| Record Information |
|---|
| Version | 5.0 |
|---|
| Status | Expected but not Quantified |
|---|
| Creation Date | 2017-03-23 06:17:21 UTC |
|---|
| Update Date | 2022-03-07 03:17:59 UTC |
|---|
| HMDB ID | HMDB0062782 |
|---|
| Secondary Accession Numbers | |
|---|
| Metabolite Identification |
|---|
| Common Name | Pregnanolone |
|---|
| Description | Pregnanolone, also known as eltanolone or 3alpha-hydroxy-5beta-pregnan-20-one, belongs to the class of organic compounds known as gluco/mineralocorticoids, progestogens, and derivatives. These are steroids with a structure based on a hydroxylated prostane moiety. Pregnanolone is considered to be practically insoluble (in water) and basic. Pregnanolone is an endogenous inhibitory neurosteroid that is produced in the body from progesterone. It is closely related to allopregnanolone, which has similar properties (Wikipedia ). |
|---|
| Structure | [H][C@@]1(CC[C@@]2([H])[C@]3([H])CC[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)C(C)=O InChI=1S/C21H34O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h14-19,23H,4-12H2,1-3H3/t14-,15-,16+,17-,18+,19+,20+,21-/m1/s1 |
|---|
| Synonyms | | Value | Source |
|---|
| (3alpha,5beta)-3-Hydroxypregnan-20-one | ChEBI | | 3alpha-Hydroxy-5beta-pregnane-20-one | ChEBI | | Eltanolona | ChEBI | | Eltanolonum | ChEBI | | Pregnan-3alpha-ol-20-one | ChEBI | | Pregnanolone | ChEBI | | (3a,5b)-3-Hydroxypregnan-20-one | Generator | | (3Α,5β)-3-hydroxypregnan-20-one | Generator | | 3a-Hydroxy-5b-pregnane-20-one | Generator | | 3Α-hydroxy-5β-pregnane-20-one | Generator | | Pregnan-3a-ol-20-one | Generator | | Pregnan-3α-ol-20-one | Generator | | Pregnanolone, (3alpha, 5beta, 17-alpha)-isomer | MeSH | | alpha-Hydroxy-5 alpha-pregnan-20-one, 3 | MeSH | | 3 alpha Hydroxy 5 beta pregnan 20 one | MeSH | | 3-Hydroxypregnan-20-one | MeSH | | 3 alpha, 5 beta-Tetrahydroprogesterone | MeSH | | Pregnanolone, (3alpha)-isomer | MeSH | | 3 alpha, 5 beta Tetrahydroprogesterone | MeSH | | 3 Hydroxypregnan 20 one | MeSH | | 3 alpha-Hydroxy-5 beta-pregnan-20-one | MeSH | | Pregnanolone, (3alpha,5beta)-isomer | MeSH | | beta-Pregnan-20-one, 3 alpha-hydroxy-5 | MeSH | | Eltanolone | ChEBI | | 3a-Hydroxy-5b-pregnan-20-one | Generator | | 3Α-hydroxy-5β-pregnan-20-one | Generator | | 3-Deoxo-3alpha-hydroxy-5beta-dihydroprogesterone | HMDB | | 3-Deoxo-3α-hydroxy-5β-dihydroprogesterone | HMDB | | 3alpha,5beta-Pregnanolone | HMDB | | 3alpha,5beta-Tetrahydroprogesterone | HMDB | | 3alpha-Hydroxy-20-oxo-5beta-pregnane | HMDB | | 3alpha-Hydroxy-5beta,17beta-pregnan-20-one | HMDB | | 3alpha-Hydroxy-5beta-pregnan-20-one | HMDB | | 3alpha-Hydroxy-5beta-tetrahydroprogesterone | HMDB | | 3α,5β-Pregnanolone | HMDB | | 3α,5β-Tetrahydroprogesterone | HMDB | | 3α-Hydroxy-20-oxo-5β-pregnane | HMDB | | 3α-Hydroxy-5β,17β-pregnan-20-one | HMDB | | 3α-Hydroxy-5β-tetrahydroprogesterone | HMDB | | 5beta-Pregnan-3alpha-ol-20-one | HMDB | | 5beta-Pregnane-3alpha-ol-20-one | HMDB | | 5β-Pregnan-3α-ol-20-one | HMDB | | 5β-Pregnane-3α-ol-20-one | HMDB |
|
|---|
| Chemical Formula | C21H34O2 |
|---|
| Average Molecular Weight | 318.501 |
|---|
| Monoisotopic Molecular Weight | 318.255880335 |
|---|
| IUPAC Name | 1-[(1S,2S,5R,7R,10R,11S,14S,15S)-5-hydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl]ethan-1-one |
|---|
| Traditional Name | 1-[(1S,2S,5R,7R,10R,11S,14S,15S)-5-hydroxy-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadecan-14-yl]ethanone |
|---|
| CAS Registry Number | 128-20-1 |
|---|
| SMILES | [H][C@@]1(CC[C@@]2([H])[C@]3([H])CC[C@]4([H])C[C@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)C(C)=O |
|---|
| InChI Identifier | InChI=1S/C21H34O2/c1-13(22)17-6-7-18-16-5-4-14-12-15(23)8-10-20(14,2)19(16)9-11-21(17,18)3/h14-19,23H,4-12H2,1-3H3/t14-,15-,16+,17-,18+,19+,20+,21-/m1/s1 |
|---|
| InChI Key | AURFZBICLPNKBZ-YZRLXODZSA-N |
|---|
| Chemical Taxonomy |
|---|
| Description | Belongs to the class of organic compounds known as gluco/mineralocorticoids, progestogins and derivatives. These are steroids with a structure based on a hydroxylated prostane moiety. |
|---|
| Kingdom | Organic compounds |
|---|
| Super Class | Lipids and lipid-like molecules |
|---|
| Class | Steroids and steroid derivatives |
|---|
| Sub Class | Pregnane steroids |
|---|
| Direct Parent | Gluco/mineralocorticoids, progestogins and derivatives |
|---|
| Alternative Parents | |
|---|
| Substituents | - Progestogin-skeleton
- 20-oxosteroid
- 3-hydroxysteroid
- Hydroxysteroid
- 3-alpha-hydroxysteroid
- Oxosteroid
- Cyclic alcohol
- Ketone
- Secondary alcohol
- Organooxygen compound
- Hydrocarbon derivative
- Organic oxide
- Organic oxygen compound
- Carbonyl group
- Alcohol
- Aliphatic homopolycyclic compound
|
|---|
| Molecular Framework | Aliphatic homopolycyclic compounds |
|---|
| External Descriptors | - 3alpha-hydroxy steroid (CHEBI:1712 )
- 3-hydroxy-5beta-pregnan-20-one (CHEBI:1712 )
- C21 steroids (gluco/mineralocorticoids, progestogins) and derivatives (LMST02030175 )
|
|---|
| Ontology |
|---|
| Physiological effect | Not Available |
|---|
| Disposition | |
|---|
| Process | |
|---|
| Role | |
|---|
| Physical Properties |
|---|
| State | Not Available |
|---|
| Experimental Molecular Properties | | Property | Value | Reference |
|---|
| Melting Point | Not Available | Not Available | | Boiling Point | Not Available | Not Available | | Water Solubility | 0.0014 g/l | ALOGPS | | LogP | 4.28 | ALOGPS |
|
|---|
| Experimental Chromatographic Properties | Not Available |
|---|
| Predicted Molecular Properties | |
|---|
| Predicted Chromatographic Properties | Predicted Collision Cross SectionsPredicted Retention Times Underivatized| Chromatographic Method | Retention Time | Reference |
|---|
| Measured using a Waters Acquity ultraperformance liquid chromatography (UPLC) ethylene-bridged hybrid (BEH) C18 column (100 mm × 2.1 mm; 1.7 μmparticle diameter)). Predicted by Afia on May 17, 2022. | 7.74 minutes | 32390414 | | Predicted by Siyang on May 30, 2022 | 17.457 minutes | 33406817 | | Predicted by Siyang using ReTip algorithm on June 8, 2022 | 2.03 minutes | 32390414 | | Fem_Long = Waters ACQUITY UPLC HSS T3 C18 with Water:MeOH and 0.1% Formic Acid | 2755.4 seconds | 40023050 | | Fem_Lipids = Ascentis Express C18 with (60:40 water:ACN):(90:10 IPA:ACN) and 10mM NH4COOH + 0.1% Formic Acid | 444.8 seconds | 40023050 | | Life_Old = Waters ACQUITY UPLC BEH C18 with Water:(20:80 acetone:ACN) and 0.1% Formic Acid | 225.5 seconds | 40023050 | | Life_New = RP Waters ACQUITY UPLC HSS T3 C18 with Water:(30:70 MeOH:ACN) and 0.1% Formic Acid | 194.4 seconds | 40023050 | | RIKEN = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 527.5 seconds | 40023050 | | Eawag_XBridgeC18 = XBridge C18 3.5u 2.1x50 mm with Water:MeOH and 0.1% Formic Acid | 719.8 seconds | 40023050 | | BfG_NTS_RP1 =Agilent Zorbax Eclipse Plus C18 (2.1 mm x 150 mm, 3.5 um) with Water:ACN and 0.1% Formic Acid | 706.8 seconds | 40023050 | | HILIC_BDD_2 = Merck SeQuant ZIC-HILIC with ACN(0.1% formic acid):water(16 mM ammonium formate) | 102.5 seconds | 40023050 | | UniToyama_Atlantis = RP Waters Atlantis T3 (2.1 x 150 mm, 5 um) with ACN:Water and 0.1% Formic Acid | 1346.5 seconds | 40023050 | | BDD_C18 = Hypersil Gold 1.9µm C18 with Water:ACN and 0.1% Formic Acid | 495.6 seconds | 40023050 | | UFZ_Phenomenex = Kinetex Core-Shell C18 2.6 um, 3.0 x 100 mm, Phenomenex with Water:MeOH and 0.1% Formic Acid | 1610.9 seconds | 40023050 | | SNU_RIKEN_POS = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 419.8 seconds | 40023050 | | RPMMFDA = Waters ACQUITY UPLC BEH C18 with Water:ACN and 0.1% Formic Acid | 466.4 seconds | 40023050 | | MTBLS87 = Merck SeQuant ZIC-pHILIC column with ACN:Water and :ammonium carbonate | 263.7 seconds | 40023050 | | KI_GIAR_zic_HILIC_pH2_7 = Merck SeQuant ZIC-HILIC with ACN:Water and 0.1% FA | 443.5 seconds | 40023050 | | Meister zic-pHILIC pH9.3 = Merck SeQuant ZIC-pHILIC column with ACN:Water 5mM NH4Ac pH9.3 and 5mM ammonium acetate in water | 12.6 seconds | 40023050 |
Predicted Kovats Retention IndicesUnderivatizedDerivatized| Derivative Name / Structure | SMILES | Kovats RI Value | Column Type | Reference |
|---|
| Pregnanolone,1TMS,isomer #1 | CC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 2738.7 | Semi standard non polar | 33892256 | | Pregnanolone,1TMS,isomer #2 | CC(O[Si](C)(C)C)=C1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C | 2783.9 | Semi standard non polar | 33892256 | | Pregnanolone,1TMS,isomer #3 | C=C(O[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C | 2734.6 | Semi standard non polar | 33892256 | | Pregnanolone,2TMS,isomer #1 | CC(O[Si](C)(C)C)=C1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 2787.6 | Semi standard non polar | 33892256 | | Pregnanolone,2TMS,isomer #1 | CC(O[Si](C)(C)C)=C1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 2777.0 | Standard non polar | 33892256 | | Pregnanolone,2TMS,isomer #1 | CC(O[Si](C)(C)C)=C1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 3133.8 | Standard polar | 33892256 | | Pregnanolone,2TMS,isomer #2 | C=C(O[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 2760.9 | Semi standard non polar | 33892256 | | Pregnanolone,2TMS,isomer #2 | C=C(O[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 2765.2 | Standard non polar | 33892256 | | Pregnanolone,2TMS,isomer #2 | C=C(O[Si](C)(C)C)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O[Si](C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 3230.8 | Standard polar | 33892256 | | Pregnanolone,1TBDMS,isomer #1 | CC(=O)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 2985.7 | Semi standard non polar | 33892256 | | Pregnanolone,1TBDMS,isomer #2 | CC(O[Si](C)(C)C(C)(C)C)=C1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C | 3032.5 | Semi standard non polar | 33892256 | | Pregnanolone,1TBDMS,isomer #3 | C=C(O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O)CC[C@]4(C)[C@H]3CC[C@]12C | 2995.8 | Semi standard non polar | 33892256 | | Pregnanolone,2TBDMS,isomer #1 | CC(O[Si](C)(C)C(C)(C)C)=C1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 3282.4 | Semi standard non polar | 33892256 | | Pregnanolone,2TBDMS,isomer #1 | CC(O[Si](C)(C)C(C)(C)C)=C1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 3254.0 | Standard non polar | 33892256 | | Pregnanolone,2TBDMS,isomer #1 | CC(O[Si](C)(C)C(C)(C)C)=C1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 3369.8 | Standard polar | 33892256 | | Pregnanolone,2TBDMS,isomer #2 | C=C(O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 3288.7 | Semi standard non polar | 33892256 | | Pregnanolone,2TBDMS,isomer #2 | C=C(O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 3256.2 | Standard non polar | 33892256 | | Pregnanolone,2TBDMS,isomer #2 | C=C(O[Si](C)(C)C(C)(C)C)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@H](O[Si](C)(C)C(C)(C)C)CC[C@]4(C)[C@H]3CC[C@]12C | 3436.2 | Standard polar | 33892256 |
|
|---|