Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 19:14:34 UTC

Update Date

2022-03-07 02:54:05 UTC

HMDB ID

HMDB0034403

Secondary Accession Numbers

HMDB34403

Metabolite Identification

Common Name

Barogenin

Description

Barogenin belongs to the class of organic compounds known as dihydroxy bile acids, alcohols and derivatives. Dihydroxy bile acids, alcohols and derivatives are compounds containing or derived from a bile acid or alcohol, and which bears exactly two carboxylic acid groups. Based on a literature review a small amount of articles have been published on Barogenin.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI

  Mrv0541 02241209202D          

 31 34  0  0  0  0            999 V2000
    0.1324   -3.2114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5799   -3.6232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2948   -3.2100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0030   -3.6190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7221   -3.2046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7221   -2.3728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0016   -1.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2948   -2.3811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2948   -1.5576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3333    0.4639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9152   -0.1193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6447   -0.9098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1251   -1.5823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6365   -2.2425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8516   -1.9762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1324   -2.3906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5758   -1.9666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5758   -1.1514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1448   -0.7342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8516   -1.1597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9517   -0.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4289    2.4182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6371    2.2439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3764    1.4355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9582    0.8537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6961    0.0468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2794   -0.5352    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0551    2.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3063    3.6232    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9485   -1.5823    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4289   -3.6121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  1 16  1  0  0  0  0
  2  3  2  0  0  0  0
  3  4  1  0  0  0  0
  3  8  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  1  0  0  0  0
  5 31  1  0  0  0  0
  6  7  1  0  0  0  0
  7  8  1  0  0  0  0
  8  9  1  0  0  0  0
  8 17  1  0  0  0  0
 10 11  1  0  0  0  0
 11 12  1  0  0  0  0
 11 26  1  0  0  0  0
 12 13  1  0  0  0  0
 12 20  1  0  0  0  0
 13 14  1  0  0  0  0
 13 30  2  0  0  0  0
 14 15  1  0  0  0  0
 15 16  1  0  0  0  0
 15 20  1  0  0  0  0
 16 17  1  0  0  0  0
 17 18  1  0  0  0  0
 18 19  1  0  0  0  0
 19 20  1  0  0  0  0
 20 21  1  0  0  0  0
 22 23  1  0  0  0  0
 23 24  1  0  0  0  0
 23 28  1  0  0  0  0
 24 25  1  0  0  0  0
 25 26  1  0  0  0  0
 26 27  2  0  0  0  0
 28 29  1  0  0  0  0
M  END

HMDB0034403
     RDKit          3D
Barogenin
 73 76  0  0  0  0  0  0  0  0999 V2000
   -7.2069    0.1689   -2.3181 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2327   -0.6396   -1.0391 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9246    0.2112    0.0038 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2123    0.4826   -0.4572 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8687   -1.0767   -0.6074 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9437    0.0952   -0.3518 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5937   -0.3578    0.0748 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4158   -1.5586    0.1728 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4843    0.5898    0.3768 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8741    1.4739    1.5077 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2419   -0.1760    0.5152 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2307   -1.1929    1.5880 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0165   -1.5683    2.4035 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1656   -1.7612    1.4491 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9269   -0.4230    1.3688 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3262   -0.5792    0.9752 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7288   -2.0655    0.9488 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1744   -2.1200    0.5915 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8437   -1.1403    0.0356 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2790   -1.3405   -0.2623 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9185   -0.0359   -0.6029 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2205   -0.3274   -1.0721 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2302    0.7404   -1.6726 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7445    0.6596   -1.6581 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2391    0.1867   -0.3219 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5781    1.1819    0.7391 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7455   -0.0138   -0.3349 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9778    1.1988   -0.7564 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5392    0.8137   -0.7970 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0593    0.5183    0.6038 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0400    1.8607    1.3174 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6371   -0.3894   -3.0852 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2549    0.2242   -2.6902 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8478    1.1944   -2.1683 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8793   -1.5070   -1.2233 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4025    1.1891    0.0465 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9947   -0.2661    0.9806 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.8213   -0.1927   -0.0485 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9846   -1.6642    0.3259 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4468   -1.7547   -1.3637 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8224    0.6248   -1.3111 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4548    0.7152    0.4112 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3933    1.2357   -0.5277 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9949    1.5739    1.4961 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6641    1.0420    2.5089 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5260    2.5223    1.3931 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1875   -0.8123   -0.4311 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1800   -2.2810    0.4886 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4606   -2.3477    2.3159 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8963   -0.0829    2.4504 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0307   -0.1428    1.7483 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1897   -2.5844    0.1137 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5683   -2.5385    1.9158 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6876   -3.0561    0.8209 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7629   -1.7236    0.6620 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.4315   -2.1217   -1.0353 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0810    0.5342    0.3414 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.8785   -0.3250   -0.3314 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5782    0.3200   -2.6614 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6155    1.7859   -1.6540 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3517    1.7054   -1.7899 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3396    0.0642   -2.4922 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0626    0.7074    1.6278 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2061    2.0312    0.3403 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6723    1.7020    1.1619 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5489   -0.8051   -1.1171 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2846    1.4145   -1.8188 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2079    2.1103   -0.1975 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4470   -0.1214   -1.3755 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1122    1.6177   -1.1957 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1339    2.0723    1.5311 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4217    1.8353    2.3024 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2609    2.6898    0.6544 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  2  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
  9 11  1  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 30 11  1  0
 30 15  1  0
 27 16  1  0
 25 19  1  0
  1 32  1  0
  1 33  1  0
  1 34  1  0
  2 35  1  0
  3 36  1  0
  3 37  1  0
  4 38  1  0
  5 39  1  0
  5 40  1  0
  6 41  1  0
  6 42  1  0
  9 43  1  0
 10 44  1  0
 10 45  1  0
 10 46  1  0
 11 47  1  0
 14 48  1  0
 14 49  1  0
 15 50  1  0
 16 51  1  0
 17 52  1  0
 17 53  1  0
 18 54  1  0
 20 55  1  0
 20 56  1  0
 21 57  1  0
 22 58  1  0
 23 59  1  0
 23 60  1  0
 24 61  1  0
 24 62  1  0
 26 63  1  0
 26 64  1  0
 26 65  1  0
 27 66  1  0
 28 67  1  0
 28 68  1  0
 29 69  1  0
 29 70  1  0
 31 71  1  0
 31 72  1  0
 31 73  1  0
M  END

  Mrv0541 02241209202D          

 31 34  0  0  0  0            999 V2000
    0.1324   -3.2114    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5799   -3.6232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2948   -3.2100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0030   -3.6190    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7221   -3.2046    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7221   -2.3728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0016   -1.9556    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2948   -2.3811    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2948   -1.5576    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3333    0.4639    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9152   -0.1193    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6447   -0.9098    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1251   -1.5823    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6365   -2.2425    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8516   -1.9762    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1324   -2.3906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5758   -1.9666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5758   -1.1514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1448   -0.7342    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8516   -1.1597    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9517   -0.3417    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4289    2.4182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6371    2.2439    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3764    1.4355    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9582    0.8537    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6961    0.0468    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2794   -0.5352    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0551    2.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3063    3.6232    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9485   -1.5823    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4289   -3.6121    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  1 16  1  0  0  0  0
  2  3  2  0  0  0  0
  3  4  1  0  0  0  0
  3  8  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  1  0  0  0  0
  5 31  1  0  0  0  0
  6  7  1  0  0  0  0
  7  8  1  0  0  0  0
  8  9  1  0  0  0  0
  8 17  1  0  0  0  0
 10 11  1  0  0  0  0
 11 12  1  0  0  0  0
 11 26  1  0  0  0  0
 12 13  1  0  0  0  0
 12 20  1  0  0  0  0
 13 14  1  0  0  0  0
 13 30  2  0  0  0  0
 14 15  1  0  0  0  0
 15 16  1  0  0  0  0
 15 20  1  0  0  0  0
 16 17  1  0  0  0  0
 17 18  1  0  0  0  0
 18 19  1  0  0  0  0
 19 20  1  0  0  0  0
 20 21  1  0  0  0  0
 22 23  1  0  0  0  0
 23 24  1  0  0  0  0
 23 28  1  0  0  0  0
 24 25  1  0  0  0  0
 25 26  1  0  0  0  0
 26 27  2  0  0  0  0
 28 29  1  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0034403

> <DATABASE_NAME>
hmdb

> <SMILES>
CC(CO)CCC(=O)C(C)C1C(=O)CC2C3CC=C4CC(O)CCC4(C)C3CCC12C

> <INCHI_IDENTIFIER>
InChI=1S/C27H42O4/c1-16(15-28)5-8-23(30)17(2)25-24(31)14-22-20-7-6-18-13-19(29)9-11-26(18,3)21(20)10-12-27(22,25)4/h6,16-17,19-22,25,28-29H,5,7-15H2,1-4H3

> <INCHI_KEY>
GDKGOXUWEBGZBY-UHFFFAOYSA-N

> <FORMULA>
C27H42O4

> <MOLECULAR_WEIGHT>
430.62

> <EXACT_MASS>
430.308309832

> <JCHEM_ACCEPTOR_COUNT>
4

> <JCHEM_AVERAGE_POLARIZABILITY>
50.059016085512354

> <JCHEM_BIOAVAILABILITY>
1

> <JCHEM_DONOR_COUNT>
2

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
5-hydroxy-14-(7-hydroxy-6-methyl-3-oxoheptan-2-yl)-2,15-dimethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-7-en-13-one

> <ALOGPS_LOGP>
4.42

> <JCHEM_LOGP>
3.9076630573333326

> <ALOGPS_LOGS>
-4.59

> <JCHEM_MDDR_LIKE_RULE>
1

> <JCHEM_NUMBER_OF_RINGS>
4

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
18.20428950550309

> <JCHEM_PKA_STRONGEST_ACIDIC>
17.49078674737361

> <JCHEM_PKA_STRONGEST_BASIC>
-1.224806155067014

> <JCHEM_POLAR_SURFACE_AREA>
74.6

> <JCHEM_REFRACTIVITY>
123.80279999999995

> <JCHEM_ROTATABLE_BOND_COUNT>
6

> <JCHEM_RULE_OF_FIVE>
1

> <ALOGPS_SOLUBILITY>
1.11e-02 g/l

> <JCHEM_TRADITIONAL_IUPAC>
kryptogenin

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0034403
     RDKit          3D
Barogenin
 73 76  0  0  0  0  0  0  0  0999 V2000
   -7.2069    0.1689   -2.3181 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2327   -0.6396   -1.0391 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9246    0.2112    0.0038 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2123    0.4826   -0.4572 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8687   -1.0767   -0.6074 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9437    0.0952   -0.3518 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5937   -0.3578    0.0748 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4158   -1.5586    0.1728 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4843    0.5898    0.3768 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8741    1.4739    1.5077 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2419   -0.1760    0.5152 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2307   -1.1929    1.5880 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0165   -1.5683    2.4035 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1656   -1.7612    1.4491 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9269   -0.4230    1.3688 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3262   -0.5792    0.9752 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7288   -2.0655    0.9488 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1744   -2.1200    0.5915 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8437   -1.1403    0.0356 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2790   -1.3405   -0.2623 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9185   -0.0359   -0.6029 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2205   -0.3274   -1.0721 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2302    0.7404   -1.6726 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7445    0.6596   -1.6581 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2391    0.1867   -0.3219 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5781    1.1819    0.7391 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7455   -0.0138   -0.3349 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9778    1.1988   -0.7564 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5392    0.8137   -0.7970 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0593    0.5183    0.6038 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0400    1.8607    1.3174 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6371   -0.3894   -3.0852 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2549    0.2242   -2.6902 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8478    1.1944   -2.1683 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8793   -1.5070   -1.2233 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4025    1.1891    0.0465 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9947   -0.2661    0.9806 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.8213   -0.1927   -0.0485 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9846   -1.6642    0.3259 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4468   -1.7547   -1.3637 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8224    0.6248   -1.3111 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4548    0.7152    0.4112 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3933    1.2357   -0.5277 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9949    1.5739    1.4961 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6641    1.0420    2.5089 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5260    2.5223    1.3931 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1875   -0.8123   -0.4311 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1800   -2.2810    0.4886 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4606   -2.3477    2.3159 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8963   -0.0829    2.4504 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0307   -0.1428    1.7483 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1897   -2.5844    0.1137 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5683   -2.5385    1.9158 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6876   -3.0561    0.8209 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7629   -1.7236    0.6620 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.4315   -2.1217   -1.0353 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0810    0.5342    0.3414 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.8785   -0.3250   -0.3314 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5782    0.3200   -2.6614 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6155    1.7859   -1.6540 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3517    1.7054   -1.7899 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3396    0.0642   -2.4922 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0626    0.7074    1.6278 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2061    2.0312    0.3403 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6723    1.7020    1.1619 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5489   -0.8051   -1.1171 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2846    1.4145   -1.8188 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2079    2.1103   -0.1975 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4470   -0.1214   -1.3755 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1122    1.6177   -1.1957 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1339    2.0723    1.5311 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4217    1.8353    2.3024 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2609    2.6898    0.6544 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  2  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
  9 11  1  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 30 11  1  0
 30 15  1  0
 27 16  1  0
 25 19  1  0
  1 32  1  0
  1 33  1  0
  1 34  1  0
  2 35  1  0
  3 36  1  0
  3 37  1  0
  4 38  1  0
  5 39  1  0
  5 40  1  0
  6 41  1  0
  6 42  1  0
  9 43  1  0
 10 44  1  0
 10 45  1  0
 10 46  1  0
 11 47  1  0
 14 48  1  0
 14 49  1  0
 15 50  1  0
 16 51  1  0
 17 52  1  0
 17 53  1  0
 18 54  1  0
 20 55  1  0
 20 56  1  0
 21 57  1  0
 22 58  1  0
 23 59  1  0
 23 60  1  0
 24 61  1  0
 24 62  1  0
 26 63  1  0
 26 64  1  0
 26 65  1  0
 27 66  1  0
 28 67  1  0
 28 68  1  0
 29 69  1  0
 29 70  1  0
 31 71  1  0
 31 72  1  0
 31 73  1  0
M  END

HEADER    PROTEIN                                 24-FEB-12   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   24-FEB-12         0                                  
HETATM    1  C   UNK     0       0.247  -5.995   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      -1.082  -6.763   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0      -2.417  -5.992   0.000  0.00  0.00           C+0
HETATM    4  C   UNK     0      -3.739  -6.755   0.000  0.00  0.00           C+0
HETATM    5  C   UNK     0      -5.081  -5.982   0.000  0.00  0.00           C+0
HETATM    6  C   UNK     0      -5.081  -4.429   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0      -3.736  -3.650   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      -2.417  -4.445   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0      -2.417  -2.908   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0       2.489   0.866   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0       3.575  -0.223   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0       3.070  -1.698   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0       3.967  -2.954   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0       3.055  -4.186   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0       1.590  -3.689   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0       0.247  -4.462   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0      -1.075  -3.671   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0      -1.075  -2.149   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0       0.270  -1.371   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0       1.590  -2.165   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0       1.777  -0.638   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0       6.401   4.514   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0       4.923   4.189   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0       4.436   2.680   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0       5.522   1.594   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0       5.033   0.087   0.000  0.00  0.00           C+0
HETATM   27  O   UNK     0       6.122  -0.999   0.000  0.00  0.00           O+0
HETATM   28  C   UNK     0       3.836   5.275   0.000  0.00  0.00           C+0
HETATM   29  O   UNK     0       4.305   6.763   0.000  0.00  0.00           O+0
HETATM   30  O   UNK     0       5.504  -2.954   0.000  0.00  0.00           O+0
HETATM   31  O   UNK     0      -6.401  -6.743   0.000  0.00  0.00           O+0
CONECT    1    2   16                                                       
CONECT    2    1    3                                                       
CONECT    3    2    4    8                                                  
CONECT    4    3    5                                                       
CONECT    5    4    6   31                                                  
CONECT    6    5    7                                                       
CONECT    7    6    8                                                       
CONECT    8    3    7    9   17                                             
CONECT    9    8                                                            
CONECT   10   11                                                            
CONECT   11   10   12   26                                                  
CONECT   12   11   13   20                                                  
CONECT   13   12   14   30                                                  
CONECT   14   13   15                                                       
CONECT   15   14   16   20                                                  
CONECT   16    1   15   17                                                  
CONECT   17    8   16   18                                                  
CONECT   18   17   19                                                       
CONECT   19   18   20                                                       
CONECT   20   12   15   19   21                                             
CONECT   21   20                                                            
CONECT   22   23                                                            
CONECT   23   22   24   28                                                  
CONECT   24   23   25                                                       
CONECT   25   24   26                                                       
CONECT   26   11   25   27                                                  
CONECT   27   26                                                            
CONECT   28   23   29                                                       
CONECT   29   28                                                            
CONECT   30   13                                                            
CONECT   31    5                                                            
MASTER        0    0    0    0    0    0    0    0   31    0   68    0
END

COMPND    HMDB0034403
HETATM    1  C1  UNL     1      -7.207   0.169  -2.318  1.00  0.00           C  
HETATM    2  C2  UNL     1      -7.233  -0.640  -1.039  1.00  0.00           C  
HETATM    3  C3  UNL     1      -7.925   0.211   0.004  1.00  0.00           C  
HETATM    4  O1  UNL     1      -9.212   0.483  -0.457  1.00  0.00           O  
HETATM    5  C4  UNL     1      -5.869  -1.077  -0.607  1.00  0.00           C  
HETATM    6  C5  UNL     1      -4.944   0.095  -0.352  1.00  0.00           C  
HETATM    7  C6  UNL     1      -3.594  -0.358   0.075  1.00  0.00           C  
HETATM    8  O2  UNL     1      -3.416  -1.559   0.173  1.00  0.00           O  
HETATM    9  C7  UNL     1      -2.484   0.590   0.377  1.00  0.00           C  
HETATM   10  C8  UNL     1      -2.874   1.474   1.508  1.00  0.00           C  
HETATM   11  C9  UNL     1      -1.242  -0.176   0.515  1.00  0.00           C  
HETATM   12  C10 UNL     1      -1.231  -1.193   1.588  1.00  0.00           C  
HETATM   13  O3  UNL     1      -2.016  -1.568   2.404  1.00  0.00           O  
HETATM   14  C11 UNL     1       0.166  -1.761   1.449  1.00  0.00           C  
HETATM   15  C12 UNL     1       0.927  -0.423   1.369  1.00  0.00           C  
HETATM   16  C13 UNL     1       2.326  -0.579   0.975  1.00  0.00           C  
HETATM   17  C14 UNL     1       2.729  -2.066   0.949  1.00  0.00           C  
HETATM   18  C15 UNL     1       4.174  -2.120   0.592  1.00  0.00           C  
HETATM   19  C16 UNL     1       4.844  -1.140   0.036  1.00  0.00           C  
HETATM   20  C17 UNL     1       6.279  -1.341  -0.262  1.00  0.00           C  
HETATM   21  C18 UNL     1       6.919  -0.036  -0.603  1.00  0.00           C  
HETATM   22  O4  UNL     1       8.221  -0.327  -1.072  1.00  0.00           O  
HETATM   23  C19 UNL     1       6.230   0.740  -1.673  1.00  0.00           C  
HETATM   24  C20 UNL     1       4.744   0.660  -1.658  1.00  0.00           C  
HETATM   25  C21 UNL     1       4.239   0.187  -0.322  1.00  0.00           C  
HETATM   26  C22 UNL     1       4.578   1.182   0.739  1.00  0.00           C  
HETATM   27  C23 UNL     1       2.746  -0.014  -0.335  1.00  0.00           C  
HETATM   28  C24 UNL     1       1.978   1.199  -0.756  1.00  0.00           C  
HETATM   29  C25 UNL     1       0.539   0.814  -0.797  1.00  0.00           C  
HETATM   30  C26 UNL     1       0.059   0.518   0.604  1.00  0.00           C  
HETATM   31  C27 UNL     1       0.040   1.861   1.317  1.00  0.00           C  
HETATM   32  H1  UNL     1      -6.637  -0.389  -3.085  1.00  0.00           H  
HETATM   33  H2  UNL     1      -8.255   0.224  -2.690  1.00  0.00           H  
HETATM   34  H3  UNL     1      -6.848   1.194  -2.168  1.00  0.00           H  
HETATM   35  H4  UNL     1      -7.879  -1.507  -1.223  1.00  0.00           H  
HETATM   36  H5  UNL     1      -7.403   1.189   0.046  1.00  0.00           H  
HETATM   37  H6  UNL     1      -7.995  -0.266   0.981  1.00  0.00           H  
HETATM   38  H7  UNL     1      -9.821  -0.193  -0.049  1.00  0.00           H  
HETATM   39  H8  UNL     1      -5.985  -1.664   0.326  1.00  0.00           H  
HETATM   40  H9  UNL     1      -5.447  -1.755  -1.364  1.00  0.00           H  
HETATM   41  H10 UNL     1      -4.822   0.625  -1.311  1.00  0.00           H  
HETATM   42  H11 UNL     1      -5.455   0.715   0.411  1.00  0.00           H  
HETATM   43  H12 UNL     1      -2.393   1.236  -0.528  1.00  0.00           H  
HETATM   44  H13 UNL     1      -3.995   1.574   1.496  1.00  0.00           H  
HETATM   45  H14 UNL     1      -2.664   1.042   2.509  1.00  0.00           H  
HETATM   46  H15 UNL     1      -2.526   2.522   1.393  1.00  0.00           H  
HETATM   47  H16 UNL     1      -1.187  -0.812  -0.431  1.00  0.00           H  
HETATM   48  H17 UNL     1       0.180  -2.281   0.489  1.00  0.00           H  
HETATM   49  H18 UNL     1       0.461  -2.348   2.316  1.00  0.00           H  
HETATM   50  H19 UNL     1       0.896  -0.083   2.450  1.00  0.00           H  
HETATM   51  H20 UNL     1       3.031  -0.143   1.748  1.00  0.00           H  
HETATM   52  H21 UNL     1       2.190  -2.584   0.114  1.00  0.00           H  
HETATM   53  H22 UNL     1       2.568  -2.538   1.916  1.00  0.00           H  
HETATM   54  H23 UNL     1       4.688  -3.056   0.821  1.00  0.00           H  
HETATM   55  H24 UNL     1       6.763  -1.724   0.662  1.00  0.00           H  
HETATM   56  H25 UNL     1       6.432  -2.122  -1.035  1.00  0.00           H  
HETATM   57  H26 UNL     1       7.081   0.534   0.341  1.00  0.00           H  
HETATM   58  H27 UNL     1       8.879  -0.325  -0.331  1.00  0.00           H  
HETATM   59  H28 UNL     1       6.578   0.320  -2.661  1.00  0.00           H  
HETATM   60  H29 UNL     1       6.616   1.786  -1.654  1.00  0.00           H  
HETATM   61  H30 UNL     1       4.352   1.705  -1.790  1.00  0.00           H  
HETATM   62  H31 UNL     1       4.340   0.064  -2.492  1.00  0.00           H  
HETATM   63  H32 UNL     1       5.063   0.707   1.628  1.00  0.00           H  
HETATM   64  H33 UNL     1       5.206   2.031   0.340  1.00  0.00           H  
HETATM   65  H34 UNL     1       3.672   1.702   1.162  1.00  0.00           H  
HETATM   66  H35 UNL     1       2.549  -0.805  -1.117  1.00  0.00           H  
HETATM   67  H36 UNL     1       2.285   1.414  -1.819  1.00  0.00           H  
HETATM   68  H37 UNL     1       2.208   2.110  -0.198  1.00  0.00           H  
HETATM   69  H38 UNL     1       0.447  -0.121  -1.375  1.00  0.00           H  
HETATM   70  H39 UNL     1      -0.112   1.618  -1.196  1.00  0.00           H  
HETATM   71  H40 UNL     1       1.134   2.072   1.531  1.00  0.00           H  
HETATM   72  H41 UNL     1      -0.422   1.835   2.302  1.00  0.00           H  
HETATM   73  H42 UNL     1      -0.261   2.690   0.654  1.00  0.00           H  
CONECT    1    2   32   33   34
CONECT    2    3    5   35
CONECT    3    4   36   37
CONECT    4   38
CONECT    5    6   39   40
CONECT    6    7   41   42
CONECT    7    8    8    9
CONECT    9   10   11   43
CONECT   10   44   45   46
CONECT   11   12   30   47
CONECT   12   13   13   14
CONECT   14   15   48   49
CONECT   15   16   30   50
CONECT   16   17   27   51
CONECT   17   18   52   53
CONECT   18   19   19   54
CONECT   19   20   25
CONECT   20   21   55   56
CONECT   21   22   23   57
CONECT   22   58
CONECT   23   24   59   60
CONECT   24   25   61   62
CONECT   25   26   27
CONECT   26   63   64   65
CONECT   27   28   66
CONECT   28   29   67   68
CONECT   29   30   69   70
CONECT   30   31
CONECT   31   71   72   73
END

HMDB0034403
     RDKit          3D
Barogenin
 73 76  0  0  0  0  0  0  0  0999 V2000
   -7.2069    0.1689   -2.3181 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2327   -0.6396   -1.0391 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9246    0.2112    0.0038 C   0  0  0  0  0  0  0  0  0  0  0  0
   -9.2123    0.4826   -0.4572 O   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8687   -1.0767   -0.6074 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9437    0.0952   -0.3518 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5937   -0.3578    0.0748 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4158   -1.5586    0.1728 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4843    0.5898    0.3768 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8741    1.4739    1.5077 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2419   -0.1760    0.5152 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2307   -1.1929    1.5880 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0165   -1.5683    2.4035 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1656   -1.7612    1.4491 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9269   -0.4230    1.3688 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3262   -0.5792    0.9752 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7288   -2.0655    0.9488 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1744   -2.1200    0.5915 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8437   -1.1403    0.0356 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2790   -1.3405   -0.2623 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9185   -0.0359   -0.6029 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2205   -0.3274   -1.0721 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2302    0.7404   -1.6726 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7445    0.6596   -1.6581 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2391    0.1867   -0.3219 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5781    1.1819    0.7391 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7455   -0.0138   -0.3349 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9778    1.1988   -0.7564 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5392    0.8137   -0.7970 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0593    0.5183    0.6038 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0400    1.8607    1.3174 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6371   -0.3894   -3.0852 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.2549    0.2242   -2.6902 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.8478    1.1944   -2.1683 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.8793   -1.5070   -1.2233 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4025    1.1891    0.0465 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9947   -0.2661    0.9806 H   0  0  0  0  0  0  0  0  0  0  0  0
   -9.8213   -0.1927   -0.0485 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.9846   -1.6642    0.3259 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4468   -1.7547   -1.3637 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8224    0.6248   -1.3111 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.4548    0.7152    0.4112 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3933    1.2357   -0.5277 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9949    1.5739    1.4961 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6641    1.0420    2.5089 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5260    2.5223    1.3931 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1875   -0.8123   -0.4311 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1800   -2.2810    0.4886 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4606   -2.3477    2.3159 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8963   -0.0829    2.4504 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0307   -0.1428    1.7483 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1897   -2.5844    0.1137 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5683   -2.5385    1.9158 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6876   -3.0561    0.8209 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7629   -1.7236    0.6620 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.4315   -2.1217   -1.0353 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.0810    0.5342    0.3414 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.8785   -0.3250   -0.3314 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.5782    0.3200   -2.6614 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6155    1.7859   -1.6540 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3517    1.7054   -1.7899 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3396    0.0642   -2.4922 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0626    0.7074    1.6278 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.2061    2.0312    0.3403 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6723    1.7020    1.1619 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5489   -0.8051   -1.1171 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2846    1.4145   -1.8188 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2079    2.1103   -0.1975 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4470   -0.1214   -1.3755 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1122    1.6177   -1.1957 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1339    2.0723    1.5311 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4217    1.8353    2.3024 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2609    2.6898    0.6544 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  2  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
  9 11  1  0
 11 12  1  0
 12 13  2  0
 12 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 19 20  1  0
 20 21  1  0
 21 22  1  0
 21 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  1  0
 25 27  1  0
 27 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 30 11  1  0
 30 15  1  0
 27 16  1  0
 25 19  1  0
  1 32  1  0
  1 33  1  0
  1 34  1  0
  2 35  1  0
  3 36  1  0
  3 37  1  0
  4 38  1  0
  5 39  1  0
  5 40  1  0
  6 41  1  0
  6 42  1  0
  9 43  1  0
 10 44  1  0
 10 45  1  0
 10 46  1  0
 11 47  1  0
 14 48  1  0
 14 49  1  0
 15 50  1  0
 16 51  1  0
 17 52  1  0
 17 53  1  0
 18 54  1  0
 20 55  1  0
 20 56  1  0
 21 57  1  0
 22 58  1  0
 23 59  1  0
 23 60  1  0
 24 61  1  0
 24 62  1  0
 26 63  1  0
 26 64  1  0
 26 65  1  0
 27 66  1  0
 28 67  1  0
 28 68  1  0
 29 69  1  0
 29 70  1  0
 31 71  1  0
 31 72  1  0
 31 73  1  0
M  END

View in JSmol View Stereo Labels

Synonyms

Value	Source
Kryptogenin	MeSH

Chemical Formula

C₂₇H₄₂O₄

Average Molecular Weight

430.62

Monoisotopic Molecular Weight

430.308309832

IUPAC Name

5-hydroxy-14-(7-hydroxy-6-methyl-3-oxoheptan-2-yl)-2,15-dimethyltetracyclo[8.7.0.0²,⁷.0¹¹,¹⁵]heptadec-7-en-13-one

Traditional Name

kryptogenin

CAS Registry Number

64161-55-3

SMILES

CC(CO)CCC(=O)C(C)C1C(=O)CC2C3CC=C4CC(O)CCC4(C)C3CCC12C

InChI Identifier

InChI=1S/C27H42O4/c1-16(15-28)5-8-23(30)17(2)25-24(31)14-22-20-7-6-18-13-19(29)9-11-26(18,3)21(20)10-12-27(22,25)4/h6,16-17,19-22,25,28-29H,5,7-15H2,1-4H3

InChI Key

GDKGOXUWEBGZBY-UHFFFAOYSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as dihydroxy bile acids, alcohols and derivatives. Dihydroxy bile acids, alcohols and derivatives are compounds containing or derived from a bile acid or alcohol, and which bears exactly two carboxylic acid groups.

Kingdom

Organic compounds

Super Class

Lipids and lipid-like molecules

Class

Steroids and steroid derivatives

Sub Class

Bile acids, alcohols and derivatives

Direct Parent

Dihydroxy bile acids, alcohols and derivatives

Alternative Parents

Substituents

26-hydroxysteroid
Dihydroxy bile acid, alcohol, or derivatives
22-oxosteroid
21-oxosteroid
3-hydroxy-delta-5-steroid
3-hydroxysteroid
Oxosteroid
16-oxosteroid
Hydroxysteroid
Delta-5-steroid
Fatty alcohol
Fatty acyl
Cyclic alcohol
Cyclic ketone
Secondary alcohol
Ketone
Organic oxide
Organic oxygen compound
Hydrocarbon derivative
Carbonyl group
Primary alcohol
Organooxygen compound
Alcohol
Aliphatic homopolycyclic compound

Molecular Framework

Aliphatic homopolycyclic compounds

External Descriptors

Not Available

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Extracellular (HMDB: HMDB0034403)

Source

Endogenous

Endogenous (HMDB: HMDB0034403)

Exogenous

Exogenous (HMDB: HMDB0034403)

Food

Vegetable

Tuber

Potato (FooDB: FOOD00175)

Beverage

Alcoholic beverage

Alcoholic beverages (FooDB: FOOD00854)

Process

Not Available

Role

Not Available

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	196 - 199 °C	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	1.73 mg/L @ 25 °C (est)	The Good Scents Company Information System
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	0.011 g/L	ALOGPS
logP	4.42	ALOGPS
logP	3.91	ChemAxon
logS	-4.6	ALOGPS
pKa (Strongest Acidic)	17.49	ChemAxon
pKa (Strongest Basic)	-1.2	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	4	ChemAxon
Hydrogen Donor Count	2	ChemAxon
Polar Surface Area	74.6 Å²	ChemAxon
Rotatable Bond Count	6	ChemAxon
Refractivity	123.8 m³·mol⁻¹	ChemAxon
Polarizability	50.06 Å³	ChemAxon
Number of Rings	4	ChemAxon
Bioavailability	Yes	ChemAxon
Rule of Five	Yes	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	Yes	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DarkChem	[M+H]+	199.744	31661259
DarkChem	[M-H]-	197.331	31661259
DeepCCS	[M-2H]-	245.234	30932474
DeepCCS	[M+Na]+	220.461	30932474
AllCCS	[M+H]+	208.6	32859911
AllCCS	[M+H-H2O]+	206.6	32859911
AllCCS	[M+NH4]+	210.4	32859911
AllCCS	[M+Na]+	211.0	32859911
AllCCS	[M-H]-	207.2	32859911
AllCCS	[M+Na-2H]-	209.1	32859911
AllCCS	[M+HCOO]-	211.4	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Barogenin	CC(CO)CCC(=O)C(C)C1C(=O)CC2C3CC=C4CC(O)CCC4(C)C3CCC12C	2926.1	Standard polar	33892256
Barogenin	CC(CO)CCC(=O)C(C)C1C(=O)CC2C3CC=C4CC(O)CCC4(C)C3CCC12C	3456.0	Standard non polar	33892256
Barogenin	CC(CO)CCC(=O)C(C)C1C(=O)CC2C3CC=C4CC(O)CCC4(C)C3CCC12C	3710.6	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Barogenin,1TMS,isomer #1	CC(CCC(=O)C(C)C1C(=O)CC2C3CC=C4CC(O)CCC4(C)C3CCC21C)CO[Si](C)(C)C	3775.9	Semi standard non polar	33892256
Barogenin,1TMS,isomer #2	CC(CO)CCC(=O)C(C)C1C(=O)CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC21C	3752.3	Semi standard non polar	33892256
Barogenin,1TMS,isomer #3	CC(=C(CCC(C)CO)O[Si](C)(C)C)C1C(=O)CC2C3CC=C4CC(O)CCC4(C)C3CCC12C	3688.4	Semi standard non polar	33892256
Barogenin,1TMS,isomer #4	CC(CO)CCC(=O)C(C)C1=C(O[Si](C)(C)C)CC2C3CC=C4CC(O)CCC4(C)C3CCC12C	3658.4	Semi standard non polar	33892256
Barogenin,1TMS,isomer #5	CC(CO)CC=C(O[Si](C)(C)C)C(C)C1C(=O)CC2C3CC=C4CC(O)CCC4(C)C3CCC21C	3727.4	Semi standard non polar	33892256
Barogenin,1TMS,isomer #6	CC(CO)CCC(=O)C(C)C1C(O[Si](C)(C)C)=CC2C3CC=C4CC(O)CCC4(C)C3CCC21C	3673.6	Semi standard non polar	33892256
Barogenin,2TMS,isomer #1	CC(CCC(=O)C(C)C1C(=O)CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC21C)CO[Si](C)(C)C	3744.5	Semi standard non polar	33892256
Barogenin,2TMS,isomer #10	CC(=C(CCC(C)CO)O[Si](C)(C)C)C1=C(O[Si](C)(C)C)CC2C3CC=C4CC(O)CCC4(C)C3CCC12C	3599.6	Semi standard non polar	33892256
Barogenin,2TMS,isomer #11	CC(=C(CCC(C)CO)O[Si](C)(C)C)C1C(O[Si](C)(C)C)=CC2C3CC=C4CC(O)CCC4(C)C3CCC12C	3609.9	Semi standard non polar	33892256
Barogenin,2TMS,isomer #12	CC(CO)CC=C(O[Si](C)(C)C)C(C)C1=C(O[Si](C)(C)C)CC2C3CC=C4CC(O)CCC4(C)C3CCC12C	3634.0	Semi standard non polar	33892256
Barogenin,2TMS,isomer #13	CC(CO)CC=C(O[Si](C)(C)C)C(C)C1C(O[Si](C)(C)C)=CC2C3CC=C4CC(O)CCC4(C)C3CCC21C	3660.8	Semi standard non polar	33892256
Barogenin,2TMS,isomer #2	CC(=C(CCC(C)CO[Si](C)(C)C)O[Si](C)(C)C)C1C(=O)CC2C3CC=C4CC(O)CCC4(C)C3CCC12C	3667.3	Semi standard non polar	33892256
Barogenin,2TMS,isomer #3	CC(CCC(=O)C(C)C1=C(O[Si](C)(C)C)CC2C3CC=C4CC(O)CCC4(C)C3CCC12C)CO[Si](C)(C)C	3684.3	Semi standard non polar	33892256
Barogenin,2TMS,isomer #4	CC(CC=C(O[Si](C)(C)C)C(C)C1C(=O)CC2C3CC=C4CC(O)CCC4(C)C3CCC21C)CO[Si](C)(C)C	3751.1	Semi standard non polar	33892256
Barogenin,2TMS,isomer #5	CC(CCC(=O)C(C)C1C(O[Si](C)(C)C)=CC2C3CC=C4CC(O)CCC4(C)C3CCC21C)CO[Si](C)(C)C	3677.3	Semi standard non polar	33892256
Barogenin,2TMS,isomer #6	CC(=C(CCC(C)CO)O[Si](C)(C)C)C1C(=O)CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC12C	3627.1	Semi standard non polar	33892256
Barogenin,2TMS,isomer #7	CC(CO)CCC(=O)C(C)C1=C(O[Si](C)(C)C)CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC12C	3630.2	Semi standard non polar	33892256
Barogenin,2TMS,isomer #8	CC(CO)CC=C(O[Si](C)(C)C)C(C)C1C(=O)CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC21C	3677.7	Semi standard non polar	33892256
Barogenin,2TMS,isomer #9	CC(CO)CCC(=O)C(C)C1C(O[Si](C)(C)C)=CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC21C	3632.9	Semi standard non polar	33892256
Barogenin,3TMS,isomer #1	CC(=C(CCC(C)CO[Si](C)(C)C)O[Si](C)(C)C)C1C(=O)CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC12C	3606.6	Semi standard non polar	33892256
Barogenin,3TMS,isomer #1	CC(=C(CCC(C)CO[Si](C)(C)C)O[Si](C)(C)C)C1C(=O)CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC12C	3616.1	Standard non polar	33892256
Barogenin,3TMS,isomer #10	CC(=C(CCC(C)CO)O[Si](C)(C)C)C1C(O[Si](C)(C)C)=CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC12C	3575.1	Semi standard non polar	33892256
Barogenin,3TMS,isomer #10	CC(=C(CCC(C)CO)O[Si](C)(C)C)C1C(O[Si](C)(C)C)=CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC12C	3533.8	Standard non polar	33892256
Barogenin,3TMS,isomer #11	CC(CO)CC=C(O[Si](C)(C)C)C(C)C1=C(O[Si](C)(C)C)CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC12C	3592.9	Semi standard non polar	33892256
Barogenin,3TMS,isomer #11	CC(CO)CC=C(O[Si](C)(C)C)C(C)C1=C(O[Si](C)(C)C)CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC12C	3538.0	Standard non polar	33892256
Barogenin,3TMS,isomer #12	CC(CO)CC=C(O[Si](C)(C)C)C(C)C1C(O[Si](C)(C)C)=CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC21C	3623.3	Semi standard non polar	33892256
Barogenin,3TMS,isomer #12	CC(CO)CC=C(O[Si](C)(C)C)C(C)C1C(O[Si](C)(C)C)=CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC21C	3515.8	Standard non polar	33892256
Barogenin,3TMS,isomer #2	CC(CCC(=O)C(C)C1=C(O[Si](C)(C)C)CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC12C)CO[Si](C)(C)C	3598.1	Semi standard non polar	33892256
Barogenin,3TMS,isomer #2	CC(CCC(=O)C(C)C1=C(O[Si](C)(C)C)CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC12C)CO[Si](C)(C)C	3564.0	Standard non polar	33892256
Barogenin,3TMS,isomer #3	CC(CC=C(O[Si](C)(C)C)C(C)C1C(=O)CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC21C)CO[Si](C)(C)C	3668.6	Semi standard non polar	33892256
Barogenin,3TMS,isomer #3	CC(CC=C(O[Si](C)(C)C)C(C)C1C(=O)CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC21C)CO[Si](C)(C)C	3635.6	Standard non polar	33892256
Barogenin,3TMS,isomer #4	CC(CCC(=O)C(C)C1C(O[Si](C)(C)C)=CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC21C)CO[Si](C)(C)C	3613.9	Semi standard non polar	33892256
Barogenin,3TMS,isomer #4	CC(CCC(=O)C(C)C1C(O[Si](C)(C)C)=CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC21C)CO[Si](C)(C)C	3564.0	Standard non polar	33892256
Barogenin,3TMS,isomer #5	CC(=C(CCC(C)CO[Si](C)(C)C)O[Si](C)(C)C)C1=C(O[Si](C)(C)C)CC2C3CC=C4CC(O)CCC4(C)C3CCC12C	3574.4	Semi standard non polar	33892256
Barogenin,3TMS,isomer #5	CC(=C(CCC(C)CO[Si](C)(C)C)O[Si](C)(C)C)C1=C(O[Si](C)(C)C)CC2C3CC=C4CC(O)CCC4(C)C3CCC12C	3594.8	Standard non polar	33892256
Barogenin,3TMS,isomer #6	CC(=C(CCC(C)CO[Si](C)(C)C)O[Si](C)(C)C)C1C(O[Si](C)(C)C)=CC2C3CC=C4CC(O)CCC4(C)C3CCC12C	3594.8	Semi standard non polar	33892256
Barogenin,3TMS,isomer #6	CC(=C(CCC(C)CO[Si](C)(C)C)O[Si](C)(C)C)C1C(O[Si](C)(C)C)=CC2C3CC=C4CC(O)CCC4(C)C3CCC12C	3577.0	Standard non polar	33892256
Barogenin,3TMS,isomer #7	CC(CC=C(O[Si](C)(C)C)C(C)C1=C(O[Si](C)(C)C)CC2C3CC=C4CC(O)CCC4(C)C3CCC12C)CO[Si](C)(C)C	3653.3	Semi standard non polar	33892256
Barogenin,3TMS,isomer #7	CC(CC=C(O[Si](C)(C)C)C(C)C1=C(O[Si](C)(C)C)CC2C3CC=C4CC(O)CCC4(C)C3CCC12C)CO[Si](C)(C)C	3608.3	Standard non polar	33892256
Barogenin,3TMS,isomer #8	CC(CC=C(O[Si](C)(C)C)C(C)C1C(O[Si](C)(C)C)=CC2C3CC=C4CC(O)CCC4(C)C3CCC21C)CO[Si](C)(C)C	3669.0	Semi standard non polar	33892256
Barogenin,3TMS,isomer #8	CC(CC=C(O[Si](C)(C)C)C(C)C1C(O[Si](C)(C)C)=CC2C3CC=C4CC(O)CCC4(C)C3CCC21C)CO[Si](C)(C)C	3586.8	Standard non polar	33892256
Barogenin,3TMS,isomer #9	CC(=C(CCC(C)CO)O[Si](C)(C)C)C1=C(O[Si](C)(C)C)CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC12C	3564.4	Semi standard non polar	33892256
Barogenin,3TMS,isomer #9	CC(=C(CCC(C)CO)O[Si](C)(C)C)C1=C(O[Si](C)(C)C)CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC12C	3540.6	Standard non polar	33892256
Barogenin,4TMS,isomer #1	CC(=C(CCC(C)CO[Si](C)(C)C)O[Si](C)(C)C)C1=C(O[Si](C)(C)C)CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC12C	3536.3	Semi standard non polar	33892256
Barogenin,4TMS,isomer #1	CC(=C(CCC(C)CO[Si](C)(C)C)O[Si](C)(C)C)C1=C(O[Si](C)(C)C)CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC12C	3602.9	Standard non polar	33892256
Barogenin,4TMS,isomer #2	CC(=C(CCC(C)CO[Si](C)(C)C)O[Si](C)(C)C)C1C(O[Si](C)(C)C)=CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC12C	3569.8	Semi standard non polar	33892256
Barogenin,4TMS,isomer #2	CC(=C(CCC(C)CO[Si](C)(C)C)O[Si](C)(C)C)C1C(O[Si](C)(C)C)=CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC12C	3596.5	Standard non polar	33892256
Barogenin,4TMS,isomer #3	CC(CC=C(O[Si](C)(C)C)C(C)C1=C(O[Si](C)(C)C)CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC12C)CO[Si](C)(C)C	3618.2	Semi standard non polar	33892256
Barogenin,4TMS,isomer #3	CC(CC=C(O[Si](C)(C)C)C(C)C1=C(O[Si](C)(C)C)CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC12C)CO[Si](C)(C)C	3606.1	Standard non polar	33892256
Barogenin,4TMS,isomer #4	CC(CC=C(O[Si](C)(C)C)C(C)C1C(O[Si](C)(C)C)=CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC21C)CO[Si](C)(C)C	3638.6	Semi standard non polar	33892256
Barogenin,4TMS,isomer #4	CC(CC=C(O[Si](C)(C)C)C(C)C1C(O[Si](C)(C)C)=CC2C3CC=C4CC(O[Si](C)(C)C)CCC4(C)C3CCC21C)CO[Si](C)(C)C	3595.1	Standard non polar	33892256
Barogenin,1TBDMS,isomer #1	CC(CCC(=O)C(C)C1C(=O)CC2C3CC=C4CC(O)CCC4(C)C3CCC21C)CO[Si](C)(C)C(C)(C)C	4017.3	Semi standard non polar	33892256
Barogenin,1TBDMS,isomer #2	CC(CO)CCC(=O)C(C)C1C(=O)CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC21C	3959.0	Semi standard non polar	33892256
Barogenin,1TBDMS,isomer #3	CC(=C(CCC(C)CO)O[Si](C)(C)C(C)(C)C)C1C(=O)CC2C3CC=C4CC(O)CCC4(C)C3CCC12C	3930.7	Semi standard non polar	33892256
Barogenin,1TBDMS,isomer #4	CC(CO)CCC(=O)C(C)C1=C(O[Si](C)(C)C(C)(C)C)CC2C3CC=C4CC(O)CCC4(C)C3CCC12C	3913.2	Semi standard non polar	33892256
Barogenin,1TBDMS,isomer #5	CC(CO)CC=C(O[Si](C)(C)C(C)(C)C)C(C)C1C(=O)CC2C3CC=C4CC(O)CCC4(C)C3CCC21C	3970.5	Semi standard non polar	33892256
Barogenin,1TBDMS,isomer #6	CC(CO)CCC(=O)C(C)C1C(O[Si](C)(C)C(C)(C)C)=CC2C3CC=C4CC(O)CCC4(C)C3CCC21C	3919.0	Semi standard non polar	33892256
Barogenin,2TBDMS,isomer #1	CC(CCC(=O)C(C)C1C(=O)CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC21C)CO[Si](C)(C)C(C)(C)C	4189.5	Semi standard non polar	33892256
Barogenin,2TBDMS,isomer #10	CC(=C(CCC(C)CO)O[Si](C)(C)C(C)(C)C)C1=C(O[Si](C)(C)C(C)(C)C)CC2C3CC=C4CC(O)CCC4(C)C3CCC12C	4047.7	Semi standard non polar	33892256
Barogenin,2TBDMS,isomer #11	CC(=C(CCC(C)CO)O[Si](C)(C)C(C)(C)C)C1C(O[Si](C)(C)C(C)(C)C)=CC2C3CC=C4CC(O)CCC4(C)C3CCC12C	4097.4	Semi standard non polar	33892256
Barogenin,2TBDMS,isomer #12	CC(CO)CC=C(O[Si](C)(C)C(C)(C)C)C(C)C1=C(O[Si](C)(C)C(C)(C)C)CC2C3CC=C4CC(O)CCC4(C)C3CCC12C	4119.8	Semi standard non polar	33892256
Barogenin,2TBDMS,isomer #13	CC(CO)CC=C(O[Si](C)(C)C(C)(C)C)C(C)C1C(O[Si](C)(C)C(C)(C)C)=CC2C3CC=C4CC(O)CCC4(C)C3CCC21C	4133.9	Semi standard non polar	33892256
Barogenin,2TBDMS,isomer #2	CC(=C(CCC(C)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C1C(=O)CC2C3CC=C4CC(O)CCC4(C)C3CCC12C	4152.1	Semi standard non polar	33892256
Barogenin,2TBDMS,isomer #3	CC(CCC(=O)C(C)C1=C(O[Si](C)(C)C(C)(C)C)CC2C3CC=C4CC(O)CCC4(C)C3CCC12C)CO[Si](C)(C)C(C)(C)C	4154.9	Semi standard non polar	33892256
Barogenin,2TBDMS,isomer #4	CC(CC=C(O[Si](C)(C)C(C)(C)C)C(C)C1C(=O)CC2C3CC=C4CC(O)CCC4(C)C3CCC21C)CO[Si](C)(C)C(C)(C)C	4222.8	Semi standard non polar	33892256
Barogenin,2TBDMS,isomer #5	CC(CCC(=O)C(C)C1C(O[Si](C)(C)C(C)(C)C)=CC2C3CC=C4CC(O)CCC4(C)C3CCC21C)CO[Si](C)(C)C(C)(C)C	4160.8	Semi standard non polar	33892256
Barogenin,2TBDMS,isomer #6	CC(=C(CCC(C)CO)O[Si](C)(C)C(C)(C)C)C1C(=O)CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC12C	4075.0	Semi standard non polar	33892256
Barogenin,2TBDMS,isomer #7	CC(CO)CCC(=O)C(C)C1=C(O[Si](C)(C)C(C)(C)C)CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC12C	4081.7	Semi standard non polar	33892256
Barogenin,2TBDMS,isomer #8	CC(CO)CC=C(O[Si](C)(C)C(C)(C)C)C(C)C1C(=O)CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC21C	4120.9	Semi standard non polar	33892256
Barogenin,2TBDMS,isomer #9	CC(CO)CCC(=O)C(C)C1C(O[Si](C)(C)C(C)(C)C)=CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC21C	4085.3	Semi standard non polar	33892256
Barogenin,3TBDMS,isomer #1	CC(=C(CCC(C)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C1C(=O)CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC12C	4289.9	Semi standard non polar	33892256
Barogenin,3TBDMS,isomer #1	CC(=C(CCC(C)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C1C(=O)CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC12C	4286.3	Standard non polar	33892256
Barogenin,3TBDMS,isomer #10	CC(=C(CCC(C)CO)O[Si](C)(C)C(C)(C)C)C1C(O[Si](C)(C)C(C)(C)C)=CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC12C	4222.2	Semi standard non polar	33892256
Barogenin,3TBDMS,isomer #10	CC(=C(CCC(C)CO)O[Si](C)(C)C(C)(C)C)C1C(O[Si](C)(C)C(C)(C)C)=CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC12C	4066.3	Standard non polar	33892256
Barogenin,3TBDMS,isomer #11	CC(CO)CC=C(O[Si](C)(C)C(C)(C)C)C(C)C1=C(O[Si](C)(C)C(C)(C)C)CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC12C	4239.9	Semi standard non polar	33892256
Barogenin,3TBDMS,isomer #11	CC(CO)CC=C(O[Si](C)(C)C(C)(C)C)C(C)C1=C(O[Si](C)(C)C(C)(C)C)CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC12C	4185.4	Standard non polar	33892256
Barogenin,3TBDMS,isomer #12	CC(CO)CC=C(O[Si](C)(C)C(C)(C)C)C(C)C1C(O[Si](C)(C)C(C)(C)C)=CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC21C	4241.7	Semi standard non polar	33892256
Barogenin,3TBDMS,isomer #12	CC(CO)CC=C(O[Si](C)(C)C(C)(C)C)C(C)C1C(O[Si](C)(C)C(C)(C)C)=CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC21C	4077.9	Standard non polar	33892256
Barogenin,3TBDMS,isomer #2	CC(CCC(=O)C(C)C1=C(O[Si](C)(C)C(C)(C)C)CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC12C)CO[Si](C)(C)C(C)(C)C	4304.5	Semi standard non polar	33892256
Barogenin,3TBDMS,isomer #2	CC(CCC(=O)C(C)C1=C(O[Si](C)(C)C(C)(C)C)CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC12C)CO[Si](C)(C)C(C)(C)C	4247.7	Standard non polar	33892256
Barogenin,3TBDMS,isomer #3	CC(CC=C(O[Si](C)(C)C(C)(C)C)C(C)C1C(=O)CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC21C)CO[Si](C)(C)C(C)(C)C	4322.8	Semi standard non polar	33892256
Barogenin,3TBDMS,isomer #3	CC(CC=C(O[Si](C)(C)C(C)(C)C)C(C)C1C(=O)CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC21C)CO[Si](C)(C)C(C)(C)C	4306.0	Standard non polar	33892256
Barogenin,3TBDMS,isomer #4	CC(CCC(=O)C(C)C1C(O[Si](C)(C)C(C)(C)C)=CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC21C)CO[Si](C)(C)C(C)(C)C	4292.5	Semi standard non polar	33892256
Barogenin,3TBDMS,isomer #4	CC(CCC(=O)C(C)C1C(O[Si](C)(C)C(C)(C)C)=CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC21C)CO[Si](C)(C)C(C)(C)C	4124.0	Standard non polar	33892256
Barogenin,3TBDMS,isomer #5	CC(=C(CCC(C)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C1=C(O[Si](C)(C)C(C)(C)C)CC2C3CC=C4CC(O)CCC4(C)C3CCC12C	4249.4	Semi standard non polar	33892256
Barogenin,3TBDMS,isomer #5	CC(=C(CCC(C)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C1=C(O[Si](C)(C)C(C)(C)C)CC2C3CC=C4CC(O)CCC4(C)C3CCC12C	4278.6	Standard non polar	33892256
Barogenin,3TBDMS,isomer #6	CC(=C(CCC(C)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C1C(O[Si](C)(C)C(C)(C)C)=CC2C3CC=C4CC(O)CCC4(C)C3CCC12C	4293.6	Semi standard non polar	33892256
Barogenin,3TBDMS,isomer #6	CC(=C(CCC(C)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C1C(O[Si](C)(C)C(C)(C)C)=CC2C3CC=C4CC(O)CCC4(C)C3CCC12C	4144.3	Standard non polar	33892256
Barogenin,3TBDMS,isomer #7	CC(CC=C(O[Si](C)(C)C(C)(C)C)C(C)C1=C(O[Si](C)(C)C(C)(C)C)CC2C3CC=C4CC(O)CCC4(C)C3CCC12C)CO[Si](C)(C)C(C)(C)C	4314.7	Semi standard non polar	33892256
Barogenin,3TBDMS,isomer #7	CC(CC=C(O[Si](C)(C)C(C)(C)C)C(C)C1=C(O[Si](C)(C)C(C)(C)C)CC2C3CC=C4CC(O)CCC4(C)C3CCC12C)CO[Si](C)(C)C(C)(C)C	4285.0	Standard non polar	33892256
Barogenin,3TBDMS,isomer #8	CC(CC=C(O[Si](C)(C)C(C)(C)C)C(C)C1C(O[Si](C)(C)C(C)(C)C)=CC2C3CC=C4CC(O)CCC4(C)C3CCC21C)CO[Si](C)(C)C(C)(C)C	4323.8	Semi standard non polar	33892256
Barogenin,3TBDMS,isomer #8	CC(CC=C(O[Si](C)(C)C(C)(C)C)C(C)C1C(O[Si](C)(C)C(C)(C)C)=CC2C3CC=C4CC(O)CCC4(C)C3CCC21C)CO[Si](C)(C)C(C)(C)C	4173.0	Standard non polar	33892256
Barogenin,3TBDMS,isomer #9	CC(=C(CCC(C)CO)O[Si](C)(C)C(C)(C)C)C1=C(O[Si](C)(C)C(C)(C)C)CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC12C	4205.6	Semi standard non polar	33892256
Barogenin,3TBDMS,isomer #9	CC(=C(CCC(C)CO)O[Si](C)(C)C(C)(C)C)C1=C(O[Si](C)(C)C(C)(C)C)CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC12C	4192.9	Standard non polar	33892256
Barogenin,4TBDMS,isomer #1	CC(=C(CCC(C)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C1=C(O[Si](C)(C)C(C)(C)C)CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC12C	4427.6	Semi standard non polar	33892256
Barogenin,4TBDMS,isomer #1	CC(=C(CCC(C)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C1=C(O[Si](C)(C)C(C)(C)C)CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC12C	4406.1	Standard non polar	33892256
Barogenin,4TBDMS,isomer #2	CC(=C(CCC(C)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C1C(O[Si](C)(C)C(C)(C)C)=CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC12C	4423.1	Semi standard non polar	33892256
Barogenin,4TBDMS,isomer #2	CC(=C(CCC(C)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C1C(O[Si](C)(C)C(C)(C)C)=CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC12C	4277.8	Standard non polar	33892256
Barogenin,4TBDMS,isomer #3	CC(CC=C(O[Si](C)(C)C(C)(C)C)C(C)C1=C(O[Si](C)(C)C(C)(C)C)CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC12C)CO[Si](C)(C)C(C)(C)C	4471.9	Semi standard non polar	33892256
Barogenin,4TBDMS,isomer #3	CC(CC=C(O[Si](C)(C)C(C)(C)C)C(C)C1=C(O[Si](C)(C)C(C)(C)C)CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC12C)CO[Si](C)(C)C(C)(C)C	4403.2	Standard non polar	33892256
Barogenin,4TBDMS,isomer #4	CC(CC=C(O[Si](C)(C)C(C)(C)C)C(C)C1C(O[Si](C)(C)C(C)(C)C)=CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC21C)CO[Si](C)(C)C(C)(C)C	4439.1	Semi standard non polar	33892256
Barogenin,4TBDMS,isomer #4	CC(CC=C(O[Si](C)(C)C(C)(C)C)C(C)C1C(O[Si](C)(C)C(C)(C)C)=CC2C3CC=C4CC(O[Si](C)(C)C(C)(C)C)CCC4(C)C3CCC21C)CO[Si](C)(C)C(C)(C)C	4307.7	Standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Barogenin GC-MS (Non-derivatized) - 70eV, Positive	splash10-01b9-1119600000-a90a50b86cf3ab17ea6f	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Barogenin GC-MS (2 TMS) - 70eV, Positive	splash10-0a4i-2413790000-b3a22d7a0ffa722c08e1	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Barogenin GC-MS (Non-derivatized) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Barogenin GC-MS (Non-derivatized) - 70eV, Positive	Not Available	2021-10-12	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Barogenin 10V, Positive-QTOF	splash10-03di-0005900000-6b66b38994986171a2a5	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Barogenin 20V, Positive-QTOF	splash10-01td-3429300000-288e3306381d6a992a0a	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Barogenin 40V, Positive-QTOF	splash10-0076-9434000000-a528df3b1ac271df65a0	2015-04-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Barogenin 10V, Negative-QTOF	splash10-004i-0001900000-f27200022ed31f4a8ae5	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Barogenin 20V, Negative-QTOF	splash10-01tl-2885900000-6d75ae382dae1204d196	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Barogenin 40V, Negative-QTOF	splash10-02g9-9473000000-69dbb82c95e747464cef	2015-04-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Barogenin 10V, Negative-QTOF	splash10-004i-0000900000-0c34f65bf9b4c9f52e6e	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Barogenin 20V, Negative-QTOF	splash10-004r-1972600000-5e18766a948348405238	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Barogenin 40V, Negative-QTOF	splash10-00kr-0090000000-b7a0ca984bcdaf749113	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Barogenin 10V, Positive-QTOF	splash10-01pk-0116900000-0cc02167001b100e59b8	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Barogenin 20V, Positive-QTOF	splash10-0002-1159200000-002595d54003564adf12	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Barogenin 40V, Positive-QTOF	splash10-0a4j-3901000000-5d579de1de28e7f9eafa	2021-09-24	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Extracellular

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB012807

KNApSAcK ID

C00054923

Chemspider ID

91878

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

101688

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

rw1842631

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

Simons K, Toomre D: Lipid rafts and signal transduction. Nat Rev Mol Cell Biol. 2000 Oct;1(1):31-9. [PubMed:11413487 ]
Watson AD: Thematic review series: systems biology approaches to metabolic and cardiovascular disorders. Lipidomics: a global approach to lipid analysis in biological systems. J Lipid Res. 2006 Oct;47(10):2101-11. Epub 2006 Aug 10. [PubMed:16902246 ]
Sethi JK, Vidal-Puig AJ: Thematic review series: adipocyte biology. Adipose tissue function and plasticity orchestrate nutritional adaptation. J Lipid Res. 2007 Jun;48(6):1253-62. Epub 2007 Mar 20. [PubMed:17374880 ]
Lingwood D, Simons K: Lipid rafts as a membrane-organizing principle. Science. 2010 Jan 1;327(5961):46-50. doi: 10.1126/science.1174621. [PubMed:20044567 ]
(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .
Gunstone, Frank D., John L. Harwood, and Albert J. Dijkstra (2007). The lipid handbook with CD-ROM. CRC Press.

Showing metabocard for Barogenin (HMDB0034403)

MOL for HMDB0034403 (Barogenin)

3D MOL for HMDB0034403 (Barogenin)

3D SDF for HMDB0034403 (Barogenin)

3D-SDF for HMDB0034403 (Barogenin)

PDB for HMDB0034403 (Barogenin)

3D PDB for HMDB0034403 (Barogenin)

SMILES for HMDB0034403 (Barogenin)

INCHI for HMDB0034403 (Barogenin)

Structure for HMDB0034403 (Barogenin)

3D Structure for HMDB0034403 (Barogenin)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra