Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2012-09-11 22:54:21 UTC

Update Date

2022-03-07 02:55:26 UTC

HMDB ID

HMDB0037655

Secondary Accession Numbers

HMDB37655

Metabolite Identification

Common Name

Proanthocyanidin A2

Description

Proanthocyanidin A2, also known as ec-(4b,8)(2b,7)-ec or procyanidin A2, belongs to the class of organic compounds known as biflavonoids and polyflavonoids. These are organic compounds containing at least two flavan/flavone units. These units are usually linked through CC or C-O-C bonds. Some examples include C2-O-C3, C2-O-C4, C3'-C3''', and C6-C8''. Proanthocyanidin A2 is an extremely weak basic (essentially neutral) compound (based on its pKa). Outside of the human body, proanthocyanidin A2 has been detected, but not quantified in, several different foods, such as chinese cinnamons, ceylon cinnamons, lingonberries, cinnamons, and peanuts. This could make proanthocyanidin A2 a potential biomarker for the consumption of these foods. Procyanidin A2 is a A type proanthocyanidin. Procyanidin B2 can be converted into procyanidin A2 by radical oxidation using 1,1-diphenyl-2-picrylhydrazyl (DPPH) radicals under neutral conditions.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI

Procyanidin dimer A2
  Mrv1572001071617282D          

 42 48  0  0  1  0            999 V2000
    9.9383  -16.3796    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    9.9384  -17.2045    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   10.6548  -15.9641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4230  -17.2381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2286  -15.9633    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2287  -17.6165    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   11.3681  -16.3805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6548  -15.1393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4232  -18.0631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5119  -16.3788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7065  -18.4784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5119  -17.2036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0847  -15.9649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3679  -14.7273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1397  -18.4793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7953  -15.9660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7100  -19.3034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8023  -17.6191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0846  -15.1400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8012  -16.3813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1364  -19.3075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0787  -16.3849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4198  -19.7161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0003  -19.7085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0822  -17.2097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8092  -18.4440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8011  -14.7281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8530  -19.7170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3621  -15.9721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4164  -20.5377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9934  -20.5300    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   10.6998  -20.9462    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   10.6964  -21.7746    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2769  -20.9419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5636  -20.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2736  -21.7669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8470  -20.9308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5535  -22.1721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8816  -21.7590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1339  -20.5112    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1203  -22.1644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6468  -17.6219    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  1  3  1  0  0  0  0
  1  4  1  1  0  0  0
  1  5  1  0  0  0  0
  2  6  1  0  0  0  0
  3  8  1  0  0  0  0
  3  7  2  0  0  0  0
  4  9  1  0  0  0  0
  5 10  1  0  0  0  0
  6 11  1  1  0  0  0
  6 12  1  0  0  0  0
  7 13  1  0  0  0  0
  8 14  2  0  0  0  0
  9 15  1  0  0  0  0
  9 11  2  0  0  0  0
 10 16  1  0  0  0  0
 10 12  2  0  0  0  0
 11 17  1  0  0  0  0
 12 18  1  0  0  0  0
 13 19  2  0  0  0  0
 13 20  1  0  0  0  0
 14 19  1  0  0  0  0
 15 21  2  0  0  0  0
 16 22  2  0  0  0  0
 17 23  2  0  0  0  0
 17 24  1  0  0  0  0
 18 25  2  0  0  0  0
 18 26  1  0  0  0  0
 19 27  1  0  0  0  0
 21 28  1  0  0  0  0
 21 23  1  0  0  0  0
 22 29  1  0  0  0  0
 22 25  1  0  0  0  0
 23 30  1  0  0  0  0
 24 31  1  0  0  0  0
 30 32  1  0  0  0  0
 31 32  1  0  0  0  0
 31 34  1  1  0  0  0
 32 33  1  1  0  0  0
 34 35  1  0  0  0  0
 34 36  2  0  0  0  0
 35 37  2  0  0  0  0
 36 38  1  0  0  0  0
 37 39  1  0  0  0  0
 37 40  1  0  0  0  0
 38 39  2  0  0  0  0
 39 41  1  0  0  0  0
  2 42  1  6  0  0  0
M  END

HMDB0037655
     RDKit          3D
Proanthocyanidin A2
 66 72  0  0  0  0  0  0  0  0999 V2000
    3.1167   -4.7817    2.8111 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4759   -3.6857    2.2289 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1539   -3.3658    2.5090 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5301   -2.2843    1.9338 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7913   -2.0224    2.2550 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2020   -1.4712    1.0532 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5055   -1.7971    0.7836 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1651   -2.8967    1.3563 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2411   -1.0264   -0.0826 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8099    0.2765   -0.5204 C   0  0  1  0  0  0  0  0  0  0  0  0
    4.0322    1.1465   -0.4611 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2822    0.5828   -0.3768 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3899    1.3489   -0.2451 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2249    2.7475   -0.1984 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3605    3.4960   -0.0651 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9878    3.3004   -0.2873 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8363    4.6762   -0.2414 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8399    2.5176   -0.4205 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3364    0.0549   -1.8137 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0158   -0.2485   -2.0230 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5400   -0.4219   -3.2973 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7753   -0.7203   -3.5794 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2300   -0.8903   -4.8864 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6547   -0.8395   -2.4777 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1983   -0.6656   -1.1883 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1202   -0.3822   -0.9504 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6097   -0.2621    0.4380 C   0  0  2  0  0  0  0  0  0  0  0  0
    1.7675    0.7638    0.4208 C   0  0  1  0  0  0  0  0  0  0  0  0
    2.2745    0.7431    1.7073 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1925   -0.7805   -0.1684 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4457   -0.2584   -0.6713 C   0  0  2  0  0  0  0  0  0  0  0  0
   -4.3308    0.3822    0.2473 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6549    0.5558   -0.1331 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5221    1.2959    0.6428 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0979    1.8716    1.8090 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0116    2.6328    2.5812 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7943    1.7220    2.2360 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3931    2.2814    3.3627 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9250    0.9604    1.4169 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9292   -1.3528   -1.5683 C   0  0  2  0  0  0  0  0  0  0  0  0
   -3.5878   -2.6101   -1.0157 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0486   -1.2253   -2.8350 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6171   -4.6788    3.6811 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6401   -4.0337    3.2223 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2600   -2.6373    2.9079 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2140   -3.1166    1.1036 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3222   -0.5218   -0.4266 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.3592    0.8795   -0.1813 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.2684    3.0287    0.0029 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6619    5.2374   -0.1293 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8531    2.9443   -0.4905 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1824   -0.3227   -4.1949 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2035   -1.1082   -5.0140 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1610    0.1537    1.1411 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3617    1.7380    0.1754 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1621    1.6335    2.1296 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1465    0.5764   -1.4373 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0711    0.1310   -1.0307 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5672    1.4359    0.3381 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9514    2.7715    2.2603 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1244    2.6662    4.1337 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9281    0.8712    1.7846 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9802   -1.3709   -1.8109 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9594   -3.0854   -1.6048 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4728   -0.3762   -3.4307 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0515   -2.1831   -3.4159 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  4  6  2  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  1  6
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 14 16  1  0
 16 17  1  0
 16 18  2  0
 10 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 25 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 37 39  2  0
 31 40  1  0
 40 41  1  0
 40 42  1  0
  8  2  1  0
 28 10  1  0
 39 32  1  0
 27  6  1  0
 18 11  1  0
 26 20  1  0
 42 24  1  0
  1 43  1  0
  3 44  1  0
  5 45  1  0
  8 46  1  0
 12 47  1  0
 13 48  1  0
 15 49  1  0
 17 50  1  0
 18 51  1  0
 21 52  1  0
 23 53  1  0
 27 54  1  1
 28 55  1  6
 29 56  1  0
 31 57  1  6
 33 58  1  0
 34 59  1  0
 36 60  1  0
 38 61  1  0
 39 62  1  0
 40 63  1  6
 41 64  1  0
 42 65  1  0
 42 66  1  0
M  END

Procyanidin dimer A2
  Mrv1572001071617282D          

 42 48  0  0  1  0            999 V2000
    9.9383  -16.3796    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    9.9384  -17.2045    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   10.6548  -15.9641    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4230  -17.2381    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2286  -15.9633    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2287  -17.6165    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   11.3681  -16.3805    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6548  -15.1393    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4232  -18.0631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5119  -16.3788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7065  -18.4784    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5119  -17.2036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0847  -15.9649    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3679  -14.7273    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1397  -18.4793    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7953  -15.9660    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7100  -19.3034    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8023  -17.6191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0846  -15.1400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8012  -16.3813    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1364  -19.3075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0787  -16.3849    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4198  -19.7161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0003  -19.7085    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.0822  -17.2097    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8092  -18.4440    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8011  -14.7281    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8530  -19.7170    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3621  -15.9721    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4164  -20.5377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9934  -20.5300    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   10.6998  -20.9462    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
   10.6964  -21.7746    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2769  -20.9419    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5636  -20.5222    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2736  -21.7669    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8470  -20.9308    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5535  -22.1721    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8816  -21.7590    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1339  -20.5112    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1203  -22.1644    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.6468  -17.6219    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  1  3  1  0  0  0  0
  1  4  1  1  0  0  0
  1  5  1  0  0  0  0
  2  6  1  0  0  0  0
  3  8  1  0  0  0  0
  3  7  2  0  0  0  0
  4  9  1  0  0  0  0
  5 10  1  0  0  0  0
  6 11  1  1  0  0  0
  6 12  1  0  0  0  0
  7 13  1  0  0  0  0
  8 14  2  0  0  0  0
  9 15  1  0  0  0  0
  9 11  2  0  0  0  0
 10 16  1  0  0  0  0
 10 12  2  0  0  0  0
 11 17  1  0  0  0  0
 12 18  1  0  0  0  0
 13 19  2  0  0  0  0
 13 20  1  0  0  0  0
 14 19  1  0  0  0  0
 15 21  2  0  0  0  0
 16 22  2  0  0  0  0
 17 23  2  0  0  0  0
 17 24  1  0  0  0  0
 18 25  2  0  0  0  0
 18 26  1  0  0  0  0
 19 27  1  0  0  0  0
 21 28  1  0  0  0  0
 21 23  1  0  0  0  0
 22 29  1  0  0  0  0
 22 25  1  0  0  0  0
 23 30  1  0  0  0  0
 24 31  1  0  0  0  0
 30 32  1  0  0  0  0
 31 32  1  0  0  0  0
 31 34  1  1  0  0  0
 32 33  1  1  0  0  0
 34 35  1  0  0  0  0
 34 36  2  0  0  0  0
 35 37  2  0  0  0  0
 36 38  1  0  0  0  0
 37 39  1  0  0  0  0
 37 40  1  0  0  0  0
 38 39  2  0  0  0  0
 39 41  1  0  0  0  0
  2 42  1  6  0  0  0
M  END
> <DATABASE_ID>
HMDB0037655

> <DATABASE_NAME>
hmdb

> <SMILES>
O[C@@H]1CC2=C(O[C@@H]1C1=CC=C(O)C(O)=C1)C1=C(O[C@@]3(OC4=C([C@H]1[C@H]3O)C(O)=CC(O)=C4)C1=CC(O)=C(O)C=C1)C=C2O

> <INCHI_IDENTIFIER>
InChI=1S/C30H24O12/c31-13-7-20(37)24-22(8-13)41-30(12-2-4-16(33)19(36)6-12)29(39)26(24)25-23(42-30)10-17(34)14-9-21(38)27(40-28(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,21,26-27,29,31-39H,9H2/t21-,26-,27-,29-,30+/m1/s1

> <INCHI_KEY>
NSEWTSAADLNHNH-LSBOWGMISA-N

> <FORMULA>
C30H24O12

> <MOLECULAR_WEIGHT>
576.51

> <EXACT_MASS>
576.126776213

> <JCHEM_ACCEPTOR_COUNT>
12

> <JCHEM_ATOM_COUNT>
66

> <JCHEM_AVERAGE_POLARIZABILITY>
55.55253424337233

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
9

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
(1R,5R,6R,13S,21R)-5,13-bis(3,4-dihydroxyphenyl)-4,12,14-trioxapentacyclo[11.7.1.0²,¹¹.0³,⁸.0¹⁵,²⁰]henicosa-2(11),3(8),9,15(20),16,18-hexaene-6,9,17,19,21-pentol

> <ALOGPS_LOGP>
2.43

> <JCHEM_LOGP>
3.590532096666666

> <ALOGPS_LOGS>
-3.66

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
7

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA>
9.10475378074171

> <JCHEM_PKA_STRONGEST_ACIDIC>
8.663185265721914

> <JCHEM_PKA_STRONGEST_BASIC>
-3.877330901014532

> <JCHEM_POLAR_SURFACE_AREA>
209.75999999999996

> <JCHEM_REFRACTIVITY>
144.1963

> <JCHEM_ROTATABLE_BOND_COUNT>
2

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
1.27e-01 g/l

> <JCHEM_TRADITIONAL_IUPAC>
(1R,5R,6R,13S,21R)-5,13-bis(3,4-dihydroxyphenyl)-4,12,14-trioxapentacyclo[11.7.1.0²,¹¹.0³,⁸.0¹⁵,²⁰]henicosa-2(11),3(8),9,15(20),16,18-hexaene-6,9,17,19,21-pentol

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0037655
     RDKit          3D
Proanthocyanidin A2
 66 72  0  0  0  0  0  0  0  0999 V2000
    3.1167   -4.7817    2.8111 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4759   -3.6857    2.2289 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1539   -3.3658    2.5090 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5301   -2.2843    1.9338 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7913   -2.0224    2.2550 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2020   -1.4712    1.0532 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5055   -1.7971    0.7836 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1651   -2.8967    1.3563 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2411   -1.0264   -0.0826 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8099    0.2765   -0.5204 C   0  0  1  0  0  0  0  0  0  0  0  0
    4.0322    1.1465   -0.4611 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2822    0.5828   -0.3768 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3899    1.3489   -0.2451 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2249    2.7475   -0.1984 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3605    3.4960   -0.0651 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9878    3.3004   -0.2873 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8363    4.6762   -0.2414 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8399    2.5176   -0.4205 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3364    0.0549   -1.8137 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0158   -0.2485   -2.0230 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5400   -0.4219   -3.2973 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7753   -0.7203   -3.5794 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2300   -0.8903   -4.8864 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6547   -0.8395   -2.4777 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1983   -0.6656   -1.1883 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1202   -0.3822   -0.9504 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6097   -0.2621    0.4380 C   0  0  2  0  0  0  0  0  0  0  0  0
    1.7675    0.7638    0.4208 C   0  0  1  0  0  0  0  0  0  0  0  0
    2.2745    0.7431    1.7073 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1925   -0.7805   -0.1684 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4457   -0.2584   -0.6713 C   0  0  2  0  0  0  0  0  0  0  0  0
   -4.3308    0.3822    0.2473 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6549    0.5558   -0.1331 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5221    1.2959    0.6428 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0979    1.8716    1.8090 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0116    2.6328    2.5812 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7943    1.7220    2.2360 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3931    2.2814    3.3627 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9250    0.9604    1.4169 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9292   -1.3528   -1.5683 C   0  0  2  0  0  0  0  0  0  0  0  0
   -3.5878   -2.6101   -1.0157 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0486   -1.2253   -2.8350 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6171   -4.6788    3.6811 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6401   -4.0337    3.2223 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2600   -2.6373    2.9079 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2140   -3.1166    1.1036 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3222   -0.5218   -0.4266 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.3592    0.8795   -0.1813 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.2684    3.0287    0.0029 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6619    5.2374   -0.1293 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8531    2.9443   -0.4905 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1824   -0.3227   -4.1949 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2035   -1.1082   -5.0140 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1610    0.1537    1.1411 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3617    1.7380    0.1754 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1621    1.6335    2.1296 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1465    0.5764   -1.4373 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0711    0.1310   -1.0307 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5672    1.4359    0.3381 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9514    2.7715    2.2603 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1244    2.6662    4.1337 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9281    0.8712    1.7846 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9802   -1.3709   -1.8109 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9594   -3.0854   -1.6048 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4728   -0.3762   -3.4307 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0515   -2.1831   -3.4159 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  4  6  2  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  1  6
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 14 16  1  0
 16 17  1  0
 16 18  2  0
 10 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 25 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 37 39  2  0
 31 40  1  0
 40 41  1  0
 40 42  1  0
  8  2  1  0
 28 10  1  0
 39 32  1  0
 27  6  1  0
 18 11  1  0
 26 20  1  0
 42 24  1  0
  1 43  1  0
  3 44  1  0
  5 45  1  0
  8 46  1  0
 12 47  1  0
 13 48  1  0
 15 49  1  0
 17 50  1  0
 18 51  1  0
 21 52  1  0
 23 53  1  0
 27 54  1  1
 28 55  1  6
 29 56  1  0
 31 57  1  6
 33 58  1  0
 34 59  1  0
 36 60  1  0
 38 61  1  0
 39 62  1  0
 40 63  1  6
 41 64  1  0
 42 65  1  0
 42 66  1  0
M  END

HEADER    PROTEIN                                 07-JAN-16   NONE
TITLE     NULL                                                        
COMPND    MOLECULE: Procyanidin dimer A2                              
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   07-JAN-16         0                                  
HETATM    1  C   UNK     0      18.551 -30.575   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      18.552 -32.115   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0      19.889 -29.800   0.000  0.00  0.00           C+0
HETATM    4  O   UNK     0      21.323 -32.178   0.000  0.00  0.00           O+0
HETATM    5  O   UNK     0      17.227 -29.798   0.000  0.00  0.00           O+0
HETATM    6  C   UNK     0      17.227 -32.884   0.000  0.00  0.00           C+0
HETATM    7  C   UNK     0      21.220 -30.577   0.000  0.00  0.00           C+0
HETATM    8  C   UNK     0      19.889 -28.260   0.000  0.00  0.00           C+0
HETATM    9  C   UNK     0      21.323 -33.718   0.000  0.00  0.00           C+0
HETATM   10  C   UNK     0      15.889 -30.574   0.000  0.00  0.00           C+0
HETATM   11  C   UNK     0      19.985 -34.493   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0      15.889 -32.113   0.000  0.00  0.00           C+0
HETATM   13  C   UNK     0      22.558 -29.801   0.000  0.00  0.00           C+0
HETATM   14  C   UNK     0      21.220 -27.491   0.000  0.00  0.00           C+0
HETATM   15  C   UNK     0      22.661 -34.495   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0      14.551 -29.803   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0      19.992 -36.033   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0      14.564 -32.889   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0      22.558 -28.261   0.000  0.00  0.00           C+0
HETATM   20  O   UNK     0      23.896 -30.578   0.000  0.00  0.00           O+0
HETATM   21  C   UNK     0      22.655 -36.041   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0      13.214 -30.585   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0      21.317 -36.803   0.000  0.00  0.00           C+0
HETATM   24  O   UNK     0      18.667 -36.789   0.000  0.00  0.00           O+0
HETATM   25  C   UNK     0      13.220 -32.125   0.000  0.00  0.00           C+0
HETATM   26  O   UNK     0      14.577 -34.429   0.000  0.00  0.00           O+0
HETATM   27  O   UNK     0      23.895 -27.492   0.000  0.00  0.00           O+0
HETATM   28  O   UNK     0      23.992 -36.805   0.000  0.00  0.00           O+0
HETATM   29  O   UNK     0      11.876 -29.815   0.000  0.00  0.00           O+0
HETATM   30  C   UNK     0      21.311 -38.337   0.000  0.00  0.00           C+0
HETATM   31  C   UNK     0      18.654 -38.323   0.000  0.00  0.00           C+0
HETATM   32  C   UNK     0      19.973 -39.100   0.000  0.00  0.00           C+0
HETATM   33  O   UNK     0      19.967 -40.646   0.000  0.00  0.00           O+0
HETATM   34  C   UNK     0      17.317 -39.092   0.000  0.00  0.00           C+0
HETATM   35  C   UNK     0      15.985 -38.308   0.000  0.00  0.00           C+0
HETATM   36  C   UNK     0      17.311 -40.632   0.000  0.00  0.00           C+0
HETATM   37  C   UNK     0      14.648 -39.071   0.000  0.00  0.00           C+0
HETATM   38  C   UNK     0      15.967 -41.388   0.000  0.00  0.00           C+0
HETATM   39  C   UNK     0      14.712 -40.617   0.000  0.00  0.00           C+0
HETATM   40  O   UNK     0      13.317 -38.288   0.000  0.00  0.00           O+0
HETATM   41  O   UNK     0      13.291 -41.374   0.000  0.00  0.00           O+0
HETATM   42  O   UNK     0      19.874 -32.894   0.000  0.00  0.00           O+0
CONECT    1    2    3    4    5                                             
CONECT    2    1    6   42                                                  
CONECT    3    1    8    7                                                  
CONECT    4    1    9                                                       
CONECT    5    1   10                                                       
CONECT    6    2   11   12                                                  
CONECT    7    3   13                                                       
CONECT    8    3   14                                                       
CONECT    9    4   15   11                                                  
CONECT   10    5   16   12                                                  
CONECT   11    6    9   17                                                  
CONECT   12    6   10   18                                                  
CONECT   13    7   19   20                                                  
CONECT   14    8   19                                                       
CONECT   15    9   21                                                       
CONECT   16   10   22                                                       
CONECT   17   11   23   24                                                  
CONECT   18   12   25   26                                                  
CONECT   19   13   14   27                                                  
CONECT   20   13                                                            
CONECT   21   15   28   23                                                  
CONECT   22   16   29   25                                                  
CONECT   23   17   21   30                                                  
CONECT   24   17   31                                                       
CONECT   25   18   22                                                       
CONECT   26   18                                                            
CONECT   27   19                                                            
CONECT   28   21                                                            
CONECT   29   22                                                            
CONECT   30   23   32                                                       
CONECT   31   24   32   34                                                  
CONECT   32   30   31   33                                                  
CONECT   33   32                                                            
CONECT   34   31   35   36                                                  
CONECT   35   34   37                                                       
CONECT   36   34   38                                                       
CONECT   37   35   39   40                                                  
CONECT   38   36   39                                                       
CONECT   39   37   38   41                                                  
CONECT   40   37                                                            
CONECT   41   39                                                            
CONECT   42    2                                                            
MASTER        0    0    0    0    0    0    0    0   42    0   96    0
END

COMPND    HMDB0037655
HETATM    1  O1  UNL     1       3.117  -4.782   2.811  1.00  0.00           O  
HETATM    2  C1  UNL     1       2.476  -3.686   2.229  1.00  0.00           C  
HETATM    3  C2  UNL     1       1.154  -3.366   2.509  1.00  0.00           C  
HETATM    4  C3  UNL     1       0.530  -2.284   1.934  1.00  0.00           C  
HETATM    5  O2  UNL     1      -0.791  -2.022   2.255  1.00  0.00           O  
HETATM    6  C4  UNL     1       1.202  -1.471   1.053  1.00  0.00           C  
HETATM    7  C5  UNL     1       2.505  -1.797   0.784  1.00  0.00           C  
HETATM    8  C6  UNL     1       3.165  -2.897   1.356  1.00  0.00           C  
HETATM    9  O3  UNL     1       3.241  -1.026  -0.083  1.00  0.00           O  
HETATM   10  C7  UNL     1       2.810   0.277  -0.520  1.00  0.00           C  
HETATM   11  C8  UNL     1       4.032   1.146  -0.461  1.00  0.00           C  
HETATM   12  C9  UNL     1       5.282   0.583  -0.377  1.00  0.00           C  
HETATM   13  C10 UNL     1       6.390   1.349  -0.245  1.00  0.00           C  
HETATM   14  C11 UNL     1       6.225   2.747  -0.198  1.00  0.00           C  
HETATM   15  O4  UNL     1       7.361   3.496  -0.065  1.00  0.00           O  
HETATM   16  C12 UNL     1       4.988   3.300  -0.287  1.00  0.00           C  
HETATM   17  O5  UNL     1       4.836   4.676  -0.241  1.00  0.00           O  
HETATM   18  C13 UNL     1       3.840   2.518  -0.420  1.00  0.00           C  
HETATM   19  O6  UNL     1       2.336   0.055  -1.814  1.00  0.00           O  
HETATM   20  C14 UNL     1       1.016  -0.249  -2.023  1.00  0.00           C  
HETATM   21  C15 UNL     1       0.540  -0.422  -3.297  1.00  0.00           C  
HETATM   22  C16 UNL     1      -0.775  -0.720  -3.579  1.00  0.00           C  
HETATM   23  O7  UNL     1      -1.230  -0.890  -4.886  1.00  0.00           O  
HETATM   24  C17 UNL     1      -1.655  -0.840  -2.478  1.00  0.00           C  
HETATM   25  C18 UNL     1      -1.198  -0.666  -1.188  1.00  0.00           C  
HETATM   26  C19 UNL     1       0.120  -0.382  -0.950  1.00  0.00           C  
HETATM   27  C20 UNL     1       0.610  -0.262   0.438  1.00  0.00           C  
HETATM   28  C21 UNL     1       1.767   0.764   0.421  1.00  0.00           C  
HETATM   29  O8  UNL     1       2.274   0.743   1.707  1.00  0.00           O  
HETATM   30  O9  UNL     1      -2.192  -0.781  -0.168  1.00  0.00           O  
HETATM   31  C22 UNL     1      -3.446  -0.258  -0.671  1.00  0.00           C  
HETATM   32  C23 UNL     1      -4.331   0.382   0.247  1.00  0.00           C  
HETATM   33  C24 UNL     1      -5.655   0.556  -0.133  1.00  0.00           C  
HETATM   34  C25 UNL     1      -6.522   1.296   0.643  1.00  0.00           C  
HETATM   35  C26 UNL     1      -6.098   1.872   1.809  1.00  0.00           C  
HETATM   36  O10 UNL     1      -7.012   2.633   2.581  1.00  0.00           O  
HETATM   37  C27 UNL     1      -4.794   1.722   2.236  1.00  0.00           C  
HETATM   38  O11 UNL     1      -4.393   2.281   3.363  1.00  0.00           O  
HETATM   39  C28 UNL     1      -3.925   0.960   1.417  1.00  0.00           C  
HETATM   40  C29 UNL     1      -3.929  -1.353  -1.568  1.00  0.00           C  
HETATM   41  O12 UNL     1      -3.588  -2.610  -1.016  1.00  0.00           O  
HETATM   42  C30 UNL     1      -3.049  -1.225  -2.835  1.00  0.00           C  
HETATM   43  H1  UNL     1       3.617  -4.679   3.681  1.00  0.00           H  
HETATM   44  H2  UNL     1       0.640  -4.034   3.222  1.00  0.00           H  
HETATM   45  H3  UNL     1      -1.260  -2.637   2.908  1.00  0.00           H  
HETATM   46  H4  UNL     1       4.214  -3.117   1.104  1.00  0.00           H  
HETATM   47  H5  UNL     1       5.322  -0.522  -0.427  1.00  0.00           H  
HETATM   48  H6  UNL     1       7.359   0.880  -0.181  1.00  0.00           H  
HETATM   49  H7  UNL     1       8.268   3.029   0.003  1.00  0.00           H  
HETATM   50  H8  UNL     1       5.662   5.237  -0.129  1.00  0.00           H  
HETATM   51  H9  UNL     1       2.853   2.944  -0.490  1.00  0.00           H  
HETATM   52  H10 UNL     1       1.182  -0.323  -4.195  1.00  0.00           H  
HETATM   53  H11 UNL     1      -2.204  -1.108  -5.014  1.00  0.00           H  
HETATM   54  H12 UNL     1      -0.161   0.154   1.141  1.00  0.00           H  
HETATM   55  H13 UNL     1       1.362   1.738   0.175  1.00  0.00           H  
HETATM   56  H14 UNL     1       2.162   1.633   2.130  1.00  0.00           H  
HETATM   57  H15 UNL     1      -3.146   0.576  -1.437  1.00  0.00           H  
HETATM   58  H16 UNL     1      -6.071   0.131  -1.031  1.00  0.00           H  
HETATM   59  H17 UNL     1      -7.567   1.436   0.338  1.00  0.00           H  
HETATM   60  H18 UNL     1      -7.951   2.771   2.260  1.00  0.00           H  
HETATM   61  H19 UNL     1      -4.124   2.666   4.134  1.00  0.00           H  
HETATM   62  H20 UNL     1      -2.928   0.871   1.785  1.00  0.00           H  
HETATM   63  H21 UNL     1      -4.980  -1.371  -1.811  1.00  0.00           H  
HETATM   64  H22 UNL     1      -2.959  -3.085  -1.605  1.00  0.00           H  
HETATM   65  H23 UNL     1      -3.473  -0.376  -3.431  1.00  0.00           H  
HETATM   66  H24 UNL     1      -3.052  -2.183  -3.416  1.00  0.00           H  
CONECT    1    2   43
CONECT    2    3    3    8
CONECT    3    4   44
CONECT    4    5    6    6
CONECT    5   45
CONECT    6    7   27
CONECT    7    8    8    9
CONECT    8   46
CONECT    9   10
CONECT   10   11   19   28
CONECT   11   12   12   18
CONECT   12   13   47
CONECT   13   14   14   48
CONECT   14   15   16
CONECT   15   49
CONECT   16   17   18   18
CONECT   17   50
CONECT   18   51
CONECT   19   20
CONECT   20   21   21   26
CONECT   21   22   52
CONECT   22   23   24   24
CONECT   23   53
CONECT   24   25   42
CONECT   25   26   26   30
CONECT   26   27
CONECT   27   28   54
CONECT   28   29   55
CONECT   29   56
CONECT   30   31
CONECT   31   32   40   57
CONECT   32   33   33   39
CONECT   33   34   58
CONECT   34   35   35   59
CONECT   35   36   37
CONECT   36   60
CONECT   37   38   39   39
CONECT   38   61
CONECT   39   62
CONECT   40   41   42   63
CONECT   41   64
CONECT   42   65   66
END

HMDB0037655
     RDKit          3D
Proanthocyanidin A2
 66 72  0  0  0  0  0  0  0  0999 V2000
    3.1167   -4.7817    2.8111 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4759   -3.6857    2.2289 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1539   -3.3658    2.5090 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5301   -2.2843    1.9338 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7913   -2.0224    2.2550 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2020   -1.4712    1.0532 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5055   -1.7971    0.7836 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1651   -2.8967    1.3563 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2411   -1.0264   -0.0826 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.8099    0.2765   -0.5204 C   0  0  1  0  0  0  0  0  0  0  0  0
    4.0322    1.1465   -0.4611 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2822    0.5828   -0.3768 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3899    1.3489   -0.2451 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2249    2.7475   -0.1984 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3605    3.4960   -0.0651 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9878    3.3004   -0.2873 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8363    4.6762   -0.2414 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8399    2.5176   -0.4205 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3364    0.0549   -1.8137 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.0158   -0.2485   -2.0230 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5400   -0.4219   -3.2973 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7753   -0.7203   -3.5794 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2300   -0.8903   -4.8864 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6547   -0.8395   -2.4777 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1983   -0.6656   -1.1883 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1202   -0.3822   -0.9504 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6097   -0.2621    0.4380 C   0  0  2  0  0  0  0  0  0  0  0  0
    1.7675    0.7638    0.4208 C   0  0  1  0  0  0  0  0  0  0  0  0
    2.2745    0.7431    1.7073 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1925   -0.7805   -0.1684 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4457   -0.2584   -0.6713 C   0  0  2  0  0  0  0  0  0  0  0  0
   -4.3308    0.3822    0.2473 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.6549    0.5558   -0.1331 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.5221    1.2959    0.6428 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0979    1.8716    1.8090 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0116    2.6328    2.5812 O   0  0  0  0  0  0  0  0  0  0  0  0
   -4.7943    1.7220    2.2360 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.3931    2.2814    3.3627 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9250    0.9604    1.4169 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9292   -1.3528   -1.5683 C   0  0  2  0  0  0  0  0  0  0  0  0
   -3.5878   -2.6101   -1.0157 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0486   -1.2253   -2.8350 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6171   -4.6788    3.6811 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6401   -4.0337    3.2223 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2600   -2.6373    2.9079 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2140   -3.1166    1.1036 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.3222   -0.5218   -0.4266 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.3592    0.8795   -0.1813 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.2684    3.0287    0.0029 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6619    5.2374   -0.1293 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8531    2.9443   -0.4905 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1824   -0.3227   -4.1949 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2035   -1.1082   -5.0140 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1610    0.1537    1.1411 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3617    1.7380    0.1754 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1621    1.6335    2.1296 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1465    0.5764   -1.4373 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0711    0.1310   -1.0307 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.5672    1.4359    0.3381 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9514    2.7715    2.2603 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1244    2.6662    4.1337 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9281    0.8712    1.7846 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9802   -1.3709   -1.8109 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9594   -3.0854   -1.6048 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4728   -0.3762   -3.4307 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0515   -2.1831   -3.4159 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  3  4  1  0
  4  5  1  0
  4  6  2  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  1  0
 10 11  1  6
 11 12  2  0
 12 13  1  0
 13 14  2  0
 14 15  1  0
 14 16  1  0
 16 17  1  0
 16 18  2  0
 10 19  1  0
 19 20  1  0
 20 21  2  0
 21 22  1  0
 22 23  1  0
 22 24  2  0
 24 25  1  0
 25 26  2  0
 26 27  1  0
 27 28  1  0
 28 29  1  0
 25 30  1  0
 30 31  1  0
 31 32  1  0
 32 33  2  0
 33 34  1  0
 34 35  2  0
 35 36  1  0
 35 37  1  0
 37 38  1  0
 37 39  2  0
 31 40  1  0
 40 41  1  0
 40 42  1  0
  8  2  1  0
 28 10  1  0
 39 32  1  0
 27  6  1  0
 18 11  1  0
 26 20  1  0
 42 24  1  0
  1 43  1  0
  3 44  1  0
  5 45  1  0
  8 46  1  0
 12 47  1  0
 13 48  1  0
 15 49  1  0
 17 50  1  0
 18 51  1  0
 21 52  1  0
 23 53  1  0
 27 54  1  1
 28 55  1  6
 29 56  1  0
 31 57  1  6
 33 58  1  0
 34 59  1  0
 36 60  1  0
 38 61  1  0
 39 62  1  0
 40 63  1  6
 41 64  1  0
 42 65  1  0
 42 66  1  0
M  END

View in JSmol View Stereo Labels

Synonyms

Value	Source
Epicatechin-(2beta->7,4beta->8)-epicatechin	ChEBI
Epicatechin-(2b->7,4b->8)-epicatechin	Generator
Epicatechin-(2β->7,4β->8)-epicatechin	Generator
(+)-Proanthocyanidin a2	HMDB
EC-(4b,8)(2b,7)-ec	HMDB
Proanthocyanidin a-2	HMDB
Procyanidin a2	HMDB
Procyanidin dimer a2	HMDB
Procyanidoepicatechin	HMDB
Procyanidol a2	HMDB

Chemical Formula

C₃₀H₂₄O₁₂

Average Molecular Weight

576.51

Monoisotopic Molecular Weight

576.126776213

IUPAC Name

(1R,5R,6R,13S,21R)-5,13-bis(3,4-dihydroxyphenyl)-4,12,14-trioxapentacyclo[11.7.1.0²,¹¹.0³,⁸.0¹⁵,²⁰]henicosa-2(11),3(8),9,15(20),16,18-hexaene-6,9,17,19,21-pentol

Traditional Name

(1R,5R,6R,13S,21R)-5,13-bis(3,4-dihydroxyphenyl)-4,12,14-trioxapentacyclo[11.7.1.0²,¹¹.0³,⁸.0¹⁵,²⁰]henicosa-2(11),3(8),9,15(20),16,18-hexaene-6,9,17,19,21-pentol

CAS Registry Number

41743-41-3

SMILES

O[C@@H]1CC2=C(O[C@@H]1C1=CC=C(O)C(O)=C1)C1=C(O[C@@]3(OC4=C([C@H]1[C@H]3O)C(O)=CC(O)=C4)C1=CC(O)=C(O)C=C1)C=C2O

InChI Identifier

InChI=1S/C30H24O12/c31-13-7-20(37)24-22(8-13)41-30(12-2-4-16(33)19(36)6-12)29(39)26(24)25-23(42-30)10-17(34)14-9-21(38)27(40-28(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,21,26-27,29,31-39H,9H2/t21-,26-,27-,29-,30+/m1/s1

InChI Key

NSEWTSAADLNHNH-LSBOWGMISA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as biflavonoids and polyflavonoids. These are organic compounds containing at least two flavan/flavone units. These units are usually linked through CC or C-O-C bonds. Some examples include C2-O-C3, C2-O-C4, C3'-C3''', and C6-C8''.

Kingdom

Organic compounds

Super Class

Phenylpropanoids and polyketides

Class

Flavonoids

Sub Class

Biflavonoids and polyflavonoids

Direct Parent

Biflavonoids and polyflavonoids

Alternative Parents

Substituents

A-type proanthocyanidin
Bi- and polyflavonoid skeleton
Proanthocyanidin
Catechin
Pyranoflavonoid
Flavan-3-ol
Hydroxyflavonoid
3'-hydroxyflavonoid
7-hydroxyflavonoid
5-hydroxyflavonoid
4'-hydroxyflavonoid
3-hydroxyflavonoid
Flavan
Pyranochromene
Chromane
1-benzopyran
Benzopyran
Catechol
Alkyl aryl ether
1-hydroxy-2-unsubstituted benzenoid
Phenol
Ketal
1-hydroxy-4-unsubstituted benzenoid
Benzenoid
Monocyclic benzene moiety
Secondary alcohol
Polyol
Acetal
Organoheterocyclic compound
Oxacycle
Ether
Hydrocarbon derivative
Alcohol
Organic oxygen compound
Organooxygen compound
Aromatic heteropolycyclic compound

Molecular Framework

Aromatic heteropolycyclic compounds

External Descriptors

proanthocyanidin (CHEBI:28472 )
hydroxyflavan (CHEBI:28472 )
Condensed tannins (Proanthocyanidins) (C10237 )

Ontology

Physiological effect

Not Available

Disposition

Biological location

Cellular substructure

Membrane (HMDB: HMDB0037655)

Apple (FooDB: FOOD00105)

Berry

Lingonberry (FooDB: FOOD00194)

Vegetable

Fruit vegetable

Avocado (FooDB: FOOD00130)

Herb and spice

Spice

Herbs and Spices (FooDB: FOOD00866)

Nut

Peanut (FooDB: FOOD00016)

Process

Not Available

Role

Biological role

anti bacterial (HMDB: HMDB0037655)
anti capillary-fragility (HMDB: HMDB0037655)
anti enzymatic (HMDB: HMDB0037655)
anti erythemic (HMDB: HMDB0037655)
anti inflammatory (HMDB: HMDB0037655)
Antioxidant (HMDB: HMDB0037655)
anti peroxidant (HMDB: HMDB0037655)
anti proteolytic (HMDB: HMDB0037655)
antiviral agent (HMDB: HMDB0037655)
sunscreen (HMDB: HMDB0037655)
venotonic (HMDB: HMDB0037655)

Modulator

Inhibitor

Enzyme inhibitor

antielastase (HMDB: HMDB0037655)
antiglucuronidase (HMDB: HMDB0037655)

Indirect biological role

antioxidant (HMDB: HMDB0037655)

Industrial application

Manufacturing industry

Material processing agent

Coloring agent

Fluorescent agent

antiviral agent (HMDB: HMDB0037655)
vulnerary (HMDB: HMDB0037655)

Agriculture

Pesticide

Insecticide

pesticide (HMDB: HMDB0037655)

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	300 °C	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	0.11 g/L	ALOGPS
logP	2.43	ALOGPS
logP	3.59	ChemAxon
logS	-3.7	ALOGPS
pKa (Strongest Acidic)	8.66	ChemAxon
pKa (Strongest Basic)	-3.9	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	12	ChemAxon
Hydrogen Donor Count	9	ChemAxon
Polar Surface Area	209.76 Å²	ChemAxon
Rotatable Bond Count	2	ChemAxon
Refractivity	144.2 m³·mol⁻¹	ChemAxon
Polarizability	55.55 Å³	ChemAxon
Number of Rings	7	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DeepCCS	[M+H]+	224.411	30932474
DeepCCS	[M-H]-	222.587	30932474
DeepCCS	[M-2H]-	256.378	30932474
DeepCCS	[M+Na]+	230.152	30932474
AllCCS	[M+H]+	235.2	32859911
AllCCS	[M+H-H2O]+	233.5	32859911
AllCCS	[M+NH4]+	236.7	32859911
AllCCS	[M+Na]+	237.1	32859911
AllCCS	[M-H]-	231.2	32859911
AllCCS	[M+Na-2H]-	232.7	32859911
AllCCS	[M+HCOO]-	234.6	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
Proanthocyanidin A2	O[C@@H]1CC2=C(O[C@@H]1C1=CC=C(O)C(O)=C1)C1=C(O[C@@]3(OC4=C([C@H]1[C@H]3O)C(O)=CC(O)=C4)C1=CC(O)=C(O)C=C1)C=C2O	7189.6	Standard polar	33892256
Proanthocyanidin A2	O[C@@H]1CC2=C(O[C@@H]1C1=CC=C(O)C(O)=C1)C1=C(O[C@@]3(OC4=C([C@H]1[C@H]3O)C(O)=CC(O)=C4)C1=CC(O)=C(O)C=C1)C=C2O	5296.0	Standard non polar	33892256
Proanthocyanidin A2	O[C@@H]1CC2=C(O[C@@H]1C1=CC=C(O)C(O)=C1)C1=C(O[C@@]3(OC4=C([C@H]1[C@H]3O)C(O)=CC(O)=C4)C1=CC(O)=C(O)C=C1)C=C2O	5729.9	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
Proanthocyanidin A2,1TMS,isomer #1	C[Si](C)(C)O[C@@H]1CC2=C(O)C=C3O[C@]4(C5=CC=C(O)C(O)=C5)OC5=CC(O)=CC(O)=C5[C@H](C3=C2O[C@@H]1C1=CC=C(O)C(O)=C1)[C@H]4O	5551.7	Semi standard non polar	33892256
Proanthocyanidin A2,1TMS,isomer #2	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)C=C1O	5559.2	Semi standard non polar	33892256
Proanthocyanidin A2,1TMS,isomer #3	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)=CC=C1O	5542.1	Semi standard non polar	33892256
Proanthocyanidin A2,1TMS,isomer #4	C[Si](C)(C)O[C@@H]1[C@@H]2C3=C(O)C=C(O)C=C3O[C@@]1(C1=CC=C(O)C(O)=C1)OC1=CC(O)=C3C[C@@H](O)[C@@H](C4=CC=C(O)C(O)=C4)OC3=C12	5517.4	Semi standard non polar	33892256
Proanthocyanidin A2,1TMS,isomer #5	C[Si](C)(C)OC1=CC(O)=CC2=C1[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@H](O)C4)O[C@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O	5534.1	Semi standard non polar	33892256
Proanthocyanidin A2,1TMS,isomer #6	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5548.8	Semi standard non polar	33892256
Proanthocyanidin A2,1TMS,isomer #7	C[Si](C)(C)OC1=CC([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O)=CC=C1O	5555.4	Semi standard non polar	33892256
Proanthocyanidin A2,1TMS,isomer #8	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O)C=C1O	5553.6	Semi standard non polar	33892256
Proanthocyanidin A2,1TMS,isomer #9	C[Si](C)(C)OC1=CC2=C(C3=C1C[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O3)[C@H]1C3=C(O)C=C(O)C=C3O[C@@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O	5470.3	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #1	C[Si](C)(C)OC1=CC2=C(C3=C1C[C@@H](O[Si](C)(C)C)[C@@H](C1=CC=C(O)C(O)=C1)O3)[C@H]1C3=C(O)C=C(O)C=C3O[C@@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O	5357.1	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #10	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)C=C1O	5413.0	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #11	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O[Si](C)(C)C)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5392.5	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #12	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O[Si](C)(C)C)C(O)=C4)(O2)[C@@H]3O)C=C1O	5415.4	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #13	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O)C=C1O	5415.8	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #14	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O[Si](C)(C)C)C=C1O	5394.1	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #15	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)C=C1O[Si](C)(C)C	5379.3	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #16	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)=CC=C1O	5323.4	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #17	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)=CC=C1O	5384.9	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #18	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O[Si](C)(C)C)=C5)OC4=C3[C@@H]2[C@H]1O	5368.8	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #19	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O[Si](C)(C)C)=C4)[C@H](O)C5)O2)[C@H]3O)C=C1O	5382.0	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #2	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)C=C1O	5412.7	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #20	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O)=CC=C1O	5391.8	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #21	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O[Si](C)(C)C)=CC=C1O	5372.6	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #22	C[Si](C)(C)OC1=CC(O)=CC2=C1[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@H](O)C4)O[C@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O[Si](C)(C)C	5413.5	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #23	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O[Si](C)(C)C	5389.7	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #24	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O[Si](C)(C)C)C=C1O	5385.7	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #25	C[Si](C)(C)OC1=CC([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O[Si](C)(C)C)=CC=C1O	5391.6	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #26	C[Si](C)(C)OC1=CC2=C(C3=C1C[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O3)[C@H]1C3=C(O)C=C(O)C=C3O[C@@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O[Si](C)(C)C	5322.7	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #27	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@H](O)C4)O[C@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O	5384.3	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #28	C[Si](C)(C)OC1=CC2=C(C3=C1C[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O3)[C@H]1C3=C(C=C(O)C=C3O[Si](C)(C)C)O[C@@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O	5348.1	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #29	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O[Si](C)(C)C)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O)C=C1O	5403.7	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #3	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)=CC=C1O	5394.1	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #30	C[Si](C)(C)OC1=CC([C@]23OC4=CC(O)=CC(O[Si](C)(C)C)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O)=CC=C1O	5410.4	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #31	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5378.0	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #32	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5386.5	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #33	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5331.5	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #34	C[Si](C)(C)OC1=CC([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O[Si](C)(C)C)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O)=CC=C1O	5344.6	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #35	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O)C=C1O[Si](C)(C)C	5372.7	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #36	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O[Si](C)(C)C)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O)C=C1O	5329.1	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #4	C[Si](C)(C)OC1=CC(O)=CC2=C1[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@H](O[Si](C)(C)C)C4)O[C@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O	5425.3	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #5	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O)=C4C[C@@H](O[Si](C)(C)C)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5406.6	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #6	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O[Si](C)(C)C)C5)O2)[C@H]3O)C=C1O	5403.0	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #7	C[Si](C)(C)OC1=CC([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O[Si](C)(C)C)C5)O2)[C@H]3O)=CC=C1O	5405.1	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #8	C[Si](C)(C)O[C@@H]1CC2=C(O)C=C3O[C@]4(C5=CC=C(O)C(O)=C5)OC5=CC(O)=CC(O)=C5[C@H](C3=C2O[C@@H]1C1=CC=C(O)C(O)=C1)[C@H]4O[Si](C)(C)C	5413.0	Semi standard non polar	33892256
Proanthocyanidin A2,2TMS,isomer #9	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)C=C1O	5347.7	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #1	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)C=C1O	5195.1	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #10	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O[Si](C)(C)C)C(O)=C4)(O2)[C@@H]3O)C=C1O	5195.4	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #11	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O)C=C1O	5207.3	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #12	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O[Si](C)(C)C)C=C1O	5240.3	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #13	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)C=C1O[Si](C)(C)C	5261.2	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #14	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)=CC=C1O	5274.7	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #15	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O)=C4C[C@@H](O[Si](C)(C)C)[C@@H](C5=CC=C(O)C(O[Si](C)(C)C)=C5)OC4=C3[C@@H]2[C@H]1O	5211.7	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #16	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O[Si](C)(C)C)=C4)[C@H](O[Si](C)(C)C)C5)O2)[C@H]3O)C=C1O	5182.4	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #17	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O)=CC=C1O	5194.8	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #18	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O[Si](C)(C)C)=CC=C1O	5233.3	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #19	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@H](O[Si](C)(C)C)C4)O[C@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O	5276.3	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #2	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)=CC=C1O	5191.1	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #20	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O[Si](C)(C)C)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O[Si](C)(C)C)C5)O2)[C@H]3O)C=C1O	5278.3	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #21	C[Si](C)(C)OC1=CC([C@]23OC4=CC(O)=CC(O[Si](C)(C)C)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O[Si](C)(C)C)C5)O2)[C@H]3O)=CC=C1O	5291.4	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #22	C[Si](C)(C)OC1=CC(O)=CC2=C1[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@H](O[Si](C)(C)C)C4)O[C@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O[Si](C)(C)C	5311.7	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #23	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=C4C[C@@H](O[Si](C)(C)C)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5204.6	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #24	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=C4C[C@@H](O[Si](C)(C)C)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5224.1	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #25	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O)=C4C[C@@H](O[Si](C)(C)C)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O[Si](C)(C)C	5258.9	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #26	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O[Si](C)(C)C)C5)O2)[C@H]3O[Si](C)(C)C)C=C1O	5237.4	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #27	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O[Si](C)(C)C)C5)O2)[C@H]3O)C=C1O[Si](C)(C)C	5256.7	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #28	C[Si](C)(C)OC1=CC([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O[Si](C)(C)C)C5)O2)[C@H]3O[Si](C)(C)C)=CC=C1O	5246.5	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #29	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)C=C1O	5205.5	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #3	C[Si](C)(C)OC1=CC2=C(C3=C1C[C@@H](O[Si](C)(C)C)[C@@H](C1=CC=C(O)C(O)=C1)O3)[C@H]1C3=C(C=C(O)C=C3O[Si](C)(C)C)O[C@@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O	5255.7	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #30	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=C4C[C@@H](O)[C@@H](C5=CC=C(O[Si](C)(C)C)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5138.1	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #31	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O[Si](C)(C)C)C(O)=C4)(O2)[C@@H]3O)C=C1O	5104.4	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #32	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O)C=C1O	5121.5	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #33	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O[Si](C)(C)C)C=C1O	5157.7	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #34	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)C=C1O[Si](C)(C)C	5194.8	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #35	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)[C@H](O)C4)O[C@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O	5218.8	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #36	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O[Si](C)(C)C)C(O)=C4)(O2)[C@@H]3O)C=C1O	5204.1	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #37	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O)C=C1O	5214.6	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #38	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O[Si](C)(C)C)C=C1O	5284.4	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #39	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)C=C1O[Si](C)(C)C	5279.4	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #4	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=C4C[C@@H](O[Si](C)(C)C)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5214.1	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #40	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O[Si](C)(C)C)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5150.8	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #41	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O[Si](C)(C)C)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5164.7	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #42	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O[Si](C)(C)C)C(O)=C5)OC4=C3[C@@H]2[C@H]1O[Si](C)(C)C	5199.0	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #43	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)OC4=C3[C@@H]2[C@H]1O	5227.9	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #44	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O)C=C1O	5205.2	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #45	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O[Si](C)(C)C)C(O)=C4)(O2)[C@@H]3O[Si](C)(C)C)C=C1O	5154.4	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #46	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)[C@H](O)C5)O2)[C@H]3O)C=C1O	5188.0	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #47	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O[Si](C)(C)C)C=C1O	5167.9	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #48	C[Si](C)(C)OC1=CC([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)[C@H](O)C5)O2)[C@H]3O)=CC=C1O	5199.0	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #49	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O[Si](C)(C)C)C=C1O[Si](C)(C)C	5227.5	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #5	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O[Si](C)(C)C)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O[Si](C)(C)C)C5)O2)[C@H]3O)C=C1O	5183.7	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #50	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)=CC=C1O	5188.3	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #51	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O[Si](C)(C)C)=C5)OC4=C3[C@@H]2[C@H]1O	5128.7	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #52	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O[Si](C)(C)C)C5=C4O[C@H](C4=CC=C(O)C(O[Si](C)(C)C)=C4)[C@H](O)C5)O2)[C@H]3O)C=C1O	5087.7	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #53	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O)=CC=C1O	5103.6	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #54	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O[Si](C)(C)C)=CC=C1O	5145.2	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #55	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@H](O)C4)O[C@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O	5205.8	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #56	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O[Si](C)(C)C)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O[Si](C)(C)C)=C4)[C@H](O)C5)O2)[C@H]3O)C=C1O	5182.7	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #57	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O)=CC=C1O	5190.0	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #58	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O[Si](C)(C)C)=CC=C1O	5261.7	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #59	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O[Si](C)(C)C)=C5)OC4=C3[C@@H]2[C@H]1O	5135.7	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #6	C[Si](C)(C)OC1=CC([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O[Si](C)(C)C)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O[Si](C)(C)C)C5)O2)[C@H]3O)=CC=C1O	5201.6	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #60	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O[Si](C)(C)C)=C5)OC4=C3[C@@H]2[C@H]1O	5146.6	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #61	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O[Si](C)(C)C)=C5)OC4=C3[C@@H]2[C@H]1O[Si](C)(C)C	5186.0	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #62	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O[Si](C)(C)C)=C4)[C@H](O)C5)O2)[C@H]3O[Si](C)(C)C)C=C1O	5137.8	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #63	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O)=CC=C1O	5182.6	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #64	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O[Si](C)(C)C)=CC=C1O	5146.7	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #65	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@H](O)C4)O[C@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O[Si](C)(C)C	5266.6	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #66	C[Si](C)(C)OC1=CC2=C(C3=C1C[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O3)[C@H]1C3=C(C=C(O)C=C3O[Si](C)(C)C)O[C@@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O[Si](C)(C)C	5244.7	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #67	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O[Si](C)(C)C)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O[Si](C)(C)C)C=C1O	5278.6	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #68	C[Si](C)(C)OC1=CC([C@]23OC4=CC(O)=CC(O[Si](C)(C)C)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O[Si](C)(C)C)=CC=C1O	5288.5	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #69	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O[Si](C)(C)C	5181.7	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #7	C[Si](C)(C)OC1=CC2=C(C3=C1C[C@@H](O[Si](C)(C)C)[C@@H](C1=CC=C(O)C(O)=C1)O3)[C@H]1C3=C(O)C=C(O)C=C3O[C@@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O[Si](C)(C)C	5203.9	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #70	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O[Si](C)(C)C	5200.6	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #71	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O[Si](C)(C)C	5181.1	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #72	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O[Si](C)(C)C)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O[Si](C)(C)C)C=C1O	5145.9	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #73	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O[Si](C)(C)C)C=C1O[Si](C)(C)C	5232.9	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #74	C[Si](C)(C)OC1=CC([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O[Si](C)(C)C)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O[Si](C)(C)C)=CC=C1O	5166.1	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #75	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@H](O)C4)O[C@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O	5207.0	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #76	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@H](O)C4)O[C@](C3=CC=C(O[Si](C)(C)C)C(O)=C3)(O2)[C@@H]1O	5205.8	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #77	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@H](O)C4)O[C@](C3=CC=C(O)C(O[Si](C)(C)C)=C3)(O2)[C@@H]1O	5221.9	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #78	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O[Si](C)(C)C)=C4[C@H](C4=C(C=C(O[Si](C)(C)C)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O)C=C1O	5193.2	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #79	C[Si](C)(C)OC1=CC([C@]23OC4=CC(O)=CC(O[Si](C)(C)C)=C4[C@H](C4=C(C=C(O[Si](C)(C)C)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O)=CC=C1O	5209.4	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #8	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)C=C1O	5283.3	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #80	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O[Si](C)(C)C)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O)C=C1O[Si](C)(C)C	5282.6	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #81	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5226.8	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #82	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O[Si](C)(C)C)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5126.8	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #83	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5149.4	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #84	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O[Si](C)(C)C)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O)C=C1O[Si](C)(C)C	5191.9	Semi standard non polar	33892256
Proanthocyanidin A2,3TMS,isomer #9	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O)=C4C[C@@H](O[Si](C)(C)C)[C@@H](C5=CC=C(O[Si](C)(C)C)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5219.1	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #1	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)C=C1O	5079.4	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #10	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O)=CC=C1O	4957.1	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #100	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O)=CC=C1O	4964.8	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #101	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O[Si](C)(C)C)=CC=C1O	4897.0	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #102	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@H](O)C4)O[C@](C3=CC=C(O[Si](C)(C)C)C(O)=C3)(O2)[C@@H]1O	4964.2	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #103	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@H](O)C4)O[C@](C3=CC=C(O)C(O[Si](C)(C)C)=C3)(O2)[C@@H]1O	4976.1	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #104	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@H](O)C4)O[C@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O[Si](C)(C)C	5074.6	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #105	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O[Si](C)(C)C)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O[Si](C)(C)C)=C4)[C@H](O)C5)O2)[C@H]3O[Si](C)(C)C)C=C1O	5010.3	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #106	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O)=CC=C1O	5033.4	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #107	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O[Si](C)(C)C)=CC=C1O	5021.3	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #108	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O[Si](C)(C)C)=C5)OC4=C3[C@@H]2[C@H]1O	5009.7	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #109	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O[Si](C)(C)C)=C5)OC4=C3[C@@H]2[C@H]1O[Si](C)(C)C	4922.9	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #11	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O[Si](C)(C)C)=CC=C1O	5033.6	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #110	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O[Si](C)(C)C)=C5)OC4=C3[C@@H]2[C@H]1O[Si](C)(C)C	4932.7	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #111	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O[Si](C)(C)C)=CC=C1O	4995.0	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #112	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@H](O)C4)O[C@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O[Si](C)(C)C	5087.9	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #113	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@H](O)C4)O[C@](C3=CC=C(O[Si](C)(C)C)C(O)=C3)(O2)[C@@H]1O[Si](C)(C)C	5069.2	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #114	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@H](O)C4)O[C@](C3=CC=C(O)C(O[Si](C)(C)C)=C3)(O2)[C@@H]1O[Si](C)(C)C	5090.5	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #115	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O[Si](C)(C)C)=C4[C@H](C4=C(C=C(O[Si](C)(C)C)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O[Si](C)(C)C)C=C1O	5054.3	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #116	C[Si](C)(C)OC1=CC([C@]23OC4=CC(O)=CC(O[Si](C)(C)C)=C4[C@H](C4=C(C=C(O[Si](C)(C)C)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O[Si](C)(C)C)=CC=C1O	5071.9	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #117	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O[Si](C)(C)C)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O[Si](C)(C)C)C=C1O[Si](C)(C)C	5158.2	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #118	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O[Si](C)(C)C	5069.9	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #119	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O[Si](C)(C)C)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O[Si](C)(C)C	4960.6	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #12	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@H](O[Si](C)(C)C)C4)O[C@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O	5113.8	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #120	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O[Si](C)(C)C	4979.7	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #121	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O[Si](C)(C)C)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O[Si](C)(C)C)C=C1O[Si](C)(C)C	5039.0	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #122	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@H](O)C4)O[C@](C3=CC=C(O[Si](C)(C)C)C(O)=C3)(O2)[C@@H]1O	4987.9	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #123	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@H](O)C4)O[C@](C3=CC=C(O)C(O[Si](C)(C)C)=C3)(O2)[C@@H]1O	5007.9	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #124	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@H](O)C4)O[C@](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)(O2)[C@@H]1O	5100.6	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #125	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O[Si](C)(C)C)=C4[C@H](C4=C(C=C(O[Si](C)(C)C)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O)C=C1O[Si](C)(C)C	5084.7	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #126	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5027.0	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #13	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O[Si](C)(C)C)=C4[C@H](C4=C(C=C(O[Si](C)(C)C)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O[Si](C)(C)C)C5)O2)[C@H]3O)C=C1O	5078.5	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #14	C[Si](C)(C)OC1=CC([C@]23OC4=CC(O)=CC(O[Si](C)(C)C)=C4[C@H](C4=C(C=C(O[Si](C)(C)C)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O[Si](C)(C)C)C5)O2)[C@H]3O)=CC=C1O	5096.3	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #15	C[Si](C)(C)OC1=CC2=C(C3=C1C[C@@H](O[Si](C)(C)C)[C@@H](C1=CC=C(O)C(O)=C1)O3)[C@H]1C3=C(C=C(O)C=C3O[Si](C)(C)C)O[C@@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O[Si](C)(C)C	5147.1	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #16	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O[Si](C)(C)C)=C4C[C@@H](O[Si](C)(C)C)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5000.7	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #17	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=C4C[C@@H](O[Si](C)(C)C)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5023.6	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #18	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=C4C[C@@H](O[Si](C)(C)C)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O[Si](C)(C)C	5081.8	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #19	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O[Si](C)(C)C)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O[Si](C)(C)C)C5)O2)[C@H]3O[Si](C)(C)C)C=C1O	5022.8	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #2	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=C4C[C@@H](O[Si](C)(C)C)[C@@H](C5=CC=C(O[Si](C)(C)C)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5003.5	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #20	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O[Si](C)(C)C)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O[Si](C)(C)C)C5)O2)[C@H]3O)C=C1O[Si](C)(C)C	5082.7	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #21	C[Si](C)(C)OC1=CC([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O[Si](C)(C)C)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O[Si](C)(C)C)C5)O2)[C@H]3O[Si](C)(C)C)=CC=C1O	5045.4	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #22	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)[C@H](O[Si](C)(C)C)C4)O[C@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O	5081.9	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #23	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O[Si](C)(C)C)C(O)=C4)(O2)[C@@H]3O)C=C1O	5008.5	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #24	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O)C=C1O	5018.8	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #25	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O[Si](C)(C)C)C=C1O	5143.4	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #26	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)C=C1O[Si](C)(C)C	5169.2	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #27	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=C4C[C@@H](O[Si](C)(C)C)[C@@H](C5=CC=C(O[Si](C)(C)C)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	4964.3	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #28	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=C4C[C@@H](O[Si](C)(C)C)[C@@H](C5=CC=C(O[Si](C)(C)C)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	4978.2	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #29	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O)=C4C[C@@H](O[Si](C)(C)C)[C@@H](C5=CC=C(O[Si](C)(C)C)C(O)=C5)OC4=C3[C@@H]2[C@H]1O[Si](C)(C)C	5053.3	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #3	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O[Si](C)(C)C)C(O)=C4)(O2)[C@@H]3O)C=C1O	4941.2	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #30	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O)=C4C[C@@H](O[Si](C)(C)C)[C@@H](C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)OC4=C3[C@@H]2[C@H]1O	5107.8	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #31	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O)C=C1O	5027.7	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #32	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O[Si](C)(C)C)C(O)=C4)(O2)[C@@H]3O[Si](C)(C)C)C=C1O	4965.4	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #33	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)[C@H](O[Si](C)(C)C)C5)O2)[C@H]3O)C=C1O	5026.9	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #34	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O[Si](C)(C)C)C=C1O	4985.7	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #35	C[Si](C)(C)OC1=CC([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)[C@H](O[Si](C)(C)C)C5)O2)[C@H]3O)=CC=C1O	5038.3	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #36	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O[Si](C)(C)C)C=C1O[Si](C)(C)C	5113.9	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #37	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@H](O[Si](C)(C)C)C4)O[C@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O	5084.8	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #38	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O[Si](C)(C)C)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O[Si](C)(C)C)=C4)[C@H](O[Si](C)(C)C)C5)O2)[C@H]3O)C=C1O	5014.8	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #39	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O)=CC=C1O	5019.2	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #4	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O)C=C1O	4956.3	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #40	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O[Si](C)(C)C)=CC=C1O	5146.9	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #41	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=C4C[C@@H](O[Si](C)(C)C)[C@@H](C5=CC=C(O)C(O[Si](C)(C)C)=C5)OC4=C3[C@@H]2[C@H]1O	4968.6	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #42	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=C4C[C@@H](O[Si](C)(C)C)[C@@H](C5=CC=C(O)C(O[Si](C)(C)C)=C5)OC4=C3[C@@H]2[C@H]1O	4978.4	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #43	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O)=C4C[C@@H](O[Si](C)(C)C)[C@@H](C5=CC=C(O)C(O[Si](C)(C)C)=C5)OC4=C3[C@@H]2[C@H]1O[Si](C)(C)C	5056.7	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #44	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O[Si](C)(C)C)=C4)[C@H](O[Si](C)(C)C)C5)O2)[C@H]3O[Si](C)(C)C)C=C1O	4973.8	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #45	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O)=CC=C1O	5027.2	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #46	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O[Si](C)(C)C)=CC=C1O	4986.5	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #47	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@H](O[Si](C)(C)C)C4)O[C@](C3=CC=C(O[Si](C)(C)C)C(O)=C3)(O2)[C@@H]1O	5077.5	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #48	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@H](O[Si](C)(C)C)C4)O[C@](C3=CC=C(O)C(O[Si](C)(C)C)=C3)(O2)[C@@H]1O	5094.8	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #49	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@H](O[Si](C)(C)C)C4)O[C@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O[Si](C)(C)C	5159.3	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #5	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O[Si](C)(C)C)C=C1O	5026.5	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #50	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O[Si](C)(C)C)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O[Si](C)(C)C)C5)O2)[C@H]3O[Si](C)(C)C)C=C1O	5138.6	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #51	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O[Si](C)(C)C)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O[Si](C)(C)C)C5)O2)[C@H]3O)C=C1O[Si](C)(C)C	5164.9	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #52	C[Si](C)(C)OC1=CC([C@]23OC4=CC(O)=CC(O[Si](C)(C)C)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O[Si](C)(C)C)C5)O2)[C@H]3O[Si](C)(C)C)=CC=C1O	5159.9	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #53	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=C4C[C@@H](O[Si](C)(C)C)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5101.1	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #54	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=C4C[C@@H](O[Si](C)(C)C)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O[Si](C)(C)C	5038.3	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #55	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=C4C[C@@H](O[Si](C)(C)C)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O[Si](C)(C)C	5061.7	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #56	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O[Si](C)(C)C)C5)O2)[C@H]3O[Si](C)(C)C)C=C1O[Si](C)(C)C	5113.7	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #57	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)[C@H](O)C4)O[C@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O	4990.5	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #58	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O[Si](C)(C)C)C(O)=C4)(O2)[C@@H]3O)C=C1O	4947.8	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #59	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O)C=C1O	4962.1	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #6	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)C=C1O[Si](C)(C)C	5089.6	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #60	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O[Si](C)(C)C)C=C1O	5061.4	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #61	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)C=C1O[Si](C)(C)C	5080.1	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #62	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O[Si](C)(C)C)=C4C[C@@H](O)[C@@H](C5=CC=C(O[Si](C)(C)C)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	4934.7	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #63	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=C4C[C@@H](O)[C@@H](C5=CC=C(O[Si](C)(C)C)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	4944.4	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #64	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=C4C[C@@H](O)[C@@H](C5=CC=C(O[Si](C)(C)C)C(O)=C5)OC4=C3[C@@H]2[C@H]1O[Si](C)(C)C	4969.2	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #65	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=C4C[C@@H](O)[C@@H](C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)OC4=C3[C@@H]2[C@H]1O	5016.3	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #66	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O)C=C1O	4979.5	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #67	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O[Si](C)(C)C)C(O)=C4)(O2)[C@@H]3O[Si](C)(C)C)C=C1O	4899.4	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #68	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O[Si](C)(C)C)C5=C4O[C@H](C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)[C@H](O)C5)O2)[C@H]3O)C=C1O	4961.7	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #69	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O[Si](C)(C)C)C=C1O	4914.5	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #7	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)=CC=C1O	5086.3	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #70	C[Si](C)(C)OC1=CC([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O[Si](C)(C)C)C5=C4O[C@H](C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)[C@H](O)C5)O2)[C@H]3O)=CC=C1O	4975.0	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #71	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O[Si](C)(C)C)C=C1O[Si](C)(C)C	5032.3	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #72	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)[C@H](O)C4)O[C@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O	5096.4	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #73	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)[C@H](O)C4)O[C@](C3=CC=C(O[Si](C)(C)C)C(O)=C3)(O2)[C@@H]1O	4971.4	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #74	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)[C@H](O)C4)O[C@](C3=CC=C(O)C(O[Si](C)(C)C)=C3)(O2)[C@@H]1O	4986.9	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #75	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O[Si](C)(C)C)C(O)=C3)[C@H](O)C4)O[C@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O[Si](C)(C)C	5080.5	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #76	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O)C=C1O	5047.5	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #77	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O[Si](C)(C)C)C(O)=C4)(O2)[C@@H]3O[Si](C)(C)C)C=C1O	5024.1	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #78	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O[Si](C)(C)C)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)[C@H](O)C5)O2)[C@H]3O)C=C1O	5030.6	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #79	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O[Si](C)(C)C)C=C1O	5038.7	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #8	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=C4C[C@@H](O[Si](C)(C)C)[C@@H](C5=CC=C(O)C(O[Si](C)(C)C)=C5)OC4=C3[C@@H]2[C@H]1O	5010.9	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #80	C[Si](C)(C)OC1=CC([C@]23OC4=CC(O)=CC(O[Si](C)(C)C)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)[C@H](O)C5)O2)[C@H]3O)=CC=C1O	5043.5	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #81	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O[Si](C)(C)C)C=C1O[Si](C)(C)C	5150.9	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #82	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O[Si](C)(C)C)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5021.4	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #83	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O[Si](C)(C)C)C(O)=C5)OC4=C3[C@@H]2[C@H]1O[Si](C)(C)C	4935.6	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #84	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)OC4=C3[C@@H]2[C@H]1O	5003.9	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #85	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O[Si](C)(C)C)C(O)=C5)OC4=C3[C@@H]2[C@H]1O[Si](C)(C)C	4948.8	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #86	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)OC4=C3[C@@H]2[C@H]1O	5016.8	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #87	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C5)OC4=C3[C@@H]2[C@H]1O[Si](C)(C)C	5070.8	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #88	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O[Si](C)(C)C)C=C1O	5009.5	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #89	C[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O)C=C1O[Si](C)(C)C	5056.3	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #9	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O[Si](C)(C)C)C5=C4O[C@H](C4=CC=C(O)C(O[Si](C)(C)C)=C4)[C@H](O[Si](C)(C)C)C5)O2)[C@H]3O)C=C1O	4947.1	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #90	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)[C@H](O)C5)O2)[C@H]3O[Si](C)(C)C)C=C1O	4994.5	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #91	C[Si](C)(C)OC1=CC([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O[Si](C)(C)C)C(O[Si](C)(C)C)=C4)[C@H](O)C5)O2)[C@H]3O[Si](C)(C)C)=CC=C1O	5010.6	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #92	C[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C)=C1)[C@@H]1C3=C(C=C(O[Si](C)(C)C)C4=C3O[C@H](C3=CC=C(O)C(O[Si](C)(C)C)=C3)[C@H](O)C4)O[C@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O	4987.6	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #93	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O[Si](C)(C)C)=C4[C@H](C4=C(C=C(O[Si](C)(C)C)C5=C4O[C@H](C4=CC=C(O)C(O[Si](C)(C)C)=C4)[C@H](O)C5)O2)[C@H]3O)C=C1O	4939.1	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #94	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O)C(O[Si](C)(C)C)=C4)(O2)[C@@H]3O)=CC=C1O	4948.8	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #95	C[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O)C(O[Si](C)(C)C)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C)O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O[Si](C)(C)C)=CC=C1O	5054.6	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #96	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O[Si](C)(C)C)C(O)=C3)OC3=CC(O[Si](C)(C)C)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O[Si](C)(C)C)=C5)OC4=C3[C@@H]2[C@H]1O	4924.9	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #97	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O[Si](C)(C)C)=C3)OC3=CC(O[Si](C)(C)C)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O[Si](C)(C)C)=C5)OC4=C3[C@@H]2[C@H]1O	4933.7	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #98	C[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O[Si](C)(C)C)=C5)OC4=C3[C@@H]2[C@H]1O[Si](C)(C)C	4964.4	Semi standard non polar	33892256
Proanthocyanidin A2,4TMS,isomer #99	C[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O[Si](C)(C)C)C5=C4O[C@H](C4=CC=C(O)C(O[Si](C)(C)C)=C4)[C@H](O)C5)O2)[C@H]3O[Si](C)(C)C)C=C1O	4890.3	Semi standard non polar	33892256
Proanthocyanidin A2,1TBDMS,isomer #1	CC(C)(C)[Si](C)(C)O[C@@H]1CC2=C(O)C=C3O[C@]4(C5=CC=C(O)C(O)=C5)OC5=CC(O)=CC(O)=C5[C@H](C3=C2O[C@@H]1C1=CC=C(O)C(O)=C1)[C@H]4O	5754.1	Semi standard non polar	33892256
Proanthocyanidin A2,1TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)C=C1O	5810.5	Semi standard non polar	33892256
Proanthocyanidin A2,1TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)=CC=C1O	5793.5	Semi standard non polar	33892256
Proanthocyanidin A2,1TBDMS,isomer #4	CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H]2C3=C(O)C=C(O)C=C3O[C@@]1(C1=CC=C(O)C(O)=C1)OC1=CC(O)=C3C[C@@H](O)[C@@H](C4=CC=C(O)C(O)=C4)OC3=C12	5737.9	Semi standard non polar	33892256
Proanthocyanidin A2,1TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@H](O)C4)O[C@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O	5769.7	Semi standard non polar	33892256
Proanthocyanidin A2,1TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5755.0	Semi standard non polar	33892256
Proanthocyanidin A2,1TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1=CC([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O)=CC=C1O	5800.9	Semi standard non polar	33892256
Proanthocyanidin A2,1TBDMS,isomer #8	CC(C)(C)[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O)C=C1O	5791.9	Semi standard non polar	33892256
Proanthocyanidin A2,1TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1=CC2=C(C3=C1C[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O3)[C@H]1C3=C(O)C=C(O)C=C3O[C@@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O	5715.5	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #1	CC(C)(C)[Si](C)(C)OC1=CC2=C(C3=C1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C1=CC=C(O)C(O)=C1)O3)[C@H]1C3=C(O)C=C(O)C=C3O[C@@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O	5855.2	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #10	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C(C)(C)C)O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)C=C1O	5907.3	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #11	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5871.1	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #12	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C4)(O2)[C@@H]3O)C=C1O	5897.7	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #13	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)(O2)[C@@H]3O)C=C1O	5904.0	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #14	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O[Si](C)(C)C(C)(C)C)C=C1O	5861.8	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #15	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)C=C1O[Si](C)(C)C(C)(C)C	5881.4	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #16	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O)C(O[Si](C)(C)C(C)(C)C)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)=CC=C1O	5809.0	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #17	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(C=C(O)C=C4O[Si](C)(C)C(C)(C)C)O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)=CC=C1O	5890.6	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #18	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C5)OC4=C3[C@@H]2[C@H]1O	5852.7	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #19	CC(C)(C)[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)[C@H](O)C5)O2)[C@H]3O)C=C1O	5862.8	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #2	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C(C)(C)C)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)C=C1O	5895.3	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #20	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C4)(O2)[C@@H]3O)=CC=C1O	5872.3	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #21	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O[Si](C)(C)C(C)(C)C)=CC=C1O	5852.3	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #22	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@H](O)C4)O[C@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O[Si](C)(C)C(C)(C)C	5899.4	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #23	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O[Si](C)(C)C(C)(C)C	5855.8	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #24	CC(C)(C)[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O[Si](C)(C)C(C)(C)C)C=C1O	5850.9	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #25	CC(C)(C)[Si](C)(C)OC1=CC([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O[Si](C)(C)C(C)(C)C)=CC=C1O	5865.9	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #26	CC(C)(C)[Si](C)(C)OC1=CC2=C(C3=C1C[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O3)[C@H]1C3=C(O)C=C(O)C=C3O[C@@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O[Si](C)(C)C(C)(C)C	5814.3	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #27	CC(C)(C)[Si](C)(C)OC1=CC2=C(C(O[Si](C)(C)C(C)(C)C)=C1)[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@H](O)C4)O[C@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O	5877.0	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #28	CC(C)(C)[Si](C)(C)OC1=CC2=C(C3=C1C[C@@H](O)[C@@H](C1=CC=C(O)C(O)=C1)O3)[C@H]1C3=C(C=C(O)C=C3O[Si](C)(C)C(C)(C)C)O[C@@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O	5852.0	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #29	CC(C)(C)[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O)C=C1O	5894.8	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #3	CC(C)(C)[Si](C)(C)OC1=CC([C@H]2OC3=C(C[C@H]2O[Si](C)(C)C(C)(C)C)C(O)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)=CC=C1O	5883.2	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #30	CC(C)(C)[Si](C)(C)OC1=CC([C@]23OC4=CC(O)=CC(O[Si](C)(C)C(C)(C)C)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O)=CC=C1O	5907.6	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #31	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O[Si](C)(C)C(C)(C)C)C(O)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5848.7	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #32	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O[Si](C)(C)C(C)(C)C)=C3)OC3=CC(O)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5861.7	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #33	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O[Si](C)(C)C(C)(C)C)=C4C[C@@H](O)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5818.0	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #34	CC(C)(C)[Si](C)(C)OC1=CC([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O[Si](C)(C)C(C)(C)C)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O)=CC=C1O	5813.7	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #35	CC(C)(C)[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O)C=C1O[Si](C)(C)C(C)(C)C	5866.9	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #36	CC(C)(C)[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O[Si](C)(C)C(C)(C)C)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O)C5)O2)[C@H]3O)C=C1O	5803.7	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #4	CC(C)(C)[Si](C)(C)OC1=CC(O)=CC2=C1[C@@H]1C3=C(C=C(O)C4=C3O[C@H](C3=CC=C(O)C(O)=C3)[C@H](O[Si](C)(C)C(C)(C)C)C4)O[C@](C3=CC=C(O)C(O)=C3)(O2)[C@@H]1O	5904.9	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #5	CC(C)(C)[Si](C)(C)OC1=CC(O)=C2C(=C1)O[C@@]1(C3=CC=C(O)C(O)=C3)OC3=CC(O)=C4C[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](C5=CC=C(O)C(O)=C5)OC4=C3[C@@H]2[C@H]1O	5878.6	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #6	CC(C)(C)[Si](C)(C)OC1=CC=C([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O[Si](C)(C)C(C)(C)C)C5)O2)[C@H]3O)C=C1O	5875.3	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #7	CC(C)(C)[Si](C)(C)OC1=CC([C@]23OC4=CC(O)=CC(O)=C4[C@H](C4=C(C=C(O)C5=C4O[C@H](C4=CC=C(O)C(O)=C4)[C@H](O[Si](C)(C)C(C)(C)C)C5)O2)[C@H]3O)=CC=C1O	5889.3	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #8	CC(C)(C)[Si](C)(C)O[C@@H]1CC2=C(O)C=C3O[C@]4(C5=CC=C(O)C(O)=C5)OC5=CC(O)=CC(O)=C5[C@H](C3=C2O[C@@H]1C1=CC=C(O)C(O)=C1)[C@H]4O[Si](C)(C)C(C)(C)C	5883.3	Semi standard non polar	33892256
Proanthocyanidin A2,2TBDMS,isomer #9	CC(C)(C)[Si](C)(C)OC1=CC=C([C@H]2OC3=C(C[C@H]2O)C(O[Si](C)(C)C(C)(C)C)=CC2=C3[C@H]3C4=C(O)C=C(O)C=C4O[C@@](C4=CC=C(O)C(O)=C4)(O2)[C@@H]3O)C=C1O	5827.4	Semi standard non polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - Proanthocyanidin A2 GC-MS (Non-derivatized) - 70eV, Positive	splash10-0ab9-0502790000-304f891b1b3211f028e2	2017-09-01	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Proanthocyanidin A2 GC-MS (1 TMS) - 70eV, Positive	splash10-05d0-9501045000-a879ec29ba94548eeefc	2017-10-06	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Proanthocyanidin A2 GC-MS ("Proanthocyanidin A2,1TMS,#1" TMS) - 70eV, Positive	Not Available	2021-10-14	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Proanthocyanidin A2 GC-MS (TMS_1_2) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Proanthocyanidin A2 GC-MS (TMS_1_3) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Proanthocyanidin A2 GC-MS (TMS_1_4) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Proanthocyanidin A2 GC-MS (TMS_1_5) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Proanthocyanidin A2 GC-MS (TMS_1_6) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Proanthocyanidin A2 GC-MS (TMS_1_7) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Proanthocyanidin A2 GC-MS (TMS_1_8) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Proanthocyanidin A2 GC-MS (TMS_1_9) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Proanthocyanidin A2 GC-MS (TMS_2_1) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Proanthocyanidin A2 GC-MS (TMS_2_2) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Proanthocyanidin A2 GC-MS (TMS_2_3) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Proanthocyanidin A2 GC-MS (TMS_2_4) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Proanthocyanidin A2 GC-MS (TMS_2_5) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Proanthocyanidin A2 GC-MS (TMS_2_6) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Proanthocyanidin A2 GC-MS (TMS_2_7) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Proanthocyanidin A2 GC-MS (TMS_2_8) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Proanthocyanidin A2 GC-MS (TMS_2_9) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Proanthocyanidin A2 GC-MS (TMS_2_10) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Proanthocyanidin A2 GC-MS (TMS_2_11) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Proanthocyanidin A2 GC-MS (TMS_2_12) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Proanthocyanidin A2 GC-MS (TMS_2_13) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum
Predicted GC-MS	Predicted GC-MS Spectrum - Proanthocyanidin A2 GC-MS (TMS_2_14) - 70eV, Positive	Not Available	2021-10-15	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Proanthocyanidin A2 10V, Positive-QTOF	splash10-056r-0310690000-54ea277863ce3855e4f2	2017-06-28	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Proanthocyanidin A2 20V, Positive-QTOF	splash10-056r-0600930000-0793c36e7b827dadce6b	2017-06-28	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Proanthocyanidin A2 40V, Positive-QTOF	splash10-0a4i-0900010000-eb8f4971f0158e4f45e6	2017-06-28	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Proanthocyanidin A2 10V, Negative-QTOF	splash10-004i-0110290000-ced82e7f8aa80a1b71ad	2017-06-28	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Proanthocyanidin A2 20V, Negative-QTOF	splash10-0pk9-0910470000-77ee610d048e0f3bfd15	2017-06-28	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Proanthocyanidin A2 40V, Negative-QTOF	splash10-0a6r-0910000000-d53675b4ba6a9383bc64	2017-06-28	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Proanthocyanidin A2 10V, Negative-QTOF	splash10-004i-0000090000-97b4f0ce6c2f2f87ffc0	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Proanthocyanidin A2 20V, Negative-QTOF	splash10-004i-0000390000-a31ae9550ae47c29b14a	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Proanthocyanidin A2 40V, Negative-QTOF	splash10-00di-0230960000-c4d953d28ea849c22545	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Proanthocyanidin A2 10V, Positive-QTOF	splash10-004i-0000090000-0dcabebc8b6917f57a62	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Proanthocyanidin A2 20V, Positive-QTOF	splash10-004i-0010690000-044c8d9bc85848e48151	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - Proanthocyanidin A2 40V, Positive-QTOF	splash10-00di-1900660000-e3c8e610d8a5925f9195	2021-09-24	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Membrane

Biospecimen Locations

Not Available

Tissue Locations

Not Available

Pathways

Not Available

Name	SMPDB/PathBank	KEGG

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

FDB016778

KNApSAcK ID

C00002934

Chemspider ID

Not Available

KEGG Compound ID

C10237

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Proanthocyanidin_A2

METLIN ID

Not Available

PubChem Compound

124025

PDB ID

Not Available

ChEBI ID

28472

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

(). Yannai, Shmuel. (2004) Dictionary of food compounds with CD-ROM: Additives, flavors, and ingredients. Boca Raton: Chapman & Hall/CRC.. .

Showing metabocard for Proanthocyanidin A2 (HMDB0037655)

MOL for HMDB0037655 (Proanthocyanidin A2)

3D MOL for HMDB0037655 (Proanthocyanidin A2)

3D SDF for HMDB0037655 (Proanthocyanidin A2)

3D-SDF for HMDB0037655 (Proanthocyanidin A2)

PDB for HMDB0037655 (Proanthocyanidin A2)

3D PDB for HMDB0037655 (Proanthocyanidin A2)

SMILES for HMDB0037655 (Proanthocyanidin A2)

INCHI for HMDB0037655 (Proanthocyanidin A2)

Structure for HMDB0037655 (Proanthocyanidin A2)

3D Structure for HMDB0037655 (Proanthocyanidin A2)

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra