Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 18:54:30 UTC

Update Date

2022-03-07 02:53:59 UTC

HMDB ID

HMDB0034113

Secondary Accession Numbers

HMDB34113

Metabolite Identification

Common Name

3,4-Hexahydroxydiphenoylarabinose

Description

3,4-Hexahydroxydiphenoylarabinose belongs to the class of organic compounds known as hydrolyzable tannins. These are tannins with a structure characterized by either of the following models. In model 1, the structure contains galloyl units (in some cases, shikimic acid units) that are linked to diverse polyol carbohydrate-, catechin-, or triterpenoid units. In model 2, contains at least two galloyl units C-C coupled to each other, and do not contain a glycosidically linked catechin unit. 3,4-Hexahydroxydiphenoylarabinose is an extremely weak basic (essentially neutral) compound (based on its pKa). Outside of the human body, 3,4-hexahydroxydiphenoylarabinose has been detected, but not quantified in, fruits. This could make 3,4-hexahydroxydiphenoylarabinose a potential biomarker for the consumption of these foods.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv0541 05061307352D          

 32 35  0  0  0  0            999 V2000
    2.5261   -0.2111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4459    2.9071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4444   -0.3671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2560    0.5684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7159    2.1275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3362   -0.3671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9860    3.5307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0957    0.2566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7961    1.1921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5261    1.9716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8763    0.2566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7961    3.3748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6062    1.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0662    2.5952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9845    1.1921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1744    1.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5693    0.2142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2403    1.6714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5246    0.5684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6062   -1.1466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7159    4.3103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6864    0.1007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3362    3.9984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1463    1.6598    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8763    2.4393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2546    1.9716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5958   -0.6104    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5531    0.9080    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3347    0.7243    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2546   -0.2111    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8174    0.5426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3657    1.6598    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  4  1  2  0  0  0  0
  5  2  2  0  0  0  0
  6  1  1  0  0  0  0
  7  2  1  0  0  0  0
  8  3  1  0  0  0  0
  9  4  1  0  0  0  0
 10  5  1  0  0  0  0
 10  9  1  0  0  0  0
 11  6  2  0  0  0  0
 12  7  2  0  0  0  0
 13  9  2  0  0  0  0
 13 11  1  0  0  0  0
 14 10  2  0  0  0  0
 14 12  1  0  0  0  0
 16  8  1  0  0  0  0
 16 15  1  0  0  0  0
 17  4  1  0  0  0  0
 18  5  1  0  0  0  0
 19 15  1  0  0  0  0
 20  6  1  0  0  0  0
 21  7  1  0  0  0  0
 22 11  1  0  0  0  0
 23 12  1  0  0  0  0
 24 13  1  0  0  0  0
 25 14  1  0  0  0  0
 26 15  1  0  0  0  0
 27 17  2  0  0  0  0
 28 18  2  0  0  0  0
 29 19  1  0  0  0  0
 30  3  1  0  0  0  0
 30 19  1  0  0  0  0
 31  8  1  0  0  0  0
 31 17  1  0  0  0  0
 32 16  1  0  0  0  0
 32 18  1  0  0  0  0
M  END

HMDB0034113
     RDKit          3D
3,4-Hexahydroxydiphenoylarabinose
 48 51  0  0  0  0  0  0  0  0999 V2000
    0.7875    2.6842   -1.7571 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5006    2.0308   -0.6471 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5166    1.5014    0.0547 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5582    0.6658   -0.0109 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1670    0.1615    1.3012 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1078   -0.7895    0.9582 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7003   -0.6830   -0.2729 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6261   -1.7146   -0.3871 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6707   -0.9202   -1.4252 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0198   -0.0987   -2.4664 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3306   -0.5685   -0.8730 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2676   -0.3004   -1.7216 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0606   -1.0516   -1.6602 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3281   -1.5874   -2.7287 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7690   -1.2699   -0.4875 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7542   -2.6173   -0.0393 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3690   -3.0614    1.0929 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3099   -4.4147    1.4745 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0466   -2.1504    1.8491 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6964   -2.5186    3.0191 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0839   -0.8245    1.4339 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7844    0.0963    2.2453 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4647   -0.3559    0.2739 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7941    1.0469   -0.0775 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9481    2.0548   -0.4502 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5346    3.3165   -0.7197 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8603    3.6136   -0.6418 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3690    4.8745   -0.9186 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6955    2.5603   -0.2609 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0539    2.8452   -0.1768 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1955    1.3224    0.0117 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1120    0.3590    0.3681 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4673    1.1822   -0.4764 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3986   -0.2630    1.9642 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5953    1.0573    1.7940 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2507    0.2505   -0.4666 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4706   -2.4155    0.2697 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7658   -1.9959   -1.6673 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7988   -0.3746   -2.9743 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1046   -1.3736   -0.1228 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2604   -3.3959   -0.6314 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8047   -5.0343    0.8898 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6752   -3.4809    3.3298 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2248   -0.2365    3.0832 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8954    4.1652   -1.0296 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3366    5.0984   -0.8635 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7170    2.1833    0.0792 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0820    0.4265    0.4616 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  7  9  1  0
  9 10  1  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 17 19  2  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 21 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 29 31  2  0
 31 32  1  0
 25  2  1  0
 11  4  1  0
 23 15  1  0
 31 24  1  0
  4 33  1  0
  5 34  1  0
  5 35  1  0
  7 36  1  0
  8 37  1  0
  9 38  1  0
 10 39  1  0
 11 40  1  0
 16 41  1  0
 18 42  1  0
 20 43  1  0
 22 44  1  0
 26 45  1  0
 28 46  1  0
 30 47  1  0
 32 48  1  0
M  END


  Mrv0541 05061307352D          

 32 35  0  0  0  0            999 V2000
    2.5261   -0.2111    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4459    2.9071    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4444   -0.3671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2560    0.5684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7159    2.1275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3362   -0.3671    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9860    3.5307    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0957    0.2566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7961    1.1921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5261    1.9716    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8763    0.2566    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7961    3.3748    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6062    1.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0662    2.5952    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9845    1.1921    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1744    1.0361    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5693    0.2142    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2403    1.6714    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5246    0.5684    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6062   -1.1466    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7159    4.3103    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6864    0.1007    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3362    3.9984    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1463    1.6598    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8763    2.4393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2546    1.9716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5958   -0.6104    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5531    0.9080    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3347    0.7243    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2546   -0.2111    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.8174    0.5426    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3657    1.6598    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  4  1  2  0  0  0  0
  5  2  2  0  0  0  0
  6  1  1  0  0  0  0
  7  2  1  0  0  0  0
  8  3  1  0  0  0  0
  9  4  1  0  0  0  0
 10  5  1  0  0  0  0
 10  9  1  0  0  0  0
 11  6  2  0  0  0  0
 12  7  2  0  0  0  0
 13  9  2  0  0  0  0
 13 11  1  0  0  0  0
 14 10  2  0  0  0  0
 14 12  1  0  0  0  0
 16  8  1  0  0  0  0
 16 15  1  0  0  0  0
 17  4  1  0  0  0  0
 18  5  1  0  0  0  0
 19 15  1  0  0  0  0
 20  6  1  0  0  0  0
 21  7  1  0  0  0  0
 22 11  1  0  0  0  0
 23 12  1  0  0  0  0
 24 13  1  0  0  0  0
 25 14  1  0  0  0  0
 26 15  1  0  0  0  0
 27 17  2  0  0  0  0
 28 18  2  0  0  0  0
 29 19  1  0  0  0  0
 30  3  1  0  0  0  0
 30 19  1  0  0  0  0
 31  8  1  0  0  0  0
 31 17  1  0  0  0  0
 32 16  1  0  0  0  0
 32 18  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0034113

> <DATABASE_NAME>
hmdb

> <SMILES>
OC1OCC2OC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C1O

> <INCHI_IDENTIFIER>
InChI=1S/C19H16O13/c20-6-1-4-9(13(24)11(6)22)10-5(2-7(21)12(23)14(10)25)18(28)32-16-8(31-17(4)27)3-30-19(29)15(16)26/h1-2,8,15-16,19-26,29H,3H2

> <INCHI_KEY>
ZKBLUASIGJJVPP-UHFFFAOYSA-N

> <FORMULA>
C19H16O13

> <MOLECULAR_WEIGHT>
452.3225

> <EXACT_MASS>
452.059090598

> <JCHEM_ACCEPTOR_COUNT>
11

> <JCHEM_AVERAGE_POLARIZABILITY>
39.670922016508754

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
8

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
1

> <JCHEM_IUPAC>
3,4,5,13,14,20,21,22-octahydroxy-9,12,16-trioxatetracyclo[16.4.0.0²,⁷.0¹⁰,¹⁵]docosa-1(22),2,4,6,18,20-hexaene-8,17-dione

> <ALOGPS_LOGP>
0.70

> <JCHEM_LOGP>
0.14098303733333367

> <ALOGPS_LOGS>
-1.78

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
4

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
8.146180332007832

> <JCHEM_PKA_STRONGEST_ACIDIC>
7.5032202753509445

> <JCHEM_PKA_STRONGEST_BASIC>
-3.9593674933762815

> <JCHEM_POLAR_SURFACE_AREA>
223.66999999999996

> <JCHEM_REFRACTIVITY>
100.56849999999999

> <JCHEM_ROTATABLE_BOND_COUNT>
0

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
7.53e+00 g/l

> <JCHEM_TRADITIONAL_IUPAC>
3,4,5,13,14,20,21,22-octahydroxy-9,12,16-trioxatetracyclo[16.4.0.0²,⁷.0¹⁰,¹⁵]docosa-1(22),2,4,6,18,20-hexaene-8,17-dione

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0034113
     RDKit          3D
3,4-Hexahydroxydiphenoylarabinose
 48 51  0  0  0  0  0  0  0  0999 V2000
    0.7875    2.6842   -1.7571 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5006    2.0308   -0.6471 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5166    1.5014    0.0547 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5582    0.6658   -0.0109 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1670    0.1615    1.3012 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1078   -0.7895    0.9582 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7003   -0.6830   -0.2729 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6261   -1.7146   -0.3871 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6707   -0.9202   -1.4252 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0198   -0.0987   -2.4664 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3306   -0.5685   -0.8730 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2676   -0.3004   -1.7216 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0606   -1.0516   -1.6602 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3281   -1.5874   -2.7287 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7690   -1.2699   -0.4875 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7542   -2.6173   -0.0393 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3690   -3.0614    1.0929 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3099   -4.4147    1.4745 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0466   -2.1504    1.8491 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6964   -2.5186    3.0191 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0839   -0.8245    1.4339 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7844    0.0963    2.2453 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4647   -0.3559    0.2739 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7941    1.0469   -0.0775 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9481    2.0548   -0.4502 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5346    3.3165   -0.7197 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8603    3.6136   -0.6418 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3690    4.8745   -0.9186 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6955    2.5603   -0.2609 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0539    2.8452   -0.1768 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1955    1.3224    0.0117 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1120    0.3590    0.3681 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4673    1.1822   -0.4764 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3986   -0.2630    1.9642 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5953    1.0573    1.7940 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2507    0.2505   -0.4666 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4706   -2.4155    0.2697 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7658   -1.9959   -1.6673 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7988   -0.3746   -2.9743 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1046   -1.3736   -0.1228 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2604   -3.3959   -0.6314 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8047   -5.0343    0.8898 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6752   -3.4809    3.3298 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2248   -0.2365    3.0832 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8954    4.1652   -1.0296 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3366    5.0984   -0.8635 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7170    2.1833    0.0792 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0820    0.4265    0.4616 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  7  9  1  0
  9 10  1  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 17 19  2  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 21 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 29 31  2  0
 31 32  1  0
 25  2  1  0
 11  4  1  0
 23 15  1  0
 31 24  1  0
  4 33  1  0
  5 34  1  0
  5 35  1  0
  7 36  1  0
  8 37  1  0
  9 38  1  0
 10 39  1  0
 11 40  1  0
 16 41  1  0
 18 42  1  0
 20 43  1  0
 22 44  1  0
 26 45  1  0
 28 46  1  0
 30 47  1  0
 32 48  1  0
M  END

HEADER    PROTEIN                                 06-MAY-13   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   06-MAY-13         0                                  
HETATM    1  C   UNK     0       4.715  -0.394   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0       2.699   5.427   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0      -0.830  -0.685   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0       4.211   1.061   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0       3.203   3.971   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0       6.228  -0.685   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0       3.707   6.591   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0       0.179   0.479   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0       5.219   2.225   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       4.715   3.680   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       7.236   0.479   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       5.219   6.300   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       6.732   1.934   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0       5.724   4.844   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0      -1.838   2.225   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0      -0.326   1.934   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0       2.929   0.400   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0       2.315   3.120   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0      -2.846   1.061   0.000  0.00  0.00           C+0
HETATM   20  O   UNK     0       6.732  -2.140   0.000  0.00  0.00           O+0
HETATM   21  O   UNK     0       3.203   8.046   0.000  0.00  0.00           O+0
HETATM   22  O   UNK     0       8.748   0.188   0.000  0.00  0.00           O+0
HETATM   23  O   UNK     0       6.228   7.464   0.000  0.00  0.00           O+0
HETATM   24  O   UNK     0       7.740   3.098   0.000  0.00  0.00           O+0
HETATM   25  O   UNK     0       7.236   4.553   0.000  0.00  0.00           O+0
HETATM   26  O   UNK     0      -2.342   3.680   0.000  0.00  0.00           O+0
HETATM   27  O   UNK     0       2.979  -1.139   0.000  0.00  0.00           O+0
HETATM   28  O   UNK     0       2.899   1.695   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0      -4.358   1.352   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0      -2.342  -0.394   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0       1.526   1.013   0.000  0.00  0.00           O+0
HETATM   32  O   UNK     0       0.683   3.098   0.000  0.00  0.00           O+0
CONECT    1    4    6                                                       
CONECT    2    5    7                                                       
CONECT    3    8   30                                                       
CONECT    4    1    9   17                                                  
CONECT    5    2   10   18                                                  
CONECT    6    1   11   20                                                  
CONECT    7    2   12   21                                                  
CONECT    8    3   16   31                                                  
CONECT    9    4   10   13                                                  
CONECT   10    5    9   14                                                  
CONECT   11    6   13   22                                                  
CONECT   12    7   14   23                                                  
CONECT   13    9   11   24                                                  
CONECT   14   10   12   25                                                  
CONECT   15   16   19   26                                                  
CONECT   16    8   15   32                                                  
CONECT   17    4   27   31                                                  
CONECT   18    5   28   32                                                  
CONECT   19   15   29   30                                                  
CONECT   20    6                                                            
CONECT   21    7                                                            
CONECT   22   11                                                            
CONECT   23   12                                                            
CONECT   24   13                                                            
CONECT   25   14                                                            
CONECT   26   15                                                            
CONECT   27   17                                                            
CONECT   28   18                                                            
CONECT   29   19                                                            
CONECT   30    3   19                                                       
CONECT   31    8   17                                                       
CONECT   32   16   18                                                       
MASTER        0    0    0    0    0    0    0    0   32    0   70    0
END

COMPND    HMDB0034113
HETATM    1  O1  UNL     1       0.788   2.684  -1.757  1.00  0.00           O  
HETATM    2  C1  UNL     1       0.501   2.031  -0.647  1.00  0.00           C  
HETATM    3  O2  UNL     1       1.517   1.501   0.055  1.00  0.00           O  
HETATM    4  C2  UNL     1       2.558   0.666  -0.011  1.00  0.00           C  
HETATM    5  C3  UNL     1       3.167   0.161   1.301  1.00  0.00           C  
HETATM    6  O3  UNL     1       4.108  -0.789   0.958  1.00  0.00           O  
HETATM    7  C4  UNL     1       4.700  -0.683  -0.273  1.00  0.00           C  
HETATM    8  O4  UNL     1       5.626  -1.715  -0.387  1.00  0.00           O  
HETATM    9  C5  UNL     1       3.671  -0.920  -1.425  1.00  0.00           C  
HETATM   10  O5  UNL     1       4.020  -0.099  -2.466  1.00  0.00           O  
HETATM   11  C6  UNL     1       2.331  -0.569  -0.873  1.00  0.00           C  
HETATM   12  O6  UNL     1       1.268  -0.300  -1.722  1.00  0.00           O  
HETATM   13  C7  UNL     1       0.061  -1.052  -1.660  1.00  0.00           C  
HETATM   14  O7  UNL     1      -0.328  -1.587  -2.729  1.00  0.00           O  
HETATM   15  C8  UNL     1      -0.769  -1.270  -0.488  1.00  0.00           C  
HETATM   16  C9  UNL     1      -0.754  -2.617  -0.039  1.00  0.00           C  
HETATM   17  C10 UNL     1      -1.369  -3.061   1.093  1.00  0.00           C  
HETATM   18  O8  UNL     1      -1.310  -4.415   1.474  1.00  0.00           O  
HETATM   19  C11 UNL     1      -2.047  -2.150   1.849  1.00  0.00           C  
HETATM   20  O9  UNL     1      -2.696  -2.519   3.019  1.00  0.00           O  
HETATM   21  C12 UNL     1      -2.084  -0.824   1.434  1.00  0.00           C  
HETATM   22  O10 UNL     1      -2.784   0.096   2.245  1.00  0.00           O  
HETATM   23  C13 UNL     1      -1.465  -0.356   0.274  1.00  0.00           C  
HETATM   24  C14 UNL     1      -1.794   1.047  -0.077  1.00  0.00           C  
HETATM   25  C15 UNL     1      -0.948   2.055  -0.450  1.00  0.00           C  
HETATM   26  C16 UNL     1      -1.535   3.316  -0.720  1.00  0.00           C  
HETATM   27  C17 UNL     1      -2.860   3.614  -0.642  1.00  0.00           C  
HETATM   28  O11 UNL     1      -3.369   4.875  -0.919  1.00  0.00           O  
HETATM   29  C18 UNL     1      -3.695   2.560  -0.261  1.00  0.00           C  
HETATM   30  O12 UNL     1      -5.054   2.845  -0.177  1.00  0.00           O  
HETATM   31  C19 UNL     1      -3.195   1.322   0.012  1.00  0.00           C  
HETATM   32  O13 UNL     1      -4.112   0.359   0.368  1.00  0.00           O  
HETATM   33  H1  UNL     1       3.467   1.182  -0.476  1.00  0.00           H  
HETATM   34  H2  UNL     1       2.399  -0.263   1.964  1.00  0.00           H  
HETATM   35  H3  UNL     1       3.595   1.057   1.794  1.00  0.00           H  
HETATM   36  H4  UNL     1       5.251   0.250  -0.467  1.00  0.00           H  
HETATM   37  H5  UNL     1       5.471  -2.416   0.270  1.00  0.00           H  
HETATM   38  H6  UNL     1       3.766  -1.996  -1.667  1.00  0.00           H  
HETATM   39  H7  UNL     1       4.799  -0.375  -2.974  1.00  0.00           H  
HETATM   40  H8  UNL     1       2.105  -1.374  -0.123  1.00  0.00           H  
HETATM   41  H9  UNL     1      -0.260  -3.396  -0.631  1.00  0.00           H  
HETATM   42  H10 UNL     1      -0.805  -5.034   0.890  1.00  0.00           H  
HETATM   43  H11 UNL     1      -2.675  -3.481   3.330  1.00  0.00           H  
HETATM   44  H12 UNL     1      -3.225  -0.237   3.083  1.00  0.00           H  
HETATM   45  H13 UNL     1      -0.895   4.165  -1.030  1.00  0.00           H  
HETATM   46  H14 UNL     1      -4.337   5.098  -0.864  1.00  0.00           H  
HETATM   47  H15 UNL     1      -5.717   2.183   0.079  1.00  0.00           H  
HETATM   48  H16 UNL     1      -5.082   0.427   0.462  1.00  0.00           H  
CONECT    1    2    2
CONECT    2    3   25
CONECT    3    4
CONECT    4    5   11   33
CONECT    5    6   34   35
CONECT    6    7
CONECT    7    8    9   36
CONECT    8   37
CONECT    9   10   11   38
CONECT   10   39
CONECT   11   12   40
CONECT   12   13
CONECT   13   14   14   15
CONECT   15   16   16   23
CONECT   16   17   41
CONECT   17   18   19   19
CONECT   18   42
CONECT   19   20   21
CONECT   20   43
CONECT   21   22   23   23
CONECT   22   44
CONECT   23   24
CONECT   24   25   25   31
CONECT   25   26
CONECT   26   27   27   45
CONECT   27   28   29
CONECT   28   46
CONECT   29   30   31   31
CONECT   30   47
CONECT   31   32
CONECT   32   48
END

HMDB0034113
     RDKit          3D
3,4-Hexahydroxydiphenoylarabinose
 48 51  0  0  0  0  0  0  0  0999 V2000
    0.7875    2.6842   -1.7571 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5006    2.0308   -0.6471 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5166    1.5014    0.0547 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5582    0.6658   -0.0109 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1670    0.1615    1.3012 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1078   -0.7895    0.9582 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.7003   -0.6830   -0.2729 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6261   -1.7146   -0.3871 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6707   -0.9202   -1.4252 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.0198   -0.0987   -2.4664 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3306   -0.5685   -0.8730 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2676   -0.3004   -1.7216 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0606   -1.0516   -1.6602 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3281   -1.5874   -2.7287 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7690   -1.2699   -0.4875 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7542   -2.6173   -0.0393 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3690   -3.0614    1.0929 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3099   -4.4147    1.4745 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0466   -2.1504    1.8491 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6964   -2.5186    3.0191 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0839   -0.8245    1.4339 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7844    0.0963    2.2453 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4647   -0.3559    0.2739 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7941    1.0469   -0.0775 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9481    2.0548   -0.4502 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5346    3.3165   -0.7197 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8603    3.6136   -0.6418 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3690    4.8745   -0.9186 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6955    2.5603   -0.2609 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0539    2.8452   -0.1768 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1955    1.3224    0.0117 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1120    0.3590    0.3681 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4673    1.1822   -0.4764 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.3986   -0.2630    1.9642 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5953    1.0573    1.7940 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2507    0.2505   -0.4666 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.4706   -2.4155    0.2697 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7658   -1.9959   -1.6673 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7988   -0.3746   -2.9743 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1046   -1.3736   -0.1228 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2604   -3.3959   -0.6314 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8047   -5.0343    0.8898 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6752   -3.4809    3.3298 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2248   -0.2365    3.0832 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8954    4.1652   -1.0296 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3366    5.0984   -0.8635 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7170    2.1833    0.0792 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0820    0.4265    0.4616 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  7  9  1  0
  9 10  1  0
  9 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  2  0
 13 15  1  0
 15 16  2  0
 16 17  1  0
 17 18  1  0
 17 19  2  0
 19 20  1  0
 19 21  1  0
 21 22  1  0
 21 23  2  0
 23 24  1  0
 24 25  2  0
 25 26  1  0
 26 27  2  0
 27 28  1  0
 27 29  1  0
 29 30  1  0
 29 31  2  0
 31 32  1  0
 25  2  1  0
 11  4  1  0
 23 15  1  0
 31 24  1  0
  4 33  1  0
  5 34  1  0
  5 35  1  0
  7 36  1  0
  8 37  1  0
  9 38  1  0
 10 39  1  0
 11 40  1  0
 16 41  1  0
 18 42  1  0
 20 43  1  0
 22 44  1  0
 26 45  1  0
 28 46  1  0
 30 47  1  0
 32 48  1  0
M  END

View in JSmol View NMR Assignments View Stereo Labels

Synonyms

Value	Source
Arabinopyranose cyclic 3,4-(4,4',5,5',6,6'-hexahydroxydiphenate), 8ci	HMDB

Chemical Formula

C₁₉H₁₆O₁₃

Average Molecular Weight

452.3225

Monoisotopic Molecular Weight

452.059090598

IUPAC Name

3,4,5,13,14,20,21,22-octahydroxy-9,12,16-trioxatetracyclo[16.4.0.0²,⁷.0¹⁰,¹⁵]docosa-1(22),2,4,6,18,20-hexaene-8,17-dione

Traditional Name

3,4,5,13,14,20,21,22-octahydroxy-9,12,16-trioxatetracyclo[16.4.0.0²,⁷.0¹⁰,¹⁵]docosa-1(22),2,4,6,18,20-hexaene-8,17-dione

CAS Registry Number

19833-16-0

SMILES

OC1OCC2OC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C1O

InChI Identifier

InChI=1S/C19H16O13/c20-6-1-4-9(13(24)11(6)22)10-5(2-7(21)12(23)14(10)25)18(28)32-16-8(31-17(4)27)3-30-19(29)15(16)26/h1-2,8,15-16,19-26,29H,3H2

InChI Key

ZKBLUASIGJJVPP-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as hydrolyzable tannins. These are tannins with a structure characterized by either of the following models. In model 1, the structure contains galloyl units (in some cases, shikimic acid units) that are linked to diverse polyol carbohydrate-, catechin-, or triterpenoid units. In model 2, contains at least two galloyl units C-C coupled to each other, and do not contain a glycosidically linked catechin unit.

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Tannins

Sub Class

Hydrolyzable tannins

Direct Parent

Hydrolyzable tannins

Alternative Parents

Substituents

Hydrolyzable tannin
Gallic acid or derivatives
1-hydroxy-4-unsubstituted benzenoid
1-hydroxy-2-unsubstituted benzenoid
Dicarboxylic acid or derivatives
Monosaccharide
Oxane
Benzenoid
Secondary alcohol
Lactone
Hemiacetal
Carboxylic acid ester
Polyol
Carboxylic acid derivative
Organoheterocyclic compound
Oxacycle
Organooxygen compound
Organic oxide
Organic oxygen compound
Alcohol
Hydrocarbon derivative
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0034113)
Cytoplasm (HMDB: HMDB0034113)

Route of exposure

Enteral

Ingestion (HMDB: HMDB0034113)

Source

Exogenous

Food

Food (HMDB: HMDB0034113)

Fruit

Fruits (FooDB: FOOD00871)

Endogenous

Plant

Plant (HMDB: HMDB0034113)

Not Available

Nutrient (HMDB: HMDB0034113)

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	230 - 235 °C	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	7.53 g/L	ALOGPS
logP	0.7	ALOGPS
logP	0.14	ChemAxon
logS	-1.8	ALOGPS
pKa (Strongest Acidic)	7.5	ChemAxon
pKa (Strongest Basic)	-4	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	11	ChemAxon
Hydrogen Donor Count	8	ChemAxon
Polar Surface Area	223.67 Å²	ChemAxon
Rotatable Bond Count	0	ChemAxon
Refractivity	100.57 m³·mol⁻¹	ChemAxon
Polarizability	39.67 Å³	ChemAxon
Number of Rings	4	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	Yes	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DarkChem	[M+H]+	202.894	31661259
DarkChem	[M-H]-	197.511	31661259
DeepCCS	[M+H]+	196.177	30932474
DeepCCS	[M-H]-	193.782	30932474
DeepCCS	[M-2H]-	226.665	30932474
DeepCCS	[M+Na]+	202.137	30932474
AllCCS	[M+H]+	198.6	32859911
AllCCS	[M+H-H2O]+	196.2	32859911
AllCCS	[M+NH4]+	200.8	32859911
AllCCS	[M+Na]+	201.4	32859911
AllCCS	[M-H]-	194.4	32859911
AllCCS	[M+Na-2H]-	194.3	32859911
AllCCS	[M+HCOO]-	194.3	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
3,4-Hexahydroxydiphenoylarabinose	OC1OCC2OC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C1O	5262.2	Standard polar	33892256
3,4-Hexahydroxydiphenoylarabinose	OC1OCC2OC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C1O	3929.9	Standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose	OC1OCC2OC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(O)C(O)=C(O)C=C3C(=O)OC2C1O	4165.5	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
3,4-Hexahydroxydiphenoylarabinose,1TMS,isomer #1	C[Si](C)(C)OC1OCC2OC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(C=C(O)C(O)=C3O)C(=O)OC2C1O	4264.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,1TMS,isomer #2	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O)C1O)OC2=O	4228.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,1TMS,isomer #3	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O)C(O)C3OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O	4142.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,1TMS,isomer #4	C[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O)C1O)OC2=O	4189.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,1TMS,isomer #5	C[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O)C(O)C1OC2=O	4190.2	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,1TMS,isomer #6	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O)C3O)OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O	4143.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,1TMS,isomer #7	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O)C(O)C1OC2=O	4229.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,1TMS,isomer #8	C[Si](C)(C)OC1C(O)OCC2OC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(C=C(O)C(O)=C3O)C(=O)OC21	4271.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #1	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	4131.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #10	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O)=C1O)C(=O)OC1C(COC(O)C1O)OC2=O	4098.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #11	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O)C1O)OC2=O	4048.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #12	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O)OC2=O	4048.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #13	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	4119.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #14	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O)C(O)C3OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O[Si](C)(C)C	4034.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #15	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1COC(O)C(O)C1OC2=O	4048.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #16	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O)C(O)C3OC(=O)C3=C(C(O)=C(O[Si](C)(C)C)C(O)=C3)C2=C1O	4013.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #17	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O)C(O)C3OC(=O)C3=C(C(O[Si](C)(C)C)=C(O)C(O)=C3)C2=C1O	4029.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #18	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O)C(O[Si](C)(C)C)C3OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O	4058.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #19	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1COC(O)C(O)C1OC2=O	4048.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #2	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O[Si](C)(C)C)C(O)C3OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O	4058.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #20	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O)C3O)OC(=O)C3=C(C(O[Si](C)(C)C)=C(O)C(O)=C3)C2=C1O	4028.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #21	C[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O)OC2=O	4003.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #22	C[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	4095.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #23	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O)C3O)OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O[Si](C)(C)C	4034.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #24	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O)C(O)C1OC2=O	4094.2	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #25	C[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O)C(O[Si](C)(C)C)C1OC2=O	4094.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #26	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O)C(O)C1OC2=O	4070.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #27	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O)C3O[Si](C)(C)C)OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O	4059.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #28	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O)C(O[Si](C)(C)C)C1OC2=O	4119.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #3	C[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	4085.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #4	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O[Si](C)(C)C)C(O)C1OC2=O	4132.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #5	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O[Si](C)(C)C)C3O)OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O	4058.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #6	C[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O[Si](C)(C)C)C(O)C1OC2=O	4086.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #7	C[Si](C)(C)OC1OCC2OC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(C=C(O)C(O)=C3O)C(=O)OC2C1O[Si](C)(C)C	4171.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #8	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O)C1O)OC2=O	4092.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TMS,isomer #9	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O)C1O)OC2=O	4069.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #1	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	3987.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #10	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O[Si](C)(C)C)C(O)C3OC(=O)C3=C(C(O[Si](C)(C)C)=C(O)C(O)=C3)C2=C1O	3905.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #11	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C3OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O	4002.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #12	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1COC(O[Si](C)(C)C)C(O)C1OC2=O	3939.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #13	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O[Si](C)(C)C)C3O)OC(=O)C3=C(C(O[Si](C)(C)C)=C(O)C(O)=C3)C2=C1O	3905.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #14	C[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	3910.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #15	C[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C)C1O[Si](C)(C)C)OC2=O	4000.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #16	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O[Si](C)(C)C)C(O)C1OC2=O	3988.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #17	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O[Si](C)(C)C)C(O)C1OC2=O	3987.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #18	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC2=O	4035.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #19	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O[Si](C)(C)C)C3O)OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O[Si](C)(C)C	3942.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #2	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	3988.2	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #20	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O	4002.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #21	C[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC2=O	4000.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #22	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O)C1O)OC2=O	3991.2	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #23	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C)C(=O)OC1COC(O)C(O)C1OC2=O	3952.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #24	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O)C1O)OC2=O	3912.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #25	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O)OC2=O	3922.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #26	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	4003.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #27	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O)C(=O)OC1COC(O)C(O)C1OC2=O	3955.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #28	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O)C1O)OC2=O	3925.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #29	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O)OC2=O	3915.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #3	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	3972.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #30	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	3990.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #31	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O)C1O)OC2=O	3954.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #32	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O)OC2=O	3953.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #33	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O)=C1O)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	3971.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #34	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O)OC2=O	3918.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #35	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	3931.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #36	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	3948.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #37	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1COC(O)C(O)C1OC2=O	3918.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #38	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O)C3O)OC(=O)C3=C(C(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)=C3)C2=C1O	3872.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #39	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O)C(O)C3OC(=O)C3=C(C(O[Si](C)(C)C)=C(O)C(O)=C3)C2=C1O[Si](C)(C)C	3889.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #4	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	3949.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #40	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O)C(O[Si](C)(C)C)C3OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O[Si](C)(C)C	3965.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #41	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1COC(O)C(O)C1OC2=O	3913.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #42	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1COC(O)C(O)C1OC2=O	3925.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #43	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1COC(O)C(O[Si](C)(C)C)C1OC2=O	3932.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #44	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O)C(O)C3OC(=O)C3=C(C(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)=C3)C2=C1O	3871.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #45	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O)C(O[Si](C)(C)C)C3OC(=O)C3=C(C(O)=C(O[Si](C)(C)C)C(O)=C3)C2=C1O	3929.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #46	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O)C(O[Si](C)(C)C)C3OC(=O)C3=C(C(O[Si](C)(C)C)=C(O)C(O)=C3)C2=C1O	3906.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #47	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1COC(O)C(O)C1OC2=O	3923.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #48	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1COC(O)C(O)C1OC2=O	3915.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #49	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1COC(O)C(O[Si](C)(C)C)C1OC2=O	3949.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #5	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	3939.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #50	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O)C3O)OC(=O)C3=C(C(O[Si](C)(C)C)=C(O)C(O)=C3)C2=C1O[Si](C)(C)C	3889.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #51	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O)C3O[Si](C)(C)C)OC(=O)C3=C(C(O[Si](C)(C)C)=C(O)C(O)=C3)C2=C1O	3907.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #52	C[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	3926.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #53	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O)C(O)C1OC2=O	3991.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #54	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O)C3O[Si](C)(C)C)OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O[Si](C)(C)C	3965.2	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #55	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O)C(O[Si](C)(C)C)C1OC2=O	4005.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #56	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O)C(O[Si](C)(C)C)C1OC2=O	3990.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #6	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C)C1O[Si](C)(C)C)OC2=O	4033.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #7	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O[Si](C)(C)C)C(O)C3OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O[Si](C)(C)C	3942.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #8	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1COC(O[Si](C)(C)C)C(O)C1OC2=O	3949.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TMS,isomer #9	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O[Si](C)(C)C)C(O)C3OC(=O)C3=C(C(O)=C(O[Si](C)(C)C)C(O)=C3)C2=C1O	3970.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #1	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	3921.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #10	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	3875.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #11	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	3870.2	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #12	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C)C1O[Si](C)(C)C)OC2=O	3911.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #13	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	3849.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #14	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C)C1O[Si](C)(C)C)OC2=O	3878.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #15	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C)C1O[Si](C)(C)C)OC2=O	3877.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #16	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1COC(O[Si](C)(C)C)C(O)C1OC2=O	3850.2	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #17	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O[Si](C)(C)C)C3O)OC(=O)C3=C(C(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)=C3)C2=C1O	3870.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #18	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O[Si](C)(C)C)C(O)C3OC(=O)C3=C(C(O[Si](C)(C)C)=C(O)C(O)=C3)C2=C1O[Si](C)(C)C	3815.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #19	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C3OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O[Si](C)(C)C	3902.2	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #2	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C)C(=O)OC1COC(O[Si](C)(C)C)C(O)C1OC2=O	3870.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #20	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1COC(O[Si](C)(C)C)C(O)C1OC2=O	3896.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #21	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1COC(O[Si](C)(C)C)C(O)C1OC2=O	3893.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #22	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC2=O	3879.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #23	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O[Si](C)(C)C)C(O)C3OC(=O)C3=C(C(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)=C3)C2=C1O	3871.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #24	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C3OC(=O)C3=C(C(O)=C(O[Si](C)(C)C)C(O)=C3)C2=C1O	3884.2	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #25	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C3OC(=O)C3=C(C(O[Si](C)(C)C)=C(O)C(O)=C3)C2=C1O	3846.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #26	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1COC(O[Si](C)(C)C)C(O)C1OC2=O	3830.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #27	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1COC(O[Si](C)(C)C)C(O)C1OC2=O	3848.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #28	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC2=O	3877.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #29	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O[Si](C)(C)C)C3O)OC(=O)C3=C(C(O[Si](C)(C)C)=C(O)C(O)=C3)C2=C1O[Si](C)(C)C	3815.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #3	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	3895.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #30	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(=O)C3=C(C(O[Si](C)(C)C)=C(O)C(O)=C3)C2=C1O	3846.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #31	C[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C)C1O[Si](C)(C)C)OC2=O	3851.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #32	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O[Si](C)(C)C)C(O)C1OC2=O	3922.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #33	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC2=O	3936.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #34	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC2=O	3932.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #35	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O[Si](C)(C)C	3902.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #36	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1COC(O)C(O)C1OC2=O	3874.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #37	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O)C1O)OC2=O	3845.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #38	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O)OC2=O	3842.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #39	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	3949.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #4	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	3830.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #40	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O)OC2=O	3842.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #41	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O)C1O)OC2=O	3859.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #42	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C)C(=O)OC1COC(O)C(O[Si](C)(C)C)C1OC2=O	3863.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #43	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O)OC2=O	3824.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #44	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	3862.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #45	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	3834.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #46	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O)C(=O)OC1COC(O)C(O)C1OC2=O	3860.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #47	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O)C1O)OC2=O	3868.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #48	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O)C(=O)OC1COC(O)C(O[Si](C)(C)C)C1OC2=O	3877.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #49	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O)OC2=O	3842.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #5	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C)C1O[Si](C)(C)C)OC2=O	3935.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #50	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	3869.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #51	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	3855.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #52	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O)OC2=O	3875.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #53	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	3877.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #54	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	3863.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #55	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	3853.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #56	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1COC(O)C(O)C1OC2=O	3824.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #57	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1COC(O)C(O)C1OC2=O	3842.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #58	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1COC(O)C(O[Si](C)(C)C)C1OC2=O	3853.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #59	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O)C(O)C3OC(=O)C3=C(C(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)=C3)C2=C1O[Si](C)(C)C	3812.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #6	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O)C(=O)OC1COC(O[Si](C)(C)C)C(O)C1OC2=O	3876.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #60	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O)C3O[Si](C)(C)C)OC(=O)C3=C(C(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)=C3)C2=C1O	3848.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #61	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O)C(O[Si](C)(C)C)C3OC(=O)C3=C(C(O[Si](C)(C)C)=C(O)C(O)=C3)C2=C1O[Si](C)(C)C	3828.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #62	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1COC(O)C(O)C1OC2=O	3846.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #63	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1COC(O)C(O[Si](C)(C)C)C1OC2=O	3864.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #64	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1COC(O)C(O[Si](C)(C)C)C1OC2=O	3870.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #65	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O)C(O[Si](C)(C)C)C3OC(=O)C3=C(C(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)=C3)C2=C1O	3849.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #66	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1COC(O)C(O)C1OC2=O	3843.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #67	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1COC(O)C(O[Si](C)(C)C)C1OC2=O	3835.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #68	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1COC(O)C(O[Si](C)(C)C)C1OC2=O	3856.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #69	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O)C3O[Si](C)(C)C)OC(=O)C3=C(C(O[Si](C)(C)C)=C(O)C(O)=C3)C2=C1O[Si](C)(C)C	3828.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #7	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	3893.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #70	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O)C(O[Si](C)(C)C)C1OC2=O	3950.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #8	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	3847.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,4TMS,isomer #9	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C)C1O[Si](C)(C)C)OC2=O	3931.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #1	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1COC(O[Si](C)(C)C)C(O)C1OC2=O	3858.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #10	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C)C1O[Si](C)(C)C)OC2=O	3813.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #11	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O)C(=O)OC1COC(O[Si](C)(C)C)C(O)C1OC2=O	3873.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #12	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	3887.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #13	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O)C(=O)OC1COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC2=O	3867.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #14	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	3865.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #15	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C)C1O[Si](C)(C)C)OC2=O	3881.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #16	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C)C1O[Si](C)(C)C)OC2=O	3847.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #17	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	3859.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #18	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C)C1O[Si](C)(C)C)OC2=O	3867.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #19	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C)C1O[Si](C)(C)C)OC2=O	3838.2	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #2	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	3877.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #20	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C)C1O[Si](C)(C)C)OC2=O	3842.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #21	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1COC(O[Si](C)(C)C)C(O)C1OC2=O	3848.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #22	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1COC(O[Si](C)(C)C)C(O)C1OC2=O	3864.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #23	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC2=O	3842.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #24	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O[Si](C)(C)C)C(O)C3OC(=O)C3=C(C(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)=C3)C2=C1O[Si](C)(C)C	3847.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #25	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(=O)C3=C(C(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)=C3)C2=C1O	3851.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #26	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C3OC(=O)C3=C(C(O[Si](C)(C)C)=C(O)C(O)=C3)C2=C1O[Si](C)(C)C	3822.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #27	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1COC(O[Si](C)(C)C)C(O)C1OC2=O	3878.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #28	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC2=O	3865.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #29	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC2=O	3882.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #3	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	3831.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #30	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C3OC(=O)C3=C(C(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)=C3)C2=C1O	3853.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #31	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1COC(O[Si](C)(C)C)C(O)C1OC2=O	3830.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #32	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC2=O	3814.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #33	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC2=O	3848.2	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #34	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O[Si](C)(C)C)C3O[Si](C)(C)C)OC(=O)C3=C(C(O[Si](C)(C)C)=C(O)C(O)=C3)C2=C1O[Si](C)(C)C	3823.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #35	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC2=O	3918.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #36	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1COC(O)C(O)C1OC2=O	3831.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #37	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1COC(O)C(O)C1OC2=O	3861.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #38	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1COC(O)C(O[Si](C)(C)C)C1OC2=O	3870.2	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #39	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O)OC2=O	3833.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #4	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C)C1O[Si](C)(C)C)OC2=O	3917.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #40	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	3866.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #41	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	3845.2	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #42	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O)OC2=O	3831.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #43	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	3832.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #44	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	3855.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #45	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	3835.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #46	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O)OC2=O	3861.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #47	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O)C(=O)OC1COC(O)C(O[Si](C)(C)C)C1OC2=O	3856.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #48	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	3879.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #49	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	3858.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #5	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	3857.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #50	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	3871.2	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #51	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1COC(O)C(O)C1OC2=O	3832.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #52	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1COC(O)C(O[Si](C)(C)C)C1OC2=O	3836.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #53	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1COC(O)C(O[Si](C)(C)C)C1OC2=O	3858.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #54	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O)C(O[Si](C)(C)C)C3OC(=O)C3=C(C(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)=C3)C2=C1O[Si](C)(C)C	3839.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #55	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1COC(O)C(O[Si](C)(C)C)C1OC2=O	3867.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #56	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1COC(O)C(O[Si](C)(C)C)C1OC2=O	3846.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #6	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	3873.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #7	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C)C(=O)OC1COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC2=O	3838.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #8	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	3850.2	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,5TMS,isomer #9	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C)C1O[Si](C)(C)C)OC2=O	3865.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #1	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1COC(O[Si](C)(C)C)C(O)C1OC2=O	3835.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #10	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C)C1O[Si](C)(C)C)OC2=O	3830.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #11	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	3850.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #12	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O)C(=O)OC1COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC2=O	3854.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #13	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C)C1O[Si](C)(C)C)OC2=O	3860.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #14	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C)C1O[Si](C)(C)C)OC2=O	3842.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #15	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C)C1O[Si](C)(C)C)OC2=O	3859.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #16	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1COC(O[Si](C)(C)C)C(O)C1OC2=O	3828.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #17	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC2=O	3830.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #18	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC2=O	3842.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #19	C[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C3OC(=O)C3=C(C(O[Si](C)(C)C)=C(O[Si](C)(C)C)C(O)=C3)C2=C1O[Si](C)(C)C	3826.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #2	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1COC(O[Si](C)(C)C)C(O)C1OC2=O	3852.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #20	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC2=O	3852.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #21	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC2=O	3842.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #22	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O)OC2=O	3848.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #23	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1COC(O)C(O[Si](C)(C)C)C1OC2=O	3847.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #24	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1COC(O)C(O[Si](C)(C)C)C1OC2=O	3864.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #25	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	3844.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #26	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	3847.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #27	C[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O)C1O[Si](C)(C)C)OC2=O	3865.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #28	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1COC(O)C(O[Si](C)(C)C)C1OC2=O	3844.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #3	C[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1COC(O[Si](C)(C)C)C(O[Si](C)(C)C)C1OC2=O	3857.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #4	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	3831.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #5	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C)C1O[Si](C)(C)C)OC2=O	3850.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #6	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C)C1O[Si](C)(C)C)OC2=O	3841.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #7	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C)C1O)OC2=O	3834.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #8	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C)C1O[Si](C)(C)C)OC2=O	3832.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,6TMS,isomer #9	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1O)C1=C(C=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C)C1O[Si](C)(C)C)OC2=O	3853.2	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC1OCC2OC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(C=C(O)C(O)=C3O)C(=O)OC2C1O	4541.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O)C1O)OC2=O	4478.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O)C(O)C3OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O	4407.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O)C1O)OC2=O	4466.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O)C(O)C1OC2=O	4467.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O)C3O)OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O	4408.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O)C(O)C1OC2=O	4478.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,1TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1C(O)OCC2OC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(C=C(O)C(O)=C3O)C(=O)OC21	4530.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C(C)(C)C)C1O)OC2=O	4596.2	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C(C)(C)C)C(O)=C1O)C(=O)OC1C(COC(O)C1O)OC2=O	4522.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C(C)(C)C)=C1O)C(=O)OC1C(COC(O)C1O)OC2=O	4466.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C(C)(C)C)C(=O)OC1C(COC(O)C1O)OC2=O	4504.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O)C1O[Si](C)(C)C(C)(C)C)OC2=O	4586.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O)C(O)C3OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O[Si](C)(C)C(C)(C)C	4493.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C(C)(C)C)=C1O)C(=O)OC1COC(O)C(O)C1OC2=O	4466.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O)C(O)C3OC(=O)C3=C(C(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)C2=C1O	4460.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O)C(O)C3OC(=O)C3=C(C(O[Si](C)(C)C(C)(C)C)=C(O)C(O)=C3)C2=C1O	4449.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O)C(O[Si](C)(C)C(C)(C)C)C3OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O	4503.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C(C)(C)C)C(=O)OC1COC(O)C(O)C1OC2=O	4504.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O[Si](C)(C)C(C)(C)C)C(O)C3OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O	4521.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O)C3O)OC(=O)C3=C(C(O[Si](C)(C)C(C)(C)C)=C(O)C(O)=C3)C2=C1O	4449.2	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1=C(C=C(O)C(O)=C1O[Si](C)(C)C(C)(C)C)C(=O)OC1C(COC(O)C1O)OC2=O	4484.2	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O)C1O[Si](C)(C)C(C)(C)C)OC2=O	4570.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O)C3O)OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O[Si](C)(C)C(C)(C)C	4493.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C(C)(C)C)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O)C(O)C1OC2=O	4543.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O)C(O[Si](C)(C)C(C)(C)C)C1OC2=O	4570.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C(C)(C)C)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O)C(O)C1OC2=O	4485.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O)C3O[Si](C)(C)C(C)(C)C)OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O	4503.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O)C(O[Si](C)(C)C(C)(C)C)C1OC2=O	4587.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C(C)(C)C)C1O)OC2=O	4584.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O[Si](C)(C)C(C)(C)C)C(O)C1OC2=O	4596.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O[Si](C)(C)C(C)(C)C)C3O)OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O	4521.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O[Si](C)(C)C(C)(C)C)C(O)C1OC2=O	4584.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1OCC2OC(=O)C3=CC(O)=C(O)C(O)=C3C3=C(C=C(O)C(O)=C3O)C(=O)OC2C1O[Si](C)(C)C(C)(C)C	4707.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C(C)(C)C)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O)C1O)OC2=O	4542.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C(C)(C)C)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O)C1O)OC2=O	4484.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C(C)(C)C)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C(C)(C)C)C1O)OC2=O	4631.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O[Si](C)(C)C(C)(C)C)C(O)C3OC(=O)C3=C(C(O[Si](C)(C)C(C)(C)C)=C(O)C(O)=C3)C2=C1O	4583.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C3OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O	4628.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C(C)(C)C)C(=O)OC1COC(O[Si](C)(C)C(C)(C)C)C(O)C1OC2=O	4594.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O[Si](C)(C)C(C)(C)C)C3O)OC(=O)C3=C(C(O[Si](C)(C)C(C)(C)C)=C(O)C(O)=C3)C2=C1O	4583.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1=C(C=C(O)C(O)=C1O[Si](C)(C)C(C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C(C)(C)C)C1O)OC2=O	4573.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C)OC2=O	4666.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C(C)(C)C)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O[Si](C)(C)C(C)(C)C)C(O)C1OC2=O	4631.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C(C)(C)C)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O[Si](C)(C)C(C)(C)C)C(O)C1OC2=O	4606.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC2=O	4691.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O[Si](C)(C)C(C)(C)C)C3O)OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O[Si](C)(C)C(C)(C)C	4594.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C(C)(C)C)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C(C)(C)C)C1O)OC2=O	4606.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O[Si](C)(C)C(C)(C)C)C3O[Si](C)(C)C(C)(C)C)OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O	4628.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)C1OC2=O	4665.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O)C1O)OC2=O	4601.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C(C)(C)C)C(O)=C1O[Si](C)(C)C(C)(C)C)C(=O)OC1COC(O)C(O)C1OC2=O	4613.2	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C(C)(C)C)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C(C)(C)C)=C1O)C(=O)OC1C(COC(O)C1O)OC2=O	4625.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C(C)(C)C)=C1O)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C(C)(C)C)C(=O)OC1C(COC(O)C1O)OC2=O	4574.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C(C)(C)C)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O)C1O[Si](C)(C)C(C)(C)C)OC2=O	4627.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C1O)C(=O)OC1COC(O)C(O)C1OC2=O	4589.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C(C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C(C)(C)C)=C1O)C(=O)OC1C(COC(O)C1O)OC2=O	4609.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C(C)(C)C)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C(C)(C)C)C(=O)OC1C(COC(O)C1O)OC2=O	4565.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C(C)(C)C)C(O)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C(C)(C)C)C1O)OC2=O	4623.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C(C)(C)C)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O)C1O[Si](C)(C)C(C)(C)C)OC2=O	4598.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C1O)C(=O)OC1C(COC(O)C1O)OC2=O	4589.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C(C)(C)C)C(O)=C1O[Si](C)(C)C(C)(C)C)C(=O)OC1C(COC(O)C1O)OC2=O	4613.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O[Si](C)(C)C(C)(C)C)C(O)=C1O)C(=O)OC1C(COC(O)C1O[Si](C)(C)C(C)(C)C)OC2=O	4616.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C)C(=O)OC1C(COC(O)C1O)OC2=O	4582.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C(C)(C)C)=C1O)C(=O)OC1C(COC(O)C1O[Si](C)(C)C(C)(C)C)OC2=O	4588.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C(C)(C)C)C(=O)OC1C(COC(O)C1O[Si](C)(C)C(C)(C)C)OC2=O	4587.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #37	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C)C(=O)OC1COC(O)C(O)C1OC2=O	4582.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #38	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O)C3O)OC(=O)C3=C(C(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)C2=C1O	4598.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #39	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O)C(O)C3OC(=O)C3=C(C(O[Si](C)(C)C(C)(C)C)=C(O)C(O)=C3)C2=C1O[Si](C)(C)C(C)(C)C	4556.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C(C)(C)C)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C(C)(C)C)C1O)OC2=O	4605.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #40	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O)C(O[Si](C)(C)C(C)(C)C)C3OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O[Si](C)(C)C(C)(C)C	4587.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #41	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C(C)(C)C)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C(C)(C)C)=C1O)C(=O)OC1COC(O)C(O)C1OC2=O	4626.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #42	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C(C)(C)C)C1=C(C=C(O)C(O[Si](C)(C)C(C)(C)C)=C1O)C(=O)OC1COC(O)C(O)C1OC2=O	4609.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #43	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C(C)(C)C)=C1O)C(=O)OC1COC(O)C(O[Si](C)(C)C(C)(C)C)C1OC2=O	4589.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #44	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O)C(O)C3OC(=O)C3=C(C(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)C2=C1O	4598.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #45	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O)C(O[Si](C)(C)C(C)(C)C)C3OC(=O)C3=C(C(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)C2=C1O	4621.8	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #46	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O)C(O[Si](C)(C)C(C)(C)C)C3OC(=O)C3=C(C(O[Si](C)(C)C(C)(C)C)=C(O)C(O)=C3)C2=C1O	4565.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #47	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C(C)(C)C)=C1O)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C(C)(C)C)C(=O)OC1COC(O)C(O)C1OC2=O	4575.0	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #48	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C(C)(C)C)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C(C)(C)C)C(=O)OC1COC(O)C(O)C1OC2=O	4566.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #49	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C(C)(C)C)C(=O)OC1COC(O)C(O[Si](C)(C)C(C)(C)C)C1OC2=O	4588.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O[Si](C)(C)C(C)(C)C)C(=O)OC1C(COC(O[Si](C)(C)C(C)(C)C)C1O)OC2=O	4594.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #50	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O)C3O)OC(=O)C3=C(C(O[Si](C)(C)C(C)(C)C)=C(O)C(O)=C3)C2=C1O[Si](C)(C)C(C)(C)C	4555.9	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #51	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O)C3O[Si](C)(C)C(C)(C)C)OC(=O)C3=C(C(O[Si](C)(C)C(C)(C)C)=C(O)C(O)=C3)C2=C1O	4565.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #52	CC(C)(C)[Si](C)(C)OC1=C(O)C(O)=CC2=C1C1=C(C=C(O)C(O)=C1O[Si](C)(C)C(C)(C)C)C(=O)OC1C(COC(O)C1O[Si](C)(C)C(C)(C)C)OC2=O	4567.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #53	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O)C(O)C1OC2=O	4601.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #54	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3C(COC(O)C3O[Si](C)(C)C(C)(C)C)OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O[Si](C)(C)C(C)(C)C	4586.4	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #55	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C(C)(C)C)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O)C(O[Si](C)(C)C(C)(C)C)C1OC2=O	4627.5	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #56	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O[Si](C)(C)C(C)(C)C)C1=C(C=C(O)C(O)=C1O)C(=O)OC1COC(O)C(O[Si](C)(C)C(C)(C)C)C1OC2=O	4598.3	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O)=C1O)C(=O)OC1C(COC(O[Si](C)(C)C(C)(C)C)C1O[Si](C)(C)C(C)(C)C)OC2=O	4691.6	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O[Si](C)(C)C(C)(C)C)C(O)C3OC(=O)C3=C(C(O)=C(O)C(O)=C3)C2=C1O[Si](C)(C)C(C)(C)C	4594.7	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O)=C1O)C1=C(C=C(O)C(O[Si](C)(C)C(C)(C)C)=C1O)C(=O)OC1COC(O[Si](C)(C)C(C)(C)C)C(O)C1OC2=O	4606.1	Semi standard non polar	33892256
3,4-Hexahydroxydiphenoylarabinose,3TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1=C(O)C=C2C(=O)OC3COC(O[Si](C)(C)C(C)(C)C)C(O)C3OC(=O)C3=C(C(O)=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)C2=C1O	4642.4	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - 3,4-Hexahydroxydiphenoylarabinose GC-MS (Non-derivatized) - 70eV, Positive	splash10-00di-4006900000-1e6da7d53fb0457a230a	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 3,4-Hexahydroxydiphenoylarabinose GC-MS (3 TMS) - 70eV, Positive	splash10-0fmr-5000092000-9f28f0bf94c56863790c	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - 3,4-Hexahydroxydiphenoylarabinose GC-MS (Non-derivatized) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 3,4-Hexahydroxydiphenoylarabinose 10V, Positive-QTOF	splash10-0udi-0103900000-ad5dd11ddabec600f7a1	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 3,4-Hexahydroxydiphenoylarabinose 20V, Positive-QTOF	splash10-0fe1-0142900000-78a365f4a584db4b8239	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 3,4-Hexahydroxydiphenoylarabinose 40V, Positive-QTOF	splash10-000b-1491000000-0ede9c18ce531a7ea7c0	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 3,4-Hexahydroxydiphenoylarabinose 10V, Negative-QTOF	splash10-0udi-0002900000-647c9d4216e9804a9fd6	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 3,4-Hexahydroxydiphenoylarabinose 20V, Negative-QTOF	splash10-0kai-2403900000-d2066be530a74cee9427	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 3,4-Hexahydroxydiphenoylarabinose 40V, Negative-QTOF	splash10-01dj-3894100000-9f111c1c857a53b2cef9	2016-08-03	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 3,4-Hexahydroxydiphenoylarabinose 10V, Negative-QTOF	splash10-0udi-0000900000-22a879aab2933ab32501	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 3,4-Hexahydroxydiphenoylarabinose 20V, Negative-QTOF	splash10-0a4l-2005900000-c65fb4ada9a3d148ec51	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 3,4-Hexahydroxydiphenoylarabinose 40V, Negative-QTOF	splash10-0006-3009200000-76282cd37a6a873c68dd	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 3,4-Hexahydroxydiphenoylarabinose 10V, Positive-QTOF	splash10-0udi-0000900000-66da1e01c800966b9fa0	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 3,4-Hexahydroxydiphenoylarabinose 20V, Positive-QTOF	splash10-0udi-0001900000-7de62c5b9e4194bba55d	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - 3,4-Hexahydroxydiphenoylarabinose 40V, Positive-QTOF	splash10-0a6r-4009400000-ea01872d9861c5150b7e	2021-09-25	Wishart Lab	View Spectrum

NMR Spectra

Spectrum Type	Description	Deposition Date	Source	View
Predicted 1D NMR	¹H NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 100 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 1000 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 200 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 300 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 400 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 500 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 600 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 700 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 800 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹H NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum
Predicted 1D NMR	¹³C NMR Spectrum (1D, 900 MHz, D₂O, predicted)	2021-09-25	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Cytoplasm
Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB012380

KNApSAcK ID

Not Available

Chemspider ID

Not Available

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

131751527

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for 3,4-Hexahydroxydiphenoylarabinose (HMDB0034113)

MOL for HMDB0034113 (3,4-Hexahydroxydiphenoylarabinose)

3D MOL for HMDB0034113 (3,4-Hexahydroxydiphenoylarabinose)

3D SDF for HMDB0034113 (3,4-Hexahydroxydiphenoylarabinose)

3D-SDF for HMDB0034113 (3,4-Hexahydroxydiphenoylarabinose)

PDB for HMDB0034113 (3,4-Hexahydroxydiphenoylarabinose)

3D PDB for HMDB0034113 (3,4-Hexahydroxydiphenoylarabinose)

SMILES for HMDB0034113 (3,4-Hexahydroxydiphenoylarabinose)

INCHI for HMDB0034113 (3,4-Hexahydroxydiphenoylarabinose)

Structure for HMDB0034113 (3,4-Hexahydroxydiphenoylarabinose)

3D Structure for HMDB0034113 (3,4-Hexahydroxydiphenoylarabinose)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

NMR Spectra