Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References enzymes (4) Show 4 proteins XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 17:38:38 UTC

Update Date

2022-03-07 02:52:40 UTC

HMDB ID

HMDB0030721

Secondary Accession Numbers

HMDB30721

Metabolite Identification

Common Name

Isocarlinoside

Description

Isocarlinoside belongs to the class of organic compounds known as flavonoid 8-c-glycosides. Flavonoid 8-C-glycosides are compounds containing a carbohydrate moiety which is C-glycosidically linked to 8-position of a 2-phenylchromen-4-one flavonoid backbone. Based on a literature review very few articles have been published on Isocarlinoside.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv0541 05061305272D          

 41 45  0  0  0  0            999 V2000
   -2.1434    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  7  1  1  0  0  0  0
  7  3  2  0  0  0  0
  8  2  1  0  0  0  0
  9  3  1  0  0  0  0
  9  8  2  0  0  0  0
 10  4  1  0  0  0  0
 11  6  1  0  0  0  0
 12  4  2  0  0  0  0
 12  7  1  0  0  0  0
 13  5  1  0  0  0  0
 14 10  1  0  0  0  0
 17 11  1  0  0  0  0
 18 13  1  0  0  0  0
 19 14  2  0  0  0  0
 19 15  1  0  0  0  0
 20 15  2  0  0  0  0
 20 16  1  0  0  0  0
 21 18  1  0  0  0  0
 22 17  1  0  0  0  0
 23 21  1  0  0  0  0
 24 14  1  0  0  0  0
 24 16  2  0  0  0  0
 25 15  1  0  0  0  0
 25 22  1  0  0  0  0
 26 16  1  0  0  0  0
 26 23  1  0  0  0  0
 27  5  1  0  0  0  0
 28  8  1  0  0  0  0
 29  9  1  0  0  0  0
 30 10  2  0  0  0  0
 31 11  1  0  0  0  0
 32 17  1  0  0  0  0
 33 18  1  0  0  0  0
 34 19  1  0  0  0  0
 35 20  1  0  0  0  0
 36 21  1  0  0  0  0
 37 22  1  0  0  0  0
 38 23  1  0  0  0  0
 39  6  1  0  0  0  0
 39 25  1  0  0  0  0
 40 12  1  0  0  0  0
 40 24  1  0  0  0  0
 41 13  1  0  0  0  0
 41 26  1  0  0  0  0
M  END

HMDB0030721
     RDKit          3D
Isocarlinoside
 69 73  0  0  0  0  0  0  0  0999 V2000
    1.2292   -4.0697   -1.2563 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3653   -3.2305   -0.9399 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9696   -3.6223   -0.8874 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9573   -2.7407   -0.5328 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3609   -3.1819   -0.4770 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7484   -4.4335   -0.8313 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0804   -4.8665   -0.7586 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0152   -3.9729   -0.3007 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3337   -4.3663   -0.2074 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6460   -2.6550    0.0798 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6796   -1.8255    0.5247 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3418   -2.3229   -0.0279 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6288   -1.5030   -0.2431 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3801   -1.0992   -0.2875 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0653    0.2189    0.0119 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2386    1.0668    0.4413 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9299    1.3119    1.8157 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5708    2.3698    2.3808 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7123    3.5575    2.7373 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2949    3.1773    3.6498 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8573    2.7844    1.6875 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3590    3.9013    2.3508 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5655    3.0743    0.2594 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6399    4.4056   -0.1223 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2445    2.4355   -0.1887 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    2.3023   -1.5993 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2199    0.6859   -0.0306 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4924    1.9694    0.2712 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3136   -0.1476   -0.3828 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6496    0.4412   -0.3079 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5191   -0.5824    0.2441 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4700   -1.0539   -0.6056 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5145    0.0232   -0.9047 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3242    0.2235    0.1997 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7291    1.2874   -1.2051 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5346    1.9483    0.0423 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2910    0.8294   -1.6295 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7310    2.1038   -1.9780 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0038   -1.4561   -0.6781 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0227   -2.2889   -1.0156 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6740   -1.9241   -0.6299 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1717   -4.6723   -1.1431 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0750   -5.1958   -1.2197 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3749   -5.8714   -1.0460 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5596   -5.3361   -0.4762 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6076   -2.1691    0.5643 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0215   -1.2913    0.2631 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1900    0.5670    0.3711 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9172    1.9818    3.4168 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2389    4.0912    1.9194 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3210    4.3128    3.3331 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0527    3.8095    3.6055 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5756    1.9104    1.8097 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2531    3.7194    3.3170 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3949    2.5470   -0.3377 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1819    4.5238   -0.9611 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3907    3.0412   -0.0654 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9438    1.4478   -1.7337 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3121    2.5039    0.2992 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7665    1.2876    0.3759 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.9544   -1.9328   -0.1043 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1601   -1.4099   -1.6144 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0921   -0.3069   -1.7716 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7972    1.1038    0.1535 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.1104    1.9716   -1.9180 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7541    1.3408    0.7985 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3357    0.1246   -2.4179 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1521    2.3278   -2.8431 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1048   -3.2015   -1.2431 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  8 10  1  0
 10 11  1  0
 10 12  2  0
  4 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 18 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 15 27  1  0
 27 28  1  0
 27 29  2  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 29 39  1  0
 39 40  1  0
 39 41  2  0
 41  2  1  0
 12  5  1  0
 41 14  1  0
 25 16  1  0
 37 30  1  0
  3 42  1  0
  6 43  1  0
  7 44  1  0
  9 45  1  0
 11 46  1  0
 12 47  1  0
 16 48  1  0
 18 49  1  0
 19 50  1  0
 19 51  1  0
 20 52  1  0
 21 53  1  0
 22 54  1  0
 23 55  1  0
 24 56  1  0
 25 57  1  0
 26 58  1  0
 28 59  1  0
 30 60  1  0
 32 61  1  0
 32 62  1  0
 33 63  1  0
 34 64  1  0
 35 65  1  0
 36 66  1  0
 37 67  1  0
 38 68  1  0
 40 69  1  0
M  END


  Mrv0541 05061305272D          

 41 45  0  0  0  0            999 V2000
   -2.1434    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8579    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579   -1.6500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1434    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5724    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    1.2375    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5724   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    3.7125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.4750    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.8250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -0.4125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    2.0625    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    3.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2868    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868   -1.6500    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2868    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145    4.5375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7145   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    3.7125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8579    0.8250    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    2.0625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1434   -1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7145    1.2375    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4289    2.4750    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  7  1  1  0  0  0  0
  7  3  2  0  0  0  0
  8  2  1  0  0  0  0
  9  3  1  0  0  0  0
  9  8  2  0  0  0  0
 10  4  1  0  0  0  0
 11  6  1  0  0  0  0
 12  4  2  0  0  0  0
 12  7  1  0  0  0  0
 13  5  1  0  0  0  0
 14 10  1  0  0  0  0
 17 11  1  0  0  0  0
 18 13  1  0  0  0  0
 19 14  2  0  0  0  0
 19 15  1  0  0  0  0
 20 15  2  0  0  0  0
 20 16  1  0  0  0  0
 21 18  1  0  0  0  0
 22 17  1  0  0  0  0
 23 21  1  0  0  0  0
 24 14  1  0  0  0  0
 24 16  2  0  0  0  0
 25 15  1  0  0  0  0
 25 22  1  0  0  0  0
 26 16  1  0  0  0  0
 26 23  1  0  0  0  0
 27  5  1  0  0  0  0
 28  8  1  0  0  0  0
 29  9  1  0  0  0  0
 30 10  2  0  0  0  0
 31 11  1  0  0  0  0
 32 17  1  0  0  0  0
 33 18  1  0  0  0  0
 34 19  1  0  0  0  0
 35 20  1  0  0  0  0
 36 21  1  0  0  0  0
 37 22  1  0  0  0  0
 38 23  1  0  0  0  0
 39  6  1  0  0  0  0
 39 25  1  0  0  0  0
 40 12  1  0  0  0  0
 40 24  1  0  0  0  0
 41 13  1  0  0  0  0
 41 26  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0030721

> <DATABASE_NAME>
hmdb

> <SMILES>
OCC1OC(C(O)C(O)C1O)C1=C2OC(=CC(=O)C2=C(O)C(C2OCC(O)C(O)C2O)=C1O)C1=CC(O)=C(O)C=C1

> <INCHI_IDENTIFIER>
InChI=1S/C26H28O15/c27-5-13-18(33)21(36)23(38)26(41-13)16-20(35)15(25-22(37)17(32)11(31)6-39-25)19(34)14-10(30)4-12(40-24(14)16)7-1-2-8(28)9(29)3-7/h1-4,11,13,17-18,21-23,25-29,31-38H,5-6H2

> <INCHI_KEY>
WYYFCTVKFALPQV-UHFFFAOYSA-N

> <FORMULA>
C26H28O15

> <MOLECULAR_WEIGHT>
580.4915

> <EXACT_MASS>
580.142820226

> <JCHEM_ACCEPTOR_COUNT>
15

> <JCHEM_AVERAGE_POLARIZABILITY>
55.53418069942917

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
11

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-6-(3,4,5-trihydroxyoxan-2-yl)-4H-chromen-4-one

> <ALOGPS_LOGP>
-0.75

> <JCHEM_LOGP>
-2.4811830560000003

> <ALOGPS_LOGS>
-1.83

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
5

> <JCHEM_PHYSIOLOGICAL_CHARGE>
-1

> <JCHEM_PKA>
8.465636628735536

> <JCHEM_PKA_STRONGEST_ACIDIC>
5.763525337879667

> <JCHEM_PKA_STRONGEST_BASIC>
-3.6447308976215727

> <JCHEM_POLAR_SURFACE_AREA>
267.28999999999996

> <JCHEM_REFRACTIVITY>
135.16889999999998

> <JCHEM_ROTATABLE_BOND_COUNT>
4

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
8.61e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-6-(3,4,5-trihydroxyoxan-2-yl)chromen-4-one

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0030721
     RDKit          3D
Isocarlinoside
 69 73  0  0  0  0  0  0  0  0999 V2000
    1.2292   -4.0697   -1.2563 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3653   -3.2305   -0.9399 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9696   -3.6223   -0.8874 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9573   -2.7407   -0.5328 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3609   -3.1819   -0.4770 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7484   -4.4335   -0.8313 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0804   -4.8665   -0.7586 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0152   -3.9729   -0.3007 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3337   -4.3663   -0.2074 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6460   -2.6550    0.0798 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6796   -1.8255    0.5247 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3418   -2.3229   -0.0279 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6288   -1.5030   -0.2431 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3801   -1.0992   -0.2875 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0653    0.2189    0.0119 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2386    1.0668    0.4413 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9299    1.3119    1.8157 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5708    2.3698    2.3808 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7123    3.5575    2.7373 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2949    3.1773    3.6498 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8573    2.7844    1.6875 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3590    3.9013    2.3508 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5655    3.0743    0.2594 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6399    4.4056   -0.1223 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2445    2.4355   -0.1887 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    2.3023   -1.5993 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2199    0.6859   -0.0306 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4924    1.9694    0.2712 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3136   -0.1476   -0.3828 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6496    0.4412   -0.3079 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5191   -0.5824    0.2441 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4700   -1.0539   -0.6056 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5145    0.0232   -0.9047 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3242    0.2235    0.1997 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7291    1.2874   -1.2051 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5346    1.9483    0.0423 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2910    0.8294   -1.6295 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7310    2.1038   -1.9780 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0038   -1.4561   -0.6781 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0227   -2.2889   -1.0156 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6740   -1.9241   -0.6299 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1717   -4.6723   -1.1431 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0750   -5.1958   -1.2197 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3749   -5.8714   -1.0460 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5596   -5.3361   -0.4762 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6076   -2.1691    0.5643 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0215   -1.2913    0.2631 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1900    0.5670    0.3711 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9172    1.9818    3.4168 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2389    4.0912    1.9194 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3210    4.3128    3.3331 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0527    3.8095    3.6055 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5756    1.9104    1.8097 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2531    3.7194    3.3170 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3949    2.5470   -0.3377 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1819    4.5238   -0.9611 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3907    3.0412   -0.0654 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9438    1.4478   -1.7337 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3121    2.5039    0.2992 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7665    1.2876    0.3759 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.9544   -1.9328   -0.1043 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1601   -1.4099   -1.6144 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0921   -0.3069   -1.7716 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7972    1.1038    0.1535 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.1104    1.9716   -1.9180 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7541    1.3408    0.7985 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3357    0.1246   -2.4179 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1521    2.3278   -2.8431 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1048   -3.2015   -1.2431 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  8 10  1  0
 10 11  1  0
 10 12  2  0
  4 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 18 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 15 27  1  0
 27 28  1  0
 27 29  2  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 29 39  1  0
 39 40  1  0
 39 41  2  0
 41  2  1  0
 12  5  1  0
 41 14  1  0
 25 16  1  0
 37 30  1  0
  3 42  1  0
  6 43  1  0
  7 44  1  0
  9 45  1  0
 11 46  1  0
 12 47  1  0
 16 48  1  0
 18 49  1  0
 19 50  1  0
 19 51  1  0
 20 52  1  0
 21 53  1  0
 22 54  1  0
 23 55  1  0
 24 56  1  0
 25 57  1  0
 26 58  1  0
 28 59  1  0
 30 60  1  0
 32 61  1  0
 32 62  1  0
 33 63  1  0
 34 64  1  0
 35 65  1  0
 36 66  1  0
 37 67  1  0
 38 68  1  0
 40 69  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0      -4.001   3.850   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      -5.335   4.620   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0      -5.335   1.540   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0      -2.667   0.000   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0       4.001   6.930   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       5.335  -3.080   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0      -4.001   2.310   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      -6.668   3.850   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0      -6.668   2.310   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0      -1.334  -0.770   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       6.668  -2.310   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0      -2.667   1.540   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       2.667   6.160   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0       0.000   0.000   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       2.667   0.000   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       1.334   2.310   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0       6.668  -0.770   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0       1.334   6.930   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0       1.334  -0.770   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0       2.667   1.540   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0       0.000   6.160   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0       5.335   0.000   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0       0.000   4.620   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0       0.000   1.540   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0       4.001  -0.770   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0       1.334   3.850   0.000  0.00  0.00           C+0
HETATM   27  O   UNK     0       5.335   6.160   0.000  0.00  0.00           O+0
HETATM   28  O   UNK     0      -8.002   4.620   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0      -8.002   1.540   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0      -1.334  -2.310   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0       8.002  -3.080   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0       8.002   0.000   0.000  0.00  0.00           O+0
HETATM   33  O   UNK     0       1.334   8.470   0.000  0.00  0.00           O+0
HETATM   34  O   UNK     0       1.334  -2.310   0.000  0.00  0.00           O+0
HETATM   35  O   UNK     0       4.001   2.310   0.000  0.00  0.00           O+0
HETATM   36  O   UNK     0      -1.334   6.930   0.000  0.00  0.00           O+0
HETATM   37  O   UNK     0       5.335   1.540   0.000  0.00  0.00           O+0
HETATM   38  O   UNK     0      -1.334   3.850   0.000  0.00  0.00           O+0
HETATM   39  O   UNK     0       4.001  -2.310   0.000  0.00  0.00           O+0
HETATM   40  O   UNK     0      -1.334   2.310   0.000  0.00  0.00           O+0
HETATM   41  O   UNK     0       2.667   4.620   0.000  0.00  0.00           O+0
CONECT    1    2    7                                                       
CONECT    2    1    8                                                       
CONECT    3    7    9                                                       
CONECT    4   10   12                                                       
CONECT    5   13   27                                                       
CONECT    6   11   39                                                       
CONECT    7    1    3   12                                                  
CONECT    8    2    9   28                                                  
CONECT    9    3    8   29                                                  
CONECT   10    4   14   30                                                  
CONECT   11    6   17   31                                                  
CONECT   12    4    7   40                                                  
CONECT   13    5   18   41                                                  
CONECT   14   10   19   24                                                  
CONECT   15   19   20   25                                                  
CONECT   16   20   24   26                                                  
CONECT   17   11   22   32                                                  
CONECT   18   13   21   33                                                  
CONECT   19   14   15   34                                                  
CONECT   20   15   16   35                                                  
CONECT   21   18   23   36                                                  
CONECT   22   17   25   37                                                  
CONECT   23   21   26   38                                                  
CONECT   24   14   16   40                                                  
CONECT   25   15   22   39                                                  
CONECT   26   16   23   41                                                  
CONECT   27    5                                                            
CONECT   28    8                                                            
CONECT   29    9                                                            
CONECT   30   10                                                            
CONECT   31   11                                                            
CONECT   32   17                                                            
CONECT   33   18                                                            
CONECT   34   19                                                            
CONECT   35   20                                                            
CONECT   36   21                                                            
CONECT   37   22                                                            
CONECT   38   23                                                            
CONECT   39    6   25                                                       
CONECT   40   12   24                                                       
CONECT   41   13   26                                                       
MASTER        0    0    0    0    0    0    0    0   41    0   90    0
END

COMPND    HMDB0030721
HETATM    1  O1  UNL     1       1.229  -4.070  -1.256  1.00  0.00           O  
HETATM    2  C1  UNL     1       0.365  -3.231  -0.940  1.00  0.00           C  
HETATM    3  C2  UNL     1      -0.970  -3.622  -0.887  1.00  0.00           C  
HETATM    4  C3  UNL     1      -1.957  -2.741  -0.533  1.00  0.00           C  
HETATM    5  C4  UNL     1      -3.361  -3.182  -0.477  1.00  0.00           C  
HETATM    6  C5  UNL     1      -3.748  -4.433  -0.831  1.00  0.00           C  
HETATM    7  C6  UNL     1      -5.080  -4.867  -0.759  1.00  0.00           C  
HETATM    8  C7  UNL     1      -6.015  -3.973  -0.301  1.00  0.00           C  
HETATM    9  O2  UNL     1      -7.334  -4.366  -0.207  1.00  0.00           O  
HETATM   10  C8  UNL     1      -5.646  -2.655   0.080  1.00  0.00           C  
HETATM   11  O3  UNL     1      -6.680  -1.825   0.525  1.00  0.00           O  
HETATM   12  C9  UNL     1      -4.342  -2.323  -0.028  1.00  0.00           C  
HETATM   13  O4  UNL     1      -1.629  -1.503  -0.243  1.00  0.00           O  
HETATM   14  C10 UNL     1      -0.380  -1.099  -0.287  1.00  0.00           C  
HETATM   15  C11 UNL     1      -0.065   0.219   0.012  1.00  0.00           C  
HETATM   16  C12 UNL     1      -1.239   1.067   0.441  1.00  0.00           C  
HETATM   17  O5  UNL     1      -0.930   1.312   1.816  1.00  0.00           O  
HETATM   18  C13 UNL     1      -1.571   2.370   2.381  1.00  0.00           C  
HETATM   19  C14 UNL     1      -0.712   3.558   2.737  1.00  0.00           C  
HETATM   20  O6  UNL     1       0.295   3.177   3.650  1.00  0.00           O  
HETATM   21  C15 UNL     1      -2.857   2.784   1.687  1.00  0.00           C  
HETATM   22  O7  UNL     1      -3.359   3.901   2.351  1.00  0.00           O  
HETATM   23  C16 UNL     1      -2.565   3.074   0.259  1.00  0.00           C  
HETATM   24  O8  UNL     1      -2.640   4.406  -0.122  1.00  0.00           O  
HETATM   25  C17 UNL     1      -1.245   2.435  -0.189  1.00  0.00           C  
HETATM   26  O9  UNL     1      -1.429   2.302  -1.599  1.00  0.00           O  
HETATM   27  C18 UNL     1       1.220   0.686  -0.031  1.00  0.00           C  
HETATM   28  O10 UNL     1       1.492   1.969   0.271  1.00  0.00           O  
HETATM   29  C19 UNL     1       2.314  -0.148  -0.383  1.00  0.00           C  
HETATM   30  C20 UNL     1       3.650   0.441  -0.308  1.00  0.00           C  
HETATM   31  O11 UNL     1       4.519  -0.582   0.244  1.00  0.00           O  
HETATM   32  C21 UNL     1       5.470  -1.054  -0.606  1.00  0.00           C  
HETATM   33  C22 UNL     1       6.515   0.023  -0.905  1.00  0.00           C  
HETATM   34  O12 UNL     1       7.324   0.224   0.200  1.00  0.00           O  
HETATM   35  C23 UNL     1       5.729   1.287  -1.205  1.00  0.00           C  
HETATM   36  O13 UNL     1       5.535   1.948   0.042  1.00  0.00           O  
HETATM   37  C24 UNL     1       4.291   0.829  -1.629  1.00  0.00           C  
HETATM   38  O14 UNL     1       3.731   2.104  -1.978  1.00  0.00           O  
HETATM   39  C25 UNL     1       2.004  -1.456  -0.678  1.00  0.00           C  
HETATM   40  O15 UNL     1       3.023  -2.289  -1.016  1.00  0.00           O  
HETATM   41  C26 UNL     1       0.674  -1.924  -0.630  1.00  0.00           C  
HETATM   42  H1  UNL     1      -1.172  -4.672  -1.143  1.00  0.00           H  
HETATM   43  H2  UNL     1      -3.075  -5.196  -1.220  1.00  0.00           H  
HETATM   44  H3  UNL     1      -5.375  -5.871  -1.046  1.00  0.00           H  
HETATM   45  H4  UNL     1      -7.560  -5.336  -0.476  1.00  0.00           H  
HETATM   46  H5  UNL     1      -7.608  -2.169   0.564  1.00  0.00           H  
HETATM   47  H6  UNL     1      -4.021  -1.291   0.263  1.00  0.00           H  
HETATM   48  H7  UNL     1      -2.190   0.567   0.371  1.00  0.00           H  
HETATM   49  H8  UNL     1      -1.917   1.982   3.417  1.00  0.00           H  
HETATM   50  H9  UNL     1      -0.239   4.091   1.919  1.00  0.00           H  
HETATM   51  H10 UNL     1      -1.321   4.313   3.333  1.00  0.00           H  
HETATM   52  H11 UNL     1       1.053   3.809   3.606  1.00  0.00           H  
HETATM   53  H12 UNL     1      -3.576   1.910   1.810  1.00  0.00           H  
HETATM   54  H13 UNL     1      -3.253   3.719   3.317  1.00  0.00           H  
HETATM   55  H14 UNL     1      -3.395   2.547  -0.338  1.00  0.00           H  
HETATM   56  H15 UNL     1      -3.182   4.524  -0.961  1.00  0.00           H  
HETATM   57  H16 UNL     1      -0.391   3.041  -0.065  1.00  0.00           H  
HETATM   58  H17 UNL     1      -1.944   1.448  -1.734  1.00  0.00           H  
HETATM   59  H18 UNL     1       2.312   2.504   0.299  1.00  0.00           H  
HETATM   60  H19 UNL     1       3.767   1.288   0.376  1.00  0.00           H  
HETATM   61  H20 UNL     1       5.954  -1.933  -0.104  1.00  0.00           H  
HETATM   62  H21 UNL     1       5.160  -1.410  -1.614  1.00  0.00           H  
HETATM   63  H22 UNL     1       7.092  -0.307  -1.772  1.00  0.00           H  
HETATM   64  H23 UNL     1       7.797   1.104   0.154  1.00  0.00           H  
HETATM   65  H24 UNL     1       6.110   1.972  -1.918  1.00  0.00           H  
HETATM   66  H25 UNL     1       5.754   1.341   0.798  1.00  0.00           H  
HETATM   67  H26 UNL     1       4.336   0.125  -2.418  1.00  0.00           H  
HETATM   68  H27 UNL     1       4.152   2.328  -2.843  1.00  0.00           H  
HETATM   69  H28 UNL     1       3.105  -3.201  -1.243  1.00  0.00           H  
CONECT    1    2    2
CONECT    2    3   41
CONECT    3    4    4   42
CONECT    4    5   13
CONECT    5    6    6   12
CONECT    6    7   43
CONECT    7    8    8   44
CONECT    8    9   10
CONECT    9   45
CONECT   10   11   12   12
CONECT   11   46
CONECT   12   47
CONECT   13   14
CONECT   14   15   15   41
CONECT   15   16   27
CONECT   16   17   25   48
CONECT   17   18
CONECT   18   19   21   49
CONECT   19   20   50   51
CONECT   20   52
CONECT   21   22   23   53
CONECT   22   54
CONECT   23   24   25   55
CONECT   24   56
CONECT   25   26   57
CONECT   26   58
CONECT   27   28   29   29
CONECT   28   59
CONECT   29   30   39
CONECT   30   31   37   60
CONECT   31   32
CONECT   32   33   61   62
CONECT   33   34   35   63
CONECT   34   64
CONECT   35   36   37   65
CONECT   36   66
CONECT   37   38   67
CONECT   38   68
CONECT   39   40   41   41
CONECT   40   69
END

HMDB0030721
     RDKit          3D
Isocarlinoside
 69 73  0  0  0  0  0  0  0  0999 V2000
    1.2292   -4.0697   -1.2563 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3653   -3.2305   -0.9399 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9696   -3.6223   -0.8874 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9573   -2.7407   -0.5328 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3609   -3.1819   -0.4770 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7484   -4.4335   -0.8313 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0804   -4.8665   -0.7586 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0152   -3.9729   -0.3007 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.3337   -4.3663   -0.2074 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6460   -2.6550    0.0798 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6796   -1.8255    0.5247 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3418   -2.3229   -0.0279 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6288   -1.5030   -0.2431 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3801   -1.0992   -0.2875 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0653    0.2189    0.0119 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2386    1.0668    0.4413 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9299    1.3119    1.8157 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5708    2.3698    2.3808 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7123    3.5575    2.7373 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2949    3.1773    3.6498 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8573    2.7844    1.6875 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3590    3.9013    2.3508 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5655    3.0743    0.2594 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6399    4.4056   -0.1223 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2445    2.4355   -0.1887 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4289    2.3023   -1.5993 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2199    0.6859   -0.0306 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4924    1.9694    0.2712 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3136   -0.1476   -0.3828 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6496    0.4412   -0.3079 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5191   -0.5824    0.2441 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.4700   -1.0539   -0.6056 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5145    0.0232   -0.9047 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3242    0.2235    0.1997 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.7291    1.2874   -1.2051 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5346    1.9483    0.0423 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2910    0.8294   -1.6295 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7310    2.1038   -1.9780 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0038   -1.4561   -0.6781 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0227   -2.2889   -1.0156 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.6740   -1.9241   -0.6299 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1717   -4.6723   -1.1431 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0750   -5.1958   -1.2197 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.3749   -5.8714   -1.0460 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5596   -5.3361   -0.4762 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.6076   -2.1691    0.5643 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0215   -1.2913    0.2631 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1900    0.5670    0.3711 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9172    1.9818    3.4168 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2389    4.0912    1.9194 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3210    4.3128    3.3331 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0527    3.8095    3.6055 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5756    1.9104    1.8097 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2531    3.7194    3.3170 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3949    2.5470   -0.3377 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1819    4.5238   -0.9611 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3907    3.0412   -0.0654 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9438    1.4478   -1.7337 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3121    2.5039    0.2992 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7665    1.2876    0.3759 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.9544   -1.9328   -0.1043 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1601   -1.4099   -1.6144 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0921   -0.3069   -1.7716 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7972    1.1038    0.1535 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.1104    1.9716   -1.9180 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7541    1.3408    0.7985 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3357    0.1246   -2.4179 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1521    2.3278   -2.8431 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1048   -3.2015   -1.2431 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  8 10  1  0
 10 11  1  0
 10 12  2  0
  4 13  1  0
 13 14  1  0
 14 15  2  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  1  0
 19 20  1  0
 18 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 23 25  1  0
 25 26  1  0
 15 27  1  0
 27 28  1  0
 27 29  2  0
 29 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  1  0
 33 34  1  0
 33 35  1  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 29 39  1  0
 39 40  1  0
 39 41  2  0
 41  2  1  0
 12  5  1  0
 41 14  1  0
 25 16  1  0
 37 30  1  0
  3 42  1  0
  6 43  1  0
  7 44  1  0
  9 45  1  0
 11 46  1  0
 12 47  1  0
 16 48  1  0
 18 49  1  0
 19 50  1  0
 19 51  1  0
 20 52  1  0
 21 53  1  0
 22 54  1  0
 23 55  1  0
 24 56  1  0
 25 57  1  0
 26 58  1  0
 28 59  1  0
 30 60  1  0
 32 61  1  0
 32 62  1  0
 33 63  1  0
 34 64  1  0
 35 65  1  0
 36 66  1  0
 37 67  1  0
 38 68  1  0
 40 69  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
6-a-L-Arabinopyranosyl-2-(3,4-dihydroxyphenyl)-8-b-D-glucopyranosyl-5,7-dihydroxy-4H-1-benzopyran-4-one, 9ci	HMDB
6-Arabinopyranosyl-8-glucopyranosyl-3',4',5,7-tetrahydroxyflavone	HMDB
6-Arabinopyranosyl-8-glucopyranosylluteolin	HMDB
6-Arabinosyl-8-glucosylluteolin	HMDB

Chemical Formula

C₂₆H₂₈O₁₅

Average Molecular Weight

580.4915

Monoisotopic Molecular Weight

580.142820226

IUPAC Name

2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-6-(3,4,5-trihydroxyoxan-2-yl)-4H-chromen-4-one

Traditional Name

2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-6-(3,4,5-trihydroxyoxan-2-yl)chromen-4-one

CAS Registry Number

83151-90-0

SMILES

OCC1OC(C(O)C(O)C1O)C1=C2OC(=CC(=O)C2=C(O)C(C2OCC(O)C(O)C2O)=C1O)C1=CC(O)=C(O)C=C1

InChI Identifier

InChI=1S/C26H28O15/c27-5-13-18(33)21(36)23(38)26(41-13)16-20(35)15(25-22(37)17(32)11(31)6-39-25)19(34)14-10(30)4-12(40-24(14)16)7-1-2-8(28)9(29)3-7/h1-4,11,13,17-18,21-23,25-29,31-38H,5-6H2

InChI Key

WYYFCTVKFALPQV-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as flavonoid 8-c-glycosides. Flavonoid 8-C-glycosides are compounds containing a carbohydrate moiety which is C-glycosidically linked to 8-position of a 2-phenylchromen-4-one flavonoid backbone.

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Flavonoids

Sub Class

Flavonoid glycosides

Direct Parent

Flavonoid 8-C-glycosides

Alternative Parents

Substituents

Flavonoid-8-c-glycoside
3'-hydroxyflavonoid
4'-hydroxyflavonoid
5-hydroxyflavonoid
7-hydroxyflavonoid
Flavone
Hydroxyflavonoid
Phenolic glycoside
C-glycosyl compound
Chromone
Glycosyl compound
Benzopyran
1-benzopyran
Catechol
1-hydroxy-4-unsubstituted benzenoid
1-hydroxy-2-unsubstituted benzenoid
Phenol
Pyranone
Pyran
Oxane
Monocyclic benzene moiety
Monosaccharide
Benzenoid
Vinylogous acid
Heteroaromatic compound
Secondary alcohol
Polyol
Ether
Oxacycle
Organoheterocyclic compound
Dialkyl ether
Organooxygen compound
Hydrocarbon derivative
Organic oxide
Primary alcohol
Organic oxygen compound
Alcohol
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0030721)
Cytoplasm (HMDB: HMDB0030721)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0030721)

Source

Endogenous

Endogenous (HMDB: HMDB0030721)

Plant

Exogenous

Food

Food (HMDB: HMDB0030721)

Soy

Soy bean (FooDB: FOOD00085)

Pulse

Pulses (FooDB: FOOD00867)

Process

Not Available

Role

Not Available

Physical Properties

State

Not Available

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	1000000 mg/L @ 25 °C (est)	The Good Scents Company Information System
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	8.61 g/L	ALOGPS
logP	-0.75	ALOGPS
logP	-2.5	ChemAxon
logS	-1.8	ALOGPS
pKa (Strongest Acidic)	5.76	ChemAxon
pKa (Strongest Basic)	-3.6	ChemAxon
Physiological Charge	-1	ChemAxon
Hydrogen Acceptor Count	15	ChemAxon
Hydrogen Donor Count	11	ChemAxon
Polar Surface Area	267.29 Å²	ChemAxon
Rotatable Bond Count	4	ChemAxon
Refractivity	135.17 m³·mol⁻¹	ChemAxon
Polarizability	55.53 Å³	ChemAxon
Number of Rings	5	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M+H]+	223.214	30932474
DeepCCS	[M-H]-	220.988	30932474
DeepCCS	[M-2H]-	254.229	30932474
DeepCCS	[M+Na]+	229.127	30932474
AllCCS	[M+H]+	230.3	32859911
AllCCS	[M+H-H2O]+	228.8	32859911
AllCCS	[M+NH4]+	231.7	32859911
AllCCS	[M+Na]+	232.1	32859911
AllCCS	[M-H]-	230.5	32859911
AllCCS	[M+Na-2H]-	232.5	32859911
AllCCS	[M+HCOO]-	234.9	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Isocarlinoside	OCC1OC(C(O)C(O)C1O)C1=C2OC(=CC(=O)C2=C(O)C(C2OCC(O)C(O)C2O)=C1O)C1=CC(O)=C(O)C=C1	5014.2	Standard polar	33892256
Isocarlinoside	OCC1OC(C(O)C(O)C1O)C1=C2OC(=CC(=O)C2=C(O)C(C2OCC(O)C(O)C2O)=C1O)C1=CC(O)=C(O)C=C1	4478.8	Standard non polar	33892256
Isocarlinoside	OCC1OC(C(O)C(O)C1O)C1=C2OC(=CC(=O)C2=C(O)C(C2OCC(O)C(O)C2O)=C1O)C1=CC(O)=C(O)C=C1	5635.6	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Isocarlinoside,1TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5488.2	Semi standard non polar	33892256
Isocarlinoside,1TMS,isomer #10	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5575.0	Semi standard non polar	33892256
Isocarlinoside,1TMS,isomer #11	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5566.8	Semi standard non polar	33892256
Isocarlinoside,1TMS,isomer #2	C[Si](C)(C)OC1C(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)OC(CO)C(O)C1O	5523.7	Semi standard non polar	33892256
Isocarlinoside,1TMS,isomer #3	C[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C1O	5550.0	Semi standard non polar	33892256
Isocarlinoside,1TMS,isomer #4	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C1O	5533.1	Semi standard non polar	33892256
Isocarlinoside,1TMS,isomer #5	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5477.6	Semi standard non polar	33892256
Isocarlinoside,1TMS,isomer #6	C[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C1O	5543.0	Semi standard non polar	33892256
Isocarlinoside,1TMS,isomer #7	C[Si](C)(C)OC1C(O)COC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C1O	5549.1	Semi standard non polar	33892256
Isocarlinoside,1TMS,isomer #8	C[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)OCC(O)C1O	5531.5	Semi standard non polar	33892256
Isocarlinoside,1TMS,isomer #9	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5484.3	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5437.8	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #10	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5457.7	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #11	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5448.3	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #12	C[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C1O	5479.3	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #13	C[Si](C)(C)OC1C(O)COC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C1O	5478.7	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #14	C[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)OCC(O)C1O	5472.0	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #15	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O)=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5458.0	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #16	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5512.8	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #17	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5497.5	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #18	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C1O	5471.8	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #19	C[Si](C)(C)OC1C(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)OC(CO)C(O)C1O[Si](C)(C)C	5492.1	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #2	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5455.5	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #20	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C1O[Si](C)(C)C	5497.3	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #21	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5451.5	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #22	C[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C1O	5492.8	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #23	C[Si](C)(C)OC1C(O)COC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C1O	5492.4	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #24	C[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)OCC(O)C1O	5486.4	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #25	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5465.7	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #26	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5513.2	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #27	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)=CC=C1O	5492.5	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #28	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5453.3	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #29	C[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C1O	5479.0	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #3	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5454.2	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #30	C[Si](C)(C)OC1C(O)COC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C1O	5474.5	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #31	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C1O	5472.7	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #32	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5463.2	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #33	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5517.9	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #34	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)=CC=C1O	5500.6	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #35	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O)C(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5480.0	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #36	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O)C(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5471.2	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #37	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5465.8	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #38	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5468.8	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #39	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5503.5	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #4	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5446.7	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #40	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5491.4	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #41	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5464.2	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #42	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5526.5	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #43	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5512.2	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #44	C[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C1O	5477.8	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #45	C[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C1O[Si](C)(C)C	5513.3	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #46	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5457.4	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #47	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5511.8	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #48	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5494.1	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #49	C[Si](C)(C)OC1C(O)COC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C1O[Si](C)(C)C	5484.5	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #5	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5443.4	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #50	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5454.1	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #51	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5512.4	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #52	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5497.0	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #53	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5485.6	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #54	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5468.5	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #55	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5492.0	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #6	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5497.5	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #7	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5484.6	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #8	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5453.1	Semi standard non polar	33892256
Isocarlinoside,2TMS,isomer #9	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5465.4	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5334.4	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #10	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5406.9	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #100	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5331.5	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #101	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)=CC=C1O	5300.3	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #102	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O)C(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5356.4	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #103	C[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C1O	5399.9	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #104	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5354.9	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #105	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)=CC=C1O	5323.3	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #106	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5368.8	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #107	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5351.2	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #108	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)=CC=C1O	5320.5	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #109	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	5374.2	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #11	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5393.1	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #110	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5365.0	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #111	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5340.9	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #112	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5352.1	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #113	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5369.1	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #114	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5354.3	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #115	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)=CC=C1O	5322.7	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #116	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5390.3	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #117	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)=CC=C1O	5363.6	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #118	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5388.7	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #119	C[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C1O	5398.7	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #12	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5370.9	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #120	C[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C1O[Si](C)(C)C	5408.1	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #121	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5351.3	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #122	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)=CC=C1O	5321.9	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #123	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5368.1	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #124	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C1O	5397.5	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #125	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5374.7	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #126	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5373.5	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #127	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)=CC=C1O	5344.1	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #128	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5376.9	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #129	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)=CC=C1O	5344.7	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #13	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5389.6	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #130	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5391.9	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #131	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5420.3	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #132	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5401.6	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #133	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5387.5	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #134	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5405.4	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #135	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5377.1	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #136	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5391.1	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #137	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5356.9	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #138	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5374.7	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #139	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5342.6	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #14	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5365.1	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #140	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5366.1	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #141	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5386.9	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #142	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5356.2	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #143	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5372.6	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #144	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5341.6	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #145	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5398.5	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #146	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5388.5	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #147	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5371.9	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #148	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5373.8	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #149	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5346.1	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #15	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5389.4	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #150	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5422.7	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #151	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5409.9	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #152	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5415.0	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #153	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5393.4	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #154	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5383.6	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #155	C[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5452.1	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #156	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5358.1	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #157	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5345.4	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #158	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5312.6	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #159	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5402.2	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #16	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5387.1	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #160	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5383.2	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #161	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5372.5	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #162	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5357.5	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #163	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5327.3	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #164	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5398.3	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #165	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5370.9	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #17	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5396.8	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #18	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5392.9	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #19	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5352.8	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #2	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5316.0	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #20	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5357.8	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #21	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5330.6	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #22	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5372.4	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #23	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5361.0	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #24	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5380.2	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #25	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5360.2	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #26	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5375.9	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #27	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5349.1	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #28	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5384.8	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #29	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5379.5	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #3	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5324.4	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #30	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5390.8	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #31	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5380.0	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #32	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5348.6	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #33	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5366.5	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #34	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5355.7	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #35	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5369.5	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #36	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5397.2	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #37	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5390.4	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #38	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5373.9	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #39	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5401.3	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #4	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5346.6	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #40	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5363.1	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #41	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5344.3	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #42	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5374.8	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #43	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5406.9	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #44	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5408.9	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #45	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5418.7	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #46	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5367.0	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #47	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5345.4	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #48	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5352.6	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #49	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5357.9	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #5	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5343.0	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #50	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5359.9	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #51	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5327.0	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #52	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5362.1	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #53	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5367.5	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #54	C[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C1O	5401.3	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #55	C[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C1O	5416.2	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #56	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5397.2	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #57	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5369.9	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #58	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O)C(O)=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5391.4	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #59	C[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C1O	5403.3	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #6	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5311.6	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #60	C[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C1O[Si](C)(C)C	5415.4	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #61	C[Si](C)(C)OC1C(O)COC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C1O	5386.3	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #62	C[Si](C)(C)OC1C(O)COC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C1O	5400.9	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #63	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5359.0	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #64	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5330.1	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #65	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O)C(O)=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5373.5	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #66	C[Si](C)(C)OC1C(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)OC(CO)C(O)C1O	5403.4	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #67	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C1O	5399.0	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #68	C[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)OCC(O)C1O	5416.3	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #69	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5384.1	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #7	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5332.3	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #70	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5353.6	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #71	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5377.4	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #72	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5385.7	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #73	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5397.0	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #74	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5380.5	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #75	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5349.6	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #76	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5394.2	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #77	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	5401.7	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #78	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5395.0	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #79	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5365.4	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #8	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5322.1	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #80	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5372.6	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #81	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5446.1	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #82	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5374.5	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #83	C[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C1O	5414.6	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #84	C[Si](C)(C)OC1C(O)COC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C1O	5395.8	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #85	C[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)OCC(O)C1O	5412.5	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #86	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5400.2	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #87	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5402.9	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #88	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)=CC=C1O	5373.4	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #89	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5354.1	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #9	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5337.0	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #90	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5325.6	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #91	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5342.1	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #92	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5344.7	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #93	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5330.1	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #94	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)=CC=C1O	5298.1	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #95	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5374.4	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #96	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)=CC=C1O	5345.6	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #97	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O)C(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5382.9	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #98	C[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C1O	5405.6	Semi standard non polar	33892256
Isocarlinoside,3TMS,isomer #99	C[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C1O[Si](C)(C)C	5408.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #1	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5210.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #10	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5177.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #100	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5274.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #101	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5236.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #102	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5208.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #103	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5171.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #104	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5214.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #105	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5184.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #106	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5146.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #107	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5189.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #108	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5227.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #109	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5243.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #11	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5139.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #110	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5238.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #111	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5270.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #112	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5240.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #113	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5279.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #114	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5238.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #115	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5256.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #116	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5248.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #117	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5210.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #118	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5227.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #119	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5221.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #12	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5115.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #120	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5315.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #121	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5231.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #122	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5231.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #123	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5220.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #124	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5187.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #125	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5160.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #126	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5219.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #127	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5224.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #128	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5218.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #129	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5181.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #13	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5181.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #130	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5146.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #131	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5119.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #132	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5189.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #133	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5196.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #134	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C	5213.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #135	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5182.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #136	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5152.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #137	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5217.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #138	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5222.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #139	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5184.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #14	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5156.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #140	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5156.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #141	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5221.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #142	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5216.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #143	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5182.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #144	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	5185.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #145	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5229.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #146	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5151.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #147	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5159.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #148	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5268.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #149	C[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C1O	5328.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #15	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5181.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #150	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5254.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #151	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5221.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #152	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5241.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #153	C[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C1O	5295.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #154	C[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C1O[Si](C)(C)C	5290.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #155	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	5258.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #156	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5232.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #157	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O)C(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5249.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #158	C[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C1O	5307.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #159	C[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C1O[Si](C)(C)C	5306.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #16	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5202.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #160	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5212.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #161	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5253.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #162	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5258.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #163	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5294.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #164	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5183.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #165	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5229.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #166	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5225.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #167	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5257.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #168	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5254.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #169	C[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5339.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #17	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5178.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #170	C[Si](C)(C)OC1C(O)COC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C1O	5302.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #171	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5207.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #172	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5175.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #173	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5209.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #174	C[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C1O	5289.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #175	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	5215.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #176	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5190.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #177	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O)C(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5219.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #178	C[Si](C)(C)OC1C(O)COC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C1O[Si](C)(C)C	5301.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #179	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5168.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #18	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5152.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #180	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5247.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #181	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5253.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #182	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5139.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #183	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5216.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #184	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5235.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #185	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5236.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #186	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5240.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #187	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5207.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #188	C[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)OCC(O)C1O	5333.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #189	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	5249.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #19	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5204.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #190	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5221.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #191	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5244.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #192	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5204.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #193	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5281.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #194	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5173.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #195	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5290.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #196	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O	5201.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #197	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5168.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #198	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	5201.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #199	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5177.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #2	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5208.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #20	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5174.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #200	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5251.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #201	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O	5295.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #202	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5284.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #203	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)C=C1O[Si](C)(C)C	5290.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #204	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C3O2)=CC=C1O	5272.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #205	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5217.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #206	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5190.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #207	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5217.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #208	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5211.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #209	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5182.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #21	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5204.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #210	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)=CC=C1O	5158.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #211	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5250.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #212	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)=CC=C1O	5225.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #213	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5248.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #214	C[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C1O	5295.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #215	C[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C1O[Si](C)(C)C	5296.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #216	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5209.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #217	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)=CC=C1O	5185.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #218	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5215.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #219	C[Si](C)(C)OC1C(O)COC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C1O[Si](C)(C)C	5289.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #22	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5181.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #220	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5243.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #221	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)=CC=C1O	5217.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #222	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5243.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #223	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5208.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #224	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)=CC=C1O	5182.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #225	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	5289.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #226	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5204.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #227	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5202.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #228	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5186.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #229	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5146.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #23	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5156.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #230	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)=CC=C1O	5120.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #231	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5191.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #232	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5149.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #233	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5106.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #234	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)=CC=C1O	5082.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #235	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C)C1O	5182.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #236	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5135.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #237	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)=CC=C1O	5108.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #238	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5128.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #239	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)=CC=C1O	5100.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #24	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5213.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #240	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	5191.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #241	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5168.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #242	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5218.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #243	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5221.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #244	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	5261.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #245	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)=CC=C1O	5142.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #246	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)=CC=C1O	5197.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #247	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)=CC=C1O	5191.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #248	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5233.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #249	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5225.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #25	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5185.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #250	C[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5315.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #251	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5127.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #252	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5211.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #253	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	5219.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #254	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)=CC=C1O	5101.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #255	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)=CC=C1O	5184.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #256	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5208.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #257	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O	5157.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #258	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	5252.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #259	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)=CC=C1O	5127.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #26	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5216.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #260	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C)C4O)=C3O2)C=C1O[Si](C)(C)C	5214.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #261	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5222.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #262	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5217.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #263	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5209.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #264	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5173.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #265	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)=CC=C1O	5146.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #266	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5207.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #267	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5173.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #268	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5129.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #269	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)=CC=C1O	5103.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #27	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5214.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #270	C[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C)C(O)C1O	5205.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #271	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5168.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #272	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)=CC=C1O	5139.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #273	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5171.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #274	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)=CC=C1O	5142.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #275	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5222.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #276	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5201.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #277	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5244.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #278	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5250.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #279	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5284.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #28	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5191.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #280	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)=CC=C1O	5174.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #281	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)=CC=C1O	5221.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #282	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)=CC=C1O	5217.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #283	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5253.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #284	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5242.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #285	C[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5331.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #286	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5154.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #287	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5240.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #288	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5244.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #289	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)=CC=C1O	5127.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #29	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5154.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #290	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)=CC=C1O	5209.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #291	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O[Si](C)(C)C)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5226.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #292	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O	5196.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #293	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)=CC=C1O	5166.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #294	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5272.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #295	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5250.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #296	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5315.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #297	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5237.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #298	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5234.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #299	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5211.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #3	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5209.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #30	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5190.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #300	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5243.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #301	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5235.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #302	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5202.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #303	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5209.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #304	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5183.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #305	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5275.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #306	C[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O[Si](C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5224.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #307	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5214.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #308	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5186.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #309	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5149.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #31	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5169.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #310	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5124.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #311	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5235.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #312	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5191.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #313	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5163.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #314	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5259.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #315	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5248.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #316	C[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C2O[Si](C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5288.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #317	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5204.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #318	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5182.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #319	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5208.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #32	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5131.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #320	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5177.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #321	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5245.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #322	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5318.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #323	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5309.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #324	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5305.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #325	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5294.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #326	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5191.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #327	C[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5165.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #328	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5208.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #329	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C)C4O[Si](C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5294.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #33	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5166.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #330	C[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C)=C(O[Si](C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C	5233.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #34	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5214.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #35	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5229.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #36	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5219.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #37	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5315.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #38	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5241.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #39	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5234.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #4	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5184.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #40	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5213.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #41	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5276.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #42	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5245.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #43	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5283.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #44	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5232.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #45	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5234.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #46	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5205.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #47	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5273.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #48	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5245.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #49	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5274.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #5	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5160.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #50	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5209.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #51	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5185.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #52	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5229.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #53	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5204.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #54	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5235.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #55	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5269.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #56	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5246.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #57	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5212.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #58	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5251.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #59	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5220.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #6	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5207.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #60	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5188.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #61	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5229.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #62	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5267.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #63	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5280.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #64	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5270.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #65	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5220.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #66	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5228.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #67	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5199.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #68	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5268.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #69	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5240.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #7	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5179.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #70	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5273.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #71	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5162.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #72	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5137.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #73	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5199.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #74	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5175.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #75	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5205.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #76	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5229.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #77	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5198.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #78	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5166.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #79	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5206.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #8	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O[Si](C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5207.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #80	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5175.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #81	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5141.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #82	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5184.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #83	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5237.2	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #84	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5250.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #85	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O[Si](C)(C)C	5241.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #86	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5199.8	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #87	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5174.0	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #88	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5220.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #89	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5193.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #9	C[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C)C(C3OCC(O)C(O[Si](C)(C)C)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5200.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #90	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O[Si](C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5227.1	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #91	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5260.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #92	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5233.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #93	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5201.6	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #94	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5240.7	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #95	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O	5208.4	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #96	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O[Si](C)(C)C)C1O	5176.5	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #97	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C	5218.3	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #98	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O[Si](C)(C)C)C1O	5268.9	Semi standard non polar	33892256
Isocarlinoside,4TMS,isomer #99	C[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O[Si](C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C)C(O)C1O[Si](C)(C)C	5275.0	Semi standard non polar	33892256
Isocarlinoside,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5673.7	Semi standard non polar	33892256
Isocarlinoside,1TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5754.6	Semi standard non polar	33892256
Isocarlinoside,1TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5754.7	Semi standard non polar	33892256
Isocarlinoside,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1C(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)OC(CO)C(O)C1O	5759.9	Semi standard non polar	33892256
Isocarlinoside,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1C(O)C(CO)OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C1O	5784.6	Semi standard non polar	33892256
Isocarlinoside,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C1O	5767.4	Semi standard non polar	33892256
Isocarlinoside,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5702.8	Semi standard non polar	33892256
Isocarlinoside,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C1O	5776.3	Semi standard non polar	33892256
Isocarlinoside,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1C(O)COC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C1O	5783.4	Semi standard non polar	33892256
Isocarlinoside,1TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)OCC(O)C1O	5770.6	Semi standard non polar	33892256
Isocarlinoside,1TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5704.2	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O[Si](C)(C)C(C)(C)C)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5842.1	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5874.4	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O[Si](C)(C)C(C)(C)C	5863.7	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C1O	5923.4	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC1C(O)COC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C1O	5911.8	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O)C(O)C3O[Si](C)(C)C(C)(C)C)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)OCC(O)C1O	5923.0	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O)=C(C2OC(CO)C(O)C(O)C2O[Si](C)(C)C(C)(C)C)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5881.7	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C3O2)C=C1O	5922.9	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C3O2)=CC=C1O	5896.2	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C(C)(C)C)C1O	5916.2	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OC1C(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)OC(CO)C(O)C1O[Si](C)(C)C(C)(C)C	5935.0	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O[Si](C)(C)C(C)(C)C)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5881.1	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C1O[Si](C)(C)C(C)(C)C	5930.0	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5860.0	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C1O	5921.3	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OC1C(O)COC(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C1O	5914.6	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC1C(C2=C(O)C(C3OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)OCC(O)C1O	5919.1	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O)=C(C2OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5881.0	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C3O2)C=C1O	5924.9	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C3O2)=CC=C1O	5892.1	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5862.2	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C1O	5913.7	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O[Si](C)(C)C(C)(C)C)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5876.1	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OC1C(O)COC(C2=C(O)C(C3OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C1O	5899.4	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OC1C(CO)OC(C2=C(O)C(C3OCC(O)C(O)C3O[Si](C)(C)C(C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C1O	5912.6	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O)=C(C2OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5879.9	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C3O2)C=C1O	5916.5	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C3O2)=CC=C1O	5887.8	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5904.7	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5891.3	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)=C(C2OC(CO)C(O)C(O)C2O)C2=C1C(=O)C=C(C1=CC=C(O)C(O)=C1)O2	5892.4	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #38	CC(C)(C)[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O)C(O[Si](C)(C)C(C)(C)C)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5884.4	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #39	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O[Si](C)(C)C(C)(C)C)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5907.6	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O[Si](C)(C)C(C)(C)C)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5876.9	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #40	CC(C)(C)[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O[Si](C)(C)C(C)(C)C)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5885.1	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #41	CC(C)(C)[Si](C)(C)OC1=C(C2OCC(O[Si](C)(C)C(C)(C)C)C(O)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5884.0	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #42	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5940.2	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #43	CC(C)(C)[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O[Si](C)(C)C(C)(C)C)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5914.6	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #44	CC(C)(C)[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O[Si](C)(C)C(C)(C)C)C1O	5926.0	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #45	CC(C)(C)[Si](C)(C)OC1COC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C(O)C1O[Si](C)(C)C(C)(C)C	5955.7	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #46	CC(C)(C)[Si](C)(C)OC1=C(C2OCC(O)C(O[Si](C)(C)C(C)(C)C)C2O)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5871.3	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #47	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5930.4	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #48	CC(C)(C)[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O[Si](C)(C)C(C)(C)C)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5901.9	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #49	CC(C)(C)[Si](C)(C)OC1C(O)COC(C2=C(O)C(C3OC(CO)C(O)C(O)C3O)=C3OC(C4=CC=C(O)C(O)=C4)=CC(=O)C3=C2O)C1O[Si](C)(C)C(C)(C)C	5927.2	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O[Si](C)(C)C(C)(C)C)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O)C1O	5856.1	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #50	CC(C)(C)[Si](C)(C)OC1=C(C2OCC(O)C(O)C2O[Si](C)(C)C(C)(C)C)C(O)=C2C(=O)C=C(C3=CC=C(O)C(O)=C3)OC2=C1C1OC(CO)C(O)C(O)C1O	5875.3	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #51	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5925.9	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #52	CC(C)(C)[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O[Si](C)(C)C(C)(C)C)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5898.9	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #53	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O	5888.9	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #54	CC(C)(C)[Si](C)(C)OC1=CC(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O[Si](C)(C)C(C)(C)C)C(C4OC(CO)C(O)C(O)C4O)=C3O2)=CC=C1O	5860.8	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #55	CC(C)(C)[Si](C)(C)OC1=CC=C(C2=CC(=O)C3=C(O)C(C4OCC(O)C(O)C4O)=C(O)C(C4OC(CO)C(O)C(O)C4O)=C3O2)C=C1O[Si](C)(C)C(C)(C)C	5902.9	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C2)=CC3=O)C(O)C(O)C1O	5890.9	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C2)=CC3=O)C(O)C(O)C1O	5866.8	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O[Si](C)(C)C(C)(C)C)C(O)C1O	5884.6	Semi standard non polar	33892256
Isocarlinoside,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OCC1OC(C2=C(O)C(C3OCC(O)C(O)C3O)=C(O)C3=C2OC(C2=CC=C(O)C(O)=C2)=CC3=O)C(O)C(O[Si](C)(C)C(C)(C)C)C1O	5882.1	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Isocarlinoside GC-MS (1 TMS) - 70eV, Positive	splash10-0006-3200294000-c41fd092681b9e32c645	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isocarlinoside GC-MS (Non-derivatized) - 70eV, Positive	splash10-02ml-2100690000-218cade7da45284fff28	2017-11-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isocarlinoside GC-MS ("Isocarlinoside,1TMS,#1" TMS) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isocarlinoside GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isocarlinoside GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isocarlinoside GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isocarlinoside GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isocarlinoside GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isocarlinoside GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isocarlinoside GC-MS (TMS_1_8) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isocarlinoside GC-MS (TMS_1_9) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isocarlinoside GC-MS (TMS_1_10) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isocarlinoside GC-MS (TMS_1_11) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isocarlinoside GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isocarlinoside GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isocarlinoside GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isocarlinoside GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isocarlinoside GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isocarlinoside GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isocarlinoside GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isocarlinoside GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isocarlinoside GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isocarlinoside GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isocarlinoside GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Isocarlinoside GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Experimental LC-MS/MS	LC-MS/MS Spectrum - Isocarlinoside 6V, Positive-QTOF	splash10-001i-0007690000-4ca118216dd43fb9b2c3	2021-09-20	HMDB team, MONA	View Spectrum
Experimental LC-MS/MS	LC-MS/MS Spectrum - Isocarlinoside 6V, Negative-QTOF	splash10-004i-0004590000-e5d24e863644176373e0	2021-09-20	HMDB team, MONA	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isocarlinoside 10V, Positive-QTOF	splash10-03e9-0000190000-34123f2ca85893386472	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isocarlinoside 20V, Positive-QTOF	splash10-03ea-2500490000-251b202712f8f26739dd	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isocarlinoside 40V, Positive-QTOF	splash10-029b-2205960000-8cd134d512a91ffeb759	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isocarlinoside 10V, Negative-QTOF	splash10-004i-0000390000-2cf95fa531b46f5e33fa	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isocarlinoside 20V, Negative-QTOF	splash10-046v-6301790000-d2cbd2e228b9084738c9	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isocarlinoside 40V, Negative-QTOF	splash10-0006-9202610000-c3c8bbc150a00d42b399	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isocarlinoside 10V, Positive-QTOF	splash10-001i-0000090000-854aa22c873fad975f77	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isocarlinoside 20V, Positive-QTOF	splash10-001i-0000090000-854aa22c873fad975f77	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isocarlinoside 40V, Positive-QTOF	splash10-0012-0401970000-82684cda1740d5e6d8ab	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isocarlinoside 10V, Negative-QTOF	splash10-004i-0000090000-88ec610b39e4de113068	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isocarlinoside 20V, Negative-QTOF	splash10-004i-0000090000-ce7ff9fb4e625601600c	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Isocarlinoside 40V, Negative-QTOF	splash10-004i-0920750000-eae2035f3e7d2316821e	2021-09-25	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB002644

KNApSAcK ID

C00006187

Chemspider ID

35013261

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

73802481

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

rw1822241

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Enzymes

Enzyme Details

1. Catechol O-methyltransferase

General function:: Involved in magnesium ion binding
Specific function:: Catalyzes the O-methylation, and thereby the inactivation, of catecholamine neurotransmitters and catechol hormones. Also shortens the biological half-lives of certain neuroactive drugs, like L-DOPA, alpha-methyl DOPA and isoproterenol.
Gene Name:: COMT
Uniprot ID:: P21964
Molecular weight:: 30036.77

Reactions

Isocarlinoside → 5,7-dihydroxy-2-(4-hydroxy-3-methoxyphenyl)-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-6-(3,4,5-trihydroxyoxan-2-yl)-4H-chromen-4-one	details

Enzyme Details

2. Sulfotransferase family cytosolic 2B member 1

General function:: Involved in sulfotransferase activity
Specific function:: Sulfotransferase that utilizes 3'-phospho-5'-adenylyl sulfate (PAPS) as sulfonate donor to catalyze the sulfate conjugation of many hormones, neurotransmitters, drugs and xenobiotic compounds. Sulfonation increases the water solubility of most compounds, and therefore their renal excretion, but it can also result in bioactivation to form active metabolites. Sulfates hydroxysteroids like DHEA. Isoform 1 preferentially sulfonates cholesterol, and isoform 2 avidly sulfonates pregnenolone but not cholesterol.
Gene Name:: SULT2B1
Uniprot ID:: O00204
Molecular weight:: 39598.595

Reactions

Isocarlinoside → ({6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-6-(3,4,5-trihydroxyoxan-2-yl)-4H-chromen-8-yl]-3,4,5-trihydroxyoxan-2-yl}methoxy)sulfonic acid	details
Isocarlinoside → {2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-6-yl]-4,5-dihydroxyoxan-3-yl}oxidanesulfonic acid	details
Isocarlinoside → {2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-6-yl]-3,5-dihydroxyoxan-4-yl}oxidanesulfonic acid	details
Isocarlinoside → {6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-4H-chromen-6-yl]-4,5-dihydroxyoxan-3-yl}oxidanesulfonic acid	details
Isocarlinoside → {6-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-6-(3,4,5-trihydroxyoxan-2-yl)-4H-chromen-8-yl]-4,5-dihydroxy-2-(hydroxymethyl)oxan-3-yl}oxidanesulfonic acid	details
Isocarlinoside → {2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-6-(3,4,5-trihydroxyoxan-2-yl)-4H-chromen-8-yl]-3,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl}oxidanesulfonic acid	details
Isocarlinoside → {2-[2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-4-oxo-6-(3,4,5-trihydroxyoxan-2-yl)-4H-chromen-8-yl]-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl}oxidanesulfonic acid	details

Enzyme Details

3. UDP-glucuronosyltransferase 1-1

General function:: Involved in transferase activity, transferring hexosyl groups
Specific function:: UDPGT is of major importance in the conjugation and subsequent elimination of potentially toxic xenobiotics and endogenous compounds. This isoform glucuronidates bilirubin IX-alpha to form both the IX-alpha-C8 and IX-alpha-C12 monoconjugates and diconjugate. Is also able to catalyze the glucuronidation of 17beta-estradiol, 17alpha-ethinylestradiol, 1-hydroxypyrene, 4-methylumbelliferone, 1-naphthol, paranitrophenol, scopoletin, and umbelliferone.
Gene Name:: UGT1A1
Uniprot ID:: P22309
Molecular weight:: 59590.91

Reactions

Isocarlinoside → 6-(4-{5,7-dihydroxy-4-oxo-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-6-(3,4,5-trihydroxyoxan-2-yl)-4H-chromen-2-yl}-2-hydroxyphenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid	details
Isocarlinoside → 6-(5-{5,7-dihydroxy-4-oxo-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-6-(3,4,5-trihydroxyoxan-2-yl)-4H-chromen-2-yl}-2-hydroxyphenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid	details
Isocarlinoside → 6-{[2-(3,4-dihydroxyphenyl)-5-hydroxy-4-oxo-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-6-(3,4,5-trihydroxyoxan-2-yl)-4H-chromen-7-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid	details
Isocarlinoside → 6-{[2-(3,4-dihydroxyphenyl)-7-hydroxy-4-oxo-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-6-(3,4,5-trihydroxyoxan-2-yl)-4H-chromen-5-yl]oxy}-3,4,5-trihydroxyoxane-2-carboxylic acid	details

Enzyme Details

4. Sulfotransferase 1A3

General function:: sulfotransferase activity
Specific function:: Sulfotransferase that utilizes 3'-phospho-5'-adenylyl sulfate (PAPS) as sulfonate donor to catalyze the sulfate conjugation of phenolic monoamines (neurotransmitters such as dopamine, norepinephrine and serotonin) and phenolic and catechol drugs.
Gene Name:: SULT1A3
Uniprot ID:: P0DMM9
Molecular weight:: 34195.96

Reactions

Isocarlinoside → (5-{5,7-dihydroxy-4-oxo-8-[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-6-(3,4,5-trihydroxyoxan-2-yl)-4H-chromen-2-yl}-2-hydroxyphenyl)oxidanesulfonic acid	details

Showing metabocard for Isocarlinoside (HMDB0030721)

MOL for HMDB0030721 (Isocarlinoside)

3D MOL for HMDB0030721 (Isocarlinoside)

3D SDF for HMDB0030721 (Isocarlinoside)

3D-SDF for HMDB0030721 (Isocarlinoside)

PDB for HMDB0030721 (Isocarlinoside)

3D PDB for HMDB0030721 (Isocarlinoside)

SMILES for HMDB0030721 (Isocarlinoside)

INCHI for HMDB0030721 (Isocarlinoside)

Structure for HMDB0030721 (Isocarlinoside)

3D Structure for HMDB0030721 (Isocarlinoside)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra

Enzymes

Reactions

Reactions

Reactions

Reactions