Hmdb loader
You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Human Metabolome Database.
Record Information
Version5.0
StatusExpected but not Quantified
Creation Date2005-11-16 15:48:42 UTC
Update Date2021-09-14 15:18:56 UTC
HMDB IDHMDB0001346
Secondary Accession Numbers
  • HMDB01346
Metabolite Identification
Common NameGDP-4-Dehydro-6-deoxy-D-mannose
DescriptionGDP-4-Dehydro-6-deoxy-D-mannose, also known as GDP-4-dehydro-D-rhamnose or GDP-4-keto-6-deoxymannose, belongs to the class of organic compounds known as purine nucleotide sugars. These are purine nucleotides bound to a saccharide derivative through the terminal phosphate group. GDP-4-Dehydro-6-deoxy-D-mannose is a strong basic compound (based on its pKa). GDP-4-Dehydro-6-deoxy-D-mannose exists in all living organisms, ranging from bacteria to humans. Within humans, GDP-4-dehydro-6-deoxy-D-mannose participates in a number of enzymatic reactions. In particular, GDP-4-dehydro-6-deoxy-D-mannose can be biosynthesized from guanosine diphosphate mannose through its interaction with the enzyme GDP-mannose 4,6 dehydratase. In addition, GDP-4-dehydro-6-deoxy-D-mannose can be biosynthesized from GDP-L-fucose through the action of the enzyme GDP-L-fucose synthase. In humans, GDP-4-dehydro-6-deoxy-D-mannose is involved in the metabolic disorder called fructosuria. Outside of the human body, GDP-4-Dehydro-6-deoxy-D-mannose has been detected, but not quantified in, several different foods, such as common walnuts, celeriacs, blackcurrants, triticales, and evergreen huckleberries. This could make GDP-4-dehydro-6-deoxy-D-mannose a potential biomarker for the consumption of these foods. A GDP-sugar having 4-dehydro-6-deoxy-alpha-D-mannose as the sugar portion.
Structure
Data?1589308897
Synonyms
ValueSource
GDP-4-Dehydro-6-deoxy-D-taloseChEBI
GDP-4-Dehydro-D-rhamnoseChEBI
GDP-4-Keto-6-deoxy-D-mannoseChEBI
GDP-4-Keto-6-deoxymannoseChEBI
GDP-4-oxo-6-Deoxy-D-mannoseChEBI
Guanosine 5'-(trihydrogen diphosphate), p'-(6-deoxy-alpha-D-lyxo-hexopyranos-4-ulos-1-yl) esterChEBI
Guanosine diphosphate-4-keto-6-deoxy-D-mannoseChEBI
GDP-4-Dehydro-alpha-D-rhamnoseKegg
GDP-4-Dehydro-6-deoxy-alpha-D-mannoseKegg
Guanosine 5'-(trihydrogen diphosphate), p'-(6-deoxy-a-D-lyxo-hexopyranos-4-ulos-1-yl) esterGenerator
Guanosine 5'-(trihydrogen diphosphate), p'-(6-deoxy-α-D-lyxo-hexopyranos-4-ulos-1-yl) esterGenerator
Guanosine 5'-(trihydrogen diphosphoric acid), p'-(6-deoxy-a-D-lyxo-hexopyranos-4-ulos-1-yl) esterGenerator
Guanosine 5'-(trihydrogen diphosphoric acid), p'-(6-deoxy-alpha-D-lyxo-hexopyranos-4-ulos-1-yl) esterGenerator
Guanosine 5'-(trihydrogen diphosphoric acid), p'-(6-deoxy-α-D-lyxo-hexopyranos-4-ulos-1-yl) esterGenerator
Guanosine diphosphoric acid-4-keto-6-deoxy-D-mannoseGenerator
GDP-4-Dehydro-a-D-rhamnoseGenerator
GDP-4-Dehydro-α-D-rhamnoseGenerator
GDP-4-Dehydro-6-deoxy-a-D-mannoseGenerator
GDP-4-Dehydro-6-deoxy-α-D-mannoseGenerator
GDP-4-Keto-6-D-deoxymannoseHMDB
GDP-4-oxo-6-DeoxymannoseHMDB
Guanosine 5'-diphosphate 4-keto-6-deoxy-D-mannoseHMDB
Guanosine 5’-diphosphate 4-keto-6-deoxy-D-mannoseHMDB
Chemical FormulaC16H23N5O15P2
Average Molecular Weight587.3258
Monoisotopic Molecular Weight587.066588115
IUPAC Name[({[(2R,3S,4R,5R)-5-(2-amino-6-oxo-6,9-dihydro-1H-purin-9-yl)-3,4-dihydroxyoxolan-2-yl]methoxy}(hydroxy)phosphoryl)oxy]({[(2R,3S,4R,6R)-3,4-dihydroxy-6-methyl-5-oxooxan-2-yl]oxy})phosphinic acid
Traditional Namegdp-4-keto-6-deoxymannose
CAS Registry Number18186-48-6
SMILES
C[C@H]1O[C@H](OP(O)(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=NC3=C2N=C(N)NC3=O)[C@@H](O)[C@@H](O)C1=O
InChI Identifier
InChI=1S/C16H23N5O15P2/c1-4-7(22)9(24)11(26)15(33-4)35-38(30,31)36-37(28,29)32-2-5-8(23)10(25)14(34-5)21-3-18-6-12(21)19-16(17)20-13(6)27/h3-5,8-11,14-15,23-26H,2H2,1H3,(H,28,29)(H,30,31)(H3,17,19,20,27)/t4-,5-,8-,9+,10-,11+,14-,15-/m1/s1
InChI KeyPNHLMHWWFOPQLK-BKUUWRAGSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as purine nucleotide sugars. These are purine nucleotides bound to a saccharide derivative through the terminal phosphate group.
KingdomOrganic compounds
Super ClassNucleosides, nucleotides, and analogues
ClassPurine nucleotides
Sub ClassPurine nucleotide sugars
Direct ParentPurine nucleotide sugars
Alternative Parents
Substituents
  • Purine nucleotide sugar
  • Purine ribonucleoside diphosphate
  • Purine ribonucleoside monophosphate
  • Pentose phosphate
  • Pentose-5-phosphate
  • Glycosyl compound
  • N-glycosyl compound
  • 6-oxopurine
  • Hypoxanthine
  • Monosaccharide phosphate
  • Organic pyrophosphate
  • Imidazopyrimidine
  • Purine
  • Aminopyrimidine
  • Monoalkyl phosphate
  • Pyrimidone
  • Pyrimidine
  • Alkyl phosphate
  • Phosphoric acid ester
  • Oxane
  • Monosaccharide
  • Organic phosphoric acid derivative
  • N-substituted imidazole
  • Tetrahydrofuran
  • Vinylogous amide
  • Azole
  • Imidazole
  • Heteroaromatic compound
  • Cyclic ketone
  • Secondary alcohol
  • Ketone
  • Organoheterocyclic compound
  • Azacycle
  • Oxacycle
  • Hydrocarbon derivative
  • Primary amine
  • Organic oxide
  • Organopnictogen compound
  • Organic oxygen compound
  • Carbonyl group
  • Alcohol
  • Organic nitrogen compound
  • Organooxygen compound
  • Organonitrogen compound
  • Amine
  • Aromatic heteropolycyclic compound
Molecular FrameworkAromatic heteropolycyclic compounds
External Descriptors
Ontology
Physiological effectNot Available
Disposition
Biological locationRoute of exposureSource
Process
RoleNot Available
Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water SolubilityNot AvailableNot Available
LogPNot AvailableNot Available
Experimental Chromatographic PropertiesNot Available
Predicted Molecular Properties
PropertyValueSource
Water Solubility7.05 g/LALOGPS
logP-1.3ALOGPS
logP-3.6ChemAxon
logS-2ALOGPS
pKa (Strongest Acidic)1.73ChemAxon
pKa (Strongest Basic)-3.7ChemAxon
Physiological Charge-2ChemAxon
Hydrogen Acceptor Count15ChemAxon
Hydrogen Donor Count8ChemAxon
Polar Surface Area304.04 ŲChemAxon
Rotatable Bond Count8ChemAxon
Refractivity116.2 m³·mol⁻¹ChemAxon
Polarizability48.01 ųChemAxon
Number of Rings4ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleYesChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
AllCCS[M+H]+218.43632859911
AllCCS[M-H]-211.52332859911
DeepCCS[M+H]+216.37730932474
DeepCCS[M-H]-214.37830932474
DeepCCS[M-2H]-248.13830932474
DeepCCS[M+Na]+222.39530932474
AllCCS[M+H]+218.432859911
AllCCS[M+H-H2O]+217.132859911
AllCCS[M+NH4]+219.632859911
AllCCS[M+Na]+220.032859911
AllCCS[M-H]-211.532859911
AllCCS[M+Na-2H]-212.432859911
AllCCS[M+HCOO]-213.532859911

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
GDP-4-Dehydro-6-deoxy-D-mannoseC[C@H]1O[C@H](OP(O)(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=NC3=C2N=C(N)NC3=O)[C@@H](O)[C@@H](O)C1=O4524.4Standard polar33892256
GDP-4-Dehydro-6-deoxy-D-mannoseC[C@H]1O[C@H](OP(O)(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=NC3=C2N=C(N)NC3=O)[C@@H](O)[C@@H](O)C1=O3259.5Standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannoseC[C@H]1O[C@H](OP(O)(=O)OP(O)(=O)OC[C@H]2O[C@H]([C@H](O)[C@@H]2O)N2C=NC3=C2N=C(N)NC3=O)[C@@H](O)[C@@H](O)C1=O5030.2Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
GDP-4-Dehydro-6-deoxy-D-mannose,1TMS,isomer #1C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4426.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,1TMS,isomer #10C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4452.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,1TMS,isomer #2C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4429.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,1TMS,isomer #3C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4405.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,1TMS,isomer #4C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4380.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,1TMS,isomer #5C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4510.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,1TMS,isomer #6C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4501.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,1TMS,isomer #7CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O14486.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,1TMS,isomer #8C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)C(O)=C1O[Si](C)(C)C4491.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,1TMS,isomer #9C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4443.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #1C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4250.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #10C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4206.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #11C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4184.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #12C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4314.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #13C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4305.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #14CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O14321.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #15C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4345.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #16C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4296.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #17C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4317.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #18C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C1=O4227.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #19C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4292.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #2C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4201.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #20C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4284.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #21CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O14312.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #22C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C4325.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #23C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4282.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #24C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4296.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #25C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4270.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #26C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4260.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #27CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O14303.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #28C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4322.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #29C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4269.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #3C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4178.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #30C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4281.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #31C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4384.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #32CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O14384.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #33C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)C(O)=C1O[Si](C)(C)C4411.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #34C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4380.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #35C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4399.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #36CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O14377.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #37C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4401.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #38C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4369.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #39C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4379.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #4C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4310.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #40CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O14372.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #41CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O14375.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #42C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)C(O)=C1O[Si](C)(C)C4394.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #43C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)C(O)=C1O[Si](C)(C)C4392.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #44C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4404.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #45C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4400.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #5C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4302.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #6CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O14319.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #7C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)C(O)=C1O[Si](C)(C)C4343.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #8C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4300.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TMS,isomer #9C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4314.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #1C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4109.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #10C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4144.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #100C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4210.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #101CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O14287.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #102C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4288.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #103C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4290.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #104C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4295.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #105CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O14307.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #106CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O14305.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #107C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)C(O)=C1O[Si](C)(C)C4321.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #108C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)C(O)=C1O[Si](C)(C)C4319.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #109C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4356.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #11C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4132.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #110C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4314.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #111CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O14295.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #112CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O14295.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #113C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4308.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #114C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4304.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #115C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4341.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #116C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4301.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #117CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O14360.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #118CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O14327.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #119C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)C(O)=C1O[Si](C)(C)C4378.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #12CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O14173.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #120C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)C(O)=C1O[Si](C)(C)C4334.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #121C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4378.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #13C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C4181.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #14C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4146.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #15C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4182.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #16C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4125.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #17C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4111.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #18CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O14172.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #19C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4191.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #2C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4082.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #20C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4137.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #21C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4174.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #22C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4202.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #23CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O14236.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #24C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)C(O)=C1O[Si](C)(C)C4241.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #25C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4234.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #26C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4251.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #27CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)O14228.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #28C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4234.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #29C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4221.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #3C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4179.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #30C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4239.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #31CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O14265.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #32CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O14270.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #33C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)C(O)=C1O[Si](C)(C)C4281.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #34C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)C(O)=C1O[Si](C)(C)C4273.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #35C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4288.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #36C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4234.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #37C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C1=O4105.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #38C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4149.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #39C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4135.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #4C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4163.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #40CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O14178.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #41C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C4187.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #42C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4146.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #43C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4193.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #44C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4131.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #45C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4116.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #46CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O14177.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #47C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4194.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #48C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4137.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #49C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4186.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #5CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O14200.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #50C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4209.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #51CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O14246.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #52C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4250.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #53C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4233.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #54C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4259.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #55CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)O14237.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #56C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4241.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #57C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4217.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #58C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4246.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #59CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O14260.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #6C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4213.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #60CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O14275.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #61C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4277.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #62C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4277.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #63C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4286.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #64C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4236.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #65C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C1=O4167.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #66C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C1=O4149.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #67CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O14201.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #68C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4210.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #69C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C1=O4169.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #7C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4189.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #70C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C1=O4208.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #71C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4192.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #72CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O14235.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #73C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C4236.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #74C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4219.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #75C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4241.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #76CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O14220.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #77C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C4225.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #78C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4200.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #79C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4226.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #8C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4223.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #80CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O14241.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #81CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O14247.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #82C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C4264.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #83C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C4263.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #84C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4265.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #85C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4223.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #86C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4173.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #87CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O14229.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #88C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4242.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #89C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4212.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #9C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C1=O4102.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #90C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4231.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #91CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O14217.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #92C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4233.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #93C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4192.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #94C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4219.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #95CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O14237.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #96CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O14249.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #97C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4228.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #98C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4246.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,3TMS,isomer #99C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4259.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #1C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C1=O4059.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #10CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O14122.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #100C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4178.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #101CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O14170.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #102CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O14209.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #103C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C4165.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #104C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C4202.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #105C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4188.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #106C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4141.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #107C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4094.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #108CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O14152.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #109C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4154.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #11C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4122.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #110C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4136.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #111C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4187.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #112CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)O14139.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #113C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4145.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #114C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4121.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #115C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4176.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #116CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O14174.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #117CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O14219.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #118C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4160.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #119C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4210.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #12C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4094.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #120C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4187.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #121C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4134.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #122CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)O14179.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #123C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4178.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #124C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4178.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #125C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4223.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #126CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O14223.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #127CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O14257.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #128C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4211.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #129C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4247.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #13C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4149.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #130C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4262.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #131C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4206.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #132CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)O14214.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #133CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)O14253.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #134C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4204.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #135C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4240.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #136C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4247.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #137C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4193.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #138CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O14279.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #139CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O14239.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #14C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4114.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #140C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4283.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #141C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4228.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #142C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4257.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #143C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C1=O4114.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #144CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O14166.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #145C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4165.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #146C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C1=O4155.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #147C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C1=O4195.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #148CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O14153.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #149C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4151.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #15CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O14155.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #150C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C1=O4134.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #151C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C1=O4179.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #152CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O14189.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #153CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O14214.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #154C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4176.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #155C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4203.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #156C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C1=O4203.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #157C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C1=O4161.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #158CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O14167.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #159C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C4165.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #16C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4157.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #160C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4171.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #161C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4207.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #162CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O14212.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #163CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O14235.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #164C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C4205.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #165C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C4237.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #166C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4246.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #167C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4194.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #168CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O14197.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #169CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O14224.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #17C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4155.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #170C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C4191.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #171C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C4225.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #172C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4231.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #173C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4177.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #174CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O14261.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #175CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O14223.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #176C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C4270.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #177C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C4216.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #178C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4236.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #179CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O14167.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #18C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4204.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #180C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4167.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #181C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4161.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #182C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4201.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #183CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O14210.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #184CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O14245.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #185C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4195.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #186C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4228.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #187C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4244.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #188C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4182.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #189CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O14195.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #19CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)O14146.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #190CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O14234.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #191C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4181.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #192C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4217.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #193C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4228.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #194C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4170.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #195CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O14265.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #196CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O14229.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #197C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4259.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #198C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4211.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #199C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4235.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #2C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4090.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #20C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4146.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #200CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O14248.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #201CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O14272.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #202C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4242.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #203C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4267.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #204C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4303.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #205C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4244.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #206CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O14322.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #207CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O14280.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #208C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)C(O)=C1O[Si](C)(C)C4326.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #209C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)C(O)=C1O[Si](C)(C)C4262.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #21C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4139.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #210C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4316.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #211CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O14316.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #212CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)O14271.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #213C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4316.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #214C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4252.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #215C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4299.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #216CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)O14332.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #217C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)C(O)=C1O[Si](C)(C)C4337.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #22C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4190.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #23CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O14191.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #24CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O14226.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #25C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4187.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #26C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4218.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #27C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4220.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #28C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4165.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #29C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C1=O4094.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #3C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4071.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #30C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C1=O4078.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #31CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O14129.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #32C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4132.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #33C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C1=O4106.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #34C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C1=O4155.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #35C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4104.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #36CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O14144.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #37C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C4143.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #38C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4144.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #39C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4182.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #4CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O14118.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #40CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)O14131.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #41C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C4133.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #42C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4126.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #43C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4168.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #44CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O14167.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #45CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O14198.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #46C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C4164.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #47C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C4194.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #48C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4182.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #49C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4135.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #5C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C4121.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #50C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4089.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #51CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O14149.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #52C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4154.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #53C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4136.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #54C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4177.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #55CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)O14134.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #56C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4143.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #57C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4119.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #58C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4165.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #59CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O14171.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #6C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4105.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #60CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O14207.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #61C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4159.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #62C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4202.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #63C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4180.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #64C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4126.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #65CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)O14173.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #66C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4171.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #67C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4177.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #68C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4211.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #69CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O14221.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #7C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4154.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #70CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O14246.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #71C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)C(O)=C1O[Si](C)(C)C4210.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #72C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)C(O)=C1O[Si](C)(C)C4234.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #73C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4258.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #74C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4201.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #75CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)O14210.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #76CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)O14239.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #77C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4201.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #78C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C4226.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #79C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4244.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #8C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4074.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #80C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O[Si](C)(C)C)[C@@H](O)[C@@H](O)C1=O4186.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #81CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O14276.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #82CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)O14236.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #83C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)C(O)=C1O[Si](C)(C)C4282.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #84C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)C(O)=C1O[Si](C)(C)C4223.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #85C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4254.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #86C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C1=O4096.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #87C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C1=O4080.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #88CC1=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O14134.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #89C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)=C1O[Si](C)(C)C4133.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #9C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C)C1=O4057.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #90C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C1=O4107.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #91C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C1=O4163.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #92C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4107.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #93CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O14148.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #94C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C4145.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #95C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4143.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #96C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4190.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #97CC1=C(O[Si](C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C)[C@@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)O14136.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #98C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)=C1O[Si](C)(C)C4135.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,4TMS,isomer #99C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C)O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@@H](O)C1=O4127.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,1TBDMS,isomer #1C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4625.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,1TBDMS,isomer #10C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C(C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4636.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,1TBDMS,isomer #2C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)C1=O4629.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,1TBDMS,isomer #3C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)C1=O4584.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,1TBDMS,isomer #4C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C1=O4565.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,1TBDMS,isomer #5C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4694.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,1TBDMS,isomer #6C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)C1=O4684.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,1TBDMS,isomer #7CC1=C(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O14706.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,1TBDMS,isomer #8C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)C(O)=C1O[Si](C)(C)C(C)(C)C4724.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,1TBDMS,isomer #9C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C(C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4637.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #1C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)C1=O4612.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #10C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)C1=O4563.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #11C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C1=O4542.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #12C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)C1=O4664.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #13C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)C1=O4658.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #14CC1=C(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)O14671.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #15C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)C(O)=C1O[Si](C)(C)C(C)(C)C4693.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #16C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C(C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)C1=O4610.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #17C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C(C)(C)C)C4=O)[C@H](O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)C1=O4668.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #18C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C1=O4553.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #19C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)C1=O4625.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #2C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)C1=O4561.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #20C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)C1=O4617.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #21CC1=C(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O14637.5Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #22C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)=C1O[Si](C)(C)C(C)(C)C4676.6Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #23C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C(C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)C1=O4579.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #24C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C(C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O)C1=O4625.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #25C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C1=O4610.4Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #26C[C@H]1O[C@H](OP(=O)(O)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C1=O4593.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #27CC1=C(O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O14635.1Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #28C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)C(O[Si](C)(C)C(C)(C)C)=C1O[Si](C)(C)C(C)(C)C4676.0Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #29C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C(C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C1=O4564.2Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #3C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C1=O4539.8Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #30C[C@H]1O[C@H](OP(=O)(O)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)N([Si](C)(C)C(C)(C)C)C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C1=O4621.9Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #31C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H](O)C1=O4714.3Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #32CC1=C(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O)[C@@H](OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)O14727.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #33C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)C(O)=C1O[Si](C)(C)C(C)(C)C4749.7Semi standard non polar33892256
GDP-4-Dehydro-6-deoxy-D-mannose,2TBDMS,isomer #34C[C@H]1O[C@H](OP(=O)(O[Si](C)(C)C(C)(C)C)OP(=O)(O)OC[C@H]2O[C@@H](N3C=NC4=C3N=C(N[Si](C)(C)C(C)(C)C)[NH]C4=O)[C@H](O)[C@@H]2O)[C@@H](O)[C@@H](O)C1=O4699.1Semi standard non polar33892256