Showing metabocard for Hopeaphenol (HMDB0304690)
Record Information | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
Version | 5.0 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Status | Expected but not Quantified | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Creation Date | 2021-09-24 11:41:44 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Update Date | 2021-09-24 11:41:44 UTC | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
HMDB ID | HMDB0304690 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Secondary Accession Numbers | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Metabolite Identification | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Common Name | Hopeaphenol | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | (8S,16S)-8,16-bis(4-hydroxyphenyl)-9-[(8S,16S)-4,6,12-trihydroxy-8,16-bis(4-hydroxyphenyl)-15-oxatetracyclo[8.6.1.0²,⁷.0¹⁴,¹⁷]heptadeca-2(7),3,5,10(17),11,13-hexaen-9-yl]-15-oxatetracyclo[8.6.1.0²,⁷.0¹⁴,¹⁷]heptadeca-2(7),3,5,10(17),11,13-hexaene-4,6,12-triol belongs to the class of organic compounds known as 2-arylbenzofuran flavonoids. These are phenylpropanoids containing the 2-phenylbenzofuran moiety. Based on a literature review very few articles have been published on (8S,16S)-8,16-bis(4-hydroxyphenyl)-9-[(8S,16S)-4,6,12-trihydroxy-8,16-bis(4-hydroxyphenyl)-15-oxatetracyclo[8.6.1.0²,⁷.0¹⁴,¹⁷]heptadeca-2(7),3,5,10(17),11,13-hexaen-9-yl]-15-oxatetracyclo[8.6.1.0²,⁷.0¹⁴,¹⁷]heptadeca-2(7),3,5,10(17),11,13-hexaene-4,6,12-triol. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Structure | MOL for HMDB0304690 (Hopeaphenol)Mrv1652304022019462D 68 79 0 0 0 0 999 V2000 -2.7108 -1.3266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4252 -0.0891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7961 1.0445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6871 -0.0727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5700 4.0514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1839 4.3983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4266 -4.4927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7830 -4.0431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4252 -1.7391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1397 -0.5016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4412 1.5589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3320 0.4416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7703 4.8517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3842 5.1987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6861 -5.2758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0425 -4.8262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0745 2.4163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1638 -2.3747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9888 0.8077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0111 -0.9997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0464 1.3688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0547 -1.2577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4099 2.1732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3291 -2.3927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7108 -0.5016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9190 0.2287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7768 3.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9750 -3.8763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1397 -1.3266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2092 1.2575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1774 5.4254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4941 -5.4426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8628 2.1732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9318 -2.0735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5935 1.3688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5723 -1.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4697 1.8552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5188 -1.8605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2005 1.0509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7932 -1.1833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4416 0.8077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4097 -0.7433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6217 2.4163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4752 -2.5764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1389 0.4059 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.0806 -0.4400 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6533 1.0509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6418 -1.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0168 1.8552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0364 -1.9716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3139 0.4059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2579 -0.5016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7264 2.2131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8043 -2.2730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5765 3.0244 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.7155 -3.0932 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.8541 -1.7391 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8541 1.7718 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3777 6.2257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7535 -6.2257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4676 2.7343 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5768 -2.5879 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3819 1.1256 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3766 -1.4209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6252 0.0034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5327 0.0724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2393 3.1474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9111 -3.2768 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9 1 1 0 0 0 0 10 2 2 0 0 0 0 11 3 1 0 0 0 0 12 4 2 0 0 0 0 13 5 1 0 0 0 0 14 6 2 0 0 0 0 15 7 1 0 0 0 0 16 8 2 0 0 0 0 25 1 2 0 0 0 0 25 2 1 0 0 0 0 26 3 2 0 0 0 0 26 4 1 0 0 0 0 27 5 2 0 0 0 0 27 6 1 0 0 0 0 28 7 2 0 0 0 0 28 8 1 0 0 0 0 29 9 2 0 0 0 0 29 10 1 0 0 0 0 30 11 2 0 0 0 0 30 12 1 0 0 0 0 31 13 2 0 0 0 0 31 14 1 0 0 0 0 32 15 2 0 0 0 0 32 16 1 0 0 0 0 33 17 2 0 0 0 0 33 21 1 0 0 0 0 34 18 2 0 0 0 0 34 22 1 0 0 0 0 35 19 2 0 0 0 0 35 23 1 0 0 0 0 36 20 2 0 0 0 0 36 24 1 0 0 0 0 37 17 1 0 0 0 0 38 18 1 0 0 0 0 39 19 1 0 0 0 0 40 20 1 0 0 0 0 41 21 2 0 0 0 0 42 22 2 0 0 0 0 43 23 2 0 0 0 0 44 24 2 0 0 0 0 45 25 1 1 0 0 0 46 26 1 1 0 0 0 47 37 2 0 0 0 0 47 41 1 0 0 0 0 47 45 1 0 0 0 0 48 38 2 0 0 0 0 48 42 1 0 0 0 0 48 46 1 0 0 0 0 49 39 2 0 0 0 0 49 43 1 0 0 0 0 50 40 2 0 0 0 0 50 44 1 0 0 0 0 51 39 1 0 0 0 0 51 45 1 0 0 0 0 52 40 1 0 0 0 0 52 46 1 0 0 0 0 52 51 1 0 0 0 0 53 37 1 0 0 0 0 53 49 1 0 0 0 0 54 38 1 0 0 0 0 54 50 1 0 0 0 0 55 27 1 1 0 0 0 55 53 1 0 0 0 0 56 28 1 1 0 0 0 56 54 1 0 0 0 0 57 29 1 0 0 0 0 58 30 1 0 0 0 0 59 31 1 0 0 0 0 60 32 1 0 0 0 0 61 33 1 0 0 0 0 62 34 1 0 0 0 0 63 35 1 0 0 0 0 64 36 1 0 0 0 0 65 41 1 0 0 0 0 66 42 1 0 0 0 0 67 43 1 0 0 0 0 67 55 1 0 0 0 0 68 44 1 0 0 0 0 68 56 1 0 0 0 0 M END 3D MOL for HMDB0304690 (Hopeaphenol)HMDB0304690 RDKit 3D Hopeaphenol 110121 0 0 0 0 0 0 0 0999 V2000 8.7010 1.3356 -1.1796 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5438 1.3344 -0.4041 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6372 0.3299 -0.5428 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4701 0.3259 0.2362 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1779 1.2829 1.1441 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0305 1.4255 2.0230 C 0 0 1 0 0 0 0 0 0 0 0 0 3.6096 2.8224 1.8914 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7015 2.8508 0.8223 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3160 3.8468 -0.0377 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3788 3.6155 -1.0247 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0290 4.6718 -1.8690 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8424 2.3551 -1.1186 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2051 1.3168 -0.2667 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1309 1.5802 0.6893 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7560 0.7481 1.7142 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7945 -0.6913 1.4962 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5797 -1.2482 2.4921 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7893 -2.5976 2.5384 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5810 -3.1604 3.5437 O 0 0 0 0 0 0 0 0 0 0 0 0 3.1951 -3.3702 1.5652 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4158 -2.8041 0.5792 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8649 -3.6594 -0.3513 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1855 -1.4248 0.5119 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3147 -1.1250 -0.6012 C 0 0 2 0 0 0 0 0 0 0 0 0 2.0014 -1.1678 -1.9513 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9821 -0.2743 -2.2911 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5992 -0.3010 -3.5233 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2370 -1.2518 -4.4730 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8304 -1.3093 -5.7129 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2619 -2.1433 -4.1431 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6668 -2.0952 -2.9159 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4576 0.0618 -0.5561 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7951 -0.0581 0.3808 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5209 1.2552 0.2109 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9950 2.1903 1.1231 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3521 3.5114 1.1151 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7582 4.3450 2.0771 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2620 3.9932 0.1910 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7819 3.0870 -0.6999 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4213 1.7425 -0.6816 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3209 1.0124 -1.6539 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7924 -0.2273 -0.9842 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1479 -0.3560 -1.1768 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8665 -1.3378 -0.5116 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2382 -1.4874 -0.6878 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2008 -2.1792 0.3405 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8139 -2.0260 0.5109 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2558 -2.9036 1.3833 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0776 -1.0644 -0.1416 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6340 -1.2464 0.0439 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.2364 -2.5134 0.6851 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3445 -3.7376 -0.0120 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9524 -4.9321 0.5265 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4267 -4.9704 1.8021 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0152 -6.1399 2.3984 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3181 -3.7726 2.4926 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7146 -2.5734 1.9445 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4422 2.0035 -1.8291 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4127 2.1484 -0.7256 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1320 1.8248 0.5643 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0825 2.0164 1.5611 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3125 2.5327 1.2617 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2989 2.7448 2.2204 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6227 2.8702 -0.0456 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6803 2.6753 -1.0086 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6947 3.2403 -1.7536 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1412 2.3101 1.2609 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2882 2.3402 0.5143 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3999 2.0660 -1.1043 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7907 -0.4868 -1.2548 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8054 -0.4783 0.0742 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3517 1.3723 3.0896 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7873 4.8220 0.0997 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3464 4.4641 -2.5696 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1263 2.1920 -1.8896 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1061 0.9183 2.6607 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0462 -0.6123 3.2620 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7228 -4.1529 3.5624 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3805 -4.4394 1.6272 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0390 -4.6464 -0.2872 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6169 -2.0126 -0.6785 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3090 0.4866 -1.6157 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3742 0.3901 -3.8193 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5496 -2.0076 -6.3862 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9198 -2.9274 -4.8442 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8884 -2.8083 -2.6885 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0050 0.2000 -1.5585 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3507 -0.0605 1.3934 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3099 1.8366 1.8755 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2085 4.4599 2.9636 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5421 5.0358 0.1799 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8459 0.7722 -2.5859 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6941 0.2326 -1.8711 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6657 -2.0635 -1.3724 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7571 -2.9429 0.8650 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7290 -3.6267 1.8949 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2917 -1.4554 -1.0768 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7542 -3.7221 -1.0067 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0410 -5.8728 -0.0219 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0742 -7.0316 1.9362 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0971 -3.8201 3.4925 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6073 -1.6868 2.5306 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9713 1.8986 -2.7782 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2045 1.4080 0.9115 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8737 1.7636 2.5919 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0599 2.4937 3.1749 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6216 3.2867 -0.2771 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8869 2.9254 -2.0272 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9940 3.1167 1.9579 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0375 3.1158 0.5888 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 4 5 2 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 2 0 9 10 1 0 10 11 1 0 10 12 2 0 12 13 1 0 13 14 2 0 14 15 1 0 15 16 1 0 16 17 2 0 17 18 1 0 18 19 1 0 18 20 2 0 20 21 1 0 21 22 1 0 21 23 2 0 23 24 1 0 24 25 1 0 25 26 2 0 26 27 1 0 27 28 2 0 28 29 1 0 28 30 1 0 30 31 2 0 24 32 1 0 32 33 1 0 33 34 1 0 34 35 2 0 35 36 1 0 36 37 1 0 36 38 2 0 38 39 1 0 39 40 2 0 40 41 1 0 41 42 1 0 42 43 2 0 43 44 1 0 44 45 1 0 44 46 2 0 46 47 1 0 47 48 1 0 47 49 2 0 49 50 1 0 50 51 1 0 51 52 2 0 52 53 1 0 53 54 2 0 54 55 1 0 54 56 1 0 56 57 2 0 41 58 1 0 58 59 1 0 59 60 2 0 60 61 1 0 61 62 2 0 62 63 1 0 62 64 1 0 64 65 2 0 58 66 1 0 5 67 1 0 67 68 2 0 68 2 1 0 15 6 1 0 23 16 1 0 31 25 1 0 50 33 1 0 57 51 1 0 65 59 1 0 14 8 1 0 40 34 1 0 49 42 1 0 32 13 1 0 66 39 1 0 1 69 1 0 3 70 1 0 4 71 1 0 6 72 1 1 9 73 1 0 11 74 1 0 12 75 1 0 15 76 1 0 17 77 1 0 19 78 1 0 20 79 1 0 22 80 1 0 24 81 1 6 26 82 1 0 27 83 1 0 29 84 1 0 30 85 1 0 31 86 1 0 32 87 1 0 33 88 1 0 35 89 1 0 37 90 1 0 38 91 1 0 41 92 1 0 43 93 1 0 45 94 1 0 46 95 1 0 48 96 1 0 50 97 1 6 52 98 1 0 53 99 1 0 55100 1 0 56101 1 0 57102 1 0 58103 1 6 60104 1 0 61105 1 0 63106 1 0 64107 1 0 65108 1 0 67109 1 0 68110 1 0 M END 3D SDF for HMDB0304690 (Hopeaphenol)Mrv1652304022019462D 68 79 0 0 0 0 999 V2000 -2.7108 -1.3266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4252 -0.0891 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7961 1.0445 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6871 -0.0727 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5700 4.0514 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.1839 4.3983 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4266 -4.4927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7830 -4.0431 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.4252 -1.7391 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1397 -0.5016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4412 1.5589 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3320 0.4416 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.7703 4.8517 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3842 5.1987 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6861 -5.2758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0425 -4.8262 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.0745 2.4163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.1638 -2.3747 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.9888 0.8077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0111 -0.9997 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0464 1.3688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0547 -1.2577 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4099 2.1732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3291 -2.3927 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7108 -0.5016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9190 0.2287 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7768 3.8247 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9750 -3.8763 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.1397 -1.3266 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.2092 1.2575 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1774 5.4254 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4941 -5.4426 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8628 2.1732 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9318 -2.0735 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5935 1.3688 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5723 -1.6045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4697 1.8552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5188 -1.8605 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.2005 1.0509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7932 -1.1833 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4416 0.8077 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4097 -0.7433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6217 2.4163 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4752 -2.5764 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1389 0.4059 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 2.0806 -0.4400 0.0000 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.6533 1.0509 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.6418 -1.0448 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0168 1.8552 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0364 -1.9716 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.3139 0.4059 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2579 -0.5016 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7264 2.2131 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8043 -2.2730 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5765 3.0244 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 1.7155 -3.0932 0.0000 C 0 0 2 0 0 0 0 0 0 0 0 0 -4.8541 -1.7391 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8541 1.7718 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3777 6.2257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7535 -6.2257 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.4676 2.7343 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.5768 -2.5879 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2.3819 1.1256 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -1.3766 -1.4209 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.6252 0.0034 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.5327 0.0724 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.2393 3.1474 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.9111 -3.2768 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9 1 1 0 0 0 0 10 2 2 0 0 0 0 11 3 1 0 0 0 0 12 4 2 0 0 0 0 13 5 1 0 0 0 0 14 6 2 0 0 0 0 15 7 1 0 0 0 0 16 8 2 0 0 0 0 25 1 2 0 0 0 0 25 2 1 0 0 0 0 26 3 2 0 0 0 0 26 4 1 0 0 0 0 27 5 2 0 0 0 0 27 6 1 0 0 0 0 28 7 2 0 0 0 0 28 8 1 0 0 0 0 29 9 2 0 0 0 0 29 10 1 0 0 0 0 30 11 2 0 0 0 0 30 12 1 0 0 0 0 31 13 2 0 0 0 0 31 14 1 0 0 0 0 32 15 2 0 0 0 0 32 16 1 0 0 0 0 33 17 2 0 0 0 0 33 21 1 0 0 0 0 34 18 2 0 0 0 0 34 22 1 0 0 0 0 35 19 2 0 0 0 0 35 23 1 0 0 0 0 36 20 2 0 0 0 0 36 24 1 0 0 0 0 37 17 1 0 0 0 0 38 18 1 0 0 0 0 39 19 1 0 0 0 0 40 20 1 0 0 0 0 41 21 2 0 0 0 0 42 22 2 0 0 0 0 43 23 2 0 0 0 0 44 24 2 0 0 0 0 45 25 1 1 0 0 0 46 26 1 1 0 0 0 47 37 2 0 0 0 0 47 41 1 0 0 0 0 47 45 1 0 0 0 0 48 38 2 0 0 0 0 48 42 1 0 0 0 0 48 46 1 0 0 0 0 49 39 2 0 0 0 0 49 43 1 0 0 0 0 50 40 2 0 0 0 0 50 44 1 0 0 0 0 51 39 1 0 0 0 0 51 45 1 0 0 0 0 52 40 1 0 0 0 0 52 46 1 0 0 0 0 52 51 1 0 0 0 0 53 37 1 0 0 0 0 53 49 1 0 0 0 0 54 38 1 0 0 0 0 54 50 1 0 0 0 0 55 27 1 1 0 0 0 55 53 1 0 0 0 0 56 28 1 1 0 0 0 56 54 1 0 0 0 0 57 29 1 0 0 0 0 58 30 1 0 0 0 0 59 31 1 0 0 0 0 60 32 1 0 0 0 0 61 33 1 0 0 0 0 62 34 1 0 0 0 0 63 35 1 0 0 0 0 64 36 1 0 0 0 0 65 41 1 0 0 0 0 66 42 1 0 0 0 0 67 43 1 0 0 0 0 67 55 1 0 0 0 0 68 44 1 0 0 0 0 68 56 1 0 0 0 0 M END > <DATABASE_ID> HMDB0304690 > <DATABASE_NAME> hmdb > <SMILES> OC1=CC=C(C=C1)[C@H]1OC2=CC(O)=CC3=C2C1C1=C([C@@H](C3C2[C@@H](C3=CC=C(O)C=C3)C3=C(C=C(O)C=C3O)C3[C@H](OC4=CC(O)=CC2=C34)C2=CC=C(O)C=C2)C2=CC=C(O)C=C2)C(O)=CC(O)=C1 > <INCHI_IDENTIFIER> InChI=1S/C56H42O12/c57-29-9-1-25(2-10-29)45-47-37(17-33(61)21-41(47)65)53-49-39(19-35(63)23-43(49)67-55(53)27-5-13-31(59)14-6-27)51(45)52-40-20-36(64)24-44-50(40)54(56(68-44)28-7-15-32(60)16-8-28)38-18-34(62)22-42(66)48(38)46(52)26-3-11-30(58)12-4-26/h1-24,45-46,51-66H/t45-,46-,51?,52?,53?,54?,55+,56+/m0/s1 > <INCHI_KEY> YQQUILZPDYJDQJ-ZFGQVWOOSA-N > <FORMULA> C56H42O12 > <MOLECULAR_WEIGHT> 906.94 > <EXACT_MASS> 906.267626792 > <JCHEM_ACCEPTOR_COUNT> 12 > <JCHEM_ATOM_COUNT> 110 > <JCHEM_AVERAGE_POLARIZABILITY> 93.03166297244499 > <JCHEM_BIOAVAILABILITY> 0 > <JCHEM_DONOR_COUNT> 10 > <JCHEM_FORMAL_CHARGE> 0 > <JCHEM_GHOSE_FILTER> 0 > <JCHEM_IUPAC> (8S,16S)-8,16-bis(4-hydroxyphenyl)-9-[(8S,16S)-4,6,12-trihydroxy-8,16-bis(4-hydroxyphenyl)-15-oxatetracyclo[8.6.1.0^{2,7}.0^{14,17}]heptadeca-2(7),3,5,10(17),11,13-hexaen-9-yl]-15-oxatetracyclo[8.6.1.0^{2,7}.0^{14,17}]heptadeca-2(7),3,5,10(17),11,13-hexaene-4,6,12-triol > <ALOGPS_LOGP> 6.06 > <JCHEM_LOGP> 10.430361719333334 > <ALOGPS_LOGS> -5.86 > <JCHEM_MDDR_LIKE_RULE> 0 > <JCHEM_NUMBER_OF_RINGS> 12 > <JCHEM_PHYSIOLOGICAL_CHARGE> 0 > <JCHEM_PKA> 9.06939105531777 > <JCHEM_PKA_STRONGEST_ACIDIC> 8.690628616990859 > <JCHEM_PKA_STRONGEST_BASIC> -5.4537973259753665 > <JCHEM_POLAR_SURFACE_AREA> 220.75999999999996 > <JCHEM_REFRACTIVITY> 253.1100000000002 > <JCHEM_ROTATABLE_BOND_COUNT> 5 > <JCHEM_RULE_OF_FIVE> 0 > <ALOGPS_SOLUBILITY> 1.25e-03 g/l > <JCHEM_TRADITIONAL_IUPAC> (8S,16S)-8,16-bis(4-hydroxyphenyl)-9-[(8S,16S)-4,6,12-trihydroxy-8,16-bis(4-hydroxyphenyl)-15-oxatetracyclo[8.6.1.0^{2,7}.0^{14,17}]heptadeca-2(7),3,5,10(17),11,13-hexaen-9-yl]-15-oxatetracyclo[8.6.1.0^{2,7}.0^{14,17}]heptadeca-2(7),3,5,10(17),11,13-hexaene-4,6,12-triol > <JCHEM_VEBER_RULE> 0 $$$$ 3D-SDF for HMDB0304690 (Hopeaphenol)HMDB0304690 RDKit 3D Hopeaphenol 110121 0 0 0 0 0 0 0 0999 V2000 8.7010 1.3356 -1.1796 O 0 0 0 0 0 0 0 0 0 0 0 0 7.5438 1.3344 -0.4041 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6372 0.3299 -0.5428 C 0 0 0 0 0 0 0 0 0 0 0 0 5.4701 0.3259 0.2362 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1779 1.2829 1.1441 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0305 1.4255 2.0230 C 0 0 1 0 0 0 0 0 0 0 0 0 3.6096 2.8224 1.8914 O 0 0 0 0 0 0 0 0 0 0 0 0 2.7015 2.8508 0.8223 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3160 3.8468 -0.0377 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3788 3.6155 -1.0247 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0290 4.6718 -1.8690 O 0 0 0 0 0 0 0 0 0 0 0 0 0.8424 2.3551 -1.1186 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2051 1.3168 -0.2667 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1309 1.5802 0.6893 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7560 0.7481 1.7142 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7945 -0.6913 1.4962 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5797 -1.2482 2.4921 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7893 -2.5976 2.5384 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5810 -3.1604 3.5437 O 0 0 0 0 0 0 0 0 0 0 0 0 3.1951 -3.3702 1.5652 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4158 -2.8041 0.5792 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8649 -3.6594 -0.3513 O 0 0 0 0 0 0 0 0 0 0 0 0 2.1855 -1.4248 0.5119 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3147 -1.1250 -0.6012 C 0 0 2 0 0 0 0 0 0 0 0 0 2.0014 -1.1678 -1.9513 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9821 -0.2743 -2.2911 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5992 -0.3010 -3.5233 C 0 0 0 0 0 0 0 0 0 0 0 0 3.2370 -1.2518 -4.4730 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8304 -1.3093 -5.7129 O 0 0 0 0 0 0 0 0 0 0 0 0 2.2619 -2.1433 -4.1431 C 0 0 0 0 0 0 0 0 0 0 0 0 1.6668 -2.0952 -2.9159 C 0 0 0 0 0 0 0 0 0 0 0 0 0.4576 0.0618 -0.5561 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7951 -0.0581 0.3808 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5209 1.2552 0.2109 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9950 2.1903 1.1231 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3521 3.5114 1.1151 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7582 4.3450 2.0771 O 0 0 0 0 0 0 0 0 0 0 0 0 -2.2620 3.9932 0.1910 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7819 3.0870 -0.6999 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.4213 1.7425 -0.6816 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.3209 1.0124 -1.6539 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.7924 -0.2273 -0.9842 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1479 -0.3560 -1.1768 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.8665 -1.3378 -0.5116 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2382 -1.4874 -0.6878 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2008 -2.1792 0.3405 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.8139 -2.0260 0.5109 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2558 -2.9036 1.3833 O 0 0 0 0 0 0 0 0 0 0 0 0 -3.0776 -1.0644 -0.1416 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.6340 -1.2464 0.0439 C 0 0 2 0 0 0 0 0 0 0 0 0 -1.2364 -2.5134 0.6851 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3445 -3.7376 -0.0120 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.9524 -4.9321 0.5265 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4267 -4.9704 1.8021 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.0152 -6.1399 2.3984 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.3181 -3.7726 2.4926 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7146 -2.5734 1.9445 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.4422 2.0035 -1.8291 C 0 0 1 0 0 0 0 0 0 0 0 0 -5.4127 2.1484 -0.7256 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.1320 1.8248 0.5643 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0825 2.0164 1.5611 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.3125 2.5327 1.2617 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.2989 2.7448 2.2204 O 0 0 0 0 0 0 0 0 0 0 0 0 -7.6227 2.8702 -0.0456 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6803 2.6753 -1.0086 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.6947 3.2403 -1.7536 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1412 2.3101 1.2609 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2882 2.3402 0.5143 C 0 0 0 0 0 0 0 0 0 0 0 0 9.3999 2.0660 -1.1043 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7907 -0.4868 -1.2548 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8054 -0.4783 0.0742 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3517 1.3723 3.0896 H 0 0 0 0 0 0 0 0 0 0 0 0 2.7873 4.8220 0.0997 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3464 4.4641 -2.5696 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1263 2.1920 -1.8896 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1061 0.9183 2.6607 H 0 0 0 0 0 0 0 0 0 0 0 0 4.0462 -0.6123 3.2620 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7228 -4.1529 3.5624 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3805 -4.4394 1.6272 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0390 -4.6464 -0.2872 H 0 0 0 0 0 0 0 0 0 0 0 0 0.6169 -2.0126 -0.6785 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3090 0.4866 -1.6157 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3742 0.3901 -3.8193 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5496 -2.0076 -6.3862 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9198 -2.9274 -4.8442 H 0 0 0 0 0 0 0 0 0 0 0 0 0.8884 -2.8083 -2.6885 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0050 0.2000 -1.5585 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3507 -0.0605 1.3934 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3099 1.8366 1.8755 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2085 4.4599 2.9636 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5421 5.0358 0.1799 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8459 0.7722 -2.5859 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.6941 0.2326 -1.8711 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6657 -2.0635 -1.3724 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.7571 -2.9429 0.8650 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7290 -3.6267 1.8949 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2917 -1.4554 -1.0768 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7542 -3.7221 -1.0067 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0410 -5.8728 -0.0219 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0742 -7.0316 1.9362 H 0 0 0 0 0 0 0 0 0 0 0 0 0.0971 -3.8201 3.4925 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.6073 -1.6868 2.5306 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9713 1.8986 -2.7782 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.2045 1.4080 0.9115 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8737 1.7636 2.5919 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0599 2.4937 3.1749 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.6216 3.2867 -0.2771 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8869 2.9254 -2.0272 H 0 0 0 0 0 0 0 0 0 0 0 0 5.9940 3.1167 1.9579 H 0 0 0 0 0 0 0 0 0 0 0 0 8.0375 3.1158 0.5888 H 0 0 0 0 0 0 0 0 0 0 0 0 1 2 1 0 2 3 2 0 3 4 1 0 4 5 2 0 5 6 1 0 6 7 1 0 7 8 1 0 8 9 2 0 9 10 1 0 10 11 1 0 10 12 2 0 12 13 1 0 13 14 2 0 14 15 1 0 15 16 1 0 16 17 2 0 17 18 1 0 18 19 1 0 18 20 2 0 20 21 1 0 21 22 1 0 21 23 2 0 23 24 1 0 24 25 1 0 25 26 2 0 26 27 1 0 27 28 2 0 28 29 1 0 28 30 1 0 30 31 2 0 24 32 1 0 32 33 1 0 33 34 1 0 34 35 2 0 35 36 1 0 36 37 1 0 36 38 2 0 38 39 1 0 39 40 2 0 40 41 1 0 41 42 1 0 42 43 2 0 43 44 1 0 44 45 1 0 44 46 2 0 46 47 1 0 47 48 1 0 47 49 2 0 49 50 1 0 50 51 1 0 51 52 2 0 52 53 1 0 53 54 2 0 54 55 1 0 54 56 1 0 56 57 2 0 41 58 1 0 58 59 1 0 59 60 2 0 60 61 1 0 61 62 2 0 62 63 1 0 62 64 1 0 64 65 2 0 58 66 1 0 5 67 1 0 67 68 2 0 68 2 1 0 15 6 1 0 23 16 1 0 31 25 1 0 50 33 1 0 57 51 1 0 65 59 1 0 14 8 1 0 40 34 1 0 49 42 1 0 32 13 1 0 66 39 1 0 1 69 1 0 3 70 1 0 4 71 1 0 6 72 1 1 9 73 1 0 11 74 1 0 12 75 1 0 15 76 1 0 17 77 1 0 19 78 1 0 20 79 1 0 22 80 1 0 24 81 1 6 26 82 1 0 27 83 1 0 29 84 1 0 30 85 1 0 31 86 1 0 32 87 1 0 33 88 1 0 35 89 1 0 37 90 1 0 38 91 1 0 41 92 1 0 43 93 1 0 45 94 1 0 46 95 1 0 48 96 1 0 50 97 1 6 52 98 1 0 53 99 1 0 55100 1 0 56101 1 0 57102 1 0 58103 1 6 60104 1 0 61105 1 0 63106 1 0 64107 1 0 65108 1 0 67109 1 0 68110 1 0 M END PDB for HMDB0304690 (Hopeaphenol)HEADER PROTEIN 02-APR-20 NONE TITLE NULL COMPND NULL SOURCE NULL KEYWDS NULL EXPDTA NULL AUTHOR Marvin REVDAT 1 02-APR-20 0 HETATM 1 C UNK 0 -5.060 -2.476 0.000 0.00 0.00 C+0 HETATM 2 C UNK 0 -6.394 -0.166 0.000 0.00 0.00 C+0 HETATM 3 C UNK 0 5.219 1.950 0.000 0.00 0.00 C+0 HETATM 4 C UNK 0 6.883 -0.136 0.000 0.00 0.00 C+0 HETATM 5 C UNK 0 -2.931 7.563 0.000 0.00 0.00 C+0 HETATM 6 C UNK 0 -0.343 8.210 0.000 0.00 0.00 C+0 HETATM 7 C UNK 0 2.663 -8.386 0.000 0.00 0.00 C+0 HETATM 8 C UNK 0 5.195 -7.547 0.000 0.00 0.00 C+0 HETATM 9 C UNK 0 -6.394 -3.246 0.000 0.00 0.00 C+0 HETATM 10 C UNK 0 -7.727 -0.936 0.000 0.00 0.00 C+0 HETATM 11 C UNK 0 6.424 2.910 0.000 0.00 0.00 C+0 HETATM 12 C UNK 0 8.086 0.824 0.000 0.00 0.00 C+0 HETATM 13 C UNK 0 -3.305 9.057 0.000 0.00 0.00 C+0 HETATM 14 C UNK 0 -0.717 9.704 0.000 0.00 0.00 C+0 HETATM 15 C UNK 0 3.147 -9.848 0.000 0.00 0.00 C+0 HETATM 16 C UNK 0 5.679 -9.009 0.000 0.00 0.00 C+0 HETATM 17 C UNK 0 -3.872 4.510 0.000 0.00 0.00 C+0 HETATM 18 C UNK 0 5.906 -4.433 0.000 0.00 0.00 C+0 HETATM 19 C UNK 0 1.846 1.508 0.000 0.00 0.00 C+0 HETATM 20 C UNK 0 -0.021 -1.866 0.000 0.00 0.00 C+0 HETATM 21 C UNK 0 -5.687 2.555 0.000 0.00 0.00 C+0 HETATM 22 C UNK 0 7.569 -2.348 0.000 0.00 0.00 C+0 HETATM 23 C UNK 0 2.632 4.057 0.000 0.00 0.00 C+0 HETATM 24 C UNK 0 -0.614 -4.466 0.000 0.00 0.00 C+0 HETATM 25 C UNK 0 -5.060 -0.936 0.000 0.00 0.00 C+0 HETATM 26 C UNK 0 5.449 0.427 0.000 0.00 0.00 C+0 HETATM 27 C UNK 0 -1.450 7.139 0.000 0.00 0.00 C+0 HETATM 28 C UNK 0 3.687 -7.236 0.000 0.00 0.00 C+0 HETATM 29 C UNK 0 -7.727 -2.476 0.000 0.00 0.00 C+0 HETATM 30 C UNK 0 7.857 2.347 0.000 0.00 0.00 C+0 HETATM 31 C UNK 0 -2.198 10.127 0.000 0.00 0.00 C+0 HETATM 32 C UNK 0 4.656 -10.160 0.000 0.00 0.00 C+0 HETATM 33 C UNK 0 -5.344 4.057 0.000 0.00 0.00 C+0 HETATM 34 C UNK 0 7.339 -3.871 0.000 0.00 0.00 C+0 HETATM 35 C UNK 0 2.975 2.555 0.000 0.00 0.00 C+0 HETATM 36 C UNK 0 -1.068 -2.995 0.000 0.00 0.00 C+0 HETATM 37 C UNK 0 -2.743 3.463 0.000 0.00 0.00 C+0 HETATM 38 C UNK 0 4.702 -3.473 0.000 0.00 0.00 C+0 HETATM 39 C UNK 0 0.374 1.962 0.000 0.00 0.00 C+0 HETATM 40 C UNK 0 1.481 -2.209 0.000 0.00 0.00 C+0 HETATM 41 C UNK 0 -4.558 1.508 0.000 0.00 0.00 C+0 HETATM 42 C UNK 0 6.365 -1.387 0.000 0.00 0.00 C+0 HETATM 43 C UNK 0 1.161 4.510 0.000 0.00 0.00 C+0 HETATM 44 C UNK 0 0.887 -4.809 0.000 0.00 0.00 C+0 HETATM 45 C UNK 0 -2.126 0.758 0.000 0.00 0.00 C+0 HETATM 46 C UNK 0 3.884 -0.821 0.000 0.00 0.00 C+0 HETATM 47 C UNK 0 -3.086 1.962 0.000 0.00 0.00 C+0 HETATM 48 C UNK 0 4.931 -1.950 0.000 0.00 0.00 C+0 HETATM 49 C UNK 0 0.031 3.463 0.000 0.00 0.00 C+0 HETATM 50 C UNK 0 1.935 -3.680 0.000 0.00 0.00 C+0 HETATM 51 C UNK 0 -0.586 0.758 0.000 0.00 0.00 C+0 HETATM 52 C UNK 0 2.348 -0.936 0.000 0.00 0.00 C+0 HETATM 53 C UNK 0 -1.356 4.131 0.000 0.00 0.00 C+0 HETATM 54 C UNK 0 3.368 -4.243 0.000 0.00 0.00 C+0 HETATM 55 C UNK 0 -1.076 5.646 0.000 0.00 0.00 C+0 HETATM 56 C UNK 0 3.202 -5.774 0.000 0.00 0.00 C+0 HETATM 57 O UNK 0 -9.061 -3.246 0.000 0.00 0.00 O+0 HETATM 58 O UNK 0 9.061 3.307 0.000 0.00 0.00 O+0 HETATM 59 O UNK 0 -2.572 11.621 0.000 0.00 0.00 O+0 HETATM 60 O UNK 0 5.140 -11.621 0.000 0.00 0.00 O+0 HETATM 61 O UNK 0 -6.473 5.104 0.000 0.00 0.00 O+0 HETATM 62 O UNK 0 8.543 -4.831 0.000 0.00 0.00 O+0 HETATM 63 O UNK 0 4.446 2.101 0.000 0.00 0.00 O+0 HETATM 64 O UNK 0 -2.570 -2.652 0.000 0.00 0.00 O+0 HETATM 65 O UNK 0 -4.900 0.006 0.000 0.00 0.00 O+0 HETATM 66 O UNK 0 6.594 0.135 0.000 0.00 0.00 O+0 HETATM 67 O UNK 0 0.447 5.875 0.000 0.00 0.00 O+0 HETATM 68 O UNK 0 1.701 -6.117 0.000 0.00 0.00 O+0 CONECT 1 9 25 CONECT 2 10 25 CONECT 3 11 26 CONECT 4 12 26 CONECT 5 13 27 CONECT 6 14 27 CONECT 7 15 28 CONECT 8 16 28 CONECT 9 1 29 CONECT 10 2 29 CONECT 11 3 30 CONECT 12 4 30 CONECT 13 5 31 CONECT 14 6 31 CONECT 15 7 32 CONECT 16 8 32 CONECT 17 33 37 CONECT 18 34 38 CONECT 19 35 39 CONECT 20 36 40 CONECT 21 33 41 CONECT 22 34 42 CONECT 23 35 43 CONECT 24 36 44 CONECT 25 1 2 45 CONECT 26 3 4 46 CONECT 27 5 6 55 CONECT 28 7 8 56 CONECT 29 9 10 57 CONECT 30 11 12 58 CONECT 31 13 14 59 CONECT 32 15 16 60 CONECT 33 17 21 61 CONECT 34 18 22 62 CONECT 35 19 23 63 CONECT 36 20 24 64 CONECT 37 17 47 53 CONECT 38 18 48 54 CONECT 39 19 49 51 CONECT 40 20 50 52 CONECT 41 21 47 65 CONECT 42 22 48 66 CONECT 43 23 49 67 CONECT 44 24 50 68 CONECT 45 25 47 51 CONECT 46 26 48 52 CONECT 47 37 41 45 CONECT 48 38 42 46 CONECT 49 39 43 53 CONECT 50 40 44 54 CONECT 51 39 45 52 CONECT 52 40 46 51 CONECT 53 37 49 55 CONECT 54 38 50 56 CONECT 55 27 53 67 CONECT 56 28 54 68 CONECT 57 29 CONECT 58 30 CONECT 59 31 CONECT 60 32 CONECT 61 33 CONECT 62 34 CONECT 63 35 CONECT 64 36 CONECT 65 41 CONECT 66 42 CONECT 67 43 55 CONECT 68 44 56 MASTER 0 0 0 0 0 0 0 0 68 0 158 0 END 3D PDB for HMDB0304690 (Hopeaphenol)COMPND HMDB0304690 HETATM 1 O1 UNL 1 8.701 1.336 -1.180 1.00 0.00 O HETATM 2 C1 UNL 1 7.544 1.334 -0.404 1.00 0.00 C HETATM 3 C2 UNL 1 6.637 0.330 -0.543 1.00 0.00 C HETATM 4 C3 UNL 1 5.470 0.326 0.236 1.00 0.00 C HETATM 5 C4 UNL 1 5.178 1.283 1.144 1.00 0.00 C HETATM 6 C5 UNL 1 4.030 1.426 2.023 1.00 0.00 C HETATM 7 O2 UNL 1 3.610 2.822 1.891 1.00 0.00 O HETATM 8 C6 UNL 1 2.702 2.851 0.822 1.00 0.00 C HETATM 9 C7 UNL 1 2.316 3.847 -0.038 1.00 0.00 C HETATM 10 C8 UNL 1 1.379 3.615 -1.025 1.00 0.00 C HETATM 11 O3 UNL 1 1.029 4.672 -1.869 1.00 0.00 O HETATM 12 C9 UNL 1 0.842 2.355 -1.119 1.00 0.00 C HETATM 13 C10 UNL 1 1.205 1.317 -0.267 1.00 0.00 C HETATM 14 C11 UNL 1 2.131 1.580 0.689 1.00 0.00 C HETATM 15 C12 UNL 1 2.756 0.748 1.714 1.00 0.00 C HETATM 16 C13 UNL 1 2.794 -0.691 1.496 1.00 0.00 C HETATM 17 C14 UNL 1 3.580 -1.248 2.492 1.00 0.00 C HETATM 18 C15 UNL 1 3.789 -2.598 2.538 1.00 0.00 C HETATM 19 O4 UNL 1 4.581 -3.160 3.544 1.00 0.00 O HETATM 20 C16 UNL 1 3.195 -3.370 1.565 1.00 0.00 C HETATM 21 C17 UNL 1 2.416 -2.804 0.579 1.00 0.00 C HETATM 22 O5 UNL 1 1.865 -3.659 -0.351 1.00 0.00 O HETATM 23 C18 UNL 1 2.186 -1.425 0.512 1.00 0.00 C HETATM 24 C19 UNL 1 1.315 -1.125 -0.601 1.00 0.00 C HETATM 25 C20 UNL 1 2.001 -1.168 -1.951 1.00 0.00 C HETATM 26 C21 UNL 1 2.982 -0.274 -2.291 1.00 0.00 C HETATM 27 C22 UNL 1 3.599 -0.301 -3.523 1.00 0.00 C HETATM 28 C23 UNL 1 3.237 -1.252 -4.473 1.00 0.00 C HETATM 29 O6 UNL 1 3.830 -1.309 -5.713 1.00 0.00 O HETATM 30 C24 UNL 1 2.262 -2.143 -4.143 1.00 0.00 C HETATM 31 C25 UNL 1 1.667 -2.095 -2.916 1.00 0.00 C HETATM 32 C26 UNL 1 0.458 0.062 -0.556 1.00 0.00 C HETATM 33 C27 UNL 1 -0.795 -0.058 0.381 1.00 0.00 C HETATM 34 C28 UNL 1 -1.521 1.255 0.211 1.00 0.00 C HETATM 35 C29 UNL 1 -0.995 2.190 1.123 1.00 0.00 C HETATM 36 C30 UNL 1 -1.352 3.511 1.115 1.00 0.00 C HETATM 37 O7 UNL 1 -0.758 4.345 2.077 1.00 0.00 O HETATM 38 C31 UNL 1 -2.262 3.993 0.191 1.00 0.00 C HETATM 39 C32 UNL 1 -2.782 3.087 -0.700 1.00 0.00 C HETATM 40 C33 UNL 1 -2.421 1.743 -0.682 1.00 0.00 C HETATM 41 C34 UNL 1 -3.321 1.012 -1.654 1.00 0.00 C HETATM 42 C35 UNL 1 -3.792 -0.227 -0.984 1.00 0.00 C HETATM 43 C36 UNL 1 -5.148 -0.356 -1.177 1.00 0.00 C HETATM 44 C37 UNL 1 -5.866 -1.338 -0.512 1.00 0.00 C HETATM 45 O8 UNL 1 -7.238 -1.487 -0.688 1.00 0.00 O HETATM 46 C38 UNL 1 -5.201 -2.179 0.341 1.00 0.00 C HETATM 47 C39 UNL 1 -3.814 -2.026 0.511 1.00 0.00 C HETATM 48 O9 UNL 1 -3.256 -2.904 1.383 1.00 0.00 O HETATM 49 C40 UNL 1 -3.078 -1.064 -0.142 1.00 0.00 C HETATM 50 C41 UNL 1 -1.634 -1.246 0.044 1.00 0.00 C HETATM 51 C42 UNL 1 -1.236 -2.513 0.685 1.00 0.00 C HETATM 52 C43 UNL 1 -1.344 -3.738 -0.012 1.00 0.00 C HETATM 53 C44 UNL 1 -0.952 -4.932 0.527 1.00 0.00 C HETATM 54 C45 UNL 1 -0.427 -4.970 1.802 1.00 0.00 C HETATM 55 O10 UNL 1 -0.015 -6.140 2.398 1.00 0.00 O HETATM 56 C46 UNL 1 -0.318 -3.773 2.493 1.00 0.00 C HETATM 57 C47 UNL 1 -0.715 -2.573 1.944 1.00 0.00 C HETATM 58 C48 UNL 1 -4.442 2.003 -1.829 1.00 0.00 C HETATM 59 C49 UNL 1 -5.413 2.148 -0.726 1.00 0.00 C HETATM 60 C50 UNL 1 -5.132 1.825 0.564 1.00 0.00 C HETATM 61 C51 UNL 1 -6.082 2.016 1.561 1.00 0.00 C HETATM 62 C52 UNL 1 -7.312 2.533 1.262 1.00 0.00 C HETATM 63 O11 UNL 1 -8.299 2.745 2.220 1.00 0.00 O HETATM 64 C53 UNL 1 -7.623 2.870 -0.046 1.00 0.00 C HETATM 65 C54 UNL 1 -6.680 2.675 -1.009 1.00 0.00 C HETATM 66 O12 UNL 1 -3.695 3.240 -1.754 1.00 0.00 O HETATM 67 C55 UNL 1 6.141 2.310 1.261 1.00 0.00 C HETATM 68 C56 UNL 1 7.288 2.340 0.514 1.00 0.00 C HETATM 69 H1 UNL 1 9.400 2.066 -1.104 1.00 0.00 H HETATM 70 H2 UNL 1 6.791 -0.487 -1.255 1.00 0.00 H HETATM 71 H3 UNL 1 4.805 -0.478 0.074 1.00 0.00 H HETATM 72 H4 UNL 1 4.352 1.372 3.090 1.00 0.00 H HETATM 73 H5 UNL 1 2.787 4.822 0.100 1.00 0.00 H HETATM 74 H6 UNL 1 0.346 4.464 -2.570 1.00 0.00 H HETATM 75 H7 UNL 1 0.126 2.192 -1.890 1.00 0.00 H HETATM 76 H8 UNL 1 2.106 0.918 2.661 1.00 0.00 H HETATM 77 H9 UNL 1 4.046 -0.612 3.262 1.00 0.00 H HETATM 78 H10 UNL 1 4.723 -4.153 3.562 1.00 0.00 H HETATM 79 H11 UNL 1 3.381 -4.439 1.627 1.00 0.00 H HETATM 80 H12 UNL 1 2.039 -4.646 -0.287 1.00 0.00 H HETATM 81 H13 UNL 1 0.617 -2.013 -0.679 1.00 0.00 H HETATM 82 H14 UNL 1 3.309 0.487 -1.616 1.00 0.00 H HETATM 83 H15 UNL 1 4.374 0.390 -3.819 1.00 0.00 H HETATM 84 H16 UNL 1 3.550 -2.008 -6.386 1.00 0.00 H HETATM 85 H17 UNL 1 1.920 -2.927 -4.844 1.00 0.00 H HETATM 86 H18 UNL 1 0.888 -2.808 -2.689 1.00 0.00 H HETATM 87 H19 UNL 1 0.005 0.200 -1.559 1.00 0.00 H HETATM 88 H20 UNL 1 -0.351 -0.061 1.393 1.00 0.00 H HETATM 89 H21 UNL 1 -0.310 1.837 1.875 1.00 0.00 H HETATM 90 H22 UNL 1 -1.209 4.460 2.964 1.00 0.00 H HETATM 91 H23 UNL 1 -2.542 5.036 0.180 1.00 0.00 H HETATM 92 H24 UNL 1 -2.846 0.772 -2.586 1.00 0.00 H HETATM 93 H25 UNL 1 -5.694 0.233 -1.871 1.00 0.00 H HETATM 94 H26 UNL 1 -7.666 -2.063 -1.372 1.00 0.00 H HETATM 95 H27 UNL 1 -5.757 -2.943 0.865 1.00 0.00 H HETATM 96 H28 UNL 1 -3.729 -3.627 1.895 1.00 0.00 H HETATM 97 H29 UNL 1 -1.292 -1.455 -1.077 1.00 0.00 H HETATM 98 H30 UNL 1 -1.754 -3.722 -1.007 1.00 0.00 H HETATM 99 H31 UNL 1 -1.041 -5.873 -0.022 1.00 0.00 H HETATM 100 H32 UNL 1 -0.074 -7.032 1.936 1.00 0.00 H HETATM 101 H33 UNL 1 0.097 -3.820 3.492 1.00 0.00 H HETATM 102 H34 UNL 1 -0.607 -1.687 2.531 1.00 0.00 H HETATM 103 H35 UNL 1 -4.971 1.899 -2.778 1.00 0.00 H HETATM 104 H36 UNL 1 -4.205 1.408 0.912 1.00 0.00 H HETATM 105 H37 UNL 1 -5.874 1.764 2.592 1.00 0.00 H HETATM 106 H38 UNL 1 -8.060 2.494 3.175 1.00 0.00 H HETATM 107 H39 UNL 1 -8.622 3.287 -0.277 1.00 0.00 H HETATM 108 H40 UNL 1 -6.887 2.925 -2.027 1.00 0.00 H HETATM 109 H41 UNL 1 5.994 3.117 1.958 1.00 0.00 H HETATM 110 H42 UNL 1 8.038 3.116 0.589 1.00 0.00 H CONECT 1 2 69 CONECT 2 3 3 68 CONECT 3 4 70 CONECT 4 5 5 71 CONECT 5 6 67 CONECT 6 7 15 72 CONECT 7 8 CONECT 8 9 9 14 CONECT 9 10 73 CONECT 10 11 12 12 CONECT 11 74 CONECT 12 13 75 CONECT 13 14 14 32 CONECT 14 15 CONECT 15 16 76 CONECT 16 17 17 23 CONECT 17 18 77 CONECT 18 19 20 20 CONECT 19 78 CONECT 20 21 79 CONECT 21 22 23 23 CONECT 22 80 CONECT 23 24 CONECT 24 25 32 81 CONECT 25 26 26 31 CONECT 26 27 82 CONECT 27 28 28 83 CONECT 28 29 30 CONECT 29 84 CONECT 30 31 31 85 CONECT 31 86 CONECT 32 33 87 CONECT 33 34 50 88 CONECT 34 35 35 40 CONECT 35 36 89 CONECT 36 37 38 38 CONECT 37 90 CONECT 38 39 91 CONECT 39 40 40 66 CONECT 40 41 CONECT 41 42 58 92 CONECT 42 43 43 49 CONECT 43 44 93 CONECT 44 45 46 46 CONECT 45 94 CONECT 46 47 95 CONECT 47 48 49 49 CONECT 48 96 CONECT 49 50 CONECT 50 51 97 CONECT 51 52 52 57 CONECT 52 53 98 CONECT 53 54 54 99 CONECT 54 55 56 CONECT 55 100 CONECT 56 57 57 101 CONECT 57 102 CONECT 58 59 66 103 CONECT 59 60 60 65 CONECT 60 61 104 CONECT 61 62 62 105 CONECT 62 63 64 CONECT 63 106 CONECT 64 65 65 107 CONECT 65 108 CONECT 67 68 68 109 CONECT 68 110 END SMILES for HMDB0304690 (Hopeaphenol)OC1=CC=C(C=C1)[C@H]1OC2=CC(O)=CC3=C2C1C1=C([C@@H](C3C2[C@@H](C3=CC=C(O)C=C3)C3=C(C=C(O)C=C3O)C3[C@H](OC4=CC(O)=CC2=C34)C2=CC=C(O)C=C2)C2=CC=C(O)C=C2)C(O)=CC(O)=C1 INCHI for HMDB0304690 (Hopeaphenol)InChI=1S/C56H42O12/c57-29-9-1-25(2-10-29)45-47-37(17-33(61)21-41(47)65)53-49-39(19-35(63)23-43(49)67-55(53)27-5-13-31(59)14-6-27)51(45)52-40-20-36(64)24-44-50(40)54(56(68-44)28-7-15-32(60)16-8-28)38-18-34(62)22-42(66)48(38)46(52)26-3-11-30(58)12-4-26/h1-24,45-46,51-66H/t45-,46-,51?,52?,53?,54?,55+,56+/m0/s1 3D Structure for HMDB0304690 (Hopeaphenol) | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synonyms | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Formula | C56H42O12 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Average Molecular Weight | 906.94 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Monoisotopic Molecular Weight | 906.267626792 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
IUPAC Name | (8S,16S)-8,16-bis(4-hydroxyphenyl)-9-[(8S,16S)-4,6,12-trihydroxy-8,16-bis(4-hydroxyphenyl)-15-oxatetracyclo[8.6.1.0^{2,7}.0^{14,17}]heptadeca-2(7),3,5,10(17),11,13-hexaen-9-yl]-15-oxatetracyclo[8.6.1.0^{2,7}.0^{14,17}]heptadeca-2(7),3,5,10(17),11,13-hexaene-4,6,12-triol | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Traditional Name | (8S,16S)-8,16-bis(4-hydroxyphenyl)-9-[(8S,16S)-4,6,12-trihydroxy-8,16-bis(4-hydroxyphenyl)-15-oxatetracyclo[8.6.1.0^{2,7}.0^{14,17}]heptadeca-2(7),3,5,10(17),11,13-hexaen-9-yl]-15-oxatetracyclo[8.6.1.0^{2,7}.0^{14,17}]heptadeca-2(7),3,5,10(17),11,13-hexaene-4,6,12-triol | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
CAS Registry Number | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
SMILES | OC1=CC=C(C=C1)[C@H]1OC2=CC(O)=CC3=C2C1C1=C([C@@H](C3C2[C@@H](C3=CC=C(O)C=C3)C3=C(C=C(O)C=C3O)C3[C@H](OC4=CC(O)=CC2=C34)C2=CC=C(O)C=C2)C2=CC=C(O)C=C2)C(O)=CC(O)=C1 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Identifier | InChI=1S/C56H42O12/c57-29-9-1-25(2-10-29)45-47-37(17-33(61)21-41(47)65)53-49-39(19-35(63)23-43(49)67-55(53)27-5-13-31(59)14-6-27)51(45)52-40-20-36(64)24-44-50(40)54(56(68-44)28-7-15-32(60)16-8-28)38-18-34(62)22-42(66)48(38)46(52)26-3-11-30(58)12-4-26/h1-24,45-46,51-66H/t45-,46-,51?,52?,53?,54?,55+,56+/m0/s1 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
InChI Key | YQQUILZPDYJDQJ-ZFGQVWOOSA-N | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemical Taxonomy | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Description | Belongs to the class of organic compounds known as 2-arylbenzofuran flavonoids. These are phenylpropanoids containing the 2-phenylbenzofuran moiety. | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Kingdom | Organic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Super Class | Phenylpropanoids and polyketides | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Class | 2-arylbenzofuran flavonoids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Sub Class | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Direct Parent | 2-arylbenzofuran flavonoids | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Alternative Parents | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Substituents |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Molecular Framework | Aromatic heteropolycyclic compounds | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Descriptors | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Ontology | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physiological effect | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disposition | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Process | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Role | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Physical Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
State | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Experimental Chromatographic Properties | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Molecular Properties |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Predicted Chromatographic Properties | Predicted Collision Cross Sections
Predicted Kovats Retention IndicesNot Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Spectra | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MS/MS Spectra
| |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biological Properties | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Cellular Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Biospecimen Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Tissue Locations | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Pathways |
| ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Normal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Abnormal Concentrations | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Not Available | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated Disorders and Diseases | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Disease References | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Associated OMIM IDs | None | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
External Links | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
DrugBank ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Phenol Explorer Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
FooDB ID | FDB097296 | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KNApSAcK ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Chemspider ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
KEGG Compound ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BioCyc ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
BiGG ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Wikipedia Link | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
METLIN ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PubChem Compound | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
PDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
ChEBI ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Food Biomarker Ontology | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
VMH ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
MarkerDB ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Good Scents ID | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
References | |||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Synthesis Reference | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
Material Safety Data Sheet (MSDS) | Not Available | ||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||||
General References | Not Available |