Hmdb loader
You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Human Metabolome Database.
Record Information
Version5.0
StatusDetected but not Quantified
Creation Date2005-11-16 15:48:42 UTC
Update Date2022-09-22 18:35:06 UTC
HMDB IDHMDB0001030
Secondary Accession Numbers
  • HMDB01030
Metabolite Identification
Common Name3'-Ketolactose
Description3'-Ketolactose belongs to the class of organic compounds known as disaccharides. Disaccharides are compounds containing two carbohydrate moieties linked to each to each other through a glycosidic bond, no set of three or more glycosidically linked carbohydrate units. 3'-Ketolactose exists in all living organisms, ranging from bacteria to humans. 3'-Ketolactose has been detected, but not quantified in, several different foods, such as star anises (Illicium verum), calabashes (Lagenaria siceraria), purple lavers (Porphyra laciniata), cardamoms (Elettaria cardamomum), and rapes (Brassica napus var. napus). This could make 3'-ketolactose a potential biomarker for the consumption of these foods. Based on a literature review very few articles have been published on 3'-Ketolactose.
Structure
Data?1582752172
Synonyms
ValueSource
3'-dehydro-beta-D-Galactosyl-beta-D-glucopyranosideHMDB
3'-dehydro-beta-delta-Galactosyl-beta-delta-glucopyranosideHMDB
4-O-(beta-D-xylo-Hexopyranosyl-3-ulose)-D-glucopyranoseMeSH, HMDB
4-O-beta-D-xylo-Hexopyranos-3-ulos-1-yl-D-glucoseMeSH, HMDB
Chemical FormulaC12H20O11
Average Molecular Weight340.2806
Monoisotopic Molecular Weight340.100561482
IUPAC Name(2R,3S,5S,6S)-3,5-dihydroxy-2-(hydroxymethyl)-6-{[(2R,3S,4R,5R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}oxan-4-one
Traditional Name3-ketolactose
CAS Registry Number15990-62-2
SMILES
OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)C(=O)[C@H]1O
InChI Identifier
InChI=1S/C12H20O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-5,7-15,17-20H,1-2H2/t3-,4-,5+,7-,8-,9-,10-,11?,12+/m1/s1
InChI KeyHKKHTABTHSUDBP-ILXILVFVSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as disaccharides. Disaccharides are compounds containing two carbohydrate moieties linked to each to each other through a glycosidic bond, no set of three or more glycosidically linked carbohydrate units.
KingdomOrganic compounds
Super ClassOrganic oxygen compounds
ClassOrganooxygen compounds
Sub ClassCarbohydrates and carbohydrate conjugates
Direct ParentDisaccharides
Alternative Parents
Substituents
  • Disaccharide
  • Oxane
  • Hemiacetal
  • Ketone
  • Cyclic ketone
  • Secondary alcohol
  • Acetal
  • Oxacycle
  • Organoheterocyclic compound
  • Polyol
  • Hydrocarbon derivative
  • Organic oxide
  • Alcohol
  • Carbonyl group
  • Primary alcohol
  • Aliphatic heteromonocyclic compound
Molecular FrameworkAliphatic heteromonocyclic compounds
External DescriptorsNot Available
Ontology
Physiological effectNot Available
Disposition
Biological locationRoute of exposureSource
ProcessNot Available
RoleNot Available
Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water SolubilityNot AvailableNot Available
LogPNot AvailableNot Available
Experimental Chromatographic PropertiesNot Available
Predicted Molecular Properties
PropertyValueSource
Water Solubility498 g/LALOGPS
logP-2.5ALOGPS
logP-4.1ChemAxon
logS0.17ALOGPS
pKa (Strongest Acidic)10.97ChemAxon
pKa (Strongest Basic)-3ChemAxon
Physiological Charge0ChemAxon
Hydrogen Acceptor Count11ChemAxon
Hydrogen Donor Count7ChemAxon
Polar Surface Area186.37 ŲChemAxon
Rotatable Bond Count4ChemAxon
Refractivity67.57 m³·mol⁻¹ChemAxon
Polarizability30.87 ųChemAxon
Number of Rings2ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleNoChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DarkChem[M+H]+177.5931661259
DarkChem[M-H]-168.52831661259
AllCCS[M+H]+176.50532859911
AllCCS[M-H]-172.87432859911
DeepCCS[M+H]+171.32230932474
DeepCCS[M-H]-168.92630932474
DeepCCS[M-2H]-202.95630932474
DeepCCS[M+Na]+177.37230932474
AllCCS[M+H]+176.532859911
AllCCS[M+H-H2O]+173.532859911
AllCCS[M+NH4]+179.332859911
AllCCS[M+Na]+180.132859911
AllCCS[M-H]-172.932859911
AllCCS[M+Na-2H]-172.332859911
AllCCS[M+HCOO]-171.932859911

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
3'-KetolactoseOC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)C(=O)[C@H]1O3119.2Standard polar33892256
3'-KetolactoseOC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)C(=O)[C@H]1O2930.7Standard non polar33892256
3'-KetolactoseOC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O)C(O)O[C@@H]2CO)[C@H](O)C(=O)[C@H]1O2815.2Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
3'-Ketolactose,1TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)C(=O)[C@H]1O2778.7Semi standard non polar33892256
3'-Ketolactose,1TMS,isomer #2C[Si](C)(C)O[C@@H]1[C@@H](O)C(O)O[C@H](CO)[C@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O2789.6Semi standard non polar33892256
3'-Ketolactose,1TMS,isomer #3C[Si](C)(C)O[C@H]1C(O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)C(=O)[C@H]2O)[C@@H]1O2790.0Semi standard non polar33892256
3'-Ketolactose,1TMS,isomer #4C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)C(=O)[C@H]2O)[C@H](O)[C@H]1O2823.6Semi standard non polar33892256
3'-Ketolactose,1TMS,isomer #5C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O2784.3Semi standard non polar33892256
3'-Ketolactose,1TMS,isomer #6C[Si](C)(C)O[C@@H]1C(=O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O2786.5Semi standard non polar33892256
3'-Ketolactose,1TMS,isomer #7C[Si](C)(C)O[C@@H]1C(=O)[C@@H](O)[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)O[C@@H]1CO2779.8Semi standard non polar33892256
3'-Ketolactose,1TMS,isomer #8C[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@@H]1O2800.4Semi standard non polar33892256
3'-Ketolactose,1TMS,isomer #9C[Si](C)(C)OC1=C(O)[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H]1O2801.2Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O)[C@H](O)C(=O)[C@H]1O2781.3Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #10C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)C(=O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O2788.9Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #11C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O2767.3Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #12C[Si](C)(C)O[C@@H]1C(=O)[C@@H](O)[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO2775.3Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #13C[Si](C)(C)O[C@@H]1C(=O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O[Si](C)(C)C2771.9Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #14C[Si](C)(C)OC1=C(O)[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H]1O2770.6Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #15C[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O2773.7Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #16C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)C(=O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C2800.6Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #17C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O2776.5Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #18C[Si](C)(C)O[C@@H]1C(=O)[C@@H](O)[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)O[C@@H]1CO2781.3Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #19C[Si](C)(C)O[C@@H]1C(=O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]1CO2786.2Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)C(=O)[C@H]1O2798.9Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #20C[Si](C)(C)OC1=C(O)[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)O[C@H](CO)[C@@H]1O2780.7Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #21C[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@@H]1O2780.4Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #22C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O2792.3Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #23C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]2O)[C@H](O)[C@H]1O2807.2Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #24C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)C(=O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O2809.9Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #25C[Si](C)(C)OC1=C(O)[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H]1O2811.0Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #26C[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O2811.5Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #27C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O2778.8Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #28C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C2772.9Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #29C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(O[Si](C)(C)C)=C1O2779.4Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)C(=O)[C@H]1O2771.5Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #30C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)C(O)=C(O[Si](C)(C)C)[C@H]1O2779.3Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #31C[Si](C)(C)O[C@@H]1C(=O)[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O2767.6Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #32C[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C2788.5Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #33C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O2822.3Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #34C[Si](C)(C)OC1=C(O)[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H]1O[Si](C)(C)C2785.3Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #35C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)O[C@@H]1CO2819.5Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)C(=O)[C@H]1O2769.3Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O2770.7Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C2784.2Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)C(O[Si](C)(C)C)=C1O2776.6Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #8C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)C(O)=C(O[Si](C)(C)C)[C@H]1O2778.1Semi standard non polar33892256
3'-Ketolactose,2TMS,isomer #9C[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C)C(O)O[C@H](CO)[C@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O2797.2Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)C(=O)[C@H]1O2692.6Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O2717.6Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C2728.9Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)C(O[Si](C)(C)C)=C1O2746.8Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #13C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)C(O)=C(O[Si](C)(C)C)[C@H]1O2744.6Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #14C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)C(=O)[C@H]1O2706.9Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #15C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O2707.2Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C2716.2Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #17C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)C(O[Si](C)(C)C)=C1O2719.2Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #18C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)C(O)=C(O[Si](C)(C)C)[C@H]1O2722.8Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #19C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O2680.1Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)C(=O)[C@H]1O2682.0Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #20C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C2697.7Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #21C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)C(O[Si](C)(C)C)=C1O2711.8Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #22C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)C(O)=C(O[Si](C)(C)C)[C@H]1O2710.8Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O[Si](C)(C)C2704.5Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #24C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O2716.5Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #25C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O2755.2Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #26C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2762.9Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #27C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)C(O)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2728.0Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #28C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)C(=O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2751.1Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #29C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O2704.4Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)C(=O)[C@H]1O2662.1Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #30C[Si](C)(C)O[C@@H]1C(=O)[C@@H](O)[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)O[C@@H]1CO2755.4Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #31C[Si](C)(C)O[C@@H]1C(=O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]1CO2746.7Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #32C[Si](C)(C)OC1=C(O)[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)O[C@H](CO)[C@@H]1O2752.1Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #33C[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@@H]1O2764.4Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #34C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O2684.1Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #35C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O2738.3Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #36C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)C(=O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2728.5Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #37C[Si](C)(C)OC1=C(O)[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H]1O2740.1Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #38C[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O2762.1Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #39C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O2679.1Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O2682.8Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #40C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C2675.8Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #41C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(O[Si](C)(C)C)=C1O2710.0Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #42C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)C(O)=C(O[Si](C)(C)C)[C@H]1O2718.6Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #43C[Si](C)(C)O[C@@H]1C(=O)[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O[Si](C)(C)C2710.9Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #44C[Si](C)(C)OC1=C(O)[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H]1O[Si](C)(C)C2740.4Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #45C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO2774.1Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #46C[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2737.0Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #47C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O[Si](C)(C)C2768.4Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #48C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O2708.7Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #49C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C2766.8Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C2692.6Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #50C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)C(=O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C2758.5Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #51C[Si](C)(C)OC1=C(O)[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@@H]1O2761.1Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #52C[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@@H]1O2779.8Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #53C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O2701.5Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #54C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C2701.4Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #55C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(O[Si](C)(C)C)=C1O2713.0Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #56C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)C(O)=C(O[Si](C)(C)C)[C@H]1O2726.9Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #57C[Si](C)(C)O[C@@H]1C(=O)[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@H]1O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]1CO2744.5Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #58C[Si](C)(C)OC1=C(O)[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)O[C@H](CO)[C@@H]1O[Si](C)(C)C2756.3Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #59C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O)[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)O[C@@H]1CO2783.6Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O)[C@H](O)C(O[Si](C)(C)C)=C1O2723.9Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #60C[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@@H]1O[Si](C)(C)C2754.8Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #61C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O)[C@@H](CO)O[C@H]1O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]1CO2780.4Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #62C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O2701.5Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #63C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C2705.4Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #64C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(O[Si](C)(C)C)=C1O2728.3Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #65C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)C(O)=C(O[Si](C)(C)C)[C@H]1O2745.6Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #66C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O2742.7Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #67C[Si](C)(C)OC1=C(O)[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H]1O[Si](C)(C)C2767.4Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #68C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1CO2805.5Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #69C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]1O2802.4Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O)C(O)=C(O[Si](C)(C)C)[C@H]1O2719.1Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #70C[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C2774.5Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #71C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O[Si](C)(C)C2687.1Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #72C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O2731.0Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #73C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O2773.1Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #74C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2771.5Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #75C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)C(O)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2728.9Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #76C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)O[C@@H]1CO2792.7Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #77C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O2777.2Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #8C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)C(=O)[C@H]1O2726.0Semi standard non polar33892256
3'-Ketolactose,3TMS,isomer #9C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)C(=O)[C@H]1O2689.1Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O)C(=O)[C@H]1O2635.0Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)C(O[Si](C)(C)C)=C1O2669.9Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #100C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2695.4Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #101C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)C(O)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2667.7Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #102C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]1O2718.9Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #103C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1CO2730.1Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #104C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2700.1Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #105C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2705.1Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C)C(O)=C(O[Si](C)(C)C)[C@H]1O2669.9Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O2627.7Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #13C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C2642.8Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #14C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)C(O[Si](C)(C)C)=C1O2644.7Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #15C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)C(O)=C(O[Si](C)(C)C)[C@H]1O2645.9Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O[Si](C)(C)C2655.7Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #17C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O2652.6Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #18C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O2680.3Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #19C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O)[C@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2697.0Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)C(=O)[C@H]1O2633.2Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #20C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O)C(O)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2661.1Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #21C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)C(=O)[C@H]1O2670.9Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #22C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O2682.6Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C2694.9Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #24C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)C(O[Si](C)(C)C)=C1O2681.4Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #25C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)C(O)=C(O[Si](C)(C)C)[C@H]1O2682.4Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #26C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O2676.1Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #27C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C2695.7Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #28C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)C(O[Si](C)(C)C)=C1O2671.5Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #29C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)C(O)=C(O[Si](C)(C)C)[C@H]1O2674.6Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O2644.4Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #30C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O[Si](C)(C)C2681.0Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #31C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O2663.3Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #32C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O2695.6Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #33C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2708.1Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #34C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)C(O)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2679.5Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #35C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O2705.5Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #36C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C2719.9Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #37C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)C(O[Si](C)(C)C)=C1O2696.9Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #38C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)C(O)=C(O[Si](C)(C)C)[C@H]1O2702.4Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #39C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O[Si](C)(C)C2708.1Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C2653.4Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #40C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O2673.3Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #41C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O2701.1Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #42C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2714.8Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #43C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)C(O)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2687.9Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #44C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O[Si](C)(C)C2659.7Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #45C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O2649.9Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #46C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O2674.4Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #47C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2689.6Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #48C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)C(O)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2666.9Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #49C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2697.0Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)C(O[Si](C)(C)C)=C1O2650.0Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #50C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2700.9Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #51C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O2669.5Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #52C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2727.0Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #53C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)C(=O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2712.5Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #54C[Si](C)(C)OC1=C(O)[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@@H]1O2721.4Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #55C[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@@H]1O2729.6Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #56C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O2704.2Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #57C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C2691.0Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #58C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(O[Si](C)(C)C)=C1O2690.8Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #59C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)C(O)=C(O[Si](C)(C)C)[C@H]1O2691.3Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)C(O)=C(O[Si](C)(C)C)[C@H]1O2650.4Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #60C[Si](C)(C)O[C@@H]1C(=O)[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@H]1O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]1CO2722.1Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #61C[Si](C)(C)OC1=C(O)[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)O[C@H](CO)[C@@H]1O[Si](C)(C)C2730.4Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #62C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O)[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)O[C@@H]1CO2738.4Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #63C[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@@H]1O[Si](C)(C)C2723.5Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #64C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O)[C@@H](CO)O[C@H]1O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]1CO2736.5Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #65C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O2678.1Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #66C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C2664.1Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #67C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(O[Si](C)(C)C)=C1O2660.1Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #68C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)C(O)=C(O[Si](C)(C)C)[C@H]1O2670.0Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #69C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2700.7Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)C(=O)[C@H]1O2654.8Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #70C[Si](C)(C)OC1=C(O)[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@H](CO)[C@@H]1O[Si](C)(C)C2700.6Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #71C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O)[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO2718.9Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #72C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C2706.7Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #73C[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2702.4Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #74C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O[Si](C)(C)C2645.1Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #75C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O2663.4Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #76C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O2693.0Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #77C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2687.8Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #78C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)C(O)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2660.3Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #79C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO2710.8Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #8C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O2666.7Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #80C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O[Si](C)(C)C2702.8Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #81C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O2669.3Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #82C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C2659.7Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #83C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(O[Si](C)(C)C)=C1O2665.4Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #84C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)C(O)=C(O[Si](C)(C)C)[C@H]1O2676.1Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #85C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C2708.9Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #86C[Si](C)(C)OC1=C(O)[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@@H]1O[Si](C)(C)C2706.4Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #87C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O)[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)O[C@@H]1CO2732.5Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #88C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O)[C@@H](CO)O[C@H]1O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]1CO2720.7Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #89C[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@@H]1O[Si](C)(C)C2710.9Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #9C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C2676.1Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #90C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O[Si](C)(C)C2689.3Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #91C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O2689.4Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #92C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O2712.5Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #93C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2707.3Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #94C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)C(O)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2685.3Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #95C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)O[C@@H]1CO2737.3Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #96C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@H]1O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]1CO2727.5Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #97C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O[Si](C)(C)C2656.6Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #98C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O2663.5Semi standard non polar33892256
3'-Ketolactose,4TMS,isomer #99C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O2701.8Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O)C(=O)[C@H]1O2654.3Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O[Si](C)(C)C2621.0Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O2610.0Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O2631.2Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #13C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2647.8Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #14C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)C(O)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2615.1Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #15C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O2648.8Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C2667.3Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #17C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)C(O[Si](C)(C)C)=C1O2654.6Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #18C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C)C(O)=C(O[Si](C)(C)C)[C@H]1O2652.5Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #19C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O[Si](C)(C)C2664.7Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O2644.6Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #20C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O2659.8Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #21C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O2678.1Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #22C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2688.5Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C)C(O)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2668.4Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #24C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O[Si](C)(C)C2623.4Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #25C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O2622.9Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #26C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O2635.9Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #27C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2652.5Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #28C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)C(O)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2630.2Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #29C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2667.4Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C2659.4Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #30C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2663.1Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #31C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O2660.0Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #32C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C2673.2Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #33C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)C(O[Si](C)(C)C)=C1O2669.1Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #34C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)C(O)=C(O[Si](C)(C)C)[C@H]1O2670.1Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #35C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O[Si](C)(C)C2668.3Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #36C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O2656.7Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #37C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O2671.0Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #38C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2688.1Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #39C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)C(O)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2669.7Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O)C(O[Si](C)(C)C)=C1O2638.1Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #40C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O[Si](C)(C)C2643.7Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #41C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O2644.0Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #42C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O2647.4Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #43C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2672.3Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #44C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)C(O)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2658.1Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #45C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2663.3Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #46C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2659.3Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #47C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O[Si](C)(C)C2666.1Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #48C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O2681.3Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #49C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O2678.1Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)C(O)=C(O[Si](C)(C)C)[C@H]1O2638.9Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #50C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2699.2Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #51C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)C(O)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2696.5Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #52C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2708.0Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #53C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2705.2Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #54C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2670.8Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #55C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2666.8Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #56C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O2675.5Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #57C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C2664.4Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #58C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(O[Si](C)(C)C)=C1O2666.5Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #59C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)C(O)=C(O[Si](C)(C)C)[C@H]1O2673.1Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O2632.0Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #60C[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2667.9Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #61C[Si](C)(C)OC1=C(O)[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@@H]1O[Si](C)(C)C2698.6Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #62C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O)[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)O[C@@H]1CO2707.9Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #63C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O)[C@@H](CO)O[C@H]1O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]1CO2694.9Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #64C[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@@H]1O[Si](C)(C)C2693.1Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #65C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O[Si](C)(C)C2646.0Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #66C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O2679.3Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #67C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O2687.4Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #68C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2673.4Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #69C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)C(O)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2674.5Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C2655.6Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #70C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)O[C@@H]1CO2710.7Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #71C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@H]1O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]1CO2702.1Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #72C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O[Si](C)(C)C2632.1Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #73C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O2655.6Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #74C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O2672.5Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #75C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2651.2Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #76C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)C(O)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2646.2Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #77C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C2674.7Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #78C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO2683.8Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #79C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2661.7Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #8C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)C(O[Si](C)(C)C)=C1O2625.7Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #80C[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2662.8Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #81C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O[Si](C)(C)C2645.8Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #82C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O2660.9Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #83C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O2680.2Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #84C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2670.0Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #85C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)C(O)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2654.7Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #86C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@H]1O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]1CO2693.8Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #87C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)O[C@@H]1CO2699.9Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #88C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2695.1Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #89C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2698.8Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #9C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)C(O)=C(O[Si](C)(C)C)[C@H]1O2626.1Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #90C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2657.7Semi standard non polar33892256
3'-Ketolactose,5TMS,isomer #91C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2660.5Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O2630.5Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O[Si](C)(C)C2621.5Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O2613.1Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O2614.5Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #13C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2643.0Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #14C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)C(O)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2626.2Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #15C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2633.2Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2626.8Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #17C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O[Si](C)(C)C2630.4Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #18C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O2640.7Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #19C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O2631.7Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C2654.2Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #20C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C)[C@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2657.6Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #21C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C)C(O)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2645.8Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #22C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2659.0Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2655.6Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #24C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2636.7Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #25C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2630.6Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #26C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O[Si](C)(C)C2643.4Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #27C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O2643.8Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #28C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O2635.0Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #29C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2665.8Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O)C(O[Si](C)(C)C)=C1O2642.6Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #30C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)C(O)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2658.4Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #31C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2656.0Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #32C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2652.0Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #33C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2643.5Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #34C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2637.2Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #35C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2666.1Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #36C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2659.4Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #37C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O[Si](C)(C)C2637.2Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #38C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O2661.2Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #39C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O2663.6Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)C(O)=C(O[Si](C)(C)C)[C@H]1O2632.9Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #40C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2641.3Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #41C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)C(O)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2655.8Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #42C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@H]1O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]1CO2660.1Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #43C[Si](C)(C)OC1=C(O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)O[C@@H]1CO2667.7Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #44C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2652.7Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #45C[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2660.4Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #46C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2633.2Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #47C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2639.6Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #48C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2645.4Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #49C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2647.4Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O[Si](C)(C)C2628.8Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O2630.7Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O2630.4Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #8C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2649.7Semi standard non polar33892256
3'-Ketolactose,6TMS,isomer #9C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)C(O)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2633.9Semi standard non polar33892256
3'-Ketolactose,7TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(=O)[C@H]1O[Si](C)(C)C2666.1Semi standard non polar33892256
3'-Ketolactose,7TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2671.0Semi standard non polar33892256
3'-Ketolactose,7TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2661.0Semi standard non polar33892256
3'-Ketolactose,7TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2663.7Semi standard non polar33892256
3'-Ketolactose,7TMS,isomer #13C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2656.9Semi standard non polar33892256
3'-Ketolactose,7TMS,isomer #14C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2650.8Semi standard non polar33892256
3'-Ketolactose,7TMS,isomer #15C[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2658.1Semi standard non polar33892256
3'-Ketolactose,7TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O2655.7Semi standard non polar33892256
3'-Ketolactose,7TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O2636.2Semi standard non polar33892256
3'-Ketolactose,7TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2674.4Semi standard non polar33892256
3'-Ketolactose,7TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)C(O)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2666.0Semi standard non polar33892256
3'-Ketolactose,7TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2666.9Semi standard non polar33892256
3'-Ketolactose,7TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]2CO[Si](C)(C)C)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2660.4Semi standard non polar33892256
3'-Ketolactose,7TMS,isomer #8C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C2662.9Semi standard non polar33892256
3'-Ketolactose,7TMS,isomer #9C[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)C(O[Si](C)(C)C)=C(O[Si](C)(C)C)[C@H]1O[Si](C)(C)C2655.0Semi standard non polar33892256
3'-Ketolactose,1TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)C(=O)[C@H]1O3023.1Semi standard non polar33892256
3'-Ketolactose,1TBDMS,isomer #2CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)C(O)O[C@H](CO)[C@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O3043.2Semi standard non polar33892256
3'-Ketolactose,1TBDMS,isomer #3CC(C)(C)[Si](C)(C)O[C@H]1C(O)O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)C(=O)[C@H]2O)[C@@H]1O3031.6Semi standard non polar33892256
3'-Ketolactose,1TBDMS,isomer #4CC(C)(C)[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)C(=O)[C@H]2O)[C@H](O)[C@H]1O3056.4Semi standard non polar33892256
3'-Ketolactose,1TBDMS,isomer #5CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O3036.0Semi standard non polar33892256
3'-Ketolactose,1TBDMS,isomer #6CC(C)(C)[Si](C)(C)O[C@@H]1C(=O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O3029.5Semi standard non polar33892256
3'-Ketolactose,1TBDMS,isomer #7CC(C)(C)[Si](C)(C)O[C@@H]1C(=O)[C@@H](O)[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)O[C@@H]1CO3021.9Semi standard non polar33892256
3'-Ketolactose,1TBDMS,isomer #8CC(C)(C)[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@@H]1O3066.7Semi standard non polar33892256
3'-Ketolactose,1TBDMS,isomer #9CC(C)(C)[Si](C)(C)OC1=C(O)[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H]1O3067.9Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]2O)[C@H](O)C(=O)[C@H]1O3232.2Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #10CC(C)(C)[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)C(=O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3252.1Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #11CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O3241.0Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #12CC(C)(C)[Si](C)(C)O[C@@H]1C(=O)[C@@H](O)[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@@H]1CO3241.7Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #13CC(C)(C)[Si](C)(C)O[C@@H]1C(=O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3247.5Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #14CC(C)(C)[Si](C)(C)OC1=C(O)[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H]1O3256.8Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #15CC(C)(C)[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O3258.6Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #16CC(C)(C)[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)C(=O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3257.5Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #17CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O3255.6Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #18CC(C)(C)[Si](C)(C)O[C@@H]1C(=O)[C@@H](O)[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)O[C@@H]1CO3251.2Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #19CC(C)(C)[Si](C)(C)O[C@@H]1C(=O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]1CO3255.0Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)C(=O)[C@H]1O3256.2Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #20CC(C)(C)[Si](C)(C)OC1=C(O)[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)O[C@H](CO)[C@@H]1O3255.5Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #21CC(C)(C)[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)[C@@H]1O3258.5Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #22CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O3253.5Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #23CC(C)(C)[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]2O)[C@H](O)[C@H]1O3259.4Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #24CC(C)(C)[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)C(=O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3270.8Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #25CC(C)(C)[Si](C)(C)OC1=C(O)[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H]1O3281.4Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #26CC(C)(C)[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3285.3Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #27CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]1O3241.6Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #28CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C(C)(C)C3239.0Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #29CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(O[Si](C)(C)C(C)(C)C)=C1O3257.8Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)[C@H](O)C(=O)[C@H]1O3245.3Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #30CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)C(O)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O3257.8Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #31CC(C)(C)[Si](C)(C)O[C@@H]1C(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O3232.6Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #32CC(C)(C)[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C3265.3Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #33CC(C)(C)[Si](C)(C)OC1=C(O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O3311.0Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #34CC(C)(C)[Si](C)(C)OC1=C(O)[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H]1O[Si](C)(C)C(C)(C)C3260.6Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #35CC(C)(C)[Si](C)(C)OC1=C(O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)O[C@@H]1CO3316.3Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #4CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)C(=O)[C@H]1O3235.2Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #5CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]1O3233.6Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #6CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C(C)(C)C3239.1Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #7CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)C(O[Si](C)(C)C(C)(C)C)=C1O3254.0Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #8CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)C(O)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O3247.3Semi standard non polar33892256
3'-Ketolactose,2TBDMS,isomer #9CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@H](CO)[C@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O3259.7Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)C(=O)[C@H]1O3387.3Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #10CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]1O3415.3Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #11CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C(C)(C)C3418.9Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #12CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)C(O[Si](C)(C)C(C)(C)C)=C1O3401.5Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #13CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)C(O)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O3398.0Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #14CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)[C@H](O)C(=O)[C@H]1O3415.2Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #15CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]1O3423.4Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #16CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C(C)(C)C3428.7Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #17CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)[C@H](O)C(O[Si](C)(C)C(C)(C)C)=C1O3387.9Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #18CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)C(O)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O3388.8Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #19CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]1O3410.2Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C(C)(C)C)[C@H](O)C(=O)[C@H]1O3406.8Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #20CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C(C)(C)C3405.4Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #21CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)C(O[Si](C)(C)C(C)(C)C)=C1O3380.6Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #22CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C(O)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O3383.5Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #23CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]1O[Si](C)(C)C(C)(C)C3412.1Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #24CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C1O3395.3Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #25CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)C(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O3416.4Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #26CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O)C(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C3429.9Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #27CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)C(O)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3406.1Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #28CC(C)(C)[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)C(=O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3435.7Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #29CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O3426.2Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)C(=O)[C@H]1O3388.0Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #30CC(C)(C)[Si](C)(C)O[C@@H]1C(=O)[C@@H](O)[C@H](O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)O[C@@H]1CO3445.0Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #31CC(C)(C)[Si](C)(C)O[C@@H]1C(=O)[C@@H](O)[C@@H](CO)O[C@H]1O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]1CO3451.8Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #32CC(C)(C)[Si](C)(C)OC1=C(O)[C@H](O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)O[C@H](CO)[C@@H]1O3411.5Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #33CC(C)(C)[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)[C@@H]1O3409.9Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #34CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O3404.8Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #35CC(C)(C)[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3423.8Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #36CC(C)(C)[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)C(=O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3437.2Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #37CC(C)(C)[Si](C)(C)OC1=C(O)[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H]1O3404.9Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #38CC(C)(C)[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O3412.4Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #39CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]1O3398.1Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #4CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]1O3406.1Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #40CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C(C)(C)C3408.5Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #41CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(O[Si](C)(C)C(C)(C)C)=C1O3396.3Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #42CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)C(O)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O3395.1Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #43CC(C)(C)[Si](C)(C)O[C@@H]1C(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3417.3Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #44CC(C)(C)[Si](C)(C)OC1=C(O)[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@H](CO)[C@@H]1O[Si](C)(C)C(C)(C)C3394.7Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #45CC(C)(C)[Si](C)(C)OC1=C(O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@@H]1CO3452.9Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #46CC(C)(C)[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3415.0Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #47CC(C)(C)[Si](C)(C)OC1=C(O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3447.1Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #48CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O3390.8Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #49CC(C)(C)[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3431.9Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #5CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]2O)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C(C)(C)C3411.6Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #50CC(C)(C)[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)C(=O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3437.0Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #51CC(C)(C)[Si](C)(C)OC1=C(O)[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@@H]1O3403.2Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #52CC(C)(C)[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)O[C@@H]2CO)[C@@H]1O3410.7Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #53CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]1O3426.7Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #54CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C(C)(C)C3431.7Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #55CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(O[Si](C)(C)C(C)(C)C)=C1O3402.6Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #56CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)C(O)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O3406.7Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #57CC(C)(C)[Si](C)(C)O[C@@H]1C(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@H]1O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]1CO3433.1Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #58CC(C)(C)[Si](C)(C)OC1=C(O)[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)O[C@H](CO)[C@@H]1O[Si](C)(C)C(C)(C)C3397.1Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #59CC(C)(C)[Si](C)(C)OC1=C(O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)O[C@@H]1CO3467.1Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #6CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]2O)[C@H](O)C(O[Si](C)(C)C(C)(C)C)=C1O3402.6Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #60CC(C)(C)[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)[C@@H]1O[Si](C)(C)C(C)(C)C3420.4Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #61CC(C)(C)[Si](C)(C)OC1=C(O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](CO)O[C@H]1O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]1CO3455.9Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #62CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]1O3401.7Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #63CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C(C)(C)C3409.7Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #64CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(O[Si](C)(C)C(C)(C)C)=C1O3401.7Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #65CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)C(O)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O3407.6Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #66CC(C)(C)[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3425.8Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #67CC(C)(C)[Si](C)(C)OC1=C(O)[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)O[C@H](CO)[C@@H]1O[Si](C)(C)C(C)(C)C3407.6Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #68CC(C)(C)[Si](C)(C)OC1=C(O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1CO3462.1Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #69CC(C)(C)[Si](C)(C)OC1=C(O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3453.0Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #7CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]2O)C(O)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O3403.1Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #70CC(C)(C)[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C3431.5Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #71CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]1O[Si](C)(C)C(C)(C)C3402.2Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #72CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C1O3405.3Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #73CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)C(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O3448.6Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #74CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C3441.9Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #75CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)C(O)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3410.4Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #76CC(C)(C)[Si](C)(C)OC1=C(O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)O[C@@H]1CO3462.5Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #77CC(C)(C)[Si](C)(C)OC1=C(O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)OC(O)[C@H](O)[C@H]1O3439.6Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #8CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)O[C@@H]2CO)[C@H](O)C(=O)[C@H]1O3396.4Semi standard non polar33892256
3'-Ketolactose,3TBDMS,isomer #9CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)C(=O)[C@H]1O3400.3Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)O[C@@H]2CO[Si](C)(C)C(C)(C)C)[C@H](O)C(=O)[C@H]1O3539.8Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #10CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C(C)(C)C)[C@H](O)C(O[Si](C)(C)C(C)(C)C)=C1O3529.2Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #100CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C3553.8Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #101CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)C(O)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3524.4Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #102CC(C)(C)[Si](C)(C)OC1=C(O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@H]1O[C@@H]1[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3567.7Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #103CC(C)(C)[Si](C)(C)OC1=C(O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1CO3590.6Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #104CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C3565.2Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #105CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)C(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3576.5Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #11CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO[Si](C)(C)C(C)(C)C)C(O)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O3530.6Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #12CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]1O3553.7Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #13CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C(C)(C)C3555.3Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #14CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)C(O[Si](C)(C)C(C)(C)C)=C1O3515.7Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #15CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C(O)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O3519.4Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #16CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]1O[Si](C)(C)C(C)(C)C3570.3Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #17CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C1O3526.9Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #18CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]2O)C(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O3555.5Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #19CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]2O)[C@H](O)C(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C3563.0Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)C(=O)[C@H]1O3551.6Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #20CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]2O)C(O)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3540.4Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #21CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)O[C@@H]2CO)[C@H](O)C(=O)[C@H]1O3571.1Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #22CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)O[C@@H]2CO)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]1O3578.7Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #23CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)O[C@@H]2CO)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C(C)(C)C3579.6Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #24CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)O[C@@H]2CO)[C@H](O)C(O[Si](C)(C)C(C)(C)C)=C1O3526.8Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #25CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)O[C@@H]2CO)C(O)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O3526.6Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #26CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]1O3577.8Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #27CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C(C)(C)C3576.8Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #28CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)C(O[Si](C)(C)C(C)(C)C)=C1O3530.0Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #29CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C(O)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O3530.3Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]1O3547.1Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #30CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]1O[Si](C)(C)C(C)(C)C3574.1Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #31CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C1O3531.2Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #32CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)C(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O3553.4Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #33CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)C(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C3564.2Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #34CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)C(O)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3539.4Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #35CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]1O3590.5Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #36CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C(C)(C)C3592.0Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #37CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)[C@H](O)C(O[Si](C)(C)C(C)(C)C)=C1O3544.3Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #38CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)C(O)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O3548.0Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #39CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]1O[Si](C)(C)C(C)(C)C3581.3Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #4CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C(C)(C)C3548.8Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #40CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)[C@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C1O3537.0Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #41CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)C(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O3560.5Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #42CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)[C@H](O)C(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C3569.2Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #43CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@H]2[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)C(O)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3545.5Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #44CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]1O[Si](C)(C)C(C)(C)C3569.4Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #45CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C1O3532.3Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #46CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O3559.5Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #47CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)C(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C3565.7Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #48CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)C(O)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3543.4Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #49CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C3566.3Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #5CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)C(O[Si](C)(C)C(C)(C)C)=C1O3511.6Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #50CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO)OC(O)[C@H](O)[C@H]2O)C(O[Si](C)(C)C(C)(C)C)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3568.0Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #51CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O3574.2Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #52CC(C)(C)[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3596.2Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #53CC(C)(C)[Si](C)(C)OC1O[C@H](CO)[C@@H](O[C@@H]2O[C@H](CO)[C@H](O)C(=O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O[Si](C)(C)C(C)(C)C3603.4Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #54CC(C)(C)[Si](C)(C)OC1=C(O)[C@H](O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)O[C@@H]2CO)O[C@H](CO)[C@@H]1O3563.3Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #55CC(C)(C)[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)O[C@@H]2CO)[C@@H]1O3556.1Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #56CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]1O3584.8Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #57CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C(C)(C)C3589.6Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #58CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(O[Si](C)(C)C(C)(C)C)=C1O3553.7Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #59CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)C(O)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O3545.2Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #6CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](O[C@@H]2[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)C(O)=C(O[Si](C)(C)C(C)(C)C)[C@H]1O3512.8Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #60CC(C)(C)[Si](C)(C)O[C@@H]1C(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@H]1O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]1CO3588.7Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #61CC(C)(C)[Si](C)(C)OC1=C(O)[C@H](O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)O[C@H](CO)[C@@H]1O[Si](C)(C)C(C)(C)C3560.0Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #62CC(C)(C)[Si](C)(C)OC1=C(O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)O[C@@H]1CO3596.7Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #63CC(C)(C)[Si](C)(C)OC1=C(O)[C@@H](CO)O[C@@H](O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]2CO)[C@@H]1O[Si](C)(C)C(C)(C)C3569.7Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #64CC(C)(C)[Si](C)(C)OC1=C(O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](CO)O[C@H]1O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]1CO3596.9Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #65CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)[C@H]1O3566.9Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #66CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(=O)[C@H]1O[Si](C)(C)C(C)(C)C3574.5Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #67CC(C)(C)[Si](C)(C)OC[C@H]1OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)C(O[Si](C)(C)C(C)(C)C)=C1O3533.7Semi standard non polar33892256
3'-Ketolactose,4TBDMS,isomer #68