0 1 51 1 0 1 52 1 0 1 53 1 0 2 54 1 0 2 55 1 0 3 56 1 0 4 57 1 0 4 58 1 0 4 59 1 0 5 60 1 0 6 61 1 0 9 62 1 0 10 63 1 0 10 64 1 0 11 65 1 0 12 66 1 0 12 67 1 0 12 68 1 0 13 69 1 0 13 70 1 0 13 71 1 0 14 72 1 0 17 73 1 0 18 74 1 0 18 75 1 0 20 76 1 0 21 77 1 0 22 78 1 0 23 79 1 0 24 80 1 0 25 81 1 0 28 82 1 0 29 83 1 0 30 84 1 0 30 85 1 0 30 86 1 0 31 87 1 0 32 88 1 0 35 89 1 0 35 90 1 0 36 91 1 0 39 92 1 0 40 93 1 0 41 94 1 0 41 95 1 0 41 96 1 0 42 97 1 0 43 98 1 0 46 99 1 0 47100 1 0 47101 1 0 47102 1 0 48103 1 0 M END PDB for HMDB0303680 (Citrusin I)HEADER PROTEIN 26-APR-15 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 26-APR-15 0 HETATM 1 C UNK 0 -12.754 -2.498 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 -11.707 -1.369 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 -10.205 -1.712 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 -9.752 -3.184 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 -9.158 -0.583 0.000 0.00 0.00 C+0 HETATM 6 N UNK 0 -7.657 -0.926 0.000 0.00 0.00 N+0 HETATM 7 C UNK 0 -7.427 -2.449 0.000 0.00 0.00 C+0 HETATM 8 O UNK 0 -8.631 -3.409 0.000 0.00 0.00 O+0 HETATM 9 C UNK 0 -5.993 -3.011 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 -5.764 -4.534 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 -6.968 -5.494 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 -6.738 -7.017 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 -8.402 -4.932 0.000 0.00 0.00 C+0 HETATM 14 N UNK 0 -4.789 -2.051 0.000 0.00 0.00 N+0 HETATM 15 C UNK 0 -3.456 -2.821 0.000 0.00 0.00 C+0 HETATM 16 O UNK 0 -3.456 -4.361 0.000 0.00 0.00 O+0 HETATM 17 C UNK 0 -2.122 -2.051 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 -0.788 -2.821 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 -0.788 -4.361 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 0.545 -5.131 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 0.545 -6.671 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 -0.788 -7.441 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 -2.122 -6.671 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 -2.122 -5.131 0.000 0.00 0.00 C+0 HETATM 25 N UNK 0 -2.122 -0.511 0.000 0.00 0.00 N+0 HETATM 26 C UNK 0 -0.689 0.052 0.000 0.00 0.00 C+0 HETATM 27 O UNK 0 0.515 -0.909 0.000 0.00 0.00 O+0 HETATM 28 C UNK 0 -0.459 1.574 0.000 0.00 0.00 C+0 HETATM 29 N UNK 0 -1.663 2.535 0.000 0.00 0.00 N+0 HETATM 30 C UNK 0 -1.209 4.006 0.000 0.00 0.00 C+0 HETATM 31 O UNK 0 0.292 4.349 0.000 0.00 0.00 O+0 HETATM 32 C UNK 0 -2.257 5.135 0.000 0.00 0.00 C+0 HETATM 33 N UNK 0 -3.758 4.792 0.000 0.00 0.00 N+0 HETATM 34 C UNK 0 -4.626 6.065 0.000 0.00 0.00 C+0 HETATM 35 O UNK 0 -3.957 7.452 0.000 0.00 0.00 O+0 HETATM 36 C UNK 0 -6.161 5.950 0.000 0.00 0.00 C+0 HETATM 37 N UNK 0 -6.829 4.562 0.000 0.00 0.00 N+0 HETATM 38 C UNK 0 -8.365 4.677 0.000 0.00 0.00 C+0 HETATM 39 O UNK 0 -9.033 6.065 0.000 0.00 0.00 O+0 HETATM 40 C UNK 0 -9.233 3.405 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 -10.768 3.520 0.000 0.00 0.00 C+0 HETATM 42 N UNK 0 -8.564 2.017 0.000 0.00 0.00 N+0 HETATM 43 C UNK 0 -9.612 0.888 0.000 0.00 0.00 C+0 HETATM 44 O UNK 0 -11.113 1.231 0.000 0.00 0.00 O+0 HETATM 45 C UNK 0 -7.029 7.222 0.000 0.00 0.00 C+0 HETATM 46 C UNK 0 -8.564 7.107 0.000 0.00 0.00 C+0 HETATM 47 O UNK 0 -6.361 8.610 0.000 0.00 0.00 O+0 HETATM 48 C UNK 0 0.974 2.137 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 1.204 3.660 0.000 0.00 0.00 C+0 HETATM 50 O UNK 0 2.179 1.177 0.000 0.00 0.00 O+0 CONECT 1 2 CONECT 2 1 3 CONECT 3 2 4 5 CONECT 4 3 CONECT 5 3 6 43 CONECT 6 5 7 CONECT 7 6 8 9 CONECT 8 7 CONECT 9 7 10 14 CONECT 10 9 11 CONECT 11 10 12 13 CONECT 12 11 CONECT 13 11 CONECT 14 9 15 CONECT 15 14 16 17 CONECT 16 15 CONECT 17 15 18 25 CONECT 18 17 19 CONECT 19 18 20 24 CONECT 20 19 21 CONECT 21 20 22 CONECT 22 21 23 CONECT 23 22 24 CONECT 24 23 19 CONECT 25 17 26 CONECT 26 25 27 28 CONECT 27 26 CONECT 28 26 29 48 CONECT 29 28 30 CONECT 30 29 31 32 CONECT 31 30 CONECT 32 30 33 CONECT 33 32 34 CONECT 34 33 35 36 CONECT 35 34 CONECT 36 34 37 45 CONECT 37 36 38 CONECT 38 37 39 40 CONECT 39 38 CONECT 40 38 41 42 CONECT 41 40 CONECT 42 40 43 CONECT 43 42 5 44 CONECT 44 43 CONECT 45 36 46 47 CONECT 46 45 CONECT 47 45 CONECT 48 28 49 50 CONECT 49 48 CONECT 50 48 MASTER 0 0 0 0 0 0 0 0 50 0 102 0 END 3D PDB for HMDB0303680 (Citrusin I)COMPND HMDB0303680 HETATM 1 C1 UNL 1 -2.039 -2.932 3.053 1.00 0.00 C HETATM 2 C2 UNL 1 -2.744 -3.737 1.995 1.00 0.00 C HETATM 3 C3 UNL 1 -3.328 -2.855 0.889 1.00 0.00 C HETATM 4 C4 UNL 1 -3.990 -3.786 -0.077 1.00 0.00 C HETATM 5 C5 UNL 1 -2.138 -2.233 0.145 1.00 0.00 C HETATM 6 N1 UNL 1 -1.340 -3.311 -0.398 1.00 0.00 N HETATM 7 C6 UNL 1 0.022 -3.594 -0.167 1.00 0.00 C HETATM 8 O1 UNL 1 0.353 -4.753 0.252 1.00 0.00 O HETATM 9 C7 UNL 1 1.186 -2.669 -0.359 1.00 0.00 C HETATM 10 C8 UNL 1 2.422 -3.529 -0.690 1.00 0.00 C HETATM 11 C9 UNL 1 2.160 -4.318 -1.953 1.00 0.00 C HETATM 12 C10 UNL 1 3.335 -5.179 -2.327 1.00 0.00 C HETATM 13 C11 UNL 1 1.981 -3.311 -3.099 1.00 0.00 C HETATM 14 N2 UNL 1 1.390 -1.843 0.800 1.00 0.00 N HETATM 15 C12 UNL 1 2.353 -0.895 1.098 1.00 0.00 C HETATM 16 O2 UNL 1 3.019 -1.075 2.191 1.00 0.00 O HETATM 17 C13 UNL 1 2.766 0.319 0.370 1.00 0.00 C HETATM 18 C14 UNL 1 4.091 0.120 -0.265 1.00 0.00 C HETATM 19 C15 UNL 1 5.147 -0.168 0.728 1.00 0.00 C HETATM 20 C16 UNL 1 5.490 -1.435 1.112 1.00 0.00 C HETATM 21 C17 UNL 1 6.496 -1.621 2.056 1.00 0.00 C HETATM 22 C18 UNL 1 7.163 -0.561 2.620 1.00 0.00 C HETATM 23 C19 UNL 1 6.824 0.720 2.237 1.00 0.00 C HETATM 24 C20 UNL 1 5.831 0.912 1.305 1.00 0.00 C HETATM 25 N3 UNL 1 1.739 0.875 -0.495 1.00 0.00 N HETATM 26 C21 UNL 1 1.696 2.197 -0.993 1.00 0.00 C HETATM 27 O3 UNL 1 1.586 2.302 -2.250 1.00 0.00 O HETATM 28 C22 UNL 1 1.764 3.444 -0.225 1.00 0.00 C HETATM 29 C23 UNL 1 3.135 3.966 0.054 1.00 0.00 C HETATM 30 C24 UNL 1 3.940 4.174 -1.213 1.00 0.00 C HETATM 31 O4 UNL 1 2.975 5.253 0.615 1.00 0.00 O HETATM 32 N4 UNL 1 1.009 3.376 1.023 1.00 0.00 N HETATM 33 C25 UNL 1 -0.350 3.765 1.122 1.00 0.00 C HETATM 34 O5 UNL 1 -1.088 3.080 1.869 1.00 0.00 O HETATM 35 C26 UNL 1 -0.906 4.902 0.404 1.00 0.00 C HETATM 36 N5 UNL 1 -1.783 4.599 -0.695 1.00 0.00 N HETATM 37 C27 UNL 1 -2.510 3.468 -1.001 1.00 0.00 C HETATM 38 O6 UNL 1 -2.207 2.860 -2.103 1.00 0.00 O HETATM 39 C28 UNL 1 -3.615 2.795 -0.276 1.00 0.00 C HETATM 40 C29 UNL 1 -4.488 3.746 0.524 1.00 0.00 C HETATM 41 C30 UNL 1 -5.286 4.652 -0.391 1.00 0.00 C HETATM 42 O7 UNL 1 -3.843 4.429 1.515 1.00 0.00 O HETATM 43 N6 UNL 1 -4.555 2.197 -1.244 1.00 0.00 N HETATM 44 C31 UNL 1 -5.354 1.055 -0.996 1.00 0.00 C HETATM 45 O8 UNL 1 -6.579 1.100 -1.300 1.00 0.00 O HETATM 46 C32 UNL 1 -4.875 -0.221 -0.401 1.00 0.00 C HETATM 47 C33 UNL 1 -6.095 -1.119 -0.273 1.00 0.00 C HETATM 48 N7 UNL 1 -3.868 -0.850 -1.211 1.00 0.00 N HETATM 49 C34 UNL 1 -2.578 -1.271 -0.900 1.00 0.00 C HETATM 50 O9 UNL 1 -1.573 -0.806 -1.569 1.00 0.00 O HETATM 51 H1 UNL 1 -2.295 -3.353 4.069 1.00 0.00 H HETATM 52 H2 UNL 1 -2.331 -1.863 3.021 1.00 0.00 H HETATM 53 H3 UNL 1 -0.954 -3.099 2.938 1.00 0.00 H HETATM 54 H4 UNL 1 -2.108 -4.533 1.579 1.00 0.00 H HETATM 55 H5 UNL 1 -3.619 -4.236 2.470 1.00 0.00 H HETATM 56 H6 UNL 1 -3.946 -2.128 1.385 1.00 0.00 H HETATM 57 H7 UNL 1 -5.080 -3.815 0.159 1.00 0.00 H HETATM 58 H8 UNL 1 -3.930 -3.425 -1.135 1.00 0.00 H HETATM 59 H9 UNL 1 -3.592 -4.819 -0.023 1.00 0.00 H HETATM 60 H10 UNL 1 -1.612 -1.632 0.910 1.00 0.00 H HETATM 61 H11 UNL 1 -1.842 -3.973 -1.042 1.00 0.00 H HETATM 62 H12 UNL 1 1.084 -2.051 -1.260 1.00 0.00 H HETATM 63 H13 UNL 1 2.543 -4.253 0.136 1.00 0.00 H HETATM 64 H14 UNL 1 3.273 -2.870 -0.836 1.00 0.00 H HETATM 65 H15 UNL 1 1.208 -4.878 -1.909 1.00 0.00 H HETATM 66 H16 UNL 1 4.126 -5.181 -1.533 1.00 0.00 H HETATM 67 H17 UNL 1 3.856 -4.828 -3.247 1.00 0.00 H HETATM 68 H18 UNL 1 2.996 -6.230 -2.560 1.00 0.00 H HETATM 69 H19 UNL 1 0.955 -2.947 -3.122 1.00 0.00 H HETATM 70 H20 UNL 1 2.762 -2.542 -3.072 1.00 0.00 H HETATM 71 H21 UNL 1 2.145 -3.886 -4.057 1.00 0.00 H HETATM 72 H22 UNL 1 0.653 -1.999 1.576 1.00 0.00 H HETATM 73 H23 UNL 1 2.935 1.175 1.122 1.00 0.00 H HETATM 74 H24 UNL 1 4.107 -0.649 -1.063 1.00 0.00 H HETATM 75 H25 UNL 1 4.424 1.060 -0.802 1.00 0.00 H HETATM 76 H26 UNL 1 4.971 -2.268 0.673 1.00 0.00 H HETATM 77 H27 UNL 1 6.711 -2.647 2.310 1.00 0.00 H HETATM 78 H28 UNL 1 7.946 -0.765 3.358 1.00 0.00 H HETATM 79 H29 UNL 1 7.352 1.557 2.684 1.00 0.00 H HETATM 80 H30 UNL 1 5.568 1.897 1.007 1.00 0.00 H HETATM 81 H31 UNL 1 0.971 0.201 -0.749 1.00 0.00 H HETATM 82 H32 UNL 1 1.255 4.267 -0.812 1.00 0.00 H HETATM 83 H33 UNL 1 3.728 3.398 0.753 1.00 0.00 H HETATM 84 H34 UNL 1 5.020 4.296 -0.949 1.00 0.00 H HETATM 85 H35 UNL 1 3.625 5.137 -1.657 1.00 0.00 H HETATM 86 H36 UNL 1 3.864 3.323 -1.918 1.00 0.00 H HETATM 87 H37 UNL 1 3.452 5.339 1.476 1.00 0.00 H HETATM 88 H38 UNL 1 1.563 3.007 1.855 1.00 0.00 H HETATM 89 H39 UNL 1 -1.462 5.617 1.083 1.00 0.00 H HETATM 90 H40 UNL 1 -0.041 5.560 0.053 1.00 0.00 H HETATM 91 H41 UNL 1 -1.864 5.414 -1.395 1.00 0.00 H HETATM 92 H42 UNL 1 -3.177 2.040 0.385 1.00 0.00 H HETATM 93 H43 UNL 1 -5.248 3.085 1.035 1.00 0.00 H HETATM 94 H44 UNL 1 -6.261 4.170 -0.660 1.00 0.00 H HETATM 95 H45 UNL 1 -5.552 5.612 0.089 1.00 0.00 H HETATM 96 H46 UNL 1 -4.773 4.880 -1.326 1.00 0.00 H HETATM 97 H47 UNL 1 -3.676 3.900 2.330 1.00 0.00 H HETATM 98 H48 UNL 1 -4.591 2.698 -2.158 1.00 0.00 H HETATM 99 H49 UNL 1 -4.519 0.052 0.613 1.00 0.00 H HETATM 100 H50 UNL 1 -7.038 -0.544 -0.399 1.00 0.00 H HETATM 101 H51 UNL 1 -6.002 -1.938 -1.008 1.00 0.00 H HETATM 102 H52 UNL 1 -6.154 -1.558 0.740 1.00 0.00 H HETATM 103 H53 UNL 1 -4.169 -1.013 -2.226 1.00 0.00 H CONECT 1 2 51 52 53 CONECT 2 3 54 55 CONECT 3 4 5 56 CONECT 4 57 58 59 CONECT 5 6 49 60 CONECT 6 7 61 CONECT 7 8 8 9 CONECT 9 10 14 62 CONECT 10 11 63 64 CONECT 11 12 13 65 CONECT 12 66 67 68 CONECT 13 69 70 71 CONECT 14 15 72 CONECT 15 16 16 17 CONECT 17 18 25 73 CONECT 18 19 74 75 CONECT 19 20 20 24 CONECT 20 21 76 CONECT 21 22 22 77 CONECT 22 23 78 CONECT 23 24 24 79 CONECT 24 80 CONECT 25 26 81 CONECT 26 27 27 28 CONECT 28 29 32 82 CONECT 29 30 31 83 CONECT 30 84 85 86 CONECT 31 87 CONECT 32 33 88 CONECT 33 34 34 35 CONECT 35 36 89 90 CONECT 36 37 91 CONECT 37 38 38 39 CONECT 39 40 43 92 CONECT 40 41 42 93 CONECT 41 94 95 96 CONECT 42 97 CONECT 43 44 98 CONECT 44 45 45 46 CONECT 46 47 48 99 CONECT 47 100 101 102 CONECT 48 49 103 CONECT 49 50 50 END SMILES for HMDB0303680 (Citrusin I)CCC(C)C1NC(=O)C(CC(C)C)NC(=O)C(CC2=CC=CC=C2)NC(=O)C(NC(=O)CNC(=O)C(NC(=O)C(C)NC1=O)C(C)O)C(C)O INCHI for HMDB0303680 (Citrusin I)InChI=1S/C34H53N7O9/c1-8-18(4)26-33(49)36-19(5)29(45)41-27(20(6)42)32(48)35-16-25(44)39-28(21(7)43)34(50)38-24(15-22-12-10-9-11-13-22)30(46)37-23(14-17(2)3)31(47)40-26/h9-13,17-21,23-24,26-28,42-43H,8,14-16H2,1-7H3,(H,35,48)(H,36,49)(H,37,46)(H,38,50)(H,39,44)(H,40,47)(H,41,45) 3D Structure for HMDB0303680 (Citrusin I) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C34H53N7O9 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 703.838 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 703.390476315 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | 15-benzyl-9-(butan-2-yl)-3,18-bis(1-hydroxyethyl)-6-methyl-12-(2-methylpropyl)-1,4,7,10,13,16,19-heptaazacyclohenicosane-2,5,8,11,14,17,20-heptone | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | 15-benzyl-3,18-bis(1-hydroxyethyl)-6-methyl-12-(2-methylpropyl)-9-(sec-butyl)-1,4,7,10,13,16,19-heptaazacyclohenicosane-2,5,8,11,14,17,20-heptone | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | CCC(C)C1NC(=O)C(CC(C)C)NC(=O)C(CC2=CC=CC=C2)NC(=O)C(NC(=O)CNC(=O)C(NC(=O)C(C)NC1=O)C(C)O)C(C)O | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C34H53N7O9/c1-8-18(4)26-33(49)36-19(5)29(45)41-27(20(6)42)32(48)35-16-25(44)39-28(21(7)43)34(50)38-24(15-22-12-10-9-11-13-22)30(46)37-23(14-17(2)3)31(47)40-26/h9-13,17-21,23-24,26-28,42-43H,8,14-16H2,1-7H3,(H,35,48)(H,36,49)(H,37,46)(H,38,50)(H,39,44)(H,40,47)(H,41,45) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | LZVXYGLCVNPQDY-UHFFFAOYSA-N | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as oligopeptides. These are organic compounds containing a sequence of between three and ten alpha-amino acids joined by peptide bonds. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Organic acids and derivatives | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | Carboxylic acids and derivatives | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Amino acids, peptides, and analogues | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | Oligopeptides | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aromatic heteromonocyclic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | FDB018074 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | 57462402 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | 85632468 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References | Not Available |