Jump To Section:

Identification Taxonomy Ontology Physical properties Spectra Biological properties Concentrations Links References enzymes (43) Show 43 proteins XML

Record Information

Version

5.0

Status

Expected but not Quantified

Creation Date

2008-09-12 01:48:00 UTC

Update Date

2022-11-30 19:03:26 UTC

HMDB ID

HMDB0009089

Secondary Accession Numbers

HMDB09089

Metabolite Identification

Common Name

PE(18:2(9Z,12Z)/16:1(9Z))

Description

PE(18:2(9Z,12Z)/16:1(9Z)) is a phosphatidylethanolamine (PE or GPEtn). It is a glycerophospholipid in which a phosphorylethanolamine moiety occupies a glycerol substitution site. As is the case with diacylglycerols, glycerophosphoethanolamines can have many different combinations of fatty acids of varying lengths and saturation attached at the C-1 and C-2 positions. Fatty acids containing 16, 18 and 20 carbons are the most common. PE(18:2(9Z,12Z)/16:1(9Z)), in particular, consists of one chain of linoleic acid at the C-1 position and one chain of palmitoleic acid at the C-2 position. The linoleic acid moiety is derived from seed oils, while the palmitoleic acid moiety is derived from animal fats and vegetable oils. Phospholipids, are ubiquitous in nature and are key components of the lipid bilayer of cells, as well as being involved in metabolism and signaling.While most phospholipids have a saturated fatty acid on C-1 and an unsaturated fatty acid on C-2 of the glycerol backbone, the fatty acid distribution at the C-1 and C-2 positions of glycerol within phospholipids is continually in flux, owing to phospholipid degradation and the continuous phospholipid remodeling that occurs while these molecules are in membranes. PEs are neutral zwitterions at physiological pH. They mostly have palmitic or stearic acid on carbon 1 and a long chain unsaturated fatty acid (e.g. 18:2, 20:4 and 22:6) on carbon 2. PE synthesis can occur via two pathways. The first requires that ethanolamine be activated by phosphorylation and then coupled to CDP. The ethanolamine is then transferred from CDP-ethanolamine to phosphatidic acid to yield PE. The second involves the decarboxylation of PS.

Structure

MOL 3D MOL SDF 3D SDF PDB 3D PDB SMILES InChI


  Mrv0541 02231223112D          

 50 49  0  0  1  0            999 V2000
   21.3385   -3.1962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6634   -3.5859    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   19.9883   -3.1962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0136   -3.5859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.3131   -3.5859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.1366   -4.3655    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.6887   -3.1962    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   22.2990   -2.5210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.0785   -3.8713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3638   -2.8064    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0389   -3.1962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7141   -2.8064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3892   -3.1962    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.2511   -4.3952    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.4526   -3.5860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1670   -3.1734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8815   -3.5860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5960   -3.1735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3104   -3.5860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0250   -3.1735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7394   -3.1734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4539   -3.5859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1684   -3.1734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8828   -3.1735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5973   -3.5860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3118   -3.1735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0263   -3.5860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7408   -3.1735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4552   -3.5860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1697   -3.1735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8842   -3.5860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5986   -3.1735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5986   -2.3484    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7051   -4.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4195   -4.3655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1340   -4.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8485   -4.3655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5629   -4.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2774   -4.3655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9919   -4.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7064   -4.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4208   -4.3655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1353   -4.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8498   -4.3655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5642   -4.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2787   -4.3655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9932   -4.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7076   -4.3655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4221   -4.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4221   -5.6030    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  1  1  0  0  0  0
  5  3  1  0  0  0  0
  2  6  1  6  0  0  0
  7  4  1  0  0  0  0
  8  7  2  0  0  0  0
  9  7  1  0  0  0  0
 10  7  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
  2 14  1  1  0  0  0
 16 15  1  0  0  0  0
 17 16  1  0  0  0  0
 18 17  1  0  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  2  0  0  0  0
 22 21  1  0  0  0  0
 23 22  1  0  0  0  0
 24 23  2  0  0  0  0
 25 24  1  0  0  0  0
 26 25  1  0  0  0  0
 27 26  1  0  0  0  0
 28 27  1  0  0  0  0
 29 28  1  0  0  0  0
 30 29  1  0  0  0  0
 31 30  1  0  0  0  0
 32 31  1  0  0  0  0
 33 32  2  0  0  0  0
  5 32  1  0  0  0  0
 34 35  1  0  0  0  0
 35 36  1  0  0  0  0
 36 37  1  0  0  0  0
 37 38  1  0  0  0  0
 38 39  1  0  0  0  0
 39 40  1  0  0  0  0
 40 41  2  0  0  0  0
 41 42  1  0  0  0  0
 42 43  1  0  0  0  0
 43 44  1  0  0  0  0
 44 45  1  0  0  0  0
 45 46  1  0  0  0  0
 46 47  1  0  0  0  0
 47 48  1  0  0  0  0
 48 49  1  0  0  0  0
 49  6  1  0  0  0  0
 49 50  2  0  0  0  0
M  END

HMDB0009089
     RDKit          3D
PE(18:2(9Z,12Z)/16:1(9Z))
121120  0  0  0  0  0  0  0  0999 V2000
    9.3373   -0.3245    3.4734 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3653   -1.4221    3.4081 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4344   -1.0384    2.4081 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7566   -0.8600    1.0826 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7101   -0.4667   -0.0401 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3932    0.7956    0.2105 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3046    1.8393   -0.5928 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5066    1.8357   -1.8194 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4931    2.9070   -1.8211 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2278    2.7262   -1.8886 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5942    1.3788   -1.9731 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6770    1.3200   -0.7432 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9703    0.0129   -0.7158 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1647   -0.2459   -1.9476 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3489   -1.5075   -1.8972 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3511   -1.3921   -0.7496 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5157   -0.1902   -0.9729 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4720   -0.0471    0.0868 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2146   -0.8829    0.9706 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7586    1.1160    0.0511 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7494    1.5724    0.8328 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4860    0.6851    0.8290 C   0  0  2  0  0  0  0  0  0  0  0  0
   -1.0234    0.5019   -0.5865 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0549   -0.0942   -1.3686 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6376   -0.3874   -2.9507 P   0  0  0  0  0  5  0  0  0  0  0  0
   -0.1247    0.6124   -3.9349 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3448   -0.3052   -2.8550 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1471   -1.9602   -3.3456 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7504   -2.3977   -4.5320 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2744   -3.8246   -4.8386 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6747   -4.6504   -3.7150 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4503    1.2967    1.6140 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0346    0.6985    2.7157 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7455   -0.4301    3.0658 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0215    1.5385    3.4169 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7610    0.8241    4.4679 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5885   -0.3591    3.9591 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5252    0.1119    2.8666 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3883   -1.0322    2.4254 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2760   -0.6412    1.2629 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1739    0.5273    1.5635 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9473    0.8474    0.3676 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.2464    0.8567    0.2637 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.1241    0.5329    1.3889 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.0064   -0.6679    1.0191 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.8463   -0.4118   -0.1900 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.7763    0.7509   -0.0827 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.5687    0.8794   -1.3922 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.5119    2.0547   -1.3313 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8338    0.6499    3.2922 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.7891   -0.2965    4.4380 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.5863   -0.4412    2.6692 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.7768   -1.6223    4.4212 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.8783   -2.3511    3.0171 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.8810   -0.0778    2.7040 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.1954   -1.8470    2.3011 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.9667   -0.0815    1.1804 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.2457   -1.7856    0.7607 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.4737   -1.3120   -0.1462 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.1199   -0.5452   -0.9622 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.0178    0.8675    1.1339 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.8666    2.7583   -0.3186 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.2476    2.1801   -2.6506 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.1753    0.8762   -2.1999 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.8771    3.9353   -1.7546 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4949    3.5825   -1.8843 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2661    0.5355   -1.9141 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9533    1.3285   -2.8901 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9826    2.1928   -0.7717 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3570    1.3655    0.1285 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3613   -0.0150    0.2154 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7702   -0.7790   -0.6180 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6025    0.6502   -2.2186 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9201   -0.4176   -2.7815 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.9620   -2.4073   -1.7338 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7694   -1.6347   -2.8256 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6969   -2.2979   -0.7174 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8740   -1.3513    0.2013 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0859    0.7735   -1.0233 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9611   -0.2491   -1.9458 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4522    2.6051    0.4401 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0370    1.7865    1.8965 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2440   -0.3039    1.2657 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3803    1.4796   -0.9592 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8973   -0.1754   -0.5320 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6135   -1.1359   -2.3858 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8555   -2.3577   -4.4687 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4000   -1.7339   -5.3241 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8146   -3.8210   -4.9673 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7453   -4.2187   -5.7425 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8191   -4.0221   -2.8871 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0596   -5.3648   -3.4677 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5064    2.4146    3.9213 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7158    1.9275    2.6291 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4973    1.4577    5.0183 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0886    0.4030    5.2627 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1168   -0.7746    4.8210 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8841   -1.1183    3.5766 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0340    1.0402    3.1064 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8358    0.3364    1.9888 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0738   -1.3787    3.2466 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7963   -1.9110    2.1199 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6623   -0.4590    0.3580 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9108   -1.5264    1.0635 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4567    1.4030    1.7046 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6959    0.4549    2.5106 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3653    1.1086   -0.5372 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.7268    1.1115   -0.6913 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.6383    0.2518    2.3164 H   0  0  0  0  0  0  0  0  0  0  0  0
  -11.8121    1.4167    1.5226 H   0  0  0  0  0  0  0  0  0  0  0  0
  -11.3216   -1.5037    0.7846 H   0  0  0  0  0  0  0  0  0  0  0  0
  -12.6202   -0.9765    1.8948 H   0  0  0  0  0  0  0  0  0  0  0  0
  -13.4847   -1.3218   -0.3265 H   0  0  0  0  0  0  0  0  0  0  0  0
  -12.2085   -0.3828   -1.0984 H   0  0  0  0  0  0  0  0  0  0  0  0
  -14.5475    0.6024    0.7144 H   0  0  0  0  0  0  0  0  0  0  0  0
  -13.2923    1.7144    0.1554 H   0  0  0  0  0  0  0  0  0  0  0  0
  -15.0423   -0.0631   -1.6691 H   0  0  0  0  0  0  0  0  0  0  0  0
  -13.7939    1.1184   -2.1753 H   0  0  0  0  0  0  0  0  0  0  0  0
  -14.8793    2.9535   -1.1399 H   0  0  0  0  0  0  0  0  0  0  0  0
  -15.9331    2.2041   -2.3422 H   0  0  0  0  0  0  0  0  0  0  0  0
  -16.2910    1.8927   -0.5606 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 25 27  1  0
 25 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 22 32  1  0
 32 33  1  0
 33 34  2  0
 33 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 42 43  2  0
 43 44  1  0
 44 45  1  0
 45 46  1  0
 46 47  1  0
 47 48  1  0
 48 49  1  0
  1 50  1  0
  1 51  1  0
  1 52  1  0
  2 53  1  0
  2 54  1  0
  3 55  1  0
  3 56  1  0
  4 57  1  0
  4 58  1  0
  5 59  1  0
  5 60  1  0
  6 61  1  0
  7 62  1  0
  8 63  1  0
  8 64  1  0
  9 65  1  0
 10 66  1  0
 11 67  1  0
 11 68  1  0
 12 69  1  0
 12 70  1  0
 13 71  1  0
 13 72  1  0
 14 73  1  0
 14 74  1  0
 15 75  1  0
 15 76  1  0
 16 77  1  0
 16 78  1  0
 17 79  1  0
 17 80  1  0
 21 81  1  0
 21 82  1  0
 22 83  1  1
 23 84  1  0
 23 85  1  0
 27 86  1  0
 29 87  1  0
 29 88  1  0
 30 89  1  0
 30 90  1  0
 31 91  1  0
 31 92  1  0
 35 93  1  0
 35 94  1  0
 36 95  1  0
 36 96  1  0
 37 97  1  0
 37 98  1  0
 38 99  1  0
 38100  1  0
 39101  1  0
 39102  1  0
 40103  1  0
 40104  1  0
 41105  1  0
 41106  1  0
 42107  1  0
 43108  1  0
 44109  1  0
 44110  1  0
 45111  1  0
 45112  1  0
 46113  1  0
 46114  1  0
 47115  1  0
 47116  1  0
 48117  1  0
 48118  1  0
 49119  1  0
 49120  1  0
 49121  1  0
M  END


  Mrv0541 02231223112D          

 50 49  0  0  1  0            999 V2000
   21.3385   -3.1962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.6634   -3.5859    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
   19.9883   -3.1962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.0136   -3.5859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.3131   -3.5859    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   20.1366   -4.3655    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   22.6887   -3.1962    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   22.2990   -2.5210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.0785   -3.8713    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3638   -2.8064    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   24.0389   -3.1962    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.7141   -2.8064    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.3892   -3.1962    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   21.2511   -4.3952    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.4526   -3.5860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1670   -3.1734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8815   -3.5860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5960   -3.1735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3104   -3.5860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0250   -3.1735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7394   -3.1734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4539   -3.5859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1684   -3.1734    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8828   -3.1735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5973   -3.5860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.3118   -3.1735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0263   -3.5860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7408   -3.1735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.4552   -3.5860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.1697   -3.1735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.8842   -3.5860    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5986   -3.1735    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5986   -2.3484    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7051   -4.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4195   -4.3655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1340   -4.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8485   -4.3655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5629   -4.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2774   -4.3655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.9919   -4.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.7064   -4.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4208   -4.3655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1353   -4.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.8498   -4.3655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.5642   -4.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.2787   -4.3655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.9932   -4.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.7076   -4.3655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4221   -4.7780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.4221   -5.6030    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  1  1  0  0  0  0
  5  3  1  0  0  0  0
  2  6  1  6  0  0  0
  7  4  1  0  0  0  0
  8  7  2  0  0  0  0
  9  7  1  0  0  0  0
 10  7  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
  2 14  1  1  0  0  0
 16 15  1  0  0  0  0
 17 16  1  0  0  0  0
 18 17  1  0  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  2  0  0  0  0
 22 21  1  0  0  0  0
 23 22  1  0  0  0  0
 24 23  2  0  0  0  0
 25 24  1  0  0  0  0
 26 25  1  0  0  0  0
 27 26  1  0  0  0  0
 28 27  1  0  0  0  0
 29 28  1  0  0  0  0
 30 29  1  0  0  0  0
 31 30  1  0  0  0  0
 32 31  1  0  0  0  0
 33 32  2  0  0  0  0
  5 32  1  0  0  0  0
 34 35  1  0  0  0  0
 35 36  1  0  0  0  0
 36 37  1  0  0  0  0
 37 38  1  0  0  0  0
 38 39  1  0  0  0  0
 39 40  1  0  0  0  0
 40 41  2  0  0  0  0
 41 42  1  0  0  0  0
 42 43  1  0  0  0  0
 43 44  1  0  0  0  0
 44 45  1  0  0  0  0
 45 46  1  0  0  0  0
 46 47  1  0  0  0  0
 47 48  1  0  0  0  0
 48 49  1  0  0  0  0
 49  6  1  0  0  0  0
 49 50  2  0  0  0  0
M  END
> <DATABASE_ID>
HMDB0009089

> <DATABASE_NAME>
hmdb

> <SMILES>
[H][C@@](COC(=O)CCCCCCC\C=C/C\C=C/CCCCC)(COP(O)(=O)OCCN)OC(=O)CCCCCCC\C=C/CCCCCC

> <INCHI_IDENTIFIER>
InChI=1S/C39H72NO8P/c1-3-5-7-9-11-13-15-17-18-20-21-23-25-27-29-31-38(41)45-35-37(36-47-49(43,44)46-34-33-40)48-39(42)32-30-28-26-24-22-19-16-14-12-10-8-6-4-2/h11,13-14,16-18,37H,3-10,12,15,19-36,40H2,1-2H3,(H,43,44)/b13-11-,16-14-,18-17-/t37-/m1/s1

> <INCHI_KEY>
LGHHSOARZMNIGJ-DFCPKGTFSA-N

> <FORMULA>
C39H72NO8P

> <MOLECULAR_WEIGHT>
713.9646

> <EXACT_MASS>
713.499554797

> <JCHEM_ACCEPTOR_COUNT>
5

> <JCHEM_AVERAGE_POLARIZABILITY>
84.6459031969533

> <JCHEM_BIOAVAILABILITY>
0

> <JCHEM_DONOR_COUNT>
2

> <JCHEM_FORMAL_CHARGE>
0

> <JCHEM_GHOSE_FILTER>
0

> <JCHEM_IUPAC>
(2-aminoethoxy)[(2R)-2-[(9Z)-hexadec-9-enoyloxy]-3-[(9Z,12Z)-octadeca-9,12-dienoyloxy]propoxy]phosphinic acid

> <ALOGPS_LOGP>
8.27

> <JCHEM_LOGP>
10.254287719136755

> <ALOGPS_LOGS>
-6.91

> <JCHEM_MDDR_LIKE_RULE>
0

> <JCHEM_NUMBER_OF_RINGS>
0

> <JCHEM_PHYSIOLOGICAL_CHARGE>
0

> <JCHEM_PKA_STRONGEST_ACIDIC>
1.8688003136581992

> <JCHEM_PKA_STRONGEST_BASIC>
9.999929336362278

> <JCHEM_POLAR_SURFACE_AREA>
134.38

> <JCHEM_REFRACTIVITY>
203.55570000000003

> <JCHEM_ROTATABLE_BOND_COUNT>
38

> <JCHEM_RULE_OF_FIVE>
0

> <ALOGPS_SOLUBILITY>
8.86e-05 g/l

> <JCHEM_TRADITIONAL_IUPAC>
2-aminoethoxy(2R)-2-[(9Z)-hexadec-9-enoyloxy]-3-[(9Z,12Z)-octadeca-9,12-dienoyloxy]propoxyphosphinic acid

> <JCHEM_VEBER_RULE>
0

$$$$

HMDB0009089
     RDKit          3D
PE(18:2(9Z,12Z)/16:1(9Z))
121120  0  0  0  0  0  0  0  0999 V2000
    9.3373   -0.3245    3.4734 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3653   -1.4221    3.4081 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4344   -1.0384    2.4081 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7566   -0.8600    1.0826 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7101   -0.4667   -0.0401 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3932    0.7956    0.2105 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3046    1.8393   -0.5928 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5066    1.8357   -1.8194 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4931    2.9070   -1.8211 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2278    2.7262   -1.8886 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5942    1.3788   -1.9731 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6770    1.3200   -0.7432 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9703    0.0129   -0.7158 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1647   -0.2459   -1.9476 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3489   -1.5075   -1.8972 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3511   -1.3921   -0.7496 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5157   -0.1902   -0.9729 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4720   -0.0471    0.0868 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2146   -0.8829    0.9706 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7586    1.1160    0.0511 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7494    1.5724    0.8328 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4860    0.6851    0.8290 C   0  0  2  0  0  0  0  0  0  0  0  0
   -1.0234    0.5019   -0.5865 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0549   -0.0942   -1.3686 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6376   -0.3874   -2.9507 P   0  0  0  0  0  5  0  0  0  0  0  0
   -0.1247    0.6124   -3.9349 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3448   -0.3052   -2.8550 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1471   -1.9602   -3.3456 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7504   -2.3977   -4.5320 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2744   -3.8246   -4.8386 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6747   -4.6504   -3.7150 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4503    1.2967    1.6140 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0346    0.6985    2.7157 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7455   -0.4301    3.0658 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0215    1.5385    3.4169 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7610    0.8241    4.4679 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5885   -0.3591    3.9591 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5252    0.1119    2.8666 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3883   -1.0322    2.4254 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2760   -0.6412    1.2629 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1739    0.5273    1.5635 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9473    0.8474    0.3676 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.2464    0.8567    0.2637 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.1241    0.5329    1.3889 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.0064   -0.6679    1.0191 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.8463   -0.4118   -0.1900 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.7763    0.7509   -0.0827 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.5687    0.8794   -1.3922 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.5119    2.0547   -1.3313 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8338    0.6499    3.2922 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.7891   -0.2965    4.4380 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.5863   -0.4412    2.6692 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.7768   -1.6223    4.4212 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.8783   -2.3511    3.0171 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.8810   -0.0778    2.7040 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.1954   -1.8470    2.3011 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.9667   -0.0815    1.1804 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.2457   -1.7856    0.7607 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.4737   -1.3120   -0.1462 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.1199   -0.5452   -0.9622 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.0178    0.8675    1.1339 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.8666    2.7583   -0.3186 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.2476    2.1801   -2.6506 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.1753    0.8762   -2.1999 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.8771    3.9353   -1.7546 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4949    3.5825   -1.8843 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2661    0.5355   -1.9141 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9533    1.3285   -2.8901 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9826    2.1928   -0.7717 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3570    1.3655    0.1285 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3613   -0.0150    0.2154 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7702   -0.7790   -0.6180 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6025    0.6502   -2.2186 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9201   -0.4176   -2.7815 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.9620   -2.4073   -1.7338 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7694   -1.6347   -2.8256 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6969   -2.2979   -0.7174 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8740   -1.3513    0.2013 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0859    0.7735   -1.0233 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9611   -0.2491   -1.9458 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4522    2.6051    0.4401 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0370    1.7865    1.8965 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2440   -0.3039    1.2657 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3803    1.4796   -0.9592 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8973   -0.1754   -0.5320 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6135   -1.1359   -2.3858 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8555   -2.3577   -4.4687 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4000   -1.7339   -5.3241 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8146   -3.8210   -4.9673 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7453   -4.2187   -5.7425 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8191   -4.0221   -2.8871 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0596   -5.3648   -3.4677 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5064    2.4146    3.9213 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7158    1.9275    2.6291 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4973    1.4577    5.0183 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0886    0.4030    5.2627 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1168   -0.7746    4.8210 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8841   -1.1183    3.5766 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0340    1.0402    3.1064 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8358    0.3364    1.9888 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0738   -1.3787    3.2466 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7963   -1.9110    2.1199 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6623   -0.4590    0.3580 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9108   -1.5264    1.0635 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4567    1.4030    1.7046 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6959    0.4549    2.5106 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3653    1.1086   -0.5372 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.7268    1.1115   -0.6913 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.6383    0.2518    2.3164 H   0  0  0  0  0  0  0  0  0  0  0  0
  -11.8121    1.4167    1.5226 H   0  0  0  0  0  0  0  0  0  0  0  0
  -11.3216   -1.5037    0.7846 H   0  0  0  0  0  0  0  0  0  0  0  0
  -12.6202   -0.9765    1.8948 H   0  0  0  0  0  0  0  0  0  0  0  0
  -13.4847   -1.3218   -0.3265 H   0  0  0  0  0  0  0  0  0  0  0  0
  -12.2085   -0.3828   -1.0984 H   0  0  0  0  0  0  0  0  0  0  0  0
  -14.5475    0.6024    0.7144 H   0  0  0  0  0  0  0  0  0  0  0  0
  -13.2923    1.7144    0.1554 H   0  0  0  0  0  0  0  0  0  0  0  0
  -15.0423   -0.0631   -1.6691 H   0  0  0  0  0  0  0  0  0  0  0  0
  -13.7939    1.1184   -2.1753 H   0  0  0  0  0  0  0  0  0  0  0  0
  -14.8793    2.9535   -1.1399 H   0  0  0  0  0  0  0  0  0  0  0  0
  -15.9331    2.2041   -2.3422 H   0  0  0  0  0  0  0  0  0  0  0  0
  -16.2910    1.8927   -0.5606 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 25 27  1  0
 25 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 22 32  1  0
 32 33  1  0
 33 34  2  0
 33 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 42 43  2  0
 43 44  1  0
 44 45  1  0
 45 46  1  0
 46 47  1  0
 47 48  1  0
 48 49  1  0
  1 50  1  0
  1 51  1  0
  1 52  1  0
  2 53  1  0
  2 54  1  0
  3 55  1  0
  3 56  1  0
  4 57  1  0
  4 58  1  0
  5 59  1  0
  5 60  1  0
  6 61  1  0
  7 62  1  0
  8 63  1  0
  8 64  1  0
  9 65  1  0
 10 66  1  0
 11 67  1  0
 11 68  1  0
 12 69  1  0
 12 70  1  0
 13 71  1  0
 13 72  1  0
 14 73  1  0
 14 74  1  0
 15 75  1  0
 15 76  1  0
 16 77  1  0
 16 78  1  0
 17 79  1  0
 17 80  1  0
 21 81  1  0
 21 82  1  0
 22 83  1  1
 23 84  1  0
 23 85  1  0
 27 86  1  0
 29 87  1  0
 29 88  1  0
 30 89  1  0
 30 90  1  0
 31 91  1  0
 31 92  1  0
 35 93  1  0
 35 94  1  0
 36 95  1  0
 36 96  1  0
 37 97  1  0
 37 98  1  0
 38 99  1  0
 38100  1  0
 39101  1  0
 39102  1  0
 40103  1  0
 40104  1  0
 41105  1  0
 41106  1  0
 42107  1  0
 43108  1  0
 44109  1  0
 44110  1  0
 45111  1  0
 45112  1  0
 46113  1  0
 46114  1  0
 47115  1  0
 47116  1  0
 48117  1  0
 48118  1  0
 49119  1  0
 49120  1  0
 49121  1  0
M  END

HEADER    PROTEIN                                 23-FEB-12   NONE
TITLE     NULL                                                        
COMPND    NULL                                                        
SOURCE    NULL                                                        
KEYWDS    NULL                                                        
EXPDTA    NULL                                                        
AUTHOR    Marvin                                                      
REVDAT   1   23-FEB-12         0                                  
HETATM    1  C   UNK     0      39.832  -5.966   0.000  0.00  0.00           C+0
HETATM    2  C   UNK     0      38.572  -6.694   0.000  0.00  0.00           C+0
HETATM    3  C   UNK     0      37.311  -5.966   0.000  0.00  0.00           C+0
HETATM    4  O   UNK     0      41.092  -6.694   0.000  0.00  0.00           O+0
HETATM    5  O   UNK     0      36.051  -6.694   0.000  0.00  0.00           O+0
HETATM    6  O   UNK     0      37.588  -8.149   0.000  0.00  0.00           O+0
HETATM    7  P   UNK     0      42.352  -5.966   0.000  0.00  0.00           P+0
HETATM    8  O   UNK     0      41.625  -4.706   0.000  0.00  0.00           O+0
HETATM    9  O   UNK     0      43.080  -7.226   0.000  0.00  0.00           O+0
HETATM   10  O   UNK     0      43.612  -5.239   0.000  0.00  0.00           O+0
HETATM   11  C   UNK     0      44.873  -5.966   0.000  0.00  0.00           C+0
HETATM   12  C   UNK     0      46.133  -5.239   0.000  0.00  0.00           C+0
HETATM   13  N   UNK     0      47.393  -5.966   0.000  0.00  0.00           N+0
HETATM   14  H   UNK     0      39.669  -8.204   0.000  0.00  0.00           H+0
HETATM   15  C   UNK     0      12.045  -6.694   0.000  0.00  0.00           C+0
HETATM   16  C   UNK     0      13.378  -5.924   0.000  0.00  0.00           C+0
HETATM   17  C   UNK     0      14.712  -6.694   0.000  0.00  0.00           C+0
HETATM   18  C   UNK     0      16.046  -5.924   0.000  0.00  0.00           C+0
HETATM   19  C   UNK     0      17.379  -6.694   0.000  0.00  0.00           C+0
HETATM   20  C   UNK     0      18.713  -5.924   0.000  0.00  0.00           C+0
HETATM   21  C   UNK     0      20.047  -5.924   0.000  0.00  0.00           C+0
HETATM   22  C   UNK     0      21.381  -6.694   0.000  0.00  0.00           C+0
HETATM   23  C   UNK     0      22.714  -5.924   0.000  0.00  0.00           C+0
HETATM   24  C   UNK     0      24.048  -5.924   0.000  0.00  0.00           C+0
HETATM   25  C   UNK     0      25.382  -6.694   0.000  0.00  0.00           C+0
HETATM   26  C   UNK     0      26.715  -5.924   0.000  0.00  0.00           C+0
HETATM   27  C   UNK     0      28.049  -6.694   0.000  0.00  0.00           C+0
HETATM   28  C   UNK     0      29.383  -5.924   0.000  0.00  0.00           C+0
HETATM   29  C   UNK     0      30.716  -6.694   0.000  0.00  0.00           C+0
HETATM   30  C   UNK     0      32.050  -5.924   0.000  0.00  0.00           C+0
HETATM   31  C   UNK     0      33.384  -6.694   0.000  0.00  0.00           C+0
HETATM   32  C   UNK     0      34.717  -5.924   0.000  0.00  0.00           C+0
HETATM   33  O   UNK     0      34.717  -4.384   0.000  0.00  0.00           O+0
HETATM   34  C   UNK     0      16.250  -8.919   0.000  0.00  0.00           C+0
HETATM   35  C   UNK     0      17.583  -8.149   0.000  0.00  0.00           C+0
HETATM   36  C   UNK     0      18.917  -8.919   0.000  0.00  0.00           C+0
HETATM   37  C   UNK     0      20.251  -8.149   0.000  0.00  0.00           C+0
HETATM   38  C   UNK     0      21.584  -8.919   0.000  0.00  0.00           C+0
HETATM   39  C   UNK     0      22.918  -8.149   0.000  0.00  0.00           C+0
HETATM   40  C   UNK     0      24.252  -8.919   0.000  0.00  0.00           C+0
HETATM   41  C   UNK     0      25.585  -8.919   0.000  0.00  0.00           C+0
HETATM   42  C   UNK     0      26.919  -8.149   0.000  0.00  0.00           C+0
HETATM   43  C   UNK     0      28.253  -8.919   0.000  0.00  0.00           C+0
HETATM   44  C   UNK     0      29.586  -8.149   0.000  0.00  0.00           C+0
HETATM   45  C   UNK     0      30.920  -8.919   0.000  0.00  0.00           C+0
HETATM   46  C   UNK     0      32.254  -8.149   0.000  0.00  0.00           C+0
HETATM   47  C   UNK     0      33.587  -8.919   0.000  0.00  0.00           C+0
HETATM   48  C   UNK     0      34.921  -8.149   0.000  0.00  0.00           C+0
HETATM   49  C   UNK     0      36.255  -8.919   0.000  0.00  0.00           C+0
HETATM   50  O   UNK     0      36.255 -10.459   0.000  0.00  0.00           O+0
CONECT    1    2    4                                                       
CONECT    2    1    3    6   14                                             
CONECT    3    2    5                                                       
CONECT    4    1    7                                                       
CONECT    5    3   32                                                       
CONECT    6    2   49                                                       
CONECT    7    4    8    9   10                                             
CONECT    8    7                                                            
CONECT    9    7                                                            
CONECT   10    7   11                                                       
CONECT   11   10   12                                                       
CONECT   12   11   13                                                       
CONECT   13   12                                                            
CONECT   14    2                                                            
CONECT   15   16                                                            
CONECT   16   15   17                                                       
CONECT   17   16   18                                                       
CONECT   18   17   19                                                       
CONECT   19   18   20                                                       
CONECT   20   19   21                                                       
CONECT   21   20   22                                                       
CONECT   22   21   23                                                       
CONECT   23   22   24                                                       
CONECT   24   23   25                                                       
CONECT   25   24   26                                                       
CONECT   26   25   27                                                       
CONECT   27   26   28                                                       
CONECT   28   27   29                                                       
CONECT   29   28   30                                                       
CONECT   30   29   31                                                       
CONECT   31   30   32                                                       
CONECT   32   31   33    5                                                  
CONECT   33   32                                                            
CONECT   34   35                                                            
CONECT   35   34   36                                                       
CONECT   36   35   37                                                       
CONECT   37   36   38                                                       
CONECT   38   37   39                                                       
CONECT   39   38   40                                                       
CONECT   40   39   41                                                       
CONECT   41   40   42                                                       
CONECT   42   41   43                                                       
CONECT   43   42   44                                                       
CONECT   44   43   45                                                       
CONECT   45   44   46                                                       
CONECT   46   45   47                                                       
CONECT   47   46   48                                                       
CONECT   48   47   49                                                       
CONECT   49   48    6   50                                                  
CONECT   50   49                                                            
MASTER        0    0    0    0    0    0    0    0   50    0   98    0
END

COMPND    HMDB0009089
HETATM    1  C1  UNL     1       9.337  -0.325   3.473  1.00  0.00           C  
HETATM    2  C2  UNL     1      10.365  -1.422   3.408  1.00  0.00           C  
HETATM    3  C3  UNL     1      11.434  -1.038   2.408  1.00  0.00           C  
HETATM    4  C4  UNL     1      10.757  -0.860   1.083  1.00  0.00           C  
HETATM    5  C5  UNL     1      11.710  -0.467  -0.040  1.00  0.00           C  
HETATM    6  C6  UNL     1      12.393   0.796   0.211  1.00  0.00           C  
HETATM    7  C7  UNL     1      12.305   1.839  -0.593  1.00  0.00           C  
HETATM    8  C8  UNL     1      11.507   1.836  -1.819  1.00  0.00           C  
HETATM    9  C9  UNL     1      10.493   2.907  -1.821  1.00  0.00           C  
HETATM   10  C10 UNL     1       9.228   2.726  -1.889  1.00  0.00           C  
HETATM   11  C11 UNL     1       8.594   1.379  -1.973  1.00  0.00           C  
HETATM   12  C12 UNL     1       7.677   1.320  -0.743  1.00  0.00           C  
HETATM   13  C13 UNL     1       6.970   0.013  -0.716  1.00  0.00           C  
HETATM   14  C14 UNL     1       6.165  -0.246  -1.948  1.00  0.00           C  
HETATM   15  C15 UNL     1       5.349  -1.508  -1.897  1.00  0.00           C  
HETATM   16  C16 UNL     1       4.351  -1.392  -0.750  1.00  0.00           C  
HETATM   17  C17 UNL     1       3.516  -0.190  -0.973  1.00  0.00           C  
HETATM   18  C18 UNL     1       2.472  -0.047   0.087  1.00  0.00           C  
HETATM   19  O1  UNL     1       2.215  -0.883   0.971  1.00  0.00           O  
HETATM   20  O2  UNL     1       1.759   1.116   0.051  1.00  0.00           O  
HETATM   21  C19 UNL     1       0.749   1.572   0.833  1.00  0.00           C  
HETATM   22  C20 UNL     1      -0.486   0.685   0.829  1.00  0.00           C  
HETATM   23  C21 UNL     1      -1.023   0.502  -0.587  1.00  0.00           C  
HETATM   24  O3  UNL     1      -0.055  -0.094  -1.369  1.00  0.00           O  
HETATM   25  P1  UNL     1      -0.638  -0.387  -2.951  1.00  0.00           P  
HETATM   26  O4  UNL     1      -0.125   0.612  -3.935  1.00  0.00           O  
HETATM   27  O5  UNL     1      -2.345  -0.305  -2.855  1.00  0.00           O  
HETATM   28  O6  UNL     1      -0.147  -1.960  -3.346  1.00  0.00           O  
HETATM   29  C22 UNL     1      -0.750  -2.398  -4.532  1.00  0.00           C  
HETATM   30  C23 UNL     1      -0.274  -3.825  -4.839  1.00  0.00           C  
HETATM   31  N1  UNL     1      -0.675  -4.650  -3.715  1.00  0.00           N  
HETATM   32  O7  UNL     1      -1.450   1.297   1.614  1.00  0.00           O  
HETATM   33  C24 UNL     1      -2.035   0.699   2.716  1.00  0.00           C  
HETATM   34  O8  UNL     1      -1.746  -0.430   3.066  1.00  0.00           O  
HETATM   35  C25 UNL     1      -3.021   1.539   3.417  1.00  0.00           C  
HETATM   36  C26 UNL     1      -3.761   0.824   4.468  1.00  0.00           C  
HETATM   37  C27 UNL     1      -4.588  -0.359   3.959  1.00  0.00           C  
HETATM   38  C28 UNL     1      -5.525   0.112   2.867  1.00  0.00           C  
HETATM   39  C29 UNL     1      -6.388  -1.032   2.425  1.00  0.00           C  
HETATM   40  C30 UNL     1      -7.276  -0.641   1.263  1.00  0.00           C  
HETATM   41  C31 UNL     1      -8.174   0.527   1.563  1.00  0.00           C  
HETATM   42  C32 UNL     1      -8.947   0.847   0.368  1.00  0.00           C  
HETATM   43  C33 UNL     1     -10.246   0.857   0.264  1.00  0.00           C  
HETATM   44  C34 UNL     1     -11.124   0.533   1.389  1.00  0.00           C  
HETATM   45  C35 UNL     1     -12.006  -0.668   1.019  1.00  0.00           C  
HETATM   46  C36 UNL     1     -12.846  -0.412  -0.190  1.00  0.00           C  
HETATM   47  C37 UNL     1     -13.776   0.751  -0.083  1.00  0.00           C  
HETATM   48  C38 UNL     1     -14.569   0.879  -1.392  1.00  0.00           C  
HETATM   49  C39 UNL     1     -15.512   2.055  -1.331  1.00  0.00           C  
HETATM   50  H1  UNL     1       9.834   0.650   3.292  1.00  0.00           H  
HETATM   51  H2  UNL     1       8.789  -0.297   4.438  1.00  0.00           H  
HETATM   52  H3  UNL     1       8.586  -0.441   2.669  1.00  0.00           H  
HETATM   53  H4  UNL     1      10.777  -1.622   4.421  1.00  0.00           H  
HETATM   54  H5  UNL     1       9.878  -2.351   3.017  1.00  0.00           H  
HETATM   55  H6  UNL     1      11.881  -0.078   2.704  1.00  0.00           H  
HETATM   56  H7  UNL     1      12.195  -1.847   2.301  1.00  0.00           H  
HETATM   57  H8  UNL     1       9.967  -0.082   1.180  1.00  0.00           H  
HETATM   58  H9  UNL     1      10.246  -1.786   0.761  1.00  0.00           H  
HETATM   59  H10 UNL     1      12.474  -1.312  -0.146  1.00  0.00           H  
HETATM   60  H11 UNL     1      11.120  -0.545  -0.962  1.00  0.00           H  
HETATM   61  H12 UNL     1      13.018   0.867   1.134  1.00  0.00           H  
HETATM   62  H13 UNL     1      12.867   2.758  -0.319  1.00  0.00           H  
HETATM   63  H14 UNL     1      12.248   2.180  -2.651  1.00  0.00           H  
HETATM   64  H15 UNL     1      11.175   0.876  -2.200  1.00  0.00           H  
HETATM   65  H16 UNL     1      10.877   3.935  -1.755  1.00  0.00           H  
HETATM   66  H17 UNL     1       8.495   3.583  -1.884  1.00  0.00           H  
HETATM   67  H18 UNL     1       9.266   0.536  -1.914  1.00  0.00           H  
HETATM   68  H19 UNL     1       7.953   1.328  -2.890  1.00  0.00           H  
HETATM   69  H20 UNL     1       6.983   2.193  -0.772  1.00  0.00           H  
HETATM   70  H21 UNL     1       8.357   1.366   0.128  1.00  0.00           H  
HETATM   71  H22 UNL     1       6.361  -0.015   0.215  1.00  0.00           H  
HETATM   72  H23 UNL     1       7.770  -0.779  -0.618  1.00  0.00           H  
HETATM   73  H24 UNL     1       5.603   0.650  -2.219  1.00  0.00           H  
HETATM   74  H25 UNL     1       6.920  -0.418  -2.781  1.00  0.00           H  
HETATM   75  H26 UNL     1       5.962  -2.407  -1.734  1.00  0.00           H  
HETATM   76  H27 UNL     1       4.769  -1.635  -2.826  1.00  0.00           H  
HETATM   77  H28 UNL     1       3.697  -2.298  -0.717  1.00  0.00           H  
HETATM   78  H29 UNL     1       4.874  -1.351   0.201  1.00  0.00           H  
HETATM   79  H30 UNL     1       4.086   0.774  -1.023  1.00  0.00           H  
HETATM   80  H31 UNL     1       2.961  -0.249  -1.946  1.00  0.00           H  
HETATM   81  H32 UNL     1       0.452   2.605   0.440  1.00  0.00           H  
HETATM   82  H33 UNL     1       1.037   1.786   1.897  1.00  0.00           H  
HETATM   83  H34 UNL     1      -0.244  -0.304   1.266  1.00  0.00           H  
HETATM   84  H35 UNL     1      -1.380   1.480  -0.959  1.00  0.00           H  
HETATM   85  H36 UNL     1      -1.897  -0.175  -0.532  1.00  0.00           H  
HETATM   86  H37 UNL     1      -2.614  -1.136  -2.386  1.00  0.00           H  
HETATM   87  H38 UNL     1      -1.856  -2.358  -4.469  1.00  0.00           H  
HETATM   88  H39 UNL     1      -0.400  -1.734  -5.324  1.00  0.00           H  
HETATM   89  H40 UNL     1       0.815  -3.821  -4.967  1.00  0.00           H  
HETATM   90  H41 UNL     1      -0.745  -4.219  -5.743  1.00  0.00           H  
HETATM   91  H42 UNL     1      -0.819  -4.022  -2.887  1.00  0.00           H  
HETATM   92  H43 UNL     1       0.060  -5.365  -3.468  1.00  0.00           H  
HETATM   93  H44 UNL     1      -2.506   2.415   3.921  1.00  0.00           H  
HETATM   94  H45 UNL     1      -3.716   1.928   2.629  1.00  0.00           H  
HETATM   95  H46 UNL     1      -4.497   1.458   5.018  1.00  0.00           H  
HETATM   96  H47 UNL     1      -3.089   0.403   5.263  1.00  0.00           H  
HETATM   97  H48 UNL     1      -5.117  -0.775   4.821  1.00  0.00           H  
HETATM   98  H49 UNL     1      -3.884  -1.118   3.577  1.00  0.00           H  
HETATM   99  H50 UNL     1      -6.034   1.040   3.106  1.00  0.00           H  
HETATM  100  H51 UNL     1      -4.836   0.336   1.989  1.00  0.00           H  
HETATM  101  H52 UNL     1      -7.074  -1.379   3.247  1.00  0.00           H  
HETATM  102  H53 UNL     1      -5.796  -1.911   2.120  1.00  0.00           H  
HETATM  103  H54 UNL     1      -6.662  -0.459   0.358  1.00  0.00           H  
HETATM  104  H55 UNL     1      -7.911  -1.526   1.063  1.00  0.00           H  
HETATM  105  H56 UNL     1      -7.457   1.403   1.705  1.00  0.00           H  
HETATM  106  H57 UNL     1      -8.696   0.455   2.511  1.00  0.00           H  
HETATM  107  H58 UNL     1      -8.365   1.109  -0.537  1.00  0.00           H  
HETATM  108  H59 UNL     1     -10.727   1.112  -0.691  1.00  0.00           H  
HETATM  109  H60 UNL     1     -10.638   0.252   2.316  1.00  0.00           H  
HETATM  110  H61 UNL     1     -11.812   1.417   1.523  1.00  0.00           H  
HETATM  111  H62 UNL     1     -11.322  -1.504   0.785  1.00  0.00           H  
HETATM  112  H63 UNL     1     -12.620  -0.977   1.895  1.00  0.00           H  
HETATM  113  H64 UNL     1     -13.485  -1.322  -0.326  1.00  0.00           H  
HETATM  114  H65 UNL     1     -12.209  -0.383  -1.098  1.00  0.00           H  
HETATM  115  H66 UNL     1     -14.547   0.602   0.714  1.00  0.00           H  
HETATM  116  H67 UNL     1     -13.292   1.714   0.155  1.00  0.00           H  
HETATM  117  H68 UNL     1     -15.042  -0.063  -1.669  1.00  0.00           H  
HETATM  118  H69 UNL     1     -13.794   1.118  -2.175  1.00  0.00           H  
HETATM  119  H70 UNL     1     -14.879   2.953  -1.140  1.00  0.00           H  
HETATM  120  H71 UNL     1     -15.933   2.204  -2.342  1.00  0.00           H  
HETATM  121  H72 UNL     1     -16.291   1.893  -0.561  1.00  0.00           H  
CONECT    1    2   50   51   52
CONECT    2    3   53   54
CONECT    3    4   55   56
CONECT    4    5   57   58
CONECT    5    6   59   60
CONECT    6    7    7   61
CONECT    7    8   62
CONECT    8    9   63   64
CONECT    9   10   10   65
CONECT   10   11   66
CONECT   11   12   67   68
CONECT   12   13   69   70
CONECT   13   14   71   72
CONECT   14   15   73   74
CONECT   15   16   75   76
CONECT   16   17   77   78
CONECT   17   18   79   80
CONECT   18   19   19   20
CONECT   20   21
CONECT   21   22   81   82
CONECT   22   23   32   83
CONECT   23   24   84   85
CONECT   24   25
CONECT   25   26   26   27   28
CONECT   27   86
CONECT   28   29
CONECT   29   30   87   88
CONECT   30   31   89   90
CONECT   31   91   92
CONECT   32   33
CONECT   33   34   34   35
CONECT   35   36   93   94
CONECT   36   37   95   96
CONECT   37   38   97   98
CONECT   38   39   99  100
CONECT   39   40  101  102
CONECT   40   41  103  104
CONECT   41   42  105  106
CONECT   42   43   43  107
CONECT   43   44  108
CONECT   44   45  109  110
CONECT   45   46  111  112
CONECT   46   47  113  114
CONECT   47   48  115  116
CONECT   48   49  117  118
CONECT   49  119  120  121
END

HMDB0009089
     RDKit          3D
PE(18:2(9Z,12Z)/16:1(9Z))
121120  0  0  0  0  0  0  0  0999 V2000
    9.3373   -0.3245    3.4734 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3653   -1.4221    3.4081 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4344   -1.0384    2.4081 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7566   -0.8600    1.0826 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7101   -0.4667   -0.0401 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3932    0.7956    0.2105 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3046    1.8393   -0.5928 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5066    1.8357   -1.8194 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4931    2.9070   -1.8211 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2278    2.7262   -1.8886 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5942    1.3788   -1.9731 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6770    1.3200   -0.7432 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9703    0.0129   -0.7158 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1647   -0.2459   -1.9476 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3489   -1.5075   -1.8972 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3511   -1.3921   -0.7496 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5157   -0.1902   -0.9729 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4720   -0.0471    0.0868 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2146   -0.8829    0.9706 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7586    1.1160    0.0511 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7494    1.5724    0.8328 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4860    0.6851    0.8290 C   0  0  2  0  0  0  0  0  0  0  0  0
   -1.0234    0.5019   -0.5865 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0549   -0.0942   -1.3686 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6376   -0.3874   -2.9507 P   0  0  0  0  0  5  0  0  0  0  0  0
   -0.1247    0.6124   -3.9349 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3448   -0.3052   -2.8550 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1471   -1.9602   -3.3456 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7504   -2.3977   -4.5320 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2744   -3.8246   -4.8386 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6747   -4.6504   -3.7150 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4503    1.2967    1.6140 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0346    0.6985    2.7157 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7455   -0.4301    3.0658 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0215    1.5385    3.4169 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7610    0.8241    4.4679 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.5885   -0.3591    3.9591 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.5252    0.1119    2.8666 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.3883   -1.0322    2.4254 C   0  0  0  0  0  0  0  0  0  0  0  0
   -7.2760   -0.6412    1.2629 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.1739    0.5273    1.5635 C   0  0  0  0  0  0  0  0  0  0  0  0
   -8.9473    0.8474    0.3676 C   0  0  0  0  0  0  0  0  0  0  0  0
  -10.2464    0.8567    0.2637 C   0  0  0  0  0  0  0  0  0  0  0  0
  -11.1241    0.5329    1.3889 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.0064   -0.6679    1.0191 C   0  0  0  0  0  0  0  0  0  0  0  0
  -12.8463   -0.4118   -0.1900 C   0  0  0  0  0  0  0  0  0  0  0  0
  -13.7763    0.7509   -0.0827 C   0  0  0  0  0  0  0  0  0  0  0  0
  -14.5687    0.8794   -1.3922 C   0  0  0  0  0  0  0  0  0  0  0  0
  -15.5119    2.0547   -1.3313 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8338    0.6499    3.2922 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.7891   -0.2965    4.4380 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.5863   -0.4412    2.6692 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.7768   -1.6223    4.4212 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.8783   -2.3511    3.0171 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.8810   -0.0778    2.7040 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.1954   -1.8470    2.3011 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.9667   -0.0815    1.1804 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.2457   -1.7856    0.7607 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.4737   -1.3120   -0.1462 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.1199   -0.5452   -0.9622 H   0  0  0  0  0  0  0  0  0  0  0  0
   13.0178    0.8675    1.1339 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.8666    2.7583   -0.3186 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.2476    2.1801   -2.6506 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.1753    0.8762   -2.1999 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.8771    3.9353   -1.7546 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4949    3.5825   -1.8843 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2661    0.5355   -1.9141 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.9533    1.3285   -2.8901 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9826    2.1928   -0.7717 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.3570    1.3655    0.1285 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3613   -0.0150    0.2154 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7702   -0.7790   -0.6180 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6025    0.6502   -2.2186 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9201   -0.4176   -2.7815 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.9620   -2.4073   -1.7338 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.7694   -1.6347   -2.8256 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6969   -2.2979   -0.7174 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.8740   -1.3513    0.2013 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0859    0.7735   -1.0233 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9611   -0.2491   -1.9458 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4522    2.6051    0.4401 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0370    1.7865    1.8965 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2440   -0.3039    1.2657 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3803    1.4796   -0.9592 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8973   -0.1754   -0.5320 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6135   -1.1359   -2.3858 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8555   -2.3577   -4.4687 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4000   -1.7339   -5.3241 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8146   -3.8210   -4.9673 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7453   -4.2187   -5.7425 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8191   -4.0221   -2.8871 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0596   -5.3648   -3.4677 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5064    2.4146    3.9213 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7158    1.9275    2.6291 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4973    1.4577    5.0183 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0886    0.4030    5.2627 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1168   -0.7746    4.8210 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8841   -1.1183    3.5766 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0340    1.0402    3.1064 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.8358    0.3364    1.9888 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.0738   -1.3787    3.2466 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.7963   -1.9110    2.1199 H   0  0  0  0  0  0  0  0  0  0  0  0
   -6.6623   -0.4590    0.3580 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.9108   -1.5264    1.0635 H   0  0  0  0  0  0  0  0  0  0  0  0
   -7.4567    1.4030    1.7046 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.6959    0.4549    2.5106 H   0  0  0  0  0  0  0  0  0  0  0  0
   -8.3653    1.1086   -0.5372 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.7268    1.1115   -0.6913 H   0  0  0  0  0  0  0  0  0  0  0  0
  -10.6383    0.2518    2.3164 H   0  0  0  0  0  0  0  0  0  0  0  0
  -11.8121    1.4167    1.5226 H   0  0  0  0  0  0  0  0  0  0  0  0
  -11.3216   -1.5037    0.7846 H   0  0  0  0  0  0  0  0  0  0  0  0
  -12.6202   -0.9765    1.8948 H   0  0  0  0  0  0  0  0  0  0  0  0
  -13.4847   -1.3218   -0.3265 H   0  0  0  0  0  0  0  0  0  0  0  0
  -12.2085   -0.3828   -1.0984 H   0  0  0  0  0  0  0  0  0  0  0  0
  -14.5475    0.6024    0.7144 H   0  0  0  0  0  0  0  0  0  0  0  0
  -13.2923    1.7144    0.1554 H   0  0  0  0  0  0  0  0  0  0  0  0
  -15.0423   -0.0631   -1.6691 H   0  0  0  0  0  0  0  0  0  0  0  0
  -13.7939    1.1184   -2.1753 H   0  0  0  0  0  0  0  0  0  0  0  0
  -14.8793    2.9535   -1.1399 H   0  0  0  0  0  0  0  0  0  0  0  0
  -15.9331    2.2041   -2.3422 H   0  0  0  0  0  0  0  0  0  0  0  0
  -16.2910    1.8927   -0.5606 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  7  8  1  0
  8  9  1  0
  9 10  2  0
 10 11  1  0
 11 12  1  0
 12 13  1  0
 13 14  1  0
 14 15  1  0
 15 16  1  0
 16 17  1  0
 17 18  1  0
 18 19  2  0
 18 20  1  0
 20 21  1  0
 21 22  1  0
 22 23  1  0
 23 24  1  0
 24 25  1  0
 25 26  2  0
 25 27  1  0
 25 28  1  0
 28 29  1  0
 29 30  1  0
 30 31  1  0
 22 32  1  0
 32 33  1  0
 33 34  2  0
 33 35  1  0
 35 36  1  0
 36 37  1  0
 37 38  1  0
 38 39  1  0
 39 40  1  0
 40 41  1  0
 41 42  1  0
 42 43  2  0
 43 44  1  0
 44 45  1  0
 45 46  1  0
 46 47  1  0
 47 48  1  0
 48 49  1  0
  1 50  1  0
  1 51  1  0
  1 52  1  0
  2 53  1  0
  2 54  1  0
  3 55  1  0
  3 56  1  0
  4 57  1  0
  4 58  1  0
  5 59  1  0
  5 60  1  0
  6 61  1  0
  7 62  1  0
  8 63  1  0
  8 64  1  0
  9 65  1  0
 10 66  1  0
 11 67  1  0
 11 68  1  0
 12 69  1  0
 12 70  1  0
 13 71  1  0
 13 72  1  0
 14 73  1  0
 14 74  1  0
 15 75  1  0
 15 76  1  0
 16 77  1  0
 16 78  1  0
 17 79  1  0
 17 80  1  0
 21 81  1  0
 21 82  1  0
 22 83  1  1
 23 84  1  0
 23 85  1  0
 27 86  1  0
 29 87  1  0
 29 88  1  0
 30 89  1  0
 30 90  1  0
 31 91  1  0
 31 92  1  0
 35 93  1  0
 35 94  1  0
 36 95  1  0
 36 96  1  0
 37 97  1  0
 37 98  1  0
 38 99  1  0
 38100  1  0
 39101  1  0
 39102  1  0
 40103  1  0
 40104  1  0
 41105  1  0
 41106  1  0
 42107  1  0
 43108  1  0
 44109  1  0
 44110  1  0
 45111  1  0
 45112  1  0
 46113  1  0
 46114  1  0
 47115  1  0
 47116  1  0
 48117  1  0
 48118  1  0
 49119  1  0
 49120  1  0
 49121  1  0
M  END

View in JSmol View Stereo Labels

Synonyms

Value	Source
GPEtn(34:3)	HMDB
PE(34:3)	HMDB
Phophatidylethanolamine(34:3)	HMDB
PE(18:2/16:1)	HMDB
1-Linoleoyl-2-palmitoleoyl-sn-glycero-3-phosphoethanolamine	HMDB
GPEtn(18:2/16:1)	HMDB
1-(9Z,12Z-Octadecadienoyl)-2-(9Z-hexadecenoyl)-sn-glycero-3-phosphoethanolamine	HMDB
Phophatidylethanolamine(18:2/16:1)	HMDB
PE(18:2(9Z,12Z)/16:1(9Z))	Lipid Annotator

Chemical Formula

C₃₉H₇₂NO₈P

Average Molecular Weight

713.9646

Monoisotopic Molecular Weight

713.499554797

IUPAC Name

(2-aminoethoxy)[(2R)-2-[(9Z)-hexadec-9-enoyloxy]-3-[(9Z,12Z)-octadeca-9,12-dienoyloxy]propoxy]phosphinic acid

Traditional Name

2-aminoethoxy(2R)-2-[(9Z)-hexadec-9-enoyloxy]-3-[(9Z,12Z)-octadeca-9,12-dienoyloxy]propoxyphosphinic acid

CAS Registry Number

Not Available

SMILES

[H][C@@](COC(=O)CCCCCCC\C=C/C\C=C/CCCCC)(COP(O)(=O)OCCN)OC(=O)CCCCCCC\C=C/CCCCCC

InChI Identifier

InChI=1S/C39H72NO8P/c1-3-5-7-9-11-13-15-17-18-20-21-23-25-27-29-31-38(41)45-35-37(36-47-49(43,44)46-34-33-40)48-39(42)32-30-28-26-24-22-19-16-14-12-10-8-6-4-2/h11,13-14,16-18,37H,3-10,12,15,19-36,40H2,1-2H3,(H,43,44)/b13-11-,16-14-,18-17-/t37-/m1/s1

InChI Key

LGHHSOARZMNIGJ-DFCPKGTFSA-N

Chemical Taxonomy

Description

Belongs to the class of organic compounds known as phosphatidylethanolamines. These are glycerophosphoetahnolamines in which two fatty acids are bonded to the glycerol moiety through ester linkages.

Kingdom

Organic compounds

Super Class

Lipids and lipid-like molecules

Class

Glycerophospholipids

Sub Class

Glycerophosphoethanolamines

Direct Parent

Phosphatidylethanolamines

Alternative Parents

Substituents

Diacylglycero-3-phosphoethanolamine
Phosphoethanolamine
Fatty acid ester
Dialkyl phosphate
Dicarboxylic acid or derivatives
Organic phosphoric acid derivative
Phosphoric acid ester
Alkyl phosphate
Fatty acyl
Amino acid or derivatives
Carboxylic acid ester
Carboxylic acid derivative
Organopnictogen compound
Organic oxygen compound
Organooxygen compound
Organonitrogen compound
Amine
Primary aliphatic amine
Organic nitrogen compound
Primary amine
Carbonyl group
Organic oxide
Hydrocarbon derivative
Aliphatic acyclic compound

Molecular Framework

Aliphatic acyclic compounds

External Descriptors

Diacylglycerophosphoethanolamines (LMGP02010659 )

Ontology

Physiological effect

Health effect

Diabetes mellitus type 2 (PMID: 30402908)
Non-alcoholic fatty liver disease (PMID: 26811286)
Parkinson's disease (PMID: 26811286)

Nervous system disorder

Central nervous system disorder

Alzheimer's Disease (PMID: 26811286)

Disposition

Biological location

Cellular substructure

Organelle

endoplasmic reticulum (HMDB: HMDB0009089)

golgi apparatus membrane (HMDB: HMDB0009089)
cell membrane (HMDB: HMDB0009089)
Membrane (HMDB: HMDB0009089)
Extracellular (HMDB: HMDB0009089)

Cell

All cells and tissues (HMDB: HMDB0009089)

Tissue

All Tissues (HMDB: HMDB0009089)

Organ

Brain (HMDB: HMDB0009089)

Greylag goose (FooDB: FOOD00368)
Guinea hen (FooDB: FOOD00373)
Ostrich (FooDB: FOOD00422)
Velvet duck (FooDB: FOOD00427)
Pheasant (FooDB: FOOD00430)
Squab (FooDB: FOOD00481)
Turkey (FooDB: FOOD00494)
Quail (FooDB: FOOD00541)
Anatidae (FooDB: FOOD00576)
Rock ptarmigan (FooDB: FOOD00597)
Columbidae (Dove, Pigeon) (FooDB: FOOD00610)
Chicken (FooDB: FOOD00329)
Mallard duck (FooDB: FOOD00353)
Emu (FooDB: FOOD00360)

Equine

Horse (FooDB: FOOD00378)

Lagomorph

Ovis

Sheep (Mutton, Lamb) (FooDB: FOOD00473)

Bovine

Venison

Deer (FooDB: FOOD00524)
Mule deer (FooDB: FOOD00348)
Elk (FooDB: FOOD00359)

Caprae

Domestic goat (FooDB: FOOD00529)

Swine

Domestic pig (FooDB: FOOD00536)
Wild boar (FooDB: FOOD00307)

Process

Naturally occurring process

Biological process

Biochemical process

Lipid transport (PMID: 26811286)

Biochemical pathway

Metabolic pathway

Phosphatidylethanolamine Biosynthesis (HMDB: HMDB0009089)
Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/16:1(9Z)) (PathBank: SMP0014451)
Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/16:1(9Z)) (PathBank: SMP0015291)

Cellular process

Autophagy (PMID: 26811286)

Role

Biological role

Nutrient

Nutrient (PMID: 26811286)

Industrial application

Pharmaceutical industry

Biomarker

Physical Properties

State

Solid

Experimental Molecular Properties

Property	Value	Reference
Melting Point	Not Available	Not Available
Boiling Point	Not Available	Not Available
Water Solubility	Not Available	Not Available
LogP	Not Available	Not Available

Experimental Chromatographic Properties

Not Available

Predicted Molecular Properties

Property	Value	Source
Water Solubility	8.9e-05 g/L	ALOGPS
logP	8.27	ALOGPS
logP	10.25	ChemAxon
logS	-6.9	ALOGPS
pKa (Strongest Acidic)	1.87	ChemAxon
pKa (Strongest Basic)	10	ChemAxon
Physiological Charge	0	ChemAxon
Hydrogen Acceptor Count	5	ChemAxon
Hydrogen Donor Count	2	ChemAxon
Polar Surface Area	134.38 Å²	ChemAxon
Rotatable Bond Count	38	ChemAxon
Refractivity	203.56 m³·mol⁻¹	ChemAxon
Polarizability	84.65 Å³	ChemAxon
Number of Rings	0	ChemAxon
Bioavailability	No	ChemAxon
Rule of Five	No	ChemAxon
Ghose Filter	No	ChemAxon
Veber's Rule	No	ChemAxon
MDDR-like Rule	No	ChemAxon

Predicted Chromatographic Properties

Predicted Collision Cross Sections

Predictor	Adduct Type	CCS Value (Å²)	Reference
DarkChem	[M+H]+	278.333	31661259
DarkChem	[M-H]-	270.704	31661259
DeepCCS	[M+H]+	283.901	30932474
DeepCCS	[M-H]-	281.528	30932474
DeepCCS	[M-2H]-	315.353	30932474
DeepCCS	[M+Na]+	291.249	30932474
AllCCS	[M+H]+	274.4	32859911
AllCCS	[M+H-H2O]+	274.2	32859911
AllCCS	[M+NH4]+	274.6	32859911
AllCCS	[M+Na]+	274.7	32859911
AllCCS	[M-H]-	259.3	32859911
AllCCS	[M+Na-2H]-	265.8	32859911
AllCCS	[M+HCOO]-	272.9	32859911

Predicted Kovats Retention Indices

Underivatized

Metabolite	SMILES	Kovats RI Value	Column Type	Reference
PE(18:2(9Z,12Z)/16:1(9Z))	[H][C@@](COC(=O)CCCCCCC\C=C/C\C=C/CCCCC)(COP(O)(=O)OCCN)OC(=O)CCCCCCC\C=C/CCCCCC	4756.8	Standard polar	33892256
PE(18:2(9Z,12Z)/16:1(9Z))	[H][C@@](COC(=O)CCCCCCC\C=C/C\C=C/CCCCC)(COP(O)(=O)OCCN)OC(=O)CCCCCCC\C=C/CCCCCC	4615.5	Standard non polar	33892256
PE(18:2(9Z,12Z)/16:1(9Z))	[H][C@@](COC(=O)CCCCCCC\C=C/C\C=C/CCCCC)(COP(O)(=O)OCCN)OC(=O)CCCCCCC\C=C/CCCCCC	5006.1	Semi standard non polar	33892256

Derivatized

Derivative Name / Structure	SMILES	Kovats RI Value	Column Type	Reference
PE(18:2(9Z,12Z)/16:1(9Z)),1TMS,isomer #1	CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(OCCN)O[Si](C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCC	5028.6	Semi standard non polar	33892256
PE(18:2(9Z,12Z)/16:1(9Z)),1TMS,isomer #1	CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(OCCN)O[Si](C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCC	4291.3	Standard non polar	33892256
PE(18:2(9Z,12Z)/16:1(9Z)),1TMS,isomer #1	CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(OCCN)O[Si](C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCC	6486.2	Standard polar	33892256
PE(18:2(9Z,12Z)/16:1(9Z)),1TMS,isomer #2	CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCN[Si](C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCC	5125.2	Semi standard non polar	33892256
PE(18:2(9Z,12Z)/16:1(9Z)),1TMS,isomer #2	CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCN[Si](C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCC	4563.7	Standard non polar	33892256
PE(18:2(9Z,12Z)/16:1(9Z)),1TMS,isomer #2	CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCN[Si](C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCC	6304.3	Standard polar	33892256
PE(18:2(9Z,12Z)/16:1(9Z)),2TMS,isomer #1	CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(OCCN[Si](C)(C)C)O[Si](C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCC	5047.2	Semi standard non polar	33892256
PE(18:2(9Z,12Z)/16:1(9Z)),2TMS,isomer #1	CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(OCCN[Si](C)(C)C)O[Si](C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCC	4483.6	Standard non polar	33892256
PE(18:2(9Z,12Z)/16:1(9Z)),2TMS,isomer #1	CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(OCCN[Si](C)(C)C)O[Si](C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCC	5297.4	Standard polar	33892256
PE(18:2(9Z,12Z)/16:1(9Z)),2TMS,isomer #2	CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCN([Si](C)(C)C)[Si](C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCC	5289.8	Semi standard non polar	33892256
PE(18:2(9Z,12Z)/16:1(9Z)),2TMS,isomer #2	CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCN([Si](C)(C)C)[Si](C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCC	4550.0	Standard non polar	33892256
PE(18:2(9Z,12Z)/16:1(9Z)),2TMS,isomer #2	CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCN([Si](C)(C)C)[Si](C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCC	5989.7	Standard polar	33892256
PE(18:2(9Z,12Z)/16:1(9Z)),1TBDMS,isomer #1	CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(OCCN)O[Si](C)(C)C(C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCC	5253.8	Semi standard non polar	33892256
PE(18:2(9Z,12Z)/16:1(9Z)),1TBDMS,isomer #1	CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(OCCN)O[Si](C)(C)C(C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCC	4344.1	Standard non polar	33892256
PE(18:2(9Z,12Z)/16:1(9Z)),1TBDMS,isomer #1	CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(OCCN)O[Si](C)(C)C(C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCC	6450.5	Standard polar	33892256
PE(18:2(9Z,12Z)/16:1(9Z)),1TBDMS,isomer #2	CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCN[Si](C)(C)C(C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCC	5326.0	Semi standard non polar	33892256
PE(18:2(9Z,12Z)/16:1(9Z)),1TBDMS,isomer #2	CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCN[Si](C)(C)C(C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCC	4643.3	Standard non polar	33892256
PE(18:2(9Z,12Z)/16:1(9Z)),1TBDMS,isomer #2	CCCCC/C=C\C/C=C\CCCCCCCC(=O)OC[C@H](COP(=O)(O)OCCN[Si](C)(C)C(C)(C)C)OC(=O)CCCCCCC/C=C\CCCCCC	6219.3	Standard polar	33892256

Spectra

GC-MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted GC-MS	Predicted GC-MS Spectrum - PE(18:2(9Z,12Z)/16:1(9Z)) GC-MS (Non-derivatized) - 70eV, Positive	Not Available	2021-10-13	Wishart Lab	View Spectrum

MS/MS Spectra

Spectrum Type	Description	Splash Key	Deposition Date	Source	View
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - PE(18:2(9Z,12Z)/16:1(9Z)) 10V, Negative-QTOF	splash10-03di-0030000900-32c8fc08c1934555367b	2017-10-04	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - PE(18:2(9Z,12Z)/16:1(9Z)) 20V, Negative-QTOF	splash10-03di-0030000900-32c8fc08c1934555367b	2017-10-04	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - PE(18:2(9Z,12Z)/16:1(9Z)) 40V, Negative-QTOF	splash10-0w4i-0190300300-86657b8b78a96b59b119	2017-10-04	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - PE(18:2(9Z,12Z)/16:1(9Z)) 10V, Positive-QTOF	splash10-03di-0000011900-95cc383c6d1d01e7967c	2017-10-04	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - PE(18:2(9Z,12Z)/16:1(9Z)) 20V, Positive-QTOF	splash10-03r0-0003691600-2608430d4ebdcd7c402c	2017-10-04	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - PE(18:2(9Z,12Z)/16:1(9Z)) 40V, Positive-QTOF	splash10-0229-0003691100-418c96145d1d6f04d8e1	2017-10-04	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - PE(18:2(9Z,12Z)/16:1(9Z)) 10V, Negative-QTOF	splash10-03di-0030000900-3e4359ccb841275e012f	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - PE(18:2(9Z,12Z)/16:1(9Z)) 20V, Negative-QTOF	splash10-03di-0030000900-3e4359ccb841275e012f	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - PE(18:2(9Z,12Z)/16:1(9Z)) 40V, Negative-QTOF	splash10-0w4i-0190300300-a090cd2415ea0fa32b1c	2021-09-23	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - PE(18:2(9Z,12Z)/16:1(9Z)) 10V, Positive-QTOF	splash10-03di-0000011900-134506c18d94e4a087a7	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - PE(18:2(9Z,12Z)/16:1(9Z)) 20V, Positive-QTOF	splash10-03k9-0003691600-a30e1e1c153022c74d01	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - PE(18:2(9Z,12Z)/16:1(9Z)) 40V, Positive-QTOF	splash10-0229-0003691100-dcf5ad66193bba345f84	2021-09-24	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - PE(18:2(9Z,12Z)/16:1(9Z)) 10V, Positive-QTOF	splash10-000i-0000010900-c9e6a88a4b1083f19d41	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - PE(18:2(9Z,12Z)/16:1(9Z)) 20V, Positive-QTOF	splash10-000i-0000022900-c22730aa7d46e7968fe6	2021-09-25	Wishart Lab	View Spectrum
Predicted LC-MS/MS	Predicted LC-MS/MS Spectrum - PE(18:2(9Z,12Z)/16:1(9Z)) 40V, Positive-QTOF	splash10-0006-0100319100-a50add63ef8555162f13	2021-09-25	Wishart Lab	View Spectrum

Biological Properties

Cellular Locations

Extracellular
Membrane

Biospecimen Locations

Not Available

Tissue Locations

All Tissues
Brain

Pathways

Name	SMPDB/PathBank	KEGG
Phosphatidylcholine Biosynthesis PC(18:2(9Z,12Z)/16:1(9Z))		Not Available
Phosphatidylethanolamine Biosynthesis PE(18:2(9Z,12Z)/16:1(9Z))		Not Available

Normal Concentrations

Not Available

Abnormal Concentrations

Not Available

Predicted Concentrations

Biospecimen	Value	Original age	Original sex	Original condition	Comments
Blood	0.128 +/- 0.090 uM	Adult (>18 years old)	Both	Normal (Most Probable)	Calculated using MetaboAnalyst
Blood	2.133 +/- 1.250 uM	Adult (>18 years old)	Both	Normal (Upper Limit)	Calculated using MetaboAnalyst

Associated Disorders and Diseases

Disease References

None

Associated OMIM IDs

None

External Links

DrugBank ID

Not Available

Phenol Explorer Compound ID

Not Available

FooDB ID

Not Available

KNApSAcK ID

Not Available

Chemspider ID

Not Available

KEGG Compound ID

Not Available

BioCyc ID

Not Available

BiGG ID

Not Available

Wikipedia Link

Not Available

METLIN ID

Not Available

PubChem Compound

52924360

PDB ID

Not Available

ChEBI ID

Not Available

Food Biomarker Ontology

Not Available

VMH ID

Not Available

MarkerDB ID

Not Available

Good Scents ID

Not Available

References

Synthesis Reference

Not Available

Material Safety Data Sheet (MSDS)

Not Available

General References

Not Available

Only showing the first 10 proteins. There are 43 proteins in total.

Show all enzymes and transporters

Enzymes

Enzyme Details

1. Calcium-dependent phospholipase A2

General function:: Involved in phospholipase A2 activity
Specific function:: PA2 catalyzes the calcium-dependent hydrolysis of the 2-acyl groups in 3-sn-phosphoglycerides. This isozyme hydrolyzes more efficiently L-alpha-1-palmitoyl-2-oleoyl phosphatidylcholine than L-alpha-1-palmitoyl-2-arachidonyl phosphatidylcholine, L-alpha-1-palmitoyl-2-arachidonyl phosphatidylethanolamine, or L-alpha-1-stearoyl-2-arachidonyl phosphatidylinositol. May be involved in the production of lung surfactant, the remodeling or regulation of cardiac muscle.
Gene Name:: PLA2G5
Uniprot ID:: P39877
Molecular weight:: 15674.065

Enzyme Details

2. Group IIF secretory phospholipase A2

General function:: Involved in phospholipase A2 activity
Specific function:: PA2 catalyzes the calcium-dependent hydrolysis of the 2-acyl groups in 3-sn-phosphoglycerides. Hydrolyzes phosphatidylglycerol versus phosphatidylcholine with a 15-fold preference.
Gene Name:: PLA2G2F
Uniprot ID:: Q9BZM2
Molecular weight:: 23256.29

Enzyme Details

3. Cytosolic phospholipase A2

General function:: Involved in metabolic process
Specific function:: Selectively hydrolyzes arachidonyl phospholipids in the sn-2 position releasing arachidonic acid. Together with its lysophospholipid activity, it is implicated in the initiation of the inflammatory response.
Gene Name:: PLA2G4A
Uniprot ID:: P47712
Molecular weight:: 85210.19

Enzyme Details

4. Phospholipase A2

General function:: Involved in phospholipase A2 activity
Specific function:: PA2 catalyzes the calcium-dependent hydrolysis of the 2-acyl groups in 3-sn-phosphoglycerides.
Gene Name:: PLA2G1B
Uniprot ID:: P04054
Molecular weight:: 16359.535

Enzyme Details

5. Group XIIB secretory phospholipase A2-like protein

General function:: Involved in phospholipase A2 activity
Specific function:: Not known; does not seem to have catalytic activity.
Gene Name:: PLA2G12B
Uniprot ID:: Q9BX93
Molecular weight:: Not Available

Enzyme Details

6. Group 10 secretory phospholipase A2

General function:: Involved in phospholipase A2 activity
Specific function:: PA2 catalyzes the calcium-dependent hydrolysis of the 2-acyl groups in 3-sn-phosphoglycerides. Has a powerful potency for releasing arachidonic acid from cell membrane phospholipids. Prefers phosphatidylethanolamine and phosphatidylcholine liposomes to those of phosphatidylserine.
Gene Name:: PLA2G10
Uniprot ID:: O15496
Molecular weight:: 18153.04

Enzyme Details

7. Group IIE secretory phospholipase A2

General function:: Involved in phospholipase A2 activity
Specific function:: PA2 catalyzes the calcium-dependent hydrolysis of the 2-acyl groups in 3-sn-phosphoglycerides. Has a preference for arachidonic-containing phospholipids.
Gene Name:: PLA2G2E
Uniprot ID:: Q9NZK7
Molecular weight:: 15988.525

Enzyme Details

8. 85/88 kDa calcium-independent phospholipase A2

General function:: Involved in metabolic process
Specific function:: Catalyzes the release of fatty acids from phospholipids. It has been implicated in normal phospholipid remodeling, nitric oxide-induced or vasopressin-induced arachidonic acid release and in leukotriene and prostaglandin production. May participate in fas mediated apoptosis and in regulating transmembrane ion flux in glucose-stimulated B-cells. Has a role in cardiolipin (CL) deacylation. Required for both speed and directionality of monocyte MCP1/CCL2-induced chemotaxis through regulation of F-actin polymerization at the pseudopods. Isoform ankyrin-iPLA2-1 and isoform ankyrin-iPLA2-2, which lack the catalytic domain, are probably involved in the negative regulation of iPLA2 activity.
Gene Name:: PLA2G6
Uniprot ID:: O60733
Molecular weight:: 84092.635

Enzyme Details

9. Group IID secretory phospholipase A2

General function:: Involved in phospholipase A2 activity
Specific function:: PA2 catalyzes the calcium-dependent hydrolysis of the 2-acyl groups in 3-sn-phosphoglycerides. L-alpha-1-palmitoyl-2-linoleoyl phosphatidylethanolamine is more efficiently hydrolyzed than the other phospholipids examined.
Gene Name:: PLA2G2D
Uniprot ID:: Q9UNK4
Molecular weight:: 16546.1

Enzyme Details

10. Phospholipase D2

General function:: Involved in protein binding
Specific function:: May have a role in signal-induced cytoskeletal regulation and/or endocytosis (By similarity).
Gene Name:: PLD2
Uniprot ID:: O14939
Molecular weight:: 104656.485

Only showing the first 10 proteins. There are 43 proteins in total.

Show all enzymes and transporters

Showing metabocard for PE(18:2(9Z,12Z)/16:1(9Z)) (HMDB0009089)

MOL for HMDB0009089 (PE(18:2(9Z,12Z)/16:1(9Z)))

3D MOL for HMDB0009089 (PE(18:2(9Z,12Z)/16:1(9Z)))

3D SDF for HMDB0009089 (PE(18:2(9Z,12Z)/16:1(9Z)))

3D-SDF for HMDB0009089 (PE(18:2(9Z,12Z)/16:1(9Z)))

PDB for HMDB0009089 (PE(18:2(9Z,12Z)/16:1(9Z)))

3D PDB for HMDB0009089 (PE(18:2(9Z,12Z)/16:1(9Z)))

SMILES for HMDB0009089 (PE(18:2(9Z,12Z)/16:1(9Z)))

INCHI for HMDB0009089 (PE(18:2(9Z,12Z)/16:1(9Z)))

Structure for HMDB0009089 (PE(18:2(9Z,12Z)/16:1(9Z)))

3D Structure for HMDB0009089 (PE(18:2(9Z,12Z)/16:1(9Z)))

Predicted Collision Cross Sections

Predicted Kovats Retention Indices

Underivatized

Derivatized

GC-MS Spectra

MS/MS Spectra

Enzymes