Hmdb loader
You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Human Metabolome Database.
Record Information
Version5.0
StatusExpected but not Quantified
Creation Date2005-11-16 15:48:42 UTC
Update Date2022-03-07 02:49:08 UTC
HMDB IDHMDB0001124
Secondary Accession Numbers
  • HMDB01124
Metabolite Identification
Common NameTrehalose 6-phosphate
DescriptionTrehalose 6-phosphate belongs to the class of organic compounds known as disaccharide phosphates. These are disaccharides carrying one or more phosphate group on a sugar unit. Trehalose 6-phosphate exists in all living species, ranging from bacteria to plants to humans. Trehalose 6-phosphate has been detected, but not quantified in, several different foods, such as broccolis (Brassica oleracea var. italica), sour oranges (Citrus × aurantium), chicory roots (Cichorium intybus var. sativum), red tea, and catjang peas (Vigna unguiculata ssp. cylindrica). This could make trehalose 6-phosphate a potential biomarker for the consumption of these foods. Trehalose 6-phosphate is a secondary metabolite. Secondary metabolites are metabolically or physiologically non-essential metabolites that may serve a role as defense or signalling molecules. In some cases they are simply molecules that arise from the incomplete metabolism of other secondary metabolites. Based on a literature review a significant number of articles have been published on Trehalose 6-phosphate.
Structure
Data?1584117468
Synonyms
ValueSource
alpha,Alpha'-trehalose 6-phosphateChEBI
alpha-D-Glucopyranosyl alpha-D-glucopyranoside 6-(dihydrogen phosphate)ChEBI
a,Alpha'-trehalose 6-phosphateGenerator
a,Alpha'-trehalose 6-phosphoric acidGenerator
alpha,Alpha'-trehalose 6-phosphoric acidGenerator
Α,alpha'-trehalose 6-phosphateGenerator
Α,alpha'-trehalose 6-phosphoric acidGenerator
a-D-Glucopyranosyl a-D-glucopyranoside 6-(dihydrogen phosphate)Generator
a-D-Glucopyranosyl a-D-glucopyranoside 6-(dihydrogen phosphoric acid)Generator
alpha-D-Glucopyranosyl alpha-D-glucopyranoside 6-(dihydrogen phosphoric acid)Generator
Α-D-glucopyranosyl α-D-glucopyranoside 6-(dihydrogen phosphate)Generator
Α-D-glucopyranosyl α-D-glucopyranoside 6-(dihydrogen phosphoric acid)Generator
Trehalose 6-phosphoric acidGenerator
Trehalose-6-phosphateHMDB, MeSH
Chemical FormulaC12H23O14P
Average Molecular Weight422.2764
Monoisotopic Molecular Weight422.082541956
IUPAC Name{[(2R,3S,4S,5R,6R)-3,4,5-trihydroxy-6-{[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}oxan-2-yl]methoxy}phosphonic acid
Traditional Nameα,α'-trehalose 6-phosphate
CAS Registry Number4484-88-2
SMILES
OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(O)(O)=O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O
InChI Identifier
InChI=1S/C12H23O14P/c13-1-3-5(14)7(16)9(18)11(24-3)26-12-10(19)8(17)6(15)4(25-12)2-23-27(20,21)22/h3-19H,1-2H2,(H2,20,21,22)/t3-,4-,5-,6-,7+,8+,9-,10-,11-,12-/m1/s1
InChI KeyLABSPYBHMPDTEL-LIZSDCNHSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as disaccharide phosphates. These are disaccharides carrying one or more phosphate group on a sugar unit.
KingdomOrganic compounds
Super ClassOrganic oxygen compounds
ClassOrganooxygen compounds
Sub ClassCarbohydrates and carbohydrate conjugates
Direct ParentDisaccharide phosphates
Alternative Parents
Substituents
  • Disaccharide phosphate
  • Glycosyl compound
  • O-glycosyl compound
  • Monoalkyl phosphate
  • Alkyl phosphate
  • Phosphoric acid ester
  • Oxane
  • Organic phosphoric acid derivative
  • Secondary alcohol
  • Acetal
  • Polyol
  • Oxacycle
  • Organoheterocyclic compound
  • Primary alcohol
  • Hydrocarbon derivative
  • Organic oxide
  • Alcohol
  • Aliphatic heteromonocyclic compound
Molecular FrameworkAliphatic heteromonocyclic compounds
External Descriptors
Ontology
Physiological effectNot Available
Disposition
Biological locationRoute of exposureSource
Process
Role
Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water SolubilityNot AvailableNot Available
LogPNot AvailableNot Available
Experimental Chromatographic Properties

Experimental Collision Cross Sections

Adduct TypeData SourceCCS Value (Å2)Reference
[M-H]-Baker181.53730932474
[M-H]-Not Available181.537http://allccs.zhulab.cn/database/detail?ID=AllCCS00001814
Predicted Molecular Properties
PropertyValueSource
Water Solubility40.6 g/LALOGPS
logP-2.4ALOGPS
logP-4.8ChemAxon
logS-1ALOGPS
pKa (Strongest Acidic)1.22ChemAxon
pKa (Strongest Basic)-3.6ChemAxon
Physiological Charge-2ChemAxon
Hydrogen Acceptor Count13ChemAxon
Hydrogen Donor Count9ChemAxon
Polar Surface Area236.06 ŲChemAxon
Rotatable Bond Count6ChemAxon
Refractivity79.21 m³·mol⁻¹ChemAxon
Polarizability35.55 ųChemAxon
Number of Rings2ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleNoChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DarkChem[M+H]+190.92231661259
DarkChem[M-H]-187.16831661259
AllCCS[M+H]+189.54232859911
AllCCS[M-H]-185.22632859911
DeepCCS[M+H]+175.8430932474
DeepCCS[M-H]-173.80730932474
DeepCCS[M-2H]-207.30330932474
DeepCCS[M+Na]+181.58130932474
AllCCS[M+H]+189.532859911
AllCCS[M+H-H2O]+187.332859911
AllCCS[M+NH4]+191.632859911
AllCCS[M+Na]+192.232859911
AllCCS[M-H]-185.232859911
AllCCS[M+Na-2H]-185.132859911
AllCCS[M+HCOO]-185.132859911

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
Trehalose 6-phosphateOC[C@H]1O[C@H](O[C@H]2O[C@H](COP(O)(O)=O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3304.0Standard polar33892256
Trehalose 6-phosphateOC[C@H]1O[C@H](O[C@H]2O[C@H](COP(O)(O)=O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3185.5Standard non polar33892256
Trehalose 6-phosphateOC[C@H]1O[C@H](O[C@H]2O[C@H](COP(O)(O)=O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3573.2Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
Trehalose 6-phosphate,1TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3135.8Semi standard non polar33892256
Trehalose 6-phosphate,1TMS,isomer #2C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3134.5Semi standard non polar33892256
Trehalose 6-phosphate,1TMS,isomer #3C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3123.1Semi standard non polar33892256
Trehalose 6-phosphate,1TMS,isomer #4C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3130.5Semi standard non polar33892256
Trehalose 6-phosphate,1TMS,isomer #5C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]1O3121.4Semi standard non polar33892256
Trehalose 6-phosphate,1TMS,isomer #6C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3109.5Semi standard non polar33892256
Trehalose 6-phosphate,1TMS,isomer #7C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3123.5Semi standard non polar33892256
Trehalose 6-phosphate,1TMS,isomer #8C[Si](C)(C)OP(=O)(O)OC[C@H]1O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3259.6Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3106.3Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #10C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3091.0Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #11C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H]1COP(=O)(O)O3092.2Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #12C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3100.8Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #13C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3217.4Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #14C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3079.3Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #15C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3066.2Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #16C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3072.8Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #17C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3088.8Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #18C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3199.5Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #19C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3083.2Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3091.2Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #20C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3071.0Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #21C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3082.0Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #22C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3210.4Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #23C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3079.4Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #24C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H]1CO3074.8Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #25C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@H]1O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O3200.3Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #26C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3080.2Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #27C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3192.4Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #28C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3202.4Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #29C[Si](C)(C)OP(=O)(OC[C@H]1O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O)O[Si](C)(C)C3285.5Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3097.8Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3097.2Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3091.0Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3109.4Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3202.1Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #8C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3093.9Semi standard non polar33892256
Trehalose 6-phosphate,2TMS,isomer #9C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3082.1Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O2990.9Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C2975.8Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3048.8Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O2970.7Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #13C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O2970.4Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #14C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C2984.4Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #15C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3063.3Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2977.3Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #17C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2986.3Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #18C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3060.0Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #19C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2987.9Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O2991.8Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #20C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3046.5Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #21C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3066.2Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #22C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3107.7Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #23C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3000.9Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #24C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1COP(=O)(O)O3000.3Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #25C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1CO2989.8Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #26C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O2991.7Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #27C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3078.9Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #28C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O2995.0Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #29C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1COP(=O)(O)O2994.4Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O2983.2Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #30C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O2993.5Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #31C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3071.4Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #32C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1COP(=O)(O)O2999.8Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #33C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@H]1O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2999.8Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #34C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3075.4Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #35C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3019.2Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #36C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H]1COP(=O)(O)O[Si](C)(C)C3087.0Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #37C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3086.5Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #38C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3140.6Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #39C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O2978.1Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O2975.8Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #40C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO2978.4Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #41C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O2992.3Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #42C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3058.0Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #43C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O2990.0Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #44C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O2981.3Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #45C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3053.2Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #46C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2990.4Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #47C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3054.4Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #48C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3079.1Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #49C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3119.0Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C2993.9Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #50C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO2981.7Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #51C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O2984.1Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #52C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3068.4Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #53C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2984.4Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #54C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3059.1Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #55C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@H]1O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3062.2Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #56C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3131.1Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #57C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C2989.5Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #58C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3070.6Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #59C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H]1CO3059.8Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3071.5Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #60C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@H]1O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O3123.1Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #61C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3058.9Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #62C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3108.7Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #63C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3122.0Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O2980.8Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #8C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O2969.4Semi standard non polar33892256
Trehalose 6-phosphate,3TMS,isomer #9C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O2969.1Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O2986.1Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2984.3Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2984.5Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3001.1Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #13C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2993.3Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #14C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3020.5Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #15C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3008.5Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3026.9Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #17C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O2976.3Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #18C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O2994.9Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #19C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C2984.3Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O2985.3Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #20C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3014.3Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #21C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2991.4Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #22C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2991.7Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3012.1Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #24C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3001.0Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #25C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3028.4Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #26C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3019.0Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #27C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3032.4Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #28C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O2975.9Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #29C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C2978.1Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3002.7Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #30C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O2989.4Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #31C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2986.3Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #32C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3010.2Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #33C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C2997.6Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #34C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3014.5Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #35C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2980.5Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #36C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3007.5Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #37C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3019.5Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #38C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3012.6Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #39C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3018.4Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C2991.6Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #40C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3027.9Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #41C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3019.9Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #42C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3019.8Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #43C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3019.5Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #44C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3032.2Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #45C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3063.1Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #46C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1COP(=O)(O)O3020.8Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #47C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3012.4Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #48C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1COP(=O)(O)O[Si](C)(C)C3067.3Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #49C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O2998.0Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3024.3Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #50C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1CO3051.3Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #51C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3054.9Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #52C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3067.1Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #53C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3028.1Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #54C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3026.4Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #55C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3075.3Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #56C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1COP(=O)(O)O3017.4Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #57C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1COP(=O)(O)O[Si](C)(C)C3073.4Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #58C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3055.9Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #59C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3073.3Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O2980.6Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #60C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3002.9Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #61C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1COP(=O)(O)O[Si](C)(C)C3056.8Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #62C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@H]1O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3052.9Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #63C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3060.8Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #64C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3067.3Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #65C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H]1COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3086.1Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #66C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3087.5Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #67C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3005.9Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #68C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3028.5Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #69C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3058.7Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O2999.0Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #70C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3017.3Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #71C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3051.4Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #72C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3055.8Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #73C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3074.4Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #74C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3026.8Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #75C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3067.3Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #76C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3056.5Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #77C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3079.7Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #78C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3046.8Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #79C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3067.1Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #8C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C2988.7Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #80C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3082.5Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #81C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2985.0Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #82C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3038.7Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #83C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3039.8Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #84C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3053.5Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #85C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3039.7Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #86C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O3060.5Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #87C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@H]1O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C3046.7Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #88C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3042.5Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #89C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3059.7Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #9C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3026.6Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #90C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H]1CO3059.4Semi standard non polar33892256
Trehalose 6-phosphate,4TMS,isomer #91C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3059.2Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O2989.8Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3048.2Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3052.6Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3019.2Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #13C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3015.2Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #14C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3032.8Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #15C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3026.9Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3059.0Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #17C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3042.2Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #18C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3043.1Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #19C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2996.4Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3017.0Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #20C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3037.9Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #21C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3040.3Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #22C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3038.1Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3046.4Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #24C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3065.2Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #25C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3051.6Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #26C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3025.2Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #27C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3012.5Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #28C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3027.0Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #29C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3033.8Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C2998.4Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #30C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3057.4Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #31C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3038.9Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #32C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3043.5Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #33C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3010.0Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #34C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3053.4Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #35C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3052.6Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #36C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3051.8Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #37C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3064.2Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #38C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3080.5Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #39C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3061.8Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3027.1Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #40C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C2988.6Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #41C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3025.0Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #42C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3028.2Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #43C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3023.6Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #44C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3032.8Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #45C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3053.8Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #46C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3038.2Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #47C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3022.0Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #48C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3040.9Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #49C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3040.5Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3032.2Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #50C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3050.3Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #51C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3023.0Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #52C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3046.0Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #53C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3080.5Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #54C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3039.4Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #55C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3085.0Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #56C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3102.3Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #57C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3099.0Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #58C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1COP(=O)(O)O3021.3Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #59C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1COP(=O)(O)O[Si](C)(C)C3088.3Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3020.1Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #60C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3082.0Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #61C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3085.1Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #62C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3066.2Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #63C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1CO3077.0Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #64C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3090.9Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #65C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3031.1Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #66C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3091.9Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #67C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3092.7Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #68C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3113.6Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #69C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1COP(=O)(O)O[Si](C)(C)C3082.5Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3036.2Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #70C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3103.7Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #71C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3076.1Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #72C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3055.9Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #73C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3071.5Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #74C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@H]1O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3079.4Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #75C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3079.3Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #76C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3032.9Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #77C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3074.8Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #78C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3097.3Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #79C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O3105.7Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #8C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3043.4Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #80C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3081.7Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #81C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3093.2Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #82C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3092.4Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #83C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3093.5Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #84C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3104.2Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #85C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3087.6Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #86C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3070.9Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #87C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3049.8Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #88C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3063.4Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #89C[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]1O3076.1Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #9C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3068.2Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #90C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3063.6Semi standard non polar33892256
Trehalose 6-phosphate,5TMS,isomer #91C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C3060.4Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #1C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3032.5Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #10C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3094.2Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #11C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3082.3Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #12C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3107.0Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #13C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3112.8Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #14C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3099.5Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #15C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3022.0Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #16C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3080.3Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #17C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3084.1Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #18C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3057.9Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #19C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3093.7Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #2C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3019.7Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #20C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3098.2Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #21C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3075.7Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #22C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3072.7Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #23C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3085.7Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #24C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3076.8Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #25C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3099.1Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #26C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3029.5Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #27C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3076.6Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #28C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3077.8Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #29C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3063.2Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #3C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O3053.6Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #30C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3092.5Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #31C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3100.5Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #32C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3083.9Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #33C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3075.5Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #34C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3097.5Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #35C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3094.2Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #36C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3107.7Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #37C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3055.1Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #38C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3066.8Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #39C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C3060.0Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #4C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3043.6Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #40C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3084.2Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #41C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3063.8Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #42C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3046.9Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #43C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3090.4Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #44C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3108.2Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #45C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3100.5Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #46C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3112.1Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #47C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1CO3114.6Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #48C[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C3127.5Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #49C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1COP(=O)(O)O[Si](C)(C)C3092.1Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #5C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H]1O3081.1Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #50C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)O[C@@H]1COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3114.9Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #51C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3097.2Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #52C[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@H]1O3101.9Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #53C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3093.9Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #54C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3106.5Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #55C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3114.1Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #56C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C3100.8Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #57C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3076.1Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #58C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3092.6Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #59C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O3103.7Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #6C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C3073.1Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #60C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@@H]1O[Si](C)(C)C3116.5Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #61C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)O[C@@H]1CO3098.9Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #62C[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3098.0Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #63C[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3082.6Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #7C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O[Si](C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3061.6Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #8C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3042.0Semi standard non polar33892256
Trehalose 6-phosphate,6TMS,isomer #9C[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H]1O3094.9Semi standard non polar33892256
Trehalose 6-phosphate,1TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3357.9Semi standard non polar33892256
Trehalose 6-phosphate,1TBDMS,isomer #2CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3366.9Semi standard non polar33892256
Trehalose 6-phosphate,1TBDMS,isomer #3CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3357.7Semi standard non polar33892256
Trehalose 6-phosphate,1TBDMS,isomer #4CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3363.5Semi standard non polar33892256
Trehalose 6-phosphate,1TBDMS,isomer #5CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]1O3349.2Semi standard non polar33892256
Trehalose 6-phosphate,1TBDMS,isomer #6CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3344.1Semi standard non polar33892256
Trehalose 6-phosphate,1TBDMS,isomer #7CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3357.3Semi standard non polar33892256
Trehalose 6-phosphate,1TBDMS,isomer #8CC(C)(C)[Si](C)(C)OP(=O)(O)OC[C@H]1O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3486.6Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3511.8Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #10CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3496.2Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #11CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H]1COP(=O)(O)O3496.4Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #12CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3505.8Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #13CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3618.4Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #14CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3490.0Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #15CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H]1O3476.6Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #16CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O3479.1Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #17CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C3500.9Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #18CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3600.7Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #19CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3494.8Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3494.9Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #20CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O3480.2Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #21CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@H]1O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3483.9Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #22CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3608.5Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #23CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C3489.4Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #24CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H]1CO3480.5Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #25CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@H]1O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O3591.4Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #26CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3485.3Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #27CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3590.7Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #28CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3603.9Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #29CC(C)(C)[Si](C)(C)OP(=O)(OC[C@H]1O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O)O[Si](C)(C)C(C)(C)C3659.8Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3505.2Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #4CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3506.3Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #5CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3496.3Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #6CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3510.0Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #7CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3604.5Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #8CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3505.0Semi standard non polar33892256
Trehalose 6-phosphate,2TBDMS,isomer #9CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3492.9Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3628.7Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #10CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3622.5Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #11CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3685.5Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #12CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3619.1Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #13CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3620.0Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #14CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3624.0Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #15CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3681.0Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #16CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3626.6Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #17CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3613.0Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #18CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3680.7Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #19CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3628.5Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3618.4Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #20CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3684.5Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #21CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3686.5Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #22CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3695.5Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #23CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3640.1Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #24CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1COP(=O)(O)O3630.7Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #25CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)O[C@@H]1CO3621.1Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #26CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@H]1O3625.5Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #27CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3697.0Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #28CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H]1O3631.0Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #29CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@@H]1COP(=O)(O)O3619.3Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #3CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3625.8Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #30CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3627.3Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #31CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3692.2Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #32CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@@H]1COP(=O)(O)O3619.9Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #33CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@H]1O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3630.6Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #34CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3690.8Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #35CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C3638.8Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #36CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H]1COP(=O)(O)O[Si](C)(C)C(C)(C)C3695.2Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #37CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3703.4Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #38CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3713.7Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #39CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H]1O3619.5Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #4CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3624.1Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #40CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)O[C@@H]1CO3613.8Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #41CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3636.3Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #42CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@@H]1O3697.7Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #43CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O3627.3Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #44CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O3621.6Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #45CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@@H]1O3691.8Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #46CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3626.9Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #47CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O3689.8Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #48CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C3700.0Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #49CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3712.8Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #5CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3628.9Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #50CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)O[C@@H]1CO3612.0Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #51CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](COP(=O)(O)O)O[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1O3618.5Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #52CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]1O3689.9Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #53CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3619.2Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #54CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2O[Si](C)(C)C(C)(C)C)[C@@H]1O3685.8Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #55CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@H]1O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3678.6Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #56CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)O[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O3705.9Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #57CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C3619.8Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #58CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O[Si](C)(C)C(C)(C)C3677.3Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #59CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)O[C@@H]1CO3672.0Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #6CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3689.4Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #60CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@@H]1O[C@H]1O[C@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O3696.1Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #61CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O[Si](C)(C)C(C)(C)C3673.3Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #62CC(C)(C)[Si](C)(C)O[C@H]1[C@H](O)[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@@H]1O3694.5Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #63CC(C)(C)[Si](C)(C)O[C@@H]1[C@@H](CO)O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@H]1O3698.3Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #7CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3628.0Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #8CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3620.1Semi standard non polar33892256
Trehalose 6-phosphate,3TBDMS,isomer #9CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3615.6Semi standard non polar33892256
Trehalose 6-phosphate,4TBDMS,isomer #1CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3802.7Semi standard non polar33892256
Trehalose 6-phosphate,4TBDMS,isomer #10CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3810.4Semi standard non polar33892256
Trehalose 6-phosphate,4TBDMS,isomer #11CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3801.8Semi standard non polar33892256
Trehalose 6-phosphate,4TBDMS,isomer #12CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3842.5Semi standard non polar33892256
Trehalose 6-phosphate,4TBDMS,isomer #13CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C3819.9Semi standard non polar33892256
Trehalose 6-phosphate,4TBDMS,isomer #14CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3854.0Semi standard non polar33892256
Trehalose 6-phosphate,4TBDMS,isomer #15CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3847.5Semi standard non polar33892256
Trehalose 6-phosphate,4TBDMS,isomer #16CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O3845.8Semi standard non polar33892256
Trehalose 6-phosphate,4TBDMS,isomer #17CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3806.1Semi standard non polar33892256
Trehalose 6-phosphate,4TBDMS,isomer #18CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3816.2Semi standard non polar33892256
Trehalose 6-phosphate,4TBDMS,isomer #19CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3809.6Semi standard non polar33892256
Trehalose 6-phosphate,4TBDMS,isomer #2CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O3809.3Semi standard non polar33892256
Trehalose 6-phosphate,4TBDMS,isomer #20CC(C)(C)[Si](C)(C)OC[C@H]1O[C@H](O[C@H]2O[C@H](COP(=O)(O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]2O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](O)[C@@H]1O3845.5Semi standard non polar