Hmdb loader
You are using an unsupported browser. Please upgrade your browser to a newer version to get the best experience on Human Metabolome Database.
Record Information
Version5.0
StatusDetected and Quantified
Creation Date2006-05-22 14:17:36 UTC
Update Date2021-09-14 15:40:23 UTC
HMDB IDHMDB0002094
Secondary Accession Numbers
  • HMDB02094
Metabolite Identification
Common Name3-Fucosyllactose
Description3-Fucosyllactose is a milk oligosaccharide isolated in 1958 (PMID: 13546862 ), and that was also isolated for the first time from the urine of a blood group O, nonsecretor, woman during pregnancy and lactation in 1977 (PMID: 838696 ). Is resistant to enzymic hydrolysis in the gastrointestinal tract of the infant; it is postulated that they reach the large intestine where they serve as substrates for bacterial metabolism. (PMID 10837303 ).
Structure
Data?1582752229
Synonyms
ValueSource
3-O-FucosyllactoseMeSH
3'-FucosyllactoseHMDB, MeSH
O-6-Deoxy-a-L-galactopyranosyl-(1->3)-O-[b-D-galactopyranosyl-(1->4)]- D-glucoseHMDB
O-6-Deoxy-alpha-L-galactopyranosyl-(1->3)-O-[b-D-galactopyranosyl-(1->4)]- D-glucoseHMDB
O-6-Deoxy-alpha-L-galactopyranosyl-(1->3)-O-[b-delta-galactopyranosyl-(1->4)]- D-glucoseHMDB
Chemical FormulaC18H32O15
Average Molecular Weight488.4377
Monoisotopic Molecular Weight488.174120354
IUPAC Name(2S,3S,4R,5S,6S)-2-{[(2R,3S,4S,5R,6S)-3,5-dihydroxy-2-(hydroxymethyl)-6-{[(2R,3S,4R,5R)-4,5,6-trihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy}oxan-4-yl]oxy}-6-methyloxane-3,4,5-triol
Traditional Name3-fucosyllactose
CAS Registry Number41312-47-4
SMILES
C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O
InChI Identifier
InChI=1S/C18H32O15/c1-4-7(21)9(23)12(26)17(29-4)33-15-8(22)5(2-19)31-18(13(15)27)32-14-6(3-20)30-16(28)11(25)10(14)24/h4-28H,2-3H2,1H3/t4-,5+,6+,7+,8-,9+,10+,11+,12-,13+,14+,15-,16?,17-,18-/m0/s1
InChI KeyAUNPEJDACLEKSC-ZAYDSPBTSA-N
Chemical Taxonomy
Description Belongs to the class of organic compounds known as oligosaccharides. These are carbohydrates made up of 3 to 10 monosaccharide units linked to each other through glycosidic bonds.
KingdomOrganic compounds
Super ClassOrganic oxygen compounds
ClassOrganooxygen compounds
Sub ClassCarbohydrates and carbohydrate conjugates
Direct ParentOligosaccharides
Alternative Parents
Substituents
  • Oligosaccharide
  • O-glycosyl compound
  • Glycosyl compound
  • Oxane
  • Secondary alcohol
  • Hemiacetal
  • Oxacycle
  • Organoheterocyclic compound
  • Polyol
  • Acetal
  • Hydrocarbon derivative
  • Primary alcohol
  • Alcohol
  • Aliphatic heteromonocyclic compound
Molecular FrameworkAliphatic heteromonocyclic compounds
External DescriptorsNot Available
Ontology
Disposition

Biological location

Source

Route of exposure

Physical Properties
StateSolid
Experimental Molecular Properties
PropertyValueReference
Melting PointNot AvailableNot Available
Boiling PointNot AvailableNot Available
Water SolubilityNot AvailableNot Available
LogPNot AvailableNot Available
Experimental Chromatographic PropertiesNot Available
Predicted Molecular Properties
PropertyValueSource
Water Solubility398 g/LALOGPS
logP10(-2.4) g/LALOGPS
logP10(-5.4) g/LChemAxon
logS10(-0.09) g/LALOGPS
pKa (Strongest Acidic)11.22ChemAxon
pKa (Strongest Basic)-3.6ChemAxon
Physiological Charge0ChemAxon
Hydrogen Acceptor Count15ChemAxon
Hydrogen Donor Count10ChemAxon
Polar Surface Area248.45 ŲChemAxon
Rotatable Bond Count6ChemAxon
Refractivity99.21 m³·mol⁻¹ChemAxon
Polarizability46.19 ųChemAxon
Number of Rings3ChemAxon
BioavailabilityNoChemAxon
Rule of FiveNoChemAxon
Ghose FilterNoChemAxon
Veber's RuleNoChemAxon
MDDR-like RuleYesChemAxon
Predicted Chromatographic Properties

Predicted Collision Cross Sections

PredictorAdduct TypeCCS Value (Å2)Reference
DeepCCS[M+H]+204.12630932474
DeepCCS[M-H]-202.23130932474

Predicted Kovats Retention Indices

Underivatized

MetaboliteSMILESKovats RI ValueColumn TypeReference
3-FucosyllactoseC[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3586.1Standard polar33892256
3-FucosyllactoseC[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3872.1Standard non polar33892256
3-FucosyllactoseC[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3989.2Semi standard non polar33892256

Derivatized

Derivative Name / StructureSMILESKovats RI ValueColumn TypeReference
3-Fucosyllactose,1TMS,isomer #1C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3692.7Semi standard non polar33892256
3-Fucosyllactose,1TMS,isomer #10C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3724.3Semi standard non polar33892256
3-Fucosyllactose,1TMS,isomer #2C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3702.5Semi standard non polar33892256
3-Fucosyllactose,1TMS,isomer #3C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3700.7Semi standard non polar33892256
3-Fucosyllactose,1TMS,isomer #4C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3709.7Semi standard non polar33892256
3-Fucosyllactose,1TMS,isomer #5C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3735.9Semi standard non polar33892256
3-Fucosyllactose,1TMS,isomer #6C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3702.0Semi standard non polar33892256
3-Fucosyllactose,1TMS,isomer #7C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3698.6Semi standard non polar33892256
3-Fucosyllactose,1TMS,isomer #8C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3711.3Semi standard non polar33892256
3-Fucosyllactose,1TMS,isomer #9C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3695.3Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #1C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3653.2Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #10C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3650.0Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #11C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3665.6Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #12C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3652.5Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #13C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3633.5Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #14C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3636.3Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #15C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3652.3Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #16C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3637.7Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #17C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3671.0Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #18C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3621.8Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #19C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3642.5Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #2C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3637.7Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #20C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3658.8Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #21C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3631.9Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #22C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3644.1Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #23C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3628.3Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #24C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3662.2Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #25C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3677.0Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #26C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3642.4Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #27C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3651.1Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #28C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3665.6Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #29C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3648.1Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #3C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3663.8Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #30C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3680.6Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #31C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3652.1Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #32C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3664.3Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #33C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3680.7Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #34C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3667.1Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #35C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3697.1Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #36C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3636.6Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #37C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3650.3Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #38C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3635.9Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #39C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3670.2Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #4C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3650.8Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #40C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3647.8Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #41C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3629.0Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #42C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3663.4Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #43C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3646.9Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #44C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3655.4Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #45C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3653.7Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #5C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3627.7Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #6C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3627.1Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #7C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3646.1Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #8C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3629.6Semi standard non polar33892256
3-Fucosyllactose,2TMS,isomer #9C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3663.3Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #1C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3505.7Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #10C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3538.7Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #100C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3585.9Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #101C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3526.7Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #102C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3554.2Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #103C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3532.3Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #104C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3579.8Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #105C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3579.7Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #106C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3571.1Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #107C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3612.9Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #108C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3583.7Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #109C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3599.4Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #11C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3484.4Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #110C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3601.5Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #111C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3522.9Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #112C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3502.5Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #113C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3545.2Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #114C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3524.4Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #115C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3536.3Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #116C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3531.6Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #117C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3544.7Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #118C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3558.4Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #119C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3559.5Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #12C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3501.7Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #120C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3562.8Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #13C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3522.8Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #14C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3503.8Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #15C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3547.4Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #16C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3589.7Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #17C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3549.3Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #18C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3552.2Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #19C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3581.9Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #2C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3559.9Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #20C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3571.7Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #21C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3613.7Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #22C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3566.8Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #23C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3553.4Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #24C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3576.2Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #25C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3562.4Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #26C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3603.0Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #27C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3514.5Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #28C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3543.5Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #29C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3531.8Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #3C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3557.7Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #30C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3570.9Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #31C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3535.9Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #32C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3528.9Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #33C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3566.6Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #34C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3549.4Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #35C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3560.6Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #36C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3561.9Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #37C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3526.9Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #38C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3539.7Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #39C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3475.0Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #4C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3510.7Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #40C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3491.5Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #41C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3523.1Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #42C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3500.8Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #43C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3544.6Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #44C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3583.3Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #45C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3532.1Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #46C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3548.5Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #47C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3577.9Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #48C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3556.1Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #49C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3600.9Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #5C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3513.4Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #50C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3552.5Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #51C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3545.2Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #52C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3568.2Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #53C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3545.5Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #54C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3591.8Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #55C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3489.7Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #56C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3527.1Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #57C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3507.2Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #58C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3549.2Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #59C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3526.2Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #6C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3536.4Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #60C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3507.3Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #61C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3549.9Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #62C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3527.6Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #63C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3541.8Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #64C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3536.5Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #65C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3505.7Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #66C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3540.2Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #67C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3476.6Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #68C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3509.0Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #69C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3488.0Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #7C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3517.9Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #70C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3533.9Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #71C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3590.0Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #72C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3540.6Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #73C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3564.2Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #74C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3551.5Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #75C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3590.4Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #76C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3567.1Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #77C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3581.5Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #78C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3566.0Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #79C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3603.9Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #8C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3560.6Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #80C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3539.2Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #81C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3527.1Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #82C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3565.9Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #83C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3543.2Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #84C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3556.5Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #85C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3560.0Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #86C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3552.7Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #87C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3587.9Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #88C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3604.9Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #89C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3589.7Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #9C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3529.2Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #90C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3631.4Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #91C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3537.0Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #92C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3556.7Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #93C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3535.0Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #94C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3583.2Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #95C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3577.3Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #96C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3564.1Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #97C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3604.5Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #98C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3573.1Semi standard non polar33892256
3-Fucosyllactose,3TMS,isomer #99C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3582.2Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #1C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3383.6Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #10C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3408.1Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #100C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3374.3Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #101C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3360.3Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #102C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3398.7Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #103C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3378.0Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #104C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3381.8Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #105C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3390.6Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #106C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3428.3Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #107C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3408.2Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #108C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3416.2Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #109C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3398.0Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #11C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3430.8Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #110C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3450.2Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #111C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3384.3Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #112C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3394.4Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #113C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3378.0Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #114C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3427.2Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #115C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3409.6Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #116C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3400.1Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #117C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3453.9Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #118C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3415.1Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #119C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3414.1Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #12C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3417.1Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #120C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3440.5Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #121C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3418.6Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #122C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3419.7Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #123C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3398.4Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #124C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3448.6Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #125C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3401.2Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #126C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3388.9Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #127C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3439.4Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #128C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3401.9Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #129C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3391.7Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #13C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3473.0Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #130C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3426.4Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #131C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3375.2Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #132C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3368.3Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #133C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3402.2Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #134C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3384.8Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #135C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3375.3Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #136C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3401.2Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #137C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3396.6Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #138C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3393.0Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #139C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3419.3Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #14C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3444.3Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #140C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3417.0Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #141C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3404.2Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #142C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3357.1Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #143C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3372.5Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #144C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3359.4Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #145C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3404.0Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #146C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3400.2Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #147C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3404.4Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #148C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3383.1Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #149C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3432.7Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #15C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3404.4Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #150C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3361.4Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #151C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3349.2Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #152C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3384.4Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #153C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3368.4Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #154C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3357.7Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #155C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3382.3Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #156C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3445.5Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #157C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3452.0Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #158C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3435.6Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #159C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3482.1Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #16C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3427.4Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #160C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3414.5Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #161C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3405.2Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #162C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3450.3Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #163C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3422.7Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #164C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3402.8Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #165C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3441.0Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #166C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3447.1Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #167C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3433.1Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #168C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3478.1Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #169C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3451.9Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #17C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3412.1Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #170C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3420.8Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #171C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3465.4Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #172C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3405.5Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #173C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3392.9Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #174C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3425.4Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #175C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3413.6Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #176C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3374.5Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #177C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3392.3Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #178C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3375.2Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #179C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3425.4Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #18C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3465.3Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #180C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3436.0Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #181C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3425.3Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #182C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3474.9Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #183C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3445.6Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #184C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3428.4Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #185C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3464.4Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #186C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3391.1Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #187C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3374.5Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #188C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3425.1Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #189C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3390.9Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #19C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3378.8Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #190C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3378.4Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #191C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3409.3Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #192C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3425.0Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #193C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3401.6Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #194C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3445.4Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #195C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3422.3Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #196C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3382.3Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #197C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3368.4Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #198C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3422.3Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #199C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3387.6Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #2C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3405.0Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #20C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3397.5Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #200C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3388.0Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #201C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3411.5Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #202C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3439.3Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #203C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3429.0Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #204C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3466.9Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #205C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3442.3Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #206C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3383.2Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #207C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3379.7Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #208C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3400.1Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #209C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3407.7Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #21C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3388.4Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #210C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3427.7Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #22C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3426.8Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #23C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3391.3Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #24C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3385.9Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #25C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3422.2Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #26C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3416.3Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #27C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3409.9Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #28C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3439.7Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #29C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3390.6Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #3C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3370.8Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #30C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3370.9Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #31C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3366.6Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #32C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3393.9Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #33C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3381.9Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #34C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3435.8Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #35C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3415.6Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #36C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3383.3Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #37C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3405.6Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #38C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3390.3Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #39C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3442.8Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #4C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3387.4Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #40C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3350.1Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #41C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3371.1Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #42C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3359.7Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #43C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3400.6Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #44C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3370.5Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #45C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3359.7Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #46C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3402.1Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #47C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3390.2Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #48C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3388.8Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #49C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3412.5Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #5C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3393.7Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #50C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3458.6Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #51C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3423.0Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #52C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3447.0Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #53C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3437.5Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #54C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3485.0Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #55C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3401.0Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #56C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3430.8Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #57C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3423.0Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #58C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3465.1Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #59C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3415.7Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #6C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3379.0Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #60C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3410.8Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #61C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3461.9Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #62C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3453.5Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #63C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3443.7Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #64C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3478.8Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #65C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3437.0Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #66C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3458.9Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #67C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3446.7Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #68C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3489.5Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #69C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3405.9Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #7C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3420.2Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #70C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3396.6Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #71C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3444.0Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #72C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3441.7Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #73C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3418.9Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #74C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3463.2Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #75C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3382.7Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #76C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3382.1Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #77C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3415.1Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #78C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3417.4Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #79C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3398.3Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #8C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3431.6Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #80C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3441.5Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #81C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3406.6Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #82C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3392.5Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #83C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3427.4Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #84C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3440.0Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #85C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3370.9Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #86C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3351.6Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #87C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3364.0Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #88C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3379.3Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #89C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3359.9Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #9C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3410.4Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #90C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3415.9Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #91C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3390.7Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #92C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3381.5Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #93C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3385.5Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #94C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3369.1Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #95C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3421.7Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #96C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3343.4Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #97C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3359.4Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #98C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3344.8Semi standard non polar33892256
3-Fucosyllactose,4TMS,isomer #99C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3383.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #1C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3320.5Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #10C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3323.9Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #100C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3340.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #101C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3391.8Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #102C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3319.9Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #103C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3326.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #104C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3349.0Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #105C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3365.3Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #106C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3333.3Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #107C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3381.6Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #108C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3351.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #109C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3327.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #11C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3356.3Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #110C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3370.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #111C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3381.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #112C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3358.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #113C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3357.0Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #114C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3378.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #115C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3397.3Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #116C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3358.9Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #117C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3411.0Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #118C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3360.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #119C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3329.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #12C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3313.0Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #120C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3369.0Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #121C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3381.8Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #122C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3353.6Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #123C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3326.8Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #124C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3370.5Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #125C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3379.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #126C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3368.5Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #127C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3314.5Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #128C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3294.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #129C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3285.9Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #13C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3317.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #130C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3287.3Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #131C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3316.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #132C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3292.9Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #133C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3276.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #134C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3283.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #135C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3311.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #136C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3292.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #137C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3287.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #138C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3327.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #139C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3297.6Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #14C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3308.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #140C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3293.0Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #141C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3317.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #142C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3324.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #143C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3306.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #144C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3302.9Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #145C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3333.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #146C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3309.9Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #147C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3307.3Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #148C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3335.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #149C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3310.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #15C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3346.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #150C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3300.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #151C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3328.3Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #152C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3296.6Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #153C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3290.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #154C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3324.0Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #155C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3298.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #156C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3291.3Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #157C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3317.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #158C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3322.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #159C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3315.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #16C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3326.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #160C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3341.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #161C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3342.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #162C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3348.5Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #163C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3330.9Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #164C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3330.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #165C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3353.0Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #166C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3318.8Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #167C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3319.5Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #168C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3346.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #169C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3320.5Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #17C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3313.5Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #170C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3306.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #171C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3342.6Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #172C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3305.0Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #173C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3310.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #174C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3336.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #175C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3310.6Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #176C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3293.8Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #177C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3329.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #178C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3336.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #179C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3320.9Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #18C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3354.5Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #180C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3362.3Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #181C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3340.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #182C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3347.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #183C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3345.5Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #184C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3370.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #185C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3345.3Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #186C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3326.6Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #187C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3360.5Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #188C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3348.5Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #189C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3325.8Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #19C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3342.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #190C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3365.3Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #191C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3346.0Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #192C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3334.8Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #193C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3317.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #194C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3357.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #195C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3338.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #196C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3364.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #197C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3339.9Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #198C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3323.6Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #199C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3322.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #2C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3315.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #20C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3331.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #200C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3344.5Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #201C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3299.5Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #202C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3304.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #203C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3330.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #204C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3309.6Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #205C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3293.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #206C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3326.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #207C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3333.8Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #208C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3329.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #209C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3355.6Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #21C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3360.6Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #210C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3333.0Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #211C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3315.0Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #212C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3349.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #213C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3325.0Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #214C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3310.9Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #215C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3342.0Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #216C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3337.0Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #217C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3362.5Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #218C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3367.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #219C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3386.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #22C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3375.0Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #220C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3369.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #221C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3344.9Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #222C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3385.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #223C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3352.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #224C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3324.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #225C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3370.0Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #226C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3347.6Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #227C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3390.3Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #228C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3354.5Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #229C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3404.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #23C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3329.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #230C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3377.9Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #231C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3369.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #232C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3303.9Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #233C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3300.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #234C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3326.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #235C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3309.0Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #236C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3296.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #237C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3329.9Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #238C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3357.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #239C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3328.3Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #24C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3339.3Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #240C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3376.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #241C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3358.9Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #242C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3335.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #243C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3313.6Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #244C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3347.8Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #245C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3342.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #246C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3371.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #247C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3317.0Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #248C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3307.3Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #249C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3337.9Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #25C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3338.5Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #250C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3331.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #251C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3370.6Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #252C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3355.5Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #26C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3369.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #27C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3317.6Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #28C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3326.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #29C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3326.8Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #3C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3304.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #30C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3357.8Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #31C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3322.9Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #32C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3319.0Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #33C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3354.5Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #34C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3356.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #35C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3337.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #36C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3381.9Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #37C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3358.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #38C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3366.3Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #39C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3360.3Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #4C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3314.6Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #40C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3390.6Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #41C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3337.5Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #42C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3335.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #43C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3362.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #44C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3367.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #45C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3341.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #46C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3383.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #47C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3321.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #48C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3317.9Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #49C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3350.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #5C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3305.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #50C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3356.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #51C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3333.8Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #52C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3378.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #53C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3347.3Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #54C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3337.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #55C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3370.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #56C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3386.5Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #57C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3349.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #58C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3301.3Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #59C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3312.9Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #6C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3349.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #60C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3311.6Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #61C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3339.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #62C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3301.6Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #63C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3307.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #64C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3312.0Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #65C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3338.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #66C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3299.5Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #67C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3294.0Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #68C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3328.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #69C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3328.3Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #7C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3352.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #70C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3315.0Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #71C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O[Si](C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3347.9Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #72C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3335.6Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #73C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3342.8Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #74C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3337.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #75C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3364.3Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #76C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3317.3Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #77C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3313.9Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #78C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3340.0Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #79C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3346.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #8C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3331.4Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #80C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3323.0Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #81C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3357.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #82C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3307.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #83C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3304.3Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #84C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3332.5Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #85C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3335.2Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #86C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3317.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #87C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3350.5Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #88C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3332.3Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #89C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C3317.3Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #9C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO[Si](C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3329.9Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #90C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3345.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #91C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O[Si](C)(C)C3363.9Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #92C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3361.1Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #93C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3369.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #94C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3373.9Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #95C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3392.7Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #96C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H](O)[C@@H]1O3326.6Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #97C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C)[C@@H]1O3328.8Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #98C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C3351.8Semi standard non polar33892256
3-Fucosyllactose,5TMS,isomer #99C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C)C(O[Si](C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@@H]1O3370.3Semi standard non polar33892256
3-Fucosyllactose,1TBDMS,isomer #1C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3904.5Semi standard non polar33892256
3-Fucosyllactose,1TBDMS,isomer #10C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C3939.4Semi standard non polar33892256
3-Fucosyllactose,1TBDMS,isomer #2C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3909.7Semi standard non polar33892256
3-Fucosyllactose,1TBDMS,isomer #3C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3910.7Semi standard non polar33892256
3-Fucosyllactose,1TBDMS,isomer #4C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3909.5Semi standard non polar33892256
3-Fucosyllactose,1TBDMS,isomer #5C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3938.7Semi standard non polar33892256
3-Fucosyllactose,1TBDMS,isomer #6C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O3909.0Semi standard non polar33892256
3-Fucosyllactose,1TBDMS,isomer #7C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O3908.5Semi standard non polar33892256
3-Fucosyllactose,1TBDMS,isomer #8C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O3927.1Semi standard non polar33892256
3-Fucosyllactose,1TBDMS,isomer #9C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O3920.2Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #1C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4044.4Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #10C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4045.8Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #11C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4049.5Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #12C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4031.6Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #13C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4027.6Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #14C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O4036.6Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #15C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4047.8Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #16C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4040.4Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #17C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4062.9Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #18C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4024.2Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #19C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4030.7Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #2C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4035.8Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #20C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4033.6Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #21C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O4023.8Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #22C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4036.5Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #23C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4032.2Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #24C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4050.1Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #25C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4040.0Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #26C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4027.7Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #27C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O4024.8Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #28C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4039.7Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #29C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4034.8Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #3C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4046.8Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #30C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4052.4Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #31C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4043.5Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #32C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O4052.4Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #33C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4069.6Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #34C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4061.7Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #35C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4079.2Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #36C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O4040.7Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #37C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4056.4Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #38C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4047.2Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #39C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4068.6Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #4C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4020.6Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #40C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4041.0Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #41C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4034.3Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #42C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4054.9Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #43C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4045.2Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #44C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4042.0Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #45C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4046.7Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #5C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4018.1Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #6C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O4018.3Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #7C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4037.7Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #8C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4029.3Semi standard non polar33892256
3-Fucosyllactose,2TBDMS,isomer #9C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4050.3Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #1C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4134.6Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #10C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4112.6Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #100C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4135.3Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #101C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O4115.9Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #102C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4137.4Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #103C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4120.4Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #104C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4139.5Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #105C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4145.4Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #106C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4137.1Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #107C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4156.2Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #108C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4146.5Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #109C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4143.8Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #11C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4093.5Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #110C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4144.7Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #111C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4137.2Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #112C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4127.8Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #113C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4146.2Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #114C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4140.3Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #115C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4138.1Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #116C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4135.7Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #117C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4128.9Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #118C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4130.7Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #119C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4131.9Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #12C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O4107.6Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #120C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4137.9Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #13C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4129.8Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #14C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4117.7Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #15C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4137.4Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #16C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4110.2Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #17C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4105.0Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #18C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O4107.7Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #19C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4136.6Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #2C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4132.3Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #20C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4126.2Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #21C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4145.9Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #22C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4117.0Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #23C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O4102.0Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #24C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4124.9Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #25C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4119.4Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #26C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4135.3Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #27C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O4089.7Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #28C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4115.1Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #29C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4109.0Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #3C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4123.6Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #30C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4128.1Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #31C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4115.3Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #32C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4105.0Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #33C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4126.2Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #34C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4121.1Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #35C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4123.3Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #36C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4123.9Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #37C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4119.4Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #38C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4123.3Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #39C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4105.8Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #4C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4112.8Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #40C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O4128.3Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #41C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4144.4Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #42C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4130.5Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #43C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4148.5Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #44C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4113.3Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #45C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4108.1Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #46C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O4128.2Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #47C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4144.5Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #48C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4128.8Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #49C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4147.0Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #5C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O4118.2Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #50C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4123.7Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #51C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O4121.4Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #52C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4134.2Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #53C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4123.0Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #54C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4137.6Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #55C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O4104.9Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #56C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4125.5Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #57C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4116.5Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #58C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4131.9Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #59C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4134.0Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #6C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4137.7Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #60C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4124.6Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #61C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4144.4Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #62C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4133.1Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #63C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4129.8Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #64C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4129.6Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #65C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4101.8Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #66C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4124.4Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #67C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O4097.7Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #68C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4121.6Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #69C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4110.3Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #7C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4127.1Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #70C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4126.1Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #71C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4135.6Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #72C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O4110.0Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #73C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4134.9Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #74C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4133.7Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #75C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4143.4Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #76C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O4123.7Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #77C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4145.8Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #78C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4138.6Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #79C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4151.3Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #8C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO[Si](C)(C)C(C)(C)C)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4145.6Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #80C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4121.1Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #81C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4116.4Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #82C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4134.1Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #83C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4129.9Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #84C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4126.3Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #85C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO)OC(O)[C@H](O)[C@H]3O[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[Si](C)(C)C(C)(C)C4129.2Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #86C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)O[C@@H]3CO[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4100.9Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #87C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O4118.4Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #88C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4139.3Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #89C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4135.0Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #9C[C@@H]1O[C@@H](O[C@H]2[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](CO)O[C@@H](O[C@@H]3[C@@H](CO[Si](C)(C)C(C)(C)C)OC(O[Si](C)(C)C(C)(C)C)[C@H](O)[C@H]3O)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O4109.2Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #90C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O[Si](C)(C)C(C)(C)C)O[C@@H]3CO)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4146.4Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #91C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C(C)(C)C)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O4120.2Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #92C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4136.0Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #93C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4123.4Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #94C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO[Si](C)(C)C(C)(C)C)[C@@H]2O)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4139.5Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #95C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O4134.2Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #96C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4130.1Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #97C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4144.6Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #98C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O4140.1Semi standard non polar33892256
3-Fucosyllactose,3TBDMS,isomer #99C[C@@H]1O[C@@H](O[C@H]2[C@@H](O)[C@@H](CO)O[C@@H](O[C@H]3[C@H](O)[C@@H](O[Si](C)(C)C(C)(C)C)C(O)O[C@@H]3CO)[C@@H]2O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O)[C@@H]1O[Si](C)(C)C(C)(C)C4128.5Semi standard non polar33892256
Spectra

GC-MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted GC-MSPredicted GC-MS Spectrum - 3-Fucosyllactose GC-MS (Non-derivatized) - 70eV, Positivesplash10-00di-4243900000-7647bb360437419097ba2017-09-01Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 3-Fucosyllactose GC-MS (2 TMS) - 70eV, Positivesplash10-02ti-5403319000-0e9d5234e221b591faa72017-10-06Wishart LabView Spectrum
Predicted GC-MSPredicted GC-MS Spectrum - 3-Fucosyllactose GC-MS (Non-derivatized) - 70eV, PositiveNot Available2021-10-12Wishart LabView Spectrum

MS/MS Spectra

Spectrum TypeDescriptionSplash KeyDeposition DateSourceView
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 3-Fucosyllactose 10V, Positive-QTOFsplash10-01zc-0907600000-a364f2ba84ad657b5b1e2017-09-01Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 3-Fucosyllactose 20V, Positive-QTOFsplash10-03gi-0904000000-2cef226a5156ef0141482017-09-01Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 3-Fucosyllactose 40V, Positive-QTOFsplash10-01q9-1901000000-770eef91ec16245603e52017-09-01Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 3-Fucosyllactose 10V, Negative-QTOFsplash10-02bu-1625900000-4d6e41a21675e94d3f742017-09-01Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 3-Fucosyllactose 20V, Negative-QTOFsplash10-0200-2914100000-dca6ba890362ffa0e4a02017-09-01Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 3-Fucosyllactose 40V, Negative-QTOFsplash10-01t9-2911000000-625c13af5e2bd1f488022017-09-01Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 3-Fucosyllactose 10V, Negative-QTOFsplash10-002r-0001900000-d01a318d75d7a18da6162021-09-23Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 3-Fucosyllactose 20V, Negative-QTOFsplash10-0a6r-9307700000-2375dd6556d1d49d2fc12021-09-23Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 3-Fucosyllactose 40V, Negative-QTOFsplash10-0a4r-9221000000-3f856f869430faaefd452021-09-23Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 3-Fucosyllactose 10V, Positive-QTOFsplash10-000i-0003900000-06a7e58b5c15b31d57952021-09-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 3-Fucosyllactose 20V, Positive-QTOFsplash10-002f-0409200000-1cc58e649b613c2b2c1a2021-09-24Wishart LabView Spectrum
Predicted LC-MS/MSPredicted LC-MS/MS Spectrum - 3-Fucosyllactose 40V, Positive-QTOFsplash10-0006-9211100000-8722f3f8425531e5002a2021-09-24Wishart LabView Spectrum

NMR Spectra

Spectrum TypeDescriptionDeposition DateSourceView
Predicted 1D NMR13C NMR Spectrum (1D, 100 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 100 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 1000 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 1000 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 200 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 200 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 300 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 300 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 400 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 400 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 500 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 500 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 600 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 600 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 700 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 700 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 800 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 800 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR13C NMR Spectrum (1D, 900 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Predicted 1D NMR1H NMR Spectrum (1D, 900 MHz, D2O, predicted)2021-09-25Wishart LabView Spectrum
Biological Properties
Cellular LocationsNot Available
Biospecimen Locations
  • Breast Milk
Tissue LocationsNot Available
Pathways
Normal Concentrations
BiospecimenStatusValueAgeSexConditionReferenceDetails
Breast MilkDetected and Quantified2100 +/- 1200 uMAdult (>18 years old)Female
Normal
details
Breast MilkDetected and Quantified2702.494(102.367-8025.588) uMAdult (>18 years old)BothNormal details
Abnormal Concentrations
Not Available
Associated Disorders and Diseases
Disease ReferencesNone
Associated OMIM IDsNone
DrugBank IDNot Available
Phenol Explorer Compound IDNot Available
FooDB IDFDB022842
KNApSAcK IDNot Available
Chemspider ID141824
KEGG Compound IDNot Available
BioCyc IDNot Available
BiGG IDNot Available
Wikipedia LinkNot Available
METLIN IDNot Available
PubChem Compound161460
PDB IDNot Available
ChEBI ID90065
Food Biomarker OntologyNot Available
VMH IDNot Available
MarkerDB IDNot Available
Good Scents IDNot Available
References
Synthesis ReferenceNot Available
Material Safety Data Sheet (MSDS)Download (PDF)
General References
  1. Engfer MB, Stahl B, Finke B, Sawatzki G, Daniel H: Human milk oligosaccharides are resistant to enzymatic hydrolysis in the upper gastrointestinal tract. Am J Clin Nutr. 2000 Jun;71(6):1589-96. [PubMed:10837303 ]
  2. Hallgren P, Lindberg BS, Lundblad A: Quantitation of some urinary oligosaccharides during pregnancy and lactation. J Biol Chem. 1977 Feb 10;252(3):1034-40. [PubMed:838696 ]
  3. KUHN R: [Oligosaccharides of milk]. Bull Soc Chim Biol (Paris). 1958;40(2-3):297-314. [PubMed:13546862 ]