Record Information |
---|
Version | 5.0 |
---|
Status | Expected but not Quantified |
---|
Creation Date | 2012-09-11 17:35:25 UTC |
---|
Update Date | 2022-03-07 02:52:28 UTC |
---|
HMDB ID | HMDB0030200 |
---|
Secondary Accession Numbers | |
---|
Metabolite Identification |
---|
Common Name | Hovenine A |
---|
Description | Hovenine A belongs to the class of organic compounds known as oligopeptides. These are organic compounds containing a sequence of between three and ten alpha-amino acids joined by peptide bonds. Based on a literature review a significant number of articles have been published on Hovenine A. |
---|
Structure | CCC(C)C(NC)C(\O)=N\C1C(OC2=CC=C(C=C2)\C=C/N=C(O)\C(CC(C)C)\N=C1\O)C(C)C InChI=1S/C27H42N4O4/c1-8-18(6)22(28-7)26(33)31-23-24(17(4)5)35-20-11-9-19(10-12-20)13-14-29-25(32)21(15-16(2)3)30-27(23)34/h9-14,16-18,21-24,28H,8,15H2,1-7H3,(H,29,32)(H,30,34)(H,31,33)/b14-13- |
---|
Synonyms | Value | Source |
---|
N-Demethylfrangulanine | HMDB | N-[(10Z)-5,8-Dihydroxy-7-(2-methylpropyl)-3-(propan-2-yl)-2-oxa-6,9-diazabicyclo[10.2.2]hexadeca-1(14),5,8,10,12,15-hexaen-4-yl]-3-methyl-2-(methylamino)pentanimidate | HMDB |
|
---|
Chemical Formula | C27H42N4O4 |
---|
Average Molecular Weight | 486.6468 |
---|
Monoisotopic Molecular Weight | 486.320605852 |
---|
IUPAC Name | (Z)-N-[(5E,8E,10Z)-5,8-dihydroxy-7-(2-methylpropyl)-3-(propan-2-yl)-2-oxa-6,9-diazabicyclo[10.2.2]hexadeca-1(14),5,8,10,12,15-hexaen-4-yl]-3-methyl-2-(methylamino)pentimidic acid |
---|
Traditional Name | (Z)-N-[(5E,8E,10Z)-5,8-dihydroxy-3-isopropyl-7-(2-methylpropyl)-2-oxa-6,9-diazabicyclo[10.2.2]hexadeca-1(14),5,8,10,12,15-hexaen-4-yl]-3-methyl-2-(methylamino)pentimidic acid |
---|
CAS Registry Number | 52309-78-1 |
---|
SMILES | CCC(C)C(NC)C(\O)=N\C1C(OC2=CC=C(C=C2)\C=C/N=C(O)\C(CC(C)C)\N=C1\O)C(C)C |
---|
InChI Identifier | InChI=1S/C27H42N4O4/c1-8-18(6)22(28-7)26(33)31-23-24(17(4)5)35-20-11-9-19(10-12-20)13-14-29-25(32)21(15-16(2)3)30-27(23)34/h9-14,16-18,21-24,28H,8,15H2,1-7H3,(H,29,32)(H,30,34)(H,31,33)/b14-13- |
---|
InChI Key | ARFZEJYVBXGWDN-YPKPFQOOSA-N |
---|
Chemical Taxonomy |
---|
Description | Belongs to the class of organic compounds known as oligopeptides. These are organic compounds containing a sequence of between three and ten alpha-amino acids joined by peptide bonds. |
---|
Kingdom | Organic compounds |
---|
Super Class | Organic acids and derivatives |
---|
Class | Carboxylic acids and derivatives |
---|
Sub Class | Amino acids, peptides, and analogues |
---|
Direct Parent | Oligopeptides |
---|
Alternative Parents | |
---|
Substituents | - Alpha-oligopeptide
- Cyclic alpha peptide
- Isoleucine or derivatives
- Macrolactam
- N-acyl-alpha amino acid or derivatives
- Alpha-amino acid amide
- N-substituted-alpha-amino acid
- Alpha-amino acid or derivatives
- Alkyl aryl ether
- Fatty amide
- Fatty acyl
- N-acyl-amine
- Benzenoid
- Amino acid or derivatives
- Carboxamide group
- Lactam
- Secondary carboxylic acid amide
- Organoheterocyclic compound
- Azacycle
- Oxacycle
- Ether
- Secondary aliphatic amine
- Secondary amine
- Organopnictogen compound
- Hydrocarbon derivative
- Organic oxygen compound
- Carbonyl group
- Organic nitrogen compound
- Amine
- Organic oxide
- Organonitrogen compound
- Organooxygen compound
- Aromatic heteropolycyclic compound
|
---|
Molecular Framework | Aromatic heteropolycyclic compounds |
---|
External Descriptors | Not Available |
---|
Ontology |
---|
Physiological effect | Not Available |
---|
Disposition | |
---|
Process | Not Available |
---|
Role | Not Available |
---|
Physical Properties |
---|
State | Solid |
---|
Experimental Molecular Properties | |
---|
Experimental Chromatographic Properties | Not Available |
---|
Predicted Molecular Properties | |
---|
Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Kovats Retention IndicesUnderivatizedDerivatizedDerivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
---|
Hovenine A,1TMS,isomer #1 | CCC(C)C(NC)/C(=N/C1/C(O)=N\C(CC(C)C)/C(O)=N\C=C/C2=CC=C(C=C2)OC1C(C)C)O[Si](C)(C)C | 3378.4 | Semi standard non polar | 33892256 | Hovenine A,1TMS,isomer #2 | CCC(C)C(NC)/C(O)=N/C1/C(O)=N\C(CC(C)C)/C(O[Si](C)(C)C)=N\C=C/C2=CC=C(C=C2)OC1C(C)C | 3446.8 | Semi standard non polar | 33892256 | Hovenine A,1TMS,isomer #3 | CCC(C)C(NC)/C(O)=N/C1/C(O[Si](C)(C)C)=N\C(CC(C)C)/C(O)=N\C=C/C2=CC=C(C=C2)OC1C(C)C | 3414.0 | Semi standard non polar | 33892256 | Hovenine A,1TMS,isomer #4 | CCC(C)C(/C(O)=N/C1/C(O)=N\C(CC(C)C)/C(O)=N\C=C/C2=CC=C(C=C2)OC1C(C)C)N(C)[Si](C)(C)C | 3511.1 | Semi standard non polar | 33892256 | Hovenine A,2TMS,isomer #1 | CCC(C)C(NC)/C(=N/C1/C(O[Si](C)(C)C)=N\C(CC(C)C)/C(O)=N\C=C/C2=CC=C(C=C2)OC1C(C)C)O[Si](C)(C)C | 3282.3 | Semi standard non polar | 33892256 | Hovenine A,2TMS,isomer #2 | CCC(C)C(NC)/C(=N/C1/C(O)=N\C(CC(C)C)/C(O[Si](C)(C)C)=N\C=C/C2=CC=C(C=C2)OC1C(C)C)O[Si](C)(C)C | 3305.8 | Semi standard non polar | 33892256 | Hovenine A,2TMS,isomer #3 | CCC(C)C(/C(=N/C1/C(O)=N\C(CC(C)C)/C(O)=N\C=C/C2=CC=C(C=C2)OC1C(C)C)O[Si](C)(C)C)N(C)[Si](C)(C)C | 3410.5 | Semi standard non polar | 33892256 | Hovenine A,2TMS,isomer #4 | CCC(C)C(NC)/C(O)=N/C1/C(O[Si](C)(C)C)=N\C(CC(C)C)/C(O[Si](C)(C)C)=N\C=C/C2=CC=C(C=C2)OC1C(C)C | 3336.8 | Semi standard non polar | 33892256 | Hovenine A,2TMS,isomer #5 | CCC(C)C(/C(O)=N/C1/C(O)=N\C(CC(C)C)/C(O[Si](C)(C)C)=N\C=C/C2=CC=C(C=C2)OC1C(C)C)N(C)[Si](C)(C)C | 3446.3 | Semi standard non polar | 33892256 | Hovenine A,2TMS,isomer #6 | CCC(C)C(/C(O)=N/C1/C(O[Si](C)(C)C)=N\C(CC(C)C)/C(O)=N\C=C/C2=CC=C(C=C2)OC1C(C)C)N(C)[Si](C)(C)C | 3437.4 | Semi standard non polar | 33892256 | Hovenine A,3TMS,isomer #1 | CCC(C)C(NC)/C(=N/C1/C(O[Si](C)(C)C)=N\C(CC(C)C)/C(O[Si](C)(C)C)=N\C=C/C2=CC=C(C=C2)OC1C(C)C)O[Si](C)(C)C | 3267.8 | Semi standard non polar | 33892256 | Hovenine A,3TMS,isomer #2 | CCC(C)C(/C(=N/C1/C(O[Si](C)(C)C)=N\C(CC(C)C)/C(O)=N\C=C/C2=CC=C(C=C2)OC1C(C)C)O[Si](C)(C)C)N(C)[Si](C)(C)C | 3368.1 | Semi standard non polar | 33892256 | Hovenine A,3TMS,isomer #3 | CCC(C)C(/C(=N/C1/C(O)=N\C(CC(C)C)/C(O[Si](C)(C)C)=N\C=C/C2=CC=C(C=C2)OC1C(C)C)O[Si](C)(C)C)N(C)[Si](C)(C)C | 3361.4 | Semi standard non polar | 33892256 | Hovenine A,3TMS,isomer #4 | CCC(C)C(/C(O)=N/C1/C(O[Si](C)(C)C)=N\C(CC(C)C)/C(O[Si](C)(C)C)=N\C=C/C2=CC=C(C=C2)OC1C(C)C)N(C)[Si](C)(C)C | 3418.2 | Semi standard non polar | 33892256 | Hovenine A,4TMS,isomer #1 | CCC(C)C(/C(=N/C1/C(O[Si](C)(C)C)=N\C(CC(C)C)/C(O[Si](C)(C)C)=N\C=C/C2=CC=C(C=C2)OC1C(C)C)O[Si](C)(C)C)N(C)[Si](C)(C)C | 3385.8 | Semi standard non polar | 33892256 | Hovenine A,4TMS,isomer #1 | CCC(C)C(/C(=N/C1/C(O[Si](C)(C)C)=N\C(CC(C)C)/C(O[Si](C)(C)C)=N\C=C/C2=CC=C(C=C2)OC1C(C)C)O[Si](C)(C)C)N(C)[Si](C)(C)C | 3343.5 | Standard non polar | 33892256 | Hovenine A,1TBDMS,isomer #1 | CCC(C)C(NC)/C(=N/C1/C(O)=N\C(CC(C)C)/C(O)=N\C=C/C2=CC=C(C=C2)OC1C(C)C)O[Si](C)(C)C(C)(C)C | 3568.2 | Semi standard non polar | 33892256 | Hovenine A,1TBDMS,isomer #2 | CCC(C)C(NC)/C(O)=N/C1/C(O)=N\C(CC(C)C)/C(O[Si](C)(C)C(C)(C)C)=N\C=C/C2=CC=C(C=C2)OC1C(C)C | 3608.7 | Semi standard non polar | 33892256 | Hovenine A,1TBDMS,isomer #3 | CCC(C)C(NC)/C(O)=N/C1/C(O[Si](C)(C)C(C)(C)C)=N\C(CC(C)C)/C(O)=N\C=C/C2=CC=C(C=C2)OC1C(C)C | 3588.8 | Semi standard non polar | 33892256 | Hovenine A,1TBDMS,isomer #4 | CCC(C)C(/C(O)=N/C1/C(O)=N\C(CC(C)C)/C(O)=N\C=C/C2=CC=C(C=C2)OC1C(C)C)N(C)[Si](C)(C)C(C)(C)C | 3697.7 | Semi standard non polar | 33892256 | Hovenine A,2TBDMS,isomer #1 | CCC(C)C(NC)/C(=N/C1/C(O[Si](C)(C)C(C)(C)C)=N\C(CC(C)C)/C(O)=N\C=C/C2=CC=C(C=C2)OC1C(C)C)O[Si](C)(C)C(C)(C)C | 3645.8 | Semi standard non polar | 33892256 | Hovenine A,2TBDMS,isomer #2 | CCC(C)C(NC)/C(=N/C1/C(O)=N\C(CC(C)C)/C(O[Si](C)(C)C(C)(C)C)=N\C=C/C2=CC=C(C=C2)OC1C(C)C)O[Si](C)(C)C(C)(C)C | 3650.9 | Semi standard non polar | 33892256 | Hovenine A,2TBDMS,isomer #3 | CCC(C)C(/C(=N/C1/C(O)=N\C(CC(C)C)/C(O)=N\C=C/C2=CC=C(C=C2)OC1C(C)C)O[Si](C)(C)C(C)(C)C)N(C)[Si](C)(C)C(C)(C)C | 3805.0 | Semi standard non polar | 33892256 | Hovenine A,2TBDMS,isomer #4 | CCC(C)C(NC)/C(O)=N/C1/C(O[Si](C)(C)C(C)(C)C)=N\C(CC(C)C)/C(O[Si](C)(C)C(C)(C)C)=N\C=C/C2=CC=C(C=C2)OC1C(C)C | 3670.3 | Semi standard non polar | 33892256 | Hovenine A,2TBDMS,isomer #5 | CCC(C)C(/C(O)=N/C1/C(O)=N\C(CC(C)C)/C(O[Si](C)(C)C(C)(C)C)=N\C=C/C2=CC=C(C=C2)OC1C(C)C)N(C)[Si](C)(C)C(C)(C)C | 3822.1 | Semi standard non polar | 33892256 | Hovenine A,2TBDMS,isomer #6 | CCC(C)C(/C(O)=N/C1/C(O[Si](C)(C)C(C)(C)C)=N\C(CC(C)C)/C(O)=N\C=C/C2=CC=C(C=C2)OC1C(C)C)N(C)[Si](C)(C)C(C)(C)C | 3824.2 | Semi standard non polar | 33892256 | Hovenine A,3TBDMS,isomer #1 | CCC(C)C(NC)/C(=N/C1/C(O[Si](C)(C)C(C)(C)C)=N\C(CC(C)C)/C(O[Si](C)(C)C(C)(C)C)=N\C=C/C2=CC=C(C=C2)OC1C(C)C)O[Si](C)(C)C(C)(C)C | 3759.6 | Semi standard non polar | 33892256 | Hovenine A,3TBDMS,isomer #2 | CCC(C)C(/C(=N/C1/C(O[Si](C)(C)C(C)(C)C)=N\C(CC(C)C)/C(O)=N\C=C/C2=CC=C(C=C2)OC1C(C)C)O[Si](C)(C)C(C)(C)C)N(C)[Si](C)(C)C(C)(C)C | 3966.4 | Semi standard non polar | 33892256 | Hovenine A,3TBDMS,isomer #3 | CCC(C)C(/C(=N/C1/C(O)=N\C(CC(C)C)/C(O[Si](C)(C)C(C)(C)C)=N\C=C/C2=CC=C(C=C2)OC1C(C)C)O[Si](C)(C)C(C)(C)C)N(C)[Si](C)(C)C(C)(C)C | 3950.1 | Semi standard non polar | 33892256 | Hovenine A,3TBDMS,isomer #4 | CCC(C)C(/C(O)=N/C1/C(O[Si](C)(C)C(C)(C)C)=N\C(CC(C)C)/C(O[Si](C)(C)C(C)(C)C)=N\C=C/C2=CC=C(C=C2)OC1C(C)C)N(C)[Si](C)(C)C(C)(C)C | 3969.8 | Semi standard non polar | 33892256 |
|
---|